VNF_Catalogue Codebase

Catalogue of Open Source VNFs consist in helping the end users to get
information of the VNF we can deploy on top of an OPNFV solution

[Deepak]: Removed all swp files.

Change-Id: Ib2ea7330e964f1b684f32aedf631accd580df968
Signed-off-by: Kumar Rishabh <shailrishabh@gmail.com>
Signed-off-by: Deepak S <deepak.s@linux.intel.com>

100 files changed, 29045 insertions, 0 deletions

diff --git a/VNF_Catalogue/.dockerignore b/VNF_Catalogue/.dockerignore
new file mode 100644
index 00000000..93f13619
--- /dev/null
+++ b/VNF_Catalogue/.dockerignore
@@ -0,0 +1,2 @@
+node_modules
+npm-debug.log
diff --git a/VNF_Catalogue/Dockerfile b/VNF_Catalogue/Dockerfile
new file mode 100644
index 00000000..85a68b8e
--- /dev/null
+++ b/VNF_Catalogue/Dockerfile
@@ -0,0 +1,44 @@
+#############################################
+#   Docker container for VNF_Catalogue WebApp
+#############################################
+# Purpose: Don't run it from here! Use docker-compose(See README.md)
+#
+# Maintained by Kumar Rishabh :: penguinRaider
+##
+# All rights reserved. This program and the accompanying materials
+# are made available under the terms of the Apache License, Version 2.0
+# which accompanies this distribution, and is available at
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+
+FROM node:boron
+MAINTAINER KumarRishabh::penguinRaider <shailrishabh@gmail.com>
+LABEL version="v0.0.1" description="Open Source VNF_Catalogue for OPNFV"
+
+ENV DB_HOST mysql
+ENV DB_USER vnf_user
+ENV DB_PASSWORD vnf_password
+ENV DB_DATABASE vnf_catalogue
+ENV MINIO_ACCESS_KEY vnf_minio
+ENV MINIO_SECRET_KEY vnf_minio
+ENV MINIO_HOST minio
+
+RUN apt-get update 
+RUN apt-get install vim -y
+
+RUN mkdir -p /usr/src/app
+WORKDIR /usr/src/app
+
+COPY package.json /usr/src/app/
+
+# RUN npm config set proxy http://10.4.20.103:8080
+# RUN npm config set https-proxy http://10.4.20.103:8080
+
+RUN npm install
+
+COPY . /usr/src/app
+
+EXPOSE 3000
+
+# We wait for mysql service to come up before starting the server using a 3rd_party script.
+CMD [ "./migration/3rd_party/wait-for-it/wait-for-it.sh", "mysql:3306", "-t", "0", "--", "./migration/3rd_party/wait-for-it/wait-for-it.sh", "minio:9000", "-t", "0", "--", "npm", "start" ]
diff --git a/VNF_Catalogue/README.md b/VNF_Catalogue/README.md
new file mode 100644
index 00000000..91179f51
--- /dev/null
+++ b/VNF_Catalogue/README.md
@@ -0,0 +1,18 @@
+#VNF_Catalogue Nodejs + Jade + MySql server
+
+
+## Quickstart
+
+First install docker and docker-compose. This multicontainer app uses
+docker-compose to organize the vnf_catalogue web_app
+
+The use
+    ```docker-compose up```
+
+set time zone(optional)
+        Set same timezone in both nodejs server and mysql server. Something
+        similar to below can be used:
+        ``` SET GLOBAL time_zone = '+00:00'; ```
+
+
+The server would be accessible at ```ip_address:3000```
diff --git a/VNF_Catalogue/app.js b/VNF_Catalogue/app.js
new file mode 100644
index 00000000..67b280de
--- /dev/null
+++ b/VNF_Catalogue/app.js
@@ -0,0 +1,110 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+var express = require('express');
+var path = require('path');
+var favicon = require('serve-favicon');
+var logger = require('morgan');
+var cookieParser = require('cookie-parser');
+var bodyParser = require('body-parser');
+var validator = require('express-validator');
+
+var routes = require('./routes/index');
+var search_projects = require('./routes/search_projects');
+var search_projects_results = require('./routes/search_projects_results');
+var search_max = require('./routes/search_max');
+var project_profile = require('./routes/project_profile');
+var add_project = require('./routes/add_project');
+var add_tag = require('./routes/add_tag');
+var search_tag = require('./routes/search_tag');
+var search_vnf = require('./routes/search_vnf');
+var vnf_tag_association = require('./routes/vnf_tag_association');
+//var project_profile = require('./routes/project_profile');
+
+var app = express();
+
+// view engine setup
+app.set('views', path.join(__dirname, 'views'));
+app.set('view engine', 'jade');
+
+db_pool = require('./database').pool;
+minio_client = require('./minio').minio_client;
+// Database
+//var db = require('mysql2');
+
+// uncomment after placing your favicon in /public
+//app.use(favicon(__dirname + '/public/favicon.ico'));
+app.use(logger('dev'));
+app.use(bodyParser.json());
+app.use(bodyParser.urlencoded({ extended: false }));
+app.use(validator());
+app.use(cookieParser());
+app.use(express.static(path.join(__dirname, 'public')));
+
+// create minio bucket if it does not exist
+minio_client.makeBucket('opnfv-vnfcatalogue', 'us-east-1', function(err) {
+    if (err) {
+        return console.log(err);
+    } else {
+        console.log('Bucket created successfully in "us-east-1".');
+    }
+});
+
+// Make our db accessible to our router
+app.use(function(req,res,next){
+    //db_pool size 50 default
+    req.db_pool = db_pool;
+    req.minio = minio_client;
+    next();
+});
+
+app.use('/', routes);
+app.use('/search_projects', search_projects);
+app.use('/search_projects_results', search_projects_results);
+app.use('/project_profile', project_profile);
+app.use('/add_project', add_project);
+app.use('/add_tag', add_tag);
+app.use('/search_tag', search_tag);
+app.use('/search_vnf', search_vnf);
+app.use('/vnf_tag_association', vnf_tag_association);
+app.use('/search_max', search_max);
+//app.use('/', project_profile);
+// Some Error handling for now #TODO Remove
+
+/// catch 404 and forwarding to error handler
+app.use(function(req, res, next) {
+    var err = new Error('Not Found');
+    err.status = 404;
+    next(err);
+});
+
+
+// development error handler
+// will print stacktrace
+if (app.get('env') === 'development') {
+    app.use(function(err, req, res, next) {
+        res.status(err.status || 500);
+        res.render('error', {
+            message: err.message,
+            error: err
+        });
+    });
+}
+
+// production error handler
+// no stacktraces leaked to user
+app.use(function(err, req, res, next) {
+    res.status(err.status || 500);
+    res.render('error', {
+        message: err.message,
+        error: {}
+    });
+});
+
+module.exports = app;
diff --git a/VNF_Catalogue/bin/www b/VNF_Catalogue/bin/www
new file mode 100644
index 00000000..3cfbf779
--- /dev/null
+++ b/VNF_Catalogue/bin/www
@@ -0,0 +1,9 @@
+#!/usr/bin/env node
+var debug = require('debug')('my-application');
+var app = require('../app');
+
+app.set('port', process.env.PORT || 3000);
+
+var server = app.listen(app.get('port'), function() {
+  debug('Express server listening on port ' + server.address().port);
+});
diff --git a/VNF_Catalogue/cronjob/3rd_party/wait-for-it/LICENSE b/VNF_Catalogue/cronjob/3rd_party/wait-for-it/LICENSE
new file mode 100644
index 00000000..bd18d0c4
--- /dev/null
+++ b/VNF_Catalogue/cronjob/3rd_party/wait-for-it/LICENSE
@@ -0,0 +1,20 @@
+The MIT License (MIT)
+Copyright (c) 2016 Giles Hall
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/VNF_Catalogue/cronjob/3rd_party/wait-for-it/README.md b/VNF_Catalogue/cronjob/3rd_party/wait-for-it/README.md
new file mode 100644
index 00000000..900b7573
--- /dev/null
+++ b/VNF_Catalogue/cronjob/3rd_party/wait-for-it/README.md
@@ -0,0 +1,75 @@
+# HELP NEEDED
+
+### March 13, 2017 update
+
+Since I posted this request for help, I've had a dozen or so responses which I am now sorting through.  Applicants need to fill out [this](https://goo.gl/forms/GKCBFxaloaU47aky1) survey by March 17th.  I will select, notify and announce the new volunteer(s) on March 19th.  Once this is done, me and my team will work through the backlog of issues amd pull requests.  Thanks for your paitence.
+
+### Old request follows:
+
+Hi there!  I wrote `wait-for-it` in order to help me orchestrate containers I operate at my day job.  I thought it was a neat little script, so I published it.  I assumed I would be its only user, but that's not what happened!  `wait-for-it` has received more stars then all of my other public repositories put together.  I had no idea this tool would solicit such an audience, and I was equally unprepared to carve out the time required to address my user's issues and patches.  I would like to solicit a volunteer from the community who would be willing to be a co-maintainer of this repository.  If this is something you might be interested in, please email me at `waitforit@polymerase.org`.  Thanks!
+
+## wait-for-it
+
+`wait-for-it.sh` is a pure bash script that will wait on the availability of a host and TCP port.  It is useful for synchronizing the spin-up of interdependent services, such as linked docker containers.  Since it is a pure bash script, it does not have any external dependencies.
+
+## Usage
+
+```
+wait-for-it.sh host:port [-s] [-t timeout] [-- command args]
+-h HOST | --host=HOST       Host or IP under test
+-p PORT | --port=PORT       TCP port under test
+                            Alternatively, you specify the host and port as host:port
+-s | --strict               Only execute subcommand if the test succeeds
+-q | --quiet                Don't output any status messages
+-t TIMEOUT | --timeout=TIMEOUT
+                            Timeout in seconds, zero for no timeout
+-- COMMAND ARGS             Execute command with args after the test finishes
+```
+
+## Examples
+
+For example, let's test to see if we can access port 80 on www.google.com, and if it is available, echo the message `google is up`.
+
+```
+$ ./wait-for-it.sh www.google.com:80 -- echo "google is up"
+wait-for-it.sh: waiting 15 seconds for www.google.com:80
+wait-for-it.sh: www.google.com:80 is available after 0 seconds
+google is up
+```
+
+You can set your own timeout with the `-t` or `--timeout=` option.  Setting the timeout value to 0 will disable the timeout:
+
+```
+$ ./wait-for-it.sh -t 0 www.google.com:80 -- echo "google is up"
+wait-for-it.sh: waiting for www.google.com:80 without a timeout
+wait-for-it.sh: www.google.com:80 is available after 0 seconds
+google is up
+```
+
+The subcommand will be executed regardless if the service is up or not.  If you wish to execute the subcommand only if the service is up, add the `--strict` argument. In this example, we will test port 81 on www.google.com which will fail:
+
+```
+$ ./wait-for-it.sh www.google.com:81 --timeout=1 --strict -- echo "google is up"
+wait-for-it.sh: waiting 1 seconds for www.google.com:81
+wait-for-it.sh: timeout occurred after waiting 1 seconds for www.google.com:81
+wait-for-it.sh: strict mode, refusing to execute subprocess
+```
+
+If you don't want to execute a subcommand, leave off the `--` argument.  This way, you can test the exit condition of `wait-for-it.sh` in your own scripts, and determine how to proceed:
+
+```
+$ ./wait-for-it.sh www.google.com:80
+wait-for-it.sh: waiting 15 seconds for www.google.com:80
+wait-for-it.sh: www.google.com:80 is available after 0 seconds
+$ echo $?
+0
+$ ./wait-for-it.sh www.google.com:81
+wait-for-it.sh: waiting 15 seconds for www.google.com:81
+wait-for-it.sh: timeout occurred after waiting 15 seconds for www.google.com:81
+$ echo $?
+124
+```
+
+## Thanks
+
+I wrote this script for my employer, [Ginkgo Bioworks](http://www.ginkgobioworks.com/), who was kind enough to let me release it as an open source tool.  We are always looking to [hire](https://jobs.lever.co/ginkgobioworks) talented folks who are interested in working in the field of synthetic biology.
diff --git a/VNF_Catalogue/cronjob/3rd_party/wait-for-it/wait-for-it.sh b/VNF_Catalogue/cronjob/3rd_party/wait-for-it/wait-for-it.sh
new file mode 100755
index 00000000..eca6c3b9
--- /dev/null
+++ b/VNF_Catalogue/cronjob/3rd_party/wait-for-it/wait-for-it.sh
@@ -0,0 +1,161 @@
+#!/usr/bin/env bash
+#   Use this script to test if a given TCP host/port are available
+
+cmdname=$(basename $0)
+
+echoerr() { if [[ $QUIET -ne 1 ]]; then echo "$@" 1>&2; fi }
+
+usage()
+{
+    cat << USAGE >&2
+Usage:
+    $cmdname host:port [-s] [-t timeout] [-- command args]
+    -h HOST | --host=HOST       Host or IP under test
+    -p PORT | --port=PORT       TCP port under test
+                                Alternatively, you specify the host and port as host:port
+    -s | --strict               Only execute subcommand if the test succeeds
+    -q | --quiet                Don't output any status messages
+    -t TIMEOUT | --timeout=TIMEOUT
+                                Timeout in seconds, zero for no timeout
+    -- COMMAND ARGS             Execute command with args after the test finishes
+USAGE
+    exit 1
+}
+
+wait_for()
+{
+    if [[ $TIMEOUT -gt 0 ]]; then
+        echoerr "$cmdname: waiting $TIMEOUT seconds for $HOST:$PORT"
+    else
+        echoerr "$cmdname: waiting for $HOST:$PORT without a timeout"
+    fi
+    start_ts=$(date +%s)
+    while :
+    do
+        (echo > /dev/tcp/$HOST/$PORT) >/dev/null 2>&1
+        result=$?
+        if [[ $result -eq 0 ]]; then
+            end_ts=$(date +%s)
+            echoerr "$cmdname: $HOST:$PORT is available after $((end_ts - start_ts)) seconds"
+            break
+        fi
+        sleep 1
+    done
+    return $result
+}
+
+wait_for_wrapper()
+{
+    # In order to support SIGINT during timeout: http://unix.stackexchange.com/a/57692
+    if [[ $QUIET -eq 1 ]]; then
+        timeout $TIMEOUT $0 --quiet --child --host=$HOST --port=$PORT --timeout=$TIMEOUT &
+    else
+        timeout $TIMEOUT $0 --child --host=$HOST --port=$PORT --timeout=$TIMEOUT &
+    fi
+    PID=$!
+    trap "kill -INT -$PID" INT
+    wait $PID
+    RESULT=$?
+    if [[ $RESULT -ne 0 ]]; then
+        echoerr "$cmdname: timeout occurred after waiting $TIMEOUT seconds for $HOST:$PORT"
+    fi
+    return $RESULT
+}
+
+# process arguments
+while [[ $# -gt 0 ]]
+do
+    case "$1" in
+        *:* )
+        hostport=(${1//:/ })
+        HOST=${hostport[0]}
+        PORT=${hostport[1]}
+        shift 1
+        ;;
+        --child)
+        CHILD=1
+        shift 1
+        ;;
+        -q | --quiet)
+        QUIET=1
+        shift 1
+        ;;
+        -s | --strict)
+        STRICT=1
+        shift 1
+        ;;
+        -h)
+        HOST="$2"
+        if [[ $HOST == "" ]]; then break; fi
+        shift 2
+        ;;
+        --host=*)
+        HOST="${1#*=}"
+        shift 1
+        ;;
+        -p)
+        PORT="$2"
+        if [[ $PORT == "" ]]; then break; fi
+        shift 2
+        ;;
+        --port=*)
+        PORT="${1#*=}"
+        shift 1
+        ;;
+        -t)
+        TIMEOUT="$2"
+        if [[ $TIMEOUT == "" ]]; then break; fi
+        shift 2
+        ;;
+        --timeout=*)
+        TIMEOUT="${1#*=}"
+        shift 1
+        ;;
+        --)
+        shift
+        CLI="$@"
+        break
+        ;;
+        --help)
+        usage
+        ;;
+        *)
+        echoerr "Unknown argument: $1"
+        usage
+        ;;
+    esac
+done
+
+if [[ "$HOST" == "" || "$PORT" == "" ]]; then
+    echoerr "Error: you need to provide a host and port to test."
+    usage
+fi
+
+TIMEOUT=${TIMEOUT:-15}
+STRICT=${STRICT:-0}
+CHILD=${CHILD:-0}
+QUIET=${QUIET:-0}
+
+if [[ $CHILD -gt 0 ]]; then
+    wait_for
+    RESULT=$?
+    exit $RESULT
+else
+    if [[ $TIMEOUT -gt 0 ]]; then
+        wait_for_wrapper
+        RESULT=$?
+    else
+        wait_for
+        RESULT=$?
+    fi
+fi
+
+if [[ $CLI != "" ]]; then
+    if [[ $RESULT -ne 0 && $STRICT -eq 1 ]]; then
+        echoerr "$cmdname: strict mode, refusing to execute subprocess"
+        exit $RESULT
+    fi
+    exec $CLI
+else
+    exit $RESULT
+fi
diff --git a/VNF_Catalogue/cronjob/Dockerfile b/VNF_Catalogue/cronjob/Dockerfile
new file mode 100644
index 00000000..350411aa
--- /dev/null
+++ b/VNF_Catalogue/cronjob/Dockerfile
@@ -0,0 +1,55 @@
+###############################################################
+#   Docker container for VNF_Catalogue cronjob service
+###############################################################
+# Purpose: Don't run it from here! Use docker-compose(See README.md)
+#
+# Maintained by Kumar Rishabh :: penguinRaider
+##
+# All rights reserved. This program and the accompanying materials
+# are made available under the terms of the Apache License, Version 2.0
+# which accompanies this distribution, and is available at
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+
+FROM node:boron
+MAINTAINER KumarRishabh::penguinRaider <shailrishabh@gmail.com>
+LABEL version="v0.0.1" description="Open Source VNF_Catalogue for OPNFV"
+
+RUN apt-get update
+RUN apt-get install vim -y
+RUN apt-get install cron -y
+
+ENV DB_HOST mysql
+ENV DB_USER vnf_user
+ENV DB_PASSWORD vnf_password
+ENV DB_DATABASE vnf_catalogue
+
+RUN mkdir -p /usr/src/app
+WORKDIR /usr/src/app
+
+COPY package.json /usr/src/app/
+
+# RUN npm config set proxy http://10.4.20.103:8080
+# RUN npm config set https-proxy http://10.4.20.103:8080
+
+RUN npm install
+
+# ADD crontab /etc/cron.d/simple-cron
+
+COPY . /usr/src/app
+
+RUN chmod +x git_count_loc.sh
+RUN chmod +x script.sh
+
+RUN crontab crontab
+RUN sed -i '/session    required     pam_loginuid.so/c\#session    required   pam_loginuid.so' /etc/pam.d/cron
+
+# Give execution rights on the cron job
+# RUN chmod 0644 /etc/cron.d/simple-cron
+#
+# # Create the log file to be able to run tail
+RUN touch /var/log/cron.log
+
+# The ordering of events should be coming up of mysql service and then running
+# of cronjob. To enforce this causal relationship we use a 3rd_party script.
+CMD [ "./3rd_party/wait-for-it/wait-for-it.sh", "mysql:3306", "-t", "0", "--", "cron", "&&", "tail", "-f", "/var/log/cron.log"]
diff --git a/VNF_Catalogue/cronjob/crontab b/VNF_Catalogue/cronjob/crontab
new file mode 100644
index 00000000..892f149d
--- /dev/null
+++ b/VNF_Catalogue/cronjob/crontab
@@ -0,0 +1,3 @@
+0 * * * * /usr/src/app/script.sh
+# * * * * * root /usr/local/bin/node github 
+# An empty line is required at the end of this file for a valid cron file.
diff --git a/VNF_Catalogue/cronjob/database.js b/VNF_Catalogue/cronjob/database.js
new file mode 100644
index 00000000..8c6d0bbf
--- /dev/null
+++ b/VNF_Catalogue/cronjob/database.js
@@ -0,0 +1,16 @@
+var mysql = require('mysql');
+
+// Hardcoding some variables for now as crontab does not seem to support
+// environment variables.
+var pool = mysql.createPool({
+  host: 'mysql',
+  user: 'vnf_user',
+  password: 'vnf_password',
+  database: 'vnf_catalogue',
+  connectionLimit: 50,
+  supportBigNumbers: true,
+  multipleStatements: true,
+  dateStrings: 'date'
+});
+
+exports.pool = pool;
diff --git a/VNF_Catalogue/cronjob/git_count_loc.sh b/VNF_Catalogue/cronjob/git_count_loc.sh
new file mode 100755
index 00000000..3b316666
--- /dev/null
+++ b/VNF_Catalogue/cronjob/git_count_loc.sh
@@ -0,0 +1,11 @@
+folder_name=$(head /dev/urandom | tr -dc A-Za-z0-9 | head -c 13 ; echo '');
+
+git clone $1 $folder_name 2> /dev/null
+if [ "$?" -ne "0" ]; then
+    echo 0;
+    exit 1;
+fi
+cd $folder_name;
+(git ls-files | xargs cat | wc -l) 2> /dev/null;
+cd ../;
+rm -rf $folder_name;
diff --git a/VNF_Catalogue/cronjob/github.js b/VNF_Catalogue/cronjob/github.js
new file mode 100644
index 00000000..cc6e35f6
--- /dev/null
+++ b/VNF_Catalogue/cronjob/github.js
@@ -0,0 +1,159 @@
+// Important Add your access token here default rate of github is limited to 60 API calls per hour
+var access_token = '523825265638c8f2b5b9f1d1f5af31d71bceb49c';
+// Important set the delta threshold for repo details updation. For instance if the threshold is
+// set to 1 day(60 * 60 * 24), the cronjob will only update the row if the difference between current
+// time and last_updated time stamp of a repo is greater than one day
+var delta = 60 * 60 * 24;
+
+
+var github = require('octonode');
+db_pool = require('/usr/src/app/database').pool;
+async = require('async');
+
+var current_time = Math.floor(new Date().getTime() / 1000);//toISOString().slice(0, 19).replace('T', ' ');
+console.log(current_time);
+
+var get_val_from_header = function(header_link) {
+    // small hack by parsing the header and setting per_page = 1, hence no pagination fetch required
+    result_intermediate = header_link.split(';');
+    result_intermediate = result_intermediate[result_intermediate.length - 2];
+    var reg = /&page=([0-9].*)>/g;
+    var match = reg.exec(result_intermediate);
+    return parseInt(match[1]);
+}
+
+var get_stargazers = function(result, ghrepo, orig_repo, primary_callback, cb) {
+    ghrepo.stargazers({per_page: 1}, function(err, data, headers) {
+    //console.log(JSON.stringify(data));
+        try {
+            result['no_of_stars'] = get_val_from_header(headers['link']);
+            cb(null, result, ghrepo, orig_repo, primary_callback);
+        } catch(err) {
+            result['no_of_stars'] = null;
+            cb(null, result, ghrepo, orig_repo, primary_callback);
+        }
+    });
+}
+
+var get_branches = function(result, ghrepo, orig_repo, primary_callback, cb) {
+    ghrepo.branches({per_page: 1}, function(err, data, headers) {
+        try {
+            result['versions'] = get_val_from_header(headers['link']);
+            cb(null, result, ghrepo, orig_repo, primary_callback);
+        } catch(err) {
+            result['versions'] = null;
+            cb(null, result, ghrepo, orig_repo, primary_callback);
+        }
+    });
+}
+
+var get_contributors = function(result, ghrepo, orig_repo, primary_callback, cb) {
+    ghrepo.contributors({per_page: 1}, function(err, data, headers) {
+        try {
+            result['no_of_developers'] = get_val_from_header(headers['link']);
+            cb(null, result, ghrepo, orig_repo, primary_callback);
+        } catch(err) {
+            result['no_of_developers'] = null;
+            cb(null, result, ghrepo, orig_repo, primary_callback);
+        }
+    });
+}
+
+var get_lines_of_code = function(result, ghrepo, orig_repo, primary_callback, cb) {
+    //    #TODO
+    console.log('here');
+
+    console.log(orig_repo);
+    const
+        spawn = require( 'child_process' ).spawn,
+        ls = spawn( 'bash', ['/usr/src/app/git_count_loc.sh', orig_repo] );
+
+    ls.stdout.on( 'data', data => {
+        console.log( `stdout: ${data}` );
+        result['lines_of_code'] = parseInt(`${data}`.replace(/\n$/, ''), 10);
+        //cb(null, result, primary_callback);
+    });
+
+    ls.stderr.on( 'data', data => {
+        //console.log( `stderr: ${data}` );
+        //cb(null, result, primary_callback);
+    });
+
+    ls.on( 'close', code => {
+        console.log( `child process exited with code ${code}` );
+        cb(null, result, primary_callback);
+    });
+}
+
+var secondary_callback = function (err, result, primary_callback) {
+    console.log(result);
+    if((result['last_updated'] == null) || (current_time - result['last_updated'] > delta)) {
+        db_pool.getConnection(function(err, connection) {
+            //Use the connection
+            var last_updated = current_time;
+            var no_of_stars = result['no_of_stars'];
+            var versions = result['versions'];
+            var no_of_developers = result['no_of_developers'];
+            var lines_of_code = result['lines_of_code'];
+            console.log('here');
+            console.log(lines_of_code);
+            sql_query = 'update vnf set last_updated = FROM_UNIXTIME(' + last_updated;
+            sql_query += '), no_of_stars =  ' + no_of_stars + ', versions = ' + versions;
+            sql_query += ', lines_of_code = ' + lines_of_code;
+            sql_query += ', no_of_developers = ' + no_of_developers + ' where vnf_id = ';
+            sql_query += result['vnf_id'];
+            console.log(sql_query);
+            connection.query(sql_query, function (error, results, fields) {
+                //if (error) throw error;
+                //And done with the connection.
+                connection.release();
+                if(error) {
+                    primary_callback(null, result['vnf_id'] + ' not updated');
+                } else {
+                    primary_callback(null, result['vnf_id'] + ' updated');
+                }
+                // Handle error after the release.
+                // Don't use the connection here, it has been returned to the pool.
+            });
+        });
+    } else {
+        primary_callback(null, result['vnf_id'] + ' not updated');
+    }
+}
+
+var get_stats = function(vnf_details, callback) {
+    repo = vnf_details['repo_url'];
+    orig_repo = repo;
+    repo = repo.split("/");
+    github_id = repo[repo.length - 2] + '/' + repo[repo.length - 1];
+
+    var async = require('async');
+    var client = github.client(access_token);
+    var ghrepo = client.repo(github_id);
+
+    result = {}
+    result['vnf_id'] = vnf_details['vnf_id'];
+    result['last_updated'] = vnf_details['last_updated'];
+
+    async.waterfall([
+            async.apply(get_stargazers, result, ghrepo, orig_repo, callback),
+            get_branches,
+            get_contributors,
+            get_lines_of_code,
+        ], secondary_callback);
+}
+
+db_pool.getConnection(function(err, connection) {
+    sql_query = 'select vnf_id, repo_url, UNIX_TIMESTAMP(last_updated) last_updated from vnf';
+    console.log(sql_query);
+    connection.query(sql_query, function (error, results, fields) {
+        if (error) throw error;
+        async.map(results, get_stats, function(error, results) {
+            //console.log(results);
+            console.log(results);
+            process.exit();
+
+        });
+    });
+});
+
diff --git a/VNF_Catalogue/cronjob/package.json b/VNF_Catalogue/cronjob/package.json
new file mode 100644
index 00000000..1b7fb1b5
--- /dev/null
+++ b/VNF_Catalogue/cronjob/package.json
@@ -0,0 +1,10 @@
+{
+    "name": "VNF_Catalogue_cron_jobs",
+    "version": "0.0.1",
+    "private": true,
+    "dependencies": {
+        "octonode": "*",
+        "async": "*",
+        "mysql": "*"
+    }
+}
diff --git a/VNF_Catalogue/cronjob/script.sh b/VNF_Catalogue/cronjob/script.sh
new file mode 100644
index 00000000..4b5a8d26
--- /dev/null
+++ b/VNF_Catalogue/cronjob/script.sh
@@ -0,0 +1,2 @@
+#!/bin/bash
+/usr/local/bin/node /usr/src/app/github >> /tmp/mybacklog 2>&1
diff --git a/VNF_Catalogue/database.js b/VNF_Catalogue/database.js
new file mode 100644
index 00000000..4fa8be10
--- /dev/null
+++ b/VNF_Catalogue/database.js
@@ -0,0 +1,23 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+var mysql = require('mysql');
+
+var pool = mysql.createPool({
+  host: process.env.DB_HOST,
+  user: process.env.DB_USER,
+  password: process.env.DB_PASSWORD,
+  database: process.env.DB_DATABASE,
+  connectionLimit: 50,
+  supportBigNumbers: true,
+  multipleStatements: true,
+  dateStrings: 'date'
+});
+
+exports.pool = pool;
diff --git a/VNF_Catalogue/docker-compose.yml b/VNF_Catalogue/docker-compose.yml
new file mode 100644
index 00000000..2efba431
--- /dev/null
+++ b/VNF_Catalogue/docker-compose.yml
@@ -0,0 +1,80 @@
+##################################################################
+#   Docker-Compose for setting up and running vnf_catalogue webapp
+##################################################################
+# Purpose: To setup and run vnf_catalogue webapp
+# Usage: docker-compose up
+#
+# The webapp would be accessible at ip_address:3000
+#
+# Maintained by Kumar Rishabh :: penguinRaider
+##
+# All rights reserved. This program and the accompanying materials
+# are made available under the terms of the Apache License, Version 2.0
+# which accompanies this distribution, and is available at
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+
+version: "2"
+services:
+    mysql:
+    # mysql service built on top of vanilla mysql container.
+    # Defines mysql credentials.
+        image: mysql
+        container_name: vnf_catalogue_database
+        environment:
+            - MYSQL_USER=vnf_user
+            - MYSQL_PASSWORD=vnf_password
+            - MYSQL_DATABASE=vnf_catalogue
+            - MYSQL_ROOT_PASSWORD=root
+        volumes:
+            - ./persistent_data/database/mysql:/var/lib/mysql
+    phpmyadmin:
+        image: phpmyadmin/phpmyadmin
+        links:
+            - "mysql:mysql"
+        ports:
+            - "8181:80"
+        environment:
+            PMA_ARBITRARY: 1
+            MYSQL_USERNAME: vnf_user
+            MYSQL_PASSWORD: vnf_password
+            MYSQL_ROOT_PASSWORD: root
+            #- MYSQL_USERNAME=root
+    minio:
+        image: minio/minio
+        environment:
+            - MINIO_ACCESS_KEY=vnf_minio
+            - MINIO_SECRET_KEY=vnf_minio
+        ports:
+            - "9000:9000"
+        volumes:
+            - ./persistent_data/minio/images:/export
+        command: server /export
+    vnf_catalogue:
+    # The vnf_catalogue webapp service.
+        build: .
+        container_name: vnf_catalogue_webapp
+        depends_on:
+            - mysql
+            - minio
+        # Port on which the node.js server would be exposed <host:container>
+        # To change host port to say 80 use 80:3000
+
+        ports:
+            - "3000:3000"
+        volumes:
+            - ./persistent_data/nodejs_server/public_images/:/usr/src/app/public/uploads
+    vnf_catalogue_migrate:
+    # We define another service for database migration. This service will
+    # migrate the database schema.(Dockerfile resides in migration
+    # directory).
+
+        build: ./migration
+        container_name: vnf_catalogue_migrate
+        depends_on:
+            - mysql
+    vnf_catalogue_cronjob:
+        build: ./cronjob
+        container_name: vnf_catalogue_cronjob
+        depends_on:
+            - mysql
diff --git a/VNF_Catalogue/docker.sh b/VNF_Catalogue/docker.sh
new file mode 100755
index 00000000..8a6622e5
--- /dev/null
+++ b/VNF_Catalogue/docker.sh
@@ -0,0 +1,8 @@
+sudo chmod -R 777 persistent_data
+docker rmi $(docker images -f dangling=true -q)
+docker rm $(docker ps -a -f status=exited -q)
+docker volume rm $(docker volume ls -f dangling=true -q)
+docker-compose stop
+docker-compose rm -f
+docker-compose build
+docker-compose up
diff --git a/VNF_Catalogue/docker_commands.sh b/VNF_Catalogue/docker_commands.sh
new file mode 100644
index 00000000..3be98ce8
--- /dev/null
+++ b/VNF_Catalogue/docker_commands.sh
@@ -0,0 +1,2 @@
+sh ./3rd_party/wait-for-it/wait-for-it.sh mysql:3306 -t 0
+node migrate
diff --git a/VNF_Catalogue/env.sh b/VNF_Catalogue/env.sh
new file mode 100644
index 00000000..c1a2ebf7
--- /dev/null
+++ b/VNF_Catalogue/env.sh
@@ -0,0 +1 @@
+MINIO_HOST='localhost'
diff --git a/VNF_Catalogue/migration/3rd_party/wait-for-it/LICENSE b/VNF_Catalogue/migration/3rd_party/wait-for-it/LICENSE
new file mode 100644
index 00000000..bd18d0c4
--- /dev/null
+++ b/VNF_Catalogue/migration/3rd_party/wait-for-it/LICENSE
@@ -0,0 +1,20 @@
+The MIT License (MIT)
+Copyright (c) 2016 Giles Hall
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/VNF_Catalogue/migration/3rd_party/wait-for-it/README.md b/VNF_Catalogue/migration/3rd_party/wait-for-it/README.md
new file mode 100644
index 00000000..900b7573
--- /dev/null
+++ b/VNF_Catalogue/migration/3rd_party/wait-for-it/README.md
@@ -0,0 +1,75 @@
+# HELP NEEDED
+
+### March 13, 2017 update
+
+Since I posted this request for help, I've had a dozen or so responses which I am now sorting through.  Applicants need to fill out [this](https://goo.gl/forms/GKCBFxaloaU47aky1) survey by March 17th.  I will select, notify and announce the new volunteer(s) on March 19th.  Once this is done, me and my team will work through the backlog of issues amd pull requests.  Thanks for your paitence.
+
+### Old request follows:
+
+Hi there!  I wrote `wait-for-it` in order to help me orchestrate containers I operate at my day job.  I thought it was a neat little script, so I published it.  I assumed I would be its only user, but that's not what happened!  `wait-for-it` has received more stars then all of my other public repositories put together.  I had no idea this tool would solicit such an audience, and I was equally unprepared to carve out the time required to address my user's issues and patches.  I would like to solicit a volunteer from the community who would be willing to be a co-maintainer of this repository.  If this is something you might be interested in, please email me at `waitforit@polymerase.org`.  Thanks!
+
+## wait-for-it
+
+`wait-for-it.sh` is a pure bash script that will wait on the availability of a host and TCP port.  It is useful for synchronizing the spin-up of interdependent services, such as linked docker containers.  Since it is a pure bash script, it does not have any external dependencies.
+
+## Usage
+
+```
+wait-for-it.sh host:port [-s] [-t timeout] [-- command args]
+-h HOST | --host=HOST       Host or IP under test
+-p PORT | --port=PORT       TCP port under test
+                            Alternatively, you specify the host and port as host:port
+-s | --strict               Only execute subcommand if the test succeeds
+-q | --quiet                Don't output any status messages
+-t TIMEOUT | --timeout=TIMEOUT
+                            Timeout in seconds, zero for no timeout
+-- COMMAND ARGS             Execute command with args after the test finishes
+```
+
+## Examples
+
+For example, let's test to see if we can access port 80 on www.google.com, and if it is available, echo the message `google is up`.
+
+```
+$ ./wait-for-it.sh www.google.com:80 -- echo "google is up"
+wait-for-it.sh: waiting 15 seconds for www.google.com:80
+wait-for-it.sh: www.google.com:80 is available after 0 seconds
+google is up
+```
+
+You can set your own timeout with the `-t` or `--timeout=` option.  Setting the timeout value to 0 will disable the timeout:
+
+```
+$ ./wait-for-it.sh -t 0 www.google.com:80 -- echo "google is up"
+wait-for-it.sh: waiting for www.google.com:80 without a timeout
+wait-for-it.sh: www.google.com:80 is available after 0 seconds
+google is up
+```
+
+The subcommand will be executed regardless if the service is up or not.  If you wish to execute the subcommand only if the service is up, add the `--strict` argument. In this example, we will test port 81 on www.google.com which will fail:
+
+```
+$ ./wait-for-it.sh www.google.com:81 --timeout=1 --strict -- echo "google is up"
+wait-for-it.sh: waiting 1 seconds for www.google.com:81
+wait-for-it.sh: timeout occurred after waiting 1 seconds for www.google.com:81
+wait-for-it.sh: strict mode, refusing to execute subprocess
+```
+
+If you don't want to execute a subcommand, leave off the `--` argument.  This way, you can test the exit condition of `wait-for-it.sh` in your own scripts, and determine how to proceed:
+
+```
+$ ./wait-for-it.sh www.google.com:80
+wait-for-it.sh: waiting 15 seconds for www.google.com:80
+wait-for-it.sh: www.google.com:80 is available after 0 seconds
+$ echo $?
+0
+$ ./wait-for-it.sh www.google.com:81
+wait-for-it.sh: waiting 15 seconds for www.google.com:81
+wait-for-it.sh: timeout occurred after waiting 15 seconds for www.google.com:81
+$ echo $?
+124
+```
+
+## Thanks
+
+I wrote this script for my employer, [Ginkgo Bioworks](http://www.ginkgobioworks.com/), who was kind enough to let me release it as an open source tool.  We are always looking to [hire](https://jobs.lever.co/ginkgobioworks) talented folks who are interested in working in the field of synthetic biology.
diff --git a/VNF_Catalogue/migration/3rd_party/wait-for-it/wait-for-it.sh b/VNF_Catalogue/migration/3rd_party/wait-for-it/wait-for-it.sh
new file mode 100755
index 00000000..eca6c3b9
--- /dev/null
+++ b/VNF_Catalogue/migration/3rd_party/wait-for-it/wait-for-it.sh
@@ -0,0 +1,161 @@
+#!/usr/bin/env bash
+#   Use this script to test if a given TCP host/port are available
+
+cmdname=$(basename $0)
+
+echoerr() { if [[ $QUIET -ne 1 ]]; then echo "$@" 1>&2; fi }
+
+usage()
+{
+    cat << USAGE >&2
+Usage:
+    $cmdname host:port [-s] [-t timeout] [-- command args]
+    -h HOST | --host=HOST       Host or IP under test
+    -p PORT | --port=PORT       TCP port under test
+                                Alternatively, you specify the host and port as host:port
+    -s | --strict               Only execute subcommand if the test succeeds
+    -q | --quiet                Don't output any status messages
+    -t TIMEOUT | --timeout=TIMEOUT
+                                Timeout in seconds, zero for no timeout
+    -- COMMAND ARGS             Execute command with args after the test finishes
+USAGE
+    exit 1
+}
+
+wait_for()
+{
+    if [[ $TIMEOUT -gt 0 ]]; then
+        echoerr "$cmdname: waiting $TIMEOUT seconds for $HOST:$PORT"
+    else
+        echoerr "$cmdname: waiting for $HOST:$PORT without a timeout"
+    fi
+    start_ts=$(date +%s)
+    while :
+    do
+        (echo > /dev/tcp/$HOST/$PORT) >/dev/null 2>&1
+        result=$?
+        if [[ $result -eq 0 ]]; then
+            end_ts=$(date +%s)
+            echoerr "$cmdname: $HOST:$PORT is available after $((end_ts - start_ts)) seconds"
+            break
+        fi
+        sleep 1
+    done
+    return $result
+}
+
+wait_for_wrapper()
+{
+    # In order to support SIGINT during timeout: http://unix.stackexchange.com/a/57692
+    if [[ $QUIET -eq 1 ]]; then
+        timeout $TIMEOUT $0 --quiet --child --host=$HOST --port=$PORT --timeout=$TIMEOUT &
+    else
+        timeout $TIMEOUT $0 --child --host=$HOST --port=$PORT --timeout=$TIMEOUT &
+    fi
+    PID=$!
+    trap "kill -INT -$PID" INT
+    wait $PID
+    RESULT=$?
+    if [[ $RESULT -ne 0 ]]; then
+        echoerr "$cmdname: timeout occurred after waiting $TIMEOUT seconds for $HOST:$PORT"
+    fi
+    return $RESULT
+}
+
+# process arguments
+while [[ $# -gt 0 ]]
+do
+    case "$1" in
+        *:* )
+        hostport=(${1//:/ })
+        HOST=${hostport[0]}
+        PORT=${hostport[1]}
+        shift 1
+        ;;
+        --child)
+        CHILD=1
+        shift 1
+        ;;
+        -q | --quiet)
+        QUIET=1
+        shift 1
+        ;;
+        -s | --strict)
+        STRICT=1
+        shift 1
+        ;;
+        -h)
+        HOST="$2"
+        if [[ $HOST == "" ]]; then break; fi
+        shift 2
+        ;;
+        --host=*)
+        HOST="${1#*=}"
+        shift 1
+        ;;
+        -p)
+        PORT="$2"
+        if [[ $PORT == "" ]]; then break; fi
+        shift 2
+        ;;
+        --port=*)
+        PORT="${1#*=}"
+        shift 1
+        ;;
+        -t)
+        TIMEOUT="$2"
+        if [[ $TIMEOUT == "" ]]; then break; fi
+        shift 2
+        ;;
+        --timeout=*)
+        TIMEOUT="${1#*=}"
+        shift 1
+        ;;
+        --)
+        shift
+        CLI="$@"
+        break
+        ;;
+        --help)
+        usage
+        ;;
+        *)
+        echoerr "Unknown argument: $1"
+        usage
+        ;;
+    esac
+done
+
+if [[ "$HOST" == "" || "$PORT" == "" ]]; then
+    echoerr "Error: you need to provide a host and port to test."
+    usage
+fi
+
+TIMEOUT=${TIMEOUT:-15}
+STRICT=${STRICT:-0}
+CHILD=${CHILD:-0}
+QUIET=${QUIET:-0}
+
+if [[ $CHILD -gt 0 ]]; then
+    wait_for
+    RESULT=$?
+    exit $RESULT
+else
+    if [[ $TIMEOUT -gt 0 ]]; then
+        wait_for_wrapper
+        RESULT=$?
+    else
+        wait_for
+        RESULT=$?
+    fi
+fi
+
+if [[ $CLI != "" ]]; then
+    if [[ $RESULT -ne 0 && $STRICT -eq 1 ]]; then
+        echoerr "$cmdname: strict mode, refusing to execute subprocess"
+        exit $RESULT
+    fi
+    exec $CLI
+else
+    exit $RESULT
+fi
diff --git a/VNF_Catalogue/migration/Dockerfile b/VNF_Catalogue/migration/Dockerfile
new file mode 100644
index 00000000..730b1ba7
--- /dev/null
+++ b/VNF_Catalogue/migration/Dockerfile
@@ -0,0 +1,37 @@
+###############################################################
+#   Docker container for VNF_Catalogue Schema Migration Service
+###############################################################
+# Purpose: Don't run it from here! Use docker-compose(See README.md)
+#
+# Maintained by Kumar Rishabh :: penguinRaider
+##
+# All rights reserved. This program and the accompanying materials
+# are made available under the terms of the Apache License, Version 2.0
+# which accompanies this distribution, and is available at
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+
+FROM node:boron
+MAINTAINER KumarRishabh::penguinRaider <shailrishabh@gmail.com>
+LABEL version="v0.0.1" description="Open Source VNF_Catalogue for OPNFV"
+
+ENV DB_HOST mysql
+ENV DB_USER vnf_user
+ENV DB_PASSWORD vnf_password
+ENV DB_DATABASE vnf_catalogue
+
+RUN mkdir -p /usr/src/app
+WORKDIR /usr/src/app
+
+COPY package.json /usr/src/app/
+
+# RUN npm config set proxy http://10.4.20.103:8080
+# RUN npm config set https-proxy http://10.4.20.103:8080
+
+RUN npm install
+
+COPY . /usr/src/app
+
+# The ordering of events should be coming up of mysql service and then migration
+# of schema for the database. To enforce this causal relationship we use a 3rd_party script.
+CMD [ "./3rd_party/wait-for-it/wait-for-it.sh", "mysql:3306", "-t", "0", "--", "node", "migrate"]
diff --git a/VNF_Catalogue/migration/bash.sh b/VNF_Catalogue/migration/bash.sh
new file mode 100644
index 00000000..1625a06a
--- /dev/null
+++ b/VNF_Catalogue/migration/bash.sh
@@ -0,0 +1,4 @@
+DB_HOST='localhost';
+DB_USER='root';
+DB_PASSWORD='iiit123';
+DB_DATABASE='vnf_catalogue';
diff --git a/VNF_Catalogue/migration/migrate.js b/VNF_Catalogue/migration/migrate.js
new file mode 100644
index 00000000..24332fd9
--- /dev/null
+++ b/VNF_Catalogue/migration/migrate.js
@@ -0,0 +1,100 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh(penguinRaider) and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+var knex = require('knex')({
+    client: 'mysql',
+    connection: {
+        host     : process.env.DB_HOST,
+        user     : process.env.DB_USER,
+        password : process.env.DB_PASSWORD,
+        database : process.env.DB_DATABASE,
+        charset  : 'utf8'
+    }
+});
+var Schema = require('./schema');
+var sequence = require('when/sequence');
+var _ = require('lodash');
+var moment = require('moment');
+
+function createTable(tableName) {
+    return knex.schema.createTable(tableName, function (table) {
+    var column;
+    var columnKeys = _.keys(Schema[tableName]);
+    _.each(columnKeys, function (key) {
+        if (Schema[tableName][key].type === 'text' && Schema[tableName][key].hasOwnProperty('fieldtype')) {
+        column = table[Schema[tableName][key].type](key, Schema[tableName][key].fieldtype);
+        }
+        else if (Schema[tableName][key].type === 'enum' && Schema[tableName][key].hasOwnProperty('values') && Schema[tableName][key].nullable === true) {
+        console.log(Schema[tableName][key].values);
+        column = table[Schema[tableName][key].type](key, Schema[tableName][key].values).nullable();
+        }
+        else if (Schema[tableName][key].type === 'enum' && Schema[tableName][key].hasOwnProperty('values')) {
+        console.log(Schema[tableName][key].values);
+        column = table[Schema[tableName][key].type](key, Schema[tableName][key].values).notNullable();
+        }
+        else if (Schema[tableName][key].type === 'string' && Schema[tableName][key].hasOwnProperty('maxlength')) {
+        column = table[Schema[tableName][key].type](key, Schema[tableName][key].maxlength);
+        }
+        else {
+        column = table[Schema[tableName][key].type](key);
+        }
+        if (Schema[tableName][key].hasOwnProperty('nullable') && Schema[tableName][key].nullable === true) {
+        column.nullable();
+        }
+        else {
+        column.notNullable();
+        }
+        if (Schema[tableName][key].hasOwnProperty('primary') && Schema[tableName][key].primary === true) {
+        column.primary();
+        }
+        if (Schema[tableName][key].hasOwnProperty('unique') && Schema[tableName][key].unique) {
+        column.unique();
+        }
+        if (Schema[tableName][key].hasOwnProperty('unsigned') && Schema[tableName][key].unsigned) {
+        column.unsigned();
+        }
+        if (Schema[tableName][key].hasOwnProperty('references')) {
+        column.references(Schema[tableName][key].references);
+        }
+        if (Schema[tableName][key].hasOwnProperty('defaultTo')) {
+        column.defaultTo(Schema[tableName][key].defaultTo);
+        }
+    });
+    });
+}
+function createTables () {
+    var tables = [];
+    var tableNames = _.keys(Schema);
+    tables = _.map(tableNames, function (tableName) {
+    return function () {
+        return createTable(tableName);
+    };
+    });
+    return sequence(tables);
+}
+
+function mysql_datetime() {
+    return moment(new Date()).format('YYYY-MM-DD HH:mm:ss');
+}
+
+createTables()
+.then(function() {
+    console.log('Tables created!!');
+    var current_time = mysql_datetime();
+    console.log(current_time);
+
+    knex.insert([{user_name: 'admin', password: 'admin', email_id: 'admin@opnfv.org', company: 'opnfv', introduction: 'hello world',
+                created_at: current_time}]).into('user').then(function() {                                                           
+                    process.exit(0)});;
+})
+.catch(function (error) {
+    console.log('error creating the database perhaps it exists?(If yes congrats the persistance of mysql works :-D)');
+    process.exit(0);
+    //throw error;
+});
diff --git a/VNF_Catalogue/migration/package.json b/VNF_Catalogue/migration/package.json
new file mode 100644
index 00000000..3c636d8b
--- /dev/null
+++ b/VNF_Catalogue/migration/package.json
@@ -0,0 +1,16 @@
+{
+  "name": "VNF_Catalogue_migration",
+  "version": "0.0.1",
+  "private": true,
+  "scripts": {
+    "start": "node ./bin/www"
+  },
+  "dependencies": {
+    "bookshelf": "*",
+    "knex": "*",
+    "lodash": "*",
+    "mysql": "^2.13.0",
+    "when": "*",
+    "moment": "*"
+  }
+}
diff --git a/VNF_Catalogue/migration/schema.js b/VNF_Catalogue/migration/schema.js
new file mode 100644
index 00000000..9a1a5e76
--- /dev/null
+++ b/VNF_Catalogue/migration/schema.js
@@ -0,0 +1,58 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh(penguinRaider) and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+var Schema = {
+    photo: {
+        photo_id: {type: 'increments', nullable: false, primary: true},
+        photo_url: {type: 'string', maxlength: 254, nullable: false}
+    },
+    user: {
+        user_id: {type: 'increments', nullable: false, primary: true},
+        user_name: {type: 'string', maxlength: 254, nullable: false},
+        password: {type: 'string', maxlength: 150, nullable: false},
+        email_id: {type: 'string', maxlength: 254, nullable: false, unique: true, validations: {isEmail: true}},
+        photo_id: {type: 'integer', nullable: true, unsigned: true, references: 'photo.photo_id'},
+        company: {type: 'string', maxlength: 254, nullable: false},
+        introduction: {type: 'string', maxlength: 510, nullable: false},
+        last_login: {type: 'dateTime', nullable: true},
+        created_at: {type: 'dateTime', nullable: false},
+    },
+    vnf: {
+        vnf_id: {type: 'increments', nullable: false, primary: true},
+        vnf_name: {type: 'string', maxlength: 254, nullable: false},
+        repo_url: {type: 'string', maxlength: 254, nullable: false},
+        photo_id: {type: 'integer', nullable: true, unsigned: true, references: 'photo.photo_id'},
+        submitter_id: {type: 'integer', nullable: false, unsigned: true, references: 'user.user_id'},
+        lines_of_code: {type: 'integer', nullable: true, unsigned: true},
+        versions: {type: 'integer', nullable: true, unsigned: true},
+        no_of_developers: {type: 'integer', nullable: true, unsigned: true},
+        no_of_stars: {type: 'integer', nullable: true, unsigned: true},
+        license: {type: 'enum', nullable: false, values: ['MIT', 'GPL', 'GPL_V2', 'BSD', 'APACHE']},
+        opnfv_indicator: {type: 'enum', nullable: false, values: ['gold', 'silver', 'platinum']},
+        complexity: {type: 'enum', nullable: true, values: ['low', 'medium', 'high']},
+        activity: {type: 'enum', nullable: true, values: ['low', 'medium', 'high']},
+        last_updated: {type: 'dateTime', nullable: true},
+    },
+    tag: {
+        tag_id: {type: 'increments', nullable: false, primary: true},
+        tag_name: {type: 'string', maxlength: 150, nullable: false},
+        is_vnf_name: {type: 'boolean', defaultTo: 'false'} 
+    },
+    vnf_tags: {
+        vnf_tag_id: {type: 'increments', nullable: false, primary: true},
+        tag_id: {type: 'integer', nullable: false, unsigned: true, references: 'tag.tag_id'},
+        vnf_id: {type: 'integer', nullable: false, unsigned: true, references: 'vnf.vnf_id'},
+    },
+    vnf_contributors: {
+        vnf_contributors_id: {type: 'increments', nullable: false, primary: true},
+        user_id: {type: 'integer', nullable: false, unsigned: true, references: 'user.user_id'},
+        vnf_id: {type: 'integer', nullable: false, unsigned: true, references: 'vnf.vnf_id'},
+        created_at: {type: 'dateTime', nullable: false},
+    }
+};
+module.exports = Schema;
diff --git a/VNF_Catalogue/minio.js b/VNF_Catalogue/minio.js
new file mode 100644
index 00000000..acf5f117
--- /dev/null
+++ b/VNF_Catalogue/minio.js
@@ -0,0 +1,11 @@
+var Minio = require("minio");
+
+var minio_client = new Minio.Client({
+    endPoint: 'localhost',//process.env.MINIO_HOST,
+    port: 9000,
+    secure: false,
+    accessKey: process.env.MINIO_ACCESS_KEY,
+    secretKey: process.env.MINIO_SECRET_KEY
+});
+
+exports.minio_client = minio_client;
diff --git a/VNF_Catalogue/package.json b/VNF_Catalogue/package.json
new file mode 100644
index 00000000..8d97069f
--- /dev/null
+++ b/VNF_Catalogue/package.json
@@ -0,0 +1,29 @@
+{
+    "name": "VNF_Catalogue",
+    "version": "0.0.1",
+    "private": true,
+    "scripts": {
+        "start": "node ./bin/www"
+    },
+    "dependencies": {
+        "body-parser": "~1.15.1",
+        "cookie-parser": "~1.4.3",
+        "debug": "~2.2.0",
+        "express": "~4.13.4",
+        "jade": "~1.11.0",
+        "morgan": "~1.7.0",
+        "serve-favicon": "~2.3.0",
+        "mysql": "*",
+        "express-validator": "*",
+        "nodemon": "*",
+        "async": "*",
+        "multer": "*",
+        "octonode": "*",
+        "bookshelf": "*",
+        "knex": "*",
+        "when": "*",
+        "lodash": "*",
+        "moment": "*",
+        "minio": "*"
+    }
+}
diff --git a/VNF_Catalogue/public/3rd_party/materialize-pagination.js b/VNF_Catalogue/public/3rd_party/materialize-pagination.js
new file mode 100644
index 00000000..d4509044
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize-pagination.js
@@ -0,0 +1,288 @@
+/*
+ materialize Pagination v0.2.2
+ http://mirjamsk.github.io/materialize-pagination/
+
+ Sample usage:
+    $('#pagination').materializePagination({ 
+        align: 'left',
+        lastPage:  10,
+        firstPage:  1,
+        urlParameter: 'page',
+        useUrlParameter: true,
+        onClickCallback: function(requestedPage){
+            console.log('Requested page is '+ requestedPage)
+        }
+    });  
+*/
+;(function($, window, document, undefined) {
+
+    var MaterializePagination = function(elem, options) {
+        this.$elem   = $(elem);
+        this.options = options;
+        this.$container    = null;
+        this.$prevEllipsis = null;
+        this.$nextEllipsis = null;
+        this.currentPage   = null;
+        this.visiblePages  = [];
+        this.maxVisiblePages = 3;
+    };
+
+    MaterializePagination.prototype = {
+        defaults: {
+            align: 'center',
+            lastPage: 1,
+            firstPage: 1,
+            urlParameter: 'page',
+            useUrlParameter: true,
+            onClickCallback: function(){}
+        },
+
+        init: function() {
+            // Combine defaults with user-specified options
+            this.config = $.extend({}, this.defaults, this.options);
+            // Get page defined by the urlParameter
+            var requestedPage =  this.config.useUrlParameter ? this.parseUrl() : this.config.firstPage;
+            // Create initial pagination and add it to the DOM
+            if(this.createPaginationBase(requestedPage))
+                this.bindClickEvent();
+        },
+
+        createPaginationBase: function(requestedPage) {
+            //alert('getting called');
+            if (isNaN(this.config.firstPage) || isNaN(this.config.lastPage) ){
+                console.error('Both firstPage and lastPage attributes need to be integer values');
+                return false;
+            }
+            else if (this.config.firstPage > this.config.lastPage ){
+                console.error('Value of firstPage must be less than the value of lastPage');
+                return false;
+            }
+            this.config.firstPage = parseInt(this.config.firstPage);
+            this.config.lastPage = parseInt(this.config.lastPage);
+            this.currentPage = this.config.firstPage - this.maxVisiblePages;
+
+            this.$container = $('<ul>')
+                .addClass('pagination')
+                .addClass(this.config.align + '-align');
+
+            this.$prevEllipsis = this.util.Ellipsis();
+            this.$nextEllipsis = this.util.Ellipsis();
+
+            var $firstPage   = this.util.createPage(this.config.firstPage);
+            var $prevChevron = this.util.createChevron('prev');
+            var $nextChevron = this.util.createChevron('next');
+
+            this.$container
+                .append($prevChevron)
+                .append($firstPage)
+                .append(this.$prevEllipsis.$elem)
+                .append(this.$nextEllipsis.$elem)
+                .append($nextChevron);
+
+            if (this.config.lastPage > this.config.firstPage) {
+                var $lastPage = this.util.createPage(this.config.lastPage);
+                $lastPage.insertBefore($nextChevron);
+            }
+
+            this.requestPage(requestedPage, true);
+            this.renderActivePage();
+            this.$elem.append(this.$container);
+            return true;
+        },
+
+        requestPage: function(requestedPage, initing){
+            //alert(initing);
+            switch (requestedPage) {
+                case this.currentPage:
+                    return;
+                case this.currentPage - 1:
+                    this.requestPrevPage();
+                    break;
+                case this.currentPage + 1:
+                    this.requestNextPage();
+                    break;
+                default:
+                    this.requestPageByNumber(requestedPage);
+            }
+            if (!initing)
+                this.config.onClickCallback(this.currentPage);
+            this.renderActivePage();
+
+            if ( this.config.useUrlParameter )
+                this.updateUrlParam(this.config.urlParameter, this.currentPage);  
+        },
+
+        requestPrevPage: function() {
+            this.currentPage -= 1;
+            this.visiblePages.pop().remove();
+            this.visiblePages.unshift(this.insertPrevPaginationComponent(this.currentPage - 1));
+        },
+
+        requestNextPage: function() {
+            this.currentPage += 1;
+            this.visiblePages.shift().remove();
+            this.visiblePages.push(this.insertNextPaginationComponent(this.currentPage + 1));
+        },
+
+        requestPageByNumber: function(requestedPage) {
+            this.purgeVisiblePages();
+            this.currentPage = requestedPage;
+            this.visiblePages.push(this.insertNextPaginationComponent(this.currentPage - 1));
+            this.visiblePages.push(this.insertNextPaginationComponent(this.currentPage));
+            this.visiblePages.push(this.insertNextPaginationComponent(this.currentPage + 1));
+        },
+
+        renderActivePage: function() {
+            this.renderEllipsis();
+            this.$container.find('li.active').removeClass('active');
+            var currentPageComponent = $(this.$container.find('[data-page="' + this.currentPage + '"]')[0]);
+                currentPageComponent.addClass('active');
+        },
+
+        renderEllipsis: function() {
+            if (this.$prevEllipsis.isHidden && 
+                this.currentPage >= this.config.firstPage + this.maxVisiblePages)
+                this.$prevEllipsis.show();
+            
+            else if (!this.$prevEllipsis.isHidden && 
+                this.currentPage <= this.config.firstPage + this.maxVisiblePages - 1)
+                this.$prevEllipsis.hide();
+
+            if (this.$nextEllipsis.isHidden && 
+                this.currentPage <= this.config.lastPage - this.maxVisiblePages)
+                this.$nextEllipsis.show();
+            
+            else if (!this.$nextEllipsis.isHidden && 
+                this.currentPage >= this.config.lastPage - this.maxVisiblePages + 1)
+                this.$nextEllipsis.hide();
+        },
+
+        bindClickEvent: function() {
+            var self = this;
+            this.$container.on('click', 'li', function() {
+                var requestedPage = self.sanitizePageRequest($(this).data('page'));
+                self.requestPage(requestedPage, false);
+            });
+        },
+
+        insertPrevPaginationComponent: function(pageNumber) {
+            if (pageNumber > this.config.firstPage && pageNumber < this.config.lastPage) {
+                var $paginationComponent = this.util.createPage(pageNumber);
+                return $paginationComponent.insertAfter(this.$prevEllipsis.$elem);
+            }
+            return $('');
+        },
+
+        insertNextPaginationComponent: function(pageNumber) {
+            if (pageNumber > this.config.firstPage && pageNumber < this.config.lastPage) {
+                var $paginationComponent = this.util.createPage(pageNumber);
+                return $paginationComponent.insertBefore(this.$nextEllipsis.$elem);
+            }
+            return $('');
+        },
+
+        sanitizePageRequest: function(pageData) {
+            var requestedPage = this.config.firstPage;
+
+            if (pageData === 'prev') {
+                requestedPage =
+                    this.currentPage === this.config.firstPage ?
+                    this.currentPage : this.currentPage - 1;
+            }
+            else if (pageData === 'next') {
+                requestedPage =
+                    this.currentPage === this.config.lastPage ?
+                    this.currentPage : this.currentPage + 1;
+            }
+            else if (!isNaN(pageData) &&
+                pageData >= this.config.firstPage &&
+                pageData <= this.config.lastPage) {
+                requestedPage = parseInt(pageData);
+            }
+            return requestedPage;
+        },
+
+        purgeVisiblePages: function() {
+            var size = this.visiblePages.length;
+            for (var page = 0; page < size; page += 1)
+                this.visiblePages.pop().remove();
+        },
+
+        parseUrl: function(){
+            var requestedPage = this.getUrlParamByName(this.config.urlParameter) || this.config.firstPage;
+            return this.sanitizePageRequest(requestedPage);
+        },
+
+        getUrlParamByName: function(name) {
+            name = name.replace(/[\[\]]/g, "\\$&");
+            var url = window.location.href;
+            var regex = new RegExp("[?&]" + name + "(=([^&#]*)|&|#|$)");
+            var results = regex.exec(url);
+            if (!results)  return null;
+            if (!results[2]) return '';
+            return decodeURIComponent(results[2].replace(/\+/g, " "));
+        },
+
+        updateUrlParam: function (key, value) {
+            var baseUrl = [location.protocol, '//', location.host, location.pathname].join(''),
+                urlQueryString = document.location.search,
+                newParam = key + '=' + value,
+                params = '?' + newParam;
+
+            if (urlQueryString) { // If the "search" string exists, then build params from it
+                keyRegex = new RegExp('([\?&])' + key + '[^&]*');
+
+                if (urlQueryString.match(keyRegex) !== null) { // If param exists already, update it
+                    params = urlQueryString.replace(keyRegex, "$1" + newParam);
+                }
+                else { // Otherwise, add it to end of query string
+                    params = urlQueryString + '&' + newParam;
+                }
+            }
+            window.history.pushState('', '', params);
+        },
+
+        util: {
+            createPage: function(pageData){
+                return $('<li>')
+                    .text(pageData)
+                    .addClass('waves-effect')
+                    .attr('data-page', pageData);
+            },
+            createChevron: function(type){
+                var direction = type === 'next' ? 'right' : 'left';
+                
+                var $icon = $('<i>')
+                    .addClass('waves-effect')
+                    .addClass('material-icons')
+                    .text('chevron_' + direction);
+                
+                return this.createPage(type).text('')
+                    .attr('data-page', type)
+                    .append($icon);
+            },
+            Ellipsis: function() {
+                var $ellipsis = $('<li>');
+                    $ellipsis.text('...');
+                    $ellipsis.addClass('hide disabled');
+                return {
+                    $elem: $ellipsis,
+                    isHidden:   true,
+                    show: function() {
+                        this.isHidden = false;
+                        this.$elem.removeClass('hide');},
+                    hide: function() {
+                        this.isHidden = true;
+                        this.$elem.addClass('hide');}
+                };
+            }
+        }
+    };
+
+    MaterializePagination.defaults = MaterializePagination.prototype.defaults;
+    $.fn.materializePagination = function(options) {
+        return this.each(function() {
+            new MaterializePagination(this, options).init();
+        });
+    };
+})(jQuery, window, document);
diff --git a/VNF_Catalogue/public/3rd_party/materialize-pagination.min.js b/VNF_Catalogue/public/3rd_party/materialize-pagination.min.js
new file mode 100644
index 00000000..c7b712c9
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize-pagination.min.js
@@ -0,0 +1,12 @@
+/* materialize Pagination v0.2.2 | http://mirjamsk.github.io/materialize-pagination */
+;(function(c,f,g,k){var d=function(a,b){this.$elem=c(a);this.options=b;this.currentPage=this.$nextEllipsis=this.$prevEllipsis=this.$container=null;this.visiblePages=[];this.maxVisiblePages=3};d.prototype={defaults:{align:"center",lastPage:1,firstPage:1,urlParameter:"page",useUrlParameter:!0,onClickCallback:function(){}},init:function(){this.config=c.extend({},this.defaults,this.options);var a=this.config.useUrlParameter?this.parseUrl():this.config.firstPage;this.createPaginationBase(a)&&this.bindClickEvent()},
+createPaginationBase:function(a){if(isNaN(this.config.firstPage)||isNaN(this.config.lastPage))return console.error("Both firstPage and lastPage attributes need to be integer values"),!1;if(this.config.firstPage>this.config.lastPage)return console.error("Value of firstPage must be less than the value of lastPage"),!1;this.config.firstPage=parseInt(this.config.firstPage);this.config.lastPage=parseInt(this.config.lastPage);this.currentPage=this.config.firstPage-this.maxVisiblePages;this.$container=c("<ul>").addClass("pagination").addClass(this.config.align+
+"-align");this.$prevEllipsis=this.util.Ellipsis();this.$nextEllipsis=this.util.Ellipsis();var b=this.util.createPage(this.config.firstPage),h=this.util.createChevron("prev"),e=this.util.createChevron("next");this.$container.append(h).append(b).append(this.$prevEllipsis.$elem).append(this.$nextEllipsis.$elem).append(e);this.config.lastPage>this.config.firstPage&&this.util.createPage(this.config.lastPage).insertBefore(e);this.requestPage(a);this.renderActivePage();this.$elem.append(this.$container);
+return!0},requestPage:function(a){switch(a){case this.currentPage:return;case this.currentPage-1:this.requestPrevPage();break;case this.currentPage+1:this.requestNextPage();break;default:this.requestPageByNumber(a)}this.config.onClickCallback(this.currentPage);this.renderActivePage();this.config.useUrlParameter&&this.updateUrlParam(this.config.urlParameter,this.currentPage)},requestPrevPage:function(){--this.currentPage;this.visiblePages.pop().remove();this.visiblePages.unshift(this.insertPrevPaginationComponent(this.currentPage-
+1))},requestNextPage:function(){this.currentPage+=1;this.visiblePages.shift().remove();this.visiblePages.push(this.insertNextPaginationComponent(this.currentPage+1))},requestPageByNumber:function(a){this.purgeVisiblePages();this.currentPage=a;this.visiblePages.push(this.insertNextPaginationComponent(this.currentPage-1));this.visiblePages.push(this.insertNextPaginationComponent(this.currentPage));this.visiblePages.push(this.insertNextPaginationComponent(this.currentPage+1))},renderActivePage:function(){this.renderEllipsis();
+this.$container.find("li.active").removeClass("active");c(this.$container.find('[data-page="'+this.currentPage+'"]')[0]).addClass("active")},renderEllipsis:function(){this.$prevEllipsis.isHidden&&this.currentPage>=this.config.firstPage+this.maxVisiblePages?this.$prevEllipsis.show():!this.$prevEllipsis.isHidden&&this.currentPage<=this.config.firstPage+this.maxVisiblePages-1&&this.$prevEllipsis.hide();this.$nextEllipsis.isHidden&&this.currentPage<=this.config.lastPage-this.maxVisiblePages?this.$nextEllipsis.show():
+!this.$nextEllipsis.isHidden&&this.currentPage>=this.config.lastPage-this.maxVisiblePages+1&&this.$nextEllipsis.hide()},bindClickEvent:function(){var a=this;this.$container.on("click","li",function(){var b=a.sanitizePageRequest(c(this).data("page"));a.requestPage(b)})},insertPrevPaginationComponent:function(a){return a>this.config.firstPage&&a<this.config.lastPage?this.util.createPage(a).insertAfter(this.$prevEllipsis.$elem):c("")},insertNextPaginationComponent:function(a){return a>this.config.firstPage&&
+a<this.config.lastPage?this.util.createPage(a).insertBefore(this.$nextEllipsis.$elem):c("")},sanitizePageRequest:function(a){var b=this.config.firstPage;"prev"===a?b=this.currentPage===this.config.firstPage?this.currentPage:this.currentPage-1:"next"===a?b=this.currentPage===this.config.lastPage?this.currentPage:this.currentPage+1:!isNaN(a)&&a>=this.config.firstPage&&a<=this.config.lastPage&&(b=parseInt(a));return b},purgeVisiblePages:function(){for(var a=this.visiblePages.length,b=0;b<a;b+=1)this.visiblePages.pop().remove()},
+parseUrl:function(){var a=this.getUrlParamByName(this.config.urlParameter)||this.config.firstPage;return this.sanitizePageRequest(a)},getUrlParamByName:function(a){a=a.replace(/[\[\]]/g,"\\$&");return(a=(new RegExp("[?&]"+a+"(=([^&#]*)|&|#|$)")).exec(f.location.href))?a[2]?decodeURIComponent(a[2].replace(/\+/g," ")):"":null},updateUrlParam:function(a,b){[location.protocol,"//",location.host,location.pathname].join("");var c=g.location.search,e=a+"="+b,d="?"+e;c&&(keyRegex=new RegExp("([?&])"+a+"[^&]*"),
+d=null!==c.match(keyRegex)?c.replace(keyRegex,"$1"+e):c+"&"+e);f.history.pushState("","",d)},util:{createPage:function(a){return c("<li>").text(a).addClass("waves-effect").attr("data-page",a)},createChevron:function(a){var b="next"===a?"right":"left",b=c("<i>").addClass("waves-effect").addClass("material-icons").text("chevron_"+b);return this.createPage(a).text("").attr("data-page",a).append(b)},Ellipsis:function(){var a=c("<li>");a.text("...");a.addClass("hide disabled");return{$elem:a,isHidden:!0,
+show:function(){this.isHidden=!1;this.$elem.removeClass("hide")},hide:function(){this.isHidden=!0;this.$elem.addClass("hide")}}}}};d.defaults=d.prototype.defaults;c.fn.materializePagination=function(a){return this.each(function(){(new d(this,a)).init()})}})(jQuery,window,document);
\ No newline at end of file
diff --git a/VNF_Catalogue/public/3rd_party/materialize/.DS_Store b/VNF_Catalogue/public/3rd_party/materialize/.DS_Store
new file mode 100644
index 00000000..2828ef68
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/.DS_Store
diff --git a/VNF_Catalogue/public/3rd_party/materialize/LICENSE b/VNF_Catalogue/public/3rd_party/materialize/LICENSE
new file mode 100644
index 00000000..44bd03ea
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014-2017 Materialize
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/VNF_Catalogue/public/3rd_party/materialize/README.md b/VNF_Catalogue/public/3rd_party/materialize/README.md
new file mode 100644
index 00000000..497b01ae
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/README.md
@@ -0,0 +1,49 @@
+![alt tag](https://raw.github.com/dogfalo/materialize/master/images/materialize.gif)
+===========
+
+[![Travis CI](https://travis-ci.org/Dogfalo/materialize.svg?branch=master)](https://travis-ci.org/Dogfalo/materialize)[![devDependency Status](https://david-dm.org/Dogfalo/materialize/dev-status.svg)](https://david-dm.org/Dogfalo/materialize#info=devDependencies)[![Gitter](https://badges.gitter.im/Join Chat.svg)](https://gitter.im/Dogfalo/materialize?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+
+[Materialize](http://materializecss.com/), a CSS Framework based on material design
+
+### Current Version : v0.97.8
+
+## Sass Requirements:
+- Ruby Sass 3.3+, LibSass 0.6+
+
+## Supported Browsers:
+Chrome 35+, Firefox 31+, Safari 7+, IE 10+
+
+## Changelog
+- v0.97.8 (October 30th, 2016)
+  - **Refactored Modal plugin**
+  - Tabs now supported in navbar
+  - Chips data can now be reinitiailized
+  - Minor side nav fixes
+  - FAB to toolbar component added
+  - Fixed dropdown options bug
+- v0.97.7 (July 23rd, 2016)
+  - Basic horizontal cards
+  - Carousel bug fixes and new features
+  - Updated sidenav styles and new component
+  - Meteor package now supports Sass
+  - Autocomplete form component
+  - Chips jQuery plugin
+- v0.97.6 (April 1st, 2016)
+  - **Removed deprecated material icons from project**
+  - **Changed /font directory to /fonts**
+  - Datepicker and ScrollSpy now compatible with jQuery 2.2.x
+  - Responsive tables now work with empty cells
+  - Added focus states to checkboxes, switches, and radio buttons
+  - Sidenav and Modals no longer cause flicker with scrollbar
+  - Materialbox overflow and z-index issues fixed
+  - Added new option for Card actions within a Card reveal
+- v0.97.5 (December 21st, 2015)
+  - Fixed Meteor package crash
+
+
+
+## Contributing
+[Please read CONTRIBUTING.md for more information](CONTRIBUTING.md)
+
+## Testing
+We use Jasmine as our testing framework and we're trying to write a robust test suite for our components. If you want to help, [here's a starting guide on how to write tests in Jasmine](https://docs.google.com/document/d/1dVM6qGt_b_y9RRhr9X7oZfFydaJIEqB9CT7yekv-4XE/edit?usp=sharing)
diff --git a/VNF_Catalogue/public/3rd_party/materialize/css/materialize.css b/VNF_Catalogue/public/3rd_party/materialize/css/materialize.css
new file mode 100644
index 00000000..27de210a
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/css/materialize.css
@@ -0,0 +1,8582 @@
+/*!
+ * Materialize v0.98.0 (http://materializecss.com)
+ * Copyright 2014-2015 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+.materialize-red {
+  background-color: #e51c23 !important;
+}
+
+.materialize-red-text {
+  color: #e51c23 !important;
+}
+
+.materialize-red.lighten-5 {
+  background-color: #fdeaeb !important;
+}
+
+.materialize-red-text.text-lighten-5 {
+  color: #fdeaeb !important;
+}
+
+.materialize-red.lighten-4 {
+  background-color: #f8c1c3 !important;
+}
+
+.materialize-red-text.text-lighten-4 {
+  color: #f8c1c3 !important;
+}
+
+.materialize-red.lighten-3 {
+  background-color: #f3989b !important;
+}
+
+.materialize-red-text.text-lighten-3 {
+  color: #f3989b !important;
+}
+
+.materialize-red.lighten-2 {
+  background-color: #ee6e73 !important;
+}
+
+.materialize-red-text.text-lighten-2 {
+  color: #ee6e73 !important;
+}
+
+.materialize-red.lighten-1 {
+  background-color: #ea454b !important;
+}
+
+.materialize-red-text.text-lighten-1 {
+  color: #ea454b !important;
+}
+
+.materialize-red.darken-1 {
+  background-color: #d0181e !important;
+}
+
+.materialize-red-text.text-darken-1 {
+  color: #d0181e !important;
+}
+
+.materialize-red.darken-2 {
+  background-color: #b9151b !important;
+}
+
+.materialize-red-text.text-darken-2 {
+  color: #b9151b !important;
+}
+
+.materialize-red.darken-3 {
+  background-color: #a21318 !important;
+}
+
+.materialize-red-text.text-darken-3 {
+  color: #a21318 !important;
+}
+
+.materialize-red.darken-4 {
+  background-color: #8b1014 !important;
+}
+
+.materialize-red-text.text-darken-4 {
+  color: #8b1014 !important;
+}
+
+.red {
+  background-color: #F44336 !important;
+}
+
+.red-text {
+  color: #F44336 !important;
+}
+
+.red.lighten-5 {
+  background-color: #FFEBEE !important;
+}
+
+.red-text.text-lighten-5 {
+  color: #FFEBEE !important;
+}
+
+.red.lighten-4 {
+  background-color: #FFCDD2 !important;
+}
+
+.red-text.text-lighten-4 {
+  color: #FFCDD2 !important;
+}
+
+.red.lighten-3 {
+  background-color: #EF9A9A !important;
+}
+
+.red-text.text-lighten-3 {
+  color: #EF9A9A !important;
+}
+
+.red.lighten-2 {
+  background-color: #E57373 !important;
+}
+
+.red-text.text-lighten-2 {
+  color: #E57373 !important;
+}
+
+.red.lighten-1 {
+  background-color: #EF5350 !important;
+}
+
+.red-text.text-lighten-1 {
+  color: #EF5350 !important;
+}
+
+.red.darken-1 {
+  background-color: #E53935 !important;
+}
+
+.red-text.text-darken-1 {
+  color: #E53935 !important;
+}
+
+.red.darken-2 {
+  background-color: #D32F2F !important;
+}
+
+.red-text.text-darken-2 {
+  color: #D32F2F !important;
+}
+
+.red.darken-3 {
+  background-color: #C62828 !important;
+}
+
+.red-text.text-darken-3 {
+  color: #C62828 !important;
+}
+
+.red.darken-4 {
+  background-color: #B71C1C !important;
+}
+
+.red-text.text-darken-4 {
+  color: #B71C1C !important;
+}
+
+.red.accent-1 {
+  background-color: #FF8A80 !important;
+}
+
+.red-text.text-accent-1 {
+  color: #FF8A80 !important;
+}
+
+.red.accent-2 {
+  background-color: #FF5252 !important;
+}
+
+.red-text.text-accent-2 {
+  color: #FF5252 !important;
+}
+
+.red.accent-3 {
+  background-color: #FF1744 !important;
+}
+
+.red-text.text-accent-3 {
+  color: #FF1744 !important;
+}
+
+.red.accent-4 {
+  background-color: #D50000 !important;
+}
+
+.red-text.text-accent-4 {
+  color: #D50000 !important;
+}
+
+.pink {
+  background-color: #e91e63 !important;
+}
+
+.pink-text {
+  color: #e91e63 !important;
+}
+
+.pink.lighten-5 {
+  background-color: #fce4ec !important;
+}
+
+.pink-text.text-lighten-5 {
+  color: #fce4ec !important;
+}
+
+.pink.lighten-4 {
+  background-color: #f8bbd0 !important;
+}
+
+.pink-text.text-lighten-4 {
+  color: #f8bbd0 !important;
+}
+
+.pink.lighten-3 {
+  background-color: #f48fb1 !important;
+}
+
+.pink-text.text-lighten-3 {
+  color: #f48fb1 !important;
+}
+
+.pink.lighten-2 {
+  background-color: #f06292 !important;
+}
+
+.pink-text.text-lighten-2 {
+  color: #f06292 !important;
+}
+
+.pink.lighten-1 {
+  background-color: #ec407a !important;
+}
+
+.pink-text.text-lighten-1 {
+  color: #ec407a !important;
+}
+
+.pink.darken-1 {
+  background-color: #d81b60 !important;
+}
+
+.pink-text.text-darken-1 {
+  color: #d81b60 !important;
+}
+
+.pink.darken-2 {
+  background-color: #c2185b !important;
+}
+
+.pink-text.text-darken-2 {
+  color: #c2185b !important;
+}
+
+.pink.darken-3 {
+  background-color: #ad1457 !important;
+}
+
+.pink-text.text-darken-3 {
+  color: #ad1457 !important;
+}
+
+.pink.darken-4 {
+  background-color: #880e4f !important;
+}
+
+.pink-text.text-darken-4 {
+  color: #880e4f !important;
+}
+
+.pink.accent-1 {
+  background-color: #ff80ab !important;
+}
+
+.pink-text.text-accent-1 {
+  color: #ff80ab !important;
+}
+
+.pink.accent-2 {
+  background-color: #ff4081 !important;
+}
+
+.pink-text.text-accent-2 {
+  color: #ff4081 !important;
+}
+
+.pink.accent-3 {
+  background-color: #f50057 !important;
+}
+
+.pink-text.text-accent-3 {
+  color: #f50057 !important;
+}
+
+.pink.accent-4 {
+  background-color: #c51162 !important;
+}
+
+.pink-text.text-accent-4 {
+  color: #c51162 !important;
+}
+
+.purple {
+  background-color: #9c27b0 !important;
+}
+
+.purple-text {
+  color: #9c27b0 !important;
+}
+
+.purple.lighten-5 {
+  background-color: #f3e5f5 !important;
+}
+
+.purple-text.text-lighten-5 {
+  color: #f3e5f5 !important;
+}
+
+.purple.lighten-4 {
+  background-color: #e1bee7 !important;
+}
+
+.purple-text.text-lighten-4 {
+  color: #e1bee7 !important;
+}
+
+.purple.lighten-3 {
+  background-color: #ce93d8 !important;
+}
+
+.purple-text.text-lighten-3 {
+  color: #ce93d8 !important;
+}
+
+.purple.lighten-2 {
+  background-color: #ba68c8 !important;
+}
+
+.purple-text.text-lighten-2 {
+  color: #ba68c8 !important;
+}
+
+.purple.lighten-1 {
+  background-color: #ab47bc !important;
+}
+
+.purple-text.text-lighten-1 {
+  color: #ab47bc !important;
+}
+
+.purple.darken-1 {
+  background-color: #8e24aa !important;
+}
+
+.purple-text.text-darken-1 {
+  color: #8e24aa !important;
+}
+
+.purple.darken-2 {
+  background-color: #7b1fa2 !important;
+}
+
+.purple-text.text-darken-2 {
+  color: #7b1fa2 !important;
+}
+
+.purple.darken-3 {
+  background-color: #6a1b9a !important;
+}
+
+.purple-text.text-darken-3 {
+  color: #6a1b9a !important;
+}
+
+.purple.darken-4 {
+  background-color: #4a148c !important;
+}
+
+.purple-text.text-darken-4 {
+  color: #4a148c !important;
+}
+
+.purple.accent-1 {
+  background-color: #ea80fc !important;
+}
+
+.purple-text.text-accent-1 {
+  color: #ea80fc !important;
+}
+
+.purple.accent-2 {
+  background-color: #e040fb !important;
+}
+
+.purple-text.text-accent-2 {
+  color: #e040fb !important;
+}
+
+.purple.accent-3 {
+  background-color: #d500f9 !important;
+}
+
+.purple-text.text-accent-3 {
+  color: #d500f9 !important;
+}
+
+.purple.accent-4 {
+  background-color: #aa00ff !important;
+}
+
+.purple-text.text-accent-4 {
+  color: #aa00ff !important;
+}
+
+.deep-purple {
+  background-color: #673ab7 !important;
+}
+
+.deep-purple-text {
+  color: #673ab7 !important;
+}
+
+.deep-purple.lighten-5 {
+  background-color: #ede7f6 !important;
+}
+
+.deep-purple-text.text-lighten-5 {
+  color: #ede7f6 !important;
+}
+
+.deep-purple.lighten-4 {
+  background-color: #d1c4e9 !important;
+}
+
+.deep-purple-text.text-lighten-4 {
+  color: #d1c4e9 !important;
+}
+
+.deep-purple.lighten-3 {
+  background-color: #b39ddb !important;
+}
+
+.deep-purple-text.text-lighten-3 {
+  color: #b39ddb !important;
+}
+
+.deep-purple.lighten-2 {
+  background-color: #9575cd !important;
+}
+
+.deep-purple-text.text-lighten-2 {
+  color: #9575cd !important;
+}
+
+.deep-purple.lighten-1 {
+  background-color: #7e57c2 !important;
+}
+
+.deep-purple-text.text-lighten-1 {
+  color: #7e57c2 !important;
+}
+
+.deep-purple.darken-1 {
+  background-color: #5e35b1 !important;
+}
+
+.deep-purple-text.text-darken-1 {
+  color: #5e35b1 !important;
+}
+
+.deep-purple.darken-2 {
+  background-color: #512da8 !important;
+}
+
+.deep-purple-text.text-darken-2 {
+  color: #512da8 !important;
+}
+
+.deep-purple.darken-3 {
+  background-color: #4527a0 !important;
+}
+
+.deep-purple-text.text-darken-3 {
+  color: #4527a0 !important;
+}
+
+.deep-purple.darken-4 {
+  background-color: #311b92 !important;
+}
+
+.deep-purple-text.text-darken-4 {
+  color: #311b92 !important;
+}
+
+.deep-purple.accent-1 {
+  background-color: #b388ff !important;
+}
+
+.deep-purple-text.text-accent-1 {
+  color: #b388ff !important;
+}
+
+.deep-purple.accent-2 {
+  background-color: #7c4dff !important;
+}
+
+.deep-purple-text.text-accent-2 {
+  color: #7c4dff !important;
+}
+
+.deep-purple.accent-3 {
+  background-color: #651fff !important;
+}
+
+.deep-purple-text.text-accent-3 {
+  color: #651fff !important;
+}
+
+.deep-purple.accent-4 {
+  background-color: #6200ea !important;
+}
+
+.deep-purple-text.text-accent-4 {
+  color: #6200ea !important;
+}
+
+.indigo {
+  background-color: #3f51b5 !important;
+}
+
+.indigo-text {
+  color: #3f51b5 !important;
+}
+
+.indigo.lighten-5 {
+  background-color: #e8eaf6 !important;
+}
+
+.indigo-text.text-lighten-5 {
+  color: #e8eaf6 !important;
+}
+
+.indigo.lighten-4 {
+  background-color: #c5cae9 !important;
+}
+
+.indigo-text.text-lighten-4 {
+  color: #c5cae9 !important;
+}
+
+.indigo.lighten-3 {
+  background-color: #9fa8da !important;
+}
+
+.indigo-text.text-lighten-3 {
+  color: #9fa8da !important;
+}
+
+.indigo.lighten-2 {
+  background-color: #7986cb !important;
+}
+
+.indigo-text.text-lighten-2 {
+  color: #7986cb !important;
+}
+
+.indigo.lighten-1 {
+  background-color: #5c6bc0 !important;
+}
+
+.indigo-text.text-lighten-1 {
+  color: #5c6bc0 !important;
+}
+
+.indigo.darken-1 {
+  background-color: #3949ab !important;
+}
+
+.indigo-text.text-darken-1 {
+  color: #3949ab !important;
+}
+
+.indigo.darken-2 {
+  background-color: #303f9f !important;
+}
+
+.indigo-text.text-darken-2 {
+  color: #303f9f !important;
+}
+
+.indigo.darken-3 {
+  background-color: #283593 !important;
+}
+
+.indigo-text.text-darken-3 {
+  color: #283593 !important;
+}
+
+.indigo.darken-4 {
+  background-color: #1a237e !important;
+}
+
+.indigo-text.text-darken-4 {
+  color: #1a237e !important;
+}
+
+.indigo.accent-1 {
+  background-color: #8c9eff !important;
+}
+
+.indigo-text.text-accent-1 {
+  color: #8c9eff !important;
+}
+
+.indigo.accent-2 {
+  background-color: #536dfe !important;
+}
+
+.indigo-text.text-accent-2 {
+  color: #536dfe !important;
+}
+
+.indigo.accent-3 {
+  background-color: #3d5afe !important;
+}
+
+.indigo-text.text-accent-3 {
+  color: #3d5afe !important;
+}
+
+.indigo.accent-4 {
+  background-color: #304ffe !important;
+}
+
+.indigo-text.text-accent-4 {
+  color: #304ffe !important;
+}
+
+.blue {
+  background-color: #2196F3 !important;
+}
+
+.blue-text {
+  color: #2196F3 !important;
+}
+
+.blue.lighten-5 {
+  background-color: #E3F2FD !important;
+}
+
+.blue-text.text-lighten-5 {
+  color: #E3F2FD !important;
+}
+
+.blue.lighten-4 {
+  background-color: #BBDEFB !important;
+}
+
+.blue-text.text-lighten-4 {
+  color: #BBDEFB !important;
+}
+
+.blue.lighten-3 {
+  background-color: #90CAF9 !important;
+}
+
+.blue-text.text-lighten-3 {
+  color: #90CAF9 !important;
+}
+
+.blue.lighten-2 {
+  background-color: #64B5F6 !important;
+}
+
+.blue-text.text-lighten-2 {
+  color: #64B5F6 !important;
+}
+
+.blue.lighten-1 {
+  background-color: #42A5F5 !important;
+}
+
+.blue-text.text-lighten-1 {
+  color: #42A5F5 !important;
+}
+
+.blue.darken-1 {
+  background-color: #1E88E5 !important;
+}
+
+.blue-text.text-darken-1 {
+  color: #1E88E5 !important;
+}
+
+.blue.darken-2 {
+  background-color: #1976D2 !important;
+}
+
+.blue-text.text-darken-2 {
+  color: #1976D2 !important;
+}
+
+.blue.darken-3 {
+  background-color: #1565C0 !important;
+}
+
+.blue-text.text-darken-3 {
+  color: #1565C0 !important;
+}
+
+.blue.darken-4 {
+  background-color: #0D47A1 !important;
+}
+
+.blue-text.text-darken-4 {
+  color: #0D47A1 !important;
+}
+
+.blue.accent-1 {
+  background-color: #82B1FF !important;
+}
+
+.blue-text.text-accent-1 {
+  color: #82B1FF !important;
+}
+
+.blue.accent-2 {
+  background-color: #448AFF !important;
+}
+
+.blue-text.text-accent-2 {
+  color: #448AFF !important;
+}
+
+.blue.accent-3 {
+  background-color: #2979FF !important;
+}
+
+.blue-text.text-accent-3 {
+  color: #2979FF !important;
+}
+
+.blue.accent-4 {
+  background-color: #2962FF !important;
+}
+
+.blue-text.text-accent-4 {
+  color: #2962FF !important;
+}
+
+.light-blue {
+  background-color: #03a9f4 !important;
+}
+
+.light-blue-text {
+  color: #03a9f4 !important;
+}
+
+.light-blue.lighten-5 {
+  background-color: #e1f5fe !important;
+}
+
+.light-blue-text.text-lighten-5 {
+  color: #e1f5fe !important;
+}
+
+.light-blue.lighten-4 {
+  background-color: #b3e5fc !important;
+}
+
+.light-blue-text.text-lighten-4 {
+  color: #b3e5fc !important;
+}
+
+.light-blue.lighten-3 {
+  background-color: #81d4fa !important;
+}
+
+.light-blue-text.text-lighten-3 {
+  color: #81d4fa !important;
+}
+
+.light-blue.lighten-2 {
+  background-color: #4fc3f7 !important;
+}
+
+.light-blue-text.text-lighten-2 {
+  color: #4fc3f7 !important;
+}
+
+.light-blue.lighten-1 {
+  background-color: #29b6f6 !important;
+}
+
+.light-blue-text.text-lighten-1 {
+  color: #29b6f6 !important;
+}
+
+.light-blue.darken-1 {
+  background-color: #039be5 !important;
+}
+
+.light-blue-text.text-darken-1 {
+  color: #039be5 !important;
+}
+
+.light-blue.darken-2 {
+  background-color: #0288d1 !important;
+}
+
+.light-blue-text.text-darken-2 {
+  color: #0288d1 !important;
+}
+
+.light-blue.darken-3 {
+  background-color: #0277bd !important;
+}
+
+.light-blue-text.text-darken-3 {
+  color: #0277bd !important;
+}
+
+.light-blue.darken-4 {
+  background-color: #01579b !important;
+}
+
+.light-blue-text.text-darken-4 {
+  color: #01579b !important;
+}
+
+.light-blue.accent-1 {
+  background-color: #80d8ff !important;
+}
+
+.light-blue-text.text-accent-1 {
+  color: #80d8ff !important;
+}
+
+.light-blue.accent-2 {
+  background-color: #40c4ff !important;
+}
+
+.light-blue-text.text-accent-2 {
+  color: #40c4ff !important;
+}
+
+.light-blue.accent-3 {
+  background-color: #00b0ff !important;
+}
+
+.light-blue-text.text-accent-3 {
+  color: #00b0ff !important;
+}
+
+.light-blue.accent-4 {
+  background-color: #0091ea !important;
+}
+
+.light-blue-text.text-accent-4 {
+  color: #0091ea !important;
+}
+
+.cyan {
+  background-color: #00bcd4 !important;
+}
+
+.cyan-text {
+  color: #00bcd4 !important;
+}
+
+.cyan.lighten-5 {
+  background-color: #e0f7fa !important;
+}
+
+.cyan-text.text-lighten-5 {
+  color: #e0f7fa !important;
+}
+
+.cyan.lighten-4 {
+  background-color: #b2ebf2 !important;
+}
+
+.cyan-text.text-lighten-4 {
+  color: #b2ebf2 !important;
+}
+
+.cyan.lighten-3 {
+  background-color: #80deea !important;
+}
+
+.cyan-text.text-lighten-3 {
+  color: #80deea !important;
+}
+
+.cyan.lighten-2 {
+  background-color: #4dd0e1 !important;
+}
+
+.cyan-text.text-lighten-2 {
+  color: #4dd0e1 !important;
+}
+
+.cyan.lighten-1 {
+  background-color: #26c6da !important;
+}
+
+.cyan-text.text-lighten-1 {
+  color: #26c6da !important;
+}
+
+.cyan.darken-1 {
+  background-color: #00acc1 !important;
+}
+
+.cyan-text.text-darken-1 {
+  color: #00acc1 !important;
+}
+
+.cyan.darken-2 {
+  background-color: #0097a7 !important;
+}
+
+.cyan-text.text-darken-2 {
+  color: #0097a7 !important;
+}
+
+.cyan.darken-3 {
+  background-color: #00838f !important;
+}
+
+.cyan-text.text-darken-3 {
+  color: #00838f !important;
+}
+
+.cyan.darken-4 {
+  background-color: #006064 !important;
+}
+
+.cyan-text.text-darken-4 {
+  color: #006064 !important;
+}
+
+.cyan.accent-1 {
+  background-color: #84ffff !important;
+}
+
+.cyan-text.text-accent-1 {
+  color: #84ffff !important;
+}
+
+.cyan.accent-2 {
+  background-color: #18ffff !important;
+}
+
+.cyan-text.text-accent-2 {
+  color: #18ffff !important;
+}
+
+.cyan.accent-3 {
+  background-color: #00e5ff !important;
+}
+
+.cyan-text.text-accent-3 {
+  color: #00e5ff !important;
+}
+
+.cyan.accent-4 {
+  background-color: #00b8d4 !important;
+}
+
+.cyan-text.text-accent-4 {
+  color: #00b8d4 !important;
+}
+
+.teal {
+  background-color: #009688 !important;
+}
+
+.teal-text {
+  color: #009688 !important;
+}
+
+.teal.lighten-5 {
+  background-color: #e0f2f1 !important;
+}
+
+.teal-text.text-lighten-5 {
+  color: #e0f2f1 !important;
+}
+
+.teal.lighten-4 {
+  background-color: #b2dfdb !important;
+}
+
+.teal-text.text-lighten-4 {
+  color: #b2dfdb !important;
+}
+
+.teal.lighten-3 {
+  background-color: #80cbc4 !important;
+}
+
+.teal-text.text-lighten-3 {
+  color: #80cbc4 !important;
+}
+
+.teal.lighten-2 {
+  background-color: #4db6ac !important;
+}
+
+.teal-text.text-lighten-2 {
+  color: #4db6ac !important;
+}
+
+.teal.lighten-1 {
+  background-color: #26a69a !important;
+}
+
+.teal-text.text-lighten-1 {
+  color: #26a69a !important;
+}
+
+.teal.darken-1 {
+  background-color: #00897b !important;
+}
+
+.teal-text.text-darken-1 {
+  color: #00897b !important;
+}
+
+.teal.darken-2 {
+  background-color: #00796b !important;
+}
+
+.teal-text.text-darken-2 {
+  color: #00796b !important;
+}
+
+.teal.darken-3 {
+  background-color: #00695c !important;
+}
+
+.teal-text.text-darken-3 {
+  color: #00695c !important;
+}
+
+.teal.darken-4 {
+  background-color: #004d40 !important;
+}
+
+.teal-text.text-darken-4 {
+  color: #004d40 !important;
+}
+
+.teal.accent-1 {
+  background-color: #a7ffeb !important;
+}
+
+.teal-text.text-accent-1 {
+  color: #a7ffeb !important;
+}
+
+.teal.accent-2 {
+  background-color: #64ffda !important;
+}
+
+.teal-text.text-accent-2 {
+  color: #64ffda !important;
+}
+
+.teal.accent-3 {
+  background-color: #1de9b6 !important;
+}
+
+.teal-text.text-accent-3 {
+  color: #1de9b6 !important;
+}
+
+.teal.accent-4 {
+  background-color: #00bfa5 !important;
+}
+
+.teal-text.text-accent-4 {
+  color: #00bfa5 !important;
+}
+
+.green {
+  background-color: #4CAF50 !important;
+}
+
+.green-text {
+  color: #4CAF50 !important;
+}
+
+.green.lighten-5 {
+  background-color: #E8F5E9 !important;
+}
+
+.green-text.text-lighten-5 {
+  color: #E8F5E9 !important;
+}
+
+.green.lighten-4 {
+  background-color: #C8E6C9 !important;
+}
+
+.green-text.text-lighten-4 {
+  color: #C8E6C9 !important;
+}
+
+.green.lighten-3 {
+  background-color: #A5D6A7 !important;
+}
+
+.green-text.text-lighten-3 {
+  color: #A5D6A7 !important;
+}
+
+.green.lighten-2 {
+  background-color: #81C784 !important;
+}
+
+.green-text.text-lighten-2 {
+  color: #81C784 !important;
+}
+
+.green.lighten-1 {
+  background-color: #66BB6A !important;
+}
+
+.green-text.text-lighten-1 {
+  color: #66BB6A !important;
+}
+
+.green.darken-1 {
+  background-color: #43A047 !important;
+}
+
+.green-text.text-darken-1 {
+  color: #43A047 !important;
+}
+
+.green.darken-2 {
+  background-color: #388E3C !important;
+}
+
+.green-text.text-darken-2 {
+  color: #388E3C !important;
+}
+
+.green.darken-3 {
+  background-color: #2E7D32 !important;
+}
+
+.green-text.text-darken-3 {
+  color: #2E7D32 !important;
+}
+
+.green.darken-4 {
+  background-color: #1B5E20 !important;
+}
+
+.green-text.text-darken-4 {
+  color: #1B5E20 !important;
+}
+
+.green.accent-1 {
+  background-color: #B9F6CA !important;
+}
+
+.green-text.text-accent-1 {
+  color: #B9F6CA !important;
+}
+
+.green.accent-2 {
+  background-color: #69F0AE !important;
+}
+
+.green-text.text-accent-2 {
+  color: #69F0AE !important;
+}
+
+.green.accent-3 {
+  background-color: #00E676 !important;
+}
+
+.green-text.text-accent-3 {
+  color: #00E676 !important;
+}
+
+.green.accent-4 {
+  background-color: #00C853 !important;
+}
+
+.green-text.text-accent-4 {
+  color: #00C853 !important;
+}
+
+.light-green {
+  background-color: #8bc34a !important;
+}
+
+.light-green-text {
+  color: #8bc34a !important;
+}
+
+.light-green.lighten-5 {
+  background-color: #f1f8e9 !important;
+}
+
+.light-green-text.text-lighten-5 {
+  color: #f1f8e9 !important;
+}
+
+.light-green.lighten-4 {
+  background-color: #dcedc8 !important;
+}
+
+.light-green-text.text-lighten-4 {
+  color: #dcedc8 !important;
+}
+
+.light-green.lighten-3 {
+  background-color: #c5e1a5 !important;
+}
+
+.light-green-text.text-lighten-3 {
+  color: #c5e1a5 !important;
+}
+
+.light-green.lighten-2 {
+  background-color: #aed581 !important;
+}
+
+.light-green-text.text-lighten-2 {
+  color: #aed581 !important;
+}
+
+.light-green.lighten-1 {
+  background-color: #9ccc65 !important;
+}
+
+.light-green-text.text-lighten-1 {
+  color: #9ccc65 !important;
+}
+
+.light-green.darken-1 {
+  background-color: #7cb342 !important;
+}
+
+.light-green-text.text-darken-1 {
+  color: #7cb342 !important;
+}
+
+.light-green.darken-2 {
+  background-color: #689f38 !important;
+}
+
+.light-green-text.text-darken-2 {
+  color: #689f38 !important;
+}
+
+.light-green.darken-3 {
+  background-color: #558b2f !important;
+}
+
+.light-green-text.text-darken-3 {
+  color: #558b2f !important;
+}
+
+.light-green.darken-4 {
+  background-color: #33691e !important;
+}
+
+.light-green-text.text-darken-4 {
+  color: #33691e !important;
+}
+
+.light-green.accent-1 {
+  background-color: #ccff90 !important;
+}
+
+.light-green-text.text-accent-1 {
+  color: #ccff90 !important;
+}
+
+.light-green.accent-2 {
+  background-color: #b2ff59 !important;
+}
+
+.light-green-text.text-accent-2 {
+  color: #b2ff59 !important;
+}
+
+.light-green.accent-3 {
+  background-color: #76ff03 !important;
+}
+
+.light-green-text.text-accent-3 {
+  color: #76ff03 !important;
+}
+
+.light-green.accent-4 {
+  background-color: #64dd17 !important;
+}
+
+.light-green-text.text-accent-4 {
+  color: #64dd17 !important;
+}
+
+.lime {
+  background-color: #cddc39 !important;
+}
+
+.lime-text {
+  color: #cddc39 !important;
+}
+
+.lime.lighten-5 {
+  background-color: #f9fbe7 !important;
+}
+
+.lime-text.text-lighten-5 {
+  color: #f9fbe7 !important;
+}
+
+.lime.lighten-4 {
+  background-color: #f0f4c3 !important;
+}
+
+.lime-text.text-lighten-4 {
+  color: #f0f4c3 !important;
+}
+
+.lime.lighten-3 {
+  background-color: #e6ee9c !important;
+}
+
+.lime-text.text-lighten-3 {
+  color: #e6ee9c !important;
+}
+
+.lime.lighten-2 {
+  background-color: #dce775 !important;
+}
+
+.lime-text.text-lighten-2 {
+  color: #dce775 !important;
+}
+
+.lime.lighten-1 {
+  background-color: #d4e157 !important;
+}
+
+.lime-text.text-lighten-1 {
+  color: #d4e157 !important;
+}
+
+.lime.darken-1 {
+  background-color: #c0ca33 !important;
+}
+
+.lime-text.text-darken-1 {
+  color: #c0ca33 !important;
+}
+
+.lime.darken-2 {
+  background-color: #afb42b !important;
+}
+
+.lime-text.text-darken-2 {
+  color: #afb42b !important;
+}
+
+.lime.darken-3 {
+  background-color: #9e9d24 !important;
+}
+
+.lime-text.text-darken-3 {
+  color: #9e9d24 !important;
+}
+
+.lime.darken-4 {
+  background-color: #827717 !important;
+}
+
+.lime-text.text-darken-4 {
+  color: #827717 !important;
+}
+
+.lime.accent-1 {
+  background-color: #f4ff81 !important;
+}
+
+.lime-text.text-accent-1 {
+  color: #f4ff81 !important;
+}
+
+.lime.accent-2 {
+  background-color: #eeff41 !important;
+}
+
+.lime-text.text-accent-2 {
+  color: #eeff41 !important;
+}
+
+.lime.accent-3 {
+  background-color: #c6ff00 !important;
+}
+
+.lime-text.text-accent-3 {
+  color: #c6ff00 !important;
+}
+
+.lime.accent-4 {
+  background-color: #aeea00 !important;
+}
+
+.lime-text.text-accent-4 {
+  color: #aeea00 !important;
+}
+
+.yellow {
+  background-color: #ffeb3b !important;
+}
+
+.yellow-text {
+  color: #ffeb3b !important;
+}
+
+.yellow.lighten-5 {
+  background-color: #fffde7 !important;
+}
+
+.yellow-text.text-lighten-5 {
+  color: #fffde7 !important;
+}
+
+.yellow.lighten-4 {
+  background-color: #fff9c4 !important;
+}
+
+.yellow-text.text-lighten-4 {
+  color: #fff9c4 !important;
+}
+
+.yellow.lighten-3 {
+  background-color: #fff59d !important;
+}
+
+.yellow-text.text-lighten-3 {
+  color: #fff59d !important;
+}
+
+.yellow.lighten-2 {
+  background-color: #fff176 !important;
+}
+
+.yellow-text.text-lighten-2 {
+  color: #fff176 !important;
+}
+
+.yellow.lighten-1 {
+  background-color: #ffee58 !important;
+}
+
+.yellow-text.text-lighten-1 {
+  color: #ffee58 !important;
+}
+
+.yellow.darken-1 {
+  background-color: #fdd835 !important;
+}
+
+.yellow-text.text-darken-1 {
+  color: #fdd835 !important;
+}
+
+.yellow.darken-2 {
+  background-color: #fbc02d !important;
+}
+
+.yellow-text.text-darken-2 {
+  color: #fbc02d !important;
+}
+
+.yellow.darken-3 {
+  background-color: #f9a825 !important;
+}
+
+.yellow-text.text-darken-3 {
+  color: #f9a825 !important;
+}
+
+.yellow.darken-4 {
+  background-color: #f57f17 !important;
+}
+
+.yellow-text.text-darken-4 {
+  color: #f57f17 !important;
+}
+
+.yellow.accent-1 {
+  background-color: #ffff8d !important;
+}
+
+.yellow-text.text-accent-1 {
+  color: #ffff8d !important;
+}
+
+.yellow.accent-2 {
+  background-color: #ffff00 !important;
+}
+
+.yellow-text.text-accent-2 {
+  color: #ffff00 !important;
+}
+
+.yellow.accent-3 {
+  background-color: #ffea00 !important;
+}
+
+.yellow-text.text-accent-3 {
+  color: #ffea00 !important;
+}
+
+.yellow.accent-4 {
+  background-color: #ffd600 !important;
+}
+
+.yellow-text.text-accent-4 {
+  color: #ffd600 !important;
+}
+
+.amber {
+  background-color: #ffc107 !important;
+}
+
+.amber-text {
+  color: #ffc107 !important;
+}
+
+.amber.lighten-5 {
+  background-color: #fff8e1 !important;
+}
+
+.amber-text.text-lighten-5 {
+  color: #fff8e1 !important;
+}
+
+.amber.lighten-4 {
+  background-color: #ffecb3 !important;
+}
+
+.amber-text.text-lighten-4 {
+  color: #ffecb3 !important;
+}
+
+.amber.lighten-3 {
+  background-color: #ffe082 !important;
+}
+
+.amber-text.text-lighten-3 {
+  color: #ffe082 !important;
+}
+
+.amber.lighten-2 {
+  background-color: #ffd54f !important;
+}
+
+.amber-text.text-lighten-2 {
+  color: #ffd54f !important;
+}
+
+.amber.lighten-1 {
+  background-color: #ffca28 !important;
+}
+
+.amber-text.text-lighten-1 {
+  color: #ffca28 !important;
+}
+
+.amber.darken-1 {
+  background-color: #ffb300 !important;
+}
+
+.amber-text.text-darken-1 {
+  color: #ffb300 !important;
+}
+
+.amber.darken-2 {
+  background-color: #ffa000 !important;
+}
+
+.amber-text.text-darken-2 {
+  color: #ffa000 !important;
+}
+
+.amber.darken-3 {
+  background-color: #ff8f00 !important;
+}
+
+.amber-text.text-darken-3 {
+  color: #ff8f00 !important;
+}
+
+.amber.darken-4 {
+  background-color: #ff6f00 !important;
+}
+
+.amber-text.text-darken-4 {
+  color: #ff6f00 !important;
+}
+
+.amber.accent-1 {
+  background-color: #ffe57f !important;
+}
+
+.amber-text.text-accent-1 {
+  color: #ffe57f !important;
+}
+
+.amber.accent-2 {
+  background-color: #ffd740 !important;
+}
+
+.amber-text.text-accent-2 {
+  color: #ffd740 !important;
+}
+
+.amber.accent-3 {
+  background-color: #ffc400 !important;
+}
+
+.amber-text.text-accent-3 {
+  color: #ffc400 !important;
+}
+
+.amber.accent-4 {
+  background-color: #ffab00 !important;
+}
+
+.amber-text.text-accent-4 {
+  color: #ffab00 !important;
+}
+
+.orange {
+  background-color: #ff9800 !important;
+}
+
+.orange-text {
+  color: #ff9800 !important;
+}
+
+.orange.lighten-5 {
+  background-color: #fff3e0 !important;
+}
+
+.orange-text.text-lighten-5 {
+  color: #fff3e0 !important;
+}
+
+.orange.lighten-4 {
+  background-color: #ffe0b2 !important;
+}
+
+.orange-text.text-lighten-4 {
+  color: #ffe0b2 !important;
+}
+
+.orange.lighten-3 {
+  background-color: #ffcc80 !important;
+}
+
+.orange-text.text-lighten-3 {
+  color: #ffcc80 !important;
+}
+
+.orange.lighten-2 {
+  background-color: #ffb74d !important;
+}
+
+.orange-text.text-lighten-2 {
+  color: #ffb74d !important;
+}
+
+.orange.lighten-1 {
+  background-color: #ffa726 !important;
+}
+
+.orange-text.text-lighten-1 {
+  color: #ffa726 !important;
+}
+
+.orange.darken-1 {
+  background-color: #fb8c00 !important;
+}
+
+.orange-text.text-darken-1 {
+  color: #fb8c00 !important;
+}
+
+.orange.darken-2 {
+  background-color: #f57c00 !important;
+}
+
+.orange-text.text-darken-2 {
+  color: #f57c00 !important;
+}
+
+.orange.darken-3 {
+  background-color: #ef6c00 !important;
+}
+
+.orange-text.text-darken-3 {
+  color: #ef6c00 !important;
+}
+
+.orange.darken-4 {
+  background-color: #e65100 !important;
+}
+
+.orange-text.text-darken-4 {
+  color: #e65100 !important;
+}
+
+.orange.accent-1 {
+  background-color: #ffd180 !important;
+}
+
+.orange-text.text-accent-1 {
+  color: #ffd180 !important;
+}
+
+.orange.accent-2 {
+  background-color: #ffab40 !important;
+}
+
+.orange-text.text-accent-2 {
+  color: #ffab40 !important;
+}
+
+.orange.accent-3 {
+  background-color: #ff9100 !important;
+}
+
+.orange-text.text-accent-3 {
+  color: #ff9100 !important;
+}
+
+.orange.accent-4 {
+  background-color: #ff6d00 !important;
+}
+
+.orange-text.text-accent-4 {
+  color: #ff6d00 !important;
+}
+
+.deep-orange {
+  background-color: #ff5722 !important;
+}
+
+.deep-orange-text {
+  color: #ff5722 !important;
+}
+
+.deep-orange.lighten-5 {
+  background-color: #fbe9e7 !important;
+}
+
+.deep-orange-text.text-lighten-5 {
+  color: #fbe9e7 !important;
+}
+
+.deep-orange.lighten-4 {
+  background-color: #ffccbc !important;
+}
+
+.deep-orange-text.text-lighten-4 {
+  color: #ffccbc !important;
+}
+
+.deep-orange.lighten-3 {
+  background-color: #ffab91 !important;
+}
+
+.deep-orange-text.text-lighten-3 {
+  color: #ffab91 !important;
+}
+
+.deep-orange.lighten-2 {
+  background-color: #ff8a65 !important;
+}
+
+.deep-orange-text.text-lighten-2 {
+  color: #ff8a65 !important;
+}
+
+.deep-orange.lighten-1 {
+  background-color: #ff7043 !important;
+}
+
+.deep-orange-text.text-lighten-1 {
+  color: #ff7043 !important;
+}
+
+.deep-orange.darken-1 {
+  background-color: #f4511e !important;
+}
+
+.deep-orange-text.text-darken-1 {
+  color: #f4511e !important;
+}
+
+.deep-orange.darken-2 {
+  background-color: #e64a19 !important;
+}
+
+.deep-orange-text.text-darken-2 {
+  color: #e64a19 !important;
+}
+
+.deep-orange.darken-3 {
+  background-color: #d84315 !important;
+}
+
+.deep-orange-text.text-darken-3 {
+  color: #d84315 !important;
+}
+
+.deep-orange.darken-4 {
+  background-color: #bf360c !important;
+}
+
+.deep-orange-text.text-darken-4 {
+  color: #bf360c !important;
+}
+
+.deep-orange.accent-1 {
+  background-color: #ff9e80 !important;
+}
+
+.deep-orange-text.text-accent-1 {
+  color: #ff9e80 !important;
+}
+
+.deep-orange.accent-2 {
+  background-color: #ff6e40 !important;
+}
+
+.deep-orange-text.text-accent-2 {
+  color: #ff6e40 !important;
+}
+
+.deep-orange.accent-3 {
+  background-color: #ff3d00 !important;
+}
+
+.deep-orange-text.text-accent-3 {
+  color: #ff3d00 !important;
+}
+
+.deep-orange.accent-4 {
+  background-color: #dd2c00 !important;
+}
+
+.deep-orange-text.text-accent-4 {
+  color: #dd2c00 !important;
+}
+
+.brown {
+  background-color: #795548 !important;
+}
+
+.brown-text {
+  color: #795548 !important;
+}
+
+.brown.lighten-5 {
+  background-color: #efebe9 !important;
+}
+
+.brown-text.text-lighten-5 {
+  color: #efebe9 !important;
+}
+
+.brown.lighten-4 {
+  background-color: #d7ccc8 !important;
+}
+
+.brown-text.text-lighten-4 {
+  color: #d7ccc8 !important;
+}
+
+.brown.lighten-3 {
+  background-color: #bcaaa4 !important;
+}
+
+.brown-text.text-lighten-3 {
+  color: #bcaaa4 !important;
+}
+
+.brown.lighten-2 {
+  background-color: #a1887f !important;
+}
+
+.brown-text.text-lighten-2 {
+  color: #a1887f !important;
+}
+
+.brown.lighten-1 {
+  background-color: #8d6e63 !important;
+}
+
+.brown-text.text-lighten-1 {
+  color: #8d6e63 !important;
+}
+
+.brown.darken-1 {
+  background-color: #6d4c41 !important;
+}
+
+.brown-text.text-darken-1 {
+  color: #6d4c41 !important;
+}
+
+.brown.darken-2 {
+  background-color: #5d4037 !important;
+}
+
+.brown-text.text-darken-2 {
+  color: #5d4037 !important;
+}
+
+.brown.darken-3 {
+  background-color: #4e342e !important;
+}
+
+.brown-text.text-darken-3 {
+  color: #4e342e !important;
+}
+
+.brown.darken-4 {
+  background-color: #3e2723 !important;
+}
+
+.brown-text.text-darken-4 {
+  color: #3e2723 !important;
+}
+
+.blue-grey {
+  background-color: #607d8b !important;
+}
+
+.blue-grey-text {
+  color: #607d8b !important;
+}
+
+.blue-grey.lighten-5 {
+  background-color: #eceff1 !important;
+}
+
+.blue-grey-text.text-lighten-5 {
+  color: #eceff1 !important;
+}
+
+.blue-grey.lighten-4 {
+  background-color: #cfd8dc !important;
+}
+
+.blue-grey-text.text-lighten-4 {
+  color: #cfd8dc !important;
+}
+
+.blue-grey.lighten-3 {
+  background-color: #b0bec5 !important;
+}
+
+.blue-grey-text.text-lighten-3 {
+  color: #b0bec5 !important;
+}
+
+.blue-grey.lighten-2 {
+  background-color: #90a4ae !important;
+}
+
+.blue-grey-text.text-lighten-2 {
+  color: #90a4ae !important;
+}
+
+.blue-grey.lighten-1 {
+  background-color: #78909c !important;
+}
+
+.blue-grey-text.text-lighten-1 {
+  color: #78909c !important;
+}
+
+.blue-grey.darken-1 {
+  background-color: #546e7a !important;
+}
+
+.blue-grey-text.text-darken-1 {
+  color: #546e7a !important;
+}
+
+.blue-grey.darken-2 {
+  background-color: #455a64 !important;
+}
+
+.blue-grey-text.text-darken-2 {
+  color: #455a64 !important;
+}
+
+.blue-grey.darken-3 {
+  background-color: #37474f !important;
+}
+
+.blue-grey-text.text-darken-3 {
+  color: #37474f !important;
+}
+
+.blue-grey.darken-4 {
+  background-color: #263238 !important;
+}
+
+.blue-grey-text.text-darken-4 {
+  color: #263238 !important;
+}
+
+.grey {
+  background-color: #9e9e9e !important;
+}
+
+.grey-text {
+  color: #9e9e9e !important;
+}
+
+.grey.lighten-5 {
+  background-color: #fafafa !important;
+}
+
+.grey-text.text-lighten-5 {
+  color: #fafafa !important;
+}
+
+.grey.lighten-4 {
+  background-color: #f5f5f5 !important;
+}
+
+.grey-text.text-lighten-4 {
+  color: #f5f5f5 !important;
+}
+
+.grey.lighten-3 {
+  background-color: #eeeeee !important;
+}
+
+.grey-text.text-lighten-3 {
+  color: #eeeeee !important;
+}
+
+.grey.lighten-2 {
+  background-color: #e0e0e0 !important;
+}
+
+.grey-text.text-lighten-2 {
+  color: #e0e0e0 !important;
+}
+
+.grey.lighten-1 {
+  background-color: #bdbdbd !important;
+}
+
+.grey-text.text-lighten-1 {
+  color: #bdbdbd !important;
+}
+
+.grey.darken-1 {
+  background-color: #757575 !important;
+}
+
+.grey-text.text-darken-1 {
+  color: #757575 !important;
+}
+
+.grey.darken-2 {
+  background-color: #616161 !important;
+}
+
+.grey-text.text-darken-2 {
+  color: #616161 !important;
+}
+
+.grey.darken-3 {
+  background-color: #424242 !important;
+}
+
+.grey-text.text-darken-3 {
+  color: #424242 !important;
+}
+
+.grey.darken-4 {
+  background-color: #212121 !important;
+}
+
+.grey-text.text-darken-4 {
+  color: #212121 !important;
+}
+
+.black {
+  background-color: #000000 !important;
+}
+
+.black-text {
+  color: #000000 !important;
+}
+
+.white {
+  background-color: #FFFFFF !important;
+}
+
+.white-text {
+  color: #FFFFFF !important;
+}
+
+.transparent {
+  background-color: transparent !important;
+}
+
+.transparent-text {
+  color: transparent !important;
+}
+
+/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */
+/**
+ * 1. Set default font family to sans-serif.
+ * 2. Prevent iOS and IE text size adjust after device orientation change,
+ *    without disabling user zoom.
+ */
+html {
+  font-family: sans-serif;
+  /* 1 */
+  -ms-text-size-adjust: 100%;
+  /* 2 */
+  -webkit-text-size-adjust: 100%;
+  /* 2 */
+}
+
+/**
+ * Remove default margin.
+ */
+body {
+  margin: 0;
+}
+
+/* HTML5 display definitions
+   ========================================================================== */
+/**
+ * Correct `block` display not defined for any HTML5 element in IE 8/9.
+ * Correct `block` display not defined for `details` or `summary` in IE 10/11
+ * and Firefox.
+ * Correct `block` display not defined for `main` in IE 11.
+ */
+article,
+aside,
+details,
+figcaption,
+figure,
+footer,
+header,
+hgroup,
+main,
+menu,
+nav,
+section,
+summary {
+  display: block;
+}
+
+/**
+ * 1. Correct `inline-block` display not defined in IE 8/9.
+ * 2. Normalize vertical alignment of `progress` in Chrome, Firefox, and Opera.
+ */
+audio,
+canvas,
+progress,
+video {
+  display: inline-block;
+  /* 1 */
+  vertical-align: baseline;
+  /* 2 */
+}
+
+/**
+ * Prevent modern browsers from displaying `audio` without controls.
+ * Remove excess height in iOS 5 devices.
+ */
+audio:not([controls]) {
+  display: none;
+  height: 0;
+}
+
+/**
+ * Address `[hidden]` styling not present in IE 8/9/10.
+ * Hide the `template` element in IE 8/9/10/11, Safari, and Firefox < 22.
+ */
+[hidden],
+template {
+  display: none;
+}
+
+/* Links
+   ========================================================================== */
+/**
+ * Remove the gray background color from active links in IE 10.
+ */
+a {
+  background-color: transparent;
+}
+
+/**
+ * Improve readability of focused elements when they are also in an
+ * active/hover state.
+ */
+a:active,
+a:hover {
+  outline: 0;
+}
+
+/* Text-level semantics
+   ========================================================================== */
+/**
+ * Address styling not present in IE 8/9/10/11, Safari, and Chrome.
+ */
+abbr[title] {
+  border-bottom: 1px dotted;
+}
+
+/**
+ * Address style set to `bolder` in Firefox 4+, Safari, and Chrome.
+ */
+b,
+strong {
+  font-weight: bold;
+}
+
+/**
+ * Address styling not present in Safari and Chrome.
+ */
+dfn {
+  font-style: italic;
+}
+
+/**
+ * Address variable `h1` font-size and margin within `section` and `article`
+ * contexts in Firefox 4+, Safari, and Chrome.
+ */
+h1 {
+  font-size: 2em;
+  margin: 0.67em 0;
+}
+
+/**
+ * Address styling not present in IE 8/9.
+ */
+mark {
+  background: #ff0;
+  color: #000;
+}
+
+/**
+ * Address inconsistent and variable font size in all browsers.
+ */
+small {
+  font-size: 80%;
+}
+
+/**
+ * Prevent `sub` and `sup` affecting `line-height` in all browsers.
+ */
+sub,
+sup {
+  font-size: 75%;
+  line-height: 0;
+  position: relative;
+  vertical-align: baseline;
+}
+
+sup {
+  top: -0.5em;
+}
+
+sub {
+  bottom: -0.25em;
+}
+
+/* Embedded content
+   ========================================================================== */
+/**
+ * Remove border when inside `a` element in IE 8/9/10.
+ */
+img {
+  border: 0;
+}
+
+/**
+ * Correct overflow not hidden in IE 9/10/11.
+ */
+svg:not(:root) {
+  overflow: hidden;
+}
+
+/* Grouping content
+   ========================================================================== */
+/**
+ * Address margin not present in IE 8/9 and Safari.
+ */
+figure {
+  margin: 1em 40px;
+}
+
+/**
+ * Address differences between Firefox and other browsers.
+ */
+hr {
+  box-sizing: content-box;
+  height: 0;
+}
+
+/**
+ * Contain overflow in all browsers.
+ */
+pre {
+  overflow: auto;
+}
+
+/**
+ * Address odd `em`-unit font size rendering in all browsers.
+ */
+code,
+kbd,
+pre,
+samp {
+  font-family: monospace, monospace;
+  font-size: 1em;
+}
+
+/* Forms
+   ========================================================================== */
+/**
+ * Known limitation: by default, Chrome and Safari on OS X allow very limited
+ * styling of `select`, unless a `border` property is set.
+ */
+/**
+ * 1. Correct color not being inherited.
+ *    Known issue: affects color of disabled elements.
+ * 2. Correct font properties not being inherited.
+ * 3. Address margins set differently in Firefox 4+, Safari, and Chrome.
+ */
+button,
+input,
+optgroup,
+select,
+textarea {
+  color: inherit;
+  /* 1 */
+  font: inherit;
+  /* 2 */
+  margin: 0;
+  /* 3 */
+}
+
+/**
+ * Address `overflow` set to `hidden` in IE 8/9/10/11.
+ */
+button {
+  overflow: visible;
+}
+
+/**
+ * Address inconsistent `text-transform` inheritance for `button` and `select`.
+ * All other form control elements do not inherit `text-transform` values.
+ * Correct `button` style inheritance in Firefox, IE 8/9/10/11, and Opera.
+ * Correct `select` style inheritance in Firefox.
+ */
+button,
+select {
+  text-transform: none;
+}
+
+/**
+ * 1. Avoid the WebKit bug in Android 4.0.* where (2) destroys native `audio`
+ *    and `video` controls.
+ * 2. Correct inability to style clickable `input` types in iOS.
+ * 3. Improve usability and consistency of cursor style between image-type
+ *    `input` and others.
+ */
+button,
+html input[type="button"],
+input[type="reset"],
+input[type="submit"] {
+  -webkit-appearance: button;
+  /* 2 */
+  cursor: pointer;
+  /* 3 */
+}
+
+/**
+ * Re-set default cursor for disabled elements.
+ */
+button[disabled],
+html input[disabled] {
+  cursor: default;
+}
+
+/**
+ * Remove inner padding and border in Firefox 4+.
+ */
+button::-moz-focus-inner,
+input::-moz-focus-inner {
+  border: 0;
+  padding: 0;
+}
+
+/**
+ * Address Firefox 4+ setting `line-height` on `input` using `!important` in
+ * the UA stylesheet.
+ */
+input {
+  line-height: normal;
+}
+
+/**
+ * It's recommended that you don't attempt to style these elements.
+ * Firefox's implementation doesn't respect box-sizing, padding, or width.
+ *
+ * 1. Address box sizing set to `content-box` in IE 8/9/10.
+ * 2. Remove excess padding in IE 8/9/10.
+ */
+input[type="checkbox"],
+input[type="radio"] {
+  box-sizing: border-box;
+  /* 1 */
+  padding: 0;
+  /* 2 */
+}
+
+/**
+ * Fix the cursor style for Chrome's increment/decrement buttons. For certain
+ * `font-size` values of the `input`, it causes the cursor style of the
+ * decrement button to change from `default` to `text`.
+ */
+input[type="number"]::-webkit-inner-spin-button,
+input[type="number"]::-webkit-outer-spin-button {
+  height: auto;
+}
+
+/**
+ * 1. Address `appearance` set to `searchfield` in Safari and Chrome.
+ * 2. Address `box-sizing` set to `border-box` in Safari and Chrome.
+ */
+input[type="search"] {
+  -webkit-appearance: textfield;
+  /* 1 */
+  box-sizing: content-box;
+  /* 2 */
+}
+
+/**
+ * Remove inner padding and search cancel button in Safari and Chrome on OS X.
+ * Safari (but not Chrome) clips the cancel button when the search input has
+ * padding (and `textfield` appearance).
+ */
+input[type="search"]::-webkit-search-cancel-button,
+input[type="search"]::-webkit-search-decoration {
+  -webkit-appearance: none;
+}
+
+/**
+ * Define consistent border, margin, and padding.
+ */
+fieldset {
+  border: 1px solid #c0c0c0;
+  margin: 0 2px;
+  padding: 0.35em 0.625em 0.75em;
+}
+
+/**
+ * 1. Correct `color` not being inherited in IE 8/9/10/11.
+ * 2. Remove padding so people aren't caught out if they zero out fieldsets.
+ */
+legend {
+  border: 0;
+  /* 1 */
+  padding: 0;
+  /* 2 */
+}
+
+/**
+ * Remove default vertical scrollbar in IE 8/9/10/11.
+ */
+textarea {
+  overflow: auto;
+}
+
+/**
+ * Don't inherit the `font-weight` (applied by a rule above).
+ * NOTE: the default cannot safely be changed in Chrome and Safari on OS X.
+ */
+optgroup {
+  font-weight: bold;
+}
+
+/* Tables
+   ========================================================================== */
+/**
+ * Remove most spacing between table cells.
+ */
+table {
+  border-collapse: collapse;
+  border-spacing: 0;
+}
+
+td,
+th {
+  padding: 0;
+}
+
+html {
+  box-sizing: border-box;
+}
+
+*, *:before, *:after {
+  box-sizing: inherit;
+}
+
+ul:not(.browser-default) {
+  padding-left: 0;
+  list-style-type: none;
+}
+
+ul:not(.browser-default) li {
+  list-style-type: none;
+}
+
+a {
+  color: #039be5;
+  text-decoration: none;
+  -webkit-tap-highlight-color: transparent;
+}
+
+.valign-wrapper {
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-align-items: center;
+      -ms-flex-align: center;
+          align-items: center;
+}
+
+.valign-wrapper .valign {
+  display: block;
+}
+
+.clearfix {
+  clear: both;
+}
+
+.z-depth-0 {
+  box-shadow: none !important;
+}
+
+.z-depth-1, nav, .card-panel, .card, .toast, .btn, .btn-large, .btn-floating, .dropdown-content, .collapsible, .side-nav {
+  box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2);
+}
+
+.z-depth-1-half, .btn:hover, .btn-large:hover, .btn-floating:hover {
+  box-shadow: 0 3px 3px 0 rgba(0, 0, 0, 0.14), 0 1px 7px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -1px rgba(0, 0, 0, 0.2);
+}
+
+.z-depth-2 {
+  box-shadow: 0 4px 5px 0 rgba(0, 0, 0, 0.14), 0 1px 10px 0 rgba(0, 0, 0, 0.12), 0 2px 4px -1px rgba(0, 0, 0, 0.3);
+}
+
+.z-depth-3 {
+  box-shadow: 0 6px 10px 0 rgba(0, 0, 0, 0.14), 0 1px 18px 0 rgba(0, 0, 0, 0.12), 0 3px 5px -1px rgba(0, 0, 0, 0.3);
+}
+
+.z-depth-4, .modal {
+  box-shadow: 0 8px 10px 1px rgba(0, 0, 0, 0.14), 0 3px 14px 2px rgba(0, 0, 0, 0.12), 0 5px 5px -3px rgba(0, 0, 0, 0.3);
+}
+
+.z-depth-5 {
+  box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14), 0 6px 30px 5px rgba(0, 0, 0, 0.12), 0 8px 10px -5px rgba(0, 0, 0, 0.3);
+}
+
+.hoverable {
+  transition: box-shadow .25s;
+  box-shadow: 0;
+}
+
+.hoverable:hover {
+  transition: box-shadow .25s;
+  box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19);
+}
+
+.divider {
+  height: 1px;
+  overflow: hidden;
+  background-color: #e0e0e0;
+}
+
+blockquote {
+  margin: 20px 0;
+  padding-left: 1.5rem;
+  border-left: 5px solid #ee6e73;
+}
+
+i {
+  line-height: inherit;
+}
+
+i.left {
+  float: left;
+  margin-right: 15px;
+}
+
+i.right {
+  float: right;
+  margin-left: 15px;
+}
+
+i.tiny {
+  font-size: 1rem;
+}
+
+i.small {
+  font-size: 2rem;
+}
+
+i.medium {
+  font-size: 4rem;
+}
+
+i.large {
+  font-size: 6rem;
+}
+
+img.responsive-img,
+video.responsive-video {
+  max-width: 100%;
+  height: auto;
+}
+
+.pagination li {
+  display: inline-block;
+  border-radius: 2px;
+  text-align: center;
+  vertical-align: top;
+  height: 30px;
+}
+
+.pagination li a {
+  color: #444;
+  display: inline-block;
+  font-size: 1.2rem;
+  padding: 0 10px;
+  line-height: 30px;
+}
+
+.pagination li.active a {
+  color: #fff;
+}
+
+.pagination li.active {
+  background-color: #ee6e73;
+}
+
+.pagination li.disabled a {
+  cursor: default;
+  color: #999;
+}
+
+.pagination li i {
+  font-size: 2rem;
+}
+
+.pagination li.pages ul li {
+  display: inline-block;
+  float: none;
+}
+
+@media only screen and (max-width: 992px) {
+  .pagination {
+    width: 100%;
+  }
+  .pagination li.prev,
+  .pagination li.next {
+    width: 10%;
+  }
+  .pagination li.pages {
+    width: 80%;
+    overflow: hidden;
+    white-space: nowrap;
+  }
+}
+
+.breadcrumb {
+  font-size: 18px;
+  color: rgba(255, 255, 255, 0.7);
+}
+
+.breadcrumb i,
+.breadcrumb [class^="mdi-"], .breadcrumb [class*="mdi-"],
+.breadcrumb i.material-icons {
+  display: inline-block;
+  float: left;
+  font-size: 24px;
+}
+
+.breadcrumb:before {
+  content: '\E5CC';
+  color: rgba(255, 255, 255, 0.7);
+  vertical-align: top;
+  display: inline-block;
+  font-family: 'Material Icons';
+  font-weight: normal;
+  font-style: normal;
+  font-size: 25px;
+  margin: 0 10px 0 8px;
+  -webkit-font-smoothing: antialiased;
+}
+
+.breadcrumb:first-child:before {
+  display: none;
+}
+
+.breadcrumb:last-child {
+  color: #fff;
+}
+
+.parallax-container {
+  position: relative;
+  overflow: hidden;
+  height: 500px;
+}
+
+.parallax {
+  position: absolute;
+  top: 0;
+  left: 0;
+  right: 0;
+  bottom: 0;
+  z-index: -1;
+}
+
+.parallax img {
+  display: none;
+  position: absolute;
+  left: 50%;
+  bottom: 0;
+  min-width: 100%;
+  min-height: 100%;
+  -webkit-transform: translate3d(0, 0, 0);
+  transform: translate3d(0, 0, 0);
+  -webkit-transform: translateX(-50%);
+          transform: translateX(-50%);
+}
+
+.pin-top, .pin-bottom {
+  position: relative;
+}
+
+.pinned {
+  position: fixed !important;
+}
+
+/*********************
+  Transition Classes
+**********************/
+ul.staggered-list li {
+  opacity: 0;
+}
+
+.fade-in {
+  opacity: 0;
+  -webkit-transform-origin: 0 50%;
+          transform-origin: 0 50%;
+}
+
+/*********************
+  Media Query Classes
+**********************/
+@media only screen and (max-width: 600px) {
+  .hide-on-small-only, .hide-on-small-and-down {
+    display: none !important;
+  }
+}
+
+@media only screen and (max-width: 992px) {
+  .hide-on-med-and-down {
+    display: none !important;
+  }
+}
+
+@media only screen and (min-width: 601px) {
+  .hide-on-med-and-up {
+    display: none !important;
+  }
+}
+
+@media only screen and (min-width: 600px) and (max-width: 992px) {
+  .hide-on-med-only {
+    display: none !important;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  .hide-on-large-only {
+    display: none !important;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  .show-on-large {
+    display: block !important;
+  }
+}
+
+@media only screen and (min-width: 600px) and (max-width: 992px) {
+  .show-on-medium {
+    display: block !important;
+  }
+}
+
+@media only screen and (max-width: 600px) {
+  .show-on-small {
+    display: block !important;
+  }
+}
+
+@media only screen and (min-width: 601px) {
+  .show-on-medium-and-up {
+    display: block !important;
+  }
+}
+
+@media only screen and (max-width: 992px) {
+  .show-on-medium-and-down {
+    display: block !important;
+  }
+}
+
+@media only screen and (max-width: 600px) {
+  .center-on-small-only {
+    text-align: center;
+  }
+}
+
+footer.page-footer {
+  padding-top: 20px;
+  background-color: #ee6e73;
+}
+
+footer.page-footer .footer-copyright {
+  overflow: hidden;
+  min-height: 50px;
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-align-items: center;
+      -ms-flex-align: center;
+          align-items: center;
+  padding: 10px 0px;
+  color: rgba(255, 255, 255, 0.8);
+  background-color: rgba(51, 51, 51, 0.08);
+}
+
+table, th, td {
+  border: none;
+}
+
+table {
+  width: 100%;
+  display: table;
+}
+
+table.bordered > thead > tr,
+table.bordered > tbody > tr {
+  border-bottom: 1px solid #d0d0d0;
+}
+
+table.striped > tbody > tr:nth-child(odd) {
+  background-color: #f2f2f2;
+}
+
+table.striped > tbody > tr > td {
+  border-radius: 0;
+}
+
+table.highlight > tbody > tr {
+  transition: background-color .25s ease;
+}
+
+table.highlight > tbody > tr:hover {
+  background-color: #f2f2f2;
+}
+
+table.centered thead tr th, table.centered tbody tr td {
+  text-align: center;
+}
+
+thead {
+  border-bottom: 1px solid #d0d0d0;
+}
+
+td, th {
+  padding: 15px 5px;
+  display: table-cell;
+  text-align: left;
+  vertical-align: middle;
+  border-radius: 2px;
+}
+
+@media only screen and (max-width: 992px) {
+  table.responsive-table {
+    width: 100%;
+    border-collapse: collapse;
+    border-spacing: 0;
+    display: block;
+    position: relative;
+    /* sort out borders */
+  }
+  table.responsive-table td:empty:before {
+    content: '\00a0';
+  }
+  table.responsive-table th,
+  table.responsive-table td {
+    margin: 0;
+    vertical-align: top;
+  }
+  table.responsive-table th {
+    text-align: left;
+  }
+  table.responsive-table thead {
+    display: block;
+    float: left;
+  }
+  table.responsive-table thead tr {
+    display: block;
+    padding: 0 10px 0 0;
+  }
+  table.responsive-table thead tr th::before {
+    content: "\00a0";
+  }
+  table.responsive-table tbody {
+    display: block;
+    width: auto;
+    position: relative;
+    overflow-x: auto;
+    white-space: nowrap;
+  }
+  table.responsive-table tbody tr {
+    display: inline-block;
+    vertical-align: top;
+  }
+  table.responsive-table th {
+    display: block;
+    text-align: right;
+  }
+  table.responsive-table td {
+    display: block;
+    min-height: 1.25em;
+    text-align: left;
+  }
+  table.responsive-table tr {
+    padding: 0 10px;
+  }
+  table.responsive-table thead {
+    border: 0;
+    border-right: 1px solid #d0d0d0;
+  }
+  table.responsive-table.bordered th {
+    border-bottom: 0;
+    border-left: 0;
+  }
+  table.responsive-table.bordered td {
+    border-left: 0;
+    border-right: 0;
+    border-bottom: 0;
+  }
+  table.responsive-table.bordered tr {
+    border: 0;
+  }
+  table.responsive-table.bordered tbody tr {
+    border-right: 1px solid #d0d0d0;
+  }
+}
+
+.collection {
+  margin: 0.5rem 0 1rem 0;
+  border: 1px solid #e0e0e0;
+  border-radius: 2px;
+  overflow: hidden;
+  position: relative;
+}
+
+.collection .collection-item {
+  background-color: #fff;
+  line-height: 1.5rem;
+  padding: 10px 20px;
+  margin: 0;
+  border-bottom: 1px solid #e0e0e0;
+}
+
+.collection .collection-item.avatar {
+  min-height: 84px;
+  padding-left: 72px;
+  position: relative;
+}
+
+.collection .collection-item.avatar .circle {
+  position: absolute;
+  width: 42px;
+  height: 42px;
+  overflow: hidden;
+  left: 15px;
+  display: inline-block;
+  vertical-align: middle;
+}
+
+.collection .collection-item.avatar i.circle {
+  font-size: 18px;
+  line-height: 42px;
+  color: #fff;
+  background-color: #999;
+  text-align: center;
+}
+
+.collection .collection-item.avatar .title {
+  font-size: 16px;
+}
+
+.collection .collection-item.avatar p {
+  margin: 0;
+}
+
+.collection .collection-item.avatar .secondary-content {
+  position: absolute;
+  top: 16px;
+  right: 16px;
+}
+
+.collection .collection-item:last-child {
+  border-bottom: none;
+}
+
+.collection .collection-item.active {
+  background-color: #26a69a;
+  color: #eafaf9;
+}
+
+.collection .collection-item.active .secondary-content {
+  color: #fff;
+}
+
+.collection a.collection-item {
+  display: block;
+  transition: .25s;
+  color: #26a69a;
+}
+
+.collection a.collection-item:not(.active):hover {
+  background-color: #ddd;
+}
+
+.collection.with-header .collection-header {
+  background-color: #fff;
+  border-bottom: 1px solid #e0e0e0;
+  padding: 10px 20px;
+}
+
+.collection.with-header .collection-item {
+  padding-left: 30px;
+}
+
+.collection.with-header .collection-item.avatar {
+  padding-left: 72px;
+}
+
+.secondary-content {
+  float: right;
+  color: #26a69a;
+}
+
+.collapsible .collection {
+  margin: 0;
+  border: none;
+}
+
+.video-container {
+  position: relative;
+  padding-bottom: 56.25%;
+  height: 0;
+  overflow: hidden;
+}
+
+.video-container iframe, .video-container object, .video-container embed {
+  position: absolute;
+  top: 0;
+  left: 0;
+  width: 100%;
+  height: 100%;
+}
+
+.progress {
+  position: relative;
+  height: 4px;
+  display: block;
+  width: 100%;
+  background-color: #acece6;
+  border-radius: 2px;
+  margin: 0.5rem 0 1rem 0;
+  overflow: hidden;
+}
+
+.progress .determinate {
+  position: absolute;
+  top: 0;
+  left: 0;
+  bottom: 0;
+  background-color: #26a69a;
+  transition: width .3s linear;
+}
+
+.progress .indeterminate {
+  background-color: #26a69a;
+}
+
+.progress .indeterminate:before {
+  content: '';
+  position: absolute;
+  background-color: inherit;
+  top: 0;
+  left: 0;
+  bottom: 0;
+  will-change: left, right;
+  -webkit-animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;
+          animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;
+}
+
+.progress .indeterminate:after {
+  content: '';
+  position: absolute;
+  background-color: inherit;
+  top: 0;
+  left: 0;
+  bottom: 0;
+  will-change: left, right;
+  -webkit-animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;
+          animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;
+  -webkit-animation-delay: 1.15s;
+          animation-delay: 1.15s;
+}
+
+@-webkit-keyframes indeterminate {
+  0% {
+    left: -35%;
+    right: 100%;
+  }
+  60% {
+    left: 100%;
+    right: -90%;
+  }
+  100% {
+    left: 100%;
+    right: -90%;
+  }
+}
+
+@keyframes indeterminate {
+  0% {
+    left: -35%;
+    right: 100%;
+  }
+  60% {
+    left: 100%;
+    right: -90%;
+  }
+  100% {
+    left: 100%;
+    right: -90%;
+  }
+}
+
+@-webkit-keyframes indeterminate-short {
+  0% {
+    left: -200%;
+    right: 100%;
+  }
+  60% {
+    left: 107%;
+    right: -8%;
+  }
+  100% {
+    left: 107%;
+    right: -8%;
+  }
+}
+
+@keyframes indeterminate-short {
+  0% {
+    left: -200%;
+    right: 100%;
+  }
+  60% {
+    left: 107%;
+    right: -8%;
+  }
+  100% {
+    left: 107%;
+    right: -8%;
+  }
+}
+
+/*******************
+  Utility Classes
+*******************/
+.hide {
+  display: none !important;
+}
+
+.left-align {
+  text-align: left;
+}
+
+.right-align {
+  text-align: right;
+}
+
+.center, .center-align {
+  text-align: center;
+}
+
+.left {
+  float: left !important;
+}
+
+.right {
+  float: right !important;
+}
+
+.no-select, input[type=range],
+input[type=range] + .thumb {
+  -webkit-touch-callout: none;
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -ms-user-select: none;
+  user-select: none;
+}
+
+.circle {
+  border-radius: 50%;
+}
+
+.center-block {
+  display: block;
+  margin-left: auto;
+  margin-right: auto;
+}
+
+.truncate {
+  display: block;
+  white-space: nowrap;
+  overflow: hidden;
+  text-overflow: ellipsis;
+}
+
+.no-padding {
+  padding: 0 !important;
+}
+
+span.badge {
+  min-width: 3rem;
+  padding: 0 6px;
+  margin-left: 14px;
+  text-align: center;
+  font-size: 1rem;
+  line-height: 22px;
+  height: 22px;
+  color: #757575;
+  float: right;
+  box-sizing: border-box;
+}
+
+span.badge.new {
+  font-weight: 300;
+  font-size: 0.8rem;
+  color: #fff;
+  background-color: #26a69a;
+  border-radius: 2px;
+}
+
+span.badge.new:after {
+  content: " new";
+}
+
+span.badge[data-badge-caption]::after {
+  content: " " attr(data-badge-caption);
+}
+
+nav ul a span.badge {
+  display: inline-block;
+  float: none;
+  margin-left: 4px;
+  line-height: 22px;
+  height: 22px;
+}
+
+.collection-item span.badge {
+  margin-top: calc(0.75rem - 11px);
+}
+
+.collapsible span.badge {
+  margin-top: calc(1.5rem - 11px);
+}
+
+.side-nav span.badge {
+  margin-top: calc(24px - 11px);
+}
+
+/* This is needed for some mobile phones to display the Google Icon font properly */
+.material-icons {
+  text-rendering: optimizeLegibility;
+  -webkit-font-feature-settings: 'liga';
+     -moz-font-feature-settings: 'liga';
+          font-feature-settings: 'liga';
+}
+
+.container {
+  margin: 0 auto;
+  max-width: 1280px;
+  width: 90%;
+}
+
+@media only screen and (min-width: 601px) {
+  .container {
+    width: 85%;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  .container {
+    width: 70%;
+  }
+}
+
+.container .row {
+  margin-left: -0.75rem;
+  margin-right: -0.75rem;
+}
+
+.section {
+  padding-top: 1rem;
+  padding-bottom: 1rem;
+}
+
+.section.no-pad {
+  padding: 0;
+}
+
+.section.no-pad-bot {
+  padding-bottom: 0;
+}
+
+.section.no-pad-top {
+  padding-top: 0;
+}
+
+.row {
+  margin-left: auto;
+  margin-right: auto;
+  margin-bottom: 20px;
+}
+
+.row:after {
+  content: "";
+  display: table;
+  clear: both;
+}
+
+.row .col {
+  float: left;
+  box-sizing: border-box;
+  padding: 0 0.75rem;
+  min-height: 1px;
+}
+
+.row .col[class*="push-"], .row .col[class*="pull-"] {
+  position: relative;
+}
+
+.row .col.s1 {
+  width: 8.3333333333%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s2 {
+  width: 16.6666666667%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s3 {
+  width: 25%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s4 {
+  width: 33.3333333333%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s5 {
+  width: 41.6666666667%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s6 {
+  width: 50%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s7 {
+  width: 58.3333333333%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s8 {
+  width: 66.6666666667%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s9 {
+  width: 75%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s10 {
+  width: 83.3333333333%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s11 {
+  width: 91.6666666667%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.s12 {
+  width: 100%;
+  margin-left: auto;
+  left: auto;
+  right: auto;
+}
+
+.row .col.offset-s1 {
+  margin-left: 8.3333333333%;
+}
+
+.row .col.pull-s1 {
+  right: 8.3333333333%;
+}
+
+.row .col.push-s1 {
+  left: 8.3333333333%;
+}
+
+.row .col.offset-s2 {
+  margin-left: 16.6666666667%;
+}
+
+.row .col.pull-s2 {
+  right: 16.6666666667%;
+}
+
+.row .col.push-s2 {
+  left: 16.6666666667%;
+}
+
+.row .col.offset-s3 {
+  margin-left: 25%;
+}
+
+.row .col.pull-s3 {
+  right: 25%;
+}
+
+.row .col.push-s3 {
+  left: 25%;
+}
+
+.row .col.offset-s4 {
+  margin-left: 33.3333333333%;
+}
+
+.row .col.pull-s4 {
+  right: 33.3333333333%;
+}
+
+.row .col.push-s4 {
+  left: 33.3333333333%;
+}
+
+.row .col.offset-s5 {
+  margin-left: 41.6666666667%;
+}
+
+.row .col.pull-s5 {
+  right: 41.6666666667%;
+}
+
+.row .col.push-s5 {
+  left: 41.6666666667%;
+}
+
+.row .col.offset-s6 {
+  margin-left: 50%;
+}
+
+.row .col.pull-s6 {
+  right: 50%;
+}
+
+.row .col.push-s6 {
+  left: 50%;
+}
+
+.row .col.offset-s7 {
+  margin-left: 58.3333333333%;
+}
+
+.row .col.pull-s7 {
+  right: 58.3333333333%;
+}
+
+.row .col.push-s7 {
+  left: 58.3333333333%;
+}
+
+.row .col.offset-s8 {
+  margin-left: 66.6666666667%;
+}
+
+.row .col.pull-s8 {
+  right: 66.6666666667%;
+}
+
+.row .col.push-s8 {
+  left: 66.6666666667%;
+}
+
+.row .col.offset-s9 {
+  margin-left: 75%;
+}
+
+.row .col.pull-s9 {
+  right: 75%;
+}
+
+.row .col.push-s9 {
+  left: 75%;
+}
+
+.row .col.offset-s10 {
+  margin-left: 83.3333333333%;
+}
+
+.row .col.pull-s10 {
+  right: 83.3333333333%;
+}
+
+.row .col.push-s10 {
+  left: 83.3333333333%;
+}
+
+.row .col.offset-s11 {
+  margin-left: 91.6666666667%;
+}
+
+.row .col.pull-s11 {
+  right: 91.6666666667%;
+}
+
+.row .col.push-s11 {
+  left: 91.6666666667%;
+}
+
+.row .col.offset-s12 {
+  margin-left: 100%;
+}
+
+.row .col.pull-s12 {
+  right: 100%;
+}
+
+.row .col.push-s12 {
+  left: 100%;
+}
+
+@media only screen and (min-width: 601px) {
+  .row .col.m1 {
+    width: 8.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m2 {
+    width: 16.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m3 {
+    width: 25%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m4 {
+    width: 33.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m5 {
+    width: 41.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m6 {
+    width: 50%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m7 {
+    width: 58.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m8 {
+    width: 66.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m9 {
+    width: 75%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m10 {
+    width: 83.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m11 {
+    width: 91.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.m12 {
+    width: 100%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.offset-m1 {
+    margin-left: 8.3333333333%;
+  }
+  .row .col.pull-m1 {
+    right: 8.3333333333%;
+  }
+  .row .col.push-m1 {
+    left: 8.3333333333%;
+  }
+  .row .col.offset-m2 {
+    margin-left: 16.6666666667%;
+  }
+  .row .col.pull-m2 {
+    right: 16.6666666667%;
+  }
+  .row .col.push-m2 {
+    left: 16.6666666667%;
+  }
+  .row .col.offset-m3 {
+    margin-left: 25%;
+  }
+  .row .col.pull-m3 {
+    right: 25%;
+  }
+  .row .col.push-m3 {
+    left: 25%;
+  }
+  .row .col.offset-m4 {
+    margin-left: 33.3333333333%;
+  }
+  .row .col.pull-m4 {
+    right: 33.3333333333%;
+  }
+  .row .col.push-m4 {
+    left: 33.3333333333%;
+  }
+  .row .col.offset-m5 {
+    margin-left: 41.6666666667%;
+  }
+  .row .col.pull-m5 {
+    right: 41.6666666667%;
+  }
+  .row .col.push-m5 {
+    left: 41.6666666667%;
+  }
+  .row .col.offset-m6 {
+    margin-left: 50%;
+  }
+  .row .col.pull-m6 {
+    right: 50%;
+  }
+  .row .col.push-m6 {
+    left: 50%;
+  }
+  .row .col.offset-m7 {
+    margin-left: 58.3333333333%;
+  }
+  .row .col.pull-m7 {
+    right: 58.3333333333%;
+  }
+  .row .col.push-m7 {
+    left: 58.3333333333%;
+  }
+  .row .col.offset-m8 {
+    margin-left: 66.6666666667%;
+  }
+  .row .col.pull-m8 {
+    right: 66.6666666667%;
+  }
+  .row .col.push-m8 {
+    left: 66.6666666667%;
+  }
+  .row .col.offset-m9 {
+    margin-left: 75%;
+  }
+  .row .col.pull-m9 {
+    right: 75%;
+  }
+  .row .col.push-m9 {
+    left: 75%;
+  }
+  .row .col.offset-m10 {
+    margin-left: 83.3333333333%;
+  }
+  .row .col.pull-m10 {
+    right: 83.3333333333%;
+  }
+  .row .col.push-m10 {
+    left: 83.3333333333%;
+  }
+  .row .col.offset-m11 {
+    margin-left: 91.6666666667%;
+  }
+  .row .col.pull-m11 {
+    right: 91.6666666667%;
+  }
+  .row .col.push-m11 {
+    left: 91.6666666667%;
+  }
+  .row .col.offset-m12 {
+    margin-left: 100%;
+  }
+  .row .col.pull-m12 {
+    right: 100%;
+  }
+  .row .col.push-m12 {
+    left: 100%;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  .row .col.l1 {
+    width: 8.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l2 {
+    width: 16.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l3 {
+    width: 25%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l4 {
+    width: 33.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l5 {
+    width: 41.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l6 {
+    width: 50%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l7 {
+    width: 58.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l8 {
+    width: 66.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l9 {
+    width: 75%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l10 {
+    width: 83.3333333333%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l11 {
+    width: 91.6666666667%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.l12 {
+    width: 100%;
+    margin-left: auto;
+    left: auto;
+    right: auto;
+  }
+  .row .col.offset-l1 {
+    margin-left: 8.3333333333%;
+  }
+  .row .col.pull-l1 {
+    right: 8.3333333333%;
+  }
+  .row .col.push-l1 {
+    left: 8.3333333333%;
+  }
+  .row .col.offset-l2 {
+    margin-left: 16.6666666667%;
+  }
+  .row .col.pull-l2 {
+    right: 16.6666666667%;
+  }
+  .row .col.push-l2 {
+    left: 16.6666666667%;
+  }
+  .row .col.offset-l3 {
+    margin-left: 25%;
+  }
+  .row .col.pull-l3 {
+    right: 25%;
+  }
+  .row .col.push-l3 {
+    left: 25%;
+  }
+  .row .col.offset-l4 {
+    margin-left: 33.3333333333%;
+  }
+  .row .col.pull-l4 {
+    right: 33.3333333333%;
+  }
+  .row .col.push-l4 {
+    left: 33.3333333333%;
+  }
+  .row .col.offset-l5 {
+    margin-left: 41.6666666667%;
+  }
+  .row .col.pull-l5 {
+    right: 41.6666666667%;
+  }
+  .row .col.push-l5 {
+    left: 41.6666666667%;
+  }
+  .row .col.offset-l6 {
+    margin-left: 50%;
+  }
+  .row .col.pull-l6 {
+    right: 50%;
+  }
+  .row .col.push-l6 {
+    left: 50%;
+  }
+  .row .col.offset-l7 {
+    margin-left: 58.3333333333%;
+  }
+  .row .col.pull-l7 {
+    right: 58.3333333333%;
+  }
+  .row .col.push-l7 {
+    left: 58.3333333333%;
+  }
+  .row .col.offset-l8 {
+    margin-left: 66.6666666667%;
+  }
+  .row .col.pull-l8 {
+    right: 66.6666666667%;
+  }
+  .row .col.push-l8 {
+    left: 66.6666666667%;
+  }
+  .row .col.offset-l9 {
+    margin-left: 75%;
+  }
+  .row .col.pull-l9 {
+    right: 75%;
+  }
+  .row .col.push-l9 {
+    left: 75%;
+  }
+  .row .col.offset-l10 {
+    margin-left: 83.3333333333%;
+  }
+  .row .col.pull-l10 {
+    right: 83.3333333333%;
+  }
+  .row .col.push-l10 {
+    left: 83.3333333333%;
+  }
+  .row .col.offset-l11 {
+    margin-left: 91.6666666667%;
+  }
+  .row .col.pull-l11 {
+    right: 91.6666666667%;
+  }
+  .row .col.push-l11 {
+    left: 91.6666666667%;
+  }
+  .row .col.offset-l12 {
+    margin-left: 100%;
+  }
+  .row .col.pull-l12 {
+    right: 100%;
+  }
+  .row .col.push-l12 {
+    left: 100%;
+  }
+}
+
+nav {
+  color: #fff;
+  background-color: #ee6e73;
+  width: 100%;
+  height: 56px;
+  line-height: 56px;
+}
+
+nav.nav-extended {
+  height: auto;
+}
+
+nav.nav-extended .nav-wrapper {
+  min-height: 56px;
+  height: auto;
+}
+
+nav.nav-extended .nav-content {
+  position: relative;
+  line-height: normal;
+}
+
+nav a {
+  color: #fff;
+}
+
+nav i,
+nav [class^="mdi-"], nav [class*="mdi-"],
+nav i.material-icons {
+  display: block;
+  font-size: 24px;
+  height: 56px;
+  line-height: 56px;
+}
+
+nav .nav-wrapper {
+  position: relative;
+  height: 100%;
+}
+
+@media only screen and (min-width: 993px) {
+  nav a.button-collapse {
+    display: none;
+  }
+}
+
+nav .button-collapse {
+  float: left;
+  position: relative;
+  z-index: 1;
+  height: 56px;
+  margin: 0 18px;
+}
+
+nav .button-collapse i {
+  height: 56px;
+  line-height: 56px;
+}
+
+nav .brand-logo {
+  position: absolute;
+  color: #fff;
+  display: inline-block;
+  font-size: 2.1rem;
+  padding: 0;
+  white-space: nowrap;
+}
+
+nav .brand-logo.center {
+  left: 50%;
+  -webkit-transform: translateX(-50%);
+          transform: translateX(-50%);
+}
+
+@media only screen and (max-width: 992px) {
+  nav .brand-logo {
+    left: 50%;
+    -webkit-transform: translateX(-50%);
+            transform: translateX(-50%);
+  }
+  nav .brand-logo.left, nav .brand-logo.right {
+    padding: 0;
+    -webkit-transform: none;
+            transform: none;
+  }
+  nav .brand-logo.left {
+    left: 0.5rem;
+  }
+  nav .brand-logo.right {
+    right: 0.5rem;
+    left: auto;
+  }
+}
+
+nav .brand-logo.right {
+  right: 0.5rem;
+  padding: 0;
+}
+
+nav .brand-logo i,
+nav .brand-logo [class^="mdi-"], nav .brand-logo [class*="mdi-"],
+nav .brand-logo i.material-icons {
+  float: left;
+  margin-right: 15px;
+}
+
+nav .nav-title {
+  display: inline-block;
+  font-size: 32px;
+  padding: 28px 0;
+}
+
+nav ul {
+  margin: 0;
+}
+
+nav ul li {
+  transition: background-color .3s;
+  float: left;
+  padding: 0;
+}
+
+nav ul li.active {
+  background-color: rgba(0, 0, 0, 0.1);
+}
+
+nav ul a {
+  transition: background-color .3s;
+  font-size: 1rem;
+  color: #fff;
+  display: block;
+  padding: 0 15px;
+  cursor: pointer;
+}
+
+nav ul a.btn, nav ul a.btn-large, nav ul a.btn-large, nav ul a.btn-flat, nav ul a.btn-floating {
+  margin-top: -2px;
+  margin-left: 15px;
+  margin-right: 15px;
+}
+
+nav ul a.btn > .material-icons, nav ul a.btn-large > .material-icons, nav ul a.btn-large > .material-icons, nav ul a.btn-flat > .material-icons, nav ul a.btn-floating > .material-icons {
+  height: inherit;
+  line-height: inherit;
+}
+
+nav ul a:hover {
+  background-color: rgba(0, 0, 0, 0.1);
+}
+
+nav ul.left {
+  float: left;
+}
+
+nav form {
+  height: 100%;
+}
+
+nav .input-field {
+  margin: 0;
+  height: 100%;
+}
+
+nav .input-field input {
+  height: 100%;
+  font-size: 1.2rem;
+  border: none;
+  padding-left: 2rem;
+}
+
+nav .input-field input:focus, nav .input-field input[type=text]:valid, nav .input-field input[type=password]:valid, nav .input-field input[type=email]:valid, nav .input-field input[type=url]:valid, nav .input-field input[type=date]:valid {
+  border: none;
+  box-shadow: none;
+}
+
+nav .input-field label {
+  top: 0;
+  left: 0;
+}
+
+nav .input-field label i {
+  color: rgba(255, 255, 255, 0.7);
+  transition: color .3s;
+}
+
+nav .input-field label.active i {
+  color: #fff;
+}
+
+.navbar-fixed {
+  position: relative;
+  height: 56px;
+  z-index: 997;
+}
+
+.navbar-fixed nav {
+  position: fixed;
+}
+
+@media only screen and (min-width: 601px) {
+  nav.nav-extended .nav-wrapper {
+    min-height: 64px;
+  }
+  nav, nav .nav-wrapper i, nav a.button-collapse, nav a.button-collapse i {
+    height: 64px;
+    line-height: 64px;
+  }
+  .navbar-fixed {
+    height: 64px;
+  }
+}
+
+@font-face {
+  font-family: "Roboto";
+  src: local(Roboto Thin), url("../fonts/roboto/Roboto-Thin.eot");
+  src: url("../fonts/roboto/Roboto-Thin.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Thin.woff2") format("woff2"), url("../fonts/roboto/Roboto-Thin.woff") format("woff"), url("../fonts/roboto/Roboto-Thin.ttf") format("truetype");
+  font-weight: 200;
+}
+
+@font-face {
+  font-family: "Roboto";
+  src: local(Roboto Light), url("../fonts/roboto/Roboto-Light.eot");
+  src: url("../fonts/roboto/Roboto-Light.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Light.woff2") format("woff2"), url("../fonts/roboto/Roboto-Light.woff") format("woff"), url("../fonts/roboto/Roboto-Light.ttf") format("truetype");
+  font-weight: 300;
+}
+
+@font-face {
+  font-family: "Roboto";
+  src: local(Roboto Regular), url("../fonts/roboto/Roboto-Regular.eot");
+  src: url("../fonts/roboto/Roboto-Regular.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Regular.woff2") format("woff2"), url("../fonts/roboto/Roboto-Regular.woff") format("woff"), url("../fonts/roboto/Roboto-Regular.ttf") format("truetype");
+  font-weight: 400;
+}
+
+@font-face {
+  font-family: "Roboto";
+  src: url("../fonts/roboto/Roboto-Medium.eot");
+  src: url("../fonts/roboto/Roboto-Medium.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Medium.woff2") format("woff2"), url("../fonts/roboto/Roboto-Medium.woff") format("woff"), url("../fonts/roboto/Roboto-Medium.ttf") format("truetype");
+  font-weight: 500;
+}
+
+@font-face {
+  font-family: "Roboto";
+  src: url("../fonts/roboto/Roboto-Bold.eot");
+  src: url("../fonts/roboto/Roboto-Bold.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Bold.woff2") format("woff2"), url("../fonts/roboto/Roboto-Bold.woff") format("woff"), url("../fonts/roboto/Roboto-Bold.ttf") format("truetype");
+  font-weight: 700;
+}
+
+a {
+  text-decoration: none;
+}
+
+html {
+  line-height: 1.5;
+  font-family: "Roboto", sans-serif;
+  font-weight: normal;
+  color: rgba(0, 0, 0, 0.87);
+}
+
+@media only screen and (min-width: 0) {
+  html {
+    font-size: 14px;
+  }
+}
+
+@media only screen and (min-width: 992px) {
+  html {
+    font-size: 14.5px;
+  }
+}
+
+@media only screen and (min-width: 1200px) {
+  html {
+    font-size: 15px;
+  }
+}
+
+h1, h2, h3, h4, h5, h6 {
+  font-weight: 400;
+  line-height: 1.1;
+}
+
+h1 a, h2 a, h3 a, h4 a, h5 a, h6 a {
+  font-weight: inherit;
+}
+
+h1 {
+  font-size: 4.2rem;
+  line-height: 110%;
+  margin: 2.1rem 0 1.68rem 0;
+}
+
+h2 {
+  font-size: 3.56rem;
+  line-height: 110%;
+  margin: 1.78rem 0 1.424rem 0;
+}
+
+h3 {
+  font-size: 2.92rem;
+  line-height: 110%;
+  margin: 1.46rem 0 1.168rem 0;
+}
+
+h4 {
+  font-size: 2.28rem;
+  line-height: 110%;
+  margin: 1.14rem 0 0.912rem 0;
+}
+
+h5 {
+  font-size: 1.64rem;
+  line-height: 110%;
+  margin: 0.82rem 0 0.656rem 0;
+}
+
+h6 {
+  font-size: 1rem;
+  line-height: 110%;
+  margin: 0.5rem 0 0.4rem 0;
+}
+
+em {
+  font-style: italic;
+}
+
+strong {
+  font-weight: 500;
+}
+
+small {
+  font-size: 75%;
+}
+
+.light, footer.page-footer .footer-copyright {
+  font-weight: 300;
+}
+
+.thin {
+  font-weight: 200;
+}
+
+.flow-text {
+  font-weight: 300;
+}
+
+@media only screen and (min-width: 360px) {
+  .flow-text {
+    font-size: 1.2rem;
+  }
+}
+
+@media only screen and (min-width: 390px) {
+  .flow-text {
+    font-size: 1.224rem;
+  }
+}
+
+@media only screen and (min-width: 420px) {
+  .flow-text {
+    font-size: 1.248rem;
+  }
+}
+
+@media only screen and (min-width: 450px) {
+  .flow-text {
+    font-size: 1.272rem;
+  }
+}
+
+@media only screen and (min-width: 480px) {
+  .flow-text {
+    font-size: 1.296rem;
+  }
+}
+
+@media only screen and (min-width: 510px) {
+  .flow-text {
+    font-size: 1.32rem;
+  }
+}
+
+@media only screen and (min-width: 540px) {
+  .flow-text {
+    font-size: 1.344rem;
+  }
+}
+
+@media only screen and (min-width: 570px) {
+  .flow-text {
+    font-size: 1.368rem;
+  }
+}
+
+@media only screen and (min-width: 600px) {
+  .flow-text {
+    font-size: 1.392rem;
+  }
+}
+
+@media only screen and (min-width: 630px) {
+  .flow-text {
+    font-size: 1.416rem;
+  }
+}
+
+@media only screen and (min-width: 660px) {
+  .flow-text {
+    font-size: 1.44rem;
+  }
+}
+
+@media only screen and (min-width: 690px) {
+  .flow-text {
+    font-size: 1.464rem;
+  }
+}
+
+@media only screen and (min-width: 720px) {
+  .flow-text {
+    font-size: 1.488rem;
+  }
+}
+
+@media only screen and (min-width: 750px) {
+  .flow-text {
+    font-size: 1.512rem;
+  }
+}
+
+@media only screen and (min-width: 780px) {
+  .flow-text {
+    font-size: 1.536rem;
+  }
+}
+
+@media only screen and (min-width: 810px) {
+  .flow-text {
+    font-size: 1.56rem;
+  }
+}
+
+@media only screen and (min-width: 840px) {
+  .flow-text {
+    font-size: 1.584rem;
+  }
+}
+
+@media only screen and (min-width: 870px) {
+  .flow-text {
+    font-size: 1.608rem;
+  }
+}
+
+@media only screen and (min-width: 900px) {
+  .flow-text {
+    font-size: 1.632rem;
+  }
+}
+
+@media only screen and (min-width: 930px) {
+  .flow-text {
+    font-size: 1.656rem;
+  }
+}
+
+@media only screen and (min-width: 960px) {
+  .flow-text {
+    font-size: 1.68rem;
+  }
+}
+
+@media only screen and (max-width: 360px) {
+  .flow-text {
+    font-size: 1.2rem;
+  }
+}
+
+.scale-transition {
+  transition: -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;
+  transition: transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;
+  transition: transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63), -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;
+}
+
+.scale-transition.scale-out {
+  -webkit-transform: scale(0);
+          transform: scale(0);
+  transition: -webkit-transform .2s !important;
+  transition: transform .2s !important;
+  transition: transform .2s, -webkit-transform .2s !important;
+}
+
+.scale-transition.scale-in {
+  -webkit-transform: scale(1);
+          transform: scale(1);
+}
+
+.card-panel {
+  transition: box-shadow .25s;
+  padding: 24px;
+  margin: 0.5rem 0 1rem 0;
+  border-radius: 2px;
+  background-color: #fff;
+}
+
+.card {
+  position: relative;
+  margin: 0.5rem 0 1rem 0;
+  background-color: #fff;
+  transition: box-shadow .25s;
+  border-radius: 2px;
+}
+
+.card .card-title {
+  font-size: 24px;
+  font-weight: 300;
+}
+
+.card .card-title.activator {
+  cursor: pointer;
+}
+
+.card.small, .card.medium, .card.large {
+  position: relative;
+}
+
+.card.small .card-image, .card.medium .card-image, .card.large .card-image {
+  max-height: 60%;
+  overflow: hidden;
+}
+
+.card.small .card-image + .card-content, .card.medium .card-image + .card-content, .card.large .card-image + .card-content {
+  max-height: 40%;
+}
+
+.card.small .card-content, .card.medium .card-content, .card.large .card-content {
+  max-height: 100%;
+  overflow: hidden;
+}
+
+.card.small .card-action, .card.medium .card-action, .card.large .card-action {
+  position: absolute;
+  bottom: 0;
+  left: 0;
+  right: 0;
+}
+
+.card.small {
+  height: 300px;
+}
+
+.card.medium {
+  height: 400px;
+}
+
+.card.large {
+  height: 500px;
+}
+
+.card.horizontal {
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+}
+
+.card.horizontal.small .card-image, .card.horizontal.medium .card-image, .card.horizontal.large .card-image {
+  height: 100%;
+  max-height: none;
+  overflow: visible;
+}
+
+.card.horizontal.small .card-image img, .card.horizontal.medium .card-image img, .card.horizontal.large .card-image img {
+  height: 100%;
+}
+
+.card.horizontal .card-image {
+  max-width: 50%;
+}
+
+.card.horizontal .card-image img {
+  border-radius: 2px 0 0 2px;
+  max-width: 100%;
+  width: auto;
+}
+
+.card.horizontal .card-stacked {
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-flex-direction: column;
+      -ms-flex-direction: column;
+          flex-direction: column;
+  -webkit-flex: 1;
+      -ms-flex: 1;
+          flex: 1;
+  position: relative;
+}
+
+.card.horizontal .card-stacked .card-content {
+  -webkit-flex-grow: 1;
+      -ms-flex-positive: 1;
+          flex-grow: 1;
+}
+
+.card.sticky-action .card-action {
+  z-index: 2;
+}
+
+.card.sticky-action .card-reveal {
+  z-index: 1;
+  padding-bottom: 64px;
+}
+
+.card .card-image {
+  position: relative;
+}
+
+.card .card-image img {
+  display: block;
+  border-radius: 2px 2px 0 0;
+  position: relative;
+  left: 0;
+  right: 0;
+  top: 0;
+  bottom: 0;
+  width: 100%;
+}
+
+.card .card-image .card-title {
+  color: #fff;
+  position: absolute;
+  bottom: 0;
+  left: 0;
+  max-width: 100%;
+  padding: 24px;
+}
+
+.card .card-content {
+  padding: 24px;
+  border-radius: 0 0 2px 2px;
+}
+
+.card .card-content p {
+  margin: 0;
+  color: inherit;
+}
+
+.card .card-content .card-title {
+  display: block;
+  line-height: 32px;
+  margin-bottom: 8px;
+}
+
+.card .card-content .card-title i {
+  line-height: 32px;
+}
+
+.card .card-action {
+  position: relative;
+  background-color: inherit;
+  border-top: 1px solid rgba(160, 160, 160, 0.2);
+  padding: 16px 24px;
+}
+
+.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating) {
+  color: #ffab40;
+  margin-right: 24px;
+  transition: color .3s ease;
+  text-transform: uppercase;
+}
+
+.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating):hover {
+  color: #ffd8a6;
+}
+
+.card .card-reveal {
+  padding: 24px;
+  position: absolute;
+  background-color: #fff;
+  width: 100%;
+  overflow-y: auto;
+  left: 0;
+  top: 100%;
+  height: 100%;
+  z-index: 3;
+  display: none;
+}
+
+.card .card-reveal .card-title {
+  cursor: pointer;
+  display: block;
+}
+
+#toast-container {
+  display: block;
+  position: fixed;
+  z-index: 10000;
+}
+
+@media only screen and (max-width: 600px) {
+  #toast-container {
+    min-width: 100%;
+    bottom: 0%;
+  }
+}
+
+@media only screen and (min-width: 601px) and (max-width: 992px) {
+  #toast-container {
+    left: 5%;
+    bottom: 7%;
+    max-width: 90%;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  #toast-container {
+    top: 10%;
+    right: 7%;
+    max-width: 86%;
+  }
+}
+
+.toast {
+  border-radius: 2px;
+  top: 35px;
+  width: auto;
+  clear: both;
+  margin-top: 10px;
+  position: relative;
+  max-width: 100%;
+  height: auto;
+  min-height: 48px;
+  line-height: 1.5em;
+  word-break: break-all;
+  background-color: #323232;
+  padding: 10px 25px;
+  font-size: 1.1rem;
+  font-weight: 300;
+  color: #fff;
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-align-items: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-justify-content: space-between;
+      -ms-flex-pack: justify;
+          justify-content: space-between;
+}
+
+.toast .btn, .toast .btn-large, .toast .btn-flat {
+  margin: 0;
+  margin-left: 3rem;
+}
+
+.toast.rounded {
+  border-radius: 24px;
+}
+
+@media only screen and (max-width: 600px) {
+  .toast {
+    width: 100%;
+    border-radius: 0;
+  }
+}
+
+@media only screen and (min-width: 601px) and (max-width: 992px) {
+  .toast {
+    float: left;
+  }
+}
+
+@media only screen and (min-width: 993px) {
+  .toast {
+    float: right;
+  }
+}
+
+.tabs {
+  position: relative;
+  overflow-x: auto;
+  overflow-y: hidden;
+  height: 48px;
+  width: 100%;
+  background-color: #fff;
+  margin: 0 auto;
+  white-space: nowrap;
+}
+
+.tabs.tabs-transparent {
+  background-color: transparent;
+}
+
+.tabs.tabs-transparent .tab a,
+.tabs.tabs-transparent .tab.disabled a,
+.tabs.tabs-transparent .tab.disabled a:hover {
+  color: rgba(255, 255, 255, 0.7);
+}
+
+.tabs.tabs-transparent .tab a:hover,
+.tabs.tabs-transparent .tab a.active {
+  color: #fff;
+}
+
+.tabs.tabs-transparent .indicator {
+  background-color: #fff;
+}
+
+.tabs.tabs-fixed-width {
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+}
+
+.tabs.tabs-fixed-width .tab {
+  -webkit-flex-grow: 1;
+  -ms-flex-positive: 1;
+  flex-grow: 1;
+}
+
+.tabs .tab {
+  display: inline-block;
+  text-align: center;
+  line-height: 48px;
+  height: 48px;
+  padding: 0;
+  margin: 0;
+  text-transform: uppercase;
+}
+
+.tabs .tab a {
+  color: rgba(238, 110, 115, 0.7);
+  display: block;
+  width: 100%;
+  height: 100%;
+  padding: 0 24px;
+  font-size: 14px;
+  text-overflow: ellipsis;
+  overflow: hidden;
+  transition: color .28s ease;
+}
+
+.tabs .tab a:hover, .tabs .tab a.active {
+  background-color: transparent;
+  color: #ee6e73;
+}
+
+.tabs .tab.disabled a,
+.tabs .tab.disabled a:hover {
+  color: rgba(238, 110, 115, 0.7);
+  cursor: default;
+}
+
+.tabs .indicator {
+  position: absolute;
+  bottom: 0;
+  height: 2px;
+  background-color: #f6b2b5;
+  will-change: left, right;
+}
+
+@media only screen and (max-width: 992px) {
+  .tabs {
+    display: -webkit-flex;
+    display: -ms-flexbox;
+    display: flex;
+  }
+  .tabs .tab {
+    -webkit-flex-grow: 1;
+    -ms-flex-positive: 1;
+    flex-grow: 1;
+  }
+  .tabs .tab a {
+    padding: 0 12px;
+  }
+}
+
+.material-tooltip {
+  padding: 10px 8px;
+  font-size: 1rem;
+  z-index: 2000;
+  background-color: transparent;
+  border-radius: 2px;
+  color: #fff;
+  min-height: 36px;
+  line-height: 120%;
+  opacity: 0;
+  position: absolute;
+  text-align: center;
+  max-width: calc(100% - 4px);
+  overflow: hidden;
+  left: 0;
+  top: 0;
+  pointer-events: none;
+  visibility: hidden;
+}
+
+.backdrop {
+  position: absolute;
+  opacity: 0;
+  height: 7px;
+  width: 14px;
+  border-radius: 0 0 50% 50%;
+  background-color: #323232;
+  z-index: -1;
+  -webkit-transform-origin: 50% 0%;
+          transform-origin: 50% 0%;
+  visibility: hidden;
+}
+
+.btn, .btn-large,
+.btn-flat {
+  border: none;
+  border-radius: 2px;
+  display: inline-block;
+  height: 36px;
+  line-height: 36px;
+  padding: 0 2rem;
+  text-transform: uppercase;
+  vertical-align: middle;
+  -webkit-tap-highlight-color: transparent;
+}
+
+.btn.disabled, .disabled.btn-large,
+.btn-floating.disabled,
+.btn-large.disabled,
+.btn-flat.disabled,
+.btn:disabled,
+.btn-large:disabled,
+.btn-floating:disabled,
+.btn-large:disabled,
+.btn-flat:disabled,
+.btn[disabled],
+[disabled].btn-large,
+.btn-floating[disabled],
+.btn-large[disabled],
+.btn-flat[disabled] {
+  pointer-events: none;
+  background-color: #DFDFDF !important;
+  box-shadow: none;
+  color: #9F9F9F !important;
+  cursor: default;
+}
+
+.btn.disabled:hover, .disabled.btn-large:hover,
+.btn-floating.disabled:hover,
+.btn-large.disabled:hover,
+.btn-flat.disabled:hover,
+.btn:disabled:hover,
+.btn-large:disabled:hover,
+.btn-floating:disabled:hover,
+.btn-large:disabled:hover,
+.btn-flat:disabled:hover,
+.btn[disabled]:hover,
+[disabled].btn-large:hover,
+.btn-floating[disabled]:hover,
+.btn-large[disabled]:hover,
+.btn-flat[disabled]:hover {
+  background-color: #DFDFDF !important;
+  color: #9F9F9F !important;
+}
+
+.btn, .btn-large,
+.btn-floating,
+.btn-large,
+.btn-flat {
+  outline: 0;
+}
+
+.btn i, .btn-large i,
+.btn-floating i,
+.btn-large i,
+.btn-flat i {
+  font-size: 1.3rem;
+  line-height: inherit;
+}
+
+.btn:focus, .btn-large:focus,
+.btn-floating:focus {
+  background-color: #1d7d74;
+}
+
+.btn, .btn-large {
+  text-decoration: none;
+  color: #fff;
+  background-color: #26a69a;
+  text-align: center;
+  letter-spacing: .5px;
+  transition: .2s ease-out;
+  cursor: pointer;
+}
+
+.btn:hover, .btn-large:hover {
+  background-color: #2bbbad;
+}
+
+.btn-floating {
+  display: inline-block;
+  color: #fff;
+  position: relative;
+  overflow: hidden;
+  z-index: 1;
+  width: 40px;
+  height: 40px;
+  line-height: 40px;
+  padding: 0;
+  background-color: #26a69a;
+  border-radius: 50%;
+  transition: .3s;
+  cursor: pointer;
+  vertical-align: middle;
+}
+
+.btn-floating:hover {
+  background-color: #26a69a;
+}
+
+.btn-floating:before {
+  border-radius: 0;
+}
+
+.btn-floating.btn-large {
+  width: 56px;
+  height: 56px;
+}
+
+.btn-floating.btn-large i {
+  line-height: 56px;
+}
+
+.btn-floating.halfway-fab {
+  position: absolute;
+  right: 24px;
+  bottom: 0;
+  -webkit-transform: translateY(50%);
+          transform: translateY(50%);
+}
+
+.btn-floating.halfway-fab.left {
+  right: auto;
+  left: 24px;
+}
+
+.btn-floating i {
+  width: inherit;
+  display: inline-block;
+  text-align: center;
+  color: #fff;
+  font-size: 1.6rem;
+  line-height: 40px;
+}
+
+button.btn-floating {
+  border: none;
+}
+
+.fixed-action-btn {
+  position: fixed;
+  right: 23px;
+  bottom: 23px;
+  padding-top: 15px;
+  margin-bottom: 0;
+  z-index: 998;
+}
+
+.fixed-action-btn.active ul {
+  visibility: visible;
+}
+
+.fixed-action-btn.horizontal {
+  padding: 0 0 0 15px;
+}
+
+.fixed-action-btn.horizontal ul {
+  text-align: right;
+  right: 64px;
+  top: 50%;
+  -webkit-transform: translateY(-50%);
+          transform: translateY(-50%);
+  height: 100%;
+  left: auto;
+  width: 500px;
+  /*width 100% only goes to width of button container */
+}
+
+.fixed-action-btn.horizontal ul li {
+  display: inline-block;
+  margin: 15px 15px 0 0;
+}
+
+.fixed-action-btn.toolbar {
+  padding: 0;
+  height: 56px;
+}
+
+.fixed-action-btn.toolbar.active > a i {
+  opacity: 0;
+}
+
+.fixed-action-btn.toolbar ul {
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  top: 0;
+  bottom: 0;
+}
+
+.fixed-action-btn.toolbar ul li {
+  -webkit-flex: 1;
+      -ms-flex: 1;
+          flex: 1;
+  display: inline-block;
+  margin: 0;
+  height: 100%;
+  transition: none;
+}
+
+.fixed-action-btn.toolbar ul li a {
+  display: block;
+  overflow: hidden;
+  position: relative;
+  width: 100%;
+  height: 100%;
+  background-color: transparent;
+  box-shadow: none;
+  color: #fff;
+  line-height: 56px;
+  z-index: 1;
+}
+
+.fixed-action-btn.toolbar ul li a i {
+  line-height: inherit;
+}
+
+.fixed-action-btn ul {
+  left: 0;
+  right: 0;
+  text-align: center;
+  position: absolute;
+  bottom: 64px;
+  margin: 0;
+  visibility: hidden;
+}
+
+.fixed-action-btn ul li {
+  margin-bottom: 15px;
+}
+
+.fixed-action-btn ul a.btn-floating {
+  opacity: 0;
+}
+
+.fixed-action-btn .fab-backdrop {
+  position: absolute;
+  top: 0;
+  left: 0;
+  z-index: -1;
+  width: 40px;
+  height: 40px;
+  background-color: #26a69a;
+  border-radius: 50%;
+  -webkit-transform: scale(0);
+          transform: scale(0);
+}
+
+.btn-flat {
+  box-shadow: none;
+  background-color: transparent;
+  color: #343434;
+  cursor: pointer;
+  transition: background-color .2s;
+}
+
+.btn-flat:focus, .btn-flat:active {
+  background-color: transparent;
+}
+
+.btn-flat:focus, .btn-flat:hover {
+  background-color: rgba(0, 0, 0, 0.1);
+  box-shadow: none;
+}
+
+.btn-flat:active {
+  background-color: rgba(0, 0, 0, 0.2);
+}
+
+.btn-flat.disabled {
+  background-color: transparent !important;
+  color: #b3b3b3 !important;
+  cursor: default;
+}
+
+.btn-large {
+  height: 54px;
+  line-height: 54px;
+}
+
+.btn-large i {
+  font-size: 1.6rem;
+}
+
+.btn-block {
+  display: block;
+}
+
+.dropdown-content {
+  background-color: #fff;
+  margin: 0;
+  display: none;
+  min-width: 100px;
+  max-height: 650px;
+  overflow-y: auto;
+  opacity: 0;
+  position: absolute;
+  z-index: 999;
+  will-change: width, height;
+}
+
+.dropdown-content li {
+  clear: both;
+  color: rgba(0, 0, 0, 0.87);
+  cursor: pointer;
+  min-height: 50px;
+  line-height: 1.5rem;
+  width: 100%;
+  text-align: left;
+  text-transform: none;
+}
+
+.dropdown-content li:hover, .dropdown-content li.active, .dropdown-content li.selected {
+  background-color: #eee;
+}
+
+.dropdown-content li.active.selected {
+  background-color: #e1e1e1;
+}
+
+.dropdown-content li.divider {
+  min-height: 0;
+  height: 1px;
+}
+
+.dropdown-content li > a, .dropdown-content li > span {
+  font-size: 16px;
+  color: #26a69a;
+  display: block;
+  line-height: 22px;
+  padding: 14px 16px;
+}
+
+.dropdown-content li > span > label {
+  top: 1px;
+  left: 0;
+  height: 18px;
+}
+
+.dropdown-content li > a > i {
+  height: inherit;
+  line-height: inherit;
+}
+
+.input-field.col .dropdown-content [type="checkbox"] + label {
+  top: 1px;
+  left: 0;
+  height: 18px;
+}
+
+/*!
+ * Waves v0.6.0
+ * http://fian.my.id/Waves
+ *
+ * Copyright 2014 Alfiana E. Sibuea and other contributors
+ * Released under the MIT license
+ * https://github.com/fians/Waves/blob/master/LICENSE
+ */
+.waves-effect {
+  position: relative;
+  cursor: pointer;
+  display: inline-block;
+  overflow: hidden;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+  -webkit-tap-highlight-color: transparent;
+  vertical-align: middle;
+  z-index: 1;
+  transition: .3s ease-out;
+}
+
+.waves-effect .waves-ripple {
+  position: absolute;
+  border-radius: 50%;
+  width: 20px;
+  height: 20px;
+  margin-top: -10px;
+  margin-left: -10px;
+  opacity: 0;
+  background: rgba(0, 0, 0, 0.2);
+  transition: all 0.7s ease-out;
+  transition-property: opacity, -webkit-transform;
+  transition-property: transform, opacity;
+  transition-property: transform, opacity, -webkit-transform;
+  -webkit-transform: scale(0);
+          transform: scale(0);
+  pointer-events: none;
+}
+
+.waves-effect.waves-light .waves-ripple {
+  background-color: rgba(255, 255, 255, 0.45);
+}
+
+.waves-effect.waves-red .waves-ripple {
+  background-color: rgba(244, 67, 54, 0.7);
+}
+
+.waves-effect.waves-yellow .waves-ripple {
+  background-color: rgba(255, 235, 59, 0.7);
+}
+
+.waves-effect.waves-orange .waves-ripple {
+  background-color: rgba(255, 152, 0, 0.7);
+}
+
+.waves-effect.waves-purple .waves-ripple {
+  background-color: rgba(156, 39, 176, 0.7);
+}
+
+.waves-effect.waves-green .waves-ripple {
+  background-color: rgba(76, 175, 80, 0.7);
+}
+
+.waves-effect.waves-teal .waves-ripple {
+  background-color: rgba(0, 150, 136, 0.7);
+}
+
+.waves-effect input[type="button"], .waves-effect input[type="reset"], .waves-effect input[type="submit"] {
+  border: 0;
+  font-style: normal;
+  font-size: inherit;
+  text-transform: inherit;
+  background: none;
+}
+
+.waves-effect img {
+  position: relative;
+  z-index: -1;
+}
+
+.waves-notransition {
+  transition: none !important;
+}
+
+.waves-circle {
+  -webkit-transform: translateZ(0);
+          transform: translateZ(0);
+  -webkit-mask-image: -webkit-radial-gradient(circle, white 100%, black 100%);
+}
+
+.waves-input-wrapper {
+  border-radius: 0.2em;
+  vertical-align: bottom;
+}
+
+.waves-input-wrapper .waves-button-input {
+  position: relative;
+  top: 0;
+  left: 0;
+  z-index: 1;
+}
+
+.waves-circle {
+  text-align: center;
+  width: 2.5em;
+  height: 2.5em;
+  line-height: 2.5em;
+  border-radius: 50%;
+  -webkit-mask-image: none;
+}
+
+.waves-block {
+  display: block;
+}
+
+/* Firefox Bug: link not triggered */
+.waves-effect .waves-ripple {
+  z-index: -1;
+}
+
+.modal {
+  display: none;
+  position: fixed;
+  left: 0;
+  right: 0;
+  background-color: #fafafa;
+  padding: 0;
+  max-height: 70%;
+  width: 55%;
+  margin: auto;
+  overflow-y: auto;
+  border-radius: 2px;
+  will-change: top, opacity;
+}
+
+@media only screen and (max-width: 992px) {
+  .modal {
+    width: 80%;
+  }
+}
+
+.modal h1, .modal h2, .modal h3, .modal h4 {
+  margin-top: 0;
+}
+
+.modal .modal-content {
+  padding: 24px;
+}
+
+.modal .modal-close {
+  cursor: pointer;
+}
+
+.modal .modal-footer {
+  border-radius: 0 0 2px 2px;
+  background-color: #fafafa;
+  padding: 4px 6px;
+  height: 56px;
+  width: 100%;
+}
+
+.modal .modal-footer .btn, .modal .modal-footer .btn-large, .modal .modal-footer .btn-flat {
+  float: right;
+  margin: 6px 0;
+}
+
+.modal-overlay {
+  position: fixed;
+  z-index: 999;
+  top: -100px;
+  left: 0;
+  bottom: 0;
+  right: 0;
+  height: 125%;
+  width: 100%;
+  background: #000;
+  display: none;
+  will-change: opacity;
+}
+
+.modal.modal-fixed-footer {
+  padding: 0;
+  height: 70%;
+}
+
+.modal.modal-fixed-footer .modal-content {
+  position: absolute;
+  height: calc(100% - 56px);
+  max-height: 100%;
+  width: 100%;
+  overflow-y: auto;
+}
+
+.modal.modal-fixed-footer .modal-footer {
+  border-top: 1px solid rgba(0, 0, 0, 0.1);
+  position: absolute;
+  bottom: 0;
+}
+
+.modal.bottom-sheet {
+  top: auto;
+  bottom: -100%;
+  margin: 0;
+  width: 100%;
+  max-height: 45%;
+  border-radius: 0;
+  will-change: bottom, opacity;
+}
+
+.collapsible {
+  border-top: 1px solid #ddd;
+  border-right: 1px solid #ddd;
+  border-left: 1px solid #ddd;
+  margin: 0.5rem 0 1rem 0;
+}
+
+.collapsible-header {
+  display: block;
+  cursor: pointer;
+  min-height: 3rem;
+  line-height: 3rem;
+  padding: 0 1rem;
+  background-color: #fff;
+  border-bottom: 1px solid #ddd;
+}
+
+.collapsible-header i {
+  width: 2rem;
+  font-size: 1.6rem;
+  line-height: 3rem;
+  display: block;
+  float: left;
+  text-align: center;
+  margin-right: 1rem;
+}
+
+.collapsible-body {
+  display: none;
+  border-bottom: 1px solid #ddd;
+  box-sizing: border-box;
+  padding: 2rem;
+}
+
+.side-nav .collapsible,
+.side-nav.fixed .collapsible {
+  border: none;
+  box-shadow: none;
+}
+
+.side-nav .collapsible li,
+.side-nav.fixed .collapsible li {
+  padding: 0;
+}
+
+.side-nav .collapsible-header,
+.side-nav.fixed .collapsible-header {
+  background-color: transparent;
+  border: none;
+  line-height: inherit;
+  height: inherit;
+  padding: 0 16px;
+}
+
+.side-nav .collapsible-header:hover,
+.side-nav.fixed .collapsible-header:hover {
+  background-color: rgba(0, 0, 0, 0.05);
+}
+
+.side-nav .collapsible-header i,
+.side-nav.fixed .collapsible-header i {
+  line-height: inherit;
+}
+
+.side-nav .collapsible-body,
+.side-nav.fixed .collapsible-body {
+  border: 0;
+  background-color: #fff;
+}
+
+.side-nav .collapsible-body li a,
+.side-nav.fixed .collapsible-body li a {
+  padding: 0 23.5px 0 31px;
+}
+
+.collapsible.popout {
+  border: none;
+  box-shadow: none;
+}
+
+.collapsible.popout > li {
+  box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12);
+  margin: 0 24px;
+  transition: margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94);
+}
+
+.collapsible.popout > li.active {
+  box-shadow: 0 5px 11px 0 rgba(0, 0, 0, 0.18), 0 4px 15px 0 rgba(0, 0, 0, 0.15);
+  margin: 16px 0;
+}
+
+.chip {
+  display: inline-block;
+  height: 32px;
+  font-size: 13px;
+  font-weight: 500;
+  color: rgba(0, 0, 0, 0.6);
+  line-height: 32px;
+  padding: 0 12px;
+  border-radius: 16px;
+  background-color: #e4e4e4;
+  margin-bottom: 5px;
+  margin-right: 5px;
+}
+
+.chip img {
+  float: left;
+  margin: 0 8px 0 -12px;
+  height: 32px;
+  width: 32px;
+  border-radius: 50%;
+}
+
+.chip .close {
+  cursor: pointer;
+  float: right;
+  font-size: 16px;
+  line-height: 32px;
+  padding-left: 8px;
+}
+
+.chips {
+  border: none;
+  border-bottom: 1px solid #9e9e9e;
+  box-shadow: none;
+  margin: 0 0 20px 0;
+  min-height: 45px;
+  outline: none;
+  transition: all .3s;
+}
+
+.chips.focus {
+  border-bottom: 1px solid #26a69a;
+  box-shadow: 0 1px 0 0 #26a69a;
+}
+
+.chips:hover {
+  cursor: text;
+}
+
+.chips .chip.selected {
+  background-color: #26a69a;
+  color: #fff;
+}
+
+.chips .input {
+  background: none;
+  border: 0;
+  color: rgba(0, 0, 0, 0.6);
+  display: inline-block;
+  font-size: 1rem;
+  height: 3rem;
+  line-height: 32px;
+  outline: 0;
+  margin: 0;
+  padding: 0 !important;
+  width: 120px !important;
+}
+
+.chips .input:focus {
+  border: 0 !important;
+  box-shadow: none !important;
+}
+
+.prefix ~ .chips {
+  margin-left: 3rem;
+  width: 92%;
+  width: calc(100% - 3rem);
+}
+
+.chips:empty ~ label {
+  font-size: 0.8rem;
+  -webkit-transform: translateY(-140%);
+          transform: translateY(-140%);
+}
+
+.materialboxed {
+  display: block;
+  cursor: -webkit-zoom-in;
+  cursor: zoom-in;
+  position: relative;
+  transition: opacity .4s;
+  -webkit-backface-visibility: hidden;
+}
+
+.materialboxed:hover:not(.active) {
+  opacity: .8;
+}
+
+.materialboxed.active {
+  cursor: -webkit-zoom-out;
+  cursor: zoom-out;
+}
+
+#materialbox-overlay {
+  position: fixed;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  background-color: #292929;
+  z-index: 1000;
+  will-change: opacity;
+}
+
+.materialbox-caption {
+  position: fixed;
+  display: none;
+  color: #fff;
+  line-height: 50px;
+  bottom: 0;
+  left: 0;
+  width: 100%;
+  text-align: center;
+  padding: 0% 15%;
+  height: 50px;
+  z-index: 1000;
+  -webkit-font-smoothing: antialiased;
+}
+
+select:focus {
+  outline: 1px solid #c9f3ef;
+}
+
+button:focus {
+  outline: none;
+  background-color: #2ab7a9;
+}
+
+label {
+  font-size: 0.8rem;
+  color: #9e9e9e;
+}
+
+/* Text Inputs + Textarea
+   ========================================================================== */
+/* Style Placeholders */
+::-webkit-input-placeholder {
+  color: #d1d1d1;
+}
+
+:-moz-placeholder {
+  /* Firefox 18- */
+  color: #d1d1d1;
+}
+
+::-moz-placeholder {
+  /* Firefox 19+ */
+  color: #d1d1d1;
+}
+
+:-ms-input-placeholder {
+  color: #d1d1d1;
+}
+
+/* Text inputs */
+input:not([type]),
+input[type=text],
+input[type=password],
+input[type=email],
+input[type=url],
+input[type=time],
+input[type=date],
+input[type=datetime],
+input[type=datetime-local],
+input[type=tel],
+input[type=number],
+input[type=search],
+textarea.materialize-textarea {
+  background-color: transparent;
+  border: none;
+  border-bottom: 1px solid #9e9e9e;
+  border-radius: 0;
+  outline: none;
+  height: 3rem;
+  width: 100%;
+  font-size: 1rem;
+  margin: 0 0 20px 0;
+  padding: 0;
+  box-shadow: none;
+  box-sizing: content-box;
+  transition: all 0.3s;
+}
+
+input:not([type]):disabled, input:not([type])[readonly="readonly"],
+input[type=text]:disabled,
+input[type=text][readonly="readonly"],
+input[type=password]:disabled,
+input[type=password][readonly="readonly"],
+input[type=email]:disabled,
+input[type=email][readonly="readonly"],
+input[type=url]:disabled,
+input[type=url][readonly="readonly"],
+input[type=time]:disabled,
+input[type=time][readonly="readonly"],
+input[type=date]:disabled,
+input[type=date][readonly="readonly"],
+input[type=datetime]:disabled,
+input[type=datetime][readonly="readonly"],
+input[type=datetime-local]:disabled,
+input[type=datetime-local][readonly="readonly"],
+input[type=tel]:disabled,
+input[type=tel][readonly="readonly"],
+input[type=number]:disabled,
+input[type=number][readonly="readonly"],
+input[type=search]:disabled,
+input[type=search][readonly="readonly"],
+textarea.materialize-textarea:disabled,
+textarea.materialize-textarea[readonly="readonly"] {
+  color: rgba(0, 0, 0, 0.26);
+  border-bottom: 1px dotted rgba(0, 0, 0, 0.26);
+}
+
+input:not([type]):disabled + label,
+input:not([type])[readonly="readonly"] + label,
+input[type=text]:disabled + label,
+input[type=text][readonly="readonly"] + label,
+input[type=password]:disabled + label,
+input[type=password][readonly="readonly"] + label,
+input[type=email]:disabled + label,
+input[type=email][readonly="readonly"] + label,
+input[type=url]:disabled + label,
+input[type=url][readonly="readonly"] + label,
+input[type=time]:disabled + label,
+input[type=time][readonly="readonly"] + label,
+input[type=date]:disabled + label,
+input[type=date][readonly="readonly"] + label,
+input[type=datetime]:disabled + label,
+input[type=datetime][readonly="readonly"] + label,
+input[type=datetime-local]:disabled + label,
+input[type=datetime-local][readonly="readonly"] + label,
+input[type=tel]:disabled + label,
+input[type=tel][readonly="readonly"] + label,
+input[type=number]:disabled + label,
+input[type=number][readonly="readonly"] + label,
+input[type=search]:disabled + label,
+input[type=search][readonly="readonly"] + label,
+textarea.materialize-textarea:disabled + label,
+textarea.materialize-textarea[readonly="readonly"] + label {
+  color: rgba(0, 0, 0, 0.26);
+}
+
+input:not([type]):focus:not([readonly]),
+input[type=text]:focus:not([readonly]),
+input[type=password]:focus:not([readonly]),
+input[type=email]:focus:not([readonly]),
+input[type=url]:focus:not([readonly]),
+input[type=time]:focus:not([readonly]),
+input[type=date]:focus:not([readonly]),
+input[type=datetime]:focus:not([readonly]),
+input[type=datetime-local]:focus:not([readonly]),
+input[type=tel]:focus:not([readonly]),
+input[type=number]:focus:not([readonly]),
+input[type=search]:focus:not([readonly]),
+textarea.materialize-textarea:focus:not([readonly]) {
+  border-bottom: 1px solid #26a69a;
+  box-shadow: 0 1px 0 0 #26a69a;
+}
+
+input:not([type]):focus:not([readonly]) + label,
+input[type=text]:focus:not([readonly]) + label,
+input[type=password]:focus:not([readonly]) + label,
+input[type=email]:focus:not([readonly]) + label,
+input[type=url]:focus:not([readonly]) + label,
+input[type=time]:focus:not([readonly]) + label,
+input[type=date]:focus:not([readonly]) + label,
+input[type=datetime]:focus:not([readonly]) + label,
+input[type=datetime-local]:focus:not([readonly]) + label,
+input[type=tel]:focus:not([readonly]) + label,
+input[type=number]:focus:not([readonly]) + label,
+input[type=search]:focus:not([readonly]) + label,
+textarea.materialize-textarea:focus:not([readonly]) + label {
+  color: #26a69a;
+}
+
+input:not([type]).valid, input:not([type]):focus.valid,
+input[type=text].valid,
+input[type=text]:focus.valid,
+input[type=password].valid,
+input[type=password]:focus.valid,
+input[type=email].valid,
+input[type=email]:focus.valid,
+input[type=url].valid,
+input[type=url]:focus.valid,
+input[type=time].valid,
+input[type=time]:focus.valid,
+input[type=date].valid,
+input[type=date]:focus.valid,
+input[type=datetime].valid,
+input[type=datetime]:focus.valid,
+input[type=datetime-local].valid,
+input[type=datetime-local]:focus.valid,
+input[type=tel].valid,
+input[type=tel]:focus.valid,
+input[type=number].valid,
+input[type=number]:focus.valid,
+input[type=search].valid,
+input[type=search]:focus.valid,
+textarea.materialize-textarea.valid,
+textarea.materialize-textarea:focus.valid {
+  border-bottom: 1px solid #4CAF50;
+  box-shadow: 0 1px 0 0 #4CAF50;
+}
+
+input:not([type]).valid + label:after,
+input:not([type]):focus.valid + label:after,
+input[type=text].valid + label:after,
+input[type=text]:focus.valid + label:after,
+input[type=password].valid + label:after,
+input[type=password]:focus.valid + label:after,
+input[type=email].valid + label:after,
+input[type=email]:focus.valid + label:after,
+input[type=url].valid + label:after,
+input[type=url]:focus.valid + label:after,
+input[type=time].valid + label:after,
+input[type=time]:focus.valid + label:after,
+input[type=date].valid + label:after,
+input[type=date]:focus.valid + label:after,
+input[type=datetime].valid + label:after,
+input[type=datetime]:focus.valid + label:after,
+input[type=datetime-local].valid + label:after,
+input[type=datetime-local]:focus.valid + label:after,
+input[type=tel].valid + label:after,
+input[type=tel]:focus.valid + label:after,
+input[type=number].valid + label:after,
+input[type=number]:focus.valid + label:after,
+input[type=search].valid + label:after,
+input[type=search]:focus.valid + label:after,
+textarea.materialize-textarea.valid + label:after,
+textarea.materialize-textarea:focus.valid + label:after {
+  content: attr(data-success);
+  color: #4CAF50;
+  opacity: 1;
+}
+
+input:not([type]).invalid, input:not([type]):focus.invalid,
+input[type=text].invalid,
+input[type=text]:focus.invalid,
+input[type=password].invalid,
+input[type=password]:focus.invalid,
+input[type=email].invalid,
+input[type=email]:focus.invalid,
+input[type=url].invalid,
+input[type=url]:focus.invalid,
+input[type=time].invalid,
+input[type=time]:focus.invalid,
+input[type=date].invalid,
+input[type=date]:focus.invalid,
+input[type=datetime].invalid,
+input[type=datetime]:focus.invalid,
+input[type=datetime-local].invalid,
+input[type=datetime-local]:focus.invalid,
+input[type=tel].invalid,
+input[type=tel]:focus.invalid,
+input[type=number].invalid,
+input[type=number]:focus.invalid,
+input[type=search].invalid,
+input[type=search]:focus.invalid,
+textarea.materialize-textarea.invalid,
+textarea.materialize-textarea:focus.invalid {
+  border-bottom: 1px solid #F44336;
+  box-shadow: 0 1px 0 0 #F44336;
+}
+
+input:not([type]).invalid + label:after,
+input:not([type]):focus.invalid + label:after,
+input[type=text].invalid + label:after,
+input[type=text]:focus.invalid + label:after,
+input[type=password].invalid + label:after,
+input[type=password]:focus.invalid + label:after,
+input[type=email].invalid + label:after,
+input[type=email]:focus.invalid + label:after,
+input[type=url].invalid + label:after,
+input[type=url]:focus.invalid + label:after,
+input[type=time].invalid + label:after,
+input[type=time]:focus.invalid + label:after,
+input[type=date].invalid + label:after,
+input[type=date]:focus.invalid + label:after,
+input[type=datetime].invalid + label:after,
+input[type=datetime]:focus.invalid + label:after,
+input[type=datetime-local].invalid + label:after,
+input[type=datetime-local]:focus.invalid + label:after,
+input[type=tel].invalid + label:after,
+input[type=tel]:focus.invalid + label:after,
+input[type=number].invalid + label:after,
+input[type=number]:focus.invalid + label:after,
+input[type=search].invalid + label:after,
+input[type=search]:focus.invalid + label:after,
+textarea.materialize-textarea.invalid + label:after,
+textarea.materialize-textarea:focus.invalid + label:after {
+  content: attr(data-error);
+  color: #F44336;
+  opacity: 1;
+}
+
+input:not([type]).validate + label,
+input[type=text].validate + label,
+input[type=password].validate + label,
+input[type=email].validate + label,
+input[type=url].validate + label,
+input[type=time].validate + label,
+input[type=date].validate + label,
+input[type=datetime].validate + label,
+input[type=datetime-local].validate + label,
+input[type=tel].validate + label,
+input[type=number].validate + label,
+input[type=search].validate + label,
+textarea.materialize-textarea.validate + label {
+  width: 100%;
+  pointer-events: none;
+}
+
+input:not([type]) + label:after,
+input[type=text] + label:after,
+input[type=password] + label:after,
+input[type=email] + label:after,
+input[type=url] + label:after,
+input[type=time] + label:after,
+input[type=date] + label:after,
+input[type=datetime] + label:after,
+input[type=datetime-local] + label:after,
+input[type=tel] + label:after,
+input[type=number] + label:after,
+input[type=search] + label:after,
+textarea.materialize-textarea + label:after {
+  display: block;
+  content: "";
+  position: absolute;
+  top: 60px;
+  opacity: 0;
+  transition: .2s opacity ease-out, .2s color ease-out;
+}
+
+.input-field {
+  position: relative;
+  margin-top: 1rem;
+}
+
+.input-field.inline {
+  display: inline-block;
+  vertical-align: middle;
+  margin-left: 5px;
+}
+
+.input-field.inline input,
+.input-field.inline .select-dropdown {
+  margin-bottom: 1rem;
+}
+
+.input-field.col label {
+  left: 0.75rem;
+}
+
+.input-field.col .prefix ~ label,
+.input-field.col .prefix ~ .validate ~ label {
+  width: calc(100% - 3rem - 1.5rem);
+}
+
+.input-field label {
+  color: #9e9e9e;
+  position: absolute;
+  top: 0.8rem;
+  left: 0;
+  font-size: 1rem;
+  cursor: text;
+  transition: .2s ease-out;
+}
+
+.input-field label:not(.label-icon).active {
+  font-size: 0.8rem;
+  -webkit-transform: translateY(-140%);
+          transform: translateY(-140%);
+}
+
+.input-field .prefix {
+  position: absolute;
+  width: 3rem;
+  font-size: 2rem;
+  transition: color .2s;
+}
+
+.input-field .prefix.active {
+  color: #26a69a;
+}
+
+.input-field .prefix ~ input,
+.input-field .prefix ~ textarea,
+.input-field .prefix ~ label,
+.input-field .prefix ~ .validate ~ label,
+.input-field .prefix ~ .autocomplete-content {
+  margin-left: 3rem;
+  width: 92%;
+  width: calc(100% - 3rem);
+}
+
+.input-field .prefix ~ label {
+  margin-left: 3rem;
+}
+
+@media only screen and (max-width: 992px) {
+  .input-field .prefix ~ input {
+    width: 86%;
+    width: calc(100% - 3rem);
+  }
+}
+
+@media only screen and (max-width: 600px) {
+  .input-field .prefix ~ input {
+    width: 80%;
+    width: calc(100% - 3rem);
+  }
+}
+
+/* Search Field */
+.input-field input[type=search] {
+  display: block;
+  line-height: inherit;
+  padding-left: 4rem;
+  width: calc(100% - 4rem);
+}
+
+.input-field input[type=search]:focus {
+  background-color: #fff;
+  border: 0;
+  box-shadow: none;
+  color: #444;
+}
+
+.input-field input[type=search]:focus + label i,
+.input-field input[type=search]:focus ~ .mdi-navigation-close,
+.input-field input[type=search]:focus ~ .material-icons {
+  color: #444;
+}
+
+.input-field input[type=search] + label {
+  left: 1rem;
+}
+
+.input-field input[type=search] ~ .mdi-navigation-close,
+.input-field input[type=search] ~ .material-icons {
+  position: absolute;
+  top: 0;
+  right: 1rem;
+  color: transparent;
+  cursor: pointer;
+  font-size: 2rem;
+  transition: .3s color;
+}
+
+/* Textarea */
+textarea {
+  width: 100%;
+  height: 3rem;
+  background-color: transparent;
+}
+
+textarea.materialize-textarea {
+  overflow-y: hidden;
+  /* prevents scroll bar flash */
+  padding: .8rem 0 1.6rem 0;
+  /* prevents text jump on Enter keypress */
+  resize: none;
+  min-height: 3rem;
+}
+
+.hiddendiv {
+  display: none;
+  white-space: pre-wrap;
+  word-wrap: break-word;
+  overflow-wrap: break-word;
+  /* future version of deprecated 'word-wrap' */
+  padding-top: 1.2rem;
+  /* prevents text jump on Enter keypress */
+}
+
+/* Autocomplete */
+.autocomplete-content {
+  margin-top: -15px;
+  display: block;
+  opacity: 1;
+  position: static;
+}
+
+.autocomplete-content li .highlight {
+  color: #444;
+}
+
+.autocomplete-content li img {
+  height: 40px;
+  width: 40px;
+  margin: 5px 15px;
+}
+
+/* Radio Buttons
+   ========================================================================== */
+[type="radio"]:not(:checked),
+[type="radio"]:checked {
+  position: absolute;
+  left: -9999px;
+  opacity: 0;
+}
+
+[type="radio"]:not(:checked) + label,
+[type="radio"]:checked + label {
+  position: relative;
+  padding-left: 35px;
+  cursor: pointer;
+  display: inline-block;
+  height: 25px;
+  line-height: 25px;
+  font-size: 1rem;
+  transition: .28s ease;
+  /* webkit (konqueror) browsers */
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+}
+
+[type="radio"] + label:before,
+[type="radio"] + label:after {
+  content: '';
+  position: absolute;
+  left: 0;
+  top: 0;
+  margin: 4px;
+  width: 16px;
+  height: 16px;
+  z-index: 0;
+  transition: .28s ease;
+}
+
+/* Unchecked styles */
+[type="radio"]:not(:checked) + label:before,
+[type="radio"]:not(:checked) + label:after,
+[type="radio"]:checked + label:before,
+[type="radio"]:checked + label:after,
+[type="radio"].with-gap:checked + label:before,
+[type="radio"].with-gap:checked + label:after {
+  border-radius: 50%;
+}
+
+[type="radio"]:not(:checked) + label:before,
+[type="radio"]:not(:checked) + label:after {
+  border: 2px solid #5a5a5a;
+}
+
+[type="radio"]:not(:checked) + label:after {
+  -webkit-transform: scale(0);
+          transform: scale(0);
+}
+
+/* Checked styles */
+[type="radio"]:checked + label:before {
+  border: 2px solid transparent;
+}
+
+[type="radio"]:checked + label:after,
+[type="radio"].with-gap:checked + label:before,
+[type="radio"].with-gap:checked + label:after {
+  border: 2px solid #26a69a;
+}
+
+[type="radio"]:checked + label:after,
+[type="radio"].with-gap:checked + label:after {
+  background-color: #26a69a;
+}
+
+[type="radio"]:checked + label:after {
+  -webkit-transform: scale(1.02);
+          transform: scale(1.02);
+}
+
+/* Radio With gap */
+[type="radio"].with-gap:checked + label:after {
+  -webkit-transform: scale(0.5);
+          transform: scale(0.5);
+}
+
+/* Focused styles */
+[type="radio"].tabbed:focus + label:before {
+  box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1);
+}
+
+/* Disabled Radio With gap */
+[type="radio"].with-gap:disabled:checked + label:before {
+  border: 2px solid rgba(0, 0, 0, 0.26);
+}
+
+[type="radio"].with-gap:disabled:checked + label:after {
+  border: none;
+  background-color: rgba(0, 0, 0, 0.26);
+}
+
+/* Disabled style */
+[type="radio"]:disabled:not(:checked) + label:before,
+[type="radio"]:disabled:checked + label:before {
+  background-color: transparent;
+  border-color: rgba(0, 0, 0, 0.26);
+}
+
+[type="radio"]:disabled + label {
+  color: rgba(0, 0, 0, 0.26);
+}
+
+[type="radio"]:disabled:not(:checked) + label:before {
+  border-color: rgba(0, 0, 0, 0.26);
+}
+
+[type="radio"]:disabled:checked + label:after {
+  background-color: rgba(0, 0, 0, 0.26);
+  border-color: #BDBDBD;
+}
+
+/* Checkboxes
+   ========================================================================== */
+/* CUSTOM CSS CHECKBOXES */
+form p {
+  margin-bottom: 10px;
+  text-align: left;
+}
+
+form p:last-child {
+  margin-bottom: 0;
+}
+
+/* Remove default checkbox */
+[type="checkbox"]:not(:checked),
+[type="checkbox"]:checked {
+  position: absolute;
+  left: -9999px;
+  opacity: 0;
+}
+
+[type="checkbox"] {
+  /* checkbox aspect */
+}
+
+[type="checkbox"] + label {
+  position: relative;
+  padding-left: 35px;
+  cursor: pointer;
+  display: inline-block;
+  height: 25px;
+  line-height: 25px;
+  font-size: 1rem;
+  -webkit-user-select: none;
+  /* webkit (safari, chrome) browsers */
+  -moz-user-select: none;
+  /* mozilla browsers */
+  -khtml-user-select: none;
+  /* webkit (konqueror) browsers */
+  -ms-user-select: none;
+  /* IE10+ */
+}
+
+[type="checkbox"] + label:before,
+[type="checkbox"]:not(.filled-in) + label:after {
+  content: '';
+  position: absolute;
+  top: 0;
+  left: 0;
+  width: 18px;
+  height: 18px;
+  z-index: 0;
+  border: 2px solid #5a5a5a;
+  border-radius: 1px;
+  margin-top: 2px;
+  transition: .2s;
+}
+
+[type="checkbox"]:not(.filled-in) + label:after {
+  border: 0;
+  -webkit-transform: scale(0);
+          transform: scale(0);
+}
+
+[type="checkbox"]:not(:checked):disabled + label:before {
+  border: none;
+  background-color: rgba(0, 0, 0, 0.26);
+}
+
+[type="checkbox"].tabbed:focus + label:after {
+  -webkit-transform: scale(1);
+          transform: scale(1);
+  border: 0;
+  border-radius: 50%;
+  box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1);
+  background-color: rgba(0, 0, 0, 0.1);
+}
+
+[type="checkbox"]:checked + label:before {
+  top: -4px;
+  left: -5px;
+  width: 12px;
+  height: 22px;
+  border-top: 2px solid transparent;
+  border-left: 2px solid transparent;
+  border-right: 2px solid #26a69a;
+  border-bottom: 2px solid #26a69a;
+  -webkit-transform: rotate(40deg);
+          transform: rotate(40deg);
+  -webkit-backface-visibility: hidden;
+          backface-visibility: hidden;
+  -webkit-transform-origin: 100% 100%;
+          transform-origin: 100% 100%;
+}
+
+[type="checkbox"]:checked:disabled + label:before {
+  border-right: 2px solid rgba(0, 0, 0, 0.26);
+  border-bottom: 2px solid rgba(0, 0, 0, 0.26);
+}
+
+/* Indeterminate checkbox */
+[type="checkbox"]:indeterminate + label:before {
+  top: -11px;
+  left: -12px;
+  width: 10px;
+  height: 22px;
+  border-top: none;
+  border-left: none;
+  border-right: 2px solid #26a69a;
+  border-bottom: none;
+  -webkit-transform: rotate(90deg);
+          transform: rotate(90deg);
+  -webkit-backface-visibility: hidden;
+          backface-visibility: hidden;
+  -webkit-transform-origin: 100% 100%;
+          transform-origin: 100% 100%;
+}
+
+[type="checkbox"]:indeterminate:disabled + label:before {
+  border-right: 2px solid rgba(0, 0, 0, 0.26);
+  background-color: transparent;
+}
+
+[type="checkbox"].filled-in + label:after {
+  border-radius: 2px;
+}
+
+[type="checkbox"].filled-in + label:before,
+[type="checkbox"].filled-in + label:after {
+  content: '';
+  left: 0;
+  position: absolute;
+  /* .1s delay is for check animation */
+  transition: border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;
+  z-index: 1;
+}
+
+[type="checkbox"].filled-in:not(:checked) + label:before {
+  width: 0;
+  height: 0;
+  border: 3px solid transparent;
+  left: 6px;
+  top: 10px;
+  -webkit-transform: rotateZ(37deg);
+  transform: rotateZ(37deg);
+  -webkit-transform-origin: 20% 40%;
+  transform-origin: 100% 100%;
+}
+
+[type="checkbox"].filled-in:not(:checked) + label:after {
+  height: 20px;
+  width: 20px;
+  background-color: transparent;
+  border: 2px solid #5a5a5a;
+  top: 0px;
+  z-index: 0;
+}
+
+[type="checkbox"].filled-in:checked + label:before {
+  top: 0;
+  left: 1px;
+  width: 8px;
+  height: 13px;
+  border-top: 2px solid transparent;
+  border-left: 2px solid transparent;
+  border-right: 2px solid #fff;
+  border-bottom: 2px solid #fff;
+  -webkit-transform: rotateZ(37deg);
+  transform: rotateZ(37deg);
+  -webkit-transform-origin: 100% 100%;
+  transform-origin: 100% 100%;
+}
+
+[type="checkbox"].filled-in:checked + label:after {
+  top: 0;
+  width: 20px;
+  height: 20px;
+  border: 2px solid #26a69a;
+  background-color: #26a69a;
+  z-index: 0;
+}
+
+[type="checkbox"].filled-in.tabbed:focus + label:after {
+  border-radius: 2px;
+  border-color: #5a5a5a;
+  background-color: rgba(0, 0, 0, 0.1);
+}
+
+[type="checkbox"].filled-in.tabbed:checked:focus + label:after {
+  border-radius: 2px;
+  background-color: #26a69a;
+  border-color: #26a69a;
+}
+
+[type="checkbox"].filled-in:disabled:not(:checked) + label:before {
+  background-color: transparent;
+  border: 2px solid transparent;
+}
+
+[type="checkbox"].filled-in:disabled:not(:checked) + label:after {
+  border-color: transparent;
+  background-color: #BDBDBD;
+}
+
+[type="checkbox"].filled-in:disabled:checked + label:before {
+  background-color: transparent;
+}
+
+[type="checkbox"].filled-in:disabled:checked + label:after {
+  background-color: #BDBDBD;
+  border-color: #BDBDBD;
+}
+
+/* Switch
+   ========================================================================== */
+.switch,
+.switch * {
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -khtml-user-select: none;
+  -ms-user-select: none;
+}
+
+.switch label {
+  cursor: pointer;
+}
+
+.switch label input[type=checkbox] {
+  opacity: 0;
+  width: 0;
+  height: 0;
+}
+
+.switch label input[type=checkbox]:checked + .lever {
+  background-color: #84c7c1;
+}
+
+.switch label input[type=checkbox]:checked + .lever:after {
+  background-color: #26a69a;
+  left: 24px;
+}
+
+.switch label .lever {
+  content: "";
+  display: inline-block;
+  position: relative;
+  width: 40px;
+  height: 15px;
+  background-color: #818181;
+  border-radius: 15px;
+  margin-right: 10px;
+  transition: background 0.3s ease;
+  vertical-align: middle;
+  margin: 0 16px;
+}
+
+.switch label .lever:after {
+  content: "";
+  position: absolute;
+  display: inline-block;
+  width: 21px;
+  height: 21px;
+  background-color: #F1F1F1;
+  border-radius: 21px;
+  box-shadow: 0 1px 3px 1px rgba(0, 0, 0, 0.4);
+  left: -5px;
+  top: -3px;
+  transition: left 0.3s ease, background .3s ease, box-shadow 0.1s ease;
+}
+
+input[type=checkbox]:checked:not(:disabled) ~ .lever:active::after,
+input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::after {
+  box-shadow: 0 1px 3px 1px rgba(0, 0, 0, 0.4), 0 0 0 15px rgba(38, 166, 154, 0.1);
+}
+
+input[type=checkbox]:not(:disabled) ~ .lever:active:after,
+input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::after {
+  box-shadow: 0 1px 3px 1px rgba(0, 0, 0, 0.4), 0 0 0 15px rgba(0, 0, 0, 0.08);
+}
+
+.switch input[type=checkbox][disabled] + .lever {
+  cursor: default;
+}
+
+.switch label input[type=checkbox][disabled] + .lever:after,
+.switch label input[type=checkbox][disabled]:checked + .lever:after {
+  background-color: #BDBDBD;
+}
+
+/* Select Field
+   ========================================================================== */
+select {
+  display: none;
+}
+
+select.browser-default {
+  display: block;
+}
+
+select {
+  background-color: rgba(255, 255, 255, 0.9);
+  width: 100%;
+  padding: 5px;
+  border: 1px solid #f2f2f2;
+  border-radius: 2px;
+  height: 3rem;
+}
+
+.select-label {
+  position: absolute;
+}
+
+.select-wrapper {
+  position: relative;
+}
+
+.select-wrapper input.select-dropdown {
+  position: relative;
+  cursor: pointer;
+  background-color: transparent;
+  border: none;
+  border-bottom: 1px solid #9e9e9e;
+  outline: none;
+  height: 3rem;
+  line-height: 3rem;
+  width: 100%;
+  font-size: 1rem;
+  margin: 0 0 20px 0;
+  padding: 0;
+  display: block;
+}
+
+.select-wrapper span.caret {
+  color: initial;
+  position: absolute;
+  right: 0;
+  top: 0;
+  bottom: 0;
+  height: 10px;
+  margin: auto 0;
+  font-size: 10px;
+  line-height: 10px;
+}
+
+.select-wrapper span.caret.disabled {
+  color: rgba(0, 0, 0, 0.26);
+}
+
+.select-wrapper + label {
+  position: absolute;
+  top: -14px;
+  font-size: 0.8rem;
+}
+
+select:disabled {
+  color: rgba(0, 0, 0, 0.3);
+}
+
+.select-wrapper input.select-dropdown:disabled {
+  color: rgba(0, 0, 0, 0.3);
+  cursor: default;
+  -webkit-user-select: none;
+  /* webkit (safari, chrome) browsers */
+  -moz-user-select: none;
+  /* mozilla browsers */
+  -ms-user-select: none;
+  /* IE10+ */
+  border-bottom: 1px solid rgba(0, 0, 0, 0.3);
+}
+
+.select-wrapper i {
+  color: rgba(0, 0, 0, 0.3);
+}
+
+.select-dropdown li.disabled,
+.select-dropdown li.disabled > span,
+.select-dropdown li.optgroup {
+  color: rgba(0, 0, 0, 0.3);
+  background-color: transparent;
+}
+
+.prefix ~ .select-wrapper {
+  margin-left: 3rem;
+  width: 92%;
+  width: calc(100% - 3rem);
+}
+
+.prefix ~ label {
+  margin-left: 3rem;
+}
+
+.select-dropdown li img {
+  height: 40px;
+  width: 40px;
+  margin: 5px 15px;
+  float: right;
+}
+
+.select-dropdown li.optgroup {
+  border-top: 1px solid #eee;
+}
+
+.select-dropdown li.optgroup.selected > span {
+  color: rgba(0, 0, 0, 0.7);
+}
+
+.select-dropdown li.optgroup > span {
+  color: rgba(0, 0, 0, 0.4);
+}
+
+.select-dropdown li.optgroup ~ li.optgroup-option {
+  padding-left: 1rem;
+}
+
+/* File Input
+   ========================================================================== */
+.file-field {
+  position: relative;
+}
+
+.file-field .file-path-wrapper {
+  overflow: hidden;
+  padding-left: 10px;
+}
+
+.file-field input.file-path {
+  width: 100%;
+}
+
+.file-field .btn, .file-field .btn-large {
+  float: left;
+  height: 3rem;
+  line-height: 3rem;
+}
+
+.file-field span {
+  cursor: pointer;
+}
+
+.file-field input[type=file] {
+  position: absolute;
+  top: 0;
+  right: 0;
+  left: 0;
+  bottom: 0;
+  width: 100%;
+  margin: 0;
+  padding: 0;
+  font-size: 20px;
+  cursor: pointer;
+  opacity: 0;
+  filter: alpha(opacity=0);
+}
+
+/* Range
+   ========================================================================== */
+.range-field {
+  position: relative;
+}
+
+input[type=range],
+input[type=range] + .thumb {
+  cursor: pointer;
+}
+
+input[type=range] {
+  position: relative;
+  background-color: transparent;
+  border: none;
+  outline: none;
+  width: 100%;
+  margin: 15px 0;
+  padding: 0;
+}
+
+input[type=range]:focus {
+  outline: none;
+}
+
+input[type=range] + .thumb {
+  position: absolute;
+  border: none;
+  height: 0;
+  width: 0;
+  border-radius: 50%;
+  background-color: #26a69a;
+  top: 10px;
+  margin-left: -6px;
+  -webkit-transform-origin: 50% 50%;
+          transform-origin: 50% 50%;
+  -webkit-transform: rotate(-45deg);
+          transform: rotate(-45deg);
+}
+
+input[type=range] + .thumb .value {
+  display: block;
+  width: 30px;
+  text-align: center;
+  color: #26a69a;
+  font-size: 0;
+  -webkit-transform: rotate(45deg);
+          transform: rotate(45deg);
+}
+
+input[type=range] + .thumb.active {
+  border-radius: 50% 50% 50% 0;
+}
+
+input[type=range] + .thumb.active .value {
+  color: #fff;
+  margin-left: -1px;
+  margin-top: 8px;
+  font-size: 10px;
+}
+
+input[type=range] {
+  -webkit-appearance: none;
+}
+
+input[type=range]::-webkit-slider-runnable-track {
+  height: 3px;
+  background: #c2c0c2;
+  border: none;
+}
+
+input[type=range]::-webkit-slider-thumb {
+  -webkit-appearance: none;
+  border: none;
+  height: 14px;
+  width: 14px;
+  border-radius: 50%;
+  background-color: #26a69a;
+  -webkit-transform-origin: 50% 50%;
+          transform-origin: 50% 50%;
+  margin: -5px 0 0 0;
+  transition: .3s;
+}
+
+input[type=range]:focus::-webkit-slider-runnable-track {
+  background: #ccc;
+}
+
+input[type=range] {
+  /* fix for FF unable to apply focus style bug  */
+  border: 1px solid white;
+  /*required for proper track sizing in FF*/
+}
+
+input[type=range]::-moz-range-track {
+  height: 3px;
+  background: #ddd;
+  border: none;
+}
+
+input[type=range]::-moz-range-thumb {
+  border: none;
+  height: 14px;
+  width: 14px;
+  border-radius: 50%;
+  background: #26a69a;
+  margin-top: -5px;
+}
+
+input[type=range]:-moz-focusring {
+  outline: 1px solid #fff;
+  outline-offset: -1px;
+}
+
+input[type=range]:focus::-moz-range-track {
+  background: #ccc;
+}
+
+input[type=range]::-ms-track {
+  height: 3px;
+  background: transparent;
+  border-color: transparent;
+  border-width: 6px 0;
+  /*remove default tick marks*/
+  color: transparent;
+}
+
+input[type=range]::-ms-fill-lower {
+  background: #777;
+}
+
+input[type=range]::-ms-fill-upper {
+  background: #ddd;
+}
+
+input[type=range]::-ms-thumb {
+  border: none;
+  height: 14px;
+  width: 14px;
+  border-radius: 50%;
+  background: #26a69a;
+}
+
+input[type=range]:focus::-ms-fill-lower {
+  background: #888;
+}
+
+input[type=range]:focus::-ms-fill-upper {
+  background: #ccc;
+}
+
+/***************
+    Nav List
+***************/
+.table-of-contents.fixed {
+  position: fixed;
+}
+
+.table-of-contents li {
+  padding: 2px 0;
+}
+
+.table-of-contents a {
+  display: inline-block;
+  font-weight: 300;
+  color: #757575;
+  padding-left: 20px;
+  height: 1.5rem;
+  line-height: 1.5rem;
+  letter-spacing: .4;
+  display: inline-block;
+}
+
+.table-of-contents a:hover {
+  color: #a8a8a8;
+  padding-left: 19px;
+  border-left: 1px solid #ee6e73;
+}
+
+.table-of-contents a.active {
+  font-weight: 500;
+  padding-left: 18px;
+  border-left: 2px solid #ee6e73;
+}
+
+.side-nav {
+  position: fixed;
+  width: 300px;
+  left: 0;
+  top: 0;
+  margin: 0;
+  -webkit-transform: translateX(-100%);
+          transform: translateX(-100%);
+  height: 100%;
+  height: calc(100% + 60px);
+  height: -moz-calc(100%);
+  padding-bottom: 60px;
+  background-color: #fff;
+  z-index: 999;
+  overflow-y: auto;
+  will-change: transform;
+  -webkit-backface-visibility: hidden;
+          backface-visibility: hidden;
+  -webkit-transform: translateX(-105%);
+          transform: translateX(-105%);
+}
+
+.side-nav.right-aligned {
+  right: 0;
+  -webkit-transform: translateX(105%);
+          transform: translateX(105%);
+  left: auto;
+  -webkit-transform: translateX(100%);
+          transform: translateX(100%);
+}
+
+.side-nav .collapsible {
+  margin: 0;
+}
+
+.side-nav li {
+  float: none;
+  line-height: 48px;
+}
+
+.side-nav li.active {
+  background-color: rgba(0, 0, 0, 0.05);
+}
+
+.side-nav a {
+  color: rgba(0, 0, 0, 0.87);
+  display: block;
+  font-size: 14px;
+  font-weight: 500;
+  height: 48px;
+  line-height: 48px;
+  padding: 0 32px;
+}
+
+.side-nav a:hover {
+  background-color: rgba(0, 0, 0, 0.05);
+}
+
+.side-nav a.btn, .side-nav a.btn-large, .side-nav a.btn-large, .side-nav a.btn-flat, .side-nav a.btn-floating {
+  margin: 10px 15px;
+}
+
+.side-nav a.btn, .side-nav a.btn-large, .side-nav a.btn-large, .side-nav a.btn-floating {
+  color: #fff;
+}
+
+.side-nav a.btn-flat {
+  color: #343434;
+}
+
+.side-nav a.btn:hover, .side-nav a.btn-large:hover, .side-nav a.btn-large:hover {
+  background-color: #2bbbad;
+}
+
+.side-nav a.btn-floating:hover {
+  background-color: #26a69a;
+}
+
+.side-nav li > a > i,
+.side-nav li > a > [class^="mdi-"], .side-nav li > a > [class*="mdi-"],
+.side-nav li > a > i.material-icons {
+  float: left;
+  height: 48px;
+  line-height: 48px;
+  margin: 0 32px 0 0;
+  width: 24px;
+  color: rgba(0, 0, 0, 0.54);
+}
+
+.side-nav .divider {
+  margin: 8px 0 0 0;
+}
+
+.side-nav .subheader {
+  cursor: initial;
+  pointer-events: none;
+  color: rgba(0, 0, 0, 0.54);
+  font-size: 14px;
+  font-weight: 500;
+  line-height: 48px;
+}
+
+.side-nav .subheader:hover {
+  background-color: transparent;
+}
+
+.side-nav .userView {
+  position: relative;
+  padding: 32px 32px 0;
+  margin-bottom: 8px;
+}
+
+.side-nav .userView > a {
+  height: auto;
+  padding: 0;
+}
+
+.side-nav .userView > a:hover {
+  background-color: transparent;
+}
+
+.side-nav .userView .background {
+  overflow: hidden;
+  position: absolute;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: -1;
+}
+
+.side-nav .userView .circle, .side-nav .userView .name, .side-nav .userView .email {
+  display: block;
+}
+
+.side-nav .userView .circle {
+  height: 64px;
+  width: 64px;
+}
+
+.side-nav .userView .name,
+.side-nav .userView .email {
+  font-size: 14px;
+  line-height: 24px;
+}
+
+.side-nav .userView .name {
+  margin-top: 16px;
+  font-weight: 500;
+}
+
+.side-nav .userView .email {
+  padding-bottom: 16px;
+  font-weight: 400;
+}
+
+.drag-target {
+  height: 100%;
+  width: 10px;
+  position: fixed;
+  top: 0;
+  z-index: 998;
+}
+
+.side-nav.fixed {
+  left: 0;
+  -webkit-transform: translateX(0);
+          transform: translateX(0);
+  position: fixed;
+}
+
+.side-nav.fixed.right-aligned {
+  right: 0;
+  left: auto;
+}
+
+@media only screen and (max-width: 992px) {
+  .side-nav.fixed {
+    -webkit-transform: translateX(-105%);
+            transform: translateX(-105%);
+  }
+  .side-nav.fixed.right-aligned {
+    -webkit-transform: translateX(105%);
+            transform: translateX(105%);
+  }
+  .side-nav a {
+    padding: 0 16px;
+  }
+  .side-nav .userView {
+    padding: 16px 16px 0;
+  }
+}
+
+.side-nav .collapsible-body > ul:not(.collapsible) > li.active,
+.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active {
+  background-color: #ee6e73;
+}
+
+.side-nav .collapsible-body > ul:not(.collapsible) > li.active a,
+.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active a {
+  color: #fff;
+}
+
+#sidenav-overlay {
+  position: fixed;
+  top: 0;
+  left: 0;
+  right: 0;
+  height: 120vh;
+  background-color: rgba(0, 0, 0, 0.5);
+  z-index: 997;
+  will-change: opacity;
+}
+
+/*
+    @license
+    Copyright (c) 2014 The Polymer Project Authors. All rights reserved.
+    This code may only be used under the BSD style license found at http://polymer.github.io/LICENSE.txt
+    The complete set of authors may be found at http://polymer.github.io/AUTHORS.txt
+    The complete set of contributors may be found at http://polymer.github.io/CONTRIBUTORS.txt
+    Code distributed by Google as part of the polymer project is also
+    subject to an additional IP rights grant found at http://polymer.github.io/PATENTS.txt
+ */
+/**************************/
+/* STYLES FOR THE SPINNER */
+/**************************/
+/*
+ * Constants:
+ *      STROKEWIDTH = 3px
+ *      ARCSIZE     = 270 degrees (amount of circle the arc takes up)
+ *      ARCTIME     = 1333ms (time it takes to expand and contract arc)
+ *      ARCSTARTROT = 216 degrees (how much the start location of the arc
+ *                                should rotate each time, 216 gives us a
+ *                                5 pointed star shape (it's 360/5 * 3).
+ *                                For a 7 pointed star, we might do
+ *                                360/7 * 3 = 154.286)
+ *      CONTAINERWIDTH = 28px
+ *      SHRINK_TIME = 400ms
+ */
+.preloader-wrapper {
+  display: inline-block;
+  position: relative;
+  width: 48px;
+  height: 48px;
+}
+
+.preloader-wrapper.small {
+  width: 36px;
+  height: 36px;
+}
+
+.preloader-wrapper.big {
+  width: 64px;
+  height: 64px;
+}
+
+.preloader-wrapper.active {
+  /* duration: 360 * ARCTIME / (ARCSTARTROT + (360-ARCSIZE)) */
+  -webkit-animation: container-rotate 1568ms linear infinite;
+  animation: container-rotate 1568ms linear infinite;
+}
+
+@-webkit-keyframes container-rotate {
+  to {
+    -webkit-transform: rotate(360deg);
+  }
+}
+
+@keyframes container-rotate {
+  to {
+    -webkit-transform: rotate(360deg);
+            transform: rotate(360deg);
+  }
+}
+
+.spinner-layer {
+  position: absolute;
+  width: 100%;
+  height: 100%;
+  opacity: 0;
+  border-color: #26a69a;
+}
+
+.spinner-blue,
+.spinner-blue-only {
+  border-color: #4285f4;
+}
+
+.spinner-red,
+.spinner-red-only {
+  border-color: #db4437;
+}
+
+.spinner-yellow,
+.spinner-yellow-only {
+  border-color: #f4b400;
+}
+
+.spinner-green,
+.spinner-green-only {
+  border-color: #0f9d58;
+}
+
+/**
+ * IMPORTANT NOTE ABOUT CSS ANIMATION PROPERTIES (keanulee):
+ *
+ * iOS Safari (tested on iOS 8.1) does not handle animation-delay very well - it doesn't
+ * guarantee that the animation will start _exactly_ after that value. So we avoid using
+ * animation-delay and instead set custom keyframes for each color (as redundant as it
+ * seems).
+ *
+ * We write out each animation in full (instead of separating animation-name,
+ * animation-duration, etc.) because under the polyfill, Safari does not recognize those
+ * specific properties properly, treats them as -webkit-animation, and overrides the
+ * other animation rules. See https://github.com/Polymer/platform/issues/53.
+ */
+.active .spinner-layer.spinner-blue {
+  /* durations: 4 * ARCTIME */
+  -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer.spinner-red {
+  /* durations: 4 * ARCTIME */
+  -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer.spinner-yellow {
+  /* durations: 4 * ARCTIME */
+  -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer.spinner-green {
+  /* durations: 4 * ARCTIME */
+  -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer,
+.active .spinner-layer.spinner-blue-only,
+.active .spinner-layer.spinner-red-only,
+.active .spinner-layer.spinner-yellow-only,
+.active .spinner-layer.spinner-green-only {
+  /* durations: 4 * ARCTIME */
+  opacity: 1;
+  -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+@-webkit-keyframes fill-unfill-rotate {
+  12.5% {
+    -webkit-transform: rotate(135deg);
+  }
+  /* 0.5 * ARCSIZE */
+  25% {
+    -webkit-transform: rotate(270deg);
+  }
+  /* 1   * ARCSIZE */
+  37.5% {
+    -webkit-transform: rotate(405deg);
+  }
+  /* 1.5 * ARCSIZE */
+  50% {
+    -webkit-transform: rotate(540deg);
+  }
+  /* 2   * ARCSIZE */
+  62.5% {
+    -webkit-transform: rotate(675deg);
+  }
+  /* 2.5 * ARCSIZE */
+  75% {
+    -webkit-transform: rotate(810deg);
+  }
+  /* 3   * ARCSIZE */
+  87.5% {
+    -webkit-transform: rotate(945deg);
+  }
+  /* 3.5 * ARCSIZE */
+  to {
+    -webkit-transform: rotate(1080deg);
+  }
+  /* 4   * ARCSIZE */
+}
+
+@keyframes fill-unfill-rotate {
+  12.5% {
+    -webkit-transform: rotate(135deg);
+            transform: rotate(135deg);
+  }
+  /* 0.5 * ARCSIZE */
+  25% {
+    -webkit-transform: rotate(270deg);
+            transform: rotate(270deg);
+  }
+  /* 1   * ARCSIZE */
+  37.5% {
+    -webkit-transform: rotate(405deg);
+            transform: rotate(405deg);
+  }
+  /* 1.5 * ARCSIZE */
+  50% {
+    -webkit-transform: rotate(540deg);
+            transform: rotate(540deg);
+  }
+  /* 2   * ARCSIZE */
+  62.5% {
+    -webkit-transform: rotate(675deg);
+            transform: rotate(675deg);
+  }
+  /* 2.5 * ARCSIZE */
+  75% {
+    -webkit-transform: rotate(810deg);
+            transform: rotate(810deg);
+  }
+  /* 3   * ARCSIZE */
+  87.5% {
+    -webkit-transform: rotate(945deg);
+            transform: rotate(945deg);
+  }
+  /* 3.5 * ARCSIZE */
+  to {
+    -webkit-transform: rotate(1080deg);
+            transform: rotate(1080deg);
+  }
+  /* 4   * ARCSIZE */
+}
+
+@-webkit-keyframes blue-fade-in-out {
+  from {
+    opacity: 1;
+  }
+  25% {
+    opacity: 1;
+  }
+  26% {
+    opacity: 0;
+  }
+  89% {
+    opacity: 0;
+  }
+  90% {
+    opacity: 1;
+  }
+  100% {
+    opacity: 1;
+  }
+}
+
+@keyframes blue-fade-in-out {
+  from {
+    opacity: 1;
+  }
+  25% {
+    opacity: 1;
+  }
+  26% {
+    opacity: 0;
+  }
+  89% {
+    opacity: 0;
+  }
+  90% {
+    opacity: 1;
+  }
+  100% {
+    opacity: 1;
+  }
+}
+
+@-webkit-keyframes red-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  15% {
+    opacity: 0;
+  }
+  25% {
+    opacity: 1;
+  }
+  50% {
+    opacity: 1;
+  }
+  51% {
+    opacity: 0;
+  }
+}
+
+@keyframes red-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  15% {
+    opacity: 0;
+  }
+  25% {
+    opacity: 1;
+  }
+  50% {
+    opacity: 1;
+  }
+  51% {
+    opacity: 0;
+  }
+}
+
+@-webkit-keyframes yellow-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  40% {
+    opacity: 0;
+  }
+  50% {
+    opacity: 1;
+  }
+  75% {
+    opacity: 1;
+  }
+  76% {
+    opacity: 0;
+  }
+}
+
+@keyframes yellow-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  40% {
+    opacity: 0;
+  }
+  50% {
+    opacity: 1;
+  }
+  75% {
+    opacity: 1;
+  }
+  76% {
+    opacity: 0;
+  }
+}
+
+@-webkit-keyframes green-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  65% {
+    opacity: 0;
+  }
+  75% {
+    opacity: 1;
+  }
+  90% {
+    opacity: 1;
+  }
+  100% {
+    opacity: 0;
+  }
+}
+
+@keyframes green-fade-in-out {
+  from {
+    opacity: 0;
+  }
+  65% {
+    opacity: 0;
+  }
+  75% {
+    opacity: 1;
+  }
+  90% {
+    opacity: 1;
+  }
+  100% {
+    opacity: 0;
+  }
+}
+
+/**
+ * Patch the gap that appear between the two adjacent div.circle-clipper while the
+ * spinner is rotating (appears on Chrome 38, Safari 7.1, and IE 11).
+ */
+.gap-patch {
+  position: absolute;
+  top: 0;
+  left: 45%;
+  width: 10%;
+  height: 100%;
+  overflow: hidden;
+  border-color: inherit;
+}
+
+.gap-patch .circle {
+  width: 1000%;
+  left: -450%;
+}
+
+.circle-clipper {
+  display: inline-block;
+  position: relative;
+  width: 50%;
+  height: 100%;
+  overflow: hidden;
+  border-color: inherit;
+}
+
+.circle-clipper .circle {
+  width: 200%;
+  height: 100%;
+  border-width: 3px;
+  /* STROKEWIDTH */
+  border-style: solid;
+  border-color: inherit;
+  border-bottom-color: transparent !important;
+  border-radius: 50%;
+  -webkit-animation: none;
+  animation: none;
+  position: absolute;
+  top: 0;
+  right: 0;
+  bottom: 0;
+}
+
+.circle-clipper.left .circle {
+  left: 0;
+  border-right-color: transparent !important;
+  -webkit-transform: rotate(129deg);
+  transform: rotate(129deg);
+}
+
+.circle-clipper.right .circle {
+  left: -100%;
+  border-left-color: transparent !important;
+  -webkit-transform: rotate(-129deg);
+  transform: rotate(-129deg);
+}
+
+.active .circle-clipper.left .circle {
+  /* duration: ARCTIME */
+  -webkit-animation: left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+.active .circle-clipper.right .circle {
+  /* duration: ARCTIME */
+  -webkit-animation: right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+  animation: right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;
+}
+
+@-webkit-keyframes left-spin {
+  from {
+    -webkit-transform: rotate(130deg);
+  }
+  50% {
+    -webkit-transform: rotate(-5deg);
+  }
+  to {
+    -webkit-transform: rotate(130deg);
+  }
+}
+
+@keyframes left-spin {
+  from {
+    -webkit-transform: rotate(130deg);
+            transform: rotate(130deg);
+  }
+  50% {
+    -webkit-transform: rotate(-5deg);
+            transform: rotate(-5deg);
+  }
+  to {
+    -webkit-transform: rotate(130deg);
+            transform: rotate(130deg);
+  }
+}
+
+@-webkit-keyframes right-spin {
+  from {
+    -webkit-transform: rotate(-130deg);
+  }
+  50% {
+    -webkit-transform: rotate(5deg);
+  }
+  to {
+    -webkit-transform: rotate(-130deg);
+  }
+}
+
+@keyframes right-spin {
+  from {
+    -webkit-transform: rotate(-130deg);
+            transform: rotate(-130deg);
+  }
+  50% {
+    -webkit-transform: rotate(5deg);
+            transform: rotate(5deg);
+  }
+  to {
+    -webkit-transform: rotate(-130deg);
+            transform: rotate(-130deg);
+  }
+}
+
+#spinnerContainer.cooldown {
+  /* duration: SHRINK_TIME */
+  -webkit-animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1);
+  animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1);
+}
+
+@-webkit-keyframes fade-out {
+  from {
+    opacity: 1;
+  }
+  to {
+    opacity: 0;
+  }
+}
+
+@keyframes fade-out {
+  from {
+    opacity: 1;
+  }
+  to {
+    opacity: 0;
+  }
+}
+
+.slider {
+  position: relative;
+  height: 400px;
+  width: 100%;
+}
+
+.slider.fullscreen {
+  height: 100%;
+  width: 100%;
+  position: absolute;
+  top: 0;
+  left: 0;
+  right: 0;
+  bottom: 0;
+}
+
+.slider.fullscreen ul.slides {
+  height: 100%;
+}
+
+.slider.fullscreen ul.indicators {
+  z-index: 2;
+  bottom: 30px;
+}
+
+.slider .slides {
+  background-color: #9e9e9e;
+  margin: 0;
+  height: 400px;
+}
+
+.slider .slides li {
+  opacity: 0;
+  position: absolute;
+  top: 0;
+  left: 0;
+  z-index: 1;
+  width: 100%;
+  height: inherit;
+  overflow: hidden;
+}
+
+.slider .slides li img {
+  height: 100%;
+  width: 100%;
+  background-size: cover;
+  background-position: center;
+}
+
+.slider .slides li .caption {
+  color: #fff;
+  position: absolute;
+  top: 15%;
+  left: 15%;
+  width: 70%;
+  opacity: 0;
+}
+
+.slider .slides li .caption p {
+  color: #e0e0e0;
+}
+
+.slider .slides li.active {
+  z-index: 2;
+}
+
+.slider .indicators {
+  position: absolute;
+  text-align: center;
+  left: 0;
+  right: 0;
+  bottom: 0;
+  margin: 0;
+}
+
+.slider .indicators .indicator-item {
+  display: inline-block;
+  position: relative;
+  cursor: pointer;
+  height: 16px;
+  width: 16px;
+  margin: 0 12px;
+  background-color: #e0e0e0;
+  transition: background-color .3s;
+  border-radius: 50%;
+}
+
+.slider .indicators .indicator-item.active {
+  background-color: #4CAF50;
+}
+
+.carousel {
+  overflow: hidden;
+  position: relative;
+  width: 100%;
+  height: 400px;
+  -webkit-perspective: 500px;
+          perspective: 500px;
+  -webkit-transform-style: preserve-3d;
+          transform-style: preserve-3d;
+  -webkit-transform-origin: 0% 50%;
+          transform-origin: 0% 50%;
+}
+
+.carousel.carousel-slider {
+  top: 0;
+  left: 0;
+  height: 0;
+}
+
+.carousel.carousel-slider .carousel-fixed-item {
+  position: absolute;
+  left: 0;
+  right: 0;
+  bottom: 20px;
+  z-index: 1;
+}
+
+.carousel.carousel-slider .carousel-fixed-item.with-indicators {
+  bottom: 68px;
+}
+
+.carousel.carousel-slider .carousel-item {
+  width: 100%;
+  height: 100%;
+  min-height: 400px;
+  position: absolute;
+  top: 0;
+  left: 0;
+}
+
+.carousel.carousel-slider .carousel-item h2 {
+  font-size: 24px;
+  font-weight: 500;
+  line-height: 32px;
+}
+
+.carousel.carousel-slider .carousel-item p {
+  font-size: 15px;
+}
+
+.carousel .carousel-item {
+  display: none;
+  width: 200px;
+  height: 200px;
+  position: absolute;
+  top: 0;
+  left: 0;
+}
+
+.carousel .carousel-item img {
+  width: 100%;
+}
+
+.carousel .indicators {
+  position: absolute;
+  text-align: center;
+  left: 0;
+  right: 0;
+  bottom: 0;
+  margin: 0;
+}
+
+.carousel .indicators .indicator-item {
+  display: inline-block;
+  position: relative;
+  cursor: pointer;
+  height: 8px;
+  width: 8px;
+  margin: 24px 4px;
+  background-color: rgba(255, 255, 255, 0.5);
+  transition: background-color .3s;
+  border-radius: 50%;
+}
+
+.carousel .indicators .indicator-item.active {
+  background-color: #fff;
+}
+
+/* ==========================================================================
+   $BASE-PICKER
+   ========================================================================== */
+/**
+ * Note: the root picker element should *NOT* be styled more than what's here.
+ */
+.picker {
+  font-size: 16px;
+  text-align: left;
+  line-height: 1.2;
+  color: #000000;
+  position: absolute;
+  z-index: 10000;
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -ms-user-select: none;
+  user-select: none;
+}
+
+/**
+ * The picker input element.
+ */
+.picker__input {
+  cursor: default;
+}
+
+/**
+ * When the picker is opened, the input element is "activated".
+ */
+.picker__input.picker__input--active {
+  border-color: #0089ec;
+}
+
+/**
+ * The holder is the only "scrollable" top-level container element.
+ */
+.picker__holder {
+  width: 100%;
+  overflow-y: auto;
+  -webkit-overflow-scrolling: touch;
+}
+
+/*!
+ * Default mobile-first, responsive styling for pickadate.js
+ * Demo: http://amsul.github.io/pickadate.js
+ */
+/**
+ * Note: the root picker element should *NOT* be styled more than what's here.
+ */
+/**
+ * Make the holder and frame fullscreen.
+ */
+.picker__holder,
+.picker__frame {
+  bottom: 0;
+  left: 0;
+  right: 0;
+  top: 100%;
+}
+
+/**
+ * The holder should overlay the entire screen.
+ */
+.picker__holder {
+  position: fixed;
+  transition: background 0.15s ease-out, top 0s 0.15s;
+  -webkit-backface-visibility: hidden;
+}
+
+/**
+ * The frame that bounds the box contents of the picker.
+ */
+.picker__frame {
+  position: absolute;
+  margin: 0 auto;
+  min-width: 256px;
+  width: 300px;
+  max-height: 350px;
+  -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";
+  filter: alpha(opacity=0);
+  -moz-opacity: 0;
+  opacity: 0;
+  transition: all 0.15s ease-out;
+}
+
+@media (min-height: 28.875em) {
+  .picker__frame {
+    overflow: visible;
+    top: auto;
+    bottom: -100%;
+    max-height: 80%;
+  }
+}
+
+@media (min-height: 40.125em) {
+  .picker__frame {
+    margin-bottom: 7.5%;
+  }
+}
+
+/**
+ * The wrapper sets the stage to vertically align the box contents.
+ */
+.picker__wrap {
+  display: table;
+  width: 100%;
+  height: 100%;
+}
+
+@media (min-height: 28.875em) {
+  .picker__wrap {
+    display: block;
+  }
+}
+
+/**
+ * The box contains all the picker contents.
+ */
+.picker__box {
+  background: #ffffff;
+  display: table-cell;
+  vertical-align: middle;
+}
+
+@media (min-height: 28.875em) {
+  .picker__box {
+    display: block;
+    border: 1px solid #777777;
+    border-top-color: #898989;
+    border-bottom-width: 0;
+    border-radius: 5px 5px 0 0;
+    box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24);
+  }
+}
+
+/**
+ * When the picker opens...
+ */
+.picker--opened .picker__holder {
+  top: 0;
+  background: transparent;
+  -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorstr=#1E000000,endColorstr=#1E000000)";
+  zoom: 1;
+  background: rgba(0, 0, 0, 0.32);
+  transition: background 0.15s ease-out;
+}
+
+.picker--opened .picker__frame {
+  top: 0;
+  -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";
+  filter: alpha(opacity=100);
+  -moz-opacity: 1;
+  opacity: 1;
+}
+
+@media (min-height: 35.875em) {
+  .picker--opened .picker__frame {
+    top: 10%;
+    bottom: auto;
+  }
+}
+
+/**
+ * For `large` screens, transform into an inline picker.
+ */
+/* ==========================================================================
+   CUSTOM MATERIALIZE STYLES
+   ========================================================================== */
+.picker__input.picker__input--active {
+  border-color: #E3F2FD;
+}
+
+.picker__frame {
+  margin: 0 auto;
+  max-width: 325px;
+}
+
+@media (min-height: 38.875em) {
+  .picker--opened .picker__frame {
+    top: 10%;
+    bottom: auto;
+  }
+}
+
+/* ==========================================================================
+   $BASE-DATE-PICKER
+   ========================================================================== */
+/**
+ * The picker box.
+ */
+.picker__box {
+  padding: 0 1em;
+}
+
+/**
+ * The header containing the month and year stuff.
+ */
+.picker__header {
+  text-align: center;
+  position: relative;
+  margin-top: .75em;
+}
+
+/**
+ * The month and year labels.
+ */
+.picker__month,
+.picker__year {
+  display: inline-block;
+  margin-left: .25em;
+  margin-right: .25em;
+}
+
+/**
+ * The month and year selectors.
+ */
+.picker__select--month,
+.picker__select--year {
+  height: 2em;
+  padding: 0;
+  margin-left: .25em;
+  margin-right: .25em;
+}
+
+.picker__select--month.browser-default {
+  display: inline;
+  background-color: #FFFFFF;
+  width: 40%;
+}
+
+.picker__select--year.browser-default {
+  display: inline;
+  background-color: #FFFFFF;
+  width: 26%;
+}
+
+.picker__select--month:focus,
+.picker__select--year:focus {
+  border-color: rgba(0, 0, 0, 0.05);
+}
+
+/**
+ * The month navigation buttons.
+ */
+.picker__nav--prev,
+.picker__nav--next {
+  position: absolute;
+  padding: .5em 1.25em;
+  width: 1em;
+  height: 1em;
+  box-sizing: content-box;
+  top: -0.25em;
+}
+
+.picker__nav--prev {
+  left: -1em;
+  padding-right: 1.25em;
+}
+
+.picker__nav--next {
+  right: -1em;
+  padding-left: 1.25em;
+}
+
+.picker__nav--disabled,
+.picker__nav--disabled:hover,
+.picker__nav--disabled:before,
+.picker__nav--disabled:before:hover {
+  cursor: default;
+  background: none;
+  border-right-color: #f5f5f5;
+  border-left-color: #f5f5f5;
+}
+
+/**
+ * The calendar table of dates
+ */
+.picker__table {
+  text-align: center;
+  border-collapse: collapse;
+  border-spacing: 0;
+  table-layout: fixed;
+  font-size: 1rem;
+  width: 100%;
+  margin-top: .75em;
+  margin-bottom: .5em;
+}
+
+.picker__table th, .picker__table td {
+  text-align: center;
+}
+
+.picker__table td {
+  margin: 0;
+  padding: 0;
+}
+
+/**
+ * The weekday labels
+ */
+.picker__weekday {
+  width: 14.285714286%;
+  font-size: .75em;
+  padding-bottom: .25em;
+  color: #999999;
+  font-weight: 500;
+  /* Increase the spacing a tad */
+}
+
+@media (min-height: 33.875em) {
+  .picker__weekday {
+    padding-bottom: .5em;
+  }
+}
+
+/**
+ * The days on the calendar
+ */
+.picker__day--today {
+  position: relative;
+  color: #595959;
+  letter-spacing: -.3;
+  padding: .75rem 0;
+  font-weight: 400;
+  border: 1px solid transparent;
+}
+
+.picker__day--disabled:before {
+  border-top-color: #aaaaaa;
+}
+
+.picker__day--infocus:hover {
+  cursor: pointer;
+  color: #000;
+  font-weight: 500;
+}
+
+.picker__day--outfocus {
+  display: none;
+  padding: .75rem 0;
+  color: #fff;
+}
+
+.picker__day--outfocus:hover {
+  cursor: pointer;
+  color: #dddddd;
+  font-weight: 500;
+}
+
+.picker__day--highlighted:hover,
+.picker--focused .picker__day--highlighted {
+  cursor: pointer;
+}
+
+.picker__day--selected,
+.picker__day--selected:hover,
+.picker--focused .picker__day--selected {
+  border-radius: 50%;
+  -webkit-transform: scale(0.75);
+          transform: scale(0.75);
+  background: #0089ec;
+  color: #ffffff;
+}
+
+.picker__day--disabled,
+.picker__day--disabled:hover,
+.picker--focused .picker__day--disabled {
+  background: #f5f5f5;
+  border-color: #f5f5f5;
+  color: #dddddd;
+  cursor: default;
+}
+
+.picker__day--highlighted.picker__day--disabled,
+.picker__day--highlighted.picker__day--disabled:hover {
+  background: #bbbbbb;
+}
+
+/**
+ * The footer containing the "today", "clear", and "close" buttons.
+ */
+.picker__footer {
+  text-align: center;
+  display: -webkit-flex;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-align-items: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-justify-content: space-between;
+      -ms-flex-pack: justify;
+          justify-content: space-between;
+}
+
+.picker__button--today,
+.picker__button--clear,
+.picker__button--close {
+  border: 1px solid #ffffff;
+  background: #ffffff;
+  font-size: .8em;
+  padding: .66em 0;
+  font-weight: bold;
+  width: 33%;
+  display: inline-block;
+  vertical-align: bottom;
+}
+
+.picker__button--today:hover,
+.picker__button--clear:hover,
+.picker__button--close:hover {
+  cursor: pointer;
+  color: #000000;
+  background: #b1dcfb;
+  border-bottom-color: #b1dcfb;
+}
+
+.picker__button--today:focus,
+.picker__button--clear:focus,
+.picker__button--close:focus {
+  background: #b1dcfb;
+  border-color: rgba(0, 0, 0, 0.05);
+  outline: none;
+}
+
+.picker__button--today:before,
+.picker__button--clear:before,
+.picker__button--close:before {
+  position: relative;
+  display: inline-block;
+  height: 0;
+}
+
+.picker__button--today:before,
+.picker__button--clear:before {
+  content: " ";
+  margin-right: .45em;
+}
+
+.picker__button--today:before {
+  top: -0.05em;
+  width: 0;
+  border-top: 0.66em solid #0059bc;
+  border-left: .66em solid transparent;
+}
+
+.picker__button--clear:before {
+  top: -0.25em;
+  width: .66em;
+  border-top: 3px solid #ee2200;
+}
+
+.picker__button--close:before {
+  content: "\D7";
+  top: -0.1em;
+  vertical-align: top;
+  font-size: 1.1em;
+  margin-right: .35em;
+  color: #777777;
+}
+
+.picker__button--today[disabled],
+.picker__button--today[disabled]:hover {
+  background: #f5f5f5;
+  border-color: #f5f5f5;
+  color: #dddddd;
+  cursor: default;
+}
+
+.picker__button--today[disabled]:before {
+  border-top-color: #aaaaaa;
+}
+
+/* ==========================================================================
+   CUSTOM MATERIALIZE STYLES
+   ========================================================================== */
+.picker__box {
+  border-radius: 2px;
+  overflow: hidden;
+}
+
+.picker__date-display {
+  text-align: center;
+  background-color: #26a69a;
+  color: #fff;
+  padding-bottom: 15px;
+  font-weight: 300;
+}
+
+.picker__nav--prev:hover,
+.picker__nav--next:hover {
+  cursor: pointer;
+  color: #000000;
+  background: #a1ded8;
+}
+
+.picker__weekday-display {
+  background-color: #1f897f;
+  padding: 10px;
+  font-weight: 200;
+  letter-spacing: .5;
+  font-size: 1rem;
+  margin-bottom: 15px;
+}
+
+.picker__month-display {
+  text-transform: uppercase;
+  font-size: 2rem;
+}
+
+.picker__day-display {
+  font-size: 4.5rem;
+  font-weight: 400;
+}
+
+.picker__year-display {
+  font-size: 1.8rem;
+  color: rgba(255, 255, 255, 0.4);
+}
+
+.picker__box {
+  padding: 0;
+}
+
+.picker__calendar-container {
+  padding: 0 1rem;
+}
+
+.picker__calendar-container thead {
+  border: none;
+}
+
+.picker__table {
+  margin-top: 0;
+  margin-bottom: .5em;
+}
+
+.picker__day--infocus {
+  color: #595959;
+  letter-spacing: -.3;
+  padding: .75rem 0;
+  font-weight: 400;
+  border: 1px solid transparent;
+}
+
+.picker__day.picker__day--today {
+  color: #26a69a;
+}
+
+.picker__day.picker__day--today.picker__day--selected {
+  color: #fff;
+}
+
+.picker__weekday {
+  font-size: .9rem;
+}
+
+.picker__day--selected,
+.picker__day--selected:hover,
+.picker--focused .picker__day--selected {
+  border-radius: 50%;
+  -webkit-transform: scale(0.9);
+          transform: scale(0.9);
+  background-color: #26a69a;
+  color: #ffffff;
+}
+
+.picker__day--selected.picker__day--outfocus,
+.picker__day--selected:hover.picker__day--outfocus,
+.picker--focused .picker__day--selected.picker__day--outfocus {
+  background-color: #a1ded8;
+}
+
+.picker__footer {
+  text-align: right;
+  padding: 5px 10px;
+}
+
+.picker__close, .picker__today {
+  font-size: 1.1rem;
+  padding: 0 1rem;
+  color: #26a69a;
+}
+
+.picker__nav--prev:before,
+.picker__nav--next:before {
+  content: " ";
+  border-top: .5em solid transparent;
+  border-bottom: .5em solid transparent;
+  border-right: 0.75em solid #676767;
+  width: 0;
+  height: 0;
+  display: block;
+  margin: 0 auto;
+}
+
+.picker__nav--next:before {
+  border-right: 0;
+  border-left: 0.75em solid #676767;
+}
+
+button.picker__today:focus, button.picker__clear:focus, button.picker__close:focus {
+  background-color: #a1ded8;
+}
+
+/* ==========================================================================
+   $BASE-TIME-PICKER
+   ========================================================================== */
+/**
+ * The list of times.
+ */
+.picker__list {
+  list-style: none;
+  padding: 0.75em 0 4.2em;
+  margin: 0;
+}
+
+/**
+ * The times on the clock.
+ */
+.picker__list-item {
+  border-bottom: 1px solid #dddddd;
+  border-top: 1px solid #dddddd;
+  margin-bottom: -1px;
+  position: relative;
+  background: #ffffff;
+  padding: .75em 1.25em;
+}
+
+@media (min-height: 46.75em) {
+  .picker__list-item {
+    padding: .5em 1em;
+  }
+}
+
+/* Hovered time */
+.picker__list-item:hover {
+  cursor: pointer;
+  color: #000000;
+  background: #b1dcfb;
+  border-color: #0089ec;
+  z-index: 10;
+}
+
+/* Highlighted and hovered/focused time */
+.picker__list-item--highlighted {
+  border-color: #0089ec;
+  z-index: 10;
+}
+
+.picker__list-item--highlighted:hover,
+.picker--focused .picker__list-item--highlighted {
+  cursor: pointer;
+  color: #000000;
+  background: #b1dcfb;
+}
+
+/* Selected and hovered/focused time */
+.picker__list-item--selected,
+.picker__list-item--selected:hover,
+.picker--focused .picker__list-item--selected {
+  background: #0089ec;
+  color: #ffffff;
+  z-index: 10;
+}
+
+/* Disabled time */
+.picker__list-item--disabled,
+.picker__list-item--disabled:hover,
+.picker--focused .picker__list-item--disabled {
+  background: #f5f5f5;
+  border-color: #f5f5f5;
+  color: #dddddd;
+  cursor: default;
+  border-color: #dddddd;
+  z-index: auto;
+}
+
+/**
+ * The clear button
+ */
+.picker--time .picker__button--clear {
+  display: block;
+  width: 80%;
+  margin: 1em auto 0;
+  padding: 1em 1.25em;
+  background: none;
+  border: 0;
+  font-weight: 500;
+  font-size: .67em;
+  text-align: center;
+  text-transform: uppercase;
+  color: #666;
+}
+
+.picker--time .picker__button--clear:hover,
+.picker--time .picker__button--clear:focus {
+  color: #000000;
+  background: #b1dcfb;
+  background: #ee2200;
+  border-color: #ee2200;
+  cursor: pointer;
+  color: #ffffff;
+  outline: none;
+}
+
+.picker--time .picker__button--clear:before {
+  top: -0.25em;
+  color: #666;
+  font-size: 1.25em;
+  font-weight: bold;
+}
+
+.picker--time .picker__button--clear:hover:before,
+.picker--time .picker__button--clear:focus:before {
+  color: #ffffff;
+}
+
+/* ==========================================================================
+   $DEFAULT-TIME-PICKER
+   ========================================================================== */
+/**
+ * The frame the bounds the time picker.
+ */
+.picker--time .picker__frame {
+  min-width: 256px;
+  max-width: 320px;
+}
+
+/**
+ * The picker box.
+ */
+.picker--time .picker__box {
+  font-size: 1em;
+  background: #f2f2f2;
+  padding: 0;
+}
+
+@media (min-height: 40.125em) {
+  .picker--time .picker__box {
+    margin-bottom: 5em;
+  }
+}
diff --git a/VNF_Catalogue/public/3rd_party/materialize/css/materialize.min.css b/VNF_Catalogue/public/3rd_party/materialize/css/materialize.min.css
new file mode 100644
index 00000000..91047455
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/css/materialize.min.css
@@ -0,0 +1,16 @@
+/*!
+ * Materialize v0.98.0 (http://materializecss.com)
+ * Copyright 2014-2015 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+.materialize-red{background-color:#e51c23 !important}.materialize-red-text{color:#e51c23 !important}.materialize-red.lighten-5{background-color:#fdeaeb !important}.materialize-red-text.text-lighten-5{color:#fdeaeb !important}.materialize-red.lighten-4{background-color:#f8c1c3 !important}.materialize-red-text.text-lighten-4{color:#f8c1c3 !important}.materialize-red.lighten-3{background-color:#f3989b !important}.materialize-red-text.text-lighten-3{color:#f3989b !important}.materialize-red.lighten-2{background-color:#ee6e73 !important}.materialize-red-text.text-lighten-2{color:#ee6e73 !important}.materialize-red.lighten-1{background-color:#ea454b !important}.materialize-red-text.text-lighten-1{color:#ea454b !important}.materialize-red.darken-1{background-color:#d0181e !important}.materialize-red-text.text-darken-1{color:#d0181e !important}.materialize-red.darken-2{background-color:#b9151b !important}.materialize-red-text.text-darken-2{color:#b9151b !important}.materialize-red.darken-3{background-color:#a21318 !important}.materialize-red-text.text-darken-3{color:#a21318 !important}.materialize-red.darken-4{background-color:#8b1014 !important}.materialize-red-text.text-darken-4{color:#8b1014 !important}.red{background-color:#F44336 !important}.red-text{color:#F44336 !important}.red.lighten-5{background-color:#FFEBEE !important}.red-text.text-lighten-5{color:#FFEBEE !important}.red.lighten-4{background-color:#FFCDD2 !important}.red-text.text-lighten-4{color:#FFCDD2 !important}.red.lighten-3{background-color:#EF9A9A !important}.red-text.text-lighten-3{color:#EF9A9A !important}.red.lighten-2{background-color:#E57373 !important}.red-text.text-lighten-2{color:#E57373 !important}.red.lighten-1{background-color:#EF5350 !important}.red-text.text-lighten-1{color:#EF5350 !important}.red.darken-1{background-color:#E53935 !important}.red-text.text-darken-1{color:#E53935 !important}.red.darken-2{background-color:#D32F2F !important}.red-text.text-darken-2{color:#D32F2F !important}.red.darken-3{background-color:#C62828 !important}.red-text.text-darken-3{color:#C62828 !important}.red.darken-4{background-color:#B71C1C !important}.red-text.text-darken-4{color:#B71C1C !important}.red.accent-1{background-color:#FF8A80 !important}.red-text.text-accent-1{color:#FF8A80 !important}.red.accent-2{background-color:#FF5252 !important}.red-text.text-accent-2{color:#FF5252 !important}.red.accent-3{background-color:#FF1744 !important}.red-text.text-accent-3{color:#FF1744 !important}.red.accent-4{background-color:#D50000 !important}.red-text.text-accent-4{color:#D50000 !important}.pink{background-color:#e91e63 !important}.pink-text{color:#e91e63 !important}.pink.lighten-5{background-color:#fce4ec !important}.pink-text.text-lighten-5{color:#fce4ec !important}.pink.lighten-4{background-color:#f8bbd0 !important}.pink-text.text-lighten-4{color:#f8bbd0 !important}.pink.lighten-3{background-color:#f48fb1 !important}.pink-text.text-lighten-3{color:#f48fb1 !important}.pink.lighten-2{background-color:#f06292 !important}.pink-text.text-lighten-2{color:#f06292 !important}.pink.lighten-1{background-color:#ec407a !important}.pink-text.text-lighten-1{color:#ec407a !important}.pink.darken-1{background-color:#d81b60 !important}.pink-text.text-darken-1{color:#d81b60 !important}.pink.darken-2{background-color:#c2185b !important}.pink-text.text-darken-2{color:#c2185b !important}.pink.darken-3{background-color:#ad1457 !important}.pink-text.text-darken-3{color:#ad1457 !important}.pink.darken-4{background-color:#880e4f !important}.pink-text.text-darken-4{color:#880e4f !important}.pink.accent-1{background-color:#ff80ab !important}.pink-text.text-accent-1{color:#ff80ab !important}.pink.accent-2{background-color:#ff4081 !important}.pink-text.text-accent-2{color:#ff4081 !important}.pink.accent-3{background-color:#f50057 !important}.pink-text.text-accent-3{color:#f50057 !important}.pink.accent-4{background-color:#c51162 !important}.pink-text.text-accent-4{color:#c51162 !important}.purple{background-color:#9c27b0 !important}.purple-text{color:#9c27b0 !important}.purple.lighten-5{background-color:#f3e5f5 !important}.purple-text.text-lighten-5{color:#f3e5f5 !important}.purple.lighten-4{background-color:#e1bee7 !important}.purple-text.text-lighten-4{color:#e1bee7 !important}.purple.lighten-3{background-color:#ce93d8 !important}.purple-text.text-lighten-3{color:#ce93d8 !important}.purple.lighten-2{background-color:#ba68c8 !important}.purple-text.text-lighten-2{color:#ba68c8 !important}.purple.lighten-1{background-color:#ab47bc !important}.purple-text.text-lighten-1{color:#ab47bc !important}.purple.darken-1{background-color:#8e24aa !important}.purple-text.text-darken-1{color:#8e24aa !important}.purple.darken-2{background-color:#7b1fa2 !important}.purple-text.text-darken-2{color:#7b1fa2 !important}.purple.darken-3{background-color:#6a1b9a !important}.purple-text.text-darken-3{color:#6a1b9a !important}.purple.darken-4{background-color:#4a148c !important}.purple-text.text-darken-4{color:#4a148c !important}.purple.accent-1{background-color:#ea80fc !important}.purple-text.text-accent-1{color:#ea80fc !important}.purple.accent-2{background-color:#e040fb !important}.purple-text.text-accent-2{color:#e040fb !important}.purple.accent-3{background-color:#d500f9 !important}.purple-text.text-accent-3{color:#d500f9 !important}.purple.accent-4{background-color:#a0f !important}.purple-text.text-accent-4{color:#a0f !important}.deep-purple{background-color:#673ab7 !important}.deep-purple-text{color:#673ab7 !important}.deep-purple.lighten-5{background-color:#ede7f6 !important}.deep-purple-text.text-lighten-5{color:#ede7f6 !important}.deep-purple.lighten-4{background-color:#d1c4e9 !important}.deep-purple-text.text-lighten-4{color:#d1c4e9 !important}.deep-purple.lighten-3{background-color:#b39ddb !important}.deep-purple-text.text-lighten-3{color:#b39ddb !important}.deep-purple.lighten-2{background-color:#9575cd !important}.deep-purple-text.text-lighten-2{color:#9575cd !important}.deep-purple.lighten-1{background-color:#7e57c2 !important}.deep-purple-text.text-lighten-1{color:#7e57c2 !important}.deep-purple.darken-1{background-color:#5e35b1 !important}.deep-purple-text.text-darken-1{color:#5e35b1 !important}.deep-purple.darken-2{background-color:#512da8 !important}.deep-purple-text.text-darken-2{color:#512da8 !important}.deep-purple.darken-3{background-color:#4527a0 !important}.deep-purple-text.text-darken-3{color:#4527a0 !important}.deep-purple.darken-4{background-color:#311b92 !important}.deep-purple-text.text-darken-4{color:#311b92 !important}.deep-purple.accent-1{background-color:#b388ff !important}.deep-purple-text.text-accent-1{color:#b388ff !important}.deep-purple.accent-2{background-color:#7c4dff !important}.deep-purple-text.text-accent-2{color:#7c4dff !important}.deep-purple.accent-3{background-color:#651fff !important}.deep-purple-text.text-accent-3{color:#651fff !important}.deep-purple.accent-4{background-color:#6200ea !important}.deep-purple-text.text-accent-4{color:#6200ea !important}.indigo{background-color:#3f51b5 !important}.indigo-text{color:#3f51b5 !important}.indigo.lighten-5{background-color:#e8eaf6 !important}.indigo-text.text-lighten-5{color:#e8eaf6 !important}.indigo.lighten-4{background-color:#c5cae9 !important}.indigo-text.text-lighten-4{color:#c5cae9 !important}.indigo.lighten-3{background-color:#9fa8da !important}.indigo-text.text-lighten-3{color:#9fa8da !important}.indigo.lighten-2{background-color:#7986cb !important}.indigo-text.text-lighten-2{color:#7986cb !important}.indigo.lighten-1{background-color:#5c6bc0 !important}.indigo-text.text-lighten-1{color:#5c6bc0 !important}.indigo.darken-1{background-color:#3949ab !important}.indigo-text.text-darken-1{color:#3949ab !important}.indigo.darken-2{background-color:#303f9f !important}.indigo-text.text-darken-2{color:#303f9f !important}.indigo.darken-3{background-color:#283593 !important}.indigo-text.text-darken-3{color:#283593 !important}.indigo.darken-4{background-color:#1a237e !important}.indigo-text.text-darken-4{color:#1a237e !important}.indigo.accent-1{background-color:#8c9eff !important}.indigo-text.text-accent-1{color:#8c9eff !important}.indigo.accent-2{background-color:#536dfe !important}.indigo-text.text-accent-2{color:#536dfe !important}.indigo.accent-3{background-color:#3d5afe !important}.indigo-text.text-accent-3{color:#3d5afe !important}.indigo.accent-4{background-color:#304ffe !important}.indigo-text.text-accent-4{color:#304ffe !important}.blue{background-color:#2196F3 !important}.blue-text{color:#2196F3 !important}.blue.lighten-5{background-color:#E3F2FD !important}.blue-text.text-lighten-5{color:#E3F2FD !important}.blue.lighten-4{background-color:#BBDEFB !important}.blue-text.text-lighten-4{color:#BBDEFB !important}.blue.lighten-3{background-color:#90CAF9 !important}.blue-text.text-lighten-3{color:#90CAF9 !important}.blue.lighten-2{background-color:#64B5F6 !important}.blue-text.text-lighten-2{color:#64B5F6 !important}.blue.lighten-1{background-color:#42A5F5 !important}.blue-text.text-lighten-1{color:#42A5F5 !important}.blue.darken-1{background-color:#1E88E5 !important}.blue-text.text-darken-1{color:#1E88E5 !important}.blue.darken-2{background-color:#1976D2 !important}.blue-text.text-darken-2{color:#1976D2 !important}.blue.darken-3{background-color:#1565C0 !important}.blue-text.text-darken-3{color:#1565C0 !important}.blue.darken-4{background-color:#0D47A1 !important}.blue-text.text-darken-4{color:#0D47A1 !important}.blue.accent-1{background-color:#82B1FF !important}.blue-text.text-accent-1{color:#82B1FF !important}.blue.accent-2{background-color:#448AFF !important}.blue-text.text-accent-2{color:#448AFF !important}.blue.accent-3{background-color:#2979FF !important}.blue-text.text-accent-3{color:#2979FF !important}.blue.accent-4{background-color:#2962FF !important}.blue-text.text-accent-4{color:#2962FF !important}.light-blue{background-color:#03a9f4 !important}.light-blue-text{color:#03a9f4 !important}.light-blue.lighten-5{background-color:#e1f5fe !important}.light-blue-text.text-lighten-5{color:#e1f5fe !important}.light-blue.lighten-4{background-color:#b3e5fc !important}.light-blue-text.text-lighten-4{color:#b3e5fc !important}.light-blue.lighten-3{background-color:#81d4fa !important}.light-blue-text.text-lighten-3{color:#81d4fa !important}.light-blue.lighten-2{background-color:#4fc3f7 !important}.light-blue-text.text-lighten-2{color:#4fc3f7 !important}.light-blue.lighten-1{background-color:#29b6f6 !important}.light-blue-text.text-lighten-1{color:#29b6f6 !important}.light-blue.darken-1{background-color:#039be5 !important}.light-blue-text.text-darken-1{color:#039be5 !important}.light-blue.darken-2{background-color:#0288d1 !important}.light-blue-text.text-darken-2{color:#0288d1 !important}.light-blue.darken-3{background-color:#0277bd !important}.light-blue-text.text-darken-3{color:#0277bd !important}.light-blue.darken-4{background-color:#01579b !important}.light-blue-text.text-darken-4{color:#01579b !important}.light-blue.accent-1{background-color:#80d8ff !important}.light-blue-text.text-accent-1{color:#80d8ff !important}.light-blue.accent-2{background-color:#40c4ff !important}.light-blue-text.text-accent-2{color:#40c4ff !important}.light-blue.accent-3{background-color:#00b0ff !important}.light-blue-text.text-accent-3{color:#00b0ff !important}.light-blue.accent-4{background-color:#0091ea !important}.light-blue-text.text-accent-4{color:#0091ea !important}.cyan{background-color:#00bcd4 !important}.cyan-text{color:#00bcd4 !important}.cyan.lighten-5{background-color:#e0f7fa !important}.cyan-text.text-lighten-5{color:#e0f7fa !important}.cyan.lighten-4{background-color:#b2ebf2 !important}.cyan-text.text-lighten-4{color:#b2ebf2 !important}.cyan.lighten-3{background-color:#80deea !important}.cyan-text.text-lighten-3{color:#80deea !important}.cyan.lighten-2{background-color:#4dd0e1 !important}.cyan-text.text-lighten-2{color:#4dd0e1 !important}.cyan.lighten-1{background-color:#26c6da !important}.cyan-text.text-lighten-1{color:#26c6da !important}.cyan.darken-1{background-color:#00acc1 !important}.cyan-text.text-darken-1{color:#00acc1 !important}.cyan.darken-2{background-color:#0097a7 !important}.cyan-text.text-darken-2{color:#0097a7 !important}.cyan.darken-3{background-color:#00838f !important}.cyan-text.text-darken-3{color:#00838f !important}.cyan.darken-4{background-color:#006064 !important}.cyan-text.text-darken-4{color:#006064 !important}.cyan.accent-1{background-color:#84ffff !important}.cyan-text.text-accent-1{color:#84ffff !important}.cyan.accent-2{background-color:#18ffff !important}.cyan-text.text-accent-2{color:#18ffff !important}.cyan.accent-3{background-color:#00e5ff !important}.cyan-text.text-accent-3{color:#00e5ff !important}.cyan.accent-4{background-color:#00b8d4 !important}.cyan-text.text-accent-4{color:#00b8d4 !important}.teal{background-color:#009688 !important}.teal-text{color:#009688 !important}.teal.lighten-5{background-color:#e0f2f1 !important}.teal-text.text-lighten-5{color:#e0f2f1 !important}.teal.lighten-4{background-color:#b2dfdb !important}.teal-text.text-lighten-4{color:#b2dfdb !important}.teal.lighten-3{background-color:#80cbc4 !important}.teal-text.text-lighten-3{color:#80cbc4 !important}.teal.lighten-2{background-color:#4db6ac !important}.teal-text.text-lighten-2{color:#4db6ac !important}.teal.lighten-1{background-color:#26a69a !important}.teal-text.text-lighten-1{color:#26a69a !important}.teal.darken-1{background-color:#00897b !important}.teal-text.text-darken-1{color:#00897b !important}.teal.darken-2{background-color:#00796b !important}.teal-text.text-darken-2{color:#00796b !important}.teal.darken-3{background-color:#00695c !important}.teal-text.text-darken-3{color:#00695c !important}.teal.darken-4{background-color:#004d40 !important}.teal-text.text-darken-4{color:#004d40 !important}.teal.accent-1{background-color:#a7ffeb !important}.teal-text.text-accent-1{color:#a7ffeb !important}.teal.accent-2{background-color:#64ffda !important}.teal-text.text-accent-2{color:#64ffda !important}.teal.accent-3{background-color:#1de9b6 !important}.teal-text.text-accent-3{color:#1de9b6 !important}.teal.accent-4{background-color:#00bfa5 !important}.teal-text.text-accent-4{color:#00bfa5 !important}.green{background-color:#4CAF50 !important}.green-text{color:#4CAF50 !important}.green.lighten-5{background-color:#E8F5E9 !important}.green-text.text-lighten-5{color:#E8F5E9 !important}.green.lighten-4{background-color:#C8E6C9 !important}.green-text.text-lighten-4{color:#C8E6C9 !important}.green.lighten-3{background-color:#A5D6A7 !important}.green-text.text-lighten-3{color:#A5D6A7 !important}.green.lighten-2{background-color:#81C784 !important}.green-text.text-lighten-2{color:#81C784 !important}.green.lighten-1{background-color:#66BB6A !important}.green-text.text-lighten-1{color:#66BB6A !important}.green.darken-1{background-color:#43A047 !important}.green-text.text-darken-1{color:#43A047 !important}.green.darken-2{background-color:#388E3C !important}.green-text.text-darken-2{color:#388E3C !important}.green.darken-3{background-color:#2E7D32 !important}.green-text.text-darken-3{color:#2E7D32 !important}.green.darken-4{background-color:#1B5E20 !important}.green-text.text-darken-4{color:#1B5E20 !important}.green.accent-1{background-color:#B9F6CA !important}.green-text.text-accent-1{color:#B9F6CA !important}.green.accent-2{background-color:#69F0AE !important}.green-text.text-accent-2{color:#69F0AE !important}.green.accent-3{background-color:#00E676 !important}.green-text.text-accent-3{color:#00E676 !important}.green.accent-4{background-color:#00C853 !important}.green-text.text-accent-4{color:#00C853 !important}.light-green{background-color:#8bc34a !important}.light-green-text{color:#8bc34a !important}.light-green.lighten-5{background-color:#f1f8e9 !important}.light-green-text.text-lighten-5{color:#f1f8e9 !important}.light-green.lighten-4{background-color:#dcedc8 !important}.light-green-text.text-lighten-4{color:#dcedc8 !important}.light-green.lighten-3{background-color:#c5e1a5 !important}.light-green-text.text-lighten-3{color:#c5e1a5 !important}.light-green.lighten-2{background-color:#aed581 !important}.light-green-text.text-lighten-2{color:#aed581 !important}.light-green.lighten-1{background-color:#9ccc65 !important}.light-green-text.text-lighten-1{color:#9ccc65 !important}.light-green.darken-1{background-color:#7cb342 !important}.light-green-text.text-darken-1{color:#7cb342 !important}.light-green.darken-2{background-color:#689f38 !important}.light-green-text.text-darken-2{color:#689f38 !important}.light-green.darken-3{background-color:#558b2f !important}.light-green-text.text-darken-3{color:#558b2f !important}.light-green.darken-4{background-color:#33691e !important}.light-green-text.text-darken-4{color:#33691e !important}.light-green.accent-1{background-color:#ccff90 !important}.light-green-text.text-accent-1{color:#ccff90 !important}.light-green.accent-2{background-color:#b2ff59 !important}.light-green-text.text-accent-2{color:#b2ff59 !important}.light-green.accent-3{background-color:#76ff03 !important}.light-green-text.text-accent-3{color:#76ff03 !important}.light-green.accent-4{background-color:#64dd17 !important}.light-green-text.text-accent-4{color:#64dd17 !important}.lime{background-color:#cddc39 !important}.lime-text{color:#cddc39 !important}.lime.lighten-5{background-color:#f9fbe7 !important}.lime-text.text-lighten-5{color:#f9fbe7 !important}.lime.lighten-4{background-color:#f0f4c3 !important}.lime-text.text-lighten-4{color:#f0f4c3 !important}.lime.lighten-3{background-color:#e6ee9c !important}.lime-text.text-lighten-3{color:#e6ee9c !important}.lime.lighten-2{background-color:#dce775 !important}.lime-text.text-lighten-2{color:#dce775 !important}.lime.lighten-1{background-color:#d4e157 !important}.lime-text.text-lighten-1{color:#d4e157 !important}.lime.darken-1{background-color:#c0ca33 !important}.lime-text.text-darken-1{color:#c0ca33 !important}.lime.darken-2{background-color:#afb42b !important}.lime-text.text-darken-2{color:#afb42b !important}.lime.darken-3{background-color:#9e9d24 !important}.lime-text.text-darken-3{color:#9e9d24 !important}.lime.darken-4{background-color:#827717 !important}.lime-text.text-darken-4{color:#827717 !important}.lime.accent-1{background-color:#f4ff81 !important}.lime-text.text-accent-1{color:#f4ff81 !important}.lime.accent-2{background-color:#eeff41 !important}.lime-text.text-accent-2{color:#eeff41 !important}.lime.accent-3{background-color:#c6ff00 !important}.lime-text.text-accent-3{color:#c6ff00 !important}.lime.accent-4{background-color:#aeea00 !important}.lime-text.text-accent-4{color:#aeea00 !important}.yellow{background-color:#ffeb3b !important}.yellow-text{color:#ffeb3b !important}.yellow.lighten-5{background-color:#fffde7 !important}.yellow-text.text-lighten-5{color:#fffde7 !important}.yellow.lighten-4{background-color:#fff9c4 !important}.yellow-text.text-lighten-4{color:#fff9c4 !important}.yellow.lighten-3{background-color:#fff59d !important}.yellow-text.text-lighten-3{color:#fff59d !important}.yellow.lighten-2{background-color:#fff176 !important}.yellow-text.text-lighten-2{color:#fff176 !important}.yellow.lighten-1{background-color:#ffee58 !important}.yellow-text.text-lighten-1{color:#ffee58 !important}.yellow.darken-1{background-color:#fdd835 !important}.yellow-text.text-darken-1{color:#fdd835 !important}.yellow.darken-2{background-color:#fbc02d !important}.yellow-text.text-darken-2{color:#fbc02d !important}.yellow.darken-3{background-color:#f9a825 !important}.yellow-text.text-darken-3{color:#f9a825 !important}.yellow.darken-4{background-color:#f57f17 !important}.yellow-text.text-darken-4{color:#f57f17 !important}.yellow.accent-1{background-color:#ffff8d !important}.yellow-text.text-accent-1{color:#ffff8d !important}.yellow.accent-2{background-color:#ff0 !important}.yellow-text.text-accent-2{color:#ff0 !important}.yellow.accent-3{background-color:#ffea00 !important}.yellow-text.text-accent-3{color:#ffea00 !important}.yellow.accent-4{background-color:#ffd600 !important}.yellow-text.text-accent-4{color:#ffd600 !important}.amber{background-color:#ffc107 !important}.amber-text{color:#ffc107 !important}.amber.lighten-5{background-color:#fff8e1 !important}.amber-text.text-lighten-5{color:#fff8e1 !important}.amber.lighten-4{background-color:#ffecb3 !important}.amber-text.text-lighten-4{color:#ffecb3 !important}.amber.lighten-3{background-color:#ffe082 !important}.amber-text.text-lighten-3{color:#ffe082 !important}.amber.lighten-2{background-color:#ffd54f !important}.amber-text.text-lighten-2{color:#ffd54f !important}.amber.lighten-1{background-color:#ffca28 !important}.amber-text.text-lighten-1{color:#ffca28 !important}.amber.darken-1{background-color:#ffb300 !important}.amber-text.text-darken-1{color:#ffb300 !important}.amber.darken-2{background-color:#ffa000 !important}.amber-text.text-darken-2{color:#ffa000 !important}.amber.darken-3{background-color:#ff8f00 !important}.amber-text.text-darken-3{color:#ff8f00 !important}.amber.darken-4{background-color:#ff6f00 !important}.amber-text.text-darken-4{color:#ff6f00 !important}.amber.accent-1{background-color:#ffe57f !important}.amber-text.text-accent-1{color:#ffe57f !important}.amber.accent-2{background-color:#ffd740 !important}.amber-text.text-accent-2{color:#ffd740 !important}.amber.accent-3{background-color:#ffc400 !important}.amber-text.text-accent-3{color:#ffc400 !important}.amber.accent-4{background-color:#ffab00 !important}.amber-text.text-accent-4{color:#ffab00 !important}.orange{background-color:#ff9800 !important}.orange-text{color:#ff9800 !important}.orange.lighten-5{background-color:#fff3e0 !important}.orange-text.text-lighten-5{color:#fff3e0 !important}.orange.lighten-4{background-color:#ffe0b2 !important}.orange-text.text-lighten-4{color:#ffe0b2 !important}.orange.lighten-3{background-color:#ffcc80 !important}.orange-text.text-lighten-3{color:#ffcc80 !important}.orange.lighten-2{background-color:#ffb74d !important}.orange-text.text-lighten-2{color:#ffb74d !important}.orange.lighten-1{background-color:#ffa726 !important}.orange-text.text-lighten-1{color:#ffa726 !important}.orange.darken-1{background-color:#fb8c00 !important}.orange-text.text-darken-1{color:#fb8c00 !important}.orange.darken-2{background-color:#f57c00 !important}.orange-text.text-darken-2{color:#f57c00 !important}.orange.darken-3{background-color:#ef6c00 !important}.orange-text.text-darken-3{color:#ef6c00 !important}.orange.darken-4{background-color:#e65100 !important}.orange-text.text-darken-4{color:#e65100 !important}.orange.accent-1{background-color:#ffd180 !important}.orange-text.text-accent-1{color:#ffd180 !important}.orange.accent-2{background-color:#ffab40 !important}.orange-text.text-accent-2{color:#ffab40 !important}.orange.accent-3{background-color:#ff9100 !important}.orange-text.text-accent-3{color:#ff9100 !important}.orange.accent-4{background-color:#ff6d00 !important}.orange-text.text-accent-4{color:#ff6d00 !important}.deep-orange{background-color:#ff5722 !important}.deep-orange-text{color:#ff5722 !important}.deep-orange.lighten-5{background-color:#fbe9e7 !important}.deep-orange-text.text-lighten-5{color:#fbe9e7 !important}.deep-orange.lighten-4{background-color:#ffccbc !important}.deep-orange-text.text-lighten-4{color:#ffccbc !important}.deep-orange.lighten-3{background-color:#ffab91 !important}.deep-orange-text.text-lighten-3{color:#ffab91 !important}.deep-orange.lighten-2{background-color:#ff8a65 !important}.deep-orange-text.text-lighten-2{color:#ff8a65 !important}.deep-orange.lighten-1{background-color:#ff7043 !important}.deep-orange-text.text-lighten-1{color:#ff7043 !important}.deep-orange.darken-1{background-color:#f4511e !important}.deep-orange-text.text-darken-1{color:#f4511e !important}.deep-orange.darken-2{background-color:#e64a19 !important}.deep-orange-text.text-darken-2{color:#e64a19 !important}.deep-orange.darken-3{background-color:#d84315 !important}.deep-orange-text.text-darken-3{color:#d84315 !important}.deep-orange.darken-4{background-color:#bf360c !important}.deep-orange-text.text-darken-4{color:#bf360c !important}.deep-orange.accent-1{background-color:#ff9e80 !important}.deep-orange-text.text-accent-1{color:#ff9e80 !important}.deep-orange.accent-2{background-color:#ff6e40 !important}.deep-orange-text.text-accent-2{color:#ff6e40 !important}.deep-orange.accent-3{background-color:#ff3d00 !important}.deep-orange-text.text-accent-3{color:#ff3d00 !important}.deep-orange.accent-4{background-color:#dd2c00 !important}.deep-orange-text.text-accent-4{color:#dd2c00 !important}.brown{background-color:#795548 !important}.brown-text{color:#795548 !important}.brown.lighten-5{background-color:#efebe9 !important}.brown-text.text-lighten-5{color:#efebe9 !important}.brown.lighten-4{background-color:#d7ccc8 !important}.brown-text.text-lighten-4{color:#d7ccc8 !important}.brown.lighten-3{background-color:#bcaaa4 !important}.brown-text.text-lighten-3{color:#bcaaa4 !important}.brown.lighten-2{background-color:#a1887f !important}.brown-text.text-lighten-2{color:#a1887f !important}.brown.lighten-1{background-color:#8d6e63 !important}.brown-text.text-lighten-1{color:#8d6e63 !important}.brown.darken-1{background-color:#6d4c41 !important}.brown-text.text-darken-1{color:#6d4c41 !important}.brown.darken-2{background-color:#5d4037 !important}.brown-text.text-darken-2{color:#5d4037 !important}.brown.darken-3{background-color:#4e342e !important}.brown-text.text-darken-3{color:#4e342e !important}.brown.darken-4{background-color:#3e2723 !important}.brown-text.text-darken-4{color:#3e2723 !important}.blue-grey{background-color:#607d8b !important}.blue-grey-text{color:#607d8b !important}.blue-grey.lighten-5{background-color:#eceff1 !important}.blue-grey-text.text-lighten-5{color:#eceff1 !important}.blue-grey.lighten-4{background-color:#cfd8dc !important}.blue-grey-text.text-lighten-4{color:#cfd8dc !important}.blue-grey.lighten-3{background-color:#b0bec5 !important}.blue-grey-text.text-lighten-3{color:#b0bec5 !important}.blue-grey.lighten-2{background-color:#90a4ae !important}.blue-grey-text.text-lighten-2{color:#90a4ae !important}.blue-grey.lighten-1{background-color:#78909c !important}.blue-grey-text.text-lighten-1{color:#78909c !important}.blue-grey.darken-1{background-color:#546e7a !important}.blue-grey-text.text-darken-1{color:#546e7a !important}.blue-grey.darken-2{background-color:#455a64 !important}.blue-grey-text.text-darken-2{color:#455a64 !important}.blue-grey.darken-3{background-color:#37474f !important}.blue-grey-text.text-darken-3{color:#37474f !important}.blue-grey.darken-4{background-color:#263238 !important}.blue-grey-text.text-darken-4{color:#263238 !important}.grey{background-color:#9e9e9e !important}.grey-text{color:#9e9e9e !important}.grey.lighten-5{background-color:#fafafa !important}.grey-text.text-lighten-5{color:#fafafa !important}.grey.lighten-4{background-color:#f5f5f5 !important}.grey-text.text-lighten-4{color:#f5f5f5 !important}.grey.lighten-3{background-color:#eee !important}.grey-text.text-lighten-3{color:#eee !important}.grey.lighten-2{background-color:#e0e0e0 !important}.grey-text.text-lighten-2{color:#e0e0e0 !important}.grey.lighten-1{background-color:#bdbdbd !important}.grey-text.text-lighten-1{color:#bdbdbd !important}.grey.darken-1{background-color:#757575 !important}.grey-text.text-darken-1{color:#757575 !important}.grey.darken-2{background-color:#616161 !important}.grey-text.text-darken-2{color:#616161 !important}.grey.darken-3{background-color:#424242 !important}.grey-text.text-darken-3{color:#424242 !important}.grey.darken-4{background-color:#212121 !important}.grey-text.text-darken-4{color:#212121 !important}.black{background-color:#000 !important}.black-text{color:#000 !important}.white{background-color:#fff !important}.white-text{color:#fff !important}.transparent{background-color:transparent !important}.transparent-text{color:transparent !important}/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */html{font-family:sans-serif;-ms-text-size-adjust:100%;-webkit-text-size-adjust:100%}body{margin:0}article,aside,details,figcaption,figure,footer,header,hgroup,main,menu,nav,section,summary{display:block}audio,canvas,progress,video{display:inline-block;vertical-align:baseline}audio:not([controls]){display:none;height:0}[hidden],template{display:none}a{background-color:transparent}a:active,a:hover{outline:0}abbr[title]{border-bottom:1px dotted}b,strong{font-weight:bold}dfn{font-style:italic}h1{font-size:2em;margin:0.67em 0}mark{background:#ff0;color:#000}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sup{top:-0.5em}sub{bottom:-0.25em}img{border:0}svg:not(:root){overflow:hidden}figure{margin:1em 40px}hr{box-sizing:content-box;height:0}pre{overflow:auto}code,kbd,pre,samp{font-family:monospace, monospace;font-size:1em}button,input,optgroup,select,textarea{color:inherit;font:inherit;margin:0}button{overflow:visible}button,select{text-transform:none}button,html input[type="button"],input[type="reset"],input[type="submit"]{-webkit-appearance:button;cursor:pointer}button[disabled],html input[disabled]{cursor:default}button::-moz-focus-inner,input::-moz-focus-inner{border:0;padding:0}input{line-height:normal}input[type="checkbox"],input[type="radio"]{box-sizing:border-box;padding:0}input[type="number"]::-webkit-inner-spin-button,input[type="number"]::-webkit-outer-spin-button{height:auto}input[type="search"]{-webkit-appearance:textfield;box-sizing:content-box}input[type="search"]::-webkit-search-cancel-button,input[type="search"]::-webkit-search-decoration{-webkit-appearance:none}fieldset{border:1px solid #c0c0c0;margin:0 2px;padding:0.35em 0.625em 0.75em}legend{border:0;padding:0}textarea{overflow:auto}optgroup{font-weight:bold}table{border-collapse:collapse;border-spacing:0}td,th{padding:0}html{box-sizing:border-box}*,*:before,*:after{box-sizing:inherit}ul:not(.browser-default){padding-left:0;list-style-type:none}ul:not(.browser-default) li{list-style-type:none}a{color:#039be5;text-decoration:none;-webkit-tap-highlight-color:transparent}.valign-wrapper{display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-align-items:center;-ms-flex-align:center;align-items:center}.valign-wrapper .valign{display:block}.clearfix{clear:both}.z-depth-0{box-shadow:none !important}.z-depth-1,nav,.card-panel,.card,.toast,.btn,.btn-large,.btn-floating,.dropdown-content,.collapsible,.side-nav{box-shadow:0 2px 2px 0 rgba(0,0,0,0.14),0 1px 5px 0 rgba(0,0,0,0.12),0 3px 1px -2px rgba(0,0,0,0.2)}.z-depth-1-half,.btn:hover,.btn-large:hover,.btn-floating:hover{box-shadow:0 3px 3px 0 rgba(0,0,0,0.14),0 1px 7px 0 rgba(0,0,0,0.12),0 3px 1px -1px rgba(0,0,0,0.2)}.z-depth-2{box-shadow:0 4px 5px 0 rgba(0,0,0,0.14),0 1px 10px 0 rgba(0,0,0,0.12),0 2px 4px -1px rgba(0,0,0,0.3)}.z-depth-3{box-shadow:0 6px 10px 0 rgba(0,0,0,0.14),0 1px 18px 0 rgba(0,0,0,0.12),0 3px 5px -1px rgba(0,0,0,0.3)}.z-depth-4,.modal{box-shadow:0 8px 10px 1px rgba(0,0,0,0.14),0 3px 14px 2px rgba(0,0,0,0.12),0 5px 5px -3px rgba(0,0,0,0.3)}.z-depth-5{box-shadow:0 16px 24px 2px rgba(0,0,0,0.14),0 6px 30px 5px rgba(0,0,0,0.12),0 8px 10px -5px rgba(0,0,0,0.3)}.hoverable{transition:box-shadow .25s;box-shadow:0}.hoverable:hover{transition:box-shadow .25s;box-shadow:0 8px 17px 0 rgba(0,0,0,0.2),0 6px 20px 0 rgba(0,0,0,0.19)}.divider{height:1px;overflow:hidden;background-color:#e0e0e0}blockquote{margin:20px 0;padding-left:1.5rem;border-left:5px solid #ee6e73}i{line-height:inherit}i.left{float:left;margin-right:15px}i.right{float:right;margin-left:15px}i.tiny{font-size:1rem}i.small{font-size:2rem}i.medium{font-size:4rem}i.large{font-size:6rem}img.responsive-img,video.responsive-video{max-width:100%;height:auto}.pagination li{display:inline-block;border-radius:2px;text-align:center;vertical-align:top;height:30px}.pagination li a{color:#444;display:inline-block;font-size:1.2rem;padding:0 10px;line-height:30px}.pagination li.active a{color:#fff}.pagination li.active{background-color:#ee6e73}.pagination li.disabled a{cursor:default;color:#999}.pagination li i{font-size:2rem}.pagination li.pages ul li{display:inline-block;float:none}@media only screen and (max-width: 992px){.pagination{width:100%}.pagination li.prev,.pagination li.next{width:10%}.pagination li.pages{width:80%;overflow:hidden;white-space:nowrap}}.breadcrumb{font-size:18px;color:rgba(255,255,255,0.7)}.breadcrumb i,.breadcrumb [class^="mdi-"],.breadcrumb [class*="mdi-"],.breadcrumb i.material-icons{display:inline-block;float:left;font-size:24px}.breadcrumb:before{content:'\E5CC';color:rgba(255,255,255,0.7);vertical-align:top;display:inline-block;font-family:'Material Icons';font-weight:normal;font-style:normal;font-size:25px;margin:0 10px 0 8px;-webkit-font-smoothing:antialiased}.breadcrumb:first-child:before{display:none}.breadcrumb:last-child{color:#fff}.parallax-container{position:relative;overflow:hidden;height:500px}.parallax{position:absolute;top:0;left:0;right:0;bottom:0;z-index:-1}.parallax img{display:none;position:absolute;left:50%;bottom:0;min-width:100%;min-height:100%;-webkit-transform:translate3d(0, 0, 0);transform:translate3d(0, 0, 0);-webkit-transform:translateX(-50%);transform:translateX(-50%)}.pin-top,.pin-bottom{position:relative}.pinned{position:fixed !important}ul.staggered-list li{opacity:0}.fade-in{opacity:0;-webkit-transform-origin:0 50%;transform-origin:0 50%}@media only screen and (max-width: 600px){.hide-on-small-only,.hide-on-small-and-down{display:none !important}}@media only screen and (max-width: 992px){.hide-on-med-and-down{display:none !important}}@media only screen and (min-width: 601px){.hide-on-med-and-up{display:none !important}}@media only screen and (min-width: 600px) and (max-width: 992px){.hide-on-med-only{display:none !important}}@media only screen and (min-width: 993px){.hide-on-large-only{display:none !important}}@media only screen and (min-width: 993px){.show-on-large{display:block !important}}@media only screen and (min-width: 600px) and (max-width: 992px){.show-on-medium{display:block !important}}@media only screen and (max-width: 600px){.show-on-small{display:block !important}}@media only screen and (min-width: 601px){.show-on-medium-and-up{display:block !important}}@media only screen and (max-width: 992px){.show-on-medium-and-down{display:block !important}}@media only screen and (max-width: 600px){.center-on-small-only{text-align:center}}footer.page-footer{padding-top:20px;background-color:#ee6e73}footer.page-footer .footer-copyright{overflow:hidden;min-height:50px;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-align-items:center;-ms-flex-align:center;align-items:center;padding:10px 0px;color:rgba(255,255,255,0.8);background-color:rgba(51,51,51,0.08)}table,th,td{border:none}table{width:100%;display:table}table.bordered>thead>tr,table.bordered>tbody>tr{border-bottom:1px solid #d0d0d0}table.striped>tbody>tr:nth-child(odd){background-color:#f2f2f2}table.striped>tbody>tr>td{border-radius:0}table.highlight>tbody>tr{transition:background-color .25s ease}table.highlight>tbody>tr:hover{background-color:#f2f2f2}table.centered thead tr th,table.centered tbody tr td{text-align:center}thead{border-bottom:1px solid #d0d0d0}td,th{padding:15px 5px;display:table-cell;text-align:left;vertical-align:middle;border-radius:2px}@media only screen and (max-width: 992px){table.responsive-table{width:100%;border-collapse:collapse;border-spacing:0;display:block;position:relative}table.responsive-table td:empty:before{content:'\00a0'}table.responsive-table th,table.responsive-table td{margin:0;vertical-align:top}table.responsive-table th{text-align:left}table.responsive-table thead{display:block;float:left}table.responsive-table thead tr{display:block;padding:0 10px 0 0}table.responsive-table thead tr th::before{content:"\00a0"}table.responsive-table tbody{display:block;width:auto;position:relative;overflow-x:auto;white-space:nowrap}table.responsive-table tbody tr{display:inline-block;vertical-align:top}table.responsive-table th{display:block;text-align:right}table.responsive-table td{display:block;min-height:1.25em;text-align:left}table.responsive-table tr{padding:0 10px}table.responsive-table thead{border:0;border-right:1px solid #d0d0d0}table.responsive-table.bordered th{border-bottom:0;border-left:0}table.responsive-table.bordered td{border-left:0;border-right:0;border-bottom:0}table.responsive-table.bordered tr{border:0}table.responsive-table.bordered tbody tr{border-right:1px solid #d0d0d0}}.collection{margin:.5rem 0 1rem 0;border:1px solid #e0e0e0;border-radius:2px;overflow:hidden;position:relative}.collection .collection-item{background-color:#fff;line-height:1.5rem;padding:10px 20px;margin:0;border-bottom:1px solid #e0e0e0}.collection .collection-item.avatar{min-height:84px;padding-left:72px;position:relative}.collection .collection-item.avatar .circle{position:absolute;width:42px;height:42px;overflow:hidden;left:15px;display:inline-block;vertical-align:middle}.collection .collection-item.avatar i.circle{font-size:18px;line-height:42px;color:#fff;background-color:#999;text-align:center}.collection .collection-item.avatar .title{font-size:16px}.collection .collection-item.avatar p{margin:0}.collection .collection-item.avatar .secondary-content{position:absolute;top:16px;right:16px}.collection .collection-item:last-child{border-bottom:none}.collection .collection-item.active{background-color:#26a69a;color:#eafaf9}.collection .collection-item.active .secondary-content{color:#fff}.collection a.collection-item{display:block;transition:.25s;color:#26a69a}.collection a.collection-item:not(.active):hover{background-color:#ddd}.collection.with-header .collection-header{background-color:#fff;border-bottom:1px solid #e0e0e0;padding:10px 20px}.collection.with-header .collection-item{padding-left:30px}.collection.with-header .collection-item.avatar{padding-left:72px}.secondary-content{float:right;color:#26a69a}.collapsible .collection{margin:0;border:none}.video-container{position:relative;padding-bottom:56.25%;height:0;overflow:hidden}.video-container iframe,.video-container object,.video-container embed{position:absolute;top:0;left:0;width:100%;height:100%}.progress{position:relative;height:4px;display:block;width:100%;background-color:#acece6;border-radius:2px;margin:.5rem 0 1rem 0;overflow:hidden}.progress .determinate{position:absolute;top:0;left:0;bottom:0;background-color:#26a69a;transition:width .3s linear}.progress .indeterminate{background-color:#26a69a}.progress .indeterminate:before{content:'';position:absolute;background-color:inherit;top:0;left:0;bottom:0;will-change:left, right;-webkit-animation:indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;animation:indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite}.progress .indeterminate:after{content:'';position:absolute;background-color:inherit;top:0;left:0;bottom:0;will-change:left, right;-webkit-animation:indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;animation:indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;-webkit-animation-delay:1.15s;animation-delay:1.15s}@-webkit-keyframes indeterminate{0%{left:-35%;right:100%}60%{left:100%;right:-90%}100%{left:100%;right:-90%}}@keyframes indeterminate{0%{left:-35%;right:100%}60%{left:100%;right:-90%}100%{left:100%;right:-90%}}@-webkit-keyframes indeterminate-short{0%{left:-200%;right:100%}60%{left:107%;right:-8%}100%{left:107%;right:-8%}}@keyframes indeterminate-short{0%{left:-200%;right:100%}60%{left:107%;right:-8%}100%{left:107%;right:-8%}}.hide{display:none !important}.left-align{text-align:left}.right-align{text-align:right}.center,.center-align{text-align:center}.left{float:left !important}.right{float:right !important}.no-select,input[type=range],input[type=range]+.thumb{-webkit-touch-callout:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.circle{border-radius:50%}.center-block{display:block;margin-left:auto;margin-right:auto}.truncate{display:block;white-space:nowrap;overflow:hidden;text-overflow:ellipsis}.no-padding{padding:0 !important}span.badge{min-width:3rem;padding:0 6px;margin-left:14px;text-align:center;font-size:1rem;line-height:22px;height:22px;color:#757575;float:right;box-sizing:border-box}span.badge.new{font-weight:300;font-size:0.8rem;color:#fff;background-color:#26a69a;border-radius:2px}span.badge.new:after{content:" new"}span.badge[data-badge-caption]::after{content:" " attr(data-badge-caption)}nav ul a span.badge{display:inline-block;float:none;margin-left:4px;line-height:22px;height:22px}.collection-item span.badge{margin-top:calc(.75rem - 11px)}.collapsible span.badge{margin-top:calc(1.5rem - 11px)}.side-nav span.badge{margin-top:calc(24px - 11px)}.material-icons{text-rendering:optimizeLegibility;-webkit-font-feature-settings:'liga';-moz-font-feature-settings:'liga';font-feature-settings:'liga'}.container{margin:0 auto;max-width:1280px;width:90%}@media only screen and (min-width: 601px){.container{width:85%}}@media only screen and (min-width: 993px){.container{width:70%}}.container .row{margin-left:-.75rem;margin-right:-.75rem}.section{padding-top:1rem;padding-bottom:1rem}.section.no-pad{padding:0}.section.no-pad-bot{padding-bottom:0}.section.no-pad-top{padding-top:0}.row{margin-left:auto;margin-right:auto;margin-bottom:20px}.row:after{content:"";display:table;clear:both}.row .col{float:left;box-sizing:border-box;padding:0 .75rem;min-height:1px}.row .col[class*="push-"],.row .col[class*="pull-"]{position:relative}.row .col.s1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.s4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.s7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.s10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-s1{margin-left:8.3333333333%}.row .col.pull-s1{right:8.3333333333%}.row .col.push-s1{left:8.3333333333%}.row .col.offset-s2{margin-left:16.6666666667%}.row .col.pull-s2{right:16.6666666667%}.row .col.push-s2{left:16.6666666667%}.row .col.offset-s3{margin-left:25%}.row .col.pull-s3{right:25%}.row .col.push-s3{left:25%}.row .col.offset-s4{margin-left:33.3333333333%}.row .col.pull-s4{right:33.3333333333%}.row .col.push-s4{left:33.3333333333%}.row .col.offset-s5{margin-left:41.6666666667%}.row .col.pull-s5{right:41.6666666667%}.row .col.push-s5{left:41.6666666667%}.row .col.offset-s6{margin-left:50%}.row .col.pull-s6{right:50%}.row .col.push-s6{left:50%}.row .col.offset-s7{margin-left:58.3333333333%}.row .col.pull-s7{right:58.3333333333%}.row .col.push-s7{left:58.3333333333%}.row .col.offset-s8{margin-left:66.6666666667%}.row .col.pull-s8{right:66.6666666667%}.row .col.push-s8{left:66.6666666667%}.row .col.offset-s9{margin-left:75%}.row .col.pull-s9{right:75%}.row .col.push-s9{left:75%}.row .col.offset-s10{margin-left:83.3333333333%}.row .col.pull-s10{right:83.3333333333%}.row .col.push-s10{left:83.3333333333%}.row .col.offset-s11{margin-left:91.6666666667%}.row .col.pull-s11{right:91.6666666667%}.row .col.push-s11{left:91.6666666667%}.row .col.offset-s12{margin-left:100%}.row .col.pull-s12{right:100%}.row .col.push-s12{left:100%}@media only screen and (min-width: 601px){.row .col.m1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.m4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.m7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.m10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-m1{margin-left:8.3333333333%}.row .col.pull-m1{right:8.3333333333%}.row .col.push-m1{left:8.3333333333%}.row .col.offset-m2{margin-left:16.6666666667%}.row .col.pull-m2{right:16.6666666667%}.row .col.push-m2{left:16.6666666667%}.row .col.offset-m3{margin-left:25%}.row .col.pull-m3{right:25%}.row .col.push-m3{left:25%}.row .col.offset-m4{margin-left:33.3333333333%}.row .col.pull-m4{right:33.3333333333%}.row .col.push-m4{left:33.3333333333%}.row .col.offset-m5{margin-left:41.6666666667%}.row .col.pull-m5{right:41.6666666667%}.row .col.push-m5{left:41.6666666667%}.row .col.offset-m6{margin-left:50%}.row .col.pull-m6{right:50%}.row .col.push-m6{left:50%}.row .col.offset-m7{margin-left:58.3333333333%}.row .col.pull-m7{right:58.3333333333%}.row .col.push-m7{left:58.3333333333%}.row .col.offset-m8{margin-left:66.6666666667%}.row .col.pull-m8{right:66.6666666667%}.row .col.push-m8{left:66.6666666667%}.row .col.offset-m9{margin-left:75%}.row .col.pull-m9{right:75%}.row .col.push-m9{left:75%}.row .col.offset-m10{margin-left:83.3333333333%}.row .col.pull-m10{right:83.3333333333%}.row .col.push-m10{left:83.3333333333%}.row .col.offset-m11{margin-left:91.6666666667%}.row .col.pull-m11{right:91.6666666667%}.row .col.push-m11{left:91.6666666667%}.row .col.offset-m12{margin-left:100%}.row .col.pull-m12{right:100%}.row .col.push-m12{left:100%}}@media only screen and (min-width: 993px){.row .col.l1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.l4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.l7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.l10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-l1{margin-left:8.3333333333%}.row .col.pull-l1{right:8.3333333333%}.row .col.push-l1{left:8.3333333333%}.row .col.offset-l2{margin-left:16.6666666667%}.row .col.pull-l2{right:16.6666666667%}.row .col.push-l2{left:16.6666666667%}.row .col.offset-l3{margin-left:25%}.row .col.pull-l3{right:25%}.row .col.push-l3{left:25%}.row .col.offset-l4{margin-left:33.3333333333%}.row .col.pull-l4{right:33.3333333333%}.row .col.push-l4{left:33.3333333333%}.row .col.offset-l5{margin-left:41.6666666667%}.row .col.pull-l5{right:41.6666666667%}.row .col.push-l5{left:41.6666666667%}.row .col.offset-l6{margin-left:50%}.row .col.pull-l6{right:50%}.row .col.push-l6{left:50%}.row .col.offset-l7{margin-left:58.3333333333%}.row .col.pull-l7{right:58.3333333333%}.row .col.push-l7{left:58.3333333333%}.row .col.offset-l8{margin-left:66.6666666667%}.row .col.pull-l8{right:66.6666666667%}.row .col.push-l8{left:66.6666666667%}.row .col.offset-l9{margin-left:75%}.row .col.pull-l9{right:75%}.row .col.push-l9{left:75%}.row .col.offset-l10{margin-left:83.3333333333%}.row .col.pull-l10{right:83.3333333333%}.row .col.push-l10{left:83.3333333333%}.row .col.offset-l11{margin-left:91.6666666667%}.row .col.pull-l11{right:91.6666666667%}.row .col.push-l11{left:91.6666666667%}.row .col.offset-l12{margin-left:100%}.row .col.pull-l12{right:100%}.row .col.push-l12{left:100%}}nav{color:#fff;background-color:#ee6e73;width:100%;height:56px;line-height:56px}nav.nav-extended{height:auto}nav.nav-extended .nav-wrapper{min-height:56px;height:auto}nav.nav-extended .nav-content{position:relative;line-height:normal}nav a{color:#fff}nav i,nav [class^="mdi-"],nav [class*="mdi-"],nav i.material-icons{display:block;font-size:24px;height:56px;line-height:56px}nav .nav-wrapper{position:relative;height:100%}@media only screen and (min-width: 993px){nav a.button-collapse{display:none}}nav .button-collapse{float:left;position:relative;z-index:1;height:56px;margin:0 18px}nav .button-collapse i{height:56px;line-height:56px}nav .brand-logo{position:absolute;color:#fff;display:inline-block;font-size:2.1rem;padding:0;white-space:nowrap}nav .brand-logo.center{left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%)}@media only screen and (max-width: 992px){nav .brand-logo{left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%)}nav .brand-logo.left,nav .brand-logo.right{padding:0;-webkit-transform:none;transform:none}nav .brand-logo.left{left:0.5rem}nav .brand-logo.right{right:0.5rem;left:auto}}nav .brand-logo.right{right:0.5rem;padding:0}nav .brand-logo i,nav .brand-logo [class^="mdi-"],nav .brand-logo [class*="mdi-"],nav .brand-logo i.material-icons{float:left;margin-right:15px}nav .nav-title{display:inline-block;font-size:32px;padding:28px 0}nav ul{margin:0}nav ul li{transition:background-color .3s;float:left;padding:0}nav ul li.active{background-color:rgba(0,0,0,0.1)}nav ul a{transition:background-color .3s;font-size:1rem;color:#fff;display:block;padding:0 15px;cursor:pointer}nav ul a.btn,nav ul a.btn-large,nav ul a.btn-large,nav ul a.btn-flat,nav ul a.btn-floating{margin-top:-2px;margin-left:15px;margin-right:15px}nav ul a.btn>.material-icons,nav ul a.btn-large>.material-icons,nav ul a.btn-large>.material-icons,nav ul a.btn-flat>.material-icons,nav ul a.btn-floating>.material-icons{height:inherit;line-height:inherit}nav ul a:hover{background-color:rgba(0,0,0,0.1)}nav ul.left{float:left}nav form{height:100%}nav .input-field{margin:0;height:100%}nav .input-field input{height:100%;font-size:1.2rem;border:none;padding-left:2rem}nav .input-field input:focus,nav .input-field input[type=text]:valid,nav .input-field input[type=password]:valid,nav .input-field input[type=email]:valid,nav .input-field input[type=url]:valid,nav .input-field input[type=date]:valid{border:none;box-shadow:none}nav .input-field label{top:0;left:0}nav .input-field label i{color:rgba(255,255,255,0.7);transition:color .3s}nav .input-field label.active i{color:#fff}.navbar-fixed{position:relative;height:56px;z-index:997}.navbar-fixed nav{position:fixed}@media only screen and (min-width: 601px){nav.nav-extended .nav-wrapper{min-height:64px}nav,nav .nav-wrapper i,nav a.button-collapse,nav a.button-collapse i{height:64px;line-height:64px}.navbar-fixed{height:64px}}@font-face{font-family:"Roboto";src:local(Roboto Thin),url("../fonts/roboto/Roboto-Thin.eot");src:url("../fonts/roboto/Roboto-Thin.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Thin.woff2") format("woff2"),url("../fonts/roboto/Roboto-Thin.woff") format("woff"),url("../fonts/roboto/Roboto-Thin.ttf") format("truetype");font-weight:200}@font-face{font-family:"Roboto";src:local(Roboto Light),url("../fonts/roboto/Roboto-Light.eot");src:url("../fonts/roboto/Roboto-Light.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Light.woff2") format("woff2"),url("../fonts/roboto/Roboto-Light.woff") format("woff"),url("../fonts/roboto/Roboto-Light.ttf") format("truetype");font-weight:300}@font-face{font-family:"Roboto";src:local(Roboto Regular),url("../fonts/roboto/Roboto-Regular.eot");src:url("../fonts/roboto/Roboto-Regular.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Regular.woff2") format("woff2"),url("../fonts/roboto/Roboto-Regular.woff") format("woff"),url("../fonts/roboto/Roboto-Regular.ttf") format("truetype");font-weight:400}@font-face{font-family:"Roboto";src:url("../fonts/roboto/Roboto-Medium.eot");src:url("../fonts/roboto/Roboto-Medium.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Medium.woff2") format("woff2"),url("../fonts/roboto/Roboto-Medium.woff") format("woff"),url("../fonts/roboto/Roboto-Medium.ttf") format("truetype");font-weight:500}@font-face{font-family:"Roboto";src:url("../fonts/roboto/Roboto-Bold.eot");src:url("../fonts/roboto/Roboto-Bold.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Bold.woff2") format("woff2"),url("../fonts/roboto/Roboto-Bold.woff") format("woff"),url("../fonts/roboto/Roboto-Bold.ttf") format("truetype");font-weight:700}a{text-decoration:none}html{line-height:1.5;font-family:"Roboto", sans-serif;font-weight:normal;color:rgba(0,0,0,0.87)}@media only screen and (min-width: 0){html{font-size:14px}}@media only screen and (min-width: 992px){html{font-size:14.5px}}@media only screen and (min-width: 1200px){html{font-size:15px}}h1,h2,h3,h4,h5,h6{font-weight:400;line-height:1.1}h1 a,h2 a,h3 a,h4 a,h5 a,h6 a{font-weight:inherit}h1{font-size:4.2rem;line-height:110%;margin:2.1rem 0 1.68rem 0}h2{font-size:3.56rem;line-height:110%;margin:1.78rem 0 1.424rem 0}h3{font-size:2.92rem;line-height:110%;margin:1.46rem 0 1.168rem 0}h4{font-size:2.28rem;line-height:110%;margin:1.14rem 0 .912rem 0}h5{font-size:1.64rem;line-height:110%;margin:.82rem 0 .656rem 0}h6{font-size:1rem;line-height:110%;margin:.5rem 0 .4rem 0}em{font-style:italic}strong{font-weight:500}small{font-size:75%}.light,footer.page-footer .footer-copyright{font-weight:300}.thin{font-weight:200}.flow-text{font-weight:300}@media only screen and (min-width: 360px){.flow-text{font-size:1.2rem}}@media only screen and (min-width: 390px){.flow-text{font-size:1.224rem}}@media only screen and (min-width: 420px){.flow-text{font-size:1.248rem}}@media only screen and (min-width: 450px){.flow-text{font-size:1.272rem}}@media only screen and (min-width: 480px){.flow-text{font-size:1.296rem}}@media only screen and (min-width: 510px){.flow-text{font-size:1.32rem}}@media only screen and (min-width: 540px){.flow-text{font-size:1.344rem}}@media only screen and (min-width: 570px){.flow-text{font-size:1.368rem}}@media only screen and (min-width: 600px){.flow-text{font-size:1.392rem}}@media only screen and (min-width: 630px){.flow-text{font-size:1.416rem}}@media only screen and (min-width: 660px){.flow-text{font-size:1.44rem}}@media only screen and (min-width: 690px){.flow-text{font-size:1.464rem}}@media only screen and (min-width: 720px){.flow-text{font-size:1.488rem}}@media only screen and (min-width: 750px){.flow-text{font-size:1.512rem}}@media only screen and (min-width: 780px){.flow-text{font-size:1.536rem}}@media only screen and (min-width: 810px){.flow-text{font-size:1.56rem}}@media only screen and (min-width: 840px){.flow-text{font-size:1.584rem}}@media only screen and (min-width: 870px){.flow-text{font-size:1.608rem}}@media only screen and (min-width: 900px){.flow-text{font-size:1.632rem}}@media only screen and (min-width: 930px){.flow-text{font-size:1.656rem}}@media only screen and (min-width: 960px){.flow-text{font-size:1.68rem}}@media only screen and (max-width: 360px){.flow-text{font-size:1.2rem}}.scale-transition{transition:-webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;transition:transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;transition:transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63), -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important}.scale-transition.scale-out{-webkit-transform:scale(0);transform:scale(0);transition:-webkit-transform .2s !important;transition:transform .2s !important;transition:transform .2s, -webkit-transform .2s !important}.scale-transition.scale-in{-webkit-transform:scale(1);transform:scale(1)}.card-panel{transition:box-shadow .25s;padding:24px;margin:.5rem 0 1rem 0;border-radius:2px;background-color:#fff}.card{position:relative;margin:.5rem 0 1rem 0;background-color:#fff;transition:box-shadow .25s;border-radius:2px}.card .card-title{font-size:24px;font-weight:300}.card .card-title.activator{cursor:pointer}.card.small,.card.medium,.card.large{position:relative}.card.small .card-image,.card.medium .card-image,.card.large .card-image{max-height:60%;overflow:hidden}.card.small .card-image+.card-content,.card.medium .card-image+.card-content,.card.large .card-image+.card-content{max-height:40%}.card.small .card-content,.card.medium .card-content,.card.large .card-content{max-height:100%;overflow:hidden}.card.small .card-action,.card.medium .card-action,.card.large .card-action{position:absolute;bottom:0;left:0;right:0}.card.small{height:300px}.card.medium{height:400px}.card.large{height:500px}.card.horizontal{display:-webkit-flex;display:-ms-flexbox;display:flex}.card.horizontal.small .card-image,.card.horizontal.medium .card-image,.card.horizontal.large .card-image{height:100%;max-height:none;overflow:visible}.card.horizontal.small .card-image img,.card.horizontal.medium .card-image img,.card.horizontal.large .card-image img{height:100%}.card.horizontal .card-image{max-width:50%}.card.horizontal .card-image img{border-radius:2px 0 0 2px;max-width:100%;width:auto}.card.horizontal .card-stacked{display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-flex:1;-ms-flex:1;flex:1;position:relative}.card.horizontal .card-stacked .card-content{-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.card.sticky-action .card-action{z-index:2}.card.sticky-action .card-reveal{z-index:1;padding-bottom:64px}.card .card-image{position:relative}.card .card-image img{display:block;border-radius:2px 2px 0 0;position:relative;left:0;right:0;top:0;bottom:0;width:100%}.card .card-image .card-title{color:#fff;position:absolute;bottom:0;left:0;max-width:100%;padding:24px}.card .card-content{padding:24px;border-radius:0 0 2px 2px}.card .card-content p{margin:0;color:inherit}.card .card-content .card-title{display:block;line-height:32px;margin-bottom:8px}.card .card-content .card-title i{line-height:32px}.card .card-action{position:relative;background-color:inherit;border-top:1px solid rgba(160,160,160,0.2);padding:16px 24px}.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating){color:#ffab40;margin-right:24px;transition:color .3s ease;text-transform:uppercase}.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating):hover{color:#ffd8a6}.card .card-reveal{padding:24px;position:absolute;background-color:#fff;width:100%;overflow-y:auto;left:0;top:100%;height:100%;z-index:3;display:none}.card .card-reveal .card-title{cursor:pointer;display:block}#toast-container{display:block;position:fixed;z-index:10000}@media only screen and (max-width: 600px){#toast-container{min-width:100%;bottom:0%}}@media only screen and (min-width: 601px) and (max-width: 992px){#toast-container{left:5%;bottom:7%;max-width:90%}}@media only screen and (min-width: 993px){#toast-container{top:10%;right:7%;max-width:86%}}.toast{border-radius:2px;top:35px;width:auto;clear:both;margin-top:10px;position:relative;max-width:100%;height:auto;min-height:48px;line-height:1.5em;word-break:break-all;background-color:#323232;padding:10px 25px;font-size:1.1rem;font-weight:300;color:#fff;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between}.toast .btn,.toast .btn-large,.toast .btn-flat{margin:0;margin-left:3rem}.toast.rounded{border-radius:24px}@media only screen and (max-width: 600px){.toast{width:100%;border-radius:0}}@media only screen and (min-width: 601px) and (max-width: 992px){.toast{float:left}}@media only screen and (min-width: 993px){.toast{float:right}}.tabs{position:relative;overflow-x:auto;overflow-y:hidden;height:48px;width:100%;background-color:#fff;margin:0 auto;white-space:nowrap}.tabs.tabs-transparent{background-color:transparent}.tabs.tabs-transparent .tab a,.tabs.tabs-transparent .tab.disabled a,.tabs.tabs-transparent .tab.disabled a:hover{color:rgba(255,255,255,0.7)}.tabs.tabs-transparent .tab a:hover,.tabs.tabs-transparent .tab a.active{color:#fff}.tabs.tabs-transparent .indicator{background-color:#fff}.tabs.tabs-fixed-width{display:-webkit-flex;display:-ms-flexbox;display:flex}.tabs.tabs-fixed-width .tab{-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.tabs .tab{display:inline-block;text-align:center;line-height:48px;height:48px;padding:0;margin:0;text-transform:uppercase}.tabs .tab a{color:rgba(238,110,115,0.7);display:block;width:100%;height:100%;padding:0 24px;font-size:14px;text-overflow:ellipsis;overflow:hidden;transition:color .28s ease}.tabs .tab a:hover,.tabs .tab a.active{background-color:transparent;color:#ee6e73}.tabs .tab.disabled a,.tabs .tab.disabled a:hover{color:rgba(238,110,115,0.7);cursor:default}.tabs .indicator{position:absolute;bottom:0;height:2px;background-color:#f6b2b5;will-change:left, right}@media only screen and (max-width: 992px){.tabs{display:-webkit-flex;display:-ms-flexbox;display:flex}.tabs .tab{-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.tabs .tab a{padding:0 12px}}.material-tooltip{padding:10px 8px;font-size:1rem;z-index:2000;background-color:transparent;border-radius:2px;color:#fff;min-height:36px;line-height:120%;opacity:0;position:absolute;text-align:center;max-width:calc(100% - 4px);overflow:hidden;left:0;top:0;pointer-events:none;visibility:hidden}.backdrop{position:absolute;opacity:0;height:7px;width:14px;border-radius:0 0 50% 50%;background-color:#323232;z-index:-1;-webkit-transform-origin:50% 0%;transform-origin:50% 0%;visibility:hidden}.btn,.btn-large,.btn-flat{border:none;border-radius:2px;display:inline-block;height:36px;line-height:36px;padding:0 2rem;text-transform:uppercase;vertical-align:middle;-webkit-tap-highlight-color:transparent}.btn.disabled,.disabled.btn-large,.btn-floating.disabled,.btn-large.disabled,.btn-flat.disabled,.btn:disabled,.btn-large:disabled,.btn-floating:disabled,.btn-large:disabled,.btn-flat:disabled,.btn[disabled],[disabled].btn-large,.btn-floating[disabled],.btn-large[disabled],.btn-flat[disabled]{pointer-events:none;background-color:#DFDFDF !important;box-shadow:none;color:#9F9F9F !important;cursor:default}.btn.disabled:hover,.disabled.btn-large:hover,.btn-floating.disabled:hover,.btn-large.disabled:hover,.btn-flat.disabled:hover,.btn:disabled:hover,.btn-large:disabled:hover,.btn-floating:disabled:hover,.btn-large:disabled:hover,.btn-flat:disabled:hover,.btn[disabled]:hover,[disabled].btn-large:hover,.btn-floating[disabled]:hover,.btn-large[disabled]:hover,.btn-flat[disabled]:hover{background-color:#DFDFDF !important;color:#9F9F9F !important}.btn,.btn-large,.btn-floating,.btn-large,.btn-flat{outline:0}.btn i,.btn-large i,.btn-floating i,.btn-large i,.btn-flat i{font-size:1.3rem;line-height:inherit}.btn:focus,.btn-large:focus,.btn-floating:focus{background-color:#1d7d74}.btn,.btn-large{text-decoration:none;color:#fff;background-color:#26a69a;text-align:center;letter-spacing:.5px;transition:.2s ease-out;cursor:pointer}.btn:hover,.btn-large:hover{background-color:#2bbbad}.btn-floating{display:inline-block;color:#fff;position:relative;overflow:hidden;z-index:1;width:40px;height:40px;line-height:40px;padding:0;background-color:#26a69a;border-radius:50%;transition:.3s;cursor:pointer;vertical-align:middle}.btn-floating:hover{background-color:#26a69a}.btn-floating:before{border-radius:0}.btn-floating.btn-large{width:56px;height:56px}.btn-floating.btn-large i{line-height:56px}.btn-floating.halfway-fab{position:absolute;right:24px;bottom:0;-webkit-transform:translateY(50%);transform:translateY(50%)}.btn-floating.halfway-fab.left{right:auto;left:24px}.btn-floating i{width:inherit;display:inline-block;text-align:center;color:#fff;font-size:1.6rem;line-height:40px}button.btn-floating{border:none}.fixed-action-btn{position:fixed;right:23px;bottom:23px;padding-top:15px;margin-bottom:0;z-index:998}.fixed-action-btn.active ul{visibility:visible}.fixed-action-btn.horizontal{padding:0 0 0 15px}.fixed-action-btn.horizontal ul{text-align:right;right:64px;top:50%;-webkit-transform:translateY(-50%);transform:translateY(-50%);height:100%;left:auto;width:500px}.fixed-action-btn.horizontal ul li{display:inline-block;margin:15px 15px 0 0}.fixed-action-btn.toolbar{padding:0;height:56px}.fixed-action-btn.toolbar.active>a i{opacity:0}.fixed-action-btn.toolbar ul{display:-webkit-flex;display:-ms-flexbox;display:flex;top:0;bottom:0}.fixed-action-btn.toolbar ul li{-webkit-flex:1;-ms-flex:1;flex:1;display:inline-block;margin:0;height:100%;transition:none}.fixed-action-btn.toolbar ul li a{display:block;overflow:hidden;position:relative;width:100%;height:100%;background-color:transparent;box-shadow:none;color:#fff;line-height:56px;z-index:1}.fixed-action-btn.toolbar ul li a i{line-height:inherit}.fixed-action-btn ul{left:0;right:0;text-align:center;position:absolute;bottom:64px;margin:0;visibility:hidden}.fixed-action-btn ul li{margin-bottom:15px}.fixed-action-btn ul a.btn-floating{opacity:0}.fixed-action-btn .fab-backdrop{position:absolute;top:0;left:0;z-index:-1;width:40px;height:40px;background-color:#26a69a;border-radius:50%;-webkit-transform:scale(0);transform:scale(0)}.btn-flat{box-shadow:none;background-color:transparent;color:#343434;cursor:pointer;transition:background-color .2s}.btn-flat:focus,.btn-flat:active{background-color:transparent}.btn-flat:focus,.btn-flat:hover{background-color:rgba(0,0,0,0.1);box-shadow:none}.btn-flat:active{background-color:rgba(0,0,0,0.2)}.btn-flat.disabled{background-color:transparent !important;color:#b3b3b3 !important;cursor:default}.btn-large{height:54px;line-height:54px}.btn-large i{font-size:1.6rem}.btn-block{display:block}.dropdown-content{background-color:#fff;margin:0;display:none;min-width:100px;max-height:650px;overflow-y:auto;opacity:0;position:absolute;z-index:999;will-change:width, height}.dropdown-content li{clear:both;color:rgba(0,0,0,0.87);cursor:pointer;min-height:50px;line-height:1.5rem;width:100%;text-align:left;text-transform:none}.dropdown-content li:hover,.dropdown-content li.active,.dropdown-content li.selected{background-color:#eee}.dropdown-content li.active.selected{background-color:#e1e1e1}.dropdown-content li.divider{min-height:0;height:1px}.dropdown-content li>a,.dropdown-content li>span{font-size:16px;color:#26a69a;display:block;line-height:22px;padding:14px 16px}.dropdown-content li>span>label{top:1px;left:0;height:18px}.dropdown-content li>a>i{height:inherit;line-height:inherit}.input-field.col .dropdown-content [type="checkbox"]+label{top:1px;left:0;height:18px}/*!
+ * Waves v0.6.0
+ * http://fian.my.id/Waves
+ *
+ * Copyright 2014 Alfiana E. Sibuea and other contributors
+ * Released under the MIT license
+ * https://github.com/fians/Waves/blob/master/LICENSE
+ */.waves-effect{position:relative;cursor:pointer;display:inline-block;overflow:hidden;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;-webkit-tap-highlight-color:transparent;vertical-align:middle;z-index:1;transition:.3s ease-out}.waves-effect .waves-ripple{position:absolute;border-radius:50%;width:20px;height:20px;margin-top:-10px;margin-left:-10px;opacity:0;background:rgba(0,0,0,0.2);transition:all 0.7s ease-out;transition-property:opacity, -webkit-transform;transition-property:transform, opacity;transition-property:transform, opacity, -webkit-transform;-webkit-transform:scale(0);transform:scale(0);pointer-events:none}.waves-effect.waves-light .waves-ripple{background-color:rgba(255,255,255,0.45)}.waves-effect.waves-red .waves-ripple{background-color:rgba(244,67,54,0.7)}.waves-effect.waves-yellow .waves-ripple{background-color:rgba(255,235,59,0.7)}.waves-effect.waves-orange .waves-ripple{background-color:rgba(255,152,0,0.7)}.waves-effect.waves-purple .waves-ripple{background-color:rgba(156,39,176,0.7)}.waves-effect.waves-green .waves-ripple{background-color:rgba(76,175,80,0.7)}.waves-effect.waves-teal .waves-ripple{background-color:rgba(0,150,136,0.7)}.waves-effect input[type="button"],.waves-effect input[type="reset"],.waves-effect input[type="submit"]{border:0;font-style:normal;font-size:inherit;text-transform:inherit;background:none}.waves-effect img{position:relative;z-index:-1}.waves-notransition{transition:none !important}.waves-circle{-webkit-transform:translateZ(0);transform:translateZ(0);-webkit-mask-image:-webkit-radial-gradient(circle, #fff 100%, #000 100%)}.waves-input-wrapper{border-radius:0.2em;vertical-align:bottom}.waves-input-wrapper .waves-button-input{position:relative;top:0;left:0;z-index:1}.waves-circle{text-align:center;width:2.5em;height:2.5em;line-height:2.5em;border-radius:50%;-webkit-mask-image:none}.waves-block{display:block}.waves-effect .waves-ripple{z-index:-1}.modal{display:none;position:fixed;left:0;right:0;background-color:#fafafa;padding:0;max-height:70%;width:55%;margin:auto;overflow-y:auto;border-radius:2px;will-change:top, opacity}@media only screen and (max-width: 992px){.modal{width:80%}}.modal h1,.modal h2,.modal h3,.modal h4{margin-top:0}.modal .modal-content{padding:24px}.modal .modal-close{cursor:pointer}.modal .modal-footer{border-radius:0 0 2px 2px;background-color:#fafafa;padding:4px 6px;height:56px;width:100%}.modal .modal-footer .btn,.modal .modal-footer .btn-large,.modal .modal-footer .btn-flat{float:right;margin:6px 0}.modal-overlay{position:fixed;z-index:999;top:-100px;left:0;bottom:0;right:0;height:125%;width:100%;background:#000;display:none;will-change:opacity}.modal.modal-fixed-footer{padding:0;height:70%}.modal.modal-fixed-footer .modal-content{position:absolute;height:calc(100% - 56px);max-height:100%;width:100%;overflow-y:auto}.modal.modal-fixed-footer .modal-footer{border-top:1px solid rgba(0,0,0,0.1);position:absolute;bottom:0}.modal.bottom-sheet{top:auto;bottom:-100%;margin:0;width:100%;max-height:45%;border-radius:0;will-change:bottom, opacity}.collapsible{border-top:1px solid #ddd;border-right:1px solid #ddd;border-left:1px solid #ddd;margin:.5rem 0 1rem 0}.collapsible-header{display:block;cursor:pointer;min-height:3rem;line-height:3rem;padding:0 1rem;background-color:#fff;border-bottom:1px solid #ddd}.collapsible-header i{width:2rem;font-size:1.6rem;line-height:3rem;display:block;float:left;text-align:center;margin-right:1rem}.collapsible-body{display:none;border-bottom:1px solid #ddd;box-sizing:border-box;padding:2rem}.side-nav .collapsible,.side-nav.fixed .collapsible{border:none;box-shadow:none}.side-nav .collapsible li,.side-nav.fixed .collapsible li{padding:0}.side-nav .collapsible-header,.side-nav.fixed .collapsible-header{background-color:transparent;border:none;line-height:inherit;height:inherit;padding:0 16px}.side-nav .collapsible-header:hover,.side-nav.fixed .collapsible-header:hover{background-color:rgba(0,0,0,0.05)}.side-nav .collapsible-header i,.side-nav.fixed .collapsible-header i{line-height:inherit}.side-nav .collapsible-body,.side-nav.fixed .collapsible-body{border:0;background-color:#fff}.side-nav .collapsible-body li a,.side-nav.fixed .collapsible-body li a{padding:0 23.5px 0 31px}.collapsible.popout{border:none;box-shadow:none}.collapsible.popout>li{box-shadow:0 2px 5px 0 rgba(0,0,0,0.16),0 2px 10px 0 rgba(0,0,0,0.12);margin:0 24px;transition:margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94)}.collapsible.popout>li.active{box-shadow:0 5px 11px 0 rgba(0,0,0,0.18),0 4px 15px 0 rgba(0,0,0,0.15);margin:16px 0}.chip{display:inline-block;height:32px;font-size:13px;font-weight:500;color:rgba(0,0,0,0.6);line-height:32px;padding:0 12px;border-radius:16px;background-color:#e4e4e4;margin-bottom:5px;margin-right:5px}.chip img{float:left;margin:0 8px 0 -12px;height:32px;width:32px;border-radius:50%}.chip .close{cursor:pointer;float:right;font-size:16px;line-height:32px;padding-left:8px}.chips{border:none;border-bottom:1px solid #9e9e9e;box-shadow:none;margin:0 0 20px 0;min-height:45px;outline:none;transition:all .3s}.chips.focus{border-bottom:1px solid #26a69a;box-shadow:0 1px 0 0 #26a69a}.chips:hover{cursor:text}.chips .chip.selected{background-color:#26a69a;color:#fff}.chips .input{background:none;border:0;color:rgba(0,0,0,0.6);display:inline-block;font-size:1rem;height:3rem;line-height:32px;outline:0;margin:0;padding:0 !important;width:120px !important}.chips .input:focus{border:0 !important;box-shadow:none !important}.prefix ~ .chips{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.chips:empty ~ label{font-size:0.8rem;-webkit-transform:translateY(-140%);transform:translateY(-140%)}.materialboxed{display:block;cursor:-webkit-zoom-in;cursor:zoom-in;position:relative;transition:opacity .4s;-webkit-backface-visibility:hidden}.materialboxed:hover:not(.active){opacity:.8}.materialboxed.active{cursor:-webkit-zoom-out;cursor:zoom-out}#materialbox-overlay{position:fixed;top:0;right:0;bottom:0;left:0;background-color:#292929;z-index:1000;will-change:opacity}.materialbox-caption{position:fixed;display:none;color:#fff;line-height:50px;bottom:0;left:0;width:100%;text-align:center;padding:0% 15%;height:50px;z-index:1000;-webkit-font-smoothing:antialiased}select:focus{outline:1px solid #c9f3ef}button:focus{outline:none;background-color:#2ab7a9}label{font-size:.8rem;color:#9e9e9e}::-webkit-input-placeholder{color:#d1d1d1}:-moz-placeholder{color:#d1d1d1}::-moz-placeholder{color:#d1d1d1}:-ms-input-placeholder{color:#d1d1d1}input:not([type]),input[type=text],input[type=password],input[type=email],input[type=url],input[type=time],input[type=date],input[type=datetime],input[type=datetime-local],input[type=tel],input[type=number],input[type=search],textarea.materialize-textarea{background-color:transparent;border:none;border-bottom:1px solid #9e9e9e;border-radius:0;outline:none;height:3rem;width:100%;font-size:1rem;margin:0 0 20px 0;padding:0;box-shadow:none;box-sizing:content-box;transition:all 0.3s}input:not([type]):disabled,input:not([type])[readonly="readonly"],input[type=text]:disabled,input[type=text][readonly="readonly"],input[type=password]:disabled,input[type=password][readonly="readonly"],input[type=email]:disabled,input[type=email][readonly="readonly"],input[type=url]:disabled,input[type=url][readonly="readonly"],input[type=time]:disabled,input[type=time][readonly="readonly"],input[type=date]:disabled,input[type=date][readonly="readonly"],input[type=datetime]:disabled,input[type=datetime][readonly="readonly"],input[type=datetime-local]:disabled,input[type=datetime-local][readonly="readonly"],input[type=tel]:disabled,input[type=tel][readonly="readonly"],input[type=number]:disabled,input[type=number][readonly="readonly"],input[type=search]:disabled,input[type=search][readonly="readonly"],textarea.materialize-textarea:disabled,textarea.materialize-textarea[readonly="readonly"]{color:rgba(0,0,0,0.26);border-bottom:1px dotted rgba(0,0,0,0.26)}input:not([type]):disabled+label,input:not([type])[readonly="readonly"]+label,input[type=text]:disabled+label,input[type=text][readonly="readonly"]+label,input[type=password]:disabled+label,input[type=password][readonly="readonly"]+label,input[type=email]:disabled+label,input[type=email][readonly="readonly"]+label,input[type=url]:disabled+label,input[type=url][readonly="readonly"]+label,input[type=time]:disabled+label,input[type=time][readonly="readonly"]+label,input[type=date]:disabled+label,input[type=date][readonly="readonly"]+label,input[type=datetime]:disabled+label,input[type=datetime][readonly="readonly"]+label,input[type=datetime-local]:disabled+label,input[type=datetime-local][readonly="readonly"]+label,input[type=tel]:disabled+label,input[type=tel][readonly="readonly"]+label,input[type=number]:disabled+label,input[type=number][readonly="readonly"]+label,input[type=search]:disabled+label,input[type=search][readonly="readonly"]+label,textarea.materialize-textarea:disabled+label,textarea.materialize-textarea[readonly="readonly"]+label{color:rgba(0,0,0,0.26)}input:not([type]):focus:not([readonly]),input[type=text]:focus:not([readonly]),input[type=password]:focus:not([readonly]),input[type=email]:focus:not([readonly]),input[type=url]:focus:not([readonly]),input[type=time]:focus:not([readonly]),input[type=date]:focus:not([readonly]),input[type=datetime]:focus:not([readonly]),input[type=datetime-local]:focus:not([readonly]),input[type=tel]:focus:not([readonly]),input[type=number]:focus:not([readonly]),input[type=search]:focus:not([readonly]),textarea.materialize-textarea:focus:not([readonly]){border-bottom:1px solid #26a69a;box-shadow:0 1px 0 0 #26a69a}input:not([type]):focus:not([readonly])+label,input[type=text]:focus:not([readonly])+label,input[type=password]:focus:not([readonly])+label,input[type=email]:focus:not([readonly])+label,input[type=url]:focus:not([readonly])+label,input[type=time]:focus:not([readonly])+label,input[type=date]:focus:not([readonly])+label,input[type=datetime]:focus:not([readonly])+label,input[type=datetime-local]:focus:not([readonly])+label,input[type=tel]:focus:not([readonly])+label,input[type=number]:focus:not([readonly])+label,input[type=search]:focus:not([readonly])+label,textarea.materialize-textarea:focus:not([readonly])+label{color:#26a69a}input:not([type]).valid,input:not([type]):focus.valid,input[type=text].valid,input[type=text]:focus.valid,input[type=password].valid,input[type=password]:focus.valid,input[type=email].valid,input[type=email]:focus.valid,input[type=url].valid,input[type=url]:focus.valid,input[type=time].valid,input[type=time]:focus.valid,input[type=date].valid,input[type=date]:focus.valid,input[type=datetime].valid,input[type=datetime]:focus.valid,input[type=datetime-local].valid,input[type=datetime-local]:focus.valid,input[type=tel].valid,input[type=tel]:focus.valid,input[type=number].valid,input[type=number]:focus.valid,input[type=search].valid,input[type=search]:focus.valid,textarea.materialize-textarea.valid,textarea.materialize-textarea:focus.valid{border-bottom:1px solid #4CAF50;box-shadow:0 1px 0 0 #4CAF50}input:not([type]).valid+label:after,input:not([type]):focus.valid+label:after,input[type=text].valid+label:after,input[type=text]:focus.valid+label:after,input[type=password].valid+label:after,input[type=password]:focus.valid+label:after,input[type=email].valid+label:after,input[type=email]:focus.valid+label:after,input[type=url].valid+label:after,input[type=url]:focus.valid+label:after,input[type=time].valid+label:after,input[type=time]:focus.valid+label:after,input[type=date].valid+label:after,input[type=date]:focus.valid+label:after,input[type=datetime].valid+label:after,input[type=datetime]:focus.valid+label:after,input[type=datetime-local].valid+label:after,input[type=datetime-local]:focus.valid+label:after,input[type=tel].valid+label:after,input[type=tel]:focus.valid+label:after,input[type=number].valid+label:after,input[type=number]:focus.valid+label:after,input[type=search].valid+label:after,input[type=search]:focus.valid+label:after,textarea.materialize-textarea.valid+label:after,textarea.materialize-textarea:focus.valid+label:after{content:attr(data-success);color:#4CAF50;opacity:1}input:not([type]).invalid,input:not([type]):focus.invalid,input[type=text].invalid,input[type=text]:focus.invalid,input[type=password].invalid,input[type=password]:focus.invalid,input[type=email].invalid,input[type=email]:focus.invalid,input[type=url].invalid,input[type=url]:focus.invalid,input[type=time].invalid,input[type=time]:focus.invalid,input[type=date].invalid,input[type=date]:focus.invalid,input[type=datetime].invalid,input[type=datetime]:focus.invalid,input[type=datetime-local].invalid,input[type=datetime-local]:focus.invalid,input[type=tel].invalid,input[type=tel]:focus.invalid,input[type=number].invalid,input[type=number]:focus.invalid,input[type=search].invalid,input[type=search]:focus.invalid,textarea.materialize-textarea.invalid,textarea.materialize-textarea:focus.invalid{border-bottom:1px solid #F44336;box-shadow:0 1px 0 0 #F44336}input:not([type]).invalid+label:after,input:not([type]):focus.invalid+label:after,input[type=text].invalid+label:after,input[type=text]:focus.invalid+label:after,input[type=password].invalid+label:after,input[type=password]:focus.invalid+label:after,input[type=email].invalid+label:after,input[type=email]:focus.invalid+label:after,input[type=url].invalid+label:after,input[type=url]:focus.invalid+label:after,input[type=time].invalid+label:after,input[type=time]:focus.invalid+label:after,input[type=date].invalid+label:after,input[type=date]:focus.invalid+label:after,input[type=datetime].invalid+label:after,input[type=datetime]:focus.invalid+label:after,input[type=datetime-local].invalid+label:after,input[type=datetime-local]:focus.invalid+label:after,input[type=tel].invalid+label:after,input[type=tel]:focus.invalid+label:after,input[type=number].invalid+label:after,input[type=number]:focus.invalid+label:after,input[type=search].invalid+label:after,input[type=search]:focus.invalid+label:after,textarea.materialize-textarea.invalid+label:after,textarea.materialize-textarea:focus.invalid+label:after{content:attr(data-error);color:#F44336;opacity:1}input:not([type]).validate+label,input[type=text].validate+label,input[type=password].validate+label,input[type=email].validate+label,input[type=url].validate+label,input[type=time].validate+label,input[type=date].validate+label,input[type=datetime].validate+label,input[type=datetime-local].validate+label,input[type=tel].validate+label,input[type=number].validate+label,input[type=search].validate+label,textarea.materialize-textarea.validate+label{width:100%;pointer-events:none}input:not([type])+label:after,input[type=text]+label:after,input[type=password]+label:after,input[type=email]+label:after,input[type=url]+label:after,input[type=time]+label:after,input[type=date]+label:after,input[type=datetime]+label:after,input[type=datetime-local]+label:after,input[type=tel]+label:after,input[type=number]+label:after,input[type=search]+label:after,textarea.materialize-textarea+label:after{display:block;content:"";position:absolute;top:60px;opacity:0;transition:.2s opacity ease-out, .2s color ease-out}.input-field{position:relative;margin-top:1rem}.input-field.inline{display:inline-block;vertical-align:middle;margin-left:5px}.input-field.inline input,.input-field.inline .select-dropdown{margin-bottom:1rem}.input-field.col label{left:.75rem}.input-field.col .prefix ~ label,.input-field.col .prefix ~ .validate ~ label{width:calc(100% - 3rem - 1.5rem)}.input-field label{color:#9e9e9e;position:absolute;top:0.8rem;left:0;font-size:1rem;cursor:text;transition:.2s ease-out}.input-field label:not(.label-icon).active{font-size:.8rem;-webkit-transform:translateY(-140%);transform:translateY(-140%)}.input-field .prefix{position:absolute;width:3rem;font-size:2rem;transition:color .2s}.input-field .prefix.active{color:#26a69a}.input-field .prefix ~ input,.input-field .prefix ~ textarea,.input-field .prefix ~ label,.input-field .prefix ~ .validate ~ label,.input-field .prefix ~ .autocomplete-content{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.input-field .prefix ~ label{margin-left:3rem}@media only screen and (max-width: 992px){.input-field .prefix ~ input{width:86%;width:calc(100% - 3rem)}}@media only screen and (max-width: 600px){.input-field .prefix ~ input{width:80%;width:calc(100% - 3rem)}}.input-field input[type=search]{display:block;line-height:inherit;padding-left:4rem;width:calc(100% - 4rem)}.input-field input[type=search]:focus{background-color:#fff;border:0;box-shadow:none;color:#444}.input-field input[type=search]:focus+label i,.input-field input[type=search]:focus ~ .mdi-navigation-close,.input-field input[type=search]:focus ~ .material-icons{color:#444}.input-field input[type=search]+label{left:1rem}.input-field input[type=search] ~ .mdi-navigation-close,.input-field input[type=search] ~ .material-icons{position:absolute;top:0;right:1rem;color:transparent;cursor:pointer;font-size:2rem;transition:.3s color}textarea{width:100%;height:3rem;background-color:transparent}textarea.materialize-textarea{overflow-y:hidden;padding:.8rem 0 1.6rem 0;resize:none;min-height:3rem}.hiddendiv{display:none;white-space:pre-wrap;word-wrap:break-word;overflow-wrap:break-word;padding-top:1.2rem}.autocomplete-content{margin-top:-15px;display:block;opacity:1;position:static}.autocomplete-content li .highlight{color:#444}.autocomplete-content li img{height:40px;width:40px;margin:5px 15px}[type="radio"]:not(:checked),[type="radio"]:checked{position:absolute;left:-9999px;opacity:0}[type="radio"]:not(:checked)+label,[type="radio"]:checked+label{position:relative;padding-left:35px;cursor:pointer;display:inline-block;height:25px;line-height:25px;font-size:1rem;transition:.28s ease;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}[type="radio"]+label:before,[type="radio"]+label:after{content:'';position:absolute;left:0;top:0;margin:4px;width:16px;height:16px;z-index:0;transition:.28s ease}[type="radio"]:not(:checked)+label:before,[type="radio"]:not(:checked)+label:after,[type="radio"]:checked+label:before,[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:before,[type="radio"].with-gap:checked+label:after{border-radius:50%}[type="radio"]:not(:checked)+label:before,[type="radio"]:not(:checked)+label:after{border:2px solid #5a5a5a}[type="radio"]:not(:checked)+label:after{-webkit-transform:scale(0);transform:scale(0)}[type="radio"]:checked+label:before{border:2px solid transparent}[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:before,[type="radio"].with-gap:checked+label:after{border:2px solid #26a69a}[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:after{background-color:#26a69a}[type="radio"]:checked+label:after{-webkit-transform:scale(1.02);transform:scale(1.02)}[type="radio"].with-gap:checked+label:after{-webkit-transform:scale(0.5);transform:scale(0.5)}[type="radio"].tabbed:focus+label:before{box-shadow:0 0 0 10px rgba(0,0,0,0.1)}[type="radio"].with-gap:disabled:checked+label:before{border:2px solid rgba(0,0,0,0.26)}[type="radio"].with-gap:disabled:checked+label:after{border:none;background-color:rgba(0,0,0,0.26)}[type="radio"]:disabled:not(:checked)+label:before,[type="radio"]:disabled:checked+label:before{background-color:transparent;border-color:rgba(0,0,0,0.26)}[type="radio"]:disabled+label{color:rgba(0,0,0,0.26)}[type="radio"]:disabled:not(:checked)+label:before{border-color:rgba(0,0,0,0.26)}[type="radio"]:disabled:checked+label:after{background-color:rgba(0,0,0,0.26);border-color:#BDBDBD}form p{margin-bottom:10px;text-align:left}form p:last-child{margin-bottom:0}[type="checkbox"]:not(:checked),[type="checkbox"]:checked{position:absolute;left:-9999px;opacity:0}[type="checkbox"]+label{position:relative;padding-left:35px;cursor:pointer;display:inline-block;height:25px;line-height:25px;font-size:1rem;-webkit-user-select:none;-moz-user-select:none;-khtml-user-select:none;-ms-user-select:none}[type="checkbox"]+label:before,[type="checkbox"]:not(.filled-in)+label:after{content:'';position:absolute;top:0;left:0;width:18px;height:18px;z-index:0;border:2px solid #5a5a5a;border-radius:1px;margin-top:2px;transition:.2s}[type="checkbox"]:not(.filled-in)+label:after{border:0;-webkit-transform:scale(0);transform:scale(0)}[type="checkbox"]:not(:checked):disabled+label:before{border:none;background-color:rgba(0,0,0,0.26)}[type="checkbox"].tabbed:focus+label:after{-webkit-transform:scale(1);transform:scale(1);border:0;border-radius:50%;box-shadow:0 0 0 10px rgba(0,0,0,0.1);background-color:rgba(0,0,0,0.1)}[type="checkbox"]:checked+label:before{top:-4px;left:-5px;width:12px;height:22px;border-top:2px solid transparent;border-left:2px solid transparent;border-right:2px solid #26a69a;border-bottom:2px solid #26a69a;-webkit-transform:rotate(40deg);transform:rotate(40deg);-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"]:checked:disabled+label:before{border-right:2px solid rgba(0,0,0,0.26);border-bottom:2px solid rgba(0,0,0,0.26)}[type="checkbox"]:indeterminate+label:before{top:-11px;left:-12px;width:10px;height:22px;border-top:none;border-left:none;border-right:2px solid #26a69a;border-bottom:none;-webkit-transform:rotate(90deg);transform:rotate(90deg);-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"]:indeterminate:disabled+label:before{border-right:2px solid rgba(0,0,0,0.26);background-color:transparent}[type="checkbox"].filled-in+label:after{border-radius:2px}[type="checkbox"].filled-in+label:before,[type="checkbox"].filled-in+label:after{content:'';left:0;position:absolute;transition:border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;z-index:1}[type="checkbox"].filled-in:not(:checked)+label:before{width:0;height:0;border:3px solid transparent;left:6px;top:10px;-webkit-transform:rotateZ(37deg);transform:rotateZ(37deg);-webkit-transform-origin:20% 40%;transform-origin:100% 100%}[type="checkbox"].filled-in:not(:checked)+label:after{height:20px;width:20px;background-color:transparent;border:2px solid #5a5a5a;top:0px;z-index:0}[type="checkbox"].filled-in:checked+label:before{top:0;left:1px;width:8px;height:13px;border-top:2px solid transparent;border-left:2px solid transparent;border-right:2px solid #fff;border-bottom:2px solid #fff;-webkit-transform:rotateZ(37deg);transform:rotateZ(37deg);-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"].filled-in:checked+label:after{top:0;width:20px;height:20px;border:2px solid #26a69a;background-color:#26a69a;z-index:0}[type="checkbox"].filled-in.tabbed:focus+label:after{border-radius:2px;border-color:#5a5a5a;background-color:rgba(0,0,0,0.1)}[type="checkbox"].filled-in.tabbed:checked:focus+label:after{border-radius:2px;background-color:#26a69a;border-color:#26a69a}[type="checkbox"].filled-in:disabled:not(:checked)+label:before{background-color:transparent;border:2px solid transparent}[type="checkbox"].filled-in:disabled:not(:checked)+label:after{border-color:transparent;background-color:#BDBDBD}[type="checkbox"].filled-in:disabled:checked+label:before{background-color:transparent}[type="checkbox"].filled-in:disabled:checked+label:after{background-color:#BDBDBD;border-color:#BDBDBD}.switch,.switch *{-webkit-user-select:none;-moz-user-select:none;-khtml-user-select:none;-ms-user-select:none}.switch label{cursor:pointer}.switch label input[type=checkbox]{opacity:0;width:0;height:0}.switch label input[type=checkbox]:checked+.lever{background-color:#84c7c1}.switch label input[type=checkbox]:checked+.lever:after{background-color:#26a69a;left:24px}.switch label .lever{content:"";display:inline-block;position:relative;width:40px;height:15px;background-color:#818181;border-radius:15px;margin-right:10px;transition:background 0.3s ease;vertical-align:middle;margin:0 16px}.switch label .lever:after{content:"";position:absolute;display:inline-block;width:21px;height:21px;background-color:#F1F1F1;border-radius:21px;box-shadow:0 1px 3px 1px rgba(0,0,0,0.4);left:-5px;top:-3px;transition:left 0.3s ease, background .3s ease, box-shadow 0.1s ease}input[type=checkbox]:checked:not(:disabled) ~ .lever:active::after,input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::after{box-shadow:0 1px 3px 1px rgba(0,0,0,0.4),0 0 0 15px rgba(38,166,154,0.1)}input[type=checkbox]:not(:disabled) ~ .lever:active:after,input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::after{box-shadow:0 1px 3px 1px rgba(0,0,0,0.4),0 0 0 15px rgba(0,0,0,0.08)}.switch input[type=checkbox][disabled]+.lever{cursor:default}.switch label input[type=checkbox][disabled]+.lever:after,.switch label input[type=checkbox][disabled]:checked+.lever:after{background-color:#BDBDBD}select{display:none}select.browser-default{display:block}select{background-color:rgba(255,255,255,0.9);width:100%;padding:5px;border:1px solid #f2f2f2;border-radius:2px;height:3rem}.select-label{position:absolute}.select-wrapper{position:relative}.select-wrapper input.select-dropdown{position:relative;cursor:pointer;background-color:transparent;border:none;border-bottom:1px solid #9e9e9e;outline:none;height:3rem;line-height:3rem;width:100%;font-size:1rem;margin:0 0 20px 0;padding:0;display:block}.select-wrapper span.caret{color:initial;position:absolute;right:0;top:0;bottom:0;height:10px;margin:auto 0;font-size:10px;line-height:10px}.select-wrapper span.caret.disabled{color:rgba(0,0,0,0.26)}.select-wrapper+label{position:absolute;top:-14px;font-size:.8rem}select:disabled{color:rgba(0,0,0,0.3)}.select-wrapper input.select-dropdown:disabled{color:rgba(0,0,0,0.3);cursor:default;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;border-bottom:1px solid rgba(0,0,0,0.3)}.select-wrapper i{color:rgba(0,0,0,0.3)}.select-dropdown li.disabled,.select-dropdown li.disabled>span,.select-dropdown li.optgroup{color:rgba(0,0,0,0.3);background-color:transparent}.prefix ~ .select-wrapper{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.prefix ~ label{margin-left:3rem}.select-dropdown li img{height:40px;width:40px;margin:5px 15px;float:right}.select-dropdown li.optgroup{border-top:1px solid #eee}.select-dropdown li.optgroup.selected>span{color:rgba(0,0,0,0.7)}.select-dropdown li.optgroup>span{color:rgba(0,0,0,0.4)}.select-dropdown li.optgroup ~ li.optgroup-option{padding-left:1rem}.file-field{position:relative}.file-field .file-path-wrapper{overflow:hidden;padding-left:10px}.file-field input.file-path{width:100%}.file-field .btn,.file-field .btn-large{float:left;height:3rem;line-height:3rem}.file-field span{cursor:pointer}.file-field input[type=file]{position:absolute;top:0;right:0;left:0;bottom:0;width:100%;margin:0;padding:0;font-size:20px;cursor:pointer;opacity:0;filter:alpha(opacity=0)}.range-field{position:relative}input[type=range],input[type=range]+.thumb{cursor:pointer}input[type=range]{position:relative;background-color:transparent;border:none;outline:none;width:100%;margin:15px 0;padding:0}input[type=range]:focus{outline:none}input[type=range]+.thumb{position:absolute;border:none;height:0;width:0;border-radius:50%;background-color:#26a69a;top:10px;margin-left:-6px;-webkit-transform-origin:50% 50%;transform-origin:50% 50%;-webkit-transform:rotate(-45deg);transform:rotate(-45deg)}input[type=range]+.thumb .value{display:block;width:30px;text-align:center;color:#26a69a;font-size:0;-webkit-transform:rotate(45deg);transform:rotate(45deg)}input[type=range]+.thumb.active{border-radius:50% 50% 50% 0}input[type=range]+.thumb.active .value{color:#fff;margin-left:-1px;margin-top:8px;font-size:10px}input[type=range]{-webkit-appearance:none}input[type=range]::-webkit-slider-runnable-track{height:3px;background:#c2c0c2;border:none}input[type=range]::-webkit-slider-thumb{-webkit-appearance:none;border:none;height:14px;width:14px;border-radius:50%;background-color:#26a69a;-webkit-transform-origin:50% 50%;transform-origin:50% 50%;margin:-5px 0 0 0;transition:.3s}input[type=range]:focus::-webkit-slider-runnable-track{background:#ccc}input[type=range]{border:1px solid white}input[type=range]::-moz-range-track{height:3px;background:#ddd;border:none}input[type=range]::-moz-range-thumb{border:none;height:14px;width:14px;border-radius:50%;background:#26a69a;margin-top:-5px}input[type=range]:-moz-focusring{outline:1px solid #fff;outline-offset:-1px}input[type=range]:focus::-moz-range-track{background:#ccc}input[type=range]::-ms-track{height:3px;background:transparent;border-color:transparent;border-width:6px 0;color:transparent}input[type=range]::-ms-fill-lower{background:#777}input[type=range]::-ms-fill-upper{background:#ddd}input[type=range]::-ms-thumb{border:none;height:14px;width:14px;border-radius:50%;background:#26a69a}input[type=range]:focus::-ms-fill-lower{background:#888}input[type=range]:focus::-ms-fill-upper{background:#ccc}.table-of-contents.fixed{position:fixed}.table-of-contents li{padding:2px 0}.table-of-contents a{display:inline-block;font-weight:300;color:#757575;padding-left:20px;height:1.5rem;line-height:1.5rem;letter-spacing:.4;display:inline-block}.table-of-contents a:hover{color:#a8a8a8;padding-left:19px;border-left:1px solid #ee6e73}.table-of-contents a.active{font-weight:500;padding-left:18px;border-left:2px solid #ee6e73}.side-nav{position:fixed;width:300px;left:0;top:0;margin:0;-webkit-transform:translateX(-100%);transform:translateX(-100%);height:100%;height:calc(100% + 60px);height:-moz-calc(100%);padding-bottom:60px;background-color:#fff;z-index:999;overflow-y:auto;will-change:transform;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform:translateX(-105%);transform:translateX(-105%)}.side-nav.right-aligned{right:0;-webkit-transform:translateX(105%);transform:translateX(105%);left:auto;-webkit-transform:translateX(100%);transform:translateX(100%)}.side-nav .collapsible{margin:0}.side-nav li{float:none;line-height:48px}.side-nav li.active{background-color:rgba(0,0,0,0.05)}.side-nav a{color:rgba(0,0,0,0.87);display:block;font-size:14px;font-weight:500;height:48px;line-height:48px;padding:0 32px}.side-nav a:hover{background-color:rgba(0,0,0,0.05)}.side-nav a.btn,.side-nav a.btn-large,.side-nav a.btn-large,.side-nav a.btn-flat,.side-nav a.btn-floating{margin:10px 15px}.side-nav a.btn,.side-nav a.btn-large,.side-nav a.btn-large,.side-nav a.btn-floating{color:#fff}.side-nav a.btn-flat{color:#343434}.side-nav a.btn:hover,.side-nav a.btn-large:hover,.side-nav a.btn-large:hover{background-color:#2bbbad}.side-nav a.btn-floating:hover{background-color:#26a69a}.side-nav li>a>i,.side-nav li>a>[class^="mdi-"],.side-nav li>a>[class*="mdi-"],.side-nav li>a>i.material-icons{float:left;height:48px;line-height:48px;margin:0 32px 0 0;width:24px;color:rgba(0,0,0,0.54)}.side-nav .divider{margin:8px 0 0 0}.side-nav .subheader{cursor:initial;pointer-events:none;color:rgba(0,0,0,0.54);font-size:14px;font-weight:500;line-height:48px}.side-nav .subheader:hover{background-color:transparent}.side-nav .userView{position:relative;padding:32px 32px 0;margin-bottom:8px}.side-nav .userView>a{height:auto;padding:0}.side-nav .userView>a:hover{background-color:transparent}.side-nav .userView .background{overflow:hidden;position:absolute;top:0;right:0;bottom:0;left:0;z-index:-1}.side-nav .userView .circle,.side-nav .userView .name,.side-nav .userView .email{display:block}.side-nav .userView .circle{height:64px;width:64px}.side-nav .userView .name,.side-nav .userView .email{font-size:14px;line-height:24px}.side-nav .userView .name{margin-top:16px;font-weight:500}.side-nav .userView .email{padding-bottom:16px;font-weight:400}.drag-target{height:100%;width:10px;position:fixed;top:0;z-index:998}.side-nav.fixed{left:0;-webkit-transform:translateX(0);transform:translateX(0);position:fixed}.side-nav.fixed.right-aligned{right:0;left:auto}@media only screen and (max-width: 992px){.side-nav.fixed{-webkit-transform:translateX(-105%);transform:translateX(-105%)}.side-nav.fixed.right-aligned{-webkit-transform:translateX(105%);transform:translateX(105%)}.side-nav a{padding:0 16px}.side-nav .userView{padding:16px 16px 0}}.side-nav .collapsible-body>ul:not(.collapsible)>li.active,.side-nav.fixed .collapsible-body>ul:not(.collapsible)>li.active{background-color:#ee6e73}.side-nav .collapsible-body>ul:not(.collapsible)>li.active a,.side-nav.fixed .collapsible-body>ul:not(.collapsible)>li.active a{color:#fff}#sidenav-overlay{position:fixed;top:0;left:0;right:0;height:120vh;background-color:rgba(0,0,0,0.5);z-index:997;will-change:opacity}.preloader-wrapper{display:inline-block;position:relative;width:48px;height:48px}.preloader-wrapper.small{width:36px;height:36px}.preloader-wrapper.big{width:64px;height:64px}.preloader-wrapper.active{-webkit-animation:container-rotate 1568ms linear infinite;animation:container-rotate 1568ms linear infinite}@-webkit-keyframes container-rotate{to{-webkit-transform:rotate(360deg)}}@keyframes container-rotate{to{-webkit-transform:rotate(360deg);transform:rotate(360deg)}}.spinner-layer{position:absolute;width:100%;height:100%;opacity:0;border-color:#26a69a}.spinner-blue,.spinner-blue-only{border-color:#4285f4}.spinner-red,.spinner-red-only{border-color:#db4437}.spinner-yellow,.spinner-yellow-only{border-color:#f4b400}.spinner-green,.spinner-green-only{border-color:#0f9d58}.active .spinner-layer.spinner-blue{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-red{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-yellow{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-green{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer,.active .spinner-layer.spinner-blue-only,.active .spinner-layer.spinner-red-only,.active .spinner-layer.spinner-yellow-only,.active .spinner-layer.spinner-green-only{opacity:1;-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}@-webkit-keyframes fill-unfill-rotate{12.5%{-webkit-transform:rotate(135deg)}25%{-webkit-transform:rotate(270deg)}37.5%{-webkit-transform:rotate(405deg)}50%{-webkit-transform:rotate(540deg)}62.5%{-webkit-transform:rotate(675deg)}75%{-webkit-transform:rotate(810deg)}87.5%{-webkit-transform:rotate(945deg)}to{-webkit-transform:rotate(1080deg)}}@keyframes fill-unfill-rotate{12.5%{-webkit-transform:rotate(135deg);transform:rotate(135deg)}25%{-webkit-transform:rotate(270deg);transform:rotate(270deg)}37.5%{-webkit-transform:rotate(405deg);transform:rotate(405deg)}50%{-webkit-transform:rotate(540deg);transform:rotate(540deg)}62.5%{-webkit-transform:rotate(675deg);transform:rotate(675deg)}75%{-webkit-transform:rotate(810deg);transform:rotate(810deg)}87.5%{-webkit-transform:rotate(945deg);transform:rotate(945deg)}to{-webkit-transform:rotate(1080deg);transform:rotate(1080deg)}}@-webkit-keyframes blue-fade-in-out{from{opacity:1}25%{opacity:1}26%{opacity:0}89%{opacity:0}90%{opacity:1}100%{opacity:1}}@keyframes blue-fade-in-out{from{opacity:1}25%{opacity:1}26%{opacity:0}89%{opacity:0}90%{opacity:1}100%{opacity:1}}@-webkit-keyframes red-fade-in-out{from{opacity:0}15%{opacity:0}25%{opacity:1}50%{opacity:1}51%{opacity:0}}@keyframes red-fade-in-out{from{opacity:0}15%{opacity:0}25%{opacity:1}50%{opacity:1}51%{opacity:0}}@-webkit-keyframes yellow-fade-in-out{from{opacity:0}40%{opacity:0}50%{opacity:1}75%{opacity:1}76%{opacity:0}}@keyframes yellow-fade-in-out{from{opacity:0}40%{opacity:0}50%{opacity:1}75%{opacity:1}76%{opacity:0}}@-webkit-keyframes green-fade-in-out{from{opacity:0}65%{opacity:0}75%{opacity:1}90%{opacity:1}100%{opacity:0}}@keyframes green-fade-in-out{from{opacity:0}65%{opacity:0}75%{opacity:1}90%{opacity:1}100%{opacity:0}}.gap-patch{position:absolute;top:0;left:45%;width:10%;height:100%;overflow:hidden;border-color:inherit}.gap-patch .circle{width:1000%;left:-450%}.circle-clipper{display:inline-block;position:relative;width:50%;height:100%;overflow:hidden;border-color:inherit}.circle-clipper .circle{width:200%;height:100%;border-width:3px;border-style:solid;border-color:inherit;border-bottom-color:transparent !important;border-radius:50%;-webkit-animation:none;animation:none;position:absolute;top:0;right:0;bottom:0}.circle-clipper.left .circle{left:0;border-right-color:transparent !important;-webkit-transform:rotate(129deg);transform:rotate(129deg)}.circle-clipper.right .circle{left:-100%;border-left-color:transparent !important;-webkit-transform:rotate(-129deg);transform:rotate(-129deg)}.active .circle-clipper.left .circle{-webkit-animation:left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .circle-clipper.right .circle{-webkit-animation:right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}@-webkit-keyframes left-spin{from{-webkit-transform:rotate(130deg)}50%{-webkit-transform:rotate(-5deg)}to{-webkit-transform:rotate(130deg)}}@keyframes left-spin{from{-webkit-transform:rotate(130deg);transform:rotate(130deg)}50%{-webkit-transform:rotate(-5deg);transform:rotate(-5deg)}to{-webkit-transform:rotate(130deg);transform:rotate(130deg)}}@-webkit-keyframes right-spin{from{-webkit-transform:rotate(-130deg)}50%{-webkit-transform:rotate(5deg)}to{-webkit-transform:rotate(-130deg)}}@keyframes right-spin{from{-webkit-transform:rotate(-130deg);transform:rotate(-130deg)}50%{-webkit-transform:rotate(5deg);transform:rotate(5deg)}to{-webkit-transform:rotate(-130deg);transform:rotate(-130deg)}}#spinnerContainer.cooldown{-webkit-animation:container-rotate 1568ms linear infinite,fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1);animation:container-rotate 1568ms linear infinite,fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1)}@-webkit-keyframes fade-out{from{opacity:1}to{opacity:0}}@keyframes fade-out{from{opacity:1}to{opacity:0}}.slider{position:relative;height:400px;width:100%}.slider.fullscreen{height:100%;width:100%;position:absolute;top:0;left:0;right:0;bottom:0}.slider.fullscreen ul.slides{height:100%}.slider.fullscreen ul.indicators{z-index:2;bottom:30px}.slider .slides{background-color:#9e9e9e;margin:0;height:400px}.slider .slides li{opacity:0;position:absolute;top:0;left:0;z-index:1;width:100%;height:inherit;overflow:hidden}.slider .slides li img{height:100%;width:100%;background-size:cover;background-position:center}.slider .slides li .caption{color:#fff;position:absolute;top:15%;left:15%;width:70%;opacity:0}.slider .slides li .caption p{color:#e0e0e0}.slider .slides li.active{z-index:2}.slider .indicators{position:absolute;text-align:center;left:0;right:0;bottom:0;margin:0}.slider .indicators .indicator-item{display:inline-block;position:relative;cursor:pointer;height:16px;width:16px;margin:0 12px;background-color:#e0e0e0;transition:background-color .3s;border-radius:50%}.slider .indicators .indicator-item.active{background-color:#4CAF50}.carousel{overflow:hidden;position:relative;width:100%;height:400px;-webkit-perspective:500px;perspective:500px;-webkit-transform-style:preserve-3d;transform-style:preserve-3d;-webkit-transform-origin:0% 50%;transform-origin:0% 50%}.carousel.carousel-slider{top:0;left:0;height:0}.carousel.carousel-slider .carousel-fixed-item{position:absolute;left:0;right:0;bottom:20px;z-index:1}.carousel.carousel-slider .carousel-fixed-item.with-indicators{bottom:68px}.carousel.carousel-slider .carousel-item{width:100%;height:100%;min-height:400px;position:absolute;top:0;left:0}.carousel.carousel-slider .carousel-item h2{font-size:24px;font-weight:500;line-height:32px}.carousel.carousel-slider .carousel-item p{font-size:15px}.carousel .carousel-item{display:none;width:200px;height:200px;position:absolute;top:0;left:0}.carousel .carousel-item img{width:100%}.carousel .indicators{position:absolute;text-align:center;left:0;right:0;bottom:0;margin:0}.carousel .indicators .indicator-item{display:inline-block;position:relative;cursor:pointer;height:8px;width:8px;margin:24px 4px;background-color:rgba(255,255,255,0.5);transition:background-color .3s;border-radius:50%}.carousel .indicators .indicator-item.active{background-color:#fff}.picker{font-size:16px;text-align:left;line-height:1.2;color:#000000;position:absolute;z-index:10000;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.picker__input{cursor:default}.picker__input.picker__input--active{border-color:#0089ec}.picker__holder{width:100%;overflow-y:auto;-webkit-overflow-scrolling:touch}/*!
+ * Default mobile-first, responsive styling for pickadate.js
+ * Demo: http://amsul.github.io/pickadate.js
+ */.picker__holder,.picker__frame{bottom:0;left:0;right:0;top:100%}.picker__holder{position:fixed;transition:background 0.15s ease-out, top 0s 0.15s;-webkit-backface-visibility:hidden}.picker__frame{position:absolute;margin:0 auto;min-width:256px;width:300px;max-height:350px;-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";filter:alpha(opacity=0);-moz-opacity:0;opacity:0;transition:all 0.15s ease-out}@media (min-height: 28.875em){.picker__frame{overflow:visible;top:auto;bottom:-100%;max-height:80%}}@media (min-height: 40.125em){.picker__frame{margin-bottom:7.5%}}.picker__wrap{display:table;width:100%;height:100%}@media (min-height: 28.875em){.picker__wrap{display:block}}.picker__box{background:#ffffff;display:table-cell;vertical-align:middle}@media (min-height: 28.875em){.picker__box{display:block;border:1px solid #777777;border-top-color:#898989;border-bottom-width:0;border-radius:5px 5px 0 0;box-shadow:0 12px 36px 16px rgba(0,0,0,0.24)}}.picker--opened .picker__holder{top:0;background:transparent;-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorstr=#1E000000,endColorstr=#1E000000)";zoom:1;background:rgba(0,0,0,0.32);transition:background 0.15s ease-out}.picker--opened .picker__frame{top:0;-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";filter:alpha(opacity=100);-moz-opacity:1;opacity:1}@media (min-height: 35.875em){.picker--opened .picker__frame{top:10%;bottom:auto}}.picker__input.picker__input--active{border-color:#E3F2FD}.picker__frame{margin:0 auto;max-width:325px}@media (min-height: 38.875em){.picker--opened .picker__frame{top:10%;bottom:auto}}.picker__box{padding:0 1em}.picker__header{text-align:center;position:relative;margin-top:.75em}.picker__month,.picker__year{display:inline-block;margin-left:.25em;margin-right:.25em}.picker__select--month,.picker__select--year{height:2em;padding:0;margin-left:.25em;margin-right:.25em}.picker__select--month.browser-default{display:inline;background-color:#FFFFFF;width:40%}.picker__select--year.browser-default{display:inline;background-color:#FFFFFF;width:26%}.picker__select--month:focus,.picker__select--year:focus{border-color:rgba(0,0,0,0.05)}.picker__nav--prev,.picker__nav--next{position:absolute;padding:.5em 1.25em;width:1em;height:1em;box-sizing:content-box;top:-0.25em}.picker__nav--prev{left:-1em;padding-right:1.25em}.picker__nav--next{right:-1em;padding-left:1.25em}.picker__nav--disabled,.picker__nav--disabled:hover,.picker__nav--disabled:before,.picker__nav--disabled:before:hover{cursor:default;background:none;border-right-color:#f5f5f5;border-left-color:#f5f5f5}.picker__table{text-align:center;border-collapse:collapse;border-spacing:0;table-layout:fixed;font-size:1rem;width:100%;margin-top:.75em;margin-bottom:.5em}.picker__table th,.picker__table td{text-align:center}.picker__table td{margin:0;padding:0}.picker__weekday{width:14.285714286%;font-size:.75em;padding-bottom:.25em;color:#999999;font-weight:500}@media (min-height: 33.875em){.picker__weekday{padding-bottom:.5em}}.picker__day--today{position:relative;color:#595959;letter-spacing:-.3;padding:.75rem 0;font-weight:400;border:1px solid transparent}.picker__day--disabled:before{border-top-color:#aaaaaa}.picker__day--infocus:hover{cursor:pointer;color:#000;font-weight:500}.picker__day--outfocus{display:none;padding:.75rem 0;color:#fff}.picker__day--outfocus:hover{cursor:pointer;color:#dddddd;font-weight:500}.picker__day--highlighted:hover,.picker--focused .picker__day--highlighted{cursor:pointer}.picker__day--selected,.picker__day--selected:hover,.picker--focused .picker__day--selected{border-radius:50%;-webkit-transform:scale(0.75);transform:scale(0.75);background:#0089ec;color:#ffffff}.picker__day--disabled,.picker__day--disabled:hover,.picker--focused .picker__day--disabled{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default}.picker__day--highlighted.picker__day--disabled,.picker__day--highlighted.picker__day--disabled:hover{background:#bbbbbb}.picker__footer{text-align:center;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between}.picker__button--today,.picker__button--clear,.picker__button--close{border:1px solid #ffffff;background:#ffffff;font-size:.8em;padding:.66em 0;font-weight:bold;width:33%;display:inline-block;vertical-align:bottom}.picker__button--today:hover,.picker__button--clear:hover,.picker__button--close:hover{cursor:pointer;color:#000000;background:#b1dcfb;border-bottom-color:#b1dcfb}.picker__button--today:focus,.picker__button--clear:focus,.picker__button--close:focus{background:#b1dcfb;border-color:rgba(0,0,0,0.05);outline:none}.picker__button--today:before,.picker__button--clear:before,.picker__button--close:before{position:relative;display:inline-block;height:0}.picker__button--today:before,.picker__button--clear:before{content:" ";margin-right:.45em}.picker__button--today:before{top:-0.05em;width:0;border-top:0.66em solid #0059bc;border-left:.66em solid transparent}.picker__button--clear:before{top:-0.25em;width:.66em;border-top:3px solid #ee2200}.picker__button--close:before{content:"\D7";top:-0.1em;vertical-align:top;font-size:1.1em;margin-right:.35em;color:#777777}.picker__button--today[disabled],.picker__button--today[disabled]:hover{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default}.picker__button--today[disabled]:before{border-top-color:#aaaaaa}.picker__box{border-radius:2px;overflow:hidden}.picker__date-display{text-align:center;background-color:#26a69a;color:#fff;padding-bottom:15px;font-weight:300}.picker__nav--prev:hover,.picker__nav--next:hover{cursor:pointer;color:#000000;background:#a1ded8}.picker__weekday-display{background-color:#1f897f;padding:10px;font-weight:200;letter-spacing:.5;font-size:1rem;margin-bottom:15px}.picker__month-display{text-transform:uppercase;font-size:2rem}.picker__day-display{font-size:4.5rem;font-weight:400}.picker__year-display{font-size:1.8rem;color:rgba(255,255,255,0.4)}.picker__box{padding:0}.picker__calendar-container{padding:0 1rem}.picker__calendar-container thead{border:none}.picker__table{margin-top:0;margin-bottom:.5em}.picker__day--infocus{color:#595959;letter-spacing:-.3;padding:.75rem 0;font-weight:400;border:1px solid transparent}.picker__day.picker__day--today{color:#26a69a}.picker__day.picker__day--today.picker__day--selected{color:#fff}.picker__weekday{font-size:.9rem}.picker__day--selected,.picker__day--selected:hover,.picker--focused .picker__day--selected{border-radius:50%;-webkit-transform:scale(0.9);transform:scale(0.9);background-color:#26a69a;color:#ffffff}.picker__day--selected.picker__day--outfocus,.picker__day--selected:hover.picker__day--outfocus,.picker--focused .picker__day--selected.picker__day--outfocus{background-color:#a1ded8}.picker__footer{text-align:right;padding:5px 10px}.picker__close,.picker__today{font-size:1.1rem;padding:0 1rem;color:#26a69a}.picker__nav--prev:before,.picker__nav--next:before{content:" ";border-top:.5em solid transparent;border-bottom:.5em solid transparent;border-right:0.75em solid #676767;width:0;height:0;display:block;margin:0 auto}.picker__nav--next:before{border-right:0;border-left:0.75em solid #676767}button.picker__today:focus,button.picker__clear:focus,button.picker__close:focus{background-color:#a1ded8}.picker__list{list-style:none;padding:0.75em 0 4.2em;margin:0}.picker__list-item{border-bottom:1px solid #dddddd;border-top:1px solid #dddddd;margin-bottom:-1px;position:relative;background:#ffffff;padding:.75em 1.25em}@media (min-height: 46.75em){.picker__list-item{padding:.5em 1em}}.picker__list-item:hover{cursor:pointer;color:#000000;background:#b1dcfb;border-color:#0089ec;z-index:10}.picker__list-item--highlighted{border-color:#0089ec;z-index:10}.picker__list-item--highlighted:hover,.picker--focused .picker__list-item--highlighted{cursor:pointer;color:#000000;background:#b1dcfb}.picker__list-item--selected,.picker__list-item--selected:hover,.picker--focused .picker__list-item--selected{background:#0089ec;color:#ffffff;z-index:10}.picker__list-item--disabled,.picker__list-item--disabled:hover,.picker--focused .picker__list-item--disabled{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default;border-color:#dddddd;z-index:auto}.picker--time .picker__button--clear{display:block;width:80%;margin:1em auto 0;padding:1em 1.25em;background:none;border:0;font-weight:500;font-size:.67em;text-align:center;text-transform:uppercase;color:#666}.picker--time .picker__button--clear:hover,.picker--time .picker__button--clear:focus{color:#000000;background:#b1dcfb;background:#ee2200;border-color:#ee2200;cursor:pointer;color:#ffffff;outline:none}.picker--time .picker__button--clear:before{top:-0.25em;color:#666;font-size:1.25em;font-weight:bold}.picker--time .picker__button--clear:hover:before,.picker--time .picker__button--clear:focus:before{color:#ffffff}.picker--time .picker__frame{min-width:256px;max-width:320px}.picker--time .picker__box{font-size:1em;background:#f2f2f2;padding:0}@media (min-height: 40.125em){.picker--time .picker__box{margin-bottom:5em}}
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/.DS_Store b/VNF_Catalogue/public/3rd_party/materialize/fonts/.DS_Store
new file mode 100644
index 00000000..ae0d28ed
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/.DS_Store
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.eot b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.eot
new file mode 100644
index 00000000..b73776ee
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.eot
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.ttf b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.ttf
new file mode 100644
index 00000000..68822caf
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.ttf
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff
new file mode 100644
index 00000000..1f75afdc
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff2 b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff2
new file mode 100644
index 00000000..350d1c3a
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff2
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.eot b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.eot
new file mode 100644
index 00000000..072cdc48
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.eot
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.ttf b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.ttf
new file mode 100644
index 00000000..aa453407
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.ttf
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff
new file mode 100644
index 00000000..3480c6c8
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff2 b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff2
new file mode 100644
index 00000000..9a4d98c4
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff2
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.eot b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.eot
new file mode 100644
index 00000000..f9ad9956
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.eot
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.ttf b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.ttf
new file mode 100644
index 00000000..a3c1a1f1
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.ttf
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff
new file mode 100644
index 00000000..1186773f
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff2 b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff2
new file mode 100644
index 00000000..d10a5926
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff2
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.eot b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.eot
new file mode 100644
index 00000000..9b5e8e41
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.eot
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.ttf b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.ttf
new file mode 100644
index 00000000..0e58508a
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.ttf
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff
new file mode 100644
index 00000000..f823258a
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff2 b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff2
new file mode 100644
index 00000000..b7082ef3
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff2
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.eot b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.eot
new file mode 100644
index 00000000..2284a3b3
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.eot
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.ttf b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.ttf
new file mode 100644
index 00000000..8779333b
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.ttf
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff
new file mode 100644
index 00000000..2a98c1e4
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff
diff --git a/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff2 b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff2
new file mode 100644
index 00000000..a38025a1
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff2
diff --git a/VNF_Catalogue/public/3rd_party/materialize/js/materialize.js b/VNF_Catalogue/public/3rd_party/materialize/js/materialize.js
new file mode 100644
index 00000000..8c994c46
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/js/materialize.js
@@ -0,0 +1,8031 @@
+/*!
+ * Materialize v0.98.0 (http://materializecss.com)
+ * Copyright 2014-2015 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+// Check for jQuery.
+if (typeof(jQuery) === 'undefined') {
+  var jQuery;
+  // Check if require is a defined function.
+  if (typeof(require) === 'function') {
+    jQuery = $ = require('jquery');
+  // Else use the dollar sign alias.
+  } else {
+    jQuery = $;
+  }
+}
+;/*
+ * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
+ *
+ * Uses the built in easing capabilities added In jQuery 1.1
+ * to offer multiple easing options
+ *
+ * TERMS OF USE - jQuery Easing
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright © 2008 George McGinley Smith
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ *  COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ *  EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ *  GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ *  NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+*/
+
+// t: current time, b: begInnIng value, c: change In value, d: duration
+jQuery.easing['jswing'] = jQuery.easing['swing'];
+
+jQuery.extend( jQuery.easing,
+{
+	def: 'easeOutQuad',
+	swing: function (x, t, b, c, d) {
+		//alert(jQuery.easing.default);
+		return jQuery.easing[jQuery.easing.def](x, t, b, c, d);
+	},
+	easeInQuad: function (x, t, b, c, d) {
+		return c*(t/=d)*t + b;
+	},
+	easeOutQuad: function (x, t, b, c, d) {
+		return -c *(t/=d)*(t-2) + b;
+	},
+	easeInOutQuad: function (x, t, b, c, d) {
+		if ((t/=d/2) < 1) return c/2*t*t + b;
+		return -c/2 * ((--t)*(t-2) - 1) + b;
+	},
+	easeInCubic: function (x, t, b, c, d) {
+		return c*(t/=d)*t*t + b;
+	},
+	easeOutCubic: function (x, t, b, c, d) {
+		return c*((t=t/d-1)*t*t + 1) + b;
+	},
+	easeInOutCubic: function (x, t, b, c, d) {
+		if ((t/=d/2) < 1) return c/2*t*t*t + b;
+		return c/2*((t-=2)*t*t + 2) + b;
+	},
+	easeInQuart: function (x, t, b, c, d) {
+		return c*(t/=d)*t*t*t + b;
+	},
+	easeOutQuart: function (x, t, b, c, d) {
+		return -c * ((t=t/d-1)*t*t*t - 1) + b;
+	},
+	easeInOutQuart: function (x, t, b, c, d) {
+		if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
+		return -c/2 * ((t-=2)*t*t*t - 2) + b;
+	},
+	easeInQuint: function (x, t, b, c, d) {
+		return c*(t/=d)*t*t*t*t + b;
+	},
+	easeOutQuint: function (x, t, b, c, d) {
+		return c*((t=t/d-1)*t*t*t*t + 1) + b;
+	},
+	easeInOutQuint: function (x, t, b, c, d) {
+		if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
+		return c/2*((t-=2)*t*t*t*t + 2) + b;
+	},
+	easeInSine: function (x, t, b, c, d) {
+		return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
+	},
+	easeOutSine: function (x, t, b, c, d) {
+		return c * Math.sin(t/d * (Math.PI/2)) + b;
+	},
+	easeInOutSine: function (x, t, b, c, d) {
+		return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
+	},
+	easeInExpo: function (x, t, b, c, d) {
+		return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
+	},
+	easeOutExpo: function (x, t, b, c, d) {
+		return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
+	},
+	easeInOutExpo: function (x, t, b, c, d) {
+		if (t==0) return b;
+		if (t==d) return b+c;
+		if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
+		return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
+	},
+	easeInCirc: function (x, t, b, c, d) {
+		return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
+	},
+	easeOutCirc: function (x, t, b, c, d) {
+		return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
+	},
+	easeInOutCirc: function (x, t, b, c, d) {
+		if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
+		return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
+	},
+	easeInElastic: function (x, t, b, c, d) {
+		var s=1.70158;var p=0;var a=c;
+		if (t==0) return b;  if ((t/=d)==1) return b+c;  if (!p) p=d*.3;
+		if (a < Math.abs(c)) { a=c; var s=p/4; }
+		else var s = p/(2*Math.PI) * Math.asin (c/a);
+		return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+	},
+	easeOutElastic: function (x, t, b, c, d) {
+		var s=1.70158;var p=0;var a=c;
+		if (t==0) return b;  if ((t/=d)==1) return b+c;  if (!p) p=d*.3;
+		if (a < Math.abs(c)) { a=c; var s=p/4; }
+		else var s = p/(2*Math.PI) * Math.asin (c/a);
+		return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
+	},
+	easeInOutElastic: function (x, t, b, c, d) {
+		var s=1.70158;var p=0;var a=c;
+		if (t==0) return b;  if ((t/=d/2)==2) return b+c;  if (!p) p=d*(.3*1.5);
+		if (a < Math.abs(c)) { a=c; var s=p/4; }
+		else var s = p/(2*Math.PI) * Math.asin (c/a);
+		if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+		return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
+	},
+	easeInBack: function (x, t, b, c, d, s) {
+		if (s == undefined) s = 1.70158;
+		return c*(t/=d)*t*((s+1)*t - s) + b;
+	},
+	easeOutBack: function (x, t, b, c, d, s) {
+		if (s == undefined) s = 1.70158;
+		return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
+	},
+	easeInOutBack: function (x, t, b, c, d, s) {
+		if (s == undefined) s = 1.70158;
+		if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
+		return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
+	},
+	easeInBounce: function (x, t, b, c, d) {
+		return c - jQuery.easing.easeOutBounce (x, d-t, 0, c, d) + b;
+	},
+	easeOutBounce: function (x, t, b, c, d) {
+		if ((t/=d) < (1/2.75)) {
+			return c*(7.5625*t*t) + b;
+		} else if (t < (2/2.75)) {
+			return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
+		} else if (t < (2.5/2.75)) {
+			return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
+		} else {
+			return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
+		}
+	},
+	easeInOutBounce: function (x, t, b, c, d) {
+		if (t < d/2) return jQuery.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
+		return jQuery.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
+	}
+});
+
+/*
+ *
+ * TERMS OF USE - EASING EQUATIONS
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright © 2001 Robert Penner
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ *  COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ *  EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ *  GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ *  NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ */;// Custom Easing
+jQuery.extend( jQuery.easing,
+{
+  easeInOutMaterial: function (x, t, b, c, d) {
+    if ((t/=d/2) < 1) return c/2*t*t + b;
+    return c/4*((t-=2)*t*t + 2) + b;
+  }
+});;/*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */
+/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */
+/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */
+jQuery.Velocity?console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity."):(!function(e){function t(e){var t=e.length,a=r.type(e);return"function"===a||r.isWindow(e)?!1:1===e.nodeType&&t?!0:"array"===a||0===t||"number"==typeof t&&t>0&&t-1 in e}if(!e.jQuery){var r=function(e,t){return new r.fn.init(e,t)};r.isWindow=function(e){return null!=e&&e==e.window},r.type=function(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[i.call(e)]||"object":typeof e},r.isArray=Array.isArray||function(e){return"array"===r.type(e)},r.isPlainObject=function(e){var t;if(!e||"object"!==r.type(e)||e.nodeType||r.isWindow(e))return!1;try{if(e.constructor&&!o.call(e,"constructor")&&!o.call(e.constructor.prototype,"isPrototypeOf"))return!1}catch(a){return!1}for(t in e);return void 0===t||o.call(e,t)},r.each=function(e,r,a){var n,o=0,i=e.length,s=t(e);if(a){if(s)for(;i>o&&(n=r.apply(e[o],a),n!==!1);o++);else for(o in e)if(n=r.apply(e[o],a),n===!1)break}else if(s)for(;i>o&&(n=r.call(e[o],o,e[o]),n!==!1);o++);else for(o in e)if(n=r.call(e[o],o,e[o]),n===!1)break;return e},r.data=function(e,t,n){if(void 0===n){var o=e[r.expando],i=o&&a[o];if(void 0===t)return i;if(i&&t in i)return i[t]}else if(void 0!==t){var o=e[r.expando]||(e[r.expando]=++r.uuid);return a[o]=a[o]||{},a[o][t]=n,n}},r.removeData=function(e,t){var n=e[r.expando],o=n&&a[n];o&&r.each(t,function(e,t){delete o[t]})},r.extend=function(){var e,t,a,n,o,i,s=arguments[0]||{},l=1,u=arguments.length,c=!1;for("boolean"==typeof s&&(c=s,s=arguments[l]||{},l++),"object"!=typeof s&&"function"!==r.type(s)&&(s={}),l===u&&(s=this,l--);u>l;l++)if(null!=(o=arguments[l]))for(n in o)e=s[n],a=o[n],s!==a&&(c&&a&&(r.isPlainObject(a)||(t=r.isArray(a)))?(t?(t=!1,i=e&&r.isArray(e)?e:[]):i=e&&r.isPlainObject(e)?e:{},s[n]=r.extend(c,i,a)):void 0!==a&&(s[n]=a));return s},r.queue=function(e,a,n){function o(e,r){var a=r||[];return null!=e&&(t(Object(e))?!function(e,t){for(var r=+t.length,a=0,n=e.length;r>a;)e[n++]=t[a++];if(r!==r)for(;void 0!==t[a];)e[n++]=t[a++];return e.length=n,e}(a,"string"==typeof e?[e]:e):[].push.call(a,e)),a}if(e){a=(a||"fx")+"queue";var i=r.data(e,a);return n?(!i||r.isArray(n)?i=r.data(e,a,o(n)):i.push(n),i):i||[]}},r.dequeue=function(e,t){r.each(e.nodeType?[e]:e,function(e,a){t=t||"fx";var n=r.queue(a,t),o=n.shift();"inprogress"===o&&(o=n.shift()),o&&("fx"===t&&n.unshift("inprogress"),o.call(a,function(){r.dequeue(a,t)}))})},r.fn=r.prototype={init:function(e){if(e.nodeType)return this[0]=e,this;throw new Error("Not a DOM node.")},offset:function(){var t=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:t.top+(e.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:t.left+(e.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function e(){for(var e=this.offsetParent||document;e&&"html"===!e.nodeType.toLowerCase&&"static"===e.style.position;)e=e.offsetParent;return e||document}var t=this[0],e=e.apply(t),a=this.offset(),n=/^(?:body|html)$/i.test(e.nodeName)?{top:0,left:0}:r(e).offset();return a.top-=parseFloat(t.style.marginTop)||0,a.left-=parseFloat(t.style.marginLeft)||0,e.style&&(n.top+=parseFloat(e.style.borderTopWidth)||0,n.left+=parseFloat(e.style.borderLeftWidth)||0),{top:a.top-n.top,left:a.left-n.left}}};var a={};r.expando="velocity"+(new Date).getTime(),r.uuid=0;for(var n={},o=n.hasOwnProperty,i=n.toString,s="Boolean Number String Function Array Date RegExp Object Error".split(" "),l=0;l<s.length;l++)n["[object "+s[l]+"]"]=s[l].toLowerCase();r.fn.init.prototype=r.fn,e.Velocity={Utilities:r}}}(window),function(e){"object"==typeof module&&"object"==typeof module.exports?module.exports=e():"function"==typeof define&&define.amd?define(e):e()}(function(){return function(e,t,r,a){function n(e){for(var t=-1,r=e?e.length:0,a=[];++t<r;){var n=e[t];n&&a.push(n)}return a}function o(e){return m.isWrapped(e)?e=[].slice.call(e):m.isNode(e)&&(e=[e]),e}function i(e){var t=f.data(e,"velocity");return null===t?a:t}function s(e){return function(t){return Math.round(t*e)*(1/e)}}function l(e,r,a,n){function o(e,t){return 1-3*t+3*e}function i(e,t){return 3*t-6*e}function s(e){return 3*e}function l(e,t,r){return((o(t,r)*e+i(t,r))*e+s(t))*e}function u(e,t,r){return 3*o(t,r)*e*e+2*i(t,r)*e+s(t)}function c(t,r){for(var n=0;m>n;++n){var o=u(r,e,a);if(0===o)return r;var i=l(r,e,a)-t;r-=i/o}return r}function p(){for(var t=0;b>t;++t)w[t]=l(t*x,e,a)}function f(t,r,n){var o,i,s=0;do i=r+(n-r)/2,o=l(i,e,a)-t,o>0?n=i:r=i;while(Math.abs(o)>h&&++s<v);return i}function d(t){for(var r=0,n=1,o=b-1;n!=o&&w[n]<=t;++n)r+=x;--n;var i=(t-w[n])/(w[n+1]-w[n]),s=r+i*x,l=u(s,e,a);return l>=y?c(t,s):0==l?s:f(t,r,r+x)}function g(){V=!0,(e!=r||a!=n)&&p()}var m=4,y=.001,h=1e-7,v=10,b=11,x=1/(b-1),S="Float32Array"in t;if(4!==arguments.length)return!1;for(var P=0;4>P;++P)if("number"!=typeof arguments[P]||isNaN(arguments[P])||!isFinite(arguments[P]))return!1;e=Math.min(e,1),a=Math.min(a,1),e=Math.max(e,0),a=Math.max(a,0);var w=S?new Float32Array(b):new Array(b),V=!1,C=function(t){return V||g(),e===r&&a===n?t:0===t?0:1===t?1:l(d(t),r,n)};C.getControlPoints=function(){return[{x:e,y:r},{x:a,y:n}]};var T="generateBezier("+[e,r,a,n]+")";return C.toString=function(){return T},C}function u(e,t){var r=e;return m.isString(e)?b.Easings[e]||(r=!1):r=m.isArray(e)&&1===e.length?s.apply(null,e):m.isArray(e)&&2===e.length?x.apply(null,e.concat([t])):m.isArray(e)&&4===e.length?l.apply(null,e):!1,r===!1&&(r=b.Easings[b.defaults.easing]?b.defaults.easing:v),r}function c(e){if(e){var t=(new Date).getTime(),r=b.State.calls.length;r>1e4&&(b.State.calls=n(b.State.calls));for(var o=0;r>o;o++)if(b.State.calls[o]){var s=b.State.calls[o],l=s[0],u=s[2],d=s[3],g=!!d,y=null;d||(d=b.State.calls[o][3]=t-16);for(var h=Math.min((t-d)/u.duration,1),v=0,x=l.length;x>v;v++){var P=l[v],V=P.element;if(i(V)){var C=!1;if(u.display!==a&&null!==u.display&&"none"!==u.display){if("flex"===u.display){var T=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];f.each(T,function(e,t){S.setPropertyValue(V,"display",t)})}S.setPropertyValue(V,"display",u.display)}u.visibility!==a&&"hidden"!==u.visibility&&S.setPropertyValue(V,"visibility",u.visibility);for(var k in P)if("element"!==k){var A,F=P[k],j=m.isString(F.easing)?b.Easings[F.easing]:F.easing;if(1===h)A=F.endValue;else{var E=F.endValue-F.startValue;if(A=F.startValue+E*j(h,u,E),!g&&A===F.currentValue)continue}if(F.currentValue=A,"tween"===k)y=A;else{if(S.Hooks.registered[k]){var H=S.Hooks.getRoot(k),N=i(V).rootPropertyValueCache[H];N&&(F.rootPropertyValue=N)}var L=S.setPropertyValue(V,k,F.currentValue+(0===parseFloat(A)?"":F.unitType),F.rootPropertyValue,F.scrollData);S.Hooks.registered[k]&&(i(V).rootPropertyValueCache[H]=S.Normalizations.registered[H]?S.Normalizations.registered[H]("extract",null,L[1]):L[1]),"transform"===L[0]&&(C=!0)}}u.mobileHA&&i(V).transformCache.translate3d===a&&(i(V).transformCache.translate3d="(0px, 0px, 0px)",C=!0),C&&S.flushTransformCache(V)}}u.display!==a&&"none"!==u.display&&(b.State.calls[o][2].display=!1),u.visibility!==a&&"hidden"!==u.visibility&&(b.State.calls[o][2].visibility=!1),u.progress&&u.progress.call(s[1],s[1],h,Math.max(0,d+u.duration-t),d,y),1===h&&p(o)}}b.State.isTicking&&w(c)}function p(e,t){if(!b.State.calls[e])return!1;for(var r=b.State.calls[e][0],n=b.State.calls[e][1],o=b.State.calls[e][2],s=b.State.calls[e][4],l=!1,u=0,c=r.length;c>u;u++){var p=r[u].element;if(t||o.loop||("none"===o.display&&S.setPropertyValue(p,"display",o.display),"hidden"===o.visibility&&S.setPropertyValue(p,"visibility",o.visibility)),o.loop!==!0&&(f.queue(p)[1]===a||!/\.velocityQueueEntryFlag/i.test(f.queue(p)[1]))&&i(p)){i(p).isAnimating=!1,i(p).rootPropertyValueCache={};var d=!1;f.each(S.Lists.transforms3D,function(e,t){var r=/^scale/.test(t)?1:0,n=i(p).transformCache[t];i(p).transformCache[t]!==a&&new RegExp("^\\("+r+"[^.]").test(n)&&(d=!0,delete i(p).transformCache[t])}),o.mobileHA&&(d=!0,delete i(p).transformCache.translate3d),d&&S.flushTransformCache(p),S.Values.removeClass(p,"velocity-animating")}if(!t&&o.complete&&!o.loop&&u===c-1)try{o.complete.call(n,n)}catch(g){setTimeout(function(){throw g},1)}s&&o.loop!==!0&&s(n),i(p)&&o.loop===!0&&!t&&(f.each(i(p).tweensContainer,function(e,t){/^rotate/.test(e)&&360===parseFloat(t.endValue)&&(t.endValue=0,t.startValue=360),/^backgroundPosition/.test(e)&&100===parseFloat(t.endValue)&&"%"===t.unitType&&(t.endValue=0,t.startValue=100)}),b(p,"reverse",{loop:!0,delay:o.delay})),o.queue!==!1&&f.dequeue(p,o.queue)}b.State.calls[e]=!1;for(var m=0,y=b.State.calls.length;y>m;m++)if(b.State.calls[m]!==!1){l=!0;break}l===!1&&(b.State.isTicking=!1,delete b.State.calls,b.State.calls=[])}var f,d=function(){if(r.documentMode)return r.documentMode;for(var e=7;e>4;e--){var t=r.createElement("div");if(t.innerHTML="<!--[if IE "+e+"]><span></span><![endif]-->",t.getElementsByTagName("span").length)return t=null,e}return a}(),g=function(){var e=0;return t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||function(t){var r,a=(new Date).getTime();return r=Math.max(0,16-(a-e)),e=a+r,setTimeout(function(){t(a+r)},r)}}(),m={isString:function(e){return"string"==typeof e},isArray:Array.isArray||function(e){return"[object Array]"===Object.prototype.toString.call(e)},isFunction:function(e){return"[object Function]"===Object.prototype.toString.call(e)},isNode:function(e){return e&&e.nodeType},isNodeList:function(e){return"object"==typeof e&&/^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e))&&e.length!==a&&(0===e.length||"object"==typeof e[0]&&e[0].nodeType>0)},isWrapped:function(e){return e&&(e.jquery||t.Zepto&&t.Zepto.zepto.isZ(e))},isSVG:function(e){return t.SVGElement&&e instanceof t.SVGElement},isEmptyObject:function(e){for(var t in e)return!1;return!0}},y=!1;if(e.fn&&e.fn.jquery?(f=e,y=!0):f=t.Velocity.Utilities,8>=d&&!y)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if(7>=d)return void(jQuery.fn.velocity=jQuery.fn.animate);var h=400,v="swing",b={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:t.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:r.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:f,Redirects:{},Easings:{},Promise:t.Promise,defaults:{queue:"",duration:h,easing:v,begin:a,complete:a,progress:a,display:a,visibility:a,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(e){f.data(e,"velocity",{isSVG:m.isSVG(e),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};t.pageYOffset!==a?(b.State.scrollAnchor=t,b.State.scrollPropertyLeft="pageXOffset",b.State.scrollPropertyTop="pageYOffset"):(b.State.scrollAnchor=r.documentElement||r.body.parentNode||r.body,b.State.scrollPropertyLeft="scrollLeft",b.State.scrollPropertyTop="scrollTop");var x=function(){function e(e){return-e.tension*e.x-e.friction*e.v}function t(t,r,a){var n={x:t.x+a.dx*r,v:t.v+a.dv*r,tension:t.tension,friction:t.friction};return{dx:n.v,dv:e(n)}}function r(r,a){var n={dx:r.v,dv:e(r)},o=t(r,.5*a,n),i=t(r,.5*a,o),s=t(r,a,i),l=1/6*(n.dx+2*(o.dx+i.dx)+s.dx),u=1/6*(n.dv+2*(o.dv+i.dv)+s.dv);return r.x=r.x+l*a,r.v=r.v+u*a,r}return function a(e,t,n){var o,i,s,l={x:-1,v:0,tension:null,friction:null},u=[0],c=0,p=1e-4,f=.016;for(e=parseFloat(e)||500,t=parseFloat(t)||20,n=n||null,l.tension=e,l.friction=t,o=null!==n,o?(c=a(e,t),i=c/n*f):i=f;s=r(s||l,i),u.push(1+s.x),c+=16,Math.abs(s.x)>p&&Math.abs(s.v)>p;);return o?function(e){return u[e*(u.length-1)|0]}:c}}();b.Easings={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},spring:function(e){return 1-Math.cos(4.5*e*Math.PI)*Math.exp(6*-e)}},f.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(e,t){b.Easings[t[0]]=l.apply(null,t[1])});var S=b.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(var e=0;e<S.Lists.colors.length;e++){var t="color"===S.Lists.colors[e]?"0 0 0 1":"255 255 255 1";S.Hooks.templates[S.Lists.colors[e]]=["Red Green Blue Alpha",t]}var r,a,n;if(d)for(r in S.Hooks.templates){a=S.Hooks.templates[r],n=a[0].split(" ");var o=a[1].match(S.RegEx.valueSplit);"Color"===n[0]&&(n.push(n.shift()),o.push(o.shift()),S.Hooks.templates[r]=[n.join(" "),o.join(" ")])}for(r in S.Hooks.templates){a=S.Hooks.templates[r],n=a[0].split(" ");for(var e in n){var i=r+n[e],s=e;S.Hooks.registered[i]=[r,s]}}},getRoot:function(e){var t=S.Hooks.registered[e];return t?t[0]:e},cleanRootPropertyValue:function(e,t){return S.RegEx.valueUnwrap.test(t)&&(t=t.match(S.RegEx.valueUnwrap)[1]),S.Values.isCSSNullValue(t)&&(t=S.Hooks.templates[e][1]),t},extractValue:function(e,t){var r=S.Hooks.registered[e];if(r){var a=r[0],n=r[1];return t=S.Hooks.cleanRootPropertyValue(a,t),t.toString().match(S.RegEx.valueSplit)[n]}return t},injectValue:function(e,t,r){var a=S.Hooks.registered[e];if(a){var n,o,i=a[0],s=a[1];return r=S.Hooks.cleanRootPropertyValue(i,r),n=r.toString().match(S.RegEx.valueSplit),n[s]=t,o=n.join(" ")}return r}},Normalizations:{registered:{clip:function(e,t,r){switch(e){case"name":return"clip";case"extract":var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r)?a=r:(a=r.toString().match(S.RegEx.valueUnwrap),a=a?a[1].replace(/,(\s+)?/g," "):r),a;case"inject":return"rect("+r+")"}},blur:function(e,t,r){switch(e){case"name":return b.State.isFirefox?"filter":"-webkit-filter";case"extract":var a=parseFloat(r);if(!a&&0!==a){var n=r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a=n?n[1]:0}return a;case"inject":return parseFloat(r)?"blur("+r+")":"none"}},opacity:function(e,t,r){if(8>=d)switch(e){case"name":return"filter";case"extract":var a=r.toString().match(/alpha\(opacity=(.*)\)/i);return r=a?a[1]/100:1;case"inject":return t.style.zoom=1,parseFloat(r)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(r),10)+")"}else switch(e){case"name":return"opacity";case"extract":return r;case"inject":return r}}},register:function(){9>=d||b.State.isGingerbread||(S.Lists.transformsBase=S.Lists.transformsBase.concat(S.Lists.transforms3D));for(var e=0;e<S.Lists.transformsBase.length;e++)!function(){var t=S.Lists.transformsBase[e];S.Normalizations.registered[t]=function(e,r,n){switch(e){case"name":return"transform";case"extract":return i(r)===a||i(r).transformCache[t]===a?/^scale/i.test(t)?1:0:i(r).transformCache[t].replace(/[()]/g,"");case"inject":var o=!1;switch(t.substr(0,t.length-1)){case"translate":o=!/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case"scal":case"scale":b.State.isAndroid&&i(r).transformCache[t]===a&&1>n&&(n=1),o=!/(\d)$/i.test(n);break;case"skew":o=!/(deg|\d)$/i.test(n);break;case"rotate":o=!/(deg|\d)$/i.test(n)}return o||(i(r).transformCache[t]="("+n+")"),i(r).transformCache[t]}}}();for(var e=0;e<S.Lists.colors.length;e++)!function(){var t=S.Lists.colors[e];S.Normalizations.registered[t]=function(e,r,n){switch(e){case"name":return t;case"extract":var o;if(S.RegEx.wrappedValueAlreadyExtracted.test(n))o=n;else{var i,s={black:"rgb(0, 0, 0)",blue:"rgb(0, 0, 255)",gray:"rgb(128, 128, 128)",green:"rgb(0, 128, 0)",red:"rgb(255, 0, 0)",white:"rgb(255, 255, 255)"};/^[A-z]+$/i.test(n)?i=s[n]!==a?s[n]:s.black:S.RegEx.isHex.test(n)?i="rgb("+S.Values.hexToRgb(n).join(" ")+")":/^rgba?\(/i.test(n)||(i=s.black),o=(i||n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g," ")}return 8>=d||3!==o.split(" ").length||(o+=" 1"),o;case"inject":return 8>=d?4===n.split(" ").length&&(n=n.split(/\s+/).slice(0,3).join(" ")):3===n.split(" ").length&&(n+=" 1"),(8>=d?"rgb":"rgba")+"("+n.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(e){return e.replace(/-(\w)/g,function(e,t){return t.toUpperCase()})},SVGAttribute:function(e){var t="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(d||b.State.isAndroid&&!b.State.isChrome)&&(t+="|transform"),new RegExp("^("+t+")$","i").test(e)},prefixCheck:function(e){if(b.State.prefixMatches[e])return[b.State.prefixMatches[e],!0];for(var t=["","Webkit","Moz","ms","O"],r=0,a=t.length;a>r;r++){var n;if(n=0===r?e:t[r]+e.replace(/^\w/,function(e){return e.toUpperCase()}),m.isString(b.State.prefixElement.style[n]))return b.State.prefixMatches[e]=n,[n,!0]}return[e,!1]}},Values:{hexToRgb:function(e){var t,r=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,a=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e=e.replace(r,function(e,t,r,a){return t+t+r+r+a+a}),t=a.exec(e),t?[parseInt(t[1],16),parseInt(t[2],16),parseInt(t[3],16)]:[0,0,0]},isCSSNullValue:function(e){return 0==e||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e)},getUnitType:function(e){return/^(rotate|skew)/i.test(e)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e)?"":"px"},getDisplayType:function(e){var t=e&&e.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t)?"inline":/^(li)$/i.test(t)?"list-item":/^(tr)$/i.test(t)?"table-row":/^(table)$/i.test(t)?"table":/^(tbody)$/i.test(t)?"table-row-group":"block"},addClass:function(e,t){e.classList?e.classList.add(t):e.className+=(e.className.length?" ":"")+t},removeClass:function(e,t){e.classList?e.classList.remove(t):e.className=e.className.toString().replace(new RegExp("(^|\\s)"+t.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(e,r,n,o){function s(e,r){function n(){u&&S.setPropertyValue(e,"display","none")}var l=0;if(8>=d)l=f.css(e,r);else{var u=!1;if(/^(width|height)$/.test(r)&&0===S.getPropertyValue(e,"display")&&(u=!0,S.setPropertyValue(e,"display",S.Values.getDisplayType(e))),!o){if("height"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var c=e.offsetHeight-(parseFloat(S.getPropertyValue(e,"borderTopWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderBottomWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingTop"))||0)-(parseFloat(S.getPropertyValue(e,"paddingBottom"))||0);return n(),c}if("width"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var p=e.offsetWidth-(parseFloat(S.getPropertyValue(e,"borderLeftWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderRightWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingLeft"))||0)-(parseFloat(S.getPropertyValue(e,"paddingRight"))||0);return n(),p}}var g;g=i(e)===a?t.getComputedStyle(e,null):i(e).computedStyle?i(e).computedStyle:i(e).computedStyle=t.getComputedStyle(e,null),"borderColor"===r&&(r="borderTopColor"),l=9===d&&"filter"===r?g.getPropertyValue(r):g[r],(""===l||null===l)&&(l=e.style[r]),n()}if("auto"===l&&/^(top|right|bottom|left)$/i.test(r)){var m=s(e,"position");("fixed"===m||"absolute"===m&&/top|left/i.test(r))&&(l=f(e).position()[r]+"px")}return l}var l;if(S.Hooks.registered[r]){var u=r,c=S.Hooks.getRoot(u);n===a&&(n=S.getPropertyValue(e,S.Names.prefixCheck(c)[0])),S.Normalizations.registered[c]&&(n=S.Normalizations.registered[c]("extract",e,n)),l=S.Hooks.extractValue(u,n)}else if(S.Normalizations.registered[r]){var p,g;p=S.Normalizations.registered[r]("name",e),"transform"!==p&&(g=s(e,S.Names.prefixCheck(p)[0]),S.Values.isCSSNullValue(g)&&S.Hooks.templates[r]&&(g=S.Hooks.templates[r][1])),l=S.Normalizations.registered[r]("extract",e,g)}if(!/^[\d-]/.test(l))if(i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r))if(/^(height|width)$/i.test(r))try{l=e.getBBox()[r]}catch(m){l=0}else l=e.getAttribute(r);else l=s(e,S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l)&&(l=0),b.debug>=2&&console.log("Get "+r+": "+l),l},setPropertyValue:function(e,r,a,n,o){var s=r;if("scroll"===r)o.container?o.container["scroll"+o.direction]=a:"Left"===o.direction?t.scrollTo(a,o.alternateValue):t.scrollTo(o.alternateValue,a);else if(S.Normalizations.registered[r]&&"transform"===S.Normalizations.registered[r]("name",e))S.Normalizations.registered[r]("inject",e,a),s="transform",a=i(e).transformCache[r];else{if(S.Hooks.registered[r]){var l=r,u=S.Hooks.getRoot(r);n=n||S.getPropertyValue(e,u),a=S.Hooks.injectValue(l,a,n),r=u}if(S.Normalizations.registered[r]&&(a=S.Normalizations.registered[r]("inject",e,a),r=S.Normalizations.registered[r]("name",e)),s=S.Names.prefixCheck(r)[0],8>=d)try{e.style[s]=a}catch(c){b.debug&&console.log("Browser does not support ["+a+"] for ["+s+"]")}else i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r)?e.setAttribute(r,a):e.style[s]=a;b.debug>=2&&console.log("Set "+r+" ("+s+"): "+a)}return[s,a]},flushTransformCache:function(e){function t(t){return parseFloat(S.getPropertyValue(e,t))}var r="";if((d||b.State.isAndroid&&!b.State.isChrome)&&i(e).isSVG){var a={translate:[t("translateX"),t("translateY")],skewX:[t("skewX")],skewY:[t("skewY")],scale:1!==t("scale")?[t("scale"),t("scale")]:[t("scaleX"),t("scaleY")],rotate:[t("rotateZ"),0,0]};f.each(i(e).transformCache,function(e){/^translate/i.test(e)?e="translate":/^scale/i.test(e)?e="scale":/^rotate/i.test(e)&&(e="rotate"),a[e]&&(r+=e+"("+a[e].join(" ")+") ",delete a[e])})}else{var n,o;f.each(i(e).transformCache,function(t){return n=i(e).transformCache[t],"transformPerspective"===t?(o=n,!0):(9===d&&"rotateZ"===t&&(t="rotate"),void(r+=t+n+" "))}),o&&(r="perspective"+o+" "+r)}S.setPropertyValue(e,"transform",r)}};S.Hooks.register(),S.Normalizations.register(),b.hook=function(e,t,r){var n=a;return e=o(e),f.each(e,function(e,o){if(i(o)===a&&b.init(o),r===a)n===a&&(n=b.CSS.getPropertyValue(o,t));else{var s=b.CSS.setPropertyValue(o,t,r);"transform"===s[0]&&b.CSS.flushTransformCache(o),n=s}}),n};var P=function(){function e(){return s?k.promise||null:l}function n(){function e(e){function p(e,t){var r=a,n=a,i=a;return m.isArray(e)?(r=e[0],!m.isArray(e[1])&&/^[\d-]/.test(e[1])||m.isFunction(e[1])||S.RegEx.isHex.test(e[1])?i=e[1]:(m.isString(e[1])&&!S.RegEx.isHex.test(e[1])||m.isArray(e[1]))&&(n=t?e[1]:u(e[1],s.duration),e[2]!==a&&(i=e[2]))):r=e,t||(n=n||s.easing),m.isFunction(r)&&(r=r.call(o,V,w)),m.isFunction(i)&&(i=i.call(o,V,w)),[r||0,n,i]}function d(e,t){var r,a;return a=(t||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(e){return r=e,""}),r||(r=S.Values.getUnitType(e)),[a,r]}function h(){var e={myParent:o.parentNode||r.body,position:S.getPropertyValue(o,"position"),fontSize:S.getPropertyValue(o,"fontSize")},a=e.position===L.lastPosition&&e.myParent===L.lastParent,n=e.fontSize===L.lastFontSize;L.lastParent=e.myParent,L.lastPosition=e.position,L.lastFontSize=e.fontSize;var s=100,l={};if(n&&a)l.emToPx=L.lastEmToPx,l.percentToPxWidth=L.lastPercentToPxWidth,l.percentToPxHeight=L.lastPercentToPxHeight;else{var u=i(o).isSVG?r.createElementNS("http://www.w3.org/2000/svg","rect"):r.createElement("div");b.init(u),e.myParent.appendChild(u),f.each(["overflow","overflowX","overflowY"],function(e,t){b.CSS.setPropertyValue(u,t,"hidden")}),b.CSS.setPropertyValue(u,"position",e.position),b.CSS.setPropertyValue(u,"fontSize",e.fontSize),b.CSS.setPropertyValue(u,"boxSizing","content-box"),f.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(e,t){b.CSS.setPropertyValue(u,t,s+"%")}),b.CSS.setPropertyValue(u,"paddingLeft",s+"em"),l.percentToPxWidth=L.lastPercentToPxWidth=(parseFloat(S.getPropertyValue(u,"width",null,!0))||1)/s,l.percentToPxHeight=L.lastPercentToPxHeight=(parseFloat(S.getPropertyValue(u,"height",null,!0))||1)/s,l.emToPx=L.lastEmToPx=(parseFloat(S.getPropertyValue(u,"paddingLeft"))||1)/s,e.myParent.removeChild(u)}return null===L.remToPx&&(L.remToPx=parseFloat(S.getPropertyValue(r.body,"fontSize"))||16),null===L.vwToPx&&(L.vwToPx=parseFloat(t.innerWidth)/100,L.vhToPx=parseFloat(t.innerHeight)/100),l.remToPx=L.remToPx,l.vwToPx=L.vwToPx,l.vhToPx=L.vhToPx,b.debug>=1&&console.log("Unit ratios: "+JSON.stringify(l),o),l}if(s.begin&&0===V)try{s.begin.call(g,g)}catch(x){setTimeout(function(){throw x},1)}if("scroll"===A){var P,C,T,F=/^x$/i.test(s.axis)?"Left":"Top",j=parseFloat(s.offset)||0;s.container?m.isWrapped(s.container)||m.isNode(s.container)?(s.container=s.container[0]||s.container,P=s.container["scroll"+F],T=P+f(o).position()[F.toLowerCase()]+j):s.container=null:(P=b.State.scrollAnchor[b.State["scrollProperty"+F]],C=b.State.scrollAnchor[b.State["scrollProperty"+("Left"===F?"Top":"Left")]],T=f(o).offset()[F.toLowerCase()]+j),l={scroll:{rootPropertyValue:!1,startValue:P,currentValue:P,endValue:T,unitType:"",easing:s.easing,scrollData:{container:s.container,direction:F,alternateValue:C}},element:o},b.debug&&console.log("tweensContainer (scroll): ",l.scroll,o)}else if("reverse"===A){if(!i(o).tweensContainer)return void f.dequeue(o,s.queue);"none"===i(o).opts.display&&(i(o).opts.display="auto"),"hidden"===i(o).opts.visibility&&(i(o).opts.visibility="visible"),i(o).opts.loop=!1,i(o).opts.begin=null,i(o).opts.complete=null,v.easing||delete s.easing,v.duration||delete s.duration,s=f.extend({},i(o).opts,s);var E=f.extend(!0,{},i(o).tweensContainer);for(var H in E)if("element"!==H){var N=E[H].startValue;E[H].startValue=E[H].currentValue=E[H].endValue,E[H].endValue=N,m.isEmptyObject(v)||(E[H].easing=s.easing),b.debug&&console.log("reverse tweensContainer ("+H+"): "+JSON.stringify(E[H]),o)}l=E}else if("start"===A){var E;i(o).tweensContainer&&i(o).isAnimating===!0&&(E=i(o).tweensContainer),f.each(y,function(e,t){if(RegExp("^"+S.Lists.colors.join("$|^")+"$").test(e)){var r=p(t,!0),n=r[0],o=r[1],i=r[2];if(S.RegEx.isHex.test(n)){for(var s=["Red","Green","Blue"],l=S.Values.hexToRgb(n),u=i?S.Values.hexToRgb(i):a,c=0;c<s.length;c++){var f=[l[c]];o&&f.push(o),u!==a&&f.push(u[c]),y[e+s[c]]=f}delete y[e]}}});for(var z in y){var O=p(y[z]),q=O[0],$=O[1],M=O[2];z=S.Names.camelCase(z);var I=S.Hooks.getRoot(z),B=!1;if(i(o).isSVG||"tween"===I||S.Names.prefixCheck(I)[1]!==!1||S.Normalizations.registered[I]!==a){(s.display!==a&&null!==s.display&&"none"!==s.display||s.visibility!==a&&"hidden"!==s.visibility)&&/opacity|filter/.test(z)&&!M&&0!==q&&(M=0),s._cacheValues&&E&&E[z]?(M===a&&(M=E[z].endValue+E[z].unitType),B=i(o).rootPropertyValueCache[I]):S.Hooks.registered[z]?M===a?(B=S.getPropertyValue(o,I),M=S.getPropertyValue(o,z,B)):B=S.Hooks.templates[I][1]:M===a&&(M=S.getPropertyValue(o,z));var W,G,Y,D=!1;if(W=d(z,M),M=W[0],Y=W[1],W=d(z,q),q=W[0].replace(/^([+-\/*])=/,function(e,t){return D=t,""}),G=W[1],M=parseFloat(M)||0,q=parseFloat(q)||0,"%"===G&&(/^(fontSize|lineHeight)$/.test(z)?(q/=100,G="em"):/^scale/.test(z)?(q/=100,G=""):/(Red|Green|Blue)$/i.test(z)&&(q=q/100*255,G="")),/[\/*]/.test(D))G=Y;else if(Y!==G&&0!==M)if(0===q)G=Y;else{n=n||h();var Q=/margin|padding|left|right|width|text|word|letter/i.test(z)||/X$/.test(z)||"x"===z?"x":"y";switch(Y){case"%":M*="x"===Q?n.percentToPxWidth:n.percentToPxHeight;break;case"px":break;default:M*=n[Y+"ToPx"]}switch(G){case"%":M*=1/("x"===Q?n.percentToPxWidth:n.percentToPxHeight);break;case"px":break;default:M*=1/n[G+"ToPx"]}}switch(D){case"+":q=M+q;break;case"-":q=M-q;break;case"*":q=M*q;break;case"/":q=M/q}l[z]={rootPropertyValue:B,startValue:M,currentValue:M,endValue:q,unitType:G,easing:$},b.debug&&console.log("tweensContainer ("+z+"): "+JSON.stringify(l[z]),o)}else b.debug&&console.log("Skipping ["+I+"] due to a lack of browser support.")}l.element=o}l.element&&(S.Values.addClass(o,"velocity-animating"),R.push(l),""===s.queue&&(i(o).tweensContainer=l,i(o).opts=s),i(o).isAnimating=!0,V===w-1?(b.State.calls.push([R,g,s,null,k.resolver]),b.State.isTicking===!1&&(b.State.isTicking=!0,c())):V++)}var n,o=this,s=f.extend({},b.defaults,v),l={};switch(i(o)===a&&b.init(o),parseFloat(s.delay)&&s.queue!==!1&&f.queue(o,s.queue,function(e){b.velocityQueueEntryFlag=!0,i(o).delayTimer={setTimeout:setTimeout(e,parseFloat(s.delay)),next:e}}),s.duration.toString().toLowerCase()){case"fast":s.duration=200;break;case"normal":s.duration=h;break;case"slow":s.duration=600;break;default:s.duration=parseFloat(s.duration)||1}b.mock!==!1&&(b.mock===!0?s.duration=s.delay=1:(s.duration*=parseFloat(b.mock)||1,s.delay*=parseFloat(b.mock)||1)),s.easing=u(s.easing,s.duration),s.begin&&!m.isFunction(s.begin)&&(s.begin=null),s.progress&&!m.isFunction(s.progress)&&(s.progress=null),s.complete&&!m.isFunction(s.complete)&&(s.complete=null),s.display!==a&&null!==s.display&&(s.display=s.display.toString().toLowerCase(),"auto"===s.display&&(s.display=b.CSS.Values.getDisplayType(o))),s.visibility!==a&&null!==s.visibility&&(s.visibility=s.visibility.toString().toLowerCase()),s.mobileHA=s.mobileHA&&b.State.isMobile&&!b.State.isGingerbread,s.queue===!1?s.delay?setTimeout(e,s.delay):e():f.queue(o,s.queue,function(t,r){return r===!0?(k.promise&&k.resolver(g),!0):(b.velocityQueueEntryFlag=!0,void e(t))}),""!==s.queue&&"fx"!==s.queue||"inprogress"===f.queue(o)[0]||f.dequeue(o)}var s,l,d,g,y,v,x=arguments[0]&&(arguments[0].p||f.isPlainObject(arguments[0].properties)&&!arguments[0].properties.names||m.isString(arguments[0].properties));if(m.isWrapped(this)?(s=!1,d=0,g=this,l=this):(s=!0,d=1,g=x?arguments[0].elements||arguments[0].e:arguments[0]),g=o(g)){x?(y=arguments[0].properties||arguments[0].p,v=arguments[0].options||arguments[0].o):(y=arguments[d],v=arguments[d+1]);var w=g.length,V=0;if(!/^(stop|finish)$/i.test(y)&&!f.isPlainObject(v)){var C=d+1;v={};for(var T=C;T<arguments.length;T++)m.isArray(arguments[T])||!/^(fast|normal|slow)$/i.test(arguments[T])&&!/^\d/.test(arguments[T])?m.isString(arguments[T])||m.isArray(arguments[T])?v.easing=arguments[T]:m.isFunction(arguments[T])&&(v.complete=arguments[T]):v.duration=arguments[T]}var k={promise:null,resolver:null,rejecter:null};s&&b.Promise&&(k.promise=new b.Promise(function(e,t){k.resolver=e,k.rejecter=t}));var A;switch(y){case"scroll":A="scroll";break;case"reverse":A="reverse";break;case"finish":case"stop":f.each(g,function(e,t){i(t)&&i(t).delayTimer&&(clearTimeout(i(t).delayTimer.setTimeout),i(t).delayTimer.next&&i(t).delayTimer.next(),delete i(t).delayTimer)});var F=[];return f.each(b.State.calls,function(e,t){t&&f.each(t[1],function(r,n){var o=v===a?"":v;return o===!0||t[2].queue===o||v===a&&t[2].queue===!1?void f.each(g,function(r,a){a===n&&((v===!0||m.isString(v))&&(f.each(f.queue(a,m.isString(v)?v:""),function(e,t){
+m.isFunction(t)&&t(null,!0)}),f.queue(a,m.isString(v)?v:"",[])),"stop"===y?(i(a)&&i(a).tweensContainer&&o!==!1&&f.each(i(a).tweensContainer,function(e,t){t.endValue=t.currentValue}),F.push(e)):"finish"===y&&(t[2].duration=1))}):!0})}),"stop"===y&&(f.each(F,function(e,t){p(t,!0)}),k.promise&&k.resolver(g)),e();default:if(!f.isPlainObject(y)||m.isEmptyObject(y)){if(m.isString(y)&&b.Redirects[y]){var j=f.extend({},v),E=j.duration,H=j.delay||0;return j.backwards===!0&&(g=f.extend(!0,[],g).reverse()),f.each(g,function(e,t){parseFloat(j.stagger)?j.delay=H+parseFloat(j.stagger)*e:m.isFunction(j.stagger)&&(j.delay=H+j.stagger.call(t,e,w)),j.drag&&(j.duration=parseFloat(E)||(/^(callout|transition)/.test(y)?1e3:h),j.duration=Math.max(j.duration*(j.backwards?1-e/w:(e+1)/w),.75*j.duration,200)),b.Redirects[y].call(t,t,j||{},e,w,g,k.promise?k:a)}),e()}var N="Velocity: First argument ("+y+") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise?k.rejecter(new Error(N)):console.log(N),e()}A="start"}var L={lastParent:null,lastPosition:null,lastFontSize:null,lastPercentToPxWidth:null,lastPercentToPxHeight:null,lastEmToPx:null,remToPx:null,vwToPx:null,vhToPx:null},R=[];f.each(g,function(e,t){m.isNode(t)&&n.call(t)});var z,j=f.extend({},b.defaults,v);if(j.loop=parseInt(j.loop),z=2*j.loop-1,j.loop)for(var O=0;z>O;O++){var q={delay:j.delay,progress:j.progress};O===z-1&&(q.display=j.display,q.visibility=j.visibility,q.complete=j.complete),P(g,"reverse",q)}return e()}};b=f.extend(P,b),b.animate=P;var w=t.requestAnimationFrame||g;return b.State.isMobile||r.hidden===a||r.addEventListener("visibilitychange",function(){r.hidden?(w=function(e){return setTimeout(function(){e(!0)},16)},c()):w=t.requestAnimationFrame||g}),e.Velocity=b,e!==t&&(e.fn.velocity=P,e.fn.velocity.defaults=b.defaults),f.each(["Down","Up"],function(e,t){b.Redirects["slide"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u=l.begin,c=l.complete,p={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},d={};l.display===a&&(l.display="Down"===t?"inline"===b.CSS.Values.getDisplayType(e)?"inline-block":"block":"none"),l.begin=function(){u&&u.call(i,i);for(var r in p){d[r]=e.style[r];var a=b.CSS.getPropertyValue(e,r);p[r]="Down"===t?[a,0]:[0,a]}d.overflow=e.style.overflow,e.style.overflow="hidden"},l.complete=function(){for(var t in d)e.style[t]=d[t];c&&c.call(i,i),s&&s.resolver(i)},b(e,p,l)}}),f.each(["In","Out"],function(e,t){b.Redirects["fade"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u={opacity:"In"===t?1:0},c=l.complete;l.complete=n!==o-1?l.begin=null:function(){c&&c.call(i,i),s&&s.resolver(i)},l.display===a&&(l.display="In"===t?"auto":"none"),b(this,u,l)}}),b}(window.jQuery||window.Zepto||window,window,document)}));
+;!function(a,b,c,d){"use strict";function k(a,b,c){return setTimeout(q(a,c),b)}function l(a,b,c){return Array.isArray(a)?(m(a,c[b],c),!0):!1}function m(a,b,c){var e;if(a)if(a.forEach)a.forEach(b,c);else if(a.length!==d)for(e=0;e<a.length;)b.call(c,a[e],e,a),e++;else for(e in a)a.hasOwnProperty(e)&&b.call(c,a[e],e,a)}function n(a,b,c){for(var e=Object.keys(b),f=0;f<e.length;)(!c||c&&a[e[f]]===d)&&(a[e[f]]=b[e[f]]),f++;return a}function o(a,b){return n(a,b,!0)}function p(a,b,c){var e,d=b.prototype;e=a.prototype=Object.create(d),e.constructor=a,e._super=d,c&&n(e,c)}function q(a,b){return function(){return a.apply(b,arguments)}}function r(a,b){return typeof a==g?a.apply(b?b[0]||d:d,b):a}function s(a,b){return a===d?b:a}function t(a,b,c){m(x(b),function(b){a.addEventListener(b,c,!1)})}function u(a,b,c){m(x(b),function(b){a.removeEventListener(b,c,!1)})}function v(a,b){for(;a;){if(a==b)return!0;a=a.parentNode}return!1}function w(a,b){return a.indexOf(b)>-1}function x(a){return a.trim().split(/\s+/g)}function y(a,b,c){if(a.indexOf&&!c)return a.indexOf(b);for(var d=0;d<a.length;){if(c&&a[d][c]==b||!c&&a[d]===b)return d;d++}return-1}function z(a){return Array.prototype.slice.call(a,0)}function A(a,b,c){for(var d=[],e=[],f=0;f<a.length;){var g=b?a[f][b]:a[f];y(e,g)<0&&d.push(a[f]),e[f]=g,f++}return c&&(d=b?d.sort(function(a,c){return a[b]>c[b]}):d.sort()),d}function B(a,b){for(var c,f,g=b[0].toUpperCase()+b.slice(1),h=0;h<e.length;){if(c=e[h],f=c?c+g:b,f in a)return f;h++}return d}function D(){return C++}function E(a){var b=a.ownerDocument;return b.defaultView||b.parentWindow}function ab(a,b){var c=this;this.manager=a,this.callback=b,this.element=a.element,this.target=a.options.inputTarget,this.domHandler=function(b){r(a.options.enable,[a])&&c.handler(b)},this.init()}function bb(a){var b,c=a.options.inputClass;return b=c?c:H?wb:I?Eb:G?Gb:rb,new b(a,cb)}function cb(a,b,c){var d=c.pointers.length,e=c.changedPointers.length,f=b&O&&0===d-e,g=b&(Q|R)&&0===d-e;c.isFirst=!!f,c.isFinal=!!g,f&&(a.session={}),c.eventType=b,db(a,c),a.emit("hammer.input",c),a.recognize(c),a.session.prevInput=c}function db(a,b){var c=a.session,d=b.pointers,e=d.length;c.firstInput||(c.firstInput=gb(b)),e>1&&!c.firstMultiple?c.firstMultiple=gb(b):1===e&&(c.firstMultiple=!1);var f=c.firstInput,g=c.firstMultiple,h=g?g.center:f.center,i=b.center=hb(d);b.timeStamp=j(),b.deltaTime=b.timeStamp-f.timeStamp,b.angle=lb(h,i),b.distance=kb(h,i),eb(c,b),b.offsetDirection=jb(b.deltaX,b.deltaY),b.scale=g?nb(g.pointers,d):1,b.rotation=g?mb(g.pointers,d):0,fb(c,b);var k=a.element;v(b.srcEvent.target,k)&&(k=b.srcEvent.target),b.target=k}function eb(a,b){var c=b.center,d=a.offsetDelta||{},e=a.prevDelta||{},f=a.prevInput||{};(b.eventType===O||f.eventType===Q)&&(e=a.prevDelta={x:f.deltaX||0,y:f.deltaY||0},d=a.offsetDelta={x:c.x,y:c.y}),b.deltaX=e.x+(c.x-d.x),b.deltaY=e.y+(c.y-d.y)}function fb(a,b){var f,g,h,j,c=a.lastInterval||b,e=b.timeStamp-c.timeStamp;if(b.eventType!=R&&(e>N||c.velocity===d)){var k=c.deltaX-b.deltaX,l=c.deltaY-b.deltaY,m=ib(e,k,l);g=m.x,h=m.y,f=i(m.x)>i(m.y)?m.x:m.y,j=jb(k,l),a.lastInterval=b}else f=c.velocity,g=c.velocityX,h=c.velocityY,j=c.direction;b.velocity=f,b.velocityX=g,b.velocityY=h,b.direction=j}function gb(a){for(var b=[],c=0;c<a.pointers.length;)b[c]={clientX:h(a.pointers[c].clientX),clientY:h(a.pointers[c].clientY)},c++;return{timeStamp:j(),pointers:b,center:hb(b),deltaX:a.deltaX,deltaY:a.deltaY}}function hb(a){var b=a.length;if(1===b)return{x:h(a[0].clientX),y:h(a[0].clientY)};for(var c=0,d=0,e=0;b>e;)c+=a[e].clientX,d+=a[e].clientY,e++;return{x:h(c/b),y:h(d/b)}}function ib(a,b,c){return{x:b/a||0,y:c/a||0}}function jb(a,b){return a===b?S:i(a)>=i(b)?a>0?T:U:b>0?V:W}function kb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return Math.sqrt(d*d+e*e)}function lb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return 180*Math.atan2(e,d)/Math.PI}function mb(a,b){return lb(b[1],b[0],_)-lb(a[1],a[0],_)}function nb(a,b){return kb(b[0],b[1],_)/kb(a[0],a[1],_)}function rb(){this.evEl=pb,this.evWin=qb,this.allow=!0,this.pressed=!1,ab.apply(this,arguments)}function wb(){this.evEl=ub,this.evWin=vb,ab.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function Ab(){this.evTarget=yb,this.evWin=zb,this.started=!1,ab.apply(this,arguments)}function Bb(a,b){var c=z(a.touches),d=z(a.changedTouches);return b&(Q|R)&&(c=A(c.concat(d),"identifier",!0)),[c,d]}function Eb(){this.evTarget=Db,this.targetIds={},ab.apply(this,arguments)}function Fb(a,b){var c=z(a.touches),d=this.targetIds;if(b&(O|P)&&1===c.length)return d[c[0].identifier]=!0,[c,c];var e,f,g=z(a.changedTouches),h=[],i=this.target;if(f=c.filter(function(a){return v(a.target,i)}),b===O)for(e=0;e<f.length;)d[f[e].identifier]=!0,e++;for(e=0;e<g.length;)d[g[e].identifier]&&h.push(g[e]),b&(Q|R)&&delete d[g[e].identifier],e++;return h.length?[A(f.concat(h),"identifier",!0),h]:void 0}function Gb(){ab.apply(this,arguments);var a=q(this.handler,this);this.touch=new Eb(this.manager,a),this.mouse=new rb(this.manager,a)}function Pb(a,b){this.manager=a,this.set(b)}function Qb(a){if(w(a,Mb))return Mb;var b=w(a,Nb),c=w(a,Ob);return b&&c?Nb+" "+Ob:b||c?b?Nb:Ob:w(a,Lb)?Lb:Kb}function Yb(a){this.id=D(),this.manager=null,this.options=o(a||{},this.defaults),this.options.enable=s(this.options.enable,!0),this.state=Rb,this.simultaneous={},this.requireFail=[]}function Zb(a){return a&Wb?"cancel":a&Ub?"end":a&Tb?"move":a&Sb?"start":""}function $b(a){return a==W?"down":a==V?"up":a==T?"left":a==U?"right":""}function _b(a,b){var c=b.manager;return c?c.get(a):a}function ac(){Yb.apply(this,arguments)}function bc(){ac.apply(this,arguments),this.pX=null,this.pY=null}function cc(){ac.apply(this,arguments)}function dc(){Yb.apply(this,arguments),this._timer=null,this._input=null}function ec(){ac.apply(this,arguments)}function fc(){ac.apply(this,arguments)}function gc(){Yb.apply(this,arguments),this.pTime=!1,this.pCenter=!1,this._timer=null,this._input=null,this.count=0}function hc(a,b){return b=b||{},b.recognizers=s(b.recognizers,hc.defaults.preset),new kc(a,b)}function kc(a,b){b=b||{},this.options=o(b,hc.defaults),this.options.inputTarget=this.options.inputTarget||a,this.handlers={},this.session={},this.recognizers=[],this.element=a,this.input=bb(this),this.touchAction=new Pb(this,this.options.touchAction),lc(this,!0),m(b.recognizers,function(a){var b=this.add(new a[0](a[1]));a[2]&&b.recognizeWith(a[2]),a[3]&&b.requireFailure(a[3])},this)}function lc(a,b){var c=a.element;m(a.options.cssProps,function(a,d){c.style[B(c.style,d)]=b?a:""})}function mc(a,c){var d=b.createEvent("Event");d.initEvent(a,!0,!0),d.gesture=c,c.target.dispatchEvent(d)}var e=["","webkit","moz","MS","ms","o"],f=b.createElement("div"),g="function",h=Math.round,i=Math.abs,j=Date.now,C=1,F=/mobile|tablet|ip(ad|hone|od)|android/i,G="ontouchstart"in a,H=B(a,"PointerEvent")!==d,I=G&&F.test(navigator.userAgent),J="touch",K="pen",L="mouse",M="kinect",N=25,O=1,P=2,Q=4,R=8,S=1,T=2,U=4,V=8,W=16,X=T|U,Y=V|W,Z=X|Y,$=["x","y"],_=["clientX","clientY"];ab.prototype={handler:function(){},init:function(){this.evEl&&t(this.element,this.evEl,this.domHandler),this.evTarget&&t(this.target,this.evTarget,this.domHandler),this.evWin&&t(E(this.element),this.evWin,this.domHandler)},destroy:function(){this.evEl&&u(this.element,this.evEl,this.domHandler),this.evTarget&&u(this.target,this.evTarget,this.domHandler),this.evWin&&u(E(this.element),this.evWin,this.domHandler)}};var ob={mousedown:O,mousemove:P,mouseup:Q},pb="mousedown",qb="mousemove mouseup";p(rb,ab,{handler:function(a){var b=ob[a.type];b&O&&0===a.button&&(this.pressed=!0),b&P&&1!==a.which&&(b=Q),this.pressed&&this.allow&&(b&Q&&(this.pressed=!1),this.callback(this.manager,b,{pointers:[a],changedPointers:[a],pointerType:L,srcEvent:a}))}});var sb={pointerdown:O,pointermove:P,pointerup:Q,pointercancel:R,pointerout:R},tb={2:J,3:K,4:L,5:M},ub="pointerdown",vb="pointermove pointerup pointercancel";a.MSPointerEvent&&(ub="MSPointerDown",vb="MSPointerMove MSPointerUp MSPointerCancel"),p(wb,ab,{handler:function(a){var b=this.store,c=!1,d=a.type.toLowerCase().replace("ms",""),e=sb[d],f=tb[a.pointerType]||a.pointerType,g=f==J,h=y(b,a.pointerId,"pointerId");e&O&&(0===a.button||g)?0>h&&(b.push(a),h=b.length-1):e&(Q|R)&&(c=!0),0>h||(b[h]=a,this.callback(this.manager,e,{pointers:b,changedPointers:[a],pointerType:f,srcEvent:a}),c&&b.splice(h,1))}});var xb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},yb="touchstart",zb="touchstart touchmove touchend touchcancel";p(Ab,ab,{handler:function(a){var b=xb[a.type];if(b===O&&(this.started=!0),this.started){var c=Bb.call(this,a,b);b&(Q|R)&&0===c[0].length-c[1].length&&(this.started=!1),this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}});var Cb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},Db="touchstart touchmove touchend touchcancel";p(Eb,ab,{handler:function(a){var b=Cb[a.type],c=Fb.call(this,a,b);c&&this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}),p(Gb,ab,{handler:function(a,b,c){var d=c.pointerType==J,e=c.pointerType==L;if(d)this.mouse.allow=!1;else if(e&&!this.mouse.allow)return;b&(Q|R)&&(this.mouse.allow=!0),this.callback(a,b,c)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Hb=B(f.style,"touchAction"),Ib=Hb!==d,Jb="compute",Kb="auto",Lb="manipulation",Mb="none",Nb="pan-x",Ob="pan-y";Pb.prototype={set:function(a){a==Jb&&(a=this.compute()),Ib&&(this.manager.element.style[Hb]=a),this.actions=a.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var a=[];return m(this.manager.recognizers,function(b){r(b.options.enable,[b])&&(a=a.concat(b.getTouchAction()))}),Qb(a.join(" "))},preventDefaults:function(a){if(!Ib){var b=a.srcEvent,c=a.offsetDirection;if(this.manager.session.prevented)return b.preventDefault(),void 0;var d=this.actions,e=w(d,Mb),f=w(d,Ob),g=w(d,Nb);return e||f&&c&X||g&&c&Y?this.preventSrc(b):void 0}},preventSrc:function(a){this.manager.session.prevented=!0,a.preventDefault()}};var Rb=1,Sb=2,Tb=4,Ub=8,Vb=Ub,Wb=16,Xb=32;Yb.prototype={defaults:{},set:function(a){return n(this.options,a),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(a){if(l(a,"recognizeWith",this))return this;var b=this.simultaneous;return a=_b(a,this),b[a.id]||(b[a.id]=a,a.recognizeWith(this)),this},dropRecognizeWith:function(a){return l(a,"dropRecognizeWith",this)?this:(a=_b(a,this),delete this.simultaneous[a.id],this)},requireFailure:function(a){if(l(a,"requireFailure",this))return this;var b=this.requireFail;return a=_b(a,this),-1===y(b,a)&&(b.push(a),a.requireFailure(this)),this},dropRequireFailure:function(a){if(l(a,"dropRequireFailure",this))return this;a=_b(a,this);var b=y(this.requireFail,a);return b>-1&&this.requireFail.splice(b,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(a){return!!this.simultaneous[a.id]},emit:function(a){function d(d){b.manager.emit(b.options.event+(d?Zb(c):""),a)}var b=this,c=this.state;Ub>c&&d(!0),d(),c>=Ub&&d(!0)},tryEmit:function(a){return this.canEmit()?this.emit(a):(this.state=Xb,void 0)},canEmit:function(){for(var a=0;a<this.requireFail.length;){if(!(this.requireFail[a].state&(Xb|Rb)))return!1;a++}return!0},recognize:function(a){var b=n({},a);return r(this.options.enable,[this,b])?(this.state&(Vb|Wb|Xb)&&(this.state=Rb),this.state=this.process(b),this.state&(Sb|Tb|Ub|Wb)&&this.tryEmit(b),void 0):(this.reset(),this.state=Xb,void 0)},process:function(){},getTouchAction:function(){},reset:function(){}},p(ac,Yb,{defaults:{pointers:1},attrTest:function(a){var b=this.options.pointers;return 0===b||a.pointers.length===b},process:function(a){var b=this.state,c=a.eventType,d=b&(Sb|Tb),e=this.attrTest(a);return d&&(c&R||!e)?b|Wb:d||e?c&Q?b|Ub:b&Sb?b|Tb:Sb:Xb}}),p(bc,ac,{defaults:{event:"pan",threshold:10,pointers:1,direction:Z},getTouchAction:function(){var a=this.options.direction,b=[];return a&X&&b.push(Ob),a&Y&&b.push(Nb),b},directionTest:function(a){var b=this.options,c=!0,d=a.distance,e=a.direction,f=a.deltaX,g=a.deltaY;return e&b.direction||(b.direction&X?(e=0===f?S:0>f?T:U,c=f!=this.pX,d=Math.abs(a.deltaX)):(e=0===g?S:0>g?V:W,c=g!=this.pY,d=Math.abs(a.deltaY))),a.direction=e,c&&d>b.threshold&&e&b.direction},attrTest:function(a){return ac.prototype.attrTest.call(this,a)&&(this.state&Sb||!(this.state&Sb)&&this.directionTest(a))},emit:function(a){this.pX=a.deltaX,this.pY=a.deltaY;var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this._super.emit.call(this,a)}}),p(cc,ac,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.scale-1)>this.options.threshold||this.state&Sb)},emit:function(a){if(this._super.emit.call(this,a),1!==a.scale){var b=a.scale<1?"in":"out";this.manager.emit(this.options.event+b,a)}}}),p(dc,Yb,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[Kb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,e=a.deltaTime>b.time;if(this._input=a,!d||!c||a.eventType&(Q|R)&&!e)this.reset();else if(a.eventType&O)this.reset(),this._timer=k(function(){this.state=Vb,this.tryEmit()},b.time,this);else if(a.eventType&Q)return Vb;return Xb},reset:function(){clearTimeout(this._timer)},emit:function(a){this.state===Vb&&(a&&a.eventType&Q?this.manager.emit(this.options.event+"up",a):(this._input.timeStamp=j(),this.manager.emit(this.options.event,this._input)))}}),p(ec,ac,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.rotation)>this.options.threshold||this.state&Sb)}}),p(fc,ac,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:X|Y,pointers:1},getTouchAction:function(){return bc.prototype.getTouchAction.call(this)},attrTest:function(a){var c,b=this.options.direction;return b&(X|Y)?c=a.velocity:b&X?c=a.velocityX:b&Y&&(c=a.velocityY),this._super.attrTest.call(this,a)&&b&a.direction&&a.distance>this.options.threshold&&i(c)>this.options.velocity&&a.eventType&Q},emit:function(a){var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this.manager.emit(this.options.event,a)}}),p(gc,Yb,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[Lb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,e=a.deltaTime<b.time;if(this.reset(),a.eventType&O&&0===this.count)return this.failTimeout();if(d&&e&&c){if(a.eventType!=Q)return this.failTimeout();var f=this.pTime?a.timeStamp-this.pTime<b.interval:!0,g=!this.pCenter||kb(this.pCenter,a.center)<b.posThreshold;this.pTime=a.timeStamp,this.pCenter=a.center,g&&f?this.count+=1:this.count=1,this._input=a;var h=this.count%b.taps;if(0===h)return this.hasRequireFailures()?(this._timer=k(function(){this.state=Vb,this.tryEmit()},b.interval,this),Sb):Vb}return Xb},failTimeout:function(){return this._timer=k(function(){this.state=Xb},this.options.interval,this),Xb},reset:function(){clearTimeout(this._timer)},emit:function(){this.state==Vb&&(this._input.tapCount=this.count,this.manager.emit(this.options.event,this._input))}}),hc.VERSION="2.0.4",hc.defaults={domEvents:!1,touchAction:Jb,enable:!0,inputTarget:null,inputClass:null,preset:[[ec,{enable:!1}],[cc,{enable:!1},["rotate"]],[fc,{direction:X}],[bc,{direction:X},["swipe"]],[gc],[gc,{event:"doubletap",taps:2},["tap"]],[dc]],cssProps:{userSelect:"default",touchSelect:"none",touchCallout:"none",contentZooming:"none",userDrag:"none",tapHighlightColor:"rgba(0,0,0,0)"}};var ic=1,jc=2;kc.prototype={set:function(a){return n(this.options,a),a.touchAction&&this.touchAction.update(),a.inputTarget&&(this.input.destroy(),this.input.target=a.inputTarget,this.input.init()),this},stop:function(a){this.session.stopped=a?jc:ic},recognize:function(a){var b=this.session;if(!b.stopped){this.touchAction.preventDefaults(a);var c,d=this.recognizers,e=b.curRecognizer;(!e||e&&e.state&Vb)&&(e=b.curRecognizer=null);for(var f=0;f<d.length;)c=d[f],b.stopped===jc||e&&c!=e&&!c.canRecognizeWith(e)?c.reset():c.recognize(a),!e&&c.state&(Sb|Tb|Ub)&&(e=b.curRecognizer=c),f++}},get:function(a){if(a instanceof Yb)return a;for(var b=this.recognizers,c=0;c<b.length;c++)if(b[c].options.event==a)return b[c];return null},add:function(a){if(l(a,"add",this))return this;var b=this.get(a.options.event);return b&&this.remove(b),this.recognizers.push(a),a.manager=this,this.touchAction.update(),a},remove:function(a){if(l(a,"remove",this))return this;var b=this.recognizers;return a=this.get(a),b.splice(y(b,a),1),this.touchAction.update(),this},on:function(a,b){var c=this.handlers;return m(x(a),function(a){c[a]=c[a]||[],c[a].push(b)}),this},off:function(a,b){var c=this.handlers;return m(x(a),function(a){b?c[a].splice(y(c[a],b),1):delete c[a]}),this},emit:function(a,b){this.options.domEvents&&mc(a,b);var c=this.handlers[a]&&this.handlers[a].slice();if(c&&c.length){b.type=a,b.preventDefault=function(){b.srcEvent.preventDefault()};for(var d=0;d<c.length;)c[d](b),d++}},destroy:function(){this.element&&lc(this,!1),this.handlers={},this.session={},this.input.destroy(),this.element=null}},n(hc,{INPUT_START:O,INPUT_MOVE:P,INPUT_END:Q,INPUT_CANCEL:R,STATE_POSSIBLE:Rb,STATE_BEGAN:Sb,STATE_CHANGED:Tb,STATE_ENDED:Ub,STATE_RECOGNIZED:Vb,STATE_CANCELLED:Wb,STATE_FAILED:Xb,DIRECTION_NONE:S,DIRECTION_LEFT:T,DIRECTION_RIGHT:U,DIRECTION_UP:V,DIRECTION_DOWN:W,DIRECTION_HORIZONTAL:X,DIRECTION_VERTICAL:Y,DIRECTION_ALL:Z,Manager:kc,Input:ab,TouchAction:Pb,TouchInput:Eb,MouseInput:rb,PointerEventInput:wb,TouchMouseInput:Gb,SingleTouchInput:Ab,Recognizer:Yb,AttrRecognizer:ac,Tap:gc,Pan:bc,Swipe:fc,Pinch:cc,Rotate:ec,Press:dc,on:t,off:u,each:m,merge:o,extend:n,inherit:p,bindFn:q,prefixed:B}),typeof define==g&&define.amd?define(function(){return hc}):"undefined"!=typeof module&&module.exports?module.exports=hc:a[c]=hc}(window,document,"Hammer");;(function(factory) {
+    if (typeof define === 'function' && define.amd) {
+        define(['jquery', 'hammerjs'], factory);
+    } else if (typeof exports === 'object') {
+        factory(require('jquery'), require('hammerjs'));
+    } else {
+        factory(jQuery, Hammer);
+    }
+}(function($, Hammer) {
+    function hammerify(el, options) {
+        var $el = $(el);
+        if(!$el.data("hammer")) {
+            $el.data("hammer", new Hammer($el[0], options));
+        }
+    }
+
+    $.fn.hammer = function(options) {
+        return this.each(function() {
+            hammerify(this, options);
+        });
+    };
+
+    // extend the emit method to also trigger jQuery events
+    Hammer.Manager.prototype.emit = (function(originalEmit) {
+        return function(type, data) {
+            originalEmit.call(this, type, data);
+            $(this.element).trigger({
+                type: type,
+                gesture: data
+            });
+        };
+    })(Hammer.Manager.prototype.emit);
+}));
+;// Required for Meteor package, the use of window prevents export by Meteor
+(function(window){
+  if(window.Package){
+    Materialize = {};
+  } else {
+    window.Materialize = {};
+  }
+})(window);
+
+
+/*
+ * raf.js
+ * https://github.com/ngryman/raf.js
+ *
+ * original requestAnimationFrame polyfill by Erik Möller
+ * inspired from paul_irish gist and post
+ *
+ * Copyright (c) 2013 ngryman
+ * Licensed under the MIT license.
+ */
+(function(window) {
+  var lastTime = 0,
+    vendors = ['webkit', 'moz'],
+    requestAnimationFrame = window.requestAnimationFrame,
+    cancelAnimationFrame = window.cancelAnimationFrame,
+    i = vendors.length;
+
+  // try to un-prefix existing raf
+  while (--i >= 0 && !requestAnimationFrame) {
+    requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
+    cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
+  }
+
+  // polyfill with setTimeout fallback
+  // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
+  if (!requestAnimationFrame || !cancelAnimationFrame) {
+    requestAnimationFrame = function(callback) {
+      var now = +Date.now(),
+        nextTime = Math.max(lastTime + 16, now);
+      return setTimeout(function() {
+        callback(lastTime = nextTime);
+      }, nextTime - now);
+    };
+
+    cancelAnimationFrame = clearTimeout;
+  }
+
+  // export to window
+  window.requestAnimationFrame = requestAnimationFrame;
+  window.cancelAnimationFrame = cancelAnimationFrame;
+}(window));
+
+
+// Unique ID
+Materialize.guid = (function() {
+  function s4() {
+    return Math.floor((1 + Math.random()) * 0x10000)
+      .toString(16)
+      .substring(1);
+  }
+  return function() {
+    return s4() + s4() + '-' + s4() + '-' + s4() + '-' +
+           s4() + '-' + s4() + s4() + s4();
+  };
+})();
+
+/**
+ * Escapes hash from special characters
+ * @param {string} hash  String returned from this.hash
+ * @returns {string}
+ */
+Materialize.escapeHash = function(hash) {
+  return hash.replace( /(:|\.|\[|\]|,|=)/g, "\\$1" );
+};
+
+Materialize.elementOrParentIsFixed = function(element) {
+    var $element = $(element);
+    var $checkElements = $element.add($element.parents());
+    var isFixed = false;
+    $checkElements.each(function(){
+        if ($(this).css("position") === "fixed") {
+            isFixed = true;
+            return false;
+        }
+    });
+    return isFixed;
+};
+
+
+/**
+ * Get time in ms
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
+ * @type {function}
+ * @return {number}
+ */
+var getTime = (Date.now || function () {
+  return new Date().getTime();
+});
+
+
+/**
+ * Returns a function, that, when invoked, will only be triggered at most once
+ * during a given window of time. Normally, the throttled function will run
+ * as much as it can, without ever going more than once per `wait` duration;
+ * but if you'd like to disable the execution on the leading edge, pass
+ * `{leading: false}`. To disable execution on the trailing edge, ditto.
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
+ * @param {function} func
+ * @param {number} wait
+ * @param {Object=} options
+ * @returns {Function}
+ */
+Materialize.throttle = function(func, wait, options) {
+  var context, args, result;
+  var timeout = null;
+  var previous = 0;
+  options || (options = {});
+  var later = function () {
+    previous = options.leading === false ? 0 : getTime();
+    timeout = null;
+    result = func.apply(context, args);
+    context = args = null;
+  };
+  return function () {
+    var now = getTime();
+    if (!previous && options.leading === false) previous = now;
+    var remaining = wait - (now - previous);
+    context = this;
+    args = arguments;
+    if (remaining <= 0) {
+      clearTimeout(timeout);
+      timeout = null;
+      previous = now;
+      result = func.apply(context, args);
+      context = args = null;
+    } else if (!timeout && options.trailing !== false) {
+      timeout = setTimeout(later, remaining);
+    }
+    return result;
+  };
+};
+
+
+// Velocity has conflicts when loaded with jQuery, this will check for it
+// First, check if in noConflict mode
+var Vel;
+if (jQuery) {
+  Vel = jQuery.Velocity;
+} else if ($) {
+  Vel = $.Velocity;
+} else {
+  Vel = Velocity;
+}
+;(function ($) {
+  $.fn.collapsible = function(options) {
+    var defaults = {
+      accordion: undefined,
+      onOpen: undefined,
+      onClose: undefined
+    };
+
+    options = $.extend(defaults, options);
+
+
+    return this.each(function() {
+
+      var $this = $(this);
+
+      var $panel_headers = $(this).find('> li > .collapsible-header');
+
+      var collapsible_type = $this.data("collapsible");
+
+      // Turn off any existing event handlers
+      $this.off('click.collapse', '> li > .collapsible-header');
+      $panel_headers.off('click.collapse');
+
+
+      /****************
+      Helper Functions
+      ****************/
+
+      // Accordion Open
+      function accordionOpen(object) {
+        $panel_headers = $this.find('> li > .collapsible-header');
+        if (object.hasClass('active')) {
+          object.parent().addClass('active');
+        }
+        else {
+          object.parent().removeClass('active');
+        }
+        if (object.parent().hasClass('active')){
+          object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+        }
+        else{
+          object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+        }
+
+        $panel_headers.not(object).removeClass('active').parent().removeClass('active');
+
+        // Close previously open accordion elements.
+        $panel_headers.not(object).parent().children('.collapsible-body').stop(true,false).each(function() {
+          if ($(this).is(':visible')) {
+            $(this).slideUp({
+              duration: 350,
+              easing: "easeOutQuart",
+              queue: false,
+              complete:
+                function() {
+                  $(this).css('height', '');
+                  execCallbacks($(this).siblings('.collapsible-header'));
+                }
+            });
+          }
+        });
+      }
+
+      // Expandable Open
+      function expandableOpen(object) {
+        if (object.hasClass('active')) {
+          object.parent().addClass('active');
+        }
+        else {
+          object.parent().removeClass('active');
+        }
+        if (object.parent().hasClass('active')){
+          object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+        }
+        else {
+          object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+        }
+      }
+
+      // Open collapsible. object: .collapsible-header
+      function collapsibleOpen(object) {
+        if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
+          accordionOpen(object);
+        } else { // Handle Expandables
+          expandableOpen(object);
+        }
+
+        execCallbacks(object);
+      }
+
+      // Handle callbacks
+      function execCallbacks(object) {
+        if (object.hasClass('active')) {
+          if (typeof(options.onOpen) === "function") {
+            options.onOpen.call(this, object.parent());
+          }
+        } else {
+          if (typeof(options.onClose) === "function") {
+            options.onClose.call(this, object.parent());
+          }
+        }
+      }
+
+      /**
+       * Check if object is children of panel header
+       * @param  {Object}  object Jquery object
+       * @return {Boolean} true if it is children
+       */
+      function isChildrenOfPanelHeader(object) {
+
+        var panelHeader = getPanelHeader(object);
+
+        return panelHeader.length > 0;
+      }
+
+      /**
+       * Get panel header from a children element
+       * @param  {Object} object Jquery object
+       * @return {Object} panel header object
+       */
+      function getPanelHeader(object) {
+
+        return object.closest('li > .collapsible-header');
+      }
+
+      /*****  End Helper Functions  *****/
+
+
+
+      // Add click handler to only direct collapsible header children
+      $this.on('click.collapse', '> li > .collapsible-header', function(e) {
+        var element = $(e.target);
+
+        if (isChildrenOfPanelHeader(element)) {
+          element = getPanelHeader(element);
+        }
+
+        element.toggleClass('active');
+
+        collapsibleOpen(element);
+      });
+
+
+      // Open first active
+      if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
+        collapsibleOpen($panel_headers.filter('.active').first());
+
+      } else { // Handle Expandables
+        $panel_headers.filter('.active').each(function() {
+          collapsibleOpen($(this));
+        });
+      }
+
+    });
+  };
+
+  $(document).ready(function(){
+    $('.collapsible').collapsible();
+  });
+}( jQuery ));;(function ($) {
+
+  // Add posibility to scroll to selected option
+  // usefull for select for example
+  $.fn.scrollTo = function(elem) {
+    $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
+    return this;
+  };
+
+  $.fn.dropdown = function (options) {
+    var defaults = {
+      inDuration: 300,
+      outDuration: 225,
+      constrainWidth: true, // Constrains width of dropdown to the activator
+      hover: false,
+      gutter: 0, // Spacing from edge
+      belowOrigin: false,
+      alignment: 'left',
+      stopPropagation: false
+    };
+
+    // Open dropdown.
+    if (options === "open") {
+      this.each(function() {
+        $(this).trigger('open');
+      });
+      return false;
+    }
+
+    // Close dropdown.
+    if (options === "close") {
+      this.each(function() {
+        $(this).trigger('close');
+      });
+      return false;
+    }
+
+    this.each(function(){
+      var origin = $(this);
+      var curr_options = $.extend({}, defaults, options);
+      var isFocused = false;
+
+      // Dropdown menu
+      var activates = $("#"+ origin.attr('data-activates'));
+
+      function updateOptions() {
+        if (origin.data('induration') !== undefined)
+          curr_options.inDuration = origin.data('induration');
+        if (origin.data('outduration') !== undefined)
+          curr_options.outDuration = origin.data('outduration');
+        if (origin.data('constrainwidth') !== undefined)
+          curr_options.constrainWidth = origin.data('constrainwidth');
+        if (origin.data('hover') !== undefined)
+          curr_options.hover = origin.data('hover');
+        if (origin.data('gutter') !== undefined)
+          curr_options.gutter = origin.data('gutter');
+        if (origin.data('beloworigin') !== undefined)
+          curr_options.belowOrigin = origin.data('beloworigin');
+        if (origin.data('alignment') !== undefined)
+          curr_options.alignment = origin.data('alignment');
+        if (origin.data('stoppropagation') !== undefined)
+          curr_options.stopPropagation = origin.data('stoppropagation');
+      }
+
+      updateOptions();
+
+      // Attach dropdown to its activator
+      origin.after(activates);
+
+      /*
+        Helper function to position and resize dropdown.
+        Used in hover and click handler.
+      */
+      function placeDropdown(eventType) {
+        // Check for simultaneous focus and click events.
+        if (eventType === 'focus') {
+          isFocused = true;
+        }
+
+        // Check html data attributes
+        updateOptions();
+
+        // Set Dropdown state
+        activates.addClass('active');
+        origin.addClass('active');
+
+        // Constrain width
+        if (curr_options.constrainWidth === true) {
+          activates.css('width', origin.outerWidth());
+
+        } else {
+          activates.css('white-space', 'nowrap');
+        }
+
+        // Offscreen detection
+        var windowHeight = window.innerHeight;
+        var originHeight = origin.innerHeight();
+        var offsetLeft = origin.offset().left;
+        var offsetTop = origin.offset().top - $(window).scrollTop();
+        var currAlignment = curr_options.alignment;
+        var gutterSpacing = 0;
+        var leftPosition = 0;
+
+        // Below Origin
+        var verticalOffset = 0;
+        if (curr_options.belowOrigin === true) {
+          verticalOffset = originHeight;
+        }
+
+        // Check for scrolling positioned container.
+        var scrollYOffset = 0;
+        var scrollXOffset = 0;
+        var wrapper = origin.parent();
+        if (!wrapper.is('body')) {
+          if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
+            scrollYOffset = wrapper[0].scrollTop;
+          }
+          if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
+            scrollXOffset = wrapper[0].scrollLeft;
+          }
+        }
+
+
+        if (offsetLeft + activates.innerWidth() > $(window).width()) {
+          // Dropdown goes past screen on right, force right alignment
+          currAlignment = 'right';
+
+        } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
+          // Dropdown goes past screen on left, force left alignment
+          currAlignment = 'left';
+        }
+        // Vertical bottom offscreen detection
+        if (offsetTop + activates.innerHeight() > windowHeight) {
+          // If going upwards still goes offscreen, just crop height of dropdown.
+          if (offsetTop + originHeight - activates.innerHeight() < 0) {
+            var adjustedHeight = windowHeight - offsetTop - verticalOffset;
+            activates.css('max-height', adjustedHeight);
+          } else {
+            // Flow upwards.
+            if (!verticalOffset) {
+              verticalOffset += originHeight;
+            }
+            verticalOffset -= activates.innerHeight();
+          }
+        }
+
+        // Handle edge alignment
+        if (currAlignment === 'left') {
+          gutterSpacing = curr_options.gutter;
+          leftPosition = origin.position().left + gutterSpacing;
+        }
+        else if (currAlignment === 'right') {
+          var offsetRight = origin.position().left + origin.outerWidth() - activates.outerWidth();
+          gutterSpacing = -curr_options.gutter;
+          leftPosition =  offsetRight + gutterSpacing;
+        }
+
+        // Position dropdown
+        activates.css({
+          position: 'absolute',
+          top: origin.position().top + verticalOffset + scrollYOffset,
+          left: leftPosition + scrollXOffset
+        });
+
+
+        // Show dropdown
+        activates.stop(true, true).css('opacity', 0)
+          .slideDown({
+            queue: false,
+            duration: curr_options.inDuration,
+            easing: 'easeOutCubic',
+            complete: function() {
+              $(this).css('height', '');
+            }
+          })
+          .animate( {opacity: 1}, {queue: false, duration: curr_options.inDuration, easing: 'easeOutSine'});
+
+        // Add click close handler to document
+        $(document).bind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id'), function (e) {
+          if (!activates.is(e.target) && !origin.is(e.target) && (!origin.find(e.target).length) ) {
+            hideDropdown();
+            $(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id'));
+          }
+        });
+      }
+
+      function hideDropdown() {
+        // Check for simultaneous focus and click events.
+        isFocused = false;
+        activates.fadeOut(curr_options.outDuration);
+        activates.removeClass('active');
+        origin.removeClass('active');
+        $(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id'));
+        setTimeout(function() { activates.css('max-height', ''); }, curr_options.outDuration);
+      }
+
+      // Hover
+      if (curr_options.hover) {
+        var open = false;
+        origin.unbind('click.' + origin.attr('id'));
+        // Hover handler to show dropdown
+        origin.on('mouseenter', function(e){ // Mouse over
+          if (open === false) {
+            placeDropdown();
+            open = true;
+          }
+        });
+        origin.on('mouseleave', function(e){
+          // If hover on origin then to something other than dropdown content, then close
+          var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
+          if(!$(toEl).closest('.dropdown-content').is(activates)) {
+            activates.stop(true, true);
+            hideDropdown();
+            open = false;
+          }
+        });
+
+        activates.on('mouseleave', function(e){ // Mouse out
+          var toEl = e.toElement || e.relatedTarget;
+          if(!$(toEl).closest('.dropdown-button').is(origin)) {
+            activates.stop(true, true);
+            hideDropdown();
+            open = false;
+          }
+        });
+
+        // Click
+      } else {
+        // Click handler to show dropdown
+        origin.unbind('click.' + origin.attr('id'));
+        origin.bind('click.'+origin.attr('id'), function(e){
+          if (!isFocused) {
+            if ( origin[0] == e.currentTarget &&
+                 !origin.hasClass('active') &&
+                 ($(e.target).closest('.dropdown-content').length === 0)) {
+              e.preventDefault(); // Prevents button click from moving window
+              if (curr_options.stopPropagation) {
+                e.stopPropagation();
+              }
+              placeDropdown('click');
+            }
+            // If origin is clicked and menu is open, close menu
+            else if (origin.hasClass('active')) {
+              hideDropdown();
+              $(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id'));
+            }
+          }
+        });
+
+      } // End else
+
+      // Listen to open and close event - useful for select component
+      origin.on('open', function(e, eventType) {
+        placeDropdown(eventType);
+      });
+      origin.on('close', hideDropdown);
+
+
+    });
+  }; // End dropdown plugin
+
+  $(document).ready(function(){
+    $('.dropdown-button').dropdown();
+  });
+}( jQuery ));
+;(function($) {
+  var _stack = 0,
+  _lastID = 0,
+  _generateID = function() {
+    _lastID++;
+    return 'materialize-modal-overlay-' + _lastID;
+  };
+
+  var methods = {
+    init : function(options) {
+      var defaults = {
+        opacity: 0.5,
+        inDuration: 350,
+        outDuration: 250,
+        ready: undefined,
+        complete: undefined,
+        dismissible: true,
+        startingTop: '4%',
+        endingTop: '10%'
+      };
+
+      // Override defaults
+      options = $.extend(defaults, options);
+
+      return this.each(function() {
+        var $modal = $(this);
+        var modal_id = $(this).attr("id") || '#' + $(this).data('target');
+
+        var closeModal = function() {
+          var overlayID = $modal.data('overlay-id');
+          var $overlay = $('#' + overlayID);
+          $modal.removeClass('open');
+
+          // Enable scrolling
+          $('body').css({
+            overflow: '',
+            width: ''
+          });
+
+          $modal.find('.modal-close').off('click.close');
+          $(document).off('keyup.modal' + overlayID);
+
+          $overlay.velocity( { opacity: 0}, {duration: options.outDuration, queue: false, ease: "easeOutQuart"});
+
+
+          // Define Bottom Sheet animation
+          var exitVelocityOptions = {
+            duration: options.outDuration,
+            queue: false,
+            ease: "easeOutCubic",
+            // Handle modal ready callback
+            complete: function() {
+              $(this).css({display:"none"});
+
+              // Call complete callback
+              if (typeof(options.complete) === "function") {
+                options.complete.call(this, $modal);
+              }
+              $overlay.remove();
+              _stack--;
+            }
+          };
+          if ($modal.hasClass('bottom-sheet')) {
+            $modal.velocity({bottom: "-100%", opacity: 0}, exitVelocityOptions);
+          }
+          else {
+            $modal.velocity(
+              { top: options.startingTop, opacity: 0, scaleX: 0.7},
+              exitVelocityOptions
+            );
+          }
+        };
+
+        var openModal = function($trigger) {
+          var $body = $('body');
+          var oldWidth = $body.innerWidth();
+          $body.css('overflow', 'hidden');
+          $body.width(oldWidth);
+
+          if ($modal.hasClass('open')) {
+            return;
+          }
+
+          var overlayID = _generateID();
+          var $overlay = $('<div class="modal-overlay"></div>');
+          lStack = (++_stack);
+
+          // Store a reference of the overlay
+          $overlay.attr('id', overlayID).css('z-index', 1000 + lStack * 2);
+          $modal.data('overlay-id', overlayID).css('z-index', 1000 + lStack * 2 + 1);
+          $modal.addClass('open');
+
+          $("body").append($overlay);
+
+          if (options.dismissible) {
+            $overlay.click(function() {
+              closeModal();
+            });
+            // Return on ESC
+            $(document).on('keyup.modal' + overlayID, function(e) {
+              if (e.keyCode === 27) {   // ESC key
+                closeModal();
+              }
+            });
+          }
+
+          $modal.find(".modal-close").on('click.close', function(e) {
+            closeModal();
+          });
+
+          $overlay.css({ display : "block", opacity : 0 });
+
+          $modal.css({
+            display : "block",
+            opacity: 0
+          });
+
+          $overlay.velocity({opacity: options.opacity}, {duration: options.inDuration, queue: false, ease: "easeOutCubic"});
+          $modal.data('associated-overlay', $overlay[0]);
+
+          // Define Bottom Sheet animation
+          var enterVelocityOptions = {
+            duration: options.inDuration,
+            queue: false,
+            ease: "easeOutCubic",
+            // Handle modal ready callback
+            complete: function() {
+              if (typeof(options.ready) === "function") {
+                options.ready.call(this, $modal, $trigger);
+              }
+            }
+          };
+          if ($modal.hasClass('bottom-sheet')) {
+            $modal.velocity({bottom: "0", opacity: 1}, enterVelocityOptions);
+          }
+          else {
+            $.Velocity.hook($modal, "scaleX", 0.7);
+            $modal.css({ top: options.startingTop });
+            $modal.velocity({top: options.endingTop, opacity: 1, scaleX: '1'}, enterVelocityOptions);
+          }
+
+        };
+
+        // Reset handlers
+        $(document).off('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]');
+        $(this).off('openModal');
+        $(this).off('closeModal');
+
+        // Close Handlers
+        $(document).on('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]', function(e) {
+          options.startingTop = ($(this).offset().top - $(window).scrollTop()) /1.15;
+          openModal($(this));
+          e.preventDefault();
+        }); // done set on click
+
+        $(this).on('openModal', function() {
+          var modal_id = $(this).attr("href") || '#' + $(this).data('target');
+          openModal();
+        });
+
+        $(this).on('closeModal', function() {
+          closeModal();
+        });
+      }); // done return
+    },
+    open : function() {
+      $(this).trigger('openModal');
+    },
+    close : function() {
+      $(this).trigger('closeModal');
+    }
+  };
+
+  $.fn.modal = function(methodOrOptions) {
+    if ( methods[methodOrOptions] ) {
+      return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+    } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+      // Default to "init"
+      return methods.init.apply( this, arguments );
+    } else {
+      $.error( 'Method ' +  methodOrOptions + ' does not exist on jQuery.modal' );
+    }
+  };
+})(jQuery);
+;(function ($) {
+
+  $.fn.materialbox = function () {
+
+    return this.each(function() {
+
+      if ($(this).hasClass('initialized')) {
+        return;
+      }
+
+      $(this).addClass('initialized');
+
+      var overlayActive = false;
+      var doneAnimating = true;
+      var inDuration = 275;
+      var outDuration = 200;
+      var origin = $(this);
+      var placeholder = $('<div></div>').addClass('material-placeholder');
+      var originalWidth = 0;
+      var originalHeight = 0;
+      var ancestorsChanged;
+      var ancestor;
+      origin.wrap(placeholder);
+
+
+      origin.on('click', function(){
+        var placeholder = origin.parent('.material-placeholder');
+        var windowWidth = window.innerWidth;
+        var windowHeight = window.innerHeight;
+        var originalWidth = origin.width();
+        var originalHeight = origin.height();
+
+
+        // If already modal, return to original
+        if (doneAnimating === false) {
+          returnToOriginal();
+          return false;
+        }
+        else if (overlayActive && doneAnimating===true) {
+          returnToOriginal();
+          return false;
+        }
+
+
+        // Set states
+        doneAnimating = false;
+        origin.addClass('active');
+        overlayActive = true;
+
+        // Set positioning for placeholder
+        placeholder.css({
+          width: placeholder[0].getBoundingClientRect().width,
+          height: placeholder[0].getBoundingClientRect().height,
+          position: 'relative',
+          top: 0,
+          left: 0
+        });
+
+        // Find ancestor with overflow: hidden; and remove it
+        ancestorsChanged = undefined;
+        ancestor = placeholder[0].parentNode;
+        var count = 0;
+        while (ancestor !== null && !$(ancestor).is(document)) {
+          var curr = $(ancestor);
+          if (curr.css('overflow') !== 'visible') {
+            curr.css('overflow', 'visible');
+            if (ancestorsChanged === undefined) {
+              ancestorsChanged = curr;
+            }
+            else {
+              ancestorsChanged = ancestorsChanged.add(curr);
+            }
+          }
+          ancestor = ancestor.parentNode;
+        }
+
+        // Set css on origin
+        origin.css({
+          position: 'absolute',
+          'z-index': 1000,
+          'will-change': 'left, top, width, height'
+        })
+        .data('width', originalWidth)
+        .data('height', originalHeight);
+
+        // Add overlay
+        var overlay = $('<div id="materialbox-overlay"></div>')
+          .css({
+            opacity: 0
+          })
+          .click(function(){
+            if (doneAnimating === true)
+            returnToOriginal();
+          });
+
+        // Put before in origin image to preserve z-index layering.
+        origin.before(overlay);
+
+        // Set dimensions if needed
+        var overlayOffset = overlay[0].getBoundingClientRect();
+        overlay.css({
+          width: windowWidth,
+          height: windowHeight,
+          left: -1 * overlayOffset.left,
+          top: -1 * overlayOffset.top
+        })
+
+        // Animate Overlay
+        overlay.velocity({opacity: 1},
+                           {duration: inDuration, queue: false, easing: 'easeOutQuad'} );
+
+        // Add and animate caption if it exists
+        if (origin.data('caption') !== "") {
+          var $photo_caption = $('<div class="materialbox-caption"></div>');
+          $photo_caption.text(origin.data('caption'));
+          $('body').append($photo_caption);
+          $photo_caption.css({ "display": "inline" });
+          $photo_caption.velocity({opacity: 1}, {duration: inDuration, queue: false, easing: 'easeOutQuad'});
+        }
+
+        // Resize Image
+        var ratio = 0;
+        var widthPercent = originalWidth / windowWidth;
+        var heightPercent = originalHeight / windowHeight;
+        var newWidth = 0;
+        var newHeight = 0;
+
+        if (widthPercent > heightPercent) {
+          ratio = originalHeight / originalWidth;
+          newWidth = windowWidth * 0.9;
+          newHeight = windowWidth * 0.9 * ratio;
+        }
+        else {
+          ratio = originalWidth / originalHeight;
+          newWidth = (windowHeight * 0.9) * ratio;
+          newHeight = windowHeight * 0.9;
+        }
+
+        // Animate image + set z-index
+        if(origin.hasClass('responsive-img')) {
+          origin.velocity({'max-width': newWidth, 'width': originalWidth}, {duration: 0, queue: false,
+            complete: function(){
+              origin.css({left: 0, top: 0})
+              .velocity(
+                {
+                  height: newHeight,
+                  width: newWidth,
+                  left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2,
+                  top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2
+                },
+                {
+                  duration: inDuration,
+                  queue: false,
+                  easing: 'easeOutQuad',
+                  complete: function(){doneAnimating = true;}
+                }
+              );
+            } // End Complete
+          }); // End Velocity
+        }
+        else {
+          origin.css('left', 0)
+          .css('top', 0)
+          .velocity(
+            {
+              height: newHeight,
+              width: newWidth,
+              left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2,
+              top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2
+            },
+            {
+              duration: inDuration,
+              queue: false,
+              easing: 'easeOutQuad',
+              complete: function(){doneAnimating = true;}
+            }
+            ); // End Velocity
+        }
+
+      }); // End origin on click
+
+
+      // Return on scroll
+      $(window).scroll(function() {
+        if (overlayActive) {
+          returnToOriginal();
+        }
+      });
+
+      // Return on ESC
+      $(document).keyup(function(e) {
+
+        if (e.keyCode === 27 && doneAnimating === true) {   // ESC key
+          if (overlayActive) {
+            returnToOriginal();
+          }
+        }
+      });
+
+
+      // This function returns the modaled image to the original spot
+      function returnToOriginal() {
+
+        doneAnimating = false;
+
+        var placeholder = origin.parent('.material-placeholder');
+        var windowWidth = window.innerWidth;
+        var windowHeight = window.innerHeight;
+        var originalWidth = origin.data('width');
+        var originalHeight = origin.data('height');
+
+        origin.velocity("stop", true);
+        $('#materialbox-overlay').velocity("stop", true);
+        $('.materialbox-caption').velocity("stop", true);
+
+
+        $('#materialbox-overlay').velocity({opacity: 0}, {
+          duration: outDuration, // Delay prevents animation overlapping
+          queue: false, easing: 'easeOutQuad',
+          complete: function(){
+            // Remove Overlay
+            overlayActive = false;
+            $(this).remove();
+          }
+        });
+
+        // Resize Image
+        origin.velocity(
+          {
+            width: originalWidth,
+            height: originalHeight,
+            left: 0,
+            top: 0
+          },
+          {
+            duration: outDuration,
+            queue: false, easing: 'easeOutQuad'
+          }
+        );
+
+        // Remove Caption + reset css settings on image
+        $('.materialbox-caption').velocity({opacity: 0}, {
+          duration: outDuration, // Delay prevents animation overlapping
+          queue: false, easing: 'easeOutQuad',
+          complete: function(){
+            placeholder.css({
+              height: '',
+              width: '',
+              position: '',
+              top: '',
+              left: ''
+            });
+
+            origin.css({
+              height: '',
+              top: '',
+              left: '',
+              width: '',
+              'max-width': '',
+              position: '',
+              'z-index': '',
+              'will-change': ''
+            });
+
+            // Remove class
+            origin.removeClass('active');
+            doneAnimating = true;
+            $(this).remove();
+
+            // Remove overflow overrides on ancestors
+            if (ancestorsChanged) {
+              ancestorsChanged.css('overflow', '');
+            }
+          }
+        });
+
+      }
+    });
+  };
+
+  $(document).ready(function(){
+    $('.materialboxed').materialbox();
+  });
+
+}( jQuery ));
+;(function ($) {
+
+  $.fn.parallax = function () {
+    var window_width = $(window).width();
+    // Parallax Scripts
+    return this.each(function(i) {
+      var $this = $(this);
+      $this.addClass('parallax');
+
+      function updateParallax(initial) {
+        var container_height;
+        if (window_width < 601) {
+          container_height = ($this.height() > 0) ? $this.height() : $this.children("img").height();
+        }
+        else {
+          container_height = ($this.height() > 0) ? $this.height() : 500;
+        }
+        var $img = $this.children("img").first();
+        var img_height = $img.height();
+        var parallax_dist = img_height - container_height;
+        var bottom = $this.offset().top + container_height;
+        var top = $this.offset().top;
+        var scrollTop = $(window).scrollTop();
+        var windowHeight = window.innerHeight;
+        var windowBottom = scrollTop + windowHeight;
+        var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
+        var parallax = Math.round((parallax_dist * percentScrolled));
+
+        if (initial) {
+          $img.css('display', 'block');
+        }
+        if ((bottom > scrollTop) && (top < (scrollTop + windowHeight))) {
+          $img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
+        }
+
+      }
+
+      // Wait for image load
+      $this.children("img").one("load", function() {
+        updateParallax(true);
+      }).each(function() {
+        if (this.complete) $(this).trigger("load");
+      });
+
+      $(window).scroll(function() {
+        window_width = $(window).width();
+        updateParallax(false);
+      });
+
+      $(window).resize(function() {
+        window_width = $(window).width();
+        updateParallax(false);
+      });
+
+    });
+
+  };
+}( jQuery ));
+;(function ($) {
+
+  var methods = {
+    init : function(options) {
+      var defaults = {
+        onShow: null,
+        swipeable: false,
+        responsiveThreshold: Infinity, // breakpoint for swipeable
+      };
+      options = $.extend(defaults, options);
+
+      return this.each(function() {
+
+      // For each set of tabs, we want to keep track of
+      // which tab is active and its associated content
+      var $this = $(this),
+          window_width = $(window).width();
+
+      var $active, $content, $links = $this.find('li.tab a'),
+          $tabs_width = $this.width(),
+          $tabs_content = $(),
+          $tabs_wrapper,
+          $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
+          $indicator,
+          index = prev_index = 0,
+          clicked = false,
+          clickedTimeout,
+          transition = 300;
+
+
+      // Finds right attribute for indicator based on active tab.
+      // el: jQuery Object
+      var calcRightPos = function(el) {
+        return $tabs_width - el.position().left - el.outerWidth() - $this.scrollLeft();
+      };
+
+      // Finds left attribute for indicator based on active tab.
+      // el: jQuery Object
+      var calcLeftPos = function(el) {
+        return el.position().left + $this.scrollLeft();
+      };
+
+      // Animates Indicator to active tab.
+      // prev_index: Number
+      var animateIndicator = function(prev_index) {
+        if ((index - prev_index) >= 0) {
+          $indicator.velocity({"right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'});
+          $indicator.velocity({"left": calcLeftPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90});
+
+        } else {
+          $indicator.velocity({"left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'});
+          $indicator.velocity({"right": calcRightPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90});
+        }
+      };
+
+      // Change swipeable according to responsive threshold
+      if (options.swipeable) {
+        if (window_width > options.responsiveThreshold) {
+          options.swipeable = false;
+        }
+      }
+
+
+      // If the location.hash matches one of the links, use that as the active tab.
+      $active = $($links.filter('[href="'+location.hash+'"]'));
+
+      // If no match is found, use the first link or any with class 'active' as the initial active tab.
+      if ($active.length === 0) {
+        $active = $(this).find('li.tab a.active').first();
+      }
+      if ($active.length === 0) {
+        $active = $(this).find('li.tab a').first();
+      }
+
+      $active.addClass('active');
+      index = $links.index($active);
+      if (index < 0) {
+        index = 0;
+      }
+
+      if ($active[0] !== undefined) {
+        $content = $($active[0].hash);
+        $content.addClass('active');
+      }
+
+      // append indicator then set indicator width to tab width
+      if (!$this.find('.indicator').length) {
+        $this.append('<div class="indicator"></div>');
+      }
+      $indicator = $this.find('.indicator');
+
+      // we make sure that the indicator is at the end of the tabs
+      $this.append($indicator);
+
+      if ($this.is(":visible")) {
+        // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
+        // $indicator.css({"left": index * $tab_width});
+        setTimeout(function() {
+          $indicator.css({"right": calcRightPos($active) });
+          $indicator.css({"left": calcLeftPos($active) });
+        }, 0);
+      }
+      $(window).resize(function () {
+        $tabs_width = $this.width();
+        $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
+        if (index < 0) {
+          index = 0;
+        }
+        if ($tab_width !== 0 && $tabs_width !== 0) {
+          $indicator.css({"right": calcRightPos($active) });
+          $indicator.css({"left": calcLeftPos($active) });
+        }
+      });
+
+      // Initialize Tabs Content.
+      if (options.swipeable) {
+        // TODO: Duplicate calls with swipeable? handle multiple div wrapping.
+        $links.each(function () {
+          var $curr_content = $(Materialize.escapeHash(this.hash));
+          $curr_content.addClass('carousel-item');
+          $tabs_content = $tabs_content.add($curr_content);
+        });
+        $tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>');
+        $tabs_content.css('display', '');
+        $('.tabs-content.carousel').carousel({
+          fullWidth: true,
+          noWrap: true,
+          onCycleTo: function(item) {
+            if (!clicked) {
+              var prev_index = index;
+              index = $tabs_wrapper.index(item);
+              $active = $links.eq(index);
+              animateIndicator(prev_index);
+            }
+          },
+        });
+      } else {
+        // Hide the remaining content
+        $links.not($active).each(function () {
+          $(Materialize.escapeHash(this.hash)).hide();
+        });
+      }
+
+
+      // Bind the click event handler
+      $this.on('click', 'a', function(e) {
+        if ($(this).parent().hasClass('disabled')) {
+          e.preventDefault();
+          return;
+        }
+
+        // Act as regular link if target attribute is specified.
+        if (!!$(this).attr("target")) {
+          return;
+        }
+
+        clicked = true;
+        $tabs_width = $this.width();
+        $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
+
+        // Make the old tab inactive.
+        $active.removeClass('active');
+        var $oldContent = $content
+
+        // Update the variables with the new link and content
+        $active = $(this);
+        $content = $(Materialize.escapeHash(this.hash));
+        $links = $this.find('li.tab a');
+        var activeRect = $active.position();
+
+        // Make the tab active.
+        $active.addClass('active');
+        prev_index = index;
+        index = $links.index($(this));
+        if (index < 0) {
+          index = 0;
+        }
+        // Change url to current tab
+        // window.location.hash = $active.attr('href');
+
+        // Swap content
+        if (options.swipeable) {
+          if ($tabs_content.length) {
+            $tabs_content.carousel('set', index);
+          }
+        } else {
+          if ($content !== undefined) {
+            $content.show();
+            $content.addClass('active');
+            if (typeof(options.onShow) === "function") {
+              options.onShow.call(this, $content);
+            }
+          }
+
+          if ($oldContent !== undefined &&
+              !$oldContent.is($content)) {
+            $oldContent.hide();
+            $oldContent.removeClass('active');
+          }
+        }
+
+        // Reset clicked state
+        clickedTimeout = setTimeout(function(){ clicked = false; }, transition);
+
+        // Update indicator
+        animateIndicator(prev_index);
+
+        // Prevent the anchor's default click action
+        e.preventDefault();
+      });
+    });
+
+    },
+    select_tab : function( id ) {
+      this.find('a[href="#' + id + '"]').trigger('click');
+    }
+  };
+
+  $.fn.tabs = function(methodOrOptions) {
+    if ( methods[methodOrOptions] ) {
+      return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+    } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+      // Default to "init"
+      return methods.init.apply( this, arguments );
+    } else {
+      $.error( 'Method ' +  methodOrOptions + ' does not exist on jQuery.tabs' );
+    }
+  };
+
+  $(document).ready(function(){
+    $('ul.tabs').tabs();
+  });
+}( jQuery ));
+;(function ($) {
+    $.fn.tooltip = function (options) {
+      var timeout = null,
+      margin = 5;
+
+      // Defaults
+      var defaults = {
+        delay: 350,
+        tooltip: '',
+        position: 'bottom',
+        html: false
+      };
+
+      // Remove tooltip from the activator
+      if (options === "remove") {
+        this.each(function() {
+          $('#' + $(this).attr('data-tooltip-id')).remove();
+          $(this).off('mouseenter.tooltip mouseleave.tooltip');
+        });
+        return false;
+      }
+
+      options = $.extend(defaults, options);
+
+      return this.each(function() {
+        var tooltipId = Materialize.guid();
+        var origin = $(this);
+
+        // Destroy old tooltip
+        if (origin.attr('data-tooltip-id')) {
+          $('#' + origin.attr('data-tooltip-id')).remove();
+        }
+
+        origin.attr('data-tooltip-id', tooltipId);
+
+        // Get attributes.
+        var allowHtml,
+            tooltipDelay,
+            tooltipPosition,
+            tooltipText,
+            tooltipEl,
+            backdrop;
+        var setAttributes = function() {
+          allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
+          tooltipDelay = origin.attr('data-delay');
+          tooltipDelay = (tooltipDelay === undefined || tooltipDelay === '') ?
+              options.delay : tooltipDelay;
+          tooltipPosition = origin.attr('data-position');
+          tooltipPosition = (tooltipPosition === undefined || tooltipPosition === '') ?
+              options.position : tooltipPosition;
+          tooltipText = origin.attr('data-tooltip');
+          tooltipText = (tooltipText === undefined || tooltipText === '') ?
+              options.tooltip : tooltipText;
+        };
+        setAttributes();
+
+        var renderTooltipEl = function() {
+          var tooltip = $('<div class="material-tooltip"></div>');
+
+          // Create Text span
+          if (allowHtml) {
+            tooltipText = $('<span></span>').html(tooltipText);
+          } else{
+            tooltipText = $('<span></span>').text(tooltipText);
+          }
+
+          // Create tooltip
+          tooltip.append(tooltipText)
+            .appendTo($('body'))
+            .attr('id', tooltipId);
+
+          // Create backdrop
+          backdrop = $('<div class="backdrop"></div>');
+          backdrop.appendTo(tooltip);
+          return tooltip;
+        };
+        tooltipEl = renderTooltipEl();
+
+        // Destroy previously binded events
+        origin.off('mouseenter.tooltip mouseleave.tooltip');
+        // Mouse In
+        var started = false, timeoutRef;
+        origin.on({'mouseenter.tooltip': function(e) {
+          var showTooltip = function() {
+            setAttributes();
+            started = true;
+            tooltipEl.velocity('stop');
+            backdrop.velocity('stop');
+            tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });
+
+            // Tooltip positioning
+            var originWidth = origin.outerWidth();
+            var originHeight = origin.outerHeight();
+            var tooltipHeight = tooltipEl.outerHeight();
+            var tooltipWidth = tooltipEl.outerWidth();
+            var tooltipVerticalMovement = '0px';
+            var tooltipHorizontalMovement = '0px';
+            var backdropOffsetWidth = backdrop[0].offsetWidth;
+            var backdropOffsetHeight = backdrop[0].offsetHeight;
+            var scaleXFactor = 8;
+            var scaleYFactor = 8;
+            var scaleFactor = 0;
+            var targetTop, targetLeft, newCoordinates;
+
+            if (tooltipPosition === "top") {
+              // Top Position
+              targetTop = origin.offset().top - tooltipHeight - margin;
+              targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2;
+              newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+              tooltipVerticalMovement = '-10px';
+              backdrop.css({
+                bottom: 0,
+                left: 0,
+                borderRadius: '14px 14px 0 0',
+                transformOrigin: '50% 100%',
+                marginTop: tooltipHeight,
+                marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2)
+              });
+            }
+            // Left Position
+            else if (tooltipPosition === "left") {
+              targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2;
+              targetLeft =  origin.offset().left - tooltipWidth - margin;
+              newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+
+              tooltipHorizontalMovement = '-10px';
+              backdrop.css({
+                top: '-7px',
+                right: 0,
+                width: '14px',
+                height: '14px',
+                borderRadius: '14px 0 0 14px',
+                transformOrigin: '95% 50%',
+                marginTop: tooltipHeight/2,
+                marginLeft: tooltipWidth
+              });
+            }
+            // Right Position
+            else if (tooltipPosition === "right") {
+              targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2;
+              targetLeft = origin.offset().left + originWidth + margin;
+              newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+
+              tooltipHorizontalMovement = '+10px';
+              backdrop.css({
+                top: '-7px',
+                left: 0,
+                width: '14px',
+                height: '14px',
+                borderRadius: '0 14px 14px 0',
+                transformOrigin: '5% 50%',
+                marginTop: tooltipHeight/2,
+                marginLeft: '0px'
+              });
+            }
+            else {
+              // Bottom Position
+              targetTop = origin.offset().top + origin.outerHeight() + margin;
+              targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2;
+              newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+              tooltipVerticalMovement = '+10px';
+              backdrop.css({
+                top: 0,
+                left: 0,
+                marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2)
+              });
+            }
+
+            // Set tooptip css placement
+            tooltipEl.css({
+              top: newCoordinates.y,
+              left: newCoordinates.x
+            });
+
+            // Calculate Scale to fill
+            scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
+            scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
+            scaleFactor = Math.max(scaleXFactor, scaleYFactor);
+
+            tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement}, { duration: 350, queue: false })
+              .velocity({opacity: 1}, {duration: 300, delay: 50, queue: false});
+            backdrop.css({ visibility: 'visible' })
+              .velocity({opacity:1},{duration: 55, delay: 0, queue: false})
+              .velocity({scaleX: scaleFactor, scaleY: scaleFactor}, {duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad'});
+          };
+
+          timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
+
+        // Mouse Out
+        },
+        'mouseleave.tooltip': function(){
+          // Reset State
+          started = false;
+          clearTimeout(timeoutRef);
+
+          // Animate back
+          setTimeout(function() {
+            if (started !== true) {
+              tooltipEl.velocity({
+                opacity: 0, translateY: 0, translateX: 0}, { duration: 225, queue: false});
+              backdrop.velocity({opacity: 0, scaleX: 1, scaleY: 1}, {
+                duration:225,
+                queue: false,
+                complete: function(){
+                  backdrop.css({ visibility: 'hidden' });
+                  tooltipEl.css({ visibility: 'hidden' });
+                  started = false;}
+              });
+            }
+          },225);
+        }
+        });
+    });
+  };
+
+  var repositionWithinScreen = function(x, y, width, height) {
+    var newX = x;
+    var newY = y;
+
+    if (newX < 0) {
+      newX = 4;
+    } else if (newX + width > window.innerWidth) {
+      newX -= newX + width - window.innerWidth;
+    }
+
+    if (newY < 0) {
+      newY = 4;
+    } else if (newY + height > window.innerHeight + $(window).scrollTop) {
+      newY -= newY + height - window.innerHeight;
+    }
+
+    return {x: newX, y: newY};
+  };
+
+  $(document).ready(function(){
+     $('.tooltipped').tooltip();
+   });
+}( jQuery ));
+;/*!
+ * Waves v0.6.4
+ * http://fian.my.id/Waves
+ *
+ * Copyright 2014 Alfiana E. Sibuea and other contributors
+ * Released under the MIT license
+ * https://github.com/fians/Waves/blob/master/LICENSE
+ */
+
+;(function(window) {
+    'use strict';
+
+    var Waves = Waves || {};
+    var $$ = document.querySelectorAll.bind(document);
+
+    // Find exact position of element
+    function isWindow(obj) {
+        return obj !== null && obj === obj.window;
+    }
+
+    function getWindow(elem) {
+        return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
+    }
+
+    function offset(elem) {
+        var docElem, win,
+            box = {top: 0, left: 0},
+            doc = elem && elem.ownerDocument;
+
+        docElem = doc.documentElement;
+
+        if (typeof elem.getBoundingClientRect !== typeof undefined) {
+            box = elem.getBoundingClientRect();
+        }
+        win = getWindow(doc);
+        return {
+            top: box.top + win.pageYOffset - docElem.clientTop,
+            left: box.left + win.pageXOffset - docElem.clientLeft
+        };
+    }
+
+    function convertStyle(obj) {
+        var style = '';
+
+        for (var a in obj) {
+            if (obj.hasOwnProperty(a)) {
+                style += (a + ':' + obj[a] + ';');
+            }
+        }
+
+        return style;
+    }
+
+    var Effect = {
+
+        // Effect delay
+        duration: 750,
+
+        show: function(e, element) {
+
+            // Disable right click
+            if (e.button === 2) {
+                return false;
+            }
+
+            var el = element || this;
+
+            // Create ripple
+            var ripple = document.createElement('div');
+            ripple.className = 'waves-ripple';
+            el.appendChild(ripple);
+
+            // Get click coordinate and element witdh
+            var pos         = offset(el);
+            var relativeY   = (e.pageY - pos.top);
+            var relativeX   = (e.pageX - pos.left);
+            var scale       = 'scale('+((el.clientWidth / 100) * 10)+')';
+
+            // Support for touch devices
+            if ('touches' in e) {
+              relativeY   = (e.touches[0].pageY - pos.top);
+              relativeX   = (e.touches[0].pageX - pos.left);
+            }
+
+            // Attach data to element
+            ripple.setAttribute('data-hold', Date.now());
+            ripple.setAttribute('data-scale', scale);
+            ripple.setAttribute('data-x', relativeX);
+            ripple.setAttribute('data-y', relativeY);
+
+            // Set ripple position
+            var rippleStyle = {
+                'top': relativeY+'px',
+                'left': relativeX+'px'
+            };
+
+            ripple.className = ripple.className + ' waves-notransition';
+            ripple.setAttribute('style', convertStyle(rippleStyle));
+            ripple.className = ripple.className.replace('waves-notransition', '');
+
+            // Scale the ripple
+            rippleStyle['-webkit-transform'] = scale;
+            rippleStyle['-moz-transform'] = scale;
+            rippleStyle['-ms-transform'] = scale;
+            rippleStyle['-o-transform'] = scale;
+            rippleStyle.transform = scale;
+            rippleStyle.opacity   = '1';
+
+            rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
+            rippleStyle['-moz-transition-duration']    = Effect.duration + 'ms';
+            rippleStyle['-o-transition-duration']      = Effect.duration + 'ms';
+            rippleStyle['transition-duration']         = Effect.duration + 'ms';
+
+            rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+            rippleStyle['-moz-transition-timing-function']    = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+            rippleStyle['-o-transition-timing-function']      = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+            rippleStyle['transition-timing-function']         = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+
+            ripple.setAttribute('style', convertStyle(rippleStyle));
+        },
+
+        hide: function(e) {
+            TouchHandler.touchup(e);
+
+            var el = this;
+            var width = el.clientWidth * 1.4;
+
+            // Get first ripple
+            var ripple = null;
+            var ripples = el.getElementsByClassName('waves-ripple');
+            if (ripples.length > 0) {
+                ripple = ripples[ripples.length - 1];
+            } else {
+                return false;
+            }
+
+            var relativeX   = ripple.getAttribute('data-x');
+            var relativeY   = ripple.getAttribute('data-y');
+            var scale       = ripple.getAttribute('data-scale');
+
+            // Get delay beetween mousedown and mouse leave
+            var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
+            var delay = 350 - diff;
+
+            if (delay < 0) {
+                delay = 0;
+            }
+
+            // Fade out ripple after delay
+            setTimeout(function() {
+                var style = {
+                    'top': relativeY+'px',
+                    'left': relativeX+'px',
+                    'opacity': '0',
+
+                    // Duration
+                    '-webkit-transition-duration': Effect.duration + 'ms',
+                    '-moz-transition-duration': Effect.duration + 'ms',
+                    '-o-transition-duration': Effect.duration + 'ms',
+                    'transition-duration': Effect.duration + 'ms',
+                    '-webkit-transform': scale,
+                    '-moz-transform': scale,
+                    '-ms-transform': scale,
+                    '-o-transform': scale,
+                    'transform': scale,
+                };
+
+                ripple.setAttribute('style', convertStyle(style));
+
+                setTimeout(function() {
+                    try {
+                        el.removeChild(ripple);
+                    } catch(e) {
+                        return false;
+                    }
+                }, Effect.duration);
+            }, delay);
+        },
+
+        // Little hack to make <input> can perform waves effect
+        wrapInput: function(elements) {
+            for (var a = 0; a < elements.length; a++) {
+                var el = elements[a];
+
+                if (el.tagName.toLowerCase() === 'input') {
+                    var parent = el.parentNode;
+
+                    // If input already have parent just pass through
+                    if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
+                        continue;
+                    }
+
+                    // Put element class and style to the specified parent
+                    var wrapper = document.createElement('i');
+                    wrapper.className = el.className + ' waves-input-wrapper';
+
+                    var elementStyle = el.getAttribute('style');
+
+                    if (!elementStyle) {
+                        elementStyle = '';
+                    }
+
+                    wrapper.setAttribute('style', elementStyle);
+
+                    el.className = 'waves-button-input';
+                    el.removeAttribute('style');
+
+                    // Put element as child
+                    parent.replaceChild(wrapper, el);
+                    wrapper.appendChild(el);
+                }
+            }
+        }
+    };
+
+
+    /**
+     * Disable mousedown event for 500ms during and after touch
+     */
+    var TouchHandler = {
+        /* uses an integer rather than bool so there's no issues with
+         * needing to clear timeouts if another touch event occurred
+         * within the 500ms. Cannot mouseup between touchstart and
+         * touchend, nor in the 500ms after touchend. */
+        touches: 0,
+        allowEvent: function(e) {
+            var allow = true;
+
+            if (e.type === 'touchstart') {
+                TouchHandler.touches += 1; //push
+            } else if (e.type === 'touchend' || e.type === 'touchcancel') {
+                setTimeout(function() {
+                    if (TouchHandler.touches > 0) {
+                        TouchHandler.touches -= 1; //pop after 500ms
+                    }
+                }, 500);
+            } else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
+                allow = false;
+            }
+
+            return allow;
+        },
+        touchup: function(e) {
+            TouchHandler.allowEvent(e);
+        }
+    };
+
+
+    /**
+     * Delegated click handler for .waves-effect element.
+     * returns null when .waves-effect element not in "click tree"
+     */
+    function getWavesEffectElement(e) {
+        if (TouchHandler.allowEvent(e) === false) {
+            return null;
+        }
+
+        var element = null;
+        var target = e.target || e.srcElement;
+
+        while (target.parentElement !== null) {
+            if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
+                element = target;
+                break;
+            } else if (target.classList.contains('waves-effect')) {
+                element = target;
+                break;
+            }
+            target = target.parentElement;
+        }
+
+        return element;
+    }
+
+    /**
+     * Bubble the click and show effect if .waves-effect elem was found
+     */
+    function showEffect(e) {
+        var element = getWavesEffectElement(e);
+
+        if (element !== null) {
+            Effect.show(e, element);
+
+            if ('ontouchstart' in window) {
+                element.addEventListener('touchend', Effect.hide, false);
+                element.addEventListener('touchcancel', Effect.hide, false);
+            }
+
+            element.addEventListener('mouseup', Effect.hide, false);
+            element.addEventListener('mouseleave', Effect.hide, false);
+        }
+    }
+
+    Waves.displayEffect = function(options) {
+        options = options || {};
+
+        if ('duration' in options) {
+            Effect.duration = options.duration;
+        }
+
+        //Wrap input inside <i> tag
+        Effect.wrapInput($$('.waves-effect'));
+
+        if ('ontouchstart' in window) {
+            document.body.addEventListener('touchstart', showEffect, false);
+        }
+
+        document.body.addEventListener('mousedown', showEffect, false);
+    };
+
+    /**
+     * Attach Waves to an input element (or any element which doesn't
+     * bubble mouseup/mousedown events).
+     *   Intended to be used with dynamically loaded forms/inputs, or
+     * where the user doesn't want a delegated click handler.
+     */
+    Waves.attach = function(element) {
+        //FUTURE: automatically add waves classes and allow users
+        // to specify them with an options param? Eg. light/classic/button
+        if (element.tagName.toLowerCase() === 'input') {
+            Effect.wrapInput([element]);
+            element = element.parentElement;
+        }
+
+        if ('ontouchstart' in window) {
+            element.addEventListener('touchstart', showEffect, false);
+        }
+
+        element.addEventListener('mousedown', showEffect, false);
+    };
+
+    window.Waves = Waves;
+
+    document.addEventListener('DOMContentLoaded', function() {
+        Waves.displayEffect();
+    }, false);
+
+})(window);
+;Materialize.toast = function (message, displayLength, className, completeCallback) {
+  className = className || "";
+
+  var container = document.getElementById('toast-container');
+
+  // Create toast container if it does not exist
+  if (container === null) {
+    // create notification container
+    container = document.createElement('div');
+    container.id = 'toast-container';
+    document.body.appendChild(container);
+  }
+
+  // Select and append toast
+  var newToast = createToast(message);
+
+  // only append toast if message is not undefined
+  if(message){
+    container.appendChild(newToast);
+  }
+
+  newToast.style.opacity = 0;
+
+  // Animate toast in
+  Vel(newToast, {translateY: '-35px',  opacity: 1 }, {duration: 300,
+    easing: 'easeOutCubic',
+    queue: false});
+
+  // Allows timer to be pause while being panned
+  var timeLeft = displayLength;
+  var counterInterval;
+  if (timeLeft != null)  {
+    counterInterval = setInterval (function(){
+      if (newToast.parentNode === null)
+        window.clearInterval(counterInterval);
+
+      // If toast is not being dragged, decrease its time remaining
+      if (!newToast.classList.contains('panning')) {
+        timeLeft -= 20;
+      }
+
+      if (timeLeft <= 0) {
+        // Animate toast out
+        Vel(newToast, {"opacity": 0, marginTop: '-40px'}, { duration: 375,
+            easing: 'easeOutExpo',
+            queue: false,
+            complete: function(){
+              // Call the optional callback
+              if(typeof(completeCallback) === "function")
+                completeCallback();
+              // Remove toast after it times out
+              this[0].parentNode.removeChild(this[0]);
+            }
+          });
+        window.clearInterval(counterInterval);
+      }
+    }, 20);
+  }
+
+
+
+  function createToast(html) {
+
+    // Create toast
+    var toast = document.createElement('div');
+    toast.classList.add('toast');
+    if (className) {
+      var classes = className.split(' ');
+
+      for (var i = 0, count = classes.length; i < count; i++) {
+        toast.classList.add(classes[i]);
+      }
+    }
+  // If type of parameter is HTML Element
+    if ( typeof HTMLElement === "object" ? html instanceof HTMLElement : html && typeof html === "object" && html !== null && html.nodeType === 1 && typeof html.nodeName==="string"
+) {
+      toast.appendChild(html);
+    }
+    else if (html instanceof jQuery) {
+      // Check if it is jQuery object
+      toast.appendChild(html[0]);
+    }
+    else {
+      // Insert as text;
+      toast.innerHTML = html;
+    }
+    // Bind hammer
+    var hammerHandler = new Hammer(toast, {prevent_default: false});
+    hammerHandler.on('pan', function(e) {
+      var deltaX = e.deltaX;
+      var activationDistance = 80;
+
+      // Change toast state
+      if (!toast.classList.contains('panning')){
+        toast.classList.add('panning');
+      }
+
+      var opacityPercent = 1-Math.abs(deltaX / activationDistance);
+      if (opacityPercent < 0)
+        opacityPercent = 0;
+
+      Vel(toast, {left: deltaX, opacity: opacityPercent }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+
+    });
+
+    hammerHandler.on('panend', function(e) {
+      var deltaX = e.deltaX;
+      var activationDistance = 80;
+
+      // If toast dragged past activation point
+      if (Math.abs(deltaX) > activationDistance) {
+        Vel(toast, {marginTop: '-40px'}, { duration: 375,
+          easing: 'easeOutExpo',
+          queue: false,
+          complete: function(){
+            if(typeof(completeCallback) === "function") {
+              completeCallback();
+            }
+            toast.parentNode.removeChild(toast);
+          }
+        });
+
+      } else {
+        toast.classList.remove('panning');
+        // Put toast back into original position
+        Vel(toast, { left: 0, opacity: 1 }, { duration: 300,
+          easing: 'easeOutExpo',
+          queue: false
+        });
+
+      }
+    });
+
+    return toast;
+  }
+};
+;(function ($) {
+
+  var methods = {
+    init : function(options) {
+      var defaults = {
+        menuWidth: 300,
+        edge: 'left',
+        closeOnClick: false,
+        draggable: true
+      };
+      options = $.extend(defaults, options);
+
+      $(this).each(function(){
+        var $this = $(this);
+        var menuId = $this.attr('data-activates');
+        var menu = $("#"+ menuId);
+
+        // Set to width
+        if (options.menuWidth != 300) {
+          menu.css('width', options.menuWidth);
+        }
+
+        // Add Touch Area
+        var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
+        if (options.draggable) {
+          // Regenerate dragTarget
+          if ($dragTarget.length) {
+            $dragTarget.remove();
+          }
+
+          $dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId);
+          $('body').append($dragTarget);
+        } else {
+          $dragTarget = $();
+        }
+
+        if (options.edge == 'left') {
+          menu.css('transform', 'translateX(-100%)');
+          $dragTarget.css({'left': 0}); // Add Touch Area
+        }
+        else {
+          menu.addClass('right-aligned') // Change text-alignment to right
+            .css('transform', 'translateX(100%)');
+          $dragTarget.css({'right': 0}); // Add Touch Area
+        }
+
+        // If fixed sidenav, bring menu out
+        if (menu.hasClass('fixed')) {
+            if (window.innerWidth > 992) {
+              menu.css('transform', 'translateX(0)');
+            }
+          }
+
+        // Window resize to reset on large screens fixed
+        if (menu.hasClass('fixed')) {
+          $(window).resize( function() {
+            if (window.innerWidth > 992) {
+              // Close menu if window is resized bigger than 992 and user has fixed sidenav
+              if ($('#sidenav-overlay').length !== 0 && menuOut) {
+                removeMenu(true);
+              }
+              else {
+                // menu.removeAttr('style');
+                menu.css('transform', 'translateX(0%)');
+                // menu.css('width', options.menuWidth);
+              }
+            }
+            else if (menuOut === false){
+              if (options.edge === 'left') {
+                menu.css('transform', 'translateX(-100%)');
+              } else {
+                menu.css('transform', 'translateX(100%)');
+              }
+
+            }
+
+          });
+        }
+
+        // if closeOnClick, then add close event for all a tags in side sideNav
+        if (options.closeOnClick === true) {
+          menu.on("click.itemclick", "a:not(.collapsible-header)", function(){
+            removeMenu();
+          });
+        }
+
+        var removeMenu = function(restoreNav) {
+          panning = false;
+          menuOut = false;
+          // Reenable scrolling
+          $('body').css({
+            overflow: '',
+            width: ''
+          });
+
+          $('#sidenav-overlay').velocity({opacity: 0}, {duration: 200,
+              queue: false, easing: 'easeOutQuad',
+            complete: function() {
+              $(this).remove();
+            } });
+          if (options.edge === 'left') {
+            // Reset phantom div
+            $dragTarget.css({width: '', right: '', left: '0'});
+            menu.velocity(
+              {'translateX': '-100%'},
+              { duration: 200,
+                queue: false,
+                easing: 'easeOutCubic',
+                complete: function() {
+                  if (restoreNav === true) {
+                    // Restore Fixed sidenav
+                    menu.removeAttr('style');
+                    menu.css('width', options.menuWidth);
+                  }
+                }
+
+            });
+          }
+          else {
+            // Reset phantom div
+            $dragTarget.css({width: '', right: '0', left: ''});
+            menu.velocity(
+              {'translateX': '100%'},
+              { duration: 200,
+                queue: false,
+                easing: 'easeOutCubic',
+                complete: function() {
+                  if (restoreNav === true) {
+                    // Restore Fixed sidenav
+                    menu.removeAttr('style');
+                    menu.css('width', options.menuWidth);
+                  }
+                }
+              });
+          }
+        };
+
+
+
+        // Touch Event
+        var panning = false;
+        var menuOut = false;
+
+        if (options.draggable) {
+          $dragTarget.on('click', function(){
+            if (menuOut) {
+              removeMenu();
+            }
+          });
+
+          $dragTarget.hammer({
+            prevent_default: false
+          }).bind('pan', function(e) {
+
+            if (e.gesture.pointerType == "touch") {
+
+              var direction = e.gesture.direction;
+              var x = e.gesture.center.x;
+              var y = e.gesture.center.y;
+              var velocityX = e.gesture.velocityX;
+
+              // Disable Scrolling
+              var $body = $('body');
+              var $overlay = $('#sidenav-overlay');
+              var oldWidth = $body.innerWidth();
+              $body.css('overflow', 'hidden');
+              $body.width(oldWidth);
+
+              // If overlay does not exist, create one and if it is clicked, close menu
+              if ($overlay.length === 0) {
+                $overlay = $('<div id="sidenav-overlay"></div>');
+                $overlay.css('opacity', 0).click( function(){
+                  removeMenu();
+                });
+                $('body').append($overlay);
+              }
+
+              // Keep within boundaries
+              if (options.edge === 'left') {
+                if (x > options.menuWidth) { x = options.menuWidth; }
+                else if (x < 0) { x = 0; }
+              }
+
+              if (options.edge === 'left') {
+                // Left Direction
+                if (x < (options.menuWidth / 2)) { menuOut = false; }
+                // Right Direction
+                else if (x >= (options.menuWidth / 2)) { menuOut = true; }
+                menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
+              }
+              else {
+                // Left Direction
+                if (x < (window.innerWidth - options.menuWidth / 2)) {
+                  menuOut = true;
+                }
+                // Right Direction
+                else if (x >= (window.innerWidth - options.menuWidth / 2)) {
+                 menuOut = false;
+               }
+                var rightPos = (x - options.menuWidth / 2);
+                if (rightPos < 0) {
+                  rightPos = 0;
+                }
+
+                menu.css('transform', 'translateX(' + rightPos + 'px)');
+              }
+
+
+              // Percentage overlay
+              var overlayPerc;
+              if (options.edge === 'left') {
+                overlayPerc = x / options.menuWidth;
+                $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'});
+              }
+              else {
+                overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
+                $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'});
+              }
+            }
+
+          }).bind('panend', function(e) {
+
+            if (e.gesture.pointerType == "touch") {
+              var $overlay = $('<div id="sidenav-overlay"></div>');
+              var velocityX = e.gesture.velocityX;
+              var x = e.gesture.center.x;
+              var leftPos = x - options.menuWidth;
+              var rightPos = x - options.menuWidth / 2;
+              if (leftPos > 0 ) {
+                leftPos = 0;
+              }
+              if (rightPos < 0) {
+                rightPos = 0;
+              }
+              panning = false;
+
+              if (options.edge === 'left') {
+                // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
+                if ((menuOut && velocityX <= 0.3) || velocityX < -0.5) {
+                  // Return menu to open
+                  if (leftPos !== 0) {
+                    menu.velocity({'translateX': [0, leftPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+                  }
+
+                  $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+                  $dragTarget.css({width: '50%', right: 0, left: ''});
+                  menuOut = true;
+                }
+                else if (!menuOut || velocityX > 0.3) {
+                  // Enable Scrolling
+                  $('body').css({
+                    overflow: '',
+                    width: ''
+                  });
+                  // Slide menu closed
+                  menu.velocity({'translateX': [-1 * options.menuWidth - 10, leftPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'});
+                  $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad',
+                    complete: function () {
+                      $(this).remove();
+                    }});
+                  $dragTarget.css({width: '10px', right: '', left: 0});
+                }
+              }
+              else {
+                if ((menuOut && velocityX >= -0.3) || velocityX > 0.5) {
+                  // Return menu to open
+                  if (rightPos !== 0) {
+                    menu.velocity({'translateX': [0, rightPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+                  }
+
+                  $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+                  $dragTarget.css({width: '50%', right: '', left: 0});
+                  menuOut = true;
+                }
+                else if (!menuOut || velocityX < -0.3) {
+                  // Enable Scrolling
+                  $('body').css({
+                    overflow: '',
+                    width: ''
+                  });
+
+                  // Slide menu closed
+                  menu.velocity({'translateX': [options.menuWidth + 10, rightPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'});
+                  $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad',
+                    complete: function () {
+                      $(this).remove();
+                    }});
+                  $dragTarget.css({width: '10px', right: 0, left: ''});
+                }
+              }
+
+            }
+          });
+        }
+
+        $this.off('click.sidenav').on('click.sidenav', function() {
+          if (menuOut === true) {
+            menuOut = false;
+            panning = false;
+            removeMenu();
+          }
+          else {
+
+            // Disable Scrolling
+            var $body = $('body');
+            var $overlay = $('<div id="sidenav-overlay"></div>');
+            var oldWidth = $body.innerWidth();
+            $body.css('overflow', 'hidden');
+            $body.width(oldWidth);
+
+            // Push current drag target on top of DOM tree
+            $('body').append($dragTarget);
+
+            if (options.edge === 'left') {
+              $dragTarget.css({width: '50%', right: 0, left: ''});
+              menu.velocity({'translateX': [0, -1 * options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+            }
+            else {
+              $dragTarget.css({width: '50%', right: '', left: 0});
+              menu.velocity({'translateX': [0, options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+            }
+
+            $overlay.css('opacity', 0)
+            .click(function(){
+              menuOut = false;
+              panning = false;
+              removeMenu();
+              $overlay.velocity({opacity: 0}, {duration: 300, queue: false, easing: 'easeOutQuad',
+                complete: function() {
+                  $(this).remove();
+                } });
+
+            });
+            $('body').append($overlay);
+            $overlay.velocity({opacity: 1}, {duration: 300, queue: false, easing: 'easeOutQuad',
+              complete: function () {
+                menuOut = true;
+                panning = false;
+              }
+            });
+          }
+
+          return false;
+        });
+      });
+
+
+    },
+    destroy: function () {
+      var $overlay = $('#sidenav-overlay');
+      var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
+      $overlay.trigger('click');
+      $dragTarget.remove();
+      $(this).off('click');
+      $overlay.remove();
+    },
+    show : function() {
+      this.trigger('click');
+    },
+    hide : function() {
+      $('#sidenav-overlay').trigger('click');
+    }
+  };
+
+
+  $.fn.sideNav = function(methodOrOptions) {
+    if ( methods[methodOrOptions] ) {
+      return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+    } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+      // Default to "init"
+      return methods.init.apply( this, arguments );
+    } else {
+      $.error( 'Method ' +  methodOrOptions + ' does not exist on jQuery.sideNav' );
+    }
+  }; // Plugin end
+}( jQuery ));
+;/**
+ * Extend jquery with a scrollspy plugin.
+ * This watches the window scroll and fires events when elements are scrolled into viewport.
+ *
+ * throttle() and getTime() taken from Underscore.js
+ * https://github.com/jashkenas/underscore
+ *
+ * @author Copyright 2013 John Smart
+ * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
+ * @see https://github.com/thesmart
+ * @version 0.1.2
+ */
+(function($) {
+
+	var jWindow = $(window);
+	var elements = [];
+	var elementsInView = [];
+	var isSpying = false;
+	var ticks = 0;
+	var unique_id = 1;
+	var offset = {
+		top : 0,
+		right : 0,
+		bottom : 0,
+		left : 0,
+	}
+
+	/**
+	 * Find elements that are within the boundary
+	 * @param {number} top
+	 * @param {number} right
+	 * @param {number} bottom
+	 * @param {number} left
+	 * @return {jQuery}		A collection of elements
+	 */
+	function findElements(top, right, bottom, left) {
+		var hits = $();
+		$.each(elements, function(i, element) {
+			if (element.height() > 0) {
+				var elTop = element.offset().top,
+					elLeft = element.offset().left,
+					elRight = elLeft + element.width(),
+					elBottom = elTop + element.height();
+
+				var isIntersect = !(elLeft > right ||
+					elRight < left ||
+					elTop > bottom ||
+					elBottom < top);
+
+				if (isIntersect) {
+					hits.push(element);
+				}
+			}
+		});
+
+		return hits;
+	}
+
+
+	/**
+	 * Called when the user scrolls the window
+	 */
+	function onScroll(scrollOffset) {
+		// unique tick id
+		++ticks;
+
+		// viewport rectangle
+		var top = jWindow.scrollTop(),
+			left = jWindow.scrollLeft(),
+			right = left + jWindow.width(),
+			bottom = top + jWindow.height();
+
+		// determine which elements are in view
+		var intersections = findElements(top+offset.top + scrollOffset || 200, right+offset.right, bottom+offset.bottom, left+offset.left);
+		$.each(intersections, function(i, element) {
+
+			var lastTick = element.data('scrollSpy:ticks');
+			if (typeof lastTick != 'number') {
+				// entered into view
+				element.triggerHandler('scrollSpy:enter');
+			}
+
+			// update tick id
+			element.data('scrollSpy:ticks', ticks);
+		});
+
+		// determine which elements are no longer in view
+		$.each(elementsInView, function(i, element) {
+			var lastTick = element.data('scrollSpy:ticks');
+			if (typeof lastTick == 'number' && lastTick !== ticks) {
+				// exited from view
+				element.triggerHandler('scrollSpy:exit');
+				element.data('scrollSpy:ticks', null);
+			}
+		});
+
+		// remember elements in view for next tick
+		elementsInView = intersections;
+	}
+
+	/**
+	 * Called when window is resized
+	*/
+	function onWinSize() {
+		jWindow.trigger('scrollSpy:winSize');
+	}
+
+
+	/**
+	 * Enables ScrollSpy using a selector
+	 * @param {jQuery|string} selector  The elements collection, or a selector
+	 * @param {Object=} options	Optional.
+        throttle : number -> scrollspy throttling. Default: 100 ms
+        offsetTop : number -> offset from top. Default: 0
+        offsetRight : number -> offset from right. Default: 0
+        offsetBottom : number -> offset from bottom. Default: 0
+        offsetLeft : number -> offset from left. Default: 0
+	 * @returns {jQuery}
+	 */
+	$.scrollSpy = function(selector, options) {
+	  var defaults = {
+			throttle: 100,
+			scrollOffset: 200 // offset - 200 allows elements near bottom of page to scroll
+    };
+    options = $.extend(defaults, options);
+
+		var visible = [];
+		selector = $(selector);
+		selector.each(function(i, element) {
+			elements.push($(element));
+			$(element).data("scrollSpy:id", i);
+			// Smooth scroll to section
+		  $('a[href="#' + $(element).attr('id') + '"]').click(function(e) {
+		    e.preventDefault();
+		    var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
+	    	$('html, body').animate({ scrollTop: offset - options.scrollOffset }, {duration: 400, queue: false, easing: 'easeOutCubic'});
+		  });
+		});
+
+		offset.top = options.offsetTop || 0;
+		offset.right = options.offsetRight || 0;
+		offset.bottom = options.offsetBottom || 0;
+		offset.left = options.offsetLeft || 0;
+
+		var throttledScroll = Materialize.throttle(function() {
+			onScroll(options.scrollOffset);
+		}, options.throttle || 100);
+		var readyScroll = function(){
+			$(document).ready(throttledScroll);
+		};
+
+		if (!isSpying) {
+			jWindow.on('scroll', readyScroll);
+			jWindow.on('resize', readyScroll);
+			isSpying = true;
+		}
+
+		// perform a scan once, after current execution context, and after dom is ready
+		setTimeout(readyScroll, 0);
+
+
+		selector.on('scrollSpy:enter', function() {
+			visible = $.grep(visible, function(value) {
+	      return value.height() != 0;
+	    });
+
+			var $this = $(this);
+
+			if (visible[0]) {
+				$('a[href="#' + visible[0].attr('id') + '"]').removeClass('active');
+				if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
+					visible.unshift($(this));
+				}
+				else {
+					visible.push($(this));
+				}
+			}
+			else {
+				visible.push($(this));
+			}
+
+
+			$('a[href="#' + visible[0].attr('id') + '"]').addClass('active');
+		});
+		selector.on('scrollSpy:exit', function() {
+			visible = $.grep(visible, function(value) {
+	      return value.height() != 0;
+	    });
+
+			if (visible[0]) {
+				$('a[href="#' + visible[0].attr('id') + '"]').removeClass('active');
+				var $this = $(this);
+				visible = $.grep(visible, function(value) {
+	        return value.attr('id') != $this.attr('id');
+	      });
+	      if (visible[0]) { // Check if empty
+					$('a[href="#' + visible[0].attr('id') + '"]').addClass('active');
+	      }
+			}
+		});
+
+		return selector;
+	};
+
+	/**
+	 * Listen for window resize events
+	 * @param {Object=} options						Optional. Set { throttle: number } to change throttling. Default: 100 ms
+	 * @returns {jQuery}		$(window)
+	 */
+	$.winSizeSpy = function(options) {
+		$.winSizeSpy = function() { return jWindow; }; // lock from multiple calls
+		options = options || {
+			throttle: 100
+		};
+		return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
+	};
+
+	/**
+	 * Enables ScrollSpy on a collection of elements
+	 * e.g. $('.scrollSpy').scrollSpy()
+	 * @param {Object=} options	Optional.
+											throttle : number -> scrollspy throttling. Default: 100 ms
+											offsetTop : number -> offset from top. Default: 0
+											offsetRight : number -> offset from right. Default: 0
+											offsetBottom : number -> offset from bottom. Default: 0
+											offsetLeft : number -> offset from left. Default: 0
+	 * @returns {jQuery}
+	 */
+	$.fn.scrollSpy = function(options) {
+		return $.scrollSpy($(this), options);
+	};
+
+})(jQuery);
+;(function ($) {
+  $(document).ready(function() {
+
+    // Function to update labels of text fields
+    Materialize.updateTextFields = function() {
+      var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
+      $(input_selector).each(function(index, element) {
+        var $this = $(this);
+        if ($(element).val().length > 0 || element.autofocus || $this.attr('placeholder') !== undefined) {
+          $this.siblings('label').addClass('active');
+        } else if ($(element)[0].validity) {
+          $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
+        } else {
+          $this.siblings('label').removeClass('active');
+        }
+      });
+    };
+
+    // Text based inputs
+    var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
+
+    // Add active if form auto complete
+    $(document).on('change', input_selector, function () {
+      if($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
+        $(this).siblings('label').addClass('active');
+      }
+      validate_field($(this));
+    });
+
+    // Add active if input element has been pre-populated on document ready
+    $(document).ready(function() {
+      Materialize.updateTextFields();
+    });
+
+    // HTML DOM FORM RESET handling
+    $(document).on('reset', function(e) {
+      var formReset = $(e.target);
+      if (formReset.is('form')) {
+        formReset.find(input_selector).removeClass('valid').removeClass('invalid');
+        formReset.find(input_selector).each(function () {
+          if ($(this).attr('value') === '') {
+            $(this).siblings('label').removeClass('active');
+          }
+        });
+
+        // Reset select
+        formReset.find('select.initialized').each(function () {
+          var reset_text = formReset.find('option[selected]').text();
+          formReset.siblings('input.select-dropdown').val(reset_text);
+        });
+      }
+    });
+
+    // Add active when element has focus
+    $(document).on('focus', input_selector, function () {
+      $(this).siblings('label, .prefix').addClass('active');
+    });
+
+    $(document).on('blur', input_selector, function () {
+      var $inputElement = $(this);
+      var selector = ".prefix";
+
+      if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
+        selector += ", label";
+      }
+
+      $inputElement.siblings(selector).removeClass('active');
+
+      validate_field($inputElement);
+    });
+
+    window.validate_field = function(object) {
+      var hasLength = object.attr('data-length') !== undefined;
+      var lenAttr = parseInt(object.attr('data-length'));
+      var len = object.val().length;
+
+      if (object.val().length === 0 && object[0].validity.badInput === false) {
+        if (object.hasClass('validate')) {
+          object.removeClass('valid');
+          object.removeClass('invalid');
+        }
+      }
+      else {
+        if (object.hasClass('validate')) {
+          // Check for character counter attributes
+          if ((object.is(':valid') && hasLength && (len <= lenAttr)) || (object.is(':valid') && !hasLength)) {
+            object.removeClass('invalid');
+            object.addClass('valid');
+          }
+          else {
+            object.removeClass('valid');
+            object.addClass('invalid');
+          }
+        }
+      }
+    };
+
+    // Radio and Checkbox focus class
+    var radio_checkbox = 'input[type=radio], input[type=checkbox]';
+    $(document).on('keyup.radio', radio_checkbox, function(e) {
+      // TAB, check if tabbing to radio or checkbox.
+      if (e.which === 9) {
+        $(this).addClass('tabbed');
+        var $this = $(this);
+        $this.one('blur', function(e) {
+
+          $(this).removeClass('tabbed');
+        });
+        return;
+      }
+    });
+
+    // Textarea Auto Resize
+    var hiddenDiv = $('.hiddendiv').first();
+    if (!hiddenDiv.length) {
+      hiddenDiv = $('<div class="hiddendiv common"></div>');
+      $('body').append(hiddenDiv);
+    }
+    var text_area_selector = '.materialize-textarea';
+
+    function textareaAutoResize($textarea) {
+      // Set font properties of hiddenDiv
+
+      var fontFamily = $textarea.css('font-family');
+      var fontSize = $textarea.css('font-size');
+      var lineHeight = $textarea.css('line-height');
+
+      if (fontSize) { hiddenDiv.css('font-size', fontSize); }
+      if (fontFamily) { hiddenDiv.css('font-family', fontFamily); }
+      if (lineHeight) { hiddenDiv.css('line-height', lineHeight); }
+
+      if ($textarea.attr('wrap') === "off") {
+        hiddenDiv.css('overflow-wrap', "normal")
+                 .css('white-space', "pre");
+      }
+
+      hiddenDiv.text($textarea.val() + '\n');
+      var content = hiddenDiv.html().replace(/\n/g, '<br>');
+      hiddenDiv.html(content);
+
+
+      // When textarea is hidden, width goes crazy.
+      // Approximate with half of window size
+
+      if ($textarea.is(':visible')) {
+        hiddenDiv.css('width', $textarea.width());
+      }
+      else {
+        hiddenDiv.css('width', $(window).width()/2);
+      }
+
+      $textarea.css('height', hiddenDiv.height());
+    }
+
+    $(text_area_selector).each(function () {
+      var $textarea = $(this);
+      if ($textarea.val().length) {
+        textareaAutoResize($textarea);
+      }
+    });
+
+    $('body').on('keyup keydown autoresize', text_area_selector, function () {
+      textareaAutoResize($(this));
+    });
+
+    // File Input Path
+    $(document).on('change', '.file-field input[type="file"]', function () {
+      var file_field = $(this).closest('.file-field');
+      var path_input = file_field.find('input.file-path');
+      var files      = $(this)[0].files;
+      var file_names = [];
+      for (var i = 0; i < files.length; i++) {
+        file_names.push(files[i].name);
+      }
+      path_input.val(file_names.join(", "));
+      path_input.trigger('change');
+    });
+
+    /****************
+    *  Range Input  *
+    ****************/
+
+    var range_type = 'input[type=range]';
+    var range_mousedown = false;
+    var left;
+
+    $(range_type).each(function () {
+      var thumb = $('<span class="thumb"><span class="value"></span></span>');
+      $(this).after(thumb);
+    });
+
+    var range_wrapper = '.range-field';
+    $(document).on('change', range_type, function(e) {
+      var thumb = $(this).siblings('.thumb');
+      thumb.find('.value').html($(this).val());
+    });
+
+    $(document).on('input mousedown touchstart', range_type, function(e) {
+      var thumb = $(this).siblings('.thumb');
+      var width = $(this).outerWidth();
+
+      // If thumb indicator does not exist yet, create it
+      if (thumb.length <= 0) {
+        thumb = $('<span class="thumb"><span class="value"></span></span>');
+        $(this).after(thumb);
+      }
+
+      // Set indicator value
+      thumb.find('.value').html($(this).val());
+
+      range_mousedown = true;
+      $(this).addClass('active');
+
+      if (!thumb.hasClass('active')) {
+        thumb.velocity({ height: "30px", width: "30px", top: "-20px", marginLeft: "-15px"}, { duration: 300, easing: 'easeOutExpo' });
+      }
+
+      if (e.type !== 'input') {
+        if(e.pageX === undefined || e.pageX === null){//mobile
+           left = e.originalEvent.touches[0].pageX - $(this).offset().left;
+        }
+        else{ // desktop
+           left = e.pageX - $(this).offset().left;
+        }
+        if (left < 0) {
+          left = 0;
+        }
+        else if (left > width) {
+          left = width;
+        }
+        thumb.addClass('active').css('left', left);
+      }
+
+      thumb.find('.value').html($(this).val());
+    });
+
+    $(document).on('mouseup touchend', range_wrapper, function() {
+      range_mousedown = false;
+      $(this).removeClass('active');
+    });
+
+    $(document).on('mousemove touchmove', range_wrapper, function(e) {
+      var thumb = $(this).children('.thumb');
+      var left;
+      if (range_mousedown) {
+        if (!thumb.hasClass('active')) {
+          thumb.velocity({ height: '30px', width: '30px', top: '-20px', marginLeft: '-15px'}, { duration: 300, easing: 'easeOutExpo' });
+        }
+        if (e.pageX === undefined || e.pageX === null) { //mobile
+          left = e.originalEvent.touches[0].pageX - $(this).offset().left;
+        }
+        else{ // desktop
+          left = e.pageX - $(this).offset().left;
+        }
+        var width = $(this).outerWidth();
+
+        if (left < 0) {
+          left = 0;
+        }
+        else if (left > width) {
+          left = width;
+        }
+        thumb.addClass('active').css('left', left);
+        thumb.find('.value').html(thumb.siblings(range_type).val());
+      }
+    });
+
+    $(document).on('mouseout touchleave', range_wrapper, function() {
+      if (!range_mousedown) {
+
+        var thumb = $(this).children('.thumb');
+
+        if (thumb.hasClass('active')) {
+          thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: '-6px'}, { duration: 100 });
+        }
+        thumb.removeClass('active');
+      }
+    });
+
+    /**************************
+     * Auto complete plugin  *
+     *************************/
+    $.fn.autocomplete = function (options) {
+      // Defaults
+      var defaults = {
+        data: {},
+        limit: Infinity,
+        onAutocomplete: null
+      };
+
+      options = $.extend(defaults, options);
+
+      return this.each(function() {
+        var $input = $(this);
+        var data = options.data,
+            count = 0,
+            activeIndex = 0,
+            oldVal,
+            $inputDiv = $input.closest('.input-field'); // Div to append on
+
+        // Check if data isn't empty
+        if (!$.isEmptyObject(data)) {
+          var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>');
+          var $oldAutocomplete;
+
+          // Append autocomplete element.
+          // Prevent double structure init.
+          if ($inputDiv.length) {
+            $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
+            if (!$oldAutocomplete.length) {
+              $inputDiv.append($autocomplete); // Set ul in body
+            }
+          } else {
+            $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
+            if (!$oldAutocomplete.length) {
+              $input.after($autocomplete);
+            }
+          }
+          if ($oldAutocomplete.length) {
+            $autocomplete = $oldAutocomplete;
+          }
+
+          // Highlight partial match.
+          var highlight = function(string, $el) {
+            var img = $el.find('img');
+            var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
+                matchEnd = matchStart + string.length - 1,
+                beforeMatch = $el.text().slice(0, matchStart),
+                matchText = $el.text().slice(matchStart, matchEnd + 1),
+                afterMatch = $el.text().slice(matchEnd + 1);
+            $el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>");
+            if (img.length) {
+              $el.prepend(img);
+            }
+          };
+
+          // Reset current element position
+          var resetCurrentElement = function() {
+            activeIndex = 0;
+            $autocomplete.find('.active').removeClass('active');
+          }
+
+          // Perform search
+          $input.off('keyup.autocomplete').on('keyup.autocomplete', function (e) {
+            // Reset count.
+            count = 0;
+
+            // Don't capture enter or arrow key usage.
+            if (e.which === 13 ||
+                e.which === 38 ||
+                e.which === 40) {
+              return;
+            }
+
+            var val = $input.val().toLowerCase();
+
+            // Check if the input isn't empty
+            if (oldVal !== val) {
+              $autocomplete.empty();
+              resetCurrentElement();
+
+              if (val !== '') {
+                for(var key in data) {
+                  if (data.hasOwnProperty(key) &&
+                      key.toLowerCase().indexOf(val) !== -1 &&
+                      key.toLowerCase() !== val) {
+                    // Break if past limit
+                    if (count >= options.limit) {
+                      break;
+                    }
+
+                    var autocompleteOption = $('<li></li>');
+                    if (!!data[key]) {
+                      autocompleteOption.append('<img src="'+ data[key] +'" class="right circle"><span>'+ key +'</span>');
+                    } else {
+                      autocompleteOption.append('<span>'+ key +'</span>');
+                    }
+
+                    $autocomplete.append(autocompleteOption);
+                    highlight(val, autocompleteOption);
+                    count++;
+                  }
+                }
+              }
+            }
+
+            // Update oldVal
+            oldVal = val;
+          });
+
+          $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
+            // Arrow keys and enter key usage
+            var keyCode = e.which,
+                liElement,
+                numItems = $autocomplete.children('li').length,
+                $active = $autocomplete.children('.active').first();
+
+            // select element on Enter
+            if (keyCode === 13) {
+              liElement = $autocomplete.children('li').eq(activeIndex);
+              if (liElement.length) {
+                liElement.click();
+                e.preventDefault();
+              }
+              return;
+            }
+
+            // Capture up and down key
+            if ( keyCode === 38 || keyCode === 40 ) {
+              e.preventDefault();
+
+              if (keyCode === 38 &&
+                  activeIndex > 0) {
+                activeIndex--;
+              }
+
+              if (keyCode === 40 &&
+                  activeIndex < (numItems - 1) &&
+                  $active.length) {
+                activeIndex++;
+              }
+
+              $active.removeClass('active');
+              $autocomplete.children('li').eq(activeIndex).addClass('active');
+            }
+          });
+
+          // Set input value
+          $autocomplete.on('click', 'li', function () {
+            var text = $(this).text().trim();
+            $input.val(text);
+            $input.trigger('change');
+            $autocomplete.empty();
+            resetCurrentElement();
+
+            // Handle onAutocomplete callback.
+            if (typeof(options.onAutocomplete) === "function") {
+              options.onAutocomplete.call(this, text);
+            }
+          });
+        }
+      });
+    };
+
+  }); // End of $(document).ready
+
+  /*******************
+   *  Select Plugin  *
+   ******************/
+  $.fn.material_select = function (callback) {
+    $(this).each(function(){
+      var $select = $(this);
+
+      if ($select.hasClass('browser-default')) {
+        return; // Continue to next (return false breaks out of entire loop)
+      }
+
+      var multiple = $select.attr('multiple') ? true : false,
+          lastID = $select.data('select-id'); // Tear down structure if Select needs to be rebuilt
+
+      if (lastID) {
+        $select.parent().find('span.caret').remove();
+        $select.parent().find('input').remove();
+
+        $select.unwrap();
+        $('ul#select-options-'+lastID).remove();
+      }
+
+      // If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
+      if(callback === 'destroy') {
+        $select.data('select-id', null).removeClass('initialized');
+        return;
+      }
+
+      var uniqueID = Materialize.guid();
+      $select.data('select-id', uniqueID);
+      var wrapper = $('<div class="select-wrapper"></div>');
+      wrapper.addClass($select.attr('class'));
+      var options = $('<ul id="select-options-' + uniqueID +'" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'),
+          selectChildren = $select.children('option, optgroup'),
+          valuesSelected = [],
+          optionsHover = false;
+
+      var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
+
+      // Function that renders and appends the option taking into
+      // account type and possible image icon.
+      var appendOptionWithIcon = function(select, option, type) {
+        // Add disabled attr if disabled
+        var disabledClass = (option.is(':disabled')) ? 'disabled ' : '';
+        var optgroupClass = (type === 'optgroup-option') ? 'optgroup-option ' : '';
+
+        // add icons
+        var icon_url = option.data('icon');
+        var classes = option.attr('class');
+        if (!!icon_url) {
+          var classString = '';
+          if (!!classes) classString = ' class="' + classes + '"';
+
+          // Check for multiple type.
+          if (type === 'multiple') {
+            options.append($('<li class="' + disabledClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span><input type="checkbox"' + disabledClass + '/><label></label>' + option.html() + '</span></li>'));
+          } else {
+            options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + option.html() + '</span></li>'));
+          }
+          return true;
+        }
+
+        // Check for multiple type.
+        if (type === 'multiple') {
+          options.append($('<li class="' + disabledClass + '"><span><input type="checkbox"' + disabledClass + '/><label></label>' + option.html() + '</span></li>'));
+        } else {
+          options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + option.html() + '</span></li>'));
+        }
+      };
+
+      /* Create dropdown structure. */
+      if (selectChildren.length) {
+        selectChildren.each(function() {
+          if ($(this).is('option')) {
+            // Direct descendant option.
+            if (multiple) {
+              appendOptionWithIcon($select, $(this), 'multiple');
+
+            } else {
+              appendOptionWithIcon($select, $(this));
+            }
+          } else if ($(this).is('optgroup')) {
+            // Optgroup.
+            var selectOptions = $(this).children('option');
+            options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>'));
+
+            selectOptions.each(function() {
+              appendOptionWithIcon($select, $(this), 'optgroup-option');
+            });
+          }
+        });
+      }
+
+      options.find('li:not(.optgroup)').each(function (i) {
+        $(this).click(function (e) {
+          // Check if option element is disabled
+          if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
+            var selected = true;
+
+            if (multiple) {
+              $('input[type="checkbox"]', this).prop('checked', function(i, v) { return !v; });
+              selected = toggleEntryFromArray(valuesSelected, $(this).index(), $select);
+              $newSelect.trigger('focus');
+            } else {
+              options.find('li').removeClass('active');
+              $(this).toggleClass('active');
+              $newSelect.val($(this).text());
+            }
+
+            activateOption(options, $(this));
+            $select.find('option').eq(i).prop('selected', selected);
+            // Trigger onchange() event
+            $select.trigger('change');
+            if (typeof callback !== 'undefined') callback();
+          }
+
+          e.stopPropagation();
+        });
+      });
+
+      // Wrap Elements
+      $select.wrap(wrapper);
+      // Add Select Display Element
+      var dropdownIcon = $('<span class="caret">&#9660;</span>');
+      if ($select.is(':disabled'))
+        dropdownIcon.addClass('disabled');
+
+      // escape double quotes
+      var sanitizedLabelHtml = label.replace(/"/g, '&quot;');
+
+      var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + (($select.is(':disabled')) ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID +'" value="'+ sanitizedLabelHtml +'"/>');
+      $select.before($newSelect);
+      $newSelect.before(dropdownIcon);
+
+      $newSelect.after(options);
+      // Check if section element is disabled
+      if (!$select.is(':disabled')) {
+        $newSelect.dropdown({'hover': false, 'closeOnClick': false});
+      }
+
+      // Copy tabindex
+      if ($select.attr('tabindex')) {
+        $($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
+      }
+
+      $select.addClass('initialized');
+
+      $newSelect.on({
+        'focus': function (){
+          if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
+            $('input.select-dropdown').trigger('close');
+          }
+          if (!options.is(':visible')) {
+            $(this).trigger('open', ['focus']);
+            var label = $(this).val();
+            if (multiple && label.indexOf(',') >= 0) {
+              label = label.split(',')[0];
+            }
+
+            var selectedOption = options.find('li').filter(function() {
+              return $(this).text().toLowerCase() === label.toLowerCase();
+            })[0];
+            activateOption(options, selectedOption, true);
+          }
+        },
+        'click': function (e){
+          e.stopPropagation();
+        }
+      });
+
+      $newSelect.on('blur', function() {
+        if (!multiple) {
+          $(this).trigger('close');
+        }
+        options.find('li.selected').removeClass('selected');
+      });
+
+      options.hover(function() {
+        optionsHover = true;
+      }, function () {
+        optionsHover = false;
+      });
+
+      $(window).on({
+        'click': function () {
+          multiple && (optionsHover || $newSelect.trigger('close'));
+        }
+      });
+
+      // Add initial multiple selections.
+      if (multiple) {
+        $select.find("option:selected:not(:disabled)").each(function () {
+          var index = $(this).index();
+
+          toggleEntryFromArray(valuesSelected, index, $select);
+          options.find("li").eq(index).find(":checkbox").prop("checked", true);
+        });
+      }
+
+      /**
+       * Make option as selected and scroll to selected position
+       * @param {jQuery} collection  Select options jQuery element
+       * @param {Element} newOption  element of the new option
+       * @param {Boolean} firstActivation  If on first activation of select
+       */
+      var activateOption = function(collection, newOption, firstActivation) {
+        if (newOption) {
+          collection.find('li.selected').removeClass('selected');
+          var option = $(newOption);
+          option.addClass('selected');
+          if (!multiple || !!firstActivation) {
+            options.scrollTo(option);
+          }
+        }
+      };
+
+      // Allow user to search by typing
+      // this array is cleared after 1 second
+      var filterQuery = [],
+          onKeyDown = function(e){
+            // TAB - switch to another input
+            if(e.which == 9){
+              $newSelect.trigger('close');
+              return;
+            }
+
+            // ARROW DOWN WHEN SELECT IS CLOSED - open select options
+            if(e.which == 40 && !options.is(':visible')){
+              $newSelect.trigger('open');
+              return;
+            }
+
+            // ENTER WHEN SELECT IS CLOSED - submit form
+            if(e.which == 13 && !options.is(':visible')){
+              return;
+            }
+
+            e.preventDefault();
+
+            // CASE WHEN USER TYPE LETTERS
+            var letter = String.fromCharCode(e.which).toLowerCase(),
+                nonLetters = [9,13,27,38,40];
+            if (letter && (nonLetters.indexOf(e.which) === -1)) {
+              filterQuery.push(letter);
+
+              var string = filterQuery.join(''),
+                  newOption = options.find('li').filter(function() {
+                    return $(this).text().toLowerCase().indexOf(string) === 0;
+                  })[0];
+
+              if (newOption) {
+                activateOption(options, newOption);
+              }
+            }
+
+            // ENTER - select option and close when select options are opened
+            if (e.which == 13) {
+              var activeOption = options.find('li.selected:not(.disabled)')[0];
+              if(activeOption){
+                $(activeOption).trigger('click');
+                if (!multiple) {
+                  $newSelect.trigger('close');
+                }
+              }
+            }
+
+            // ARROW DOWN - move to next not disabled option
+            if (e.which == 40) {
+              if (options.find('li.selected').length) {
+                newOption = options.find('li.selected').next('li:not(.disabled)')[0];
+              } else {
+                newOption = options.find('li:not(.disabled)')[0];
+              }
+              activateOption(options, newOption);
+            }
+
+            // ESC - close options
+            if (e.which == 27) {
+              $newSelect.trigger('close');
+            }
+
+            // ARROW UP - move to previous not disabled option
+            if (e.which == 38) {
+              newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
+              if(newOption)
+                activateOption(options, newOption);
+            }
+
+            // Automaticaly clean filter query so user can search again by starting letters
+            setTimeout(function(){ filterQuery = []; }, 1000);
+          };
+
+      $newSelect.on('keydown', onKeyDown);
+    });
+
+    function toggleEntryFromArray(entriesArray, entryIndex, select) {
+      var index = entriesArray.indexOf(entryIndex),
+          notAdded = index === -1;
+
+      if (notAdded) {
+        entriesArray.push(entryIndex);
+      } else {
+        entriesArray.splice(index, 1);
+      }
+
+      select.siblings('ul.dropdown-content').find('li').eq(entryIndex).toggleClass('active');
+
+      // use notAdded instead of true (to detect if the option is selected or not)
+      select.find('option').eq(entryIndex).prop('selected', notAdded);
+      setValueToInput(entriesArray, select);
+
+      return notAdded;
+    }
+
+    function setValueToInput(entriesArray, select) {
+      var value = '';
+
+      for (var i = 0, count = entriesArray.length; i < count; i++) {
+        var text = select.find('option').eq(entriesArray[i]).text();
+
+        i === 0 ? value += text : value += ', ' + text;
+      }
+
+      if (value === '') {
+        value = select.find('option:disabled').eq(0).text();
+      }
+
+      select.siblings('input.select-dropdown').val(value);
+    }
+  };
+
+}( jQuery ));
+;(function ($) {
+
+  var methods = {
+
+    init : function(options) {
+      var defaults = {
+        indicators: true,
+        height: 400,
+        transition: 500,
+        interval: 6000
+      };
+      options = $.extend(defaults, options);
+
+      return this.each(function() {
+
+        // For each slider, we want to keep track of
+        // which slide is active and its associated content
+        var $this = $(this);
+        var $slider = $this.find('ul.slides').first();
+        var $slides = $slider.find('> li');
+        var $active_index = $slider.find('.active').index();
+        var $active, $indicators, $interval;
+        if ($active_index != -1) { $active = $slides.eq($active_index); }
+
+        // Transitions the caption depending on alignment
+        function captionTransition(caption, duration) {
+          if (caption.hasClass("center-align")) {
+            caption.velocity({opacity: 0, translateY: -100}, {duration: duration, queue: false});
+          }
+          else if (caption.hasClass("right-align")) {
+            caption.velocity({opacity: 0, translateX: 100}, {duration: duration, queue: false});
+          }
+          else if (caption.hasClass("left-align")) {
+            caption.velocity({opacity: 0, translateX: -100}, {duration: duration, queue: false});
+          }
+        }
+
+        // This function will transition the slide to any index of the next slide
+        function moveToSlide(index) {
+          // Wrap around indices.
+          if (index >= $slides.length) index = 0;
+          else if (index < 0) index = $slides.length -1;
+
+          $active_index = $slider.find('.active').index();
+
+          // Only do if index changes
+          if ($active_index != index) {
+            $active = $slides.eq($active_index);
+            $caption = $active.find('.caption');
+
+            $active.removeClass('active');
+            $active.velocity({opacity: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad',
+                              complete: function() {
+                                $slides.not('.active').velocity({opacity: 0, translateX: 0, translateY: 0}, {duration: 0, queue: false});
+                              } });
+            captionTransition($caption, options.transition);
+
+
+            // Update indicators
+            if (options.indicators) {
+              $indicators.eq($active_index).removeClass('active');
+            }
+
+            $slides.eq(index).velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'});
+            $slides.eq(index).find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad'});
+            $slides.eq(index).addClass('active');
+
+
+            // Update indicators
+            if (options.indicators) {
+              $indicators.eq(index).addClass('active');
+            }
+          }
+        }
+
+        // Set height of slider
+        // If fullscreen, do nothing
+        if (!$this.hasClass('fullscreen')) {
+          if (options.indicators) {
+            // Add height if indicators are present
+            $this.height(options.height + 40);
+          }
+          else {
+            $this.height(options.height);
+          }
+          $slider.height(options.height);
+        }
+
+
+        // Set initial positions of captions
+        $slides.find('.caption').each(function () {
+          captionTransition($(this), 0);
+        });
+
+        // Move img src into background-image
+        $slides.find('img').each(function () {
+          var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
+          if ($(this).attr('src') !== placeholderBase64) {
+            $(this).css('background-image', 'url(' + $(this).attr('src') + ')' );
+            $(this).attr('src', placeholderBase64);
+          }
+        });
+
+        // dynamically add indicators
+        if (options.indicators) {
+          $indicators = $('<ul class="indicators"></ul>');
+          $slides.each(function( index ) {
+            var $indicator = $('<li class="indicator-item"></li>');
+
+            // Handle clicks on indicators
+            $indicator.click(function () {
+              var $parent = $slider.parent();
+              var curr_index = $parent.find($(this)).index();
+              moveToSlide(curr_index);
+
+              // reset interval
+              clearInterval($interval);
+              $interval = setInterval(
+                function(){
+                  $active_index = $slider.find('.active').index();
+                  if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+                  else $active_index += 1;
+
+                  moveToSlide($active_index);
+
+                }, options.transition + options.interval
+              );
+            });
+            $indicators.append($indicator);
+          });
+          $this.append($indicators);
+          $indicators = $this.find('ul.indicators').find('li.indicator-item');
+        }
+
+        if ($active) {
+          $active.show();
+        }
+        else {
+          $slides.first().addClass('active').velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'});
+
+          $active_index = 0;
+          $active = $slides.eq($active_index);
+
+          // Update indicators
+          if (options.indicators) {
+            $indicators.eq($active_index).addClass('active');
+          }
+        }
+
+        // Adjust height to current slide
+        $active.find('img').each(function() {
+          $active.find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad'});
+        });
+
+        // auto scroll
+        $interval = setInterval(
+          function(){
+            $active_index = $slider.find('.active').index();
+            moveToSlide($active_index + 1);
+
+          }, options.transition + options.interval
+        );
+
+
+        // HammerJS, Swipe navigation
+
+        // Touch Event
+        var panning = false;
+        var swipeLeft = false;
+        var swipeRight = false;
+
+        $this.hammer({
+            prevent_default: false
+        }).bind('pan', function(e) {
+          if (e.gesture.pointerType === "touch") {
+
+            // reset interval
+            clearInterval($interval);
+
+            var direction = e.gesture.direction;
+            var x = e.gesture.deltaX;
+            var velocityX = e.gesture.velocityX;
+            var velocityY = e.gesture.velocityY;
+
+            $curr_slide = $slider.find('.active');
+            if (Math.abs(velocityX) > Math.abs(velocityY)) {
+              $curr_slide.velocity({ translateX: x
+                  }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+            }
+
+            // Swipe Left
+            if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.65)) {
+              swipeRight = true;
+            }
+            // Swipe Right
+            else if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.65)) {
+              swipeLeft = true;
+            }
+
+            // Make Slide Behind active slide visible
+            var next_slide;
+            if (swipeLeft) {
+              next_slide = $curr_slide.next();
+              if (next_slide.length === 0) {
+                next_slide = $slides.first();
+              }
+              next_slide.velocity({ opacity: 1
+                  }, {duration: 300, queue: false, easing: 'easeOutQuad'});
+            }
+            if (swipeRight) {
+              next_slide = $curr_slide.prev();
+              if (next_slide.length === 0) {
+                next_slide = $slides.last();
+              }
+              next_slide.velocity({ opacity: 1
+                  }, {duration: 300, queue: false, easing: 'easeOutQuad'});
+            }
+
+
+          }
+
+        }).bind('panend', function(e) {
+          if (e.gesture.pointerType === "touch") {
+
+            $curr_slide = $slider.find('.active');
+            panning = false;
+            curr_index = $slider.find('.active').index();
+
+            if (!swipeRight && !swipeLeft || $slides.length <=1) {
+              // Return to original spot
+              $curr_slide.velocity({ translateX: 0
+                  }, {duration: 300, queue: false, easing: 'easeOutQuad'});
+            }
+            else if (swipeLeft) {
+              moveToSlide(curr_index + 1);
+              $curr_slide.velocity({translateX: -1 * $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad',
+                                    complete: function() {
+                                      $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false});
+                                    } });
+            }
+            else if (swipeRight) {
+              moveToSlide(curr_index - 1);
+              $curr_slide.velocity({translateX: $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad',
+                                    complete: function() {
+                                      $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false});
+                                    } });
+            }
+            swipeLeft = false;
+            swipeRight = false;
+
+            // Restart interval
+            clearInterval($interval);
+            $interval = setInterval(
+              function(){
+                $active_index = $slider.find('.active').index();
+                if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+                else $active_index += 1;
+
+                moveToSlide($active_index);
+
+              }, options.transition + options.interval
+            );
+          }
+        });
+
+        $this.on('sliderPause', function() {
+          clearInterval($interval);
+        });
+
+        $this.on('sliderStart', function() {
+          clearInterval($interval);
+          $interval = setInterval(
+            function(){
+              $active_index = $slider.find('.active').index();
+              if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+              else $active_index += 1;
+
+              moveToSlide($active_index);
+
+            }, options.transition + options.interval
+          );
+        });
+
+        $this.on('sliderNext', function() {
+          $active_index = $slider.find('.active').index();
+          moveToSlide($active_index + 1);
+        });
+
+        $this.on('sliderPrev', function() {
+          $active_index = $slider.find('.active').index();
+          moveToSlide($active_index - 1);
+        });
+
+      });
+
+
+
+    },
+    pause : function() {
+      $(this).trigger('sliderPause');
+    },
+    start : function() {
+      $(this).trigger('sliderStart');
+    },
+    next : function() {
+      $(this).trigger('sliderNext');
+    },
+    prev : function() {
+      $(this).trigger('sliderPrev');
+    }
+  };
+
+
+  $.fn.slider = function(methodOrOptions) {
+    if ( methods[methodOrOptions] ) {
+      return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+    } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+      // Default to "init"
+      return methods.init.apply( this, arguments );
+    } else {
+      $.error( 'Method ' +  methodOrOptions + ' does not exist on jQuery.tooltip' );
+    }
+  }; // Plugin end
+}( jQuery ));
+;(function ($) {
+  $(document).ready(function() {
+
+    $(document).on('click.card', '.card', function (e) {
+      if ($(this).find('> .card-reveal').length) {
+        if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
+          // Make Reveal animate down and display none
+          $(this).find('.card-reveal').velocity(
+            {translateY: 0}, {
+              duration: 225,
+              queue: false,
+              easing: 'easeInOutQuad',
+              complete: function() { $(this).css({ display: 'none'}); }
+            }
+          );
+        }
+        else if ($(e.target).is($('.card .activator')) ||
+                 $(e.target).is($('.card .activator i')) ) {
+          $(e.target).closest('.card').css('overflow', 'hidden');
+          $(this).find('.card-reveal').css({ display: 'block'}).velocity("stop", false).velocity({translateY: '-100%'}, {duration: 300, queue: false, easing: 'easeInOutQuad'});
+        }
+      }
+    });
+
+  });
+}( jQuery ));;(function ($) {
+  var materialChipsDefaults = {
+    data: [],
+    placeholder: '',
+    secondaryPlaceholder: '',
+    autocompleteData: {},
+    autocompleteLimit: Infinity,
+  };
+
+  $(document).ready(function() {
+    // Handle removal of static chips.
+    $(document).on('click', '.chip .close', function(e){
+      var $chips = $(this).closest('.chips');
+      if ($chips.attr('data-initialized')) {
+        return;
+      }
+      $(this).closest('.chip').remove();
+    });
+  });
+
+  $.fn.material_chip = function (options) {
+    var self = this;
+    this.$el = $(this);
+    this.$document = $(document);
+    this.SELS = {
+      CHIPS: '.chips',
+      CHIP: '.chip',
+      INPUT: 'input',
+      DELETE: '.material-icons',
+      SELECTED_CHIP: '.selected',
+    };
+
+    if ('data' === options) {
+      return this.$el.data('chips');
+    }
+
+    var curr_options = $.extend({}, materialChipsDefaults, options);
+    self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteData);
+
+    // Initialize
+    this.init = function() {
+      var i = 0;
+      var chips;
+      self.$el.each(function(){
+        var $chips = $(this);
+        var chipId = Materialize.guid();
+        self.chipId = chipId;
+
+        if (!curr_options.data || !(curr_options.data instanceof Array)) {
+          curr_options.data = [];
+        }
+        $chips.data('chips', curr_options.data);
+        $chips.attr('data-index', i);
+        $chips.attr('data-initialized', true);
+
+        if (!$chips.hasClass(self.SELS.CHIPS)) {
+          $chips.addClass('chips');
+        }
+
+        self.chips($chips, chipId);
+        i++;
+      });
+    };
+
+    this.handleEvents = function() {
+      var SELS = self.SELS;
+
+      self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function(e){
+        $(e.target).find(SELS.INPUT).focus();
+      });
+
+      self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function(e){
+        var $chip = $(e.target);
+        if ($chip.length) {
+          var wasSelected = $chip.hasClass('selected');
+          var $chips = $chip.closest(SELS.CHIPS);
+          $(SELS.CHIP).removeClass('selected');
+
+          if (!wasSelected) {
+            self.selectChip($chip.index(), $chips);
+          }
+        }
+      });
+
+      self.$document.off('keydown.chips').on('keydown.chips', function(e){
+        if ($(e.target).is('input, textarea')) {
+          return;
+        }
+
+        // delete
+        var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
+        var $chips = $chip.closest(SELS.CHIPS);
+        var length = $chip.siblings(SELS.CHIP).length;
+        var index;
+
+        if (!$chip.length) {
+          return;
+        }
+
+        if (e.which === 8 || e.which === 46) {
+          e.preventDefault();
+
+          index = $chip.index();
+          self.deleteChip(index, $chips);
+
+          var selectIndex = null;
+          if ((index + 1) < length) {
+            selectIndex = index;
+          } else if (index === length || (index + 1) === length) {
+            selectIndex = length - 1;
+          }
+
+          if (selectIndex < 0) selectIndex = null;
+
+          if (null !== selectIndex) {
+            self.selectChip(selectIndex, $chips);
+          }
+          if (!length) $chips.find('input').focus();
+
+        // left
+        } else if (e.which === 37) {
+          index = $chip.index() - 1;
+          if (index < 0) {
+            return;
+          }
+          $(SELS.CHIP).removeClass('selected');
+          self.selectChip(index, $chips);
+
+        // right
+        } else if (e.which === 39) {
+          index = $chip.index() + 1;
+          $(SELS.CHIP).removeClass('selected');
+          if (index > length) {
+            $chips.find('input').focus();
+            return;
+          }
+          self.selectChip(index, $chips);
+        }
+      });
+
+      self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){
+        var $currChips = $(e.target).closest(SELS.CHIPS);
+        $currChips.addClass('focus');
+        $currChips.siblings('label, .prefix').addClass('active');
+        $(SELS.CHIP).removeClass('selected');
+      });
+
+      self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){
+        var $currChips = $(e.target).closest(SELS.CHIPS);
+        $currChips.removeClass('focus');
+
+        // Remove active if empty
+        if (!$currChips.data('chips').length) {
+          $currChips.siblings('label').removeClass('active');
+        }
+        $currChips.siblings('.prefix').removeClass('active');
+      });
+
+      self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function(e){
+        var $target = $(e.target);
+        var $chips = $target.closest(SELS.CHIPS);
+        var chipsLength = $chips.children(SELS.CHIP).length;
+
+        // enter
+        if (13 === e.which) {
+          // Override enter if autocompleting.
+          if (self.hasAutocomplete &&
+              $chips.find('.autocomplete-content.dropdown-content').length &&
+              $chips.find('.autocomplete-content.dropdown-content').children().length) {
+            return;
+          }
+
+          e.preventDefault();
+          self.addChip({tag: $target.val()}, $chips);
+          $target.val('');
+          return;
+        }
+
+        // delete or left
+        if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) {
+          e.preventDefault();
+          self.selectChip(chipsLength - 1, $chips);
+          $target.blur();
+          return;
+        }
+      });
+
+      // Click on delete icon in chip.
+      self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function(e) {
+        var $target = $(e.target);
+        var $chips = $target.closest(SELS.CHIPS);
+        var $chip = $target.closest(SELS.CHIP);
+        e.stopPropagation();
+        self.deleteChip($chip.index(), $chips);
+        $chips.find('input').focus();
+      });
+    };
+
+    this.chips = function($chips, chipId) {
+      var html = '';
+      $chips.data('chips').forEach(function(elem){
+        html += self.renderChip(elem);
+      });
+      html += '<input id="' + chipId +'" class="input" placeholder="">';
+      $chips.html(html);
+      self.setPlaceholder($chips);
+
+      // Set for attribute for label
+      var label = $chips.next('label');
+      if (label.length) {
+        label.attr('for', chipId);
+
+        if ($chips.data('chips').length) {
+          label.addClass('active');
+        }
+      }
+
+      // Setup autocomplete if needed.
+      var input = $('#' + chipId);
+      if (self.hasAutocomplete) {
+        input.autocomplete({
+          data: curr_options.autocompleteData,
+          limit: curr_options.autocompleteLimit,
+          onAutocomplete: function(val) {
+            self.addChip({tag: val}, $chips);
+            input.val('');
+            input.focus();
+          },
+        })
+      }
+    };
+
+    this.renderChip = function(elem) {
+      if (!elem.tag) return;
+
+      var html = '<div class="chip">' + elem.tag;
+      if (elem.image) {
+        html += ' <img src="' + elem.image + '"> ';
+      }
+      html += '<i class="material-icons close">close</i>';
+      html += '</div>';
+      return html;
+    };
+
+    this.setPlaceholder = function($chips) {
+      if ($chips.data('chips').length && curr_options.placeholder) {
+        $chips.find('input').prop('placeholder', curr_options.placeholder);
+
+      } else if (!$chips.data('chips').length && curr_options.secondaryPlaceholder) {
+        $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
+      }
+    };
+
+    this.isValid = function($chips, elem) {
+      var chips = $chips.data('chips');
+      var exists = false;
+      for (var i=0; i < chips.length; i++) {
+        if (chips[i].tag === elem.tag) {
+            exists = true;
+            return;
+        }
+      }
+      return '' !== elem.tag && !exists;
+    };
+
+    this.addChip = function(elem, $chips) {
+      if (!self.isValid($chips, elem)) {
+        return;
+      }
+      var chipHtml = self.renderChip(elem);
+      var newData = [];
+      var oldData = $chips.data('chips');
+      for (var i = 0; i < oldData.length; i++) {
+        newData.push(oldData[i]);
+      }
+      newData.push(elem);
+
+      $chips.data('chips', newData);
+      $(chipHtml).insertBefore($chips.find('input'));
+      $chips.trigger('chip.add', elem);
+      self.setPlaceholder($chips);
+    };
+
+    this.deleteChip = function(chipIndex, $chips) {
+      var chip = $chips.data('chips')[chipIndex];
+      $chips.find('.chip').eq(chipIndex).remove();
+
+      var newData = [];
+      var oldData = $chips.data('chips');
+      for (var i = 0; i < oldData.length; i++) {
+        if (i !== chipIndex) {
+          newData.push(oldData[i]);
+        }
+      }
+
+      $chips.data('chips', newData);
+      $chips.trigger('chip.delete', chip);
+      self.setPlaceholder($chips);
+    };
+
+    this.selectChip = function(chipIndex, $chips) {
+      var $chip = $chips.find('.chip').eq(chipIndex);
+      if ($chip && false === $chip.hasClass('selected')) {
+        $chip.addClass('selected');
+        $chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
+      }
+    };
+
+    this.getChipsElement = function(index, $chips) {
+      return $chips.eq(index);
+    };
+
+    // init
+    this.init();
+
+    this.handleEvents();
+  };
+}( jQuery ));
+;(function ($) {
+  $.fn.pushpin = function (options) {
+    // Defaults
+    var defaults = {
+      top: 0,
+      bottom: Infinity,
+      offset: 0
+    };
+
+    // Remove pushpin event and classes
+    if (options === "remove") {
+      this.each(function () {
+        if (id = $(this).data('pushpin-id')) {
+          $(window).off('scroll.' + id);
+          $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
+        }
+      });
+      return false;
+    }
+
+    options = $.extend(defaults, options);
+
+
+    $index = 0;
+    return this.each(function() {
+      var $uniqueId = Materialize.guid(),
+          $this = $(this),
+          $original_offset = $(this).offset().top;
+
+      function removePinClasses(object) {
+        object.removeClass('pin-top');
+        object.removeClass('pinned');
+        object.removeClass('pin-bottom');
+      }
+
+      function updateElements(objects, scrolled) {
+        objects.each(function () {
+          // Add position fixed (because its between top and bottom)
+          if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
+            removePinClasses($(this));
+            $(this).css('top', options.offset);
+            $(this).addClass('pinned');
+          }
+
+          // Add pin-top (when scrolled position is above top)
+          if (scrolled < options.top && !$(this).hasClass('pin-top')) {
+            removePinClasses($(this));
+            $(this).css('top', 0);
+            $(this).addClass('pin-top');
+          }
+
+          // Add pin-bottom (when scrolled position is below bottom)
+          if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
+            removePinClasses($(this));
+            $(this).addClass('pin-bottom');
+            $(this).css('top', options.bottom - $original_offset);
+          }
+        });
+      }
+
+      $(this).data('pushpin-id', $uniqueId);
+      updateElements($this, $(window).scrollTop());
+      $(window).on('scroll.' + $uniqueId, function () {
+        var $scrolled = $(window).scrollTop() + options.offset;
+        updateElements($this, $scrolled);
+      });
+
+    });
+
+  };
+}( jQuery ));;(function ($) {
+  $(document).ready(function() {
+
+    // jQuery reverse
+    $.fn.reverse = [].reverse;
+
+    // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
+    $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) {
+      var $this = $(this);
+      openFABMenu($this);
+    });
+    $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) {
+      var $this = $(this);
+      closeFABMenu($this);
+    });
+
+    // Toggle-on-click behaviour.
+    $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function(e) {
+      var $this = $(this);
+      var $menu = $this.parent();
+      if ($menu.hasClass('active')) {
+        closeFABMenu($menu);
+      } else {
+        openFABMenu($menu);
+      }
+    });
+
+    // Toolbar transition behaviour.
+    $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function(e) {
+      var $this = $(this);
+      var $menu = $this.parent();
+      FABtoToolbar($menu);
+    });
+
+  });
+
+  $.fn.extend({
+    openFAB: function() {
+      openFABMenu($(this));
+    },
+    closeFAB: function() {
+      closeFABMenu($(this));
+    },
+    openToolbar: function() {
+      FABtoToolbar($(this));
+    },
+    closeToolbar: function() {
+      toolbarToFAB($(this));
+    }
+  });
+
+
+  var openFABMenu = function (btn) {
+    var $this = btn;
+    if ($this.hasClass('active') === false) {
+
+      // Get direction option
+      var horizontal = $this.hasClass('horizontal');
+      var offsetY, offsetX;
+
+      if (horizontal === true) {
+        offsetX = 40;
+      } else {
+        offsetY = 40;
+      }
+
+      $this.addClass('active');
+      $this.find('ul .btn-floating').velocity(
+        { scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'},
+        { duration: 0 });
+
+      var time = 0;
+      $this.find('ul .btn-floating').reverse().each( function () {
+        $(this).velocity(
+          { opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0'},
+          { duration: 80, delay: time });
+        time += 40;
+      });
+    }
+  };
+
+  var closeFABMenu = function (btn) {
+    var $this = btn;
+    // Get direction option
+    var horizontal = $this.hasClass('horizontal');
+    var offsetY, offsetX;
+
+    if (horizontal === true) {
+      offsetX = 40;
+    } else {
+      offsetY = 40;
+    }
+
+    $this.removeClass('active');
+    var time = 0;
+    $this.find('ul .btn-floating').velocity("stop", true);
+    $this.find('ul .btn-floating').velocity(
+      { opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'},
+      { duration: 80 }
+    );
+  };
+
+
+  /**
+   * Transform FAB into toolbar
+   * @param  {Object}  object jQuery object
+   */
+  var FABtoToolbar = function(btn) {
+    if (btn.attr('data-open') === "true") {
+      return;
+    }
+
+    var offsetX, offsetY, scaleFactor;
+    var windowWidth = window.innerWidth;
+    var windowHeight = window.innerHeight;
+    var btnRect = btn[0].getBoundingClientRect();
+    var anchor = btn.find('> a').first();
+    var menu = btn.find('> ul').first();
+    var backdrop = $('<div class="fab-backdrop"></div>');
+    var fabColor = anchor.css('background-color');
+    anchor.append(backdrop);
+
+    offsetX = btnRect.left - (windowWidth / 2) + (btnRect.width / 2);
+    offsetY = windowHeight - btnRect.bottom;
+    scaleFactor = windowWidth / backdrop.width();
+    btn.attr('data-origin-bottom', btnRect.bottom);
+    btn.attr('data-origin-left', btnRect.left);
+    btn.attr('data-origin-width', btnRect.width);
+
+    // Set initial state
+    btn.addClass('active');
+    btn.attr('data-open', true);
+    btn.css({
+      'text-align': 'center',
+      width: '100%',
+      bottom: 0,
+      left: 0,
+      transform: 'translateX(' + offsetX + 'px)',
+      transition: 'none'
+    });
+    anchor.css({
+      transform: 'translateY(' + -offsetY + 'px)',
+      transition: 'none'
+    });
+    backdrop.css({
+      'background-color': fabColor
+    });
+
+
+    setTimeout(function() {
+      btn.css({
+        transform: '',
+        transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
+      });
+      anchor.css({
+        overflow: 'visible',
+        transform: '',
+        transition: 'transform .2s'
+      });
+
+      setTimeout(function() {
+        btn.css({
+          overflow: 'hidden',
+          'background-color': fabColor
+        });
+        backdrop.css({
+          transform: 'scale(' + scaleFactor + ')',
+          transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
+        });
+        menu.find('> li > a').css({
+          opacity: 1
+        });
+
+        // Scroll to close.
+        $(window).on('scroll.fabToolbarClose', function() {
+          toolbarToFAB(btn);
+          $(window).off('scroll.fabToolbarClose');
+          $(document).off('click.fabToolbarClose');
+        });
+
+        $(document).on('click.fabToolbarClose', function(e) {
+          if (!$(e.target).closest(menu).length) {
+            toolbarToFAB(btn);
+            $(window).off('scroll.fabToolbarClose');
+            $(document).off('click.fabToolbarClose');
+          }
+        });
+      }, 100);
+    }, 0);
+  };
+
+  /**
+   * Transform toolbar back into FAB
+   * @param  {Object}  object jQuery object
+   */
+  var toolbarToFAB = function(btn) {
+    if (btn.attr('data-open') !== "true") {
+      return;
+    }
+
+    var offsetX, offsetY, scaleFactor;
+    var windowWidth = window.innerWidth;
+    var windowHeight = window.innerHeight;
+    var btnWidth = btn.attr('data-origin-width');
+    var btnBottom = btn.attr('data-origin-bottom');
+    var btnLeft = btn.attr('data-origin-left');
+    var anchor = btn.find('> .btn-floating').first();
+    var menu = btn.find('> ul').first();
+    var backdrop = btn.find('.fab-backdrop');
+    var fabColor = anchor.css('background-color');
+
+    offsetX = btnLeft - (windowWidth / 2) + (btnWidth / 2);
+    offsetY = windowHeight - btnBottom;
+    scaleFactor = windowWidth / backdrop.width();
+
+
+    // Hide backdrop
+    btn.removeClass('active');
+    btn.attr('data-open', false);
+    btn.css({
+      'background-color': 'transparent',
+      transition: 'none'
+    });
+    anchor.css({
+      transition: 'none'
+    });
+    backdrop.css({
+      transform: 'scale(0)',
+      'background-color': fabColor
+    });
+    menu.find('> li > a').css({
+      opacity: ''
+    });
+
+    setTimeout(function() {
+      backdrop.remove();
+
+      // Set initial state.
+      btn.css({
+        'text-align': '',
+        width: '',
+        bottom: '',
+        left: '',
+        overflow: '',
+        'background-color': '',
+        transform: 'translate3d(' + -offsetX + 'px,0,0)'
+      });
+      anchor.css({
+        overflow: '',
+        transform: 'translate3d(0,' + offsetY + 'px,0)'
+      });
+
+      setTimeout(function() {
+        btn.css({
+          transform: 'translate3d(0,0,0)',
+          transition: 'transform .2s'
+        });
+        anchor.css({
+          transform: 'translate3d(0,0,0)',
+          transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
+        });
+      }, 20);
+    }, 200);
+  };
+
+
+}( jQuery ));
+;(function ($) {
+  // Image transition function
+  Materialize.fadeInImage = function(selectorOrEl) {
+    var element;
+    if (typeof(selectorOrEl) === 'string') {
+      element = $(selectorOrEl);
+    } else if (typeof(selectorOrEl) === 'object') {
+      element = selectorOrEl;
+    } else {
+      return;
+    }
+    element.css({opacity: 0});
+    $(element).velocity({opacity: 1}, {
+      duration: 650,
+      queue: false,
+      easing: 'easeOutSine'
+    });
+    $(element).velocity({opacity: 1}, {
+      duration: 1300,
+      queue: false,
+      easing: 'swing',
+      step: function(now, fx) {
+        fx.start = 100;
+        var grayscale_setting = now/100;
+        var brightness_setting = 150 - (100 - now)/1.75;
+
+        if (brightness_setting < 100) {
+          brightness_setting = 100;
+        }
+        if (now >= 0) {
+          $(this).css({
+              "-webkit-filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)",
+              "filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)"
+          });
+        }
+      }
+    });
+  };
+
+  // Horizontal staggered list
+  Materialize.showStaggeredList = function(selectorOrEl) {
+    var element;
+    if (typeof(selectorOrEl) === 'string') {
+      element = $(selectorOrEl);
+    } else if (typeof(selectorOrEl) === 'object') {
+      element = selectorOrEl;
+    } else {
+      return;
+    }
+    var time = 0;
+    element.find('li').velocity(
+        { translateX: "-100px"},
+        { duration: 0 });
+
+    element.find('li').each(function() {
+      $(this).velocity(
+        { opacity: "1", translateX: "0"},
+        { duration: 800, delay: time, easing: [60, 10] });
+      time += 120;
+    });
+  };
+
+
+  $(document).ready(function() {
+    // Hardcoded .staggered-list scrollFire
+    // var staggeredListOptions = [];
+    // $('ul.staggered-list').each(function (i) {
+
+    //   var label = 'scrollFire-' + i;
+    //   $(this).addClass(label);
+    //   staggeredListOptions.push(
+    //     {selector: 'ul.staggered-list.' + label,
+    //      offset: 200,
+    //      callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
+    // });
+    // scrollFire(staggeredListOptions);
+
+    // HammerJS, Swipe navigation
+
+    // Touch Event
+    var swipeLeft = false;
+    var swipeRight = false;
+
+
+    // Dismissible Collections
+    $('.dismissable').each(function() {
+      $(this).hammer({
+        prevent_default: false
+      }).bind('pan', function(e) {
+        if (e.gesture.pointerType === "touch") {
+          var $this = $(this);
+          var direction = e.gesture.direction;
+          var x = e.gesture.deltaX;
+          var velocityX = e.gesture.velocityX;
+
+          $this.velocity({ translateX: x
+              }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+
+          // Swipe Left
+          if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.75)) {
+            swipeLeft = true;
+          }
+
+          // Swipe Right
+          if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.75)) {
+            swipeRight = true;
+          }
+        }
+      }).bind('panend', function(e) {
+        // Reset if collection is moved back into original position
+        if (Math.abs(e.gesture.deltaX) < ($(this).innerWidth() / 2)) {
+          swipeRight = false;
+          swipeLeft = false;
+        }
+
+        if (e.gesture.pointerType === "touch") {
+          var $this = $(this);
+          if (swipeLeft || swipeRight) {
+            var fullWidth;
+            if (swipeLeft) { fullWidth = $this.innerWidth(); }
+            else { fullWidth = -1 * $this.innerWidth(); }
+
+            $this.velocity({ translateX: fullWidth,
+              }, {duration: 100, queue: false, easing: 'easeOutQuad', complete:
+              function() {
+                $this.css('border', 'none');
+                $this.velocity({ height: 0, padding: 0,
+                  }, {duration: 200, queue: false, easing: 'easeOutQuad', complete:
+                    function() { $this.remove(); }
+                  });
+              }
+            });
+          }
+          else {
+            $this.velocity({ translateX: 0,
+              }, {duration: 100, queue: false, easing: 'easeOutQuad'});
+          }
+          swipeLeft = false;
+          swipeRight = false;
+        }
+      });
+
+    });
+
+
+    // time = 0
+    // // Vertical Staggered list
+    // $('ul.staggered-list.vertical li').velocity(
+    //     { translateY: "100px"},
+    //     { duration: 0 });
+
+    // $('ul.staggered-list.vertical li').each(function() {
+    //   $(this).velocity(
+    //     { opacity: "1", translateY: "0"},
+    //     { duration: 800, delay: time, easing: [60, 25] });
+    //   time += 120;
+    // });
+
+    // // Fade in and Scale
+    // $('.fade-in.scale').velocity(
+    //     { scaleX: .4, scaleY: .4, translateX: -600},
+    //     { duration: 0});
+    // $('.fade-in').each(function() {
+    //   $(this).velocity(
+    //     { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
+    //     { duration: 800, easing: [60, 10] });
+    // });
+  });
+}( jQuery ));
+;(function($) {
+
+  var scrollFireEventsHandled = false;
+
+  // Input: Array of JSON objects {selector, offset, callback}
+  Materialize.scrollFire = function(options) {
+    var onScroll = function() {
+      var windowScroll = window.pageYOffset + window.innerHeight;
+
+      for (var i = 0 ; i < options.length; i++) {
+        // Get options from each line
+        var value = options[i];
+        var selector = value.selector,
+            offset = value.offset,
+            callback = value.callback;
+
+        var currentElement = document.querySelector(selector);
+        if ( currentElement !== null) {
+          var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
+
+          if (windowScroll > (elementOffset + offset)) {
+            if (value.done !== true) {
+              if (typeof(callback) === 'function') {
+                callback.call(this, currentElement);
+              } else if (typeof(callback) === 'string') {
+                var callbackFunc = new Function(callback);
+                callbackFunc(currentElement);
+              }
+              value.done = true;
+            }
+          }
+        }
+      }
+    };
+
+
+    var throttledScroll = Materialize.throttle(function() {
+      onScroll();
+    }, options.throttle || 100);
+
+    if (!scrollFireEventsHandled) {
+      window.addEventListener("scroll", throttledScroll);
+      window.addEventListener("resize", throttledScroll);
+      scrollFireEventsHandled = true;
+    }
+
+    // perform a scan once, after current execution context, and after dom is ready
+    setTimeout(throttledScroll, 0);
+  };
+
+})(jQuery);
+;/*!
+ * pickadate.js v3.5.0, 2014/04/13
+ * By Amsul, http://amsul.ca
+ * Hosted on http://amsul.github.io/pickadate.js
+ * Licensed under MIT
+ */
+
+(function ( factory ) {
+
+    // AMD.
+    if ( typeof define == 'function' && define.amd )
+        define( 'picker', ['jquery'], factory )
+
+    // Node.js/browserify.
+    else if ( typeof exports == 'object' )
+        module.exports = factory( require('jquery') )
+
+    // Browser globals.
+    else this.Picker = factory( jQuery )
+
+}(function( $ ) {
+
+var $window = $( window )
+var $document = $( document )
+var $html = $( document.documentElement )
+
+
+/**
+ * The picker constructor that creates a blank picker.
+ */
+function PickerConstructor( ELEMENT, NAME, COMPONENT, OPTIONS ) {
+
+    // If there’s no element, return the picker constructor.
+    if ( !ELEMENT ) return PickerConstructor
+
+
+    var
+        IS_DEFAULT_THEME = false,
+
+
+        // The state of the picker.
+        STATE = {
+            id: ELEMENT.id || 'P' + Math.abs( ~~(Math.random() * new Date()) )
+        },
+
+
+        // Merge the defaults and options passed.
+        SETTINGS = COMPONENT ? $.extend( true, {}, COMPONENT.defaults, OPTIONS ) : OPTIONS || {},
+
+
+        // Merge the default classes with the settings classes.
+        CLASSES = $.extend( {}, PickerConstructor.klasses(), SETTINGS.klass ),
+
+
+        // The element node wrapper into a jQuery object.
+        $ELEMENT = $( ELEMENT ),
+
+
+        // Pseudo picker constructor.
+        PickerInstance = function() {
+            return this.start()
+        },
+
+
+        // The picker prototype.
+        P = PickerInstance.prototype = {
+
+            constructor: PickerInstance,
+
+            $node: $ELEMENT,
+
+
+            /**
+             * Initialize everything
+             */
+            start: function() {
+
+                // If it’s already started, do nothing.
+                if ( STATE && STATE.start ) return P
+
+
+                // Update the picker states.
+                STATE.methods = {}
+                STATE.start = true
+                STATE.open = false
+                STATE.type = ELEMENT.type
+
+
+                // Confirm focus state, convert into text input to remove UA stylings,
+                // and set as readonly to prevent keyboard popup.
+                ELEMENT.autofocus = ELEMENT == getActiveElement()
+                ELEMENT.readOnly = !SETTINGS.editable
+                ELEMENT.id = ELEMENT.id || STATE.id
+                if ( ELEMENT.type != 'text' ) {
+                    ELEMENT.type = 'text'
+                }
+
+
+                // Create a new picker component with the settings.
+                P.component = new COMPONENT(P, SETTINGS)
+
+
+                // Create the picker root with a holder and then prepare it.
+                P.$root = $( PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"') )
+                prepareElementRoot()
+
+
+                // If there’s a format for the hidden input element, create the element.
+                if ( SETTINGS.formatSubmit ) {
+                    prepareElementHidden()
+                }
+
+
+                // Prepare the input element.
+                prepareElement()
+
+
+                // Insert the root as specified in the settings.
+                if ( SETTINGS.container ) $( SETTINGS.container ).append( P.$root )
+                else $ELEMENT.after( P.$root )
+
+
+                // Bind the default component and settings events.
+                P.on({
+                    start: P.component.onStart,
+                    render: P.component.onRender,
+                    stop: P.component.onStop,
+                    open: P.component.onOpen,
+                    close: P.component.onClose,
+                    set: P.component.onSet
+                }).on({
+                    start: SETTINGS.onStart,
+                    render: SETTINGS.onRender,
+                    stop: SETTINGS.onStop,
+                    open: SETTINGS.onOpen,
+                    close: SETTINGS.onClose,
+                    set: SETTINGS.onSet
+                })
+
+
+                // Once we’re all set, check the theme in use.
+                IS_DEFAULT_THEME = isUsingDefaultTheme( P.$root.children()[ 0 ] )
+
+
+                // If the element has autofocus, open the picker.
+                if ( ELEMENT.autofocus ) {
+                    P.open()
+                }
+
+
+                // Trigger queued the “start” and “render” events.
+                return P.trigger( 'start' ).trigger( 'render' )
+            }, //start
+
+
+            /**
+             * Render a new picker
+             */
+            render: function( entireComponent ) {
+
+                // Insert a new component holder in the root or box.
+                if ( entireComponent ) P.$root.html( createWrappedComponent() )
+                else P.$root.find( '.' + CLASSES.box ).html( P.component.nodes( STATE.open ) )
+
+                // Trigger the queued “render” events.
+                return P.trigger( 'render' )
+            }, //render
+
+
+            /**
+             * Destroy everything
+             */
+            stop: function() {
+
+                // If it’s already stopped, do nothing.
+                if ( !STATE.start ) return P
+
+                // Then close the picker.
+                P.close()
+
+                // Remove the hidden field.
+                if ( P._hidden ) {
+                    P._hidden.parentNode.removeChild( P._hidden )
+                }
+
+                // Remove the root.
+                P.$root.remove()
+
+                // Remove the input class, remove the stored data, and unbind
+                // the events (after a tick for IE - see `P.close`).
+                $ELEMENT.removeClass( CLASSES.input ).removeData( NAME )
+                setTimeout( function() {
+                    $ELEMENT.off( '.' + STATE.id )
+                }, 0)
+
+                // Restore the element state
+                ELEMENT.type = STATE.type
+                ELEMENT.readOnly = false
+
+                // Trigger the queued “stop” events.
+                P.trigger( 'stop' )
+
+                // Reset the picker states.
+                STATE.methods = {}
+                STATE.start = false
+
+                return P
+            }, //stop
+
+
+            /**
+             * Open up the picker
+             */
+            open: function( dontGiveFocus ) {
+
+                // If it’s already open, do nothing.
+                if ( STATE.open ) return P
+
+                // Add the “active” class.
+                $ELEMENT.addClass( CLASSES.active )
+                aria( ELEMENT, 'expanded', true )
+
+                // * A Firefox bug, when `html` has `overflow:hidden`, results in
+                //   killing transitions :(. So add the “opened” state on the next tick.
+                //   Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
+                setTimeout( function() {
+
+                    // Add the “opened” class to the picker root.
+                    P.$root.addClass( CLASSES.opened )
+                    aria( P.$root[0], 'hidden', false )
+
+                }, 0 )
+
+                // If we have to give focus, bind the element and doc events.
+                if ( dontGiveFocus !== false ) {
+
+                    // Set it as open.
+                    STATE.open = true
+
+                    // Prevent the page from scrolling.
+                    if ( IS_DEFAULT_THEME ) {
+                        $html.
+                            css( 'overflow', 'hidden' ).
+                            css( 'padding-right', '+=' + getScrollbarWidth() )
+                    }
+
+                    // Pass focus to the root element’s jQuery object.
+                    // * Workaround for iOS8 to bring the picker’s root into view.
+                    P.$root.eq(0).focus()
+
+                    // Bind the document events.
+                    $document.on( 'click.' + STATE.id + ' focusin.' + STATE.id, function( event ) {
+
+                        var target = event.target
+
+                        // If the target of the event is not the element, close the picker picker.
+                        // * Don’t worry about clicks or focusins on the root because those don’t bubble up.
+                        //   Also, for Firefox, a click on an `option` element bubbles up directly
+                        //   to the doc. So make sure the target wasn't the doc.
+                        // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
+                        //   which causes the picker to unexpectedly close when right-clicking it. So make
+                        //   sure the event wasn’t a right-click.
+                        if ( target != ELEMENT && target != document && event.which != 3 ) {
+
+                            // If the target was the holder that covers the screen,
+                            // keep the element focused to maintain tabindex.
+                            P.close( target === P.$root.children()[0] )
+                        }
+
+                    }).on( 'keydown.' + STATE.id, function( event ) {
+
+                        var
+                            // Get the keycode.
+                            keycode = event.keyCode,
+
+                            // Translate that to a selection change.
+                            keycodeToMove = P.component.key[ keycode ],
+
+                            // Grab the target.
+                            target = event.target
+
+
+                        // On escape, close the picker and give focus.
+                        if ( keycode == 27 ) {
+                            P.close( true )
+                        }
+
+
+                        // Check if there is a key movement or “enter” keypress on the element.
+                        else if ( target == P.$root[0] && ( keycodeToMove || keycode == 13 ) ) {
+
+                            // Prevent the default action to stop page movement.
+                            event.preventDefault()
+
+                            // Trigger the key movement action.
+                            if ( keycodeToMove ) {
+                                PickerConstructor._.trigger( P.component.key.go, P, [ PickerConstructor._.trigger( keycodeToMove ) ] )
+                            }
+
+                            // On “enter”, if the highlighted item isn’t disabled, set the value and close.
+                            else if ( !P.$root.find( '.' + CLASSES.highlighted ).hasClass( CLASSES.disabled ) ) {
+                                P.set( 'select', P.component.item.highlight ).close()
+                            }
+                        }
+
+
+                        // If the target is within the root and “enter” is pressed,
+                        // prevent the default action and trigger a click on the target instead.
+                        else if ( $.contains( P.$root[0], target ) && keycode == 13 ) {
+                            event.preventDefault()
+                            target.click()
+                        }
+                    })
+                }
+
+                // Trigger the queued “open” events.
+                return P.trigger( 'open' )
+            }, //open
+
+
+            /**
+             * Close the picker
+             */
+            close: function( giveFocus ) {
+
+                // If we need to give focus, do it before changing states.
+                if ( giveFocus ) {
+                    // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
+                    // The focus is triggered *after* the close has completed - causing it
+                    // to open again. So unbind and rebind the event at the next tick.
+                    P.$root.off( 'focus.toOpen' ).eq(0).focus()
+                    setTimeout( function() {
+                        P.$root.on( 'focus.toOpen', handleFocusToOpenEvent )
+                    }, 0 )
+                }
+
+                // Remove the “active” class.
+                $ELEMENT.removeClass( CLASSES.active )
+                aria( ELEMENT, 'expanded', false )
+
+                // * A Firefox bug, when `html` has `overflow:hidden`, results in
+                //   killing transitions :(. So remove the “opened” state on the next tick.
+                //   Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
+                setTimeout( function() {
+
+                    // Remove the “opened” and “focused” class from the picker root.
+                    P.$root.removeClass( CLASSES.opened + ' ' + CLASSES.focused )
+                    aria( P.$root[0], 'hidden', true )
+
+                }, 0 )
+
+                // If it’s already closed, do nothing more.
+                if ( !STATE.open ) return P
+
+                // Set it as closed.
+                STATE.open = false
+
+                // Allow the page to scroll.
+                if ( IS_DEFAULT_THEME ) {
+                    $html.
+                        css( 'overflow', '' ).
+                        css( 'padding-right', '-=' + getScrollbarWidth() )
+                }
+
+                // Unbind the document events.
+                $document.off( '.' + STATE.id )
+
+                // Trigger the queued “close” events.
+                return P.trigger( 'close' )
+            }, //close
+
+
+            /**
+             * Clear the values
+             */
+            clear: function( options ) {
+                return P.set( 'clear', null, options )
+            }, //clear
+
+
+            /**
+             * Set something
+             */
+            set: function( thing, value, options ) {
+
+                var thingItem, thingValue,
+                    thingIsObject = $.isPlainObject( thing ),
+                    thingObject = thingIsObject ? thing : {}
+
+                // Make sure we have usable options.
+                options = thingIsObject && $.isPlainObject( value ) ? value : options || {}
+
+                if ( thing ) {
+
+                    // If the thing isn’t an object, make it one.
+                    if ( !thingIsObject ) {
+                        thingObject[ thing ] = value
+                    }
+
+                    // Go through the things of items to set.
+                    for ( thingItem in thingObject ) {
+
+                        // Grab the value of the thing.
+                        thingValue = thingObject[ thingItem ]
+
+                        // First, if the item exists and there’s a value, set it.
+                        if ( thingItem in P.component.item ) {
+                            if ( thingValue === undefined ) thingValue = null
+                            P.component.set( thingItem, thingValue, options )
+                        }
+
+                        // Then, check to update the element value and broadcast a change.
+                        if ( thingItem == 'select' || thingItem == 'clear' ) {
+                            $ELEMENT.
+                                val( thingItem == 'clear' ? '' : P.get( thingItem, SETTINGS.format ) ).
+                                trigger( 'change' )
+                        }
+                    }
+
+                    // Render a new picker.
+                    P.render()
+                }
+
+                // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
+                return options.muted ? P : P.trigger( 'set', thingObject )
+            }, //set
+
+
+            /**
+             * Get something
+             */
+            get: function( thing, format ) {
+
+                // Make sure there’s something to get.
+                thing = thing || 'value'
+
+                // If a picker state exists, return that.
+                if ( STATE[ thing ] != null ) {
+                    return STATE[ thing ]
+                }
+
+                // Return the submission value, if that.
+                if ( thing == 'valueSubmit' ) {
+                    if ( P._hidden ) {
+                        return P._hidden.value
+                    }
+                    thing = 'value'
+                }
+
+                // Return the value, if that.
+                if ( thing == 'value' ) {
+                    return ELEMENT.value
+                }
+
+                // Check if a component item exists, return that.
+                if ( thing in P.component.item ) {
+                    if ( typeof format == 'string' ) {
+                        var thingValue = P.component.get( thing )
+                        return thingValue ?
+                            PickerConstructor._.trigger(
+                                P.component.formats.toString,
+                                P.component,
+                                [ format, thingValue ]
+                            ) : ''
+                    }
+                    return P.component.get( thing )
+                }
+            }, //get
+
+
+
+            /**
+             * Bind events on the things.
+             */
+            on: function( thing, method, internal ) {
+
+                var thingName, thingMethod,
+                    thingIsObject = $.isPlainObject( thing ),
+                    thingObject = thingIsObject ? thing : {}
+
+                if ( thing ) {
+
+                    // If the thing isn’t an object, make it one.
+                    if ( !thingIsObject ) {
+                        thingObject[ thing ] = method
+                    }
+
+                    // Go through the things to bind to.
+                    for ( thingName in thingObject ) {
+
+                        // Grab the method of the thing.
+                        thingMethod = thingObject[ thingName ]
+
+                        // If it was an internal binding, prefix it.
+                        if ( internal ) {
+                            thingName = '_' + thingName
+                        }
+
+                        // Make sure the thing methods collection exists.
+                        STATE.methods[ thingName ] = STATE.methods[ thingName ] || []
+
+                        // Add the method to the relative method collection.
+                        STATE.methods[ thingName ].push( thingMethod )
+                    }
+                }
+
+                return P
+            }, //on
+
+
+
+            /**
+             * Unbind events on the things.
+             */
+            off: function() {
+                var i, thingName,
+                    names = arguments;
+                for ( i = 0, namesCount = names.length; i < namesCount; i += 1 ) {
+                    thingName = names[i]
+                    if ( thingName in STATE.methods ) {
+                        delete STATE.methods[thingName]
+                    }
+                }
+                return P
+            },
+
+
+            /**
+             * Fire off method events.
+             */
+            trigger: function( name, data ) {
+                var _trigger = function( name ) {
+                    var methodList = STATE.methods[ name ]
+                    if ( methodList ) {
+                        methodList.map( function( method ) {
+                            PickerConstructor._.trigger( method, P, [ data ] )
+                        })
+                    }
+                }
+                _trigger( '_' + name )
+                _trigger( name )
+                return P
+            } //trigger
+        } //PickerInstance.prototype
+
+
+    /**
+     * Wrap the picker holder components together.
+     */
+    function createWrappedComponent() {
+
+        // Create a picker wrapper holder
+        return PickerConstructor._.node( 'div',
+
+            // Create a picker wrapper node
+            PickerConstructor._.node( 'div',
+
+                // Create a picker frame
+                PickerConstructor._.node( 'div',
+
+                    // Create a picker box node
+                    PickerConstructor._.node( 'div',
+
+                        // Create the components nodes.
+                        P.component.nodes( STATE.open ),
+
+                        // The picker box class
+                        CLASSES.box
+                    ),
+
+                    // Picker wrap class
+                    CLASSES.wrap
+                ),
+
+                // Picker frame class
+                CLASSES.frame
+            ),
+
+            // Picker holder class
+            CLASSES.holder
+        ) //endreturn
+    } //createWrappedComponent
+
+
+
+    /**
+     * Prepare the input element with all bindings.
+     */
+    function prepareElement() {
+
+        $ELEMENT.
+
+            // Store the picker data by component name.
+            data(NAME, P).
+
+            // Add the “input” class name.
+            addClass(CLASSES.input).
+
+            // Remove the tabindex.
+            attr('tabindex', -1).
+
+            // If there’s a `data-value`, update the value of the element.
+            val( $ELEMENT.data('value') ?
+                P.get('select', SETTINGS.format) :
+                ELEMENT.value
+            )
+
+
+        // Only bind keydown events if the element isn’t editable.
+        if ( !SETTINGS.editable ) {
+
+            $ELEMENT.
+
+                // On focus/click, focus onto the root to open it up.
+                on( 'focus.' + STATE.id + ' click.' + STATE.id, function( event ) {
+                    event.preventDefault()
+                    P.$root.eq(0).focus()
+                }).
+
+                // Handle keyboard event based on the picker being opened or not.
+                on( 'keydown.' + STATE.id, handleKeydownEvent )
+        }
+
+
+        // Update the aria attributes.
+        aria(ELEMENT, {
+            haspopup: true,
+            expanded: false,
+            readonly: false,
+            owns: ELEMENT.id + '_root'
+        })
+    }
+
+
+    /**
+     * Prepare the root picker element with all bindings.
+     */
+    function prepareElementRoot() {
+
+        P.$root.
+
+            on({
+
+                // For iOS8.
+                keydown: handleKeydownEvent,
+
+                // When something within the root is focused, stop from bubbling
+                // to the doc and remove the “focused” state from the root.
+                focusin: function( event ) {
+                    P.$root.removeClass( CLASSES.focused )
+                    event.stopPropagation()
+                },
+
+                // When something within the root holder is clicked, stop it
+                // from bubbling to the doc.
+                'mousedown click': function( event ) {
+
+                    var target = event.target
+
+                    // Make sure the target isn’t the root holder so it can bubble up.
+                    if ( target != P.$root.children()[ 0 ] ) {
+
+                        event.stopPropagation()
+
+                        // * For mousedown events, cancel the default action in order to
+                        //   prevent cases where focus is shifted onto external elements
+                        //   when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
+                        //   Also, for Firefox, don’t prevent action on the `option` element.
+                        if ( event.type == 'mousedown' && !$( target ).is( 'input, select, textarea, button, option' )) {
+
+                            event.preventDefault()
+
+                            // Re-focus onto the root so that users can click away
+                            // from elements focused within the picker.
+                            P.$root.eq(0).focus()
+                        }
+                    }
+                }
+            }).
+
+            // Add/remove the “target” class on focus and blur.
+            on({
+                focus: function() {
+                    $ELEMENT.addClass( CLASSES.target )
+                },
+                blur: function() {
+                    $ELEMENT.removeClass( CLASSES.target )
+                }
+            }).
+
+            // Open the picker and adjust the root “focused” state
+            on( 'focus.toOpen', handleFocusToOpenEvent ).
+
+            // If there’s a click on an actionable element, carry out the actions.
+            on( 'click', '[data-pick], [data-nav], [data-clear], [data-close]', function() {
+
+                var $target = $( this ),
+                    targetData = $target.data(),
+                    targetDisabled = $target.hasClass( CLASSES.navDisabled ) || $target.hasClass( CLASSES.disabled ),
+
+                    // * For IE, non-focusable elements can be active elements as well
+                    //   (http://stackoverflow.com/a/2684561).
+                    activeElement = getActiveElement()
+                    activeElement = activeElement && ( activeElement.type || activeElement.href )
+
+                // If it’s disabled or nothing inside is actively focused, re-focus the element.
+                if ( targetDisabled || activeElement && !$.contains( P.$root[0], activeElement ) ) {
+                    P.$root.eq(0).focus()
+                }
+
+                // If something is superficially changed, update the `highlight` based on the `nav`.
+                if ( !targetDisabled && targetData.nav ) {
+                    P.set( 'highlight', P.component.item.highlight, { nav: targetData.nav } )
+                }
+
+                // If something is picked, set `select` then close with focus.
+                else if ( !targetDisabled && 'pick' in targetData ) {
+                    P.set( 'select', targetData.pick )
+                }
+
+                // If a “clear” button is pressed, empty the values and close with focus.
+                else if ( targetData.clear ) {
+                    P.clear().close( true )
+                }
+
+                else if ( targetData.close ) {
+                    P.close( true )
+                }
+
+            }) //P.$root
+
+        aria( P.$root[0], 'hidden', true )
+    }
+
+
+     /**
+      * Prepare the hidden input element along with all bindings.
+      */
+    function prepareElementHidden() {
+
+        var name
+
+        if ( SETTINGS.hiddenName === true ) {
+            name = ELEMENT.name
+            ELEMENT.name = ''
+        }
+        else {
+            name = [
+                typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '',
+                typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'
+            ]
+            name = name[0] + ELEMENT.name + name[1]
+        }
+
+        P._hidden = $(
+            '<input ' +
+            'type=hidden ' +
+
+            // Create the name using the original input’s with a prefix and suffix.
+            'name="' + name + '"' +
+
+            // If the element has a value, set the hidden value as well.
+            (
+                $ELEMENT.data('value') || ELEMENT.value ?
+                    ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' :
+                    ''
+            ) +
+            '>'
+        )[0]
+
+        $ELEMENT.
+
+            // If the value changes, update the hidden input with the correct format.
+            on('change.' + STATE.id, function() {
+                P._hidden.value = ELEMENT.value ?
+                    P.get('select', SETTINGS.formatSubmit) :
+                    ''
+            })
+
+
+        // Insert the hidden input as specified in the settings.
+        if ( SETTINGS.container ) $( SETTINGS.container ).append( P._hidden )
+        else $ELEMENT.after( P._hidden )
+    }
+
+
+    // For iOS8.
+    function handleKeydownEvent( event ) {
+
+        var keycode = event.keyCode,
+
+            // Check if one of the delete keys was pressed.
+            isKeycodeDelete = /^(8|46)$/.test(keycode)
+
+        // For some reason IE clears the input value on “escape”.
+        if ( keycode == 27 ) {
+            P.close()
+            return false
+        }
+
+        // Check if `space` or `delete` was pressed or the picker is closed with a key movement.
+        if ( keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode] ) {
+
+            // Prevent it from moving the page and bubbling to doc.
+            event.preventDefault()
+            event.stopPropagation()
+
+            // If `delete` was pressed, clear the values and close the picker.
+            // Otherwise open the picker.
+            if ( isKeycodeDelete ) { P.clear().close() }
+            else { P.open() }
+        }
+    }
+
+
+    // Separated for IE
+    function handleFocusToOpenEvent( event ) {
+
+        // Stop the event from propagating to the doc.
+        event.stopPropagation()
+
+        // If it’s a focus event, add the “focused” class to the root.
+        if ( event.type == 'focus' ) {
+            P.$root.addClass( CLASSES.focused )
+        }
+
+        // And then finally open the picker.
+        P.open()
+    }
+
+
+    // Return a new picker instance.
+    return new PickerInstance()
+} //PickerConstructor
+
+
+
+/**
+ * The default classes and prefix to use for the HTML classes.
+ */
+PickerConstructor.klasses = function( prefix ) {
+    prefix = prefix || 'picker'
+    return {
+
+        picker: prefix,
+        opened: prefix + '--opened',
+        focused: prefix + '--focused',
+
+        input: prefix + '__input',
+        active: prefix + '__input--active',
+        target: prefix + '__input--target',
+
+        holder: prefix + '__holder',
+
+        frame: prefix + '__frame',
+        wrap: prefix + '__wrap',
+
+        box: prefix + '__box'
+    }
+} //PickerConstructor.klasses
+
+
+
+/**
+ * Check if the default theme is being used.
+ */
+function isUsingDefaultTheme( element ) {
+
+    var theme,
+        prop = 'position'
+
+    // For IE.
+    if ( element.currentStyle ) {
+        theme = element.currentStyle[prop]
+    }
+
+    // For normal browsers.
+    else if ( window.getComputedStyle ) {
+        theme = getComputedStyle( element )[prop]
+    }
+
+    return theme == 'fixed'
+}
+
+
+
+/**
+ * Get the width of the browser’s scrollbar.
+ * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
+ */
+function getScrollbarWidth() {
+
+    if ( $html.height() <= $window.height() ) {
+        return 0
+    }
+
+    var $outer = $( '<div style="visibility:hidden;width:100px" />' ).
+        appendTo( 'body' )
+
+    // Get the width without scrollbars.
+    var widthWithoutScroll = $outer[0].offsetWidth
+
+    // Force adding scrollbars.
+    $outer.css( 'overflow', 'scroll' )
+
+    // Add the inner div.
+    var $inner = $( '<div style="width:100%" />' ).appendTo( $outer )
+
+    // Get the width with scrollbars.
+    var widthWithScroll = $inner[0].offsetWidth
+
+    // Remove the divs.
+    $outer.remove()
+
+    // Return the difference between the widths.
+    return widthWithoutScroll - widthWithScroll
+}
+
+
+
+/**
+ * PickerConstructor helper methods.
+ */
+PickerConstructor._ = {
+
+    /**
+     * Create a group of nodes. Expects:
+     * `
+        {
+            min:    {Integer},
+            max:    {Integer},
+            i:      {Integer},
+            node:   {String},
+            item:   {Function}
+        }
+     * `
+     */
+    group: function( groupObject ) {
+
+        var
+            // Scope for the looped object
+            loopObjectScope,
+
+            // Create the nodes list
+            nodesList = '',
+
+            // The counter starts from the `min`
+            counter = PickerConstructor._.trigger( groupObject.min, groupObject )
+
+
+        // Loop from the `min` to `max`, incrementing by `i`
+        for ( ; counter <= PickerConstructor._.trigger( groupObject.max, groupObject, [ counter ] ); counter += groupObject.i ) {
+
+            // Trigger the `item` function within scope of the object
+            loopObjectScope = PickerConstructor._.trigger( groupObject.item, groupObject, [ counter ] )
+
+            // Splice the subgroup and create nodes out of the sub nodes
+            nodesList += PickerConstructor._.node(
+                groupObject.node,
+                loopObjectScope[ 0 ],   // the node
+                loopObjectScope[ 1 ],   // the classes
+                loopObjectScope[ 2 ]    // the attributes
+            )
+        }
+
+        // Return the list of nodes
+        return nodesList
+    }, //group
+
+
+    /**
+     * Create a dom node string
+     */
+    node: function( wrapper, item, klass, attribute ) {
+
+        // If the item is false-y, just return an empty string
+        if ( !item ) return ''
+
+        // If the item is an array, do a join
+        item = $.isArray( item ) ? item.join( '' ) : item
+
+        // Check for the class
+        klass = klass ? ' class="' + klass + '"' : ''
+
+        // Check for any attributes
+        attribute = attribute ? ' ' + attribute : ''
+
+        // Return the wrapped item
+        return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>'
+    }, //node
+
+
+    /**
+     * Lead numbers below 10 with a zero.
+     */
+    lead: function( number ) {
+        return ( number < 10 ? '0': '' ) + number
+    },
+
+
+    /**
+     * Trigger a function otherwise return the value.
+     */
+    trigger: function( callback, scope, args ) {
+        return typeof callback == 'function' ? callback.apply( scope, args || [] ) : callback
+    },
+
+
+    /**
+     * If the second character is a digit, length is 2 otherwise 1.
+     */
+    digits: function( string ) {
+        return ( /\d/ ).test( string[ 1 ] ) ? 2 : 1
+    },
+
+
+    /**
+     * Tell if something is a date object.
+     */
+    isDate: function( value ) {
+        return {}.toString.call( value ).indexOf( 'Date' ) > -1 && this.isInteger( value.getDate() )
+    },
+
+
+    /**
+     * Tell if something is an integer.
+     */
+    isInteger: function( value ) {
+        return {}.toString.call( value ).indexOf( 'Number' ) > -1 && value % 1 === 0
+    },
+
+
+    /**
+     * Create ARIA attribute strings.
+     */
+    ariaAttr: ariaAttr
+} //PickerConstructor._
+
+
+
+/**
+ * Extend the picker with a component and defaults.
+ */
+PickerConstructor.extend = function( name, Component ) {
+
+    // Extend jQuery.
+    $.fn[ name ] = function( options, action ) {
+
+        // Grab the component data.
+        var componentData = this.data( name )
+
+        // If the picker is requested, return the data object.
+        if ( options == 'picker' ) {
+            return componentData
+        }
+
+        // If the component data exists and `options` is a string, carry out the action.
+        if ( componentData && typeof options == 'string' ) {
+            return PickerConstructor._.trigger( componentData[ options ], componentData, [ action ] )
+        }
+
+        // Otherwise go through each matched element and if the component
+        // doesn’t exist, create a new picker using `this` element
+        // and merging the defaults and options with a deep copy.
+        return this.each( function() {
+            var $this = $( this )
+            if ( !$this.data( name ) ) {
+                new PickerConstructor( this, name, Component, options )
+            }
+        })
+    }
+
+    // Set the defaults.
+    $.fn[ name ].defaults = Component.defaults
+} //PickerConstructor.extend
+
+
+
+function aria(element, attribute, value) {
+    if ( $.isPlainObject(attribute) ) {
+        for ( var key in attribute ) {
+            ariaSet(element, key, attribute[key])
+        }
+    }
+    else {
+        ariaSet(element, attribute, value)
+    }
+}
+function ariaSet(element, attribute, value) {
+    element.setAttribute(
+        (attribute == 'role' ? '' : 'aria-') + attribute,
+        value
+    )
+}
+function ariaAttr(attribute, data) {
+    if ( !$.isPlainObject(attribute) ) {
+        attribute = { attribute: data }
+    }
+    data = ''
+    for ( var key in attribute ) {
+        var attr = (key == 'role' ? '' : 'aria-') + key,
+            attrVal = attribute[key]
+        data += attrVal == null ? '' : attr + '="' + attribute[key] + '"'
+    }
+    return data
+}
+
+// IE8 bug throws an error for activeElements within iframes.
+function getActiveElement() {
+    try {
+        return document.activeElement
+    } catch ( err ) { }
+}
+
+
+
+// Expose the picker constructor.
+return PickerConstructor
+
+
+}));
+
+
+;/*!
+ * Date picker for pickadate.js v3.5.0
+ * http://amsul.github.io/pickadate.js/date.htm
+ */
+
+(function ( factory ) {
+
+    // AMD.
+    if ( typeof define == 'function' && define.amd )
+        define( ['picker', 'jquery'], factory )
+
+    // Node.js/browserify.
+    else if ( typeof exports == 'object' )
+        module.exports = factory( require('./picker.js'), require('jquery') )
+
+    // Browser globals.
+    else factory( Picker, jQuery )
+
+}(function( Picker, $ ) {
+
+
+/**
+ * Globals and constants
+ */
+var DAYS_IN_WEEK = 7,
+    WEEKS_IN_CALENDAR = 6,
+    _ = Picker._
+
+
+
+/**
+ * The date picker constructor
+ */
+function DatePicker( picker, settings ) {
+
+    var calendar = this,
+        element = picker.$node[ 0 ],
+        elementValue = element.value,
+        elementDataValue = picker.$node.data( 'value' ),
+        valueString = elementDataValue || elementValue,
+        formatString = elementDataValue ? settings.formatSubmit : settings.format,
+        isRTL = function() {
+
+            return element.currentStyle ?
+
+                // For IE.
+                element.currentStyle.direction == 'rtl' :
+
+                // For normal browsers.
+                getComputedStyle( picker.$root[0] ).direction == 'rtl'
+        }
+
+    calendar.settings = settings
+    calendar.$node = picker.$node
+
+    // The queue of methods that will be used to build item objects.
+    calendar.queue = {
+        min: 'measure create',
+        max: 'measure create',
+        now: 'now create',
+        select: 'parse create validate',
+        highlight: 'parse navigate create validate',
+        view: 'parse create validate viewset',
+        disable: 'deactivate',
+        enable: 'activate'
+    }
+
+    // The component's item object.
+    calendar.item = {}
+
+    calendar.item.clear = null
+    calendar.item.disable = ( settings.disable || [] ).slice( 0 )
+    calendar.item.enable = -(function( collectionDisabled ) {
+        return collectionDisabled[ 0 ] === true ? collectionDisabled.shift() : -1
+    })( calendar.item.disable )
+
+    calendar.
+        set( 'min', settings.min ).
+        set( 'max', settings.max ).
+        set( 'now' )
+
+    // When there’s a value, set the `select`, which in turn
+    // also sets the `highlight` and `view`.
+    if ( valueString ) {
+        calendar.set( 'select', valueString, { format: formatString })
+    }
+
+    // If there’s no value, default to highlighting “today”.
+    else {
+        calendar.
+            set( 'select', null ).
+            set( 'highlight', calendar.item.now )
+    }
+
+
+    // The keycode to movement mapping.
+    calendar.key = {
+        40: 7, // Down
+        38: -7, // Up
+        39: function() { return isRTL() ? -1 : 1 }, // Right
+        37: function() { return isRTL() ? 1 : -1 }, // Left
+        go: function( timeChange ) {
+            var highlightedObject = calendar.item.highlight,
+                targetDate = new Date( highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange )
+            calendar.set(
+                'highlight',
+                targetDate,
+                { interval: timeChange }
+            )
+            this.render()
+        }
+    }
+
+
+    // Bind some picker events.
+    picker.
+        on( 'render', function() {
+            picker.$root.find( '.' + settings.klass.selectMonth ).on( 'change', function() {
+                var value = this.value
+                if ( value ) {
+                    picker.set( 'highlight', [ picker.get( 'view' ).year, value, picker.get( 'highlight' ).date ] )
+                    picker.$root.find( '.' + settings.klass.selectMonth ).trigger( 'focus' )
+                }
+            })
+            picker.$root.find( '.' + settings.klass.selectYear ).on( 'change', function() {
+                var value = this.value
+                if ( value ) {
+                    picker.set( 'highlight', [ value, picker.get( 'view' ).month, picker.get( 'highlight' ).date ] )
+                    picker.$root.find( '.' + settings.klass.selectYear ).trigger( 'focus' )
+                }
+            })
+        }, 1 ).
+        on( 'open', function() {
+            var includeToday = ''
+            if ( calendar.disabled( calendar.get('now') ) ) {
+                includeToday = ':not(.' + settings.klass.buttonToday + ')'
+            }
+            picker.$root.find( 'button' + includeToday + ', select' ).attr( 'disabled', false )
+        }, 1 ).
+        on( 'close', function() {
+            picker.$root.find( 'button, select' ).attr( 'disabled', true )
+        }, 1 )
+
+} //DatePicker
+
+
+/**
+ * Set a datepicker item object.
+ */
+DatePicker.prototype.set = function( type, value, options ) {
+
+    var calendar = this,
+        calendarItem = calendar.item
+
+    // If the value is `null` just set it immediately.
+    if ( value === null ) {
+        if ( type == 'clear' ) type = 'select'
+        calendarItem[ type ] = value
+        return calendar
+    }
+
+    // Otherwise go through the queue of methods, and invoke the functions.
+    // Update this as the time unit, and set the final value as this item.
+    // * In the case of `enable`, keep the queue but set `disable` instead.
+    //   And in the case of `flip`, keep the queue but set `enable` instead.
+    calendarItem[ ( type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type ) ] = calendar.queue[ type ].split( ' ' ).map( function( method ) {
+        value = calendar[ method ]( type, value, options )
+        return value
+    }).pop()
+
+    // Check if we need to cascade through more updates.
+    if ( type == 'select' ) {
+        calendar.set( 'highlight', calendarItem.select, options )
+    }
+    else if ( type == 'highlight' ) {
+        calendar.set( 'view', calendarItem.highlight, options )
+    }
+    else if ( type.match( /^(flip|min|max|disable|enable)$/ ) ) {
+        if ( calendarItem.select && calendar.disabled( calendarItem.select ) ) {
+            calendar.set( 'select', calendarItem.select, options )
+        }
+        if ( calendarItem.highlight && calendar.disabled( calendarItem.highlight ) ) {
+            calendar.set( 'highlight', calendarItem.highlight, options )
+        }
+    }
+
+    return calendar
+} //DatePicker.prototype.set
+
+
+/**
+ * Get a datepicker item object.
+ */
+DatePicker.prototype.get = function( type ) {
+    return this.item[ type ]
+} //DatePicker.prototype.get
+
+
+/**
+ * Create a picker date object.
+ */
+DatePicker.prototype.create = function( type, value, options ) {
+
+    var isInfiniteValue,
+        calendar = this
+
+    // If there’s no value, use the type as the value.
+    value = value === undefined ? type : value
+
+
+    // If it’s infinity, update the value.
+    if ( value == -Infinity || value == Infinity ) {
+        isInfiniteValue = value
+    }
+
+    // If it’s an object, use the native date object.
+    else if ( $.isPlainObject( value ) && _.isInteger( value.pick ) ) {
+        value = value.obj
+    }
+
+    // If it’s an array, convert it into a date and make sure
+    // that it’s a valid date – otherwise default to today.
+    else if ( $.isArray( value ) ) {
+        value = new Date( value[ 0 ], value[ 1 ], value[ 2 ] )
+        value = _.isDate( value ) ? value : calendar.create().obj
+    }
+
+    // If it’s a number or date object, make a normalized date.
+    else if ( _.isInteger( value ) || _.isDate( value ) ) {
+        value = calendar.normalize( new Date( value ), options )
+    }
+
+    // If it’s a literal true or any other case, set it to now.
+    else /*if ( value === true )*/ {
+        value = calendar.now( type, value, options )
+    }
+
+    // Return the compiled object.
+    return {
+        year: isInfiniteValue || value.getFullYear(),
+        month: isInfiniteValue || value.getMonth(),
+        date: isInfiniteValue || value.getDate(),
+        day: isInfiniteValue || value.getDay(),
+        obj: isInfiniteValue || value,
+        pick: isInfiniteValue || value.getTime()
+    }
+} //DatePicker.prototype.create
+
+
+/**
+ * Create a range limit object using an array, date object,
+ * literal “true”, or integer relative to another time.
+ */
+DatePicker.prototype.createRange = function( from, to ) {
+
+    var calendar = this,
+        createDate = function( date ) {
+            if ( date === true || $.isArray( date ) || _.isDate( date ) ) {
+                return calendar.create( date )
+            }
+            return date
+        }
+
+    // Create objects if possible.
+    if ( !_.isInteger( from ) ) {
+        from = createDate( from )
+    }
+    if ( !_.isInteger( to ) ) {
+        to = createDate( to )
+    }
+
+    // Create relative dates.
+    if ( _.isInteger( from ) && $.isPlainObject( to ) ) {
+        from = [ to.year, to.month, to.date + from ];
+    }
+    else if ( _.isInteger( to ) && $.isPlainObject( from ) ) {
+        to = [ from.year, from.month, from.date + to ];
+    }
+
+    return {
+        from: createDate( from ),
+        to: createDate( to )
+    }
+} //DatePicker.prototype.createRange
+
+
+/**
+ * Check if a date unit falls within a date range object.
+ */
+DatePicker.prototype.withinRange = function( range, dateUnit ) {
+    range = this.createRange(range.from, range.to)
+    return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick
+}
+
+
+/**
+ * Check if two date range objects overlap.
+ */
+DatePicker.prototype.overlapRanges = function( one, two ) {
+
+    var calendar = this
+
+    // Convert the ranges into comparable dates.
+    one = calendar.createRange( one.from, one.to )
+    two = calendar.createRange( two.from, two.to )
+
+    return calendar.withinRange( one, two.from ) || calendar.withinRange( one, two.to ) ||
+        calendar.withinRange( two, one.from ) || calendar.withinRange( two, one.to )
+}
+
+
+/**
+ * Get the date today.
+ */
+DatePicker.prototype.now = function( type, value, options ) {
+    value = new Date()
+    if ( options && options.rel ) {
+        value.setDate( value.getDate() + options.rel )
+    }
+    return this.normalize( value, options )
+}
+
+
+/**
+ * Navigate to next/prev month.
+ */
+DatePicker.prototype.navigate = function( type, value, options ) {
+
+    var targetDateObject,
+        targetYear,
+        targetMonth,
+        targetDate,
+        isTargetArray = $.isArray( value ),
+        isTargetObject = $.isPlainObject( value ),
+        viewsetObject = this.item.view/*,
+        safety = 100*/
+
+
+    if ( isTargetArray || isTargetObject ) {
+
+        if ( isTargetObject ) {
+            targetYear = value.year
+            targetMonth = value.month
+            targetDate = value.date
+        }
+        else {
+            targetYear = +value[0]
+            targetMonth = +value[1]
+            targetDate = +value[2]
+        }
+
+        // If we’re navigating months but the view is in a different
+        // month, navigate to the view’s year and month.
+        if ( options && options.nav && viewsetObject && viewsetObject.month !== targetMonth ) {
+            targetYear = viewsetObject.year
+            targetMonth = viewsetObject.month
+        }
+
+        // Figure out the expected target year and month.
+        targetDateObject = new Date( targetYear, targetMonth + ( options && options.nav ? options.nav : 0 ), 1 )
+        targetYear = targetDateObject.getFullYear()
+        targetMonth = targetDateObject.getMonth()
+
+        // If the month we’re going to doesn’t have enough days,
+        // keep decreasing the date until we reach the month’s last date.
+        while ( /*safety &&*/ new Date( targetYear, targetMonth, targetDate ).getMonth() !== targetMonth ) {
+            targetDate -= 1
+            /*safety -= 1
+            if ( !safety ) {
+                throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
+            }*/
+        }
+
+        value = [ targetYear, targetMonth, targetDate ]
+    }
+
+    return value
+} //DatePicker.prototype.navigate
+
+
+/**
+ * Normalize a date by setting the hours to midnight.
+ */
+DatePicker.prototype.normalize = function( value/*, options*/ ) {
+    value.setHours( 0, 0, 0, 0 )
+    return value
+}
+
+
+/**
+ * Measure the range of dates.
+ */
+DatePicker.prototype.measure = function( type, value/*, options*/ ) {
+
+    var calendar = this
+
+    // If it’s anything false-y, remove the limits.
+    if ( !value ) {
+        value = type == 'min' ? -Infinity : Infinity
+    }
+
+    // If it’s a string, parse it.
+    else if ( typeof value == 'string' ) {
+        value = calendar.parse( type, value )
+    }
+
+    // If it's an integer, get a date relative to today.
+    else if ( _.isInteger( value ) ) {
+        value = calendar.now( type, value, { rel: value } )
+    }
+
+    return value
+} ///DatePicker.prototype.measure
+
+
+/**
+ * Create a viewset object based on navigation.
+ */
+DatePicker.prototype.viewset = function( type, dateObject/*, options*/ ) {
+    return this.create([ dateObject.year, dateObject.month, 1 ])
+}
+
+
+/**
+ * Validate a date as enabled and shift if needed.
+ */
+DatePicker.prototype.validate = function( type, dateObject, options ) {
+
+    var calendar = this,
+
+        // Keep a reference to the original date.
+        originalDateObject = dateObject,
+
+        // Make sure we have an interval.
+        interval = options && options.interval ? options.interval : 1,
+
+        // Check if the calendar enabled dates are inverted.
+        isFlippedBase = calendar.item.enable === -1,
+
+        // Check if we have any enabled dates after/before now.
+        hasEnabledBeforeTarget, hasEnabledAfterTarget,
+
+        // The min & max limits.
+        minLimitObject = calendar.item.min,
+        maxLimitObject = calendar.item.max,
+
+        // Check if we’ve reached the limit during shifting.
+        reachedMin, reachedMax,
+
+        // Check if the calendar is inverted and at least one weekday is enabled.
+        hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter( function( value ) {
+
+            // If there’s a date, check where it is relative to the target.
+            if ( $.isArray( value ) ) {
+                var dateTime = calendar.create( value ).pick
+                if ( dateTime < dateObject.pick ) hasEnabledBeforeTarget = true
+                else if ( dateTime > dateObject.pick ) hasEnabledAfterTarget = true
+            }
+
+            // Return only integers for enabled weekdays.
+            return _.isInteger( value )
+        }).length/*,
+
+        safety = 100*/
+
+
+
+    // Cases to validate for:
+    // [1] Not inverted and date disabled.
+    // [2] Inverted and some dates enabled.
+    // [3] Not inverted and out of range.
+    //
+    // Cases to **not** validate for:
+    // • Navigating months.
+    // • Not inverted and date enabled.
+    // • Inverted and all dates disabled.
+    // • ..and anything else.
+    if ( !options || !options.nav ) if (
+        /* 1 */ ( !isFlippedBase && calendar.disabled( dateObject ) ) ||
+        /* 2 */ ( isFlippedBase && calendar.disabled( dateObject ) && ( hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget ) ) ||
+        /* 3 */ ( !isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick) )
+    ) {
+
+
+        // When inverted, flip the direction if there aren’t any enabled weekdays
+        // and there are no enabled dates in the direction of the interval.
+        if ( isFlippedBase && !hasEnabledWeekdays && ( ( !hasEnabledAfterTarget && interval > 0 ) || ( !hasEnabledBeforeTarget && interval < 0 ) ) ) {
+            interval *= -1
+        }
+
+
+        // Keep looping until we reach an enabled date.
+        while ( /*safety &&*/ calendar.disabled( dateObject ) ) {
+
+            /*safety -= 1
+            if ( !safety ) {
+                throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
+            }*/
+
+
+            // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
+            if ( Math.abs( interval ) > 1 && ( dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month ) ) {
+                dateObject = originalDateObject
+                interval = interval > 0 ? 1 : -1
+            }
+
+
+            // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
+            if ( dateObject.pick <= minLimitObject.pick ) {
+                reachedMin = true
+                interval = 1
+                dateObject = calendar.create([
+                    minLimitObject.year,
+                    minLimitObject.month,
+                    minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)
+                ])
+            }
+            else if ( dateObject.pick >= maxLimitObject.pick ) {
+                reachedMax = true
+                interval = -1
+                dateObject = calendar.create([
+                    maxLimitObject.year,
+                    maxLimitObject.month,
+                    maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)
+                ])
+            }
+
+
+            // If we’ve reached both limits, just break out of the loop.
+            if ( reachedMin && reachedMax ) {
+                break
+            }
+
+
+            // Finally, create the shifted date using the interval and keep looping.
+            dateObject = calendar.create([ dateObject.year, dateObject.month, dateObject.date + interval ])
+        }
+
+    } //endif
+
+
+    // Return the date object settled on.
+    return dateObject
+} //DatePicker.prototype.validate
+
+
+/**
+ * Check if a date is disabled.
+ */
+DatePicker.prototype.disabled = function( dateToVerify ) {
+
+    var
+        calendar = this,
+
+        // Filter through the disabled dates to check if this is one.
+        isDisabledMatch = calendar.item.disable.filter( function( dateToDisable ) {
+
+            // If the date is a number, match the weekday with 0index and `firstDay` check.
+            if ( _.isInteger( dateToDisable ) ) {
+                return dateToVerify.day === ( calendar.settings.firstDay ? dateToDisable : dateToDisable - 1 ) % 7
+            }
+
+            // If it’s an array or a native JS date, create and match the exact date.
+            if ( $.isArray( dateToDisable ) || _.isDate( dateToDisable ) ) {
+                return dateToVerify.pick === calendar.create( dateToDisable ).pick
+            }
+
+            // If it’s an object, match a date within the “from” and “to” range.
+            if ( $.isPlainObject( dateToDisable ) ) {
+                return calendar.withinRange( dateToDisable, dateToVerify )
+            }
+        })
+
+    // If this date matches a disabled date, confirm it’s not inverted.
+    isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function( dateToDisable ) {
+        return $.isArray( dateToDisable ) && dateToDisable[3] == 'inverted' ||
+            $.isPlainObject( dateToDisable ) && dateToDisable.inverted
+    }).length
+
+    // Check the calendar “enabled” flag and respectively flip the
+    // disabled state. Then also check if it’s beyond the min/max limits.
+    return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch ||
+        dateToVerify.pick < calendar.item.min.pick ||
+        dateToVerify.pick > calendar.item.max.pick
+
+} //DatePicker.prototype.disabled
+
+
+/**
+ * Parse a string into a usable type.
+ */
+DatePicker.prototype.parse = function( type, value, options ) {
+
+    var calendar = this,
+        parsingObject = {}
+
+    // If it’s already parsed, we’re good.
+    if ( !value || typeof value != 'string' ) {
+        return value
+    }
+
+    // We need a `.format` to parse the value with.
+    if ( !( options && options.format ) ) {
+        options = options || {}
+        options.format = calendar.settings.format
+    }
+
+    // Convert the format into an array and then map through it.
+    calendar.formats.toArray( options.format ).map( function( label ) {
+
+        var
+            // Grab the formatting label.
+            formattingLabel = calendar.formats[ label ],
+
+            // The format length is from the formatting label function or the
+            // label length without the escaping exclamation (!) mark.
+            formatLength = formattingLabel ? _.trigger( formattingLabel, calendar, [ value, parsingObject ] ) : label.replace( /^!/, '' ).length
+
+        // If there's a format label, split the value up to the format length.
+        // Then add it to the parsing object with appropriate label.
+        if ( formattingLabel ) {
+            parsingObject[ label ] = value.substr( 0, formatLength )
+        }
+
+        // Update the value as the substring from format length to end.
+        value = value.substr( formatLength )
+    })
+
+    // Compensate for month 0index.
+    return [
+        parsingObject.yyyy || parsingObject.yy,
+        +( parsingObject.mm || parsingObject.m ) - 1,
+        parsingObject.dd || parsingObject.d
+    ]
+} //DatePicker.prototype.parse
+
+
+/**
+ * Various formats to display the object in.
+ */
+DatePicker.prototype.formats = (function() {
+
+    // Return the length of the first word in a collection.
+    function getWordLengthFromCollection( string, collection, dateObject ) {
+
+        // Grab the first word from the string.
+        var word = string.match( /\w+/ )[ 0 ]
+
+        // If there's no month index, add it to the date object
+        if ( !dateObject.mm && !dateObject.m ) {
+            dateObject.m = collection.indexOf( word ) + 1
+        }
+
+        // Return the length of the word.
+        return word.length
+    }
+
+    // Get the length of the first word in a string.
+    function getFirstWordLength( string ) {
+        return string.match( /\w+/ )[ 0 ].length
+    }
+
+    return {
+
+        d: function( string, dateObject ) {
+
+            // If there's string, then get the digits length.
+            // Otherwise return the selected date.
+            return string ? _.digits( string ) : dateObject.date
+        },
+        dd: function( string, dateObject ) {
+
+            // If there's a string, then the length is always 2.
+            // Otherwise return the selected date with a leading zero.
+            return string ? 2 : _.lead( dateObject.date )
+        },
+        ddd: function( string, dateObject ) {
+
+            // If there's a string, then get the length of the first word.
+            // Otherwise return the short selected weekday.
+            return string ? getFirstWordLength( string ) : this.settings.weekdaysShort[ dateObject.day ]
+        },
+        dddd: function( string, dateObject ) {
+
+            // If there's a string, then get the length of the first word.
+            // Otherwise return the full selected weekday.
+            return string ? getFirstWordLength( string ) : this.settings.weekdaysFull[ dateObject.day ]
+        },
+        m: function( string, dateObject ) {
+
+            // If there's a string, then get the length of the digits
+            // Otherwise return the selected month with 0index compensation.
+            return string ? _.digits( string ) : dateObject.month + 1
+        },
+        mm: function( string, dateObject ) {
+
+            // If there's a string, then the length is always 2.
+            // Otherwise return the selected month with 0index and leading zero.
+            return string ? 2 : _.lead( dateObject.month + 1 )
+        },
+        mmm: function( string, dateObject ) {
+
+            var collection = this.settings.monthsShort
+
+            // If there's a string, get length of the relevant month from the short
+            // months collection. Otherwise return the selected month from that collection.
+            return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ]
+        },
+        mmmm: function( string, dateObject ) {
+
+            var collection = this.settings.monthsFull
+
+            // If there's a string, get length of the relevant month from the full
+            // months collection. Otherwise return the selected month from that collection.
+            return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ]
+        },
+        yy: function( string, dateObject ) {
+
+            // If there's a string, then the length is always 2.
+            // Otherwise return the selected year by slicing out the first 2 digits.
+            return string ? 2 : ( '' + dateObject.year ).slice( 2 )
+        },
+        yyyy: function( string, dateObject ) {
+
+            // If there's a string, then the length is always 4.
+            // Otherwise return the selected year.
+            return string ? 4 : dateObject.year
+        },
+
+        // Create an array by splitting the formatting string passed.
+        toArray: function( formatString ) { return formatString.split( /(d{1,4}|m{1,4}|y{4}|yy|!.)/g ) },
+
+        // Format an object into a string using the formatting options.
+        toString: function ( formatString, itemObject ) {
+            var calendar = this
+            return calendar.formats.toArray( formatString ).map( function( label ) {
+                return _.trigger( calendar.formats[ label ], calendar, [ 0, itemObject ] ) || label.replace( /^!/, '' )
+            }).join( '' )
+        }
+    }
+})() //DatePicker.prototype.formats
+
+
+
+
+/**
+ * Check if two date units are the exact.
+ */
+DatePicker.prototype.isDateExact = function( one, two ) {
+
+    var calendar = this
+
+    // When we’re working with weekdays, do a direct comparison.
+    if (
+        ( _.isInteger( one ) && _.isInteger( two ) ) ||
+        ( typeof one == 'boolean' && typeof two == 'boolean' )
+     ) {
+        return one === two
+    }
+
+    // When we’re working with date representations, compare the “pick” value.
+    if (
+        ( _.isDate( one ) || $.isArray( one ) ) &&
+        ( _.isDate( two ) || $.isArray( two ) )
+    ) {
+        return calendar.create( one ).pick === calendar.create( two ).pick
+    }
+
+    // When we’re working with range objects, compare the “from” and “to”.
+    if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) {
+        return calendar.isDateExact( one.from, two.from ) && calendar.isDateExact( one.to, two.to )
+    }
+
+    return false
+}
+
+
+/**
+ * Check if two date units overlap.
+ */
+DatePicker.prototype.isDateOverlap = function( one, two ) {
+
+    var calendar = this,
+        firstDay = calendar.settings.firstDay ? 1 : 0
+
+    // When we’re working with a weekday index, compare the days.
+    if ( _.isInteger( one ) && ( _.isDate( two ) || $.isArray( two ) ) ) {
+        one = one % 7 + firstDay
+        return one === calendar.create( two ).day + 1
+    }
+    if ( _.isInteger( two ) && ( _.isDate( one ) || $.isArray( one ) ) ) {
+        two = two % 7 + firstDay
+        return two === calendar.create( one ).day + 1
+    }
+
+    // When we’re working with range objects, check if the ranges overlap.
+    if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) {
+        return calendar.overlapRanges( one, two )
+    }
+
+    return false
+}
+
+
+/**
+ * Flip the “enabled” state.
+ */
+DatePicker.prototype.flipEnable = function(val) {
+    var itemObject = this.item
+    itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1)
+}
+
+
+/**
+ * Mark a collection of dates as “disabled”.
+ */
+DatePicker.prototype.deactivate = function( type, datesToDisable ) {
+
+    var calendar = this,
+        disabledItems = calendar.item.disable.slice(0)
+
+
+    // If we’re flipping, that’s all we need to do.
+    if ( datesToDisable == 'flip' ) {
+        calendar.flipEnable()
+    }
+
+    else if ( datesToDisable === false ) {
+        calendar.flipEnable(1)
+        disabledItems = []
+    }
+
+    else if ( datesToDisable === true ) {
+        calendar.flipEnable(-1)
+        disabledItems = []
+    }
+
+    // Otherwise go through the dates to disable.
+    else {
+
+        datesToDisable.map(function( unitToDisable ) {
+
+            var matchFound
+
+            // When we have disabled items, check for matches.
+            // If something is matched, immediately break out.
+            for ( var index = 0; index < disabledItems.length; index += 1 ) {
+                if ( calendar.isDateExact( unitToDisable, disabledItems[index] ) ) {
+                    matchFound = true
+                    break
+                }
+            }
+
+            // If nothing was found, add the validated unit to the collection.
+            if ( !matchFound ) {
+                if (
+                    _.isInteger( unitToDisable ) ||
+                    _.isDate( unitToDisable ) ||
+                    $.isArray( unitToDisable ) ||
+                    ( $.isPlainObject( unitToDisable ) && unitToDisable.from && unitToDisable.to )
+                ) {
+                    disabledItems.push( unitToDisable )
+                }
+            }
+        })
+    }
+
+    // Return the updated collection.
+    return disabledItems
+} //DatePicker.prototype.deactivate
+
+
+/**
+ * Mark a collection of dates as “enabled”.
+ */
+DatePicker.prototype.activate = function( type, datesToEnable ) {
+
+    var calendar = this,
+        disabledItems = calendar.item.disable,
+        disabledItemsCount = disabledItems.length
+
+    // If we’re flipping, that’s all we need to do.
+    if ( datesToEnable == 'flip' ) {
+        calendar.flipEnable()
+    }
+
+    else if ( datesToEnable === true ) {
+        calendar.flipEnable(1)
+        disabledItems = []
+    }
+
+    else if ( datesToEnable === false ) {
+        calendar.flipEnable(-1)
+        disabledItems = []
+    }
+
+    // Otherwise go through the disabled dates.
+    else {
+
+        datesToEnable.map(function( unitToEnable ) {
+
+            var matchFound,
+                disabledUnit,
+                index,
+                isExactRange
+
+            // Go through the disabled items and try to find a match.
+            for ( index = 0; index < disabledItemsCount; index += 1 ) {
+
+                disabledUnit = disabledItems[index]
+
+                // When an exact match is found, remove it from the collection.
+                if ( calendar.isDateExact( disabledUnit, unitToEnable ) ) {
+                    matchFound = disabledItems[index] = null
+                    isExactRange = true
+                    break
+                }
+
+                // When an overlapped match is found, add the “inverted” state to it.
+                else if ( calendar.isDateOverlap( disabledUnit, unitToEnable ) ) {
+                    if ( $.isPlainObject( unitToEnable ) ) {
+                        unitToEnable.inverted = true
+                        matchFound = unitToEnable
+                    }
+                    else if ( $.isArray( unitToEnable ) ) {
+                        matchFound = unitToEnable
+                        if ( !matchFound[3] ) matchFound.push( 'inverted' )
+                    }
+                    else if ( _.isDate( unitToEnable ) ) {
+                        matchFound = [ unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted' ]
+                    }
+                    break
+                }
+            }
+
+            // If a match was found, remove a previous duplicate entry.
+            if ( matchFound ) for ( index = 0; index < disabledItemsCount; index += 1 ) {
+                if ( calendar.isDateExact( disabledItems[index], unitToEnable ) ) {
+                    disabledItems[index] = null
+                    break
+                }
+            }
+
+            // In the event that we’re dealing with an exact range of dates,
+            // make sure there are no “inverted” dates because of it.
+            if ( isExactRange ) for ( index = 0; index < disabledItemsCount; index += 1 ) {
+                if ( calendar.isDateOverlap( disabledItems[index], unitToEnable ) ) {
+                    disabledItems[index] = null
+                    break
+                }
+            }
+
+            // If something is still matched, add it into the collection.
+            if ( matchFound ) {
+                disabledItems.push( matchFound )
+            }
+        })
+    }
+
+    // Return the updated collection.
+    return disabledItems.filter(function( val ) { return val != null })
+} //DatePicker.prototype.activate
+
+
+/**
+ * Create a string for the nodes in the picker.
+ */
+DatePicker.prototype.nodes = function( isOpen ) {
+
+    var
+        calendar = this,
+        settings = calendar.settings,
+        calendarItem = calendar.item,
+        nowObject = calendarItem.now,
+        selectedObject = calendarItem.select,
+        highlightedObject = calendarItem.highlight,
+        viewsetObject = calendarItem.view,
+        disabledCollection = calendarItem.disable,
+        minLimitObject = calendarItem.min,
+        maxLimitObject = calendarItem.max,
+
+
+        // Create the calendar table head using a copy of weekday labels collection.
+        // * We do a copy so we don't mutate the original array.
+        tableHead = (function( collection, fullCollection ) {
+
+            // If the first day should be Monday, move Sunday to the end.
+            if ( settings.firstDay ) {
+                collection.push( collection.shift() )
+                fullCollection.push( fullCollection.shift() )
+            }
+
+            // Create and return the table head group.
+            return _.node(
+                'thead',
+                _.node(
+                    'tr',
+                    _.group({
+                        min: 0,
+                        max: DAYS_IN_WEEK - 1,
+                        i: 1,
+                        node: 'th',
+                        item: function( counter ) {
+                            return [
+                                collection[ counter ],
+                                settings.klass.weekdays,
+                                'scope=col title="' + fullCollection[ counter ] + '"'
+                            ]
+                        }
+                    })
+                )
+            ) //endreturn
+
+        // Materialize modified
+        })( ( settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter ).slice( 0 ), settings.weekdaysFull.slice( 0 ) ), //tableHead
+
+
+        // Create the nav for next/prev month.
+        createMonthNav = function( next ) {
+
+            // Otherwise, return the created month tag.
+            return _.node(
+                'div',
+                ' ',
+                settings.klass[ 'nav' + ( next ? 'Next' : 'Prev' ) ] + (
+
+                    // If the focused month is outside the range, disabled the button.
+                    ( next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month ) ||
+                    ( !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ) ?
+                    ' ' + settings.klass.navDisabled : ''
+                ),
+                'data-nav=' + ( next || -1 ) + ' ' +
+                _.ariaAttr({
+                    role: 'button',
+                    controls: calendar.$node[0].id + '_table'
+                }) + ' ' +
+                'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev ) + '"'
+            ) //endreturn
+        }, //createMonthNav
+
+
+        // Create the month label.
+        //Materialize modified
+        createMonthLabel = function(override) {
+
+            var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull
+
+             // Materialize modified
+            if (override == "short_months") {
+              monthsCollection = settings.monthsShort;
+            }
+
+            // If there are months to select, add a dropdown menu.
+            if ( settings.selectMonths  && override == undefined) {
+
+                return _.node( 'select',
+                    _.group({
+                        min: 0,
+                        max: 11,
+                        i: 1,
+                        node: 'option',
+                        item: function( loopedMonth ) {
+
+                            return [
+
+                                // The looped month and no classes.
+                                monthsCollection[ loopedMonth ], 0,
+
+                                // Set the value and selected index.
+                                'value=' + loopedMonth +
+                                ( viewsetObject.month == loopedMonth ? ' selected' : '' ) +
+                                (
+                                    (
+                                        ( viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month ) ||
+                                        ( viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month )
+                                    ) ?
+                                    ' disabled' : ''
+                                )
+                            ]
+                        }
+                    }),
+                    settings.klass.selectMonth + ' browser-default',
+                    ( isOpen ? '' : 'disabled' ) + ' ' +
+                    _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' +
+                    'title="' + settings.labelMonthSelect + '"'
+                )
+            }
+
+            // Materialize modified
+            if (override == "short_months")
+                if (selectedObject != null)
+                return _.node( 'div', monthsCollection[ selectedObject.month ] );
+                else return _.node( 'div', monthsCollection[ viewsetObject.month ] );
+
+            // If there's a need for a month selector
+            return _.node( 'div', monthsCollection[ viewsetObject.month ], settings.klass.month )
+        }, //createMonthLabel
+
+
+        // Create the year label.
+        // Materialize modified
+        createYearLabel = function(override) {
+
+            var focusedYear = viewsetObject.year,
+
+            // If years selector is set to a literal "true", set it to 5. Otherwise
+            // divide in half to get half before and half after focused year.
+            numberYears = settings.selectYears === true ? 5 : ~~( settings.selectYears / 2 )
+
+            // If there are years to select, add a dropdown menu.
+            if ( numberYears ) {
+
+                var
+                    minYear = minLimitObject.year,
+                    maxYear = maxLimitObject.year,
+                    lowestYear = focusedYear - numberYears,
+                    highestYear = focusedYear + numberYears
+
+                // If the min year is greater than the lowest year, increase the highest year
+                // by the difference and set the lowest year to the min year.
+                if ( minYear > lowestYear ) {
+                    highestYear += minYear - lowestYear
+                    lowestYear = minYear
+                }
+
+                // If the max year is less than the highest year, decrease the lowest year
+                // by the lower of the two: available and needed years. Then set the
+                // highest year to the max year.
+                if ( maxYear < highestYear ) {
+
+                    var availableYears = lowestYear - minYear,
+                        neededYears = highestYear - maxYear
+
+                    lowestYear -= availableYears > neededYears ? neededYears : availableYears
+                    highestYear = maxYear
+                }
+
+                if ( settings.selectYears  && override == undefined ) {
+                    return _.node( 'select',
+                        _.group({
+                            min: lowestYear,
+                            max: highestYear,
+                            i: 1,
+                            node: 'option',
+                            item: function( loopedYear ) {
+                                return [
+
+                                    // The looped year and no classes.
+                                    loopedYear, 0,
+
+                                    // Set the value and selected index.
+                                    'value=' + loopedYear + ( focusedYear == loopedYear ? ' selected' : '' )
+                                ]
+                            }
+                        }),
+                        settings.klass.selectYear + ' browser-default',
+                        ( isOpen ? '' : 'disabled' ) + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' +
+                        'title="' + settings.labelYearSelect + '"'
+                    )
+                }
+            }
+
+            // Materialize modified
+            if (override == "raw")
+                return _.node( 'div', focusedYear )
+
+            // Otherwise just return the year focused
+            return _.node( 'div', focusedYear, settings.klass.year )
+        } //createYearLabel
+
+
+        // Materialize modified
+        createDayLabel = function() {
+                if (selectedObject != null)
+                    return _.node( 'div', selectedObject.date)
+                else return _.node( 'div', nowObject.date)
+            }
+        createWeekdayLabel = function() {
+            var display_day;
+
+            if (selectedObject != null)
+                display_day = selectedObject.day;
+            else
+                display_day = nowObject.day;
+            var weekday = settings.weekdaysFull[ display_day ]
+            return weekday
+        }
+
+
+    // Create and return the entire calendar.
+return _.node(
+        // Date presentation View
+        'div',
+            _.node(
+                'div',
+                createWeekdayLabel(),
+                "picker__weekday-display"
+            )+
+            _.node(
+                // Div for short Month
+                'div',
+                createMonthLabel("short_months"),
+                settings.klass.month_display
+            )+
+            _.node(
+                // Div for Day
+                'div',
+                createDayLabel() ,
+                settings.klass.day_display
+            )+
+            _.node(
+                // Div for Year
+                'div',
+                createYearLabel("raw") ,
+                settings.klass.year_display
+            ),
+        settings.klass.date_display
+    )+
+    // Calendar container
+    _.node('div',
+        _.node('div',
+        ( settings.selectYears ?  createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel() ) +
+        createMonthNav() + createMonthNav( 1 ),
+        settings.klass.header
+    ) + _.node(
+        'table',
+        tableHead +
+        _.node(
+            'tbody',
+            _.group({
+                min: 0,
+                max: WEEKS_IN_CALENDAR - 1,
+                i: 1,
+                node: 'tr',
+                item: function( rowCounter ) {
+
+                    // If Monday is the first day and the month starts on Sunday, shift the date back a week.
+                    var shiftDateBy = settings.firstDay && calendar.create([ viewsetObject.year, viewsetObject.month, 1 ]).day === 0 ? -7 : 0
+
+                    return [
+                        _.group({
+                            min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
+                            max: function() {
+                                return this.min + DAYS_IN_WEEK - 1
+                            },
+                            i: 1,
+                            node: 'td',
+                            item: function( targetDate ) {
+
+                                // Convert the time date from a relative date to a target date.
+                                targetDate = calendar.create([ viewsetObject.year, viewsetObject.month, targetDate + ( settings.firstDay ? 1 : 0 ) ])
+
+                                var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
+                                    isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
+                                    isDisabled = disabledCollection && calendar.disabled( targetDate ) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
+                                    formattedDate = _.trigger( calendar.formats.toString, calendar, [ settings.format, targetDate ] )
+
+                                return [
+                                    _.node(
+                                        'div',
+                                        targetDate.date,
+                                        (function( klasses ) {
+
+                                            // Add the `infocus` or `outfocus` classes based on month in view.
+                                            klasses.push( viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus )
+
+                                            // Add the `today` class if needed.
+                                            if ( nowObject.pick == targetDate.pick ) {
+                                                klasses.push( settings.klass.now )
+                                            }
+
+                                            // Add the `selected` class if something's selected and the time matches.
+                                            if ( isSelected ) {
+                                                klasses.push( settings.klass.selected )
+                                            }
+
+                                            // Add the `highlighted` class if something's highlighted and the time matches.
+                                            if ( isHighlighted ) {
+                                                klasses.push( settings.klass.highlighted )
+                                            }
+
+                                            // Add the `disabled` class if something's disabled and the object matches.
+                                            if ( isDisabled ) {
+                                                klasses.push( settings.klass.disabled )
+                                            }
+
+                                            return klasses.join( ' ' )
+                                        })([ settings.klass.day ]),
+                                        'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
+                                            role: 'gridcell',
+                                            label: formattedDate,
+                                            selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
+                                            activedescendant: isHighlighted ? true : null,
+                                            disabled: isDisabled ? true : null
+                                        })
+                                    ),
+                                    '',
+                                    _.ariaAttr({ role: 'presentation' })
+                                ] //endreturn
+                            }
+                        })
+                    ] //endreturn
+                }
+            })
+        ),
+        settings.klass.table,
+        'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
+            role: 'grid',
+            controls: calendar.$node[0].id,
+            readonly: true
+        })
+    )
+    , settings.klass.calendar_container) // end calendar
+
+     +
+
+    // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
+    _.node(
+        'div',
+        _.node( 'button', settings.today, "btn-flat picker__today",
+            'type=button data-pick=' + nowObject.pick +
+            ( isOpen && !calendar.disabled(nowObject) ? '' : ' disabled' ) + ' ' +
+            _.ariaAttr({ controls: calendar.$node[0].id }) ) +
+        _.node( 'button', settings.clear, "btn-flat picker__clear",
+            'type=button data-clear=1' +
+            ( isOpen ? '' : ' disabled' ) + ' ' +
+            _.ariaAttr({ controls: calendar.$node[0].id }) ) +
+        _.node('button', settings.close, "btn-flat picker__close",
+            'type=button data-close=true ' +
+            ( isOpen ? '' : ' disabled' ) + ' ' +
+            _.ariaAttr({ controls: calendar.$node[0].id }) ),
+        settings.klass.footer
+    ) //endreturn
+} //DatePicker.prototype.nodes
+
+
+
+
+/**
+ * The date picker defaults.
+ */
+DatePicker.defaults = (function( prefix ) {
+
+    return {
+
+        // The title label to use for the month nav buttons
+        labelMonthNext: 'Next month',
+        labelMonthPrev: 'Previous month',
+
+        // The title label to use for the dropdown selectors
+        labelMonthSelect: 'Select a month',
+        labelYearSelect: 'Select a year',
+
+        // Months and weekdays
+        monthsFull: [ 'January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December' ],
+        monthsShort: [ 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec' ],
+        weekdaysFull: [ 'Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday' ],
+        weekdaysShort: [ 'Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat' ],
+
+        // Materialize modified
+        weekdaysLetter: [ 'S', 'M', 'T', 'W', 'T', 'F', 'S' ],
+
+        // Today and clear
+        today: 'Today',
+        clear: 'Clear',
+        close: 'Close',
+
+        // The format to show on the `input` element
+        format: 'd mmmm, yyyy',
+
+        // Classes
+        klass: {
+
+            table: prefix + 'table',
+
+            header: prefix + 'header',
+
+
+            // Materialize Added klasses
+            date_display: prefix + 'date-display',
+            day_display: prefix + 'day-display',
+            month_display: prefix + 'month-display',
+            year_display: prefix + 'year-display',
+            calendar_container: prefix + 'calendar-container',
+            // end
+
+
+
+            navPrev: prefix + 'nav--prev',
+            navNext: prefix + 'nav--next',
+            navDisabled: prefix + 'nav--disabled',
+
+            month: prefix + 'month',
+            year: prefix + 'year',
+
+            selectMonth: prefix + 'select--month',
+            selectYear: prefix + 'select--year',
+
+            weekdays: prefix + 'weekday',
+
+            day: prefix + 'day',
+            disabled: prefix + 'day--disabled',
+            selected: prefix + 'day--selected',
+            highlighted: prefix + 'day--highlighted',
+            now: prefix + 'day--today',
+            infocus: prefix + 'day--infocus',
+            outfocus: prefix + 'day--outfocus',
+
+            footer: prefix + 'footer',
+
+            buttonClear: prefix + 'button--clear',
+            buttonToday: prefix + 'button--today',
+            buttonClose: prefix + 'button--close'
+        }
+    }
+})( Picker.klasses().picker + '__' )
+
+
+
+
+
+/**
+ * Extend the picker to add the date picker.
+ */
+Picker.extend( 'pickadate', DatePicker )
+
+
+}));
+
+
+;(function ($) {
+
+  $.fn.characterCounter = function(){
+    return this.each(function(){
+      var $input = $(this);
+      var $counterElement = $input.parent().find('span[class="character-counter"]');
+
+      // character counter has already been added appended to the parent container
+      if ($counterElement.length) {
+        return;
+      }
+
+      var itHasLengthAttribute = $input.attr('data-length') !== undefined;
+
+      if(itHasLengthAttribute){
+        $input.on('input', updateCounter);
+        $input.on('focus', updateCounter);
+        $input.on('blur', removeCounterElement);
+
+        addCounterElement($input);
+      }
+
+    });
+  };
+
+  function updateCounter(){
+    var maxLength     = +$(this).attr('data-length'),
+    actualLength      = +$(this).val().length,
+    isValidLength     = actualLength <= maxLength;
+
+    $(this).parent().find('span[class="character-counter"]')
+                    .html( actualLength + '/' + maxLength);
+
+    addInputStyle(isValidLength, $(this));
+  }
+
+  function addCounterElement($input) {
+    var $counterElement = $input.parent().find('span[class="character-counter"]');
+
+    if ($counterElement.length) {
+      return;
+    }
+
+    $counterElement = $('<span/>')
+                        .addClass('character-counter')
+                        .css('float','right')
+                        .css('font-size','12px')
+                        .css('height', 1);
+
+    $input.parent().append($counterElement);
+  }
+
+  function removeCounterElement(){
+    $(this).parent().find('span[class="character-counter"]').html('');
+  }
+
+  function addInputStyle(isValidLength, $input){
+    var inputHasInvalidClass = $input.hasClass('invalid');
+    if (isValidLength && inputHasInvalidClass) {
+      $input.removeClass('invalid');
+    }
+    else if(!isValidLength && !inputHasInvalidClass){
+      $input.removeClass('valid');
+      $input.addClass('invalid');
+    }
+  }
+
+  $(document).ready(function(){
+    $('input, textarea').characterCounter();
+  });
+
+}( jQuery ));
+;(function ($) {
+
+  var methods = {
+
+    init : function(options) {
+      var defaults = {
+        duration: 200, // ms
+        dist: -100, // zoom scale TODO: make this more intuitive as an option
+        shift: 0, // spacing for center image
+        padding: 0, // Padding between non center items
+        fullWidth: false, // Change to full width styles
+        indicators: false, // Toggle indicators
+        noWrap: false, // Don't wrap around and cycle through items.
+        onCycleTo: null // Callback for when a new slide is cycled to.
+      };
+      options = $.extend(defaults, options);
+
+      return this.each(function() {
+
+        var images, item_width, item_height, offset, center, pressed, dim, count,
+            reference, referenceY, amplitude, target, velocity,
+            xform, frame, timestamp, ticker, dragged, vertical_dragged;
+        var $indicators = $('<ul class="indicators"></ul>');
+
+
+        // Initialize
+        var view = $(this);
+        var showIndicators = view.attr('data-indicators') || options.indicators;
+
+        // Don't double initialize.
+        if (view.hasClass('initialized')) {
+          // Redraw carousel.
+          $(this).trigger('carouselNext', [0.000001]);
+          return true;
+        }
+
+
+        // Options
+        if (options.fullWidth) {
+          options.dist = 0;
+          var firstImage = view.find('.carousel-item img').first();
+          if (firstImage.length) {
+            imageHeight = firstImage.on('load', function(){
+              view.css('height', $(this).height());
+            });
+          } else {
+            imageHeight = view.find('.carousel-item').first().height();
+            view.css('height', imageHeight);
+          }
+
+          // Offset fixed items when indicators.
+          if (showIndicators) {
+            view.find('.carousel-fixed-item').addClass('with-indicators');
+          }
+        }
+
+
+        view.addClass('initialized');
+        pressed = false;
+        offset = target = 0;
+        images = [];
+        item_width = view.find('.carousel-item').first().innerWidth();
+        item_height = view.find('.carousel-item').first().innerHeight();
+        dim = item_width * 2 + options.padding;
+
+        view.find('.carousel-item').each(function (i) {
+          images.push($(this)[0]);
+          if (showIndicators) {
+            var $indicator = $('<li class="indicator-item"></li>');
+
+            // Add active to first by default.
+            if (i === 0) {
+              $indicator.addClass('active');
+            }
+
+            // Handle clicks on indicators.
+            $indicator.click(function (e) {
+              e.stopPropagation();
+
+              var index = $(this).index();
+              cycleTo(index);
+            });
+            $indicators.append($indicator);
+          }
+        });
+
+        if (showIndicators) {
+          view.append($indicators);
+        }
+        count = images.length;
+
+
+        function setupEvents() {
+          if (typeof window.ontouchstart !== 'undefined') {
+            view[0].addEventListener('touchstart', tap);
+            view[0].addEventListener('touchmove', drag);
+            view[0].addEventListener('touchend', release);
+          }
+          view[0].addEventListener('mousedown', tap);
+          view[0].addEventListener('mousemove', drag);
+          view[0].addEventListener('mouseup', release);
+          view[0].addEventListener('mouseleave', release);
+          view[0].addEventListener('click', click);
+        }
+
+        function xpos(e) {
+          // touch event
+          if (e.targetTouches && (e.targetTouches.length >= 1)) {
+            return e.targetTouches[0].clientX;
+          }
+
+          // mouse event
+          return e.clientX;
+        }
+
+        function ypos(e) {
+          // touch event
+          if (e.targetTouches && (e.targetTouches.length >= 1)) {
+            return e.targetTouches[0].clientY;
+          }
+
+          // mouse event
+          return e.clientY;
+        }
+
+        function wrap(x) {
+          return (x >= count) ? (x % count) : (x < 0) ? wrap(count + (x % count)) : x;
+        }
+
+        function scroll(x) {
+          var i, half, delta, dir, tween, el, alignment, xTranslation;
+          var lastCenter = center;
+
+          offset = (typeof x === 'number') ? x : offset;
+          center = Math.floor((offset + dim / 2) / dim);
+          delta = offset - center * dim;
+          dir = (delta < 0) ? 1 : -1;
+          tween = -dir * delta * 2 / dim;
+          half = count >> 1;
+
+          if (!options.fullWidth) {
+            alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
+            alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
+          } else {
+            alignment = 'translateX(0)';
+          }
+
+          // Set indicator active
+          if (showIndicators) {
+            var diff = (center % count);
+            var activeIndicator = $indicators.find('.indicator-item.active');
+            if (activeIndicator.index() !== diff) {
+              activeIndicator.removeClass('active');
+              $indicators.find('.indicator-item').eq(diff).addClass('active');
+            }
+          }
+
+          // center
+          // Don't show wrapped items.
+          if (!options.noWrap || (center >= 0 && center < count)) {
+            el = images[wrap(center)];
+
+            // Add active class to center item.
+            if (!$(el).hasClass('active')) {
+              view.find('.carousel-item').removeClass('active');
+              $(el).addClass('active');
+            }
+            el.style[xform] = alignment +
+              ' translateX(' + (-delta / 2) + 'px)' +
+              ' translateX(' + (dir * options.shift * tween * i) + 'px)' +
+              ' translateZ(' + (options.dist * tween) + 'px)';
+            el.style.zIndex = 0;
+            if (options.fullWidth) { tweenedOpacity = 1; }
+            else { tweenedOpacity = 1 - 0.2 * tween; }
+            el.style.opacity = tweenedOpacity;
+            el.style.display = 'block';
+          }
+
+          for (i = 1; i <= half; ++i) {
+            // right side
+            if (options.fullWidth) {
+              zTranslation = options.dist;
+              tweenedOpacity = (i === half && delta < 0) ? 1 - tween : 1;
+            } else {
+              zTranslation = options.dist * (i * 2 + tween * dir);
+              tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
+            }
+            // Don't show wrapped items.
+            if (!options.noWrap || center + i < count) {
+              el = images[wrap(center + i)];
+              el.style[xform] = alignment +
+                ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' +
+                ' translateZ(' + zTranslation + 'px)';
+              el.style.zIndex = -i;
+              el.style.opacity = tweenedOpacity;
+              el.style.display = 'block';
+            }
+
+
+            // left side
+            if (options.fullWidth) {
+              zTranslation = options.dist;
+              tweenedOpacity = (i === half && delta > 0) ? 1 - tween : 1;
+            } else {
+              zTranslation = options.dist * (i * 2 - tween * dir);
+              tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
+            }
+            // Don't show wrapped items.
+            if (!options.noWrap || center - i >= 0) {
+              el = images[wrap(center - i)];
+              el.style[xform] = alignment +
+                ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' +
+                ' translateZ(' + zTranslation + 'px)';
+              el.style.zIndex = -i;
+              el.style.opacity = tweenedOpacity;
+              el.style.display = 'block';
+            }
+          }
+
+          // center
+          // Don't show wrapped items.
+          if (!options.noWrap || (center >= 0 && center < count)) {
+            el = images[wrap(center)];
+            el.style[xform] = alignment +
+              ' translateX(' + (-delta / 2) + 'px)' +
+              ' translateX(' + (dir * options.shift * tween) + 'px)' +
+              ' translateZ(' + (options.dist * tween) + 'px)';
+            el.style.zIndex = 0;
+            if (options.fullWidth) { tweenedOpacity = 1; }
+            else { tweenedOpacity = 1 - 0.2 * tween; }
+            el.style.opacity = tweenedOpacity;
+            el.style.display = 'block';
+          }
+
+          // onCycleTo callback
+          if (lastCenter !== center &&
+              typeof(options.onCycleTo) === "function") {
+            var $curr_item = view.find('.carousel-item').eq(wrap(center));
+            options.onCycleTo.call(this, $curr_item, dragged);
+          }
+        }
+
+        function track() {
+          var now, elapsed, delta, v;
+
+          now = Date.now();
+          elapsed = now - timestamp;
+          timestamp = now;
+          delta = offset - frame;
+          frame = offset;
+
+          v = 1000 * delta / (1 + elapsed);
+          velocity = 0.8 * v + 0.2 * velocity;
+        }
+
+        function autoScroll() {
+          var elapsed, delta;
+
+          if (amplitude) {
+            elapsed = Date.now() - timestamp;
+            delta = amplitude * Math.exp(-elapsed / options.duration);
+            if (delta > 2 || delta < -2) {
+                scroll(target - delta);
+                requestAnimationFrame(autoScroll);
+            } else {
+                scroll(target);
+            }
+          }
+        }
+
+        function click(e) {
+          // Disable clicks if carousel was dragged.
+          if (dragged) {
+            e.preventDefault();
+            e.stopPropagation();
+            return false;
+
+          } else if (!options.fullWidth) {
+            var clickedIndex = $(e.target).closest('.carousel-item').index();
+            var diff = (center % count) - clickedIndex;
+
+            // Disable clicks if carousel was shifted by click
+            if (diff !== 0) {
+              e.preventDefault();
+              e.stopPropagation();
+            }
+            cycleTo(clickedIndex);
+          }
+        }
+
+        function cycleTo(n) {
+          var diff = (center % count) - n;
+
+          // Account for wraparound.
+          if (!options.noWrap) {
+            if (diff < 0) {
+              if (Math.abs(diff + count) < Math.abs(diff)) { diff += count; }
+
+            } else if (diff > 0) {
+              if (Math.abs(diff - count) < diff) { diff -= count; }
+            }
+          }
+
+          // Call prev or next accordingly.
+          if (diff < 0) {
+            view.trigger('carouselNext', [Math.abs(diff)]);
+
+          } else if (diff > 0) {
+            view.trigger('carouselPrev', [diff]);
+          }
+        }
+
+        function tap(e) {
+          pressed = true;
+          dragged = false;
+          vertical_dragged = false;
+          reference = xpos(e);
+          referenceY = ypos(e);
+
+          velocity = amplitude = 0;
+          frame = offset;
+          timestamp = Date.now();
+          clearInterval(ticker);
+          ticker = setInterval(track, 100);
+
+        }
+
+        function drag(e) {
+          var x, delta, deltaY;
+          if (pressed) {
+            x = xpos(e);
+            y = ypos(e);
+            delta = reference - x;
+            deltaY = Math.abs(referenceY - y);
+            if (deltaY < 30 && !vertical_dragged) {
+              // If vertical scrolling don't allow dragging.
+              if (delta > 2 || delta < -2) {
+                dragged = true;
+                reference = x;
+                scroll(offset + delta);
+              }
+
+            } else if (dragged) {
+              // If dragging don't allow vertical scroll.
+              e.preventDefault();
+              e.stopPropagation();
+              return false;
+
+            } else {
+              // Vertical scrolling.
+              vertical_dragged = true;
+            }
+          }
+
+          if (dragged) {
+            // If dragging don't allow vertical scroll.
+            e.preventDefault();
+            e.stopPropagation();
+            return false;
+          }
+        }
+
+        function release(e) {
+          if (pressed) {
+            pressed = false;
+          } else {
+            return;
+          }
+
+          clearInterval(ticker);
+          target = offset;
+          if (velocity > 10 || velocity < -10) {
+            amplitude = 0.9 * velocity;
+            target = offset + amplitude;
+          }
+          target = Math.round(target / dim) * dim;
+
+          // No wrap of items.
+          if (options.noWrap) {
+            if (target >= dim * (count - 1)) {
+              target = dim * (count - 1);
+            } else if (target < 0) {
+              target = 0;
+            }
+          }
+          amplitude = target - offset;
+          timestamp = Date.now();
+          requestAnimationFrame(autoScroll);
+
+          if (dragged) {
+            e.preventDefault();
+            e.stopPropagation();
+          }
+          return false;
+        }
+
+        xform = 'transform';
+        ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
+          var e = prefix + 'Transform';
+          if (typeof document.body.style[e] !== 'undefined') {
+            xform = e;
+            return false;
+          }
+          return true;
+        });
+
+
+        $(window).on('resize.carousel', function() {
+          if (options.fullWidth) {
+            item_width = view.find('.carousel-item').first().innerWidth();
+            item_height = view.find('.carousel-item').first().innerHeight();
+            dim = item_width * 2 + options.padding;
+            offset = center * 2 * item_width;
+            target = offset;
+          } else {
+            scroll();
+          }
+        });
+
+        setupEvents();
+        scroll(offset);
+
+        $(this).on('carouselNext', function(e, n) {
+          if (n === undefined) {
+            n = 1;
+          }
+          target = (dim * Math.round(offset / dim)) + (dim * n);
+          if (offset !== target) {
+            amplitude = target - offset;
+            timestamp = Date.now();
+            requestAnimationFrame(autoScroll);
+          }
+        });
+
+        $(this).on('carouselPrev', function(e, n) {
+          if (n === undefined) {
+            n = 1;
+          }
+          target = (dim * Math.round(offset / dim)) - (dim * n);
+          if (offset !== target) {
+            amplitude = target - offset;
+            timestamp = Date.now();
+            requestAnimationFrame(autoScroll);
+          }
+        });
+
+        $(this).on('carouselSet', function(e, n) {
+          if (n === undefined) {
+            n = 0;
+          }
+          cycleTo(n);
+        });
+
+      });
+
+
+
+    },
+    next : function(n) {
+      $(this).trigger('carouselNext', [n]);
+    },
+    prev : function(n) {
+      $(this).trigger('carouselPrev', [n]);
+    },
+    set : function(n) {
+      $(this).trigger('carouselSet', [n]);
+    }
+  };
+
+
+    $.fn.carousel = function(methodOrOptions) {
+      if ( methods[methodOrOptions] ) {
+        return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+      } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+        // Default to "init"
+        return methods.init.apply( this, arguments );
+      } else {
+        $.error( 'Method ' +  methodOrOptions + ' does not exist on jQuery.carousel' );
+      }
+    }; // Plugin end
+}( jQuery ));
\ No newline at end of file
diff --git a/VNF_Catalogue/public/3rd_party/materialize/js/materialize.min.js b/VNF_Catalogue/public/3rd_party/materialize/js/materialize.min.js
new file mode 100644
index 00000000..00c0d5f8
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/materialize/js/materialize.min.js
@@ -0,0 +1,10 @@
+/*!
+ * Materialize v0.98.0 (http://materializecss.com)
+ * Copyright 2014-2015 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+if("undefined"==typeof jQuery){var jQuery;jQuery="function"==typeof require?$=require("jquery"):$}jQuery.easing.jswing=jQuery.easing.swing,jQuery.extend(jQuery.easing,{def:"easeOutQuad",swing:function(a,b,c,d,e){return jQuery.easing[jQuery.easing.def](a,b,c,d,e)},easeInQuad:function(a,b,c,d,e){return d*(b/=e)*b+c},easeOutQuad:function(a,b,c,d,e){return-d*(b/=e)*(b-2)+c},easeInOutQuad:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:-d/2*(--b*(b-2)-1)+c},easeInCubic:function(a,b,c,d,e){return d*(b/=e)*b*b+c},easeOutCubic:function(a,b,c,d,e){return d*((b=b/e-1)*b*b+1)+c},easeInOutCubic:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b+c:d/2*((b-=2)*b*b+2)+c},easeInQuart:function(a,b,c,d,e){return d*(b/=e)*b*b*b+c},easeOutQuart:function(a,b,c,d,e){return-d*((b=b/e-1)*b*b*b-1)+c},easeInOutQuart:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b+c:-d/2*((b-=2)*b*b*b-2)+c},easeInQuint:function(a,b,c,d,e){return d*(b/=e)*b*b*b*b+c},easeOutQuint:function(a,b,c,d,e){return d*((b=b/e-1)*b*b*b*b+1)+c},easeInOutQuint:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b*b+c:d/2*((b-=2)*b*b*b*b+2)+c},easeInSine:function(a,b,c,d,e){return-d*Math.cos(b/e*(Math.PI/2))+d+c},easeOutSine:function(a,b,c,d,e){return d*Math.sin(b/e*(Math.PI/2))+c},easeInOutSine:function(a,b,c,d,e){return-d/2*(Math.cos(Math.PI*b/e)-1)+c},easeInExpo:function(a,b,c,d,e){return 0==b?c:d*Math.pow(2,10*(b/e-1))+c},easeOutExpo:function(a,b,c,d,e){return b==e?c+d:d*(-Math.pow(2,-10*b/e)+1)+c},easeInOutExpo:function(a,b,c,d,e){return 0==b?c:b==e?c+d:(b/=e/2)<1?d/2*Math.pow(2,10*(b-1))+c:d/2*(-Math.pow(2,-10*--b)+2)+c},easeInCirc:function(a,b,c,d,e){return-d*(Math.sqrt(1-(b/=e)*b)-1)+c},easeOutCirc:function(a,b,c,d,e){return d*Math.sqrt(1-(b=b/e-1)*b)+c},easeInOutCirc:function(a,b,c,d,e){return(b/=e/2)<1?-d/2*(Math.sqrt(1-b*b)-1)+c:d/2*(Math.sqrt(1-(b-=2)*b)+1)+c},easeInElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(0==b)return c;if(1==(b/=e))return c+d;if(g||(g=.3*e),h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(b-=1))*Math.sin((b*e-f)*(2*Math.PI)/g))+c},easeOutElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(0==b)return c;if(1==(b/=e))return c+d;if(g||(g=.3*e),h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*b)*Math.sin((b*e-f)*(2*Math.PI)/g)+d+c},easeInOutElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(0==b)return c;if(2==(b/=e/2))return c+d;if(g||(g=e*(.3*1.5)),h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return b<1?-.5*(h*Math.pow(2,10*(b-=1))*Math.sin((b*e-f)*(2*Math.PI)/g))+c:h*Math.pow(2,-10*(b-=1))*Math.sin((b*e-f)*(2*Math.PI)/g)*.5+d+c},easeInBack:function(a,b,c,d,e,f){return void 0==f&&(f=1.70158),d*(b/=e)*b*((f+1)*b-f)+c},easeOutBack:function(a,b,c,d,e,f){return void 0==f&&(f=1.70158),d*((b=b/e-1)*b*((f+1)*b+f)+1)+c},easeInOutBack:function(a,b,c,d,e,f){return void 0==f&&(f=1.70158),(b/=e/2)<1?d/2*(b*b*(((f*=1.525)+1)*b-f))+c:d/2*((b-=2)*b*(((f*=1.525)+1)*b+f)+2)+c},easeInBounce:function(a,b,c,d,e){return d-jQuery.easing.easeOutBounce(a,e-b,0,d,e)+c},easeOutBounce:function(a,b,c,d,e){return(b/=e)<1/2.75?d*(7.5625*b*b)+c:b<2/2.75?d*(7.5625*(b-=1.5/2.75)*b+.75)+c:b<2.5/2.75?d*(7.5625*(b-=2.25/2.75)*b+.9375)+c:d*(7.5625*(b-=2.625/2.75)*b+.984375)+c},easeInOutBounce:function(a,b,c,d,e){return b<e/2?.5*jQuery.easing.easeInBounce(a,2*b,0,d,e)+c:.5*jQuery.easing.easeOutBounce(a,2*b-e,0,d,e)+.5*d+c}}),jQuery.extend(jQuery.easing,{easeInOutMaterial:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:d/4*((b-=2)*b*b+2)+c}}),jQuery.Velocity?console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity."):(!function(a){function b(a){var b=a.length,d=c.type(a);return"function"!==d&&!c.isWindow(a)&&(!(1!==a.nodeType||!b)||("array"===d||0===b||"number"==typeof b&&b>0&&b-1 in a))}if(!a.jQuery){var c=function(a,b){return new c.fn.init(a,b)};c.isWindow=function(a){return null!=a&&a==a.window},c.type=function(a){return null==a?a+"":"object"==typeof a||"function"==typeof a?e[g.call(a)]||"object":typeof a},c.isArray=Array.isArray||function(a){return"array"===c.type(a)},c.isPlainObject=function(a){var b;if(!a||"object"!==c.type(a)||a.nodeType||c.isWindow(a))return!1;try{if(a.constructor&&!f.call(a,"constructor")&&!f.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(d){return!1}for(b in a);return void 0===b||f.call(a,b)},c.each=function(a,c,d){var e,f=0,g=a.length,h=b(a);if(d){if(h)for(;g>f&&(e=c.apply(a[f],d),e!==!1);f++);else for(f in a)if(e=c.apply(a[f],d),e===!1)break}else if(h)for(;g>f&&(e=c.call(a[f],f,a[f]),e!==!1);f++);else for(f in a)if(e=c.call(a[f],f,a[f]),e===!1)break;return a},c.data=function(a,b,e){if(void 0===e){var f=a[c.expando],g=f&&d[f];if(void 0===b)return g;if(g&&b in g)return g[b]}else if(void 0!==b){var f=a[c.expando]||(a[c.expando]=++c.uuid);return d[f]=d[f]||{},d[f][b]=e,e}},c.removeData=function(a,b){var e=a[c.expando],f=e&&d[e];f&&c.each(b,function(a,b){delete f[b]})},c.extend=function(){var a,b,d,e,f,g,h=arguments[0]||{},i=1,j=arguments.length,k=!1;for("boolean"==typeof h&&(k=h,h=arguments[i]||{},i++),"object"!=typeof h&&"function"!==c.type(h)&&(h={}),i===j&&(h=this,i--);j>i;i++)if(null!=(f=arguments[i]))for(e in f)a=h[e],d=f[e],h!==d&&(k&&d&&(c.isPlainObject(d)||(b=c.isArray(d)))?(b?(b=!1,g=a&&c.isArray(a)?a:[]):g=a&&c.isPlainObject(a)?a:{},h[e]=c.extend(k,g,d)):void 0!==d&&(h[e]=d));return h},c.queue=function(a,d,e){function f(a,c){var d=c||[];return null!=a&&(b(Object(a))?!function(a,b){for(var c=+b.length,d=0,e=a.length;c>d;)a[e++]=b[d++];if(c!==c)for(;void 0!==b[d];)a[e++]=b[d++];return a.length=e,a}(d,"string"==typeof a?[a]:a):[].push.call(d,a)),d}if(a){d=(d||"fx")+"queue";var g=c.data(a,d);return e?(!g||c.isArray(e)?g=c.data(a,d,f(e)):g.push(e),g):g||[]}},c.dequeue=function(a,b){c.each(a.nodeType?[a]:a,function(a,d){b=b||"fx";var e=c.queue(d,b),f=e.shift();"inprogress"===f&&(f=e.shift()),f&&("fx"===b&&e.unshift("inprogress"),f.call(d,function(){c.dequeue(d,b)}))})},c.fn=c.prototype={init:function(a){if(a.nodeType)return this[0]=a,this;throw new Error("Not a DOM node.")},offset:function(){var b=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:b.top+(a.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:b.left+(a.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function a(){for(var a=this.offsetParent||document;a&&"html"===!a.nodeType.toLowerCase&&"static"===a.style.position;)a=a.offsetParent;return a||document}var b=this[0],a=a.apply(b),d=this.offset(),e=/^(?:body|html)$/i.test(a.nodeName)?{top:0,left:0}:c(a).offset();return d.top-=parseFloat(b.style.marginTop)||0,d.left-=parseFloat(b.style.marginLeft)||0,a.style&&(e.top+=parseFloat(a.style.borderTopWidth)||0,e.left+=parseFloat(a.style.borderLeftWidth)||0),{top:d.top-e.top,left:d.left-e.left}}};var d={};c.expando="velocity"+(new Date).getTime(),c.uuid=0;for(var e={},f=e.hasOwnProperty,g=e.toString,h="Boolean Number String Function Array Date RegExp Object Error".split(" "),i=0;i<h.length;i++)e["[object "+h[i]+"]"]=h[i].toLowerCase();c.fn.init.prototype=c.fn,a.Velocity={Utilities:c}}}(window),function(a){"object"==typeof module&&"object"==typeof module.exports?module.exports=a():"function"==typeof define&&define.amd?define(a):a()}(function(){return function(a,b,c,d){function e(a){for(var b=-1,c=a?a.length:0,d=[];++b<c;){var e=a[b];e&&d.push(e)}return d}function f(a){return p.isWrapped(a)?a=[].slice.call(a):p.isNode(a)&&(a=[a]),a}function g(a){var b=m.data(a,"velocity");return null===b?d:b}function h(a){return function(b){return Math.round(b*a)*(1/a)}}function i(a,c,d,e){function f(a,b){return 1-3*b+3*a}function g(a,b){return 3*b-6*a}function h(a){return 3*a}function i(a,b,c){return((f(b,c)*a+g(b,c))*a+h(b))*a}function j(a,b,c){return 3*f(b,c)*a*a+2*g(b,c)*a+h(b)}function k(b,c){for(var e=0;p>e;++e){var f=j(c,a,d);if(0===f)return c;var g=i(c,a,d)-b;c-=g/f}return c}function l(){for(var b=0;t>b;++b)x[b]=i(b*u,a,d)}function m(b,c,e){var f,g,h=0;do g=c+(e-c)/2,f=i(g,a,d)-b,f>0?e=g:c=g;while(Math.abs(f)>r&&++h<s);return g}function n(b){for(var c=0,e=1,f=t-1;e!=f&&x[e]<=b;++e)c+=u;--e;var g=(b-x[e])/(x[e+1]-x[e]),h=c+g*u,i=j(h,a,d);return i>=q?k(b,h):0==i?h:m(b,c,c+u)}function o(){y=!0,(a!=c||d!=e)&&l()}var p=4,q=.001,r=1e-7,s=10,t=11,u=1/(t-1),v="Float32Array"in b;if(4!==arguments.length)return!1;for(var w=0;4>w;++w)if("number"!=typeof arguments[w]||isNaN(arguments[w])||!isFinite(arguments[w]))return!1;a=Math.min(a,1),d=Math.min(d,1),a=Math.max(a,0),d=Math.max(d,0);var x=v?new Float32Array(t):new Array(t),y=!1,z=function(b){return y||o(),a===c&&d===e?b:0===b?0:1===b?1:i(n(b),c,e)};z.getControlPoints=function(){return[{x:a,y:c},{x:d,y:e}]};var A="generateBezier("+[a,c,d,e]+")";return z.toString=function(){return A},z}function j(a,b){var c=a;return p.isString(a)?t.Easings[a]||(c=!1):c=p.isArray(a)&&1===a.length?h.apply(null,a):p.isArray(a)&&2===a.length?u.apply(null,a.concat([b])):!(!p.isArray(a)||4!==a.length)&&i.apply(null,a),c===!1&&(c=t.Easings[t.defaults.easing]?t.defaults.easing:s),c}function k(a){if(a){var b=(new Date).getTime(),c=t.State.calls.length;c>1e4&&(t.State.calls=e(t.State.calls));for(var f=0;c>f;f++)if(t.State.calls[f]){var h=t.State.calls[f],i=h[0],j=h[2],n=h[3],o=!!n,q=null;n||(n=t.State.calls[f][3]=b-16);for(var r=Math.min((b-n)/j.duration,1),s=0,u=i.length;u>s;s++){var w=i[s],y=w.element;if(g(y)){var z=!1;if(j.display!==d&&null!==j.display&&"none"!==j.display){if("flex"===j.display){var A=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];m.each(A,function(a,b){v.setPropertyValue(y,"display",b)})}v.setPropertyValue(y,"display",j.display)}j.visibility!==d&&"hidden"!==j.visibility&&v.setPropertyValue(y,"visibility",j.visibility);for(var B in w)if("element"!==B){var C,D=w[B],E=p.isString(D.easing)?t.Easings[D.easing]:D.easing;if(1===r)C=D.endValue;else{var F=D.endValue-D.startValue;if(C=D.startValue+F*E(r,j,F),!o&&C===D.currentValue)continue}if(D.currentValue=C,"tween"===B)q=C;else{if(v.Hooks.registered[B]){var G=v.Hooks.getRoot(B),H=g(y).rootPropertyValueCache[G];H&&(D.rootPropertyValue=H)}var I=v.setPropertyValue(y,B,D.currentValue+(0===parseFloat(C)?"":D.unitType),D.rootPropertyValue,D.scrollData);v.Hooks.registered[B]&&(g(y).rootPropertyValueCache[G]=v.Normalizations.registered[G]?v.Normalizations.registered[G]("extract",null,I[1]):I[1]),"transform"===I[0]&&(z=!0)}}j.mobileHA&&g(y).transformCache.translate3d===d&&(g(y).transformCache.translate3d="(0px, 0px, 0px)",z=!0),z&&v.flushTransformCache(y)}}j.display!==d&&"none"!==j.display&&(t.State.calls[f][2].display=!1),j.visibility!==d&&"hidden"!==j.visibility&&(t.State.calls[f][2].visibility=!1),j.progress&&j.progress.call(h[1],h[1],r,Math.max(0,n+j.duration-b),n,q),1===r&&l(f)}}t.State.isTicking&&x(k)}function l(a,b){if(!t.State.calls[a])return!1;for(var c=t.State.calls[a][0],e=t.State.calls[a][1],f=t.State.calls[a][2],h=t.State.calls[a][4],i=!1,j=0,k=c.length;k>j;j++){var l=c[j].element;if(b||f.loop||("none"===f.display&&v.setPropertyValue(l,"display",f.display),"hidden"===f.visibility&&v.setPropertyValue(l,"visibility",f.visibility)),f.loop!==!0&&(m.queue(l)[1]===d||!/\.velocityQueueEntryFlag/i.test(m.queue(l)[1]))&&g(l)){g(l).isAnimating=!1,g(l).rootPropertyValueCache={};var n=!1;m.each(v.Lists.transforms3D,function(a,b){var c=/^scale/.test(b)?1:0,e=g(l).transformCache[b];g(l).transformCache[b]!==d&&new RegExp("^\\("+c+"[^.]").test(e)&&(n=!0,delete g(l).transformCache[b])}),f.mobileHA&&(n=!0,delete g(l).transformCache.translate3d),n&&v.flushTransformCache(l),v.Values.removeClass(l,"velocity-animating")}if(!b&&f.complete&&!f.loop&&j===k-1)try{f.complete.call(e,e)}catch(o){setTimeout(function(){throw o},1)}h&&f.loop!==!0&&h(e),g(l)&&f.loop===!0&&!b&&(m.each(g(l).tweensContainer,function(a,b){/^rotate/.test(a)&&360===parseFloat(b.endValue)&&(b.endValue=0,b.startValue=360),/^backgroundPosition/.test(a)&&100===parseFloat(b.endValue)&&"%"===b.unitType&&(b.endValue=0,b.startValue=100)}),t(l,"reverse",{loop:!0,delay:f.delay})),f.queue!==!1&&m.dequeue(l,f.queue)}t.State.calls[a]=!1;for(var p=0,q=t.State.calls.length;q>p;p++)if(t.State.calls[p]!==!1){i=!0;break}i===!1&&(t.State.isTicking=!1,delete t.State.calls,t.State.calls=[])}var m,n=function(){if(c.documentMode)return c.documentMode;for(var a=7;a>4;a--){var b=c.createElement("div");if(b.innerHTML="<!--[if IE "+a+"]><span></span><![endif]-->",b.getElementsByTagName("span").length)return b=null,a}return d}(),o=function(){var a=0;return b.webkitRequestAnimationFrame||b.mozRequestAnimationFrame||function(b){var c,d=(new Date).getTime();return c=Math.max(0,16-(d-a)),a=d+c,setTimeout(function(){b(d+c)},c)}}(),p={isString:function(a){return"string"==typeof a},isArray:Array.isArray||function(a){return"[object Array]"===Object.prototype.toString.call(a)},isFunction:function(a){return"[object Function]"===Object.prototype.toString.call(a)},isNode:function(a){return a&&a.nodeType},isNodeList:function(a){return"object"==typeof a&&/^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(a))&&a.length!==d&&(0===a.length||"object"==typeof a[0]&&a[0].nodeType>0)},isWrapped:function(a){return a&&(a.jquery||b.Zepto&&b.Zepto.zepto.isZ(a))},isSVG:function(a){return b.SVGElement&&a instanceof b.SVGElement},isEmptyObject:function(a){for(var b in a)return!1;return!0}},q=!1;if(a.fn&&a.fn.jquery?(m=a,q=!0):m=b.Velocity.Utilities,8>=n&&!q)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if(7>=n)return void(jQuery.fn.velocity=jQuery.fn.animate);var r=400,s="swing",t={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:b.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:c.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:m,Redirects:{},Easings:{},Promise:b.Promise,defaults:{queue:"",duration:r,easing:s,begin:d,complete:d,progress:d,display:d,visibility:d,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(a){m.data(a,"velocity",{isSVG:p.isSVG(a),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};b.pageYOffset!==d?(t.State.scrollAnchor=b,t.State.scrollPropertyLeft="pageXOffset",t.State.scrollPropertyTop="pageYOffset"):(t.State.scrollAnchor=c.documentElement||c.body.parentNode||c.body,t.State.scrollPropertyLeft="scrollLeft",t.State.scrollPropertyTop="scrollTop");var u=function(){function a(a){return-a.tension*a.x-a.friction*a.v}function b(b,c,d){var e={x:b.x+d.dx*c,v:b.v+d.dv*c,tension:b.tension,friction:b.friction};return{dx:e.v,dv:a(e)}}function c(c,d){var e={dx:c.v,dv:a(c)},f=b(c,.5*d,e),g=b(c,.5*d,f),h=b(c,d,g),i=1/6*(e.dx+2*(f.dx+g.dx)+h.dx),j=1/6*(e.dv+2*(f.dv+g.dv)+h.dv);return c.x=c.x+i*d,c.v=c.v+j*d,c}return function d(a,b,e){var f,g,h,i={x:-1,v:0,tension:null,friction:null},j=[0],k=0,l=1e-4,m=.016;for(a=parseFloat(a)||500,b=parseFloat(b)||20,e=e||null,i.tension=a,i.friction=b,f=null!==e,f?(k=d(a,b),g=k/e*m):g=m;h=c(h||i,g),j.push(1+h.x),k+=16,Math.abs(h.x)>l&&Math.abs(h.v)>l;);return f?function(a){return j[a*(j.length-1)|0]}:k}}();t.Easings={linear:function(a){return a},swing:function(a){return.5-Math.cos(a*Math.PI)/2},spring:function(a){return 1-Math.cos(4.5*a*Math.PI)*Math.exp(6*-a)}},m.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(a,b){t.Easings[b[0]]=i.apply(null,b[1])});var v=t.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(var a=0;a<v.Lists.colors.length;a++){var b="color"===v.Lists.colors[a]?"0 0 0 1":"255 255 255 1";v.Hooks.templates[v.Lists.colors[a]]=["Red Green Blue Alpha",b]}var c,d,e;if(n)for(c in v.Hooks.templates){d=v.Hooks.templates[c],e=d[0].split(" ");var f=d[1].match(v.RegEx.valueSplit);"Color"===e[0]&&(e.push(e.shift()),f.push(f.shift()),v.Hooks.templates[c]=[e.join(" "),f.join(" ")])}for(c in v.Hooks.templates){d=v.Hooks.templates[c],e=d[0].split(" ");for(var a in e){var g=c+e[a],h=a;v.Hooks.registered[g]=[c,h]}}},getRoot:function(a){var b=v.Hooks.registered[a];return b?b[0]:a},cleanRootPropertyValue:function(a,b){return v.RegEx.valueUnwrap.test(b)&&(b=b.match(v.RegEx.valueUnwrap)[1]),v.Values.isCSSNullValue(b)&&(b=v.Hooks.templates[a][1]),b},extractValue:function(a,b){var c=v.Hooks.registered[a];if(c){var d=c[0],e=c[1];return b=v.Hooks.cleanRootPropertyValue(d,b),b.toString().match(v.RegEx.valueSplit)[e]}return b},injectValue:function(a,b,c){var d=v.Hooks.registered[a];if(d){var e,f,g=d[0],h=d[1];return c=v.Hooks.cleanRootPropertyValue(g,c),e=c.toString().match(v.RegEx.valueSplit),e[h]=b,f=e.join(" ")}return c}},Normalizations:{registered:{clip:function(a,b,c){switch(a){case"name":return"clip";case"extract":var d;return v.RegEx.wrappedValueAlreadyExtracted.test(c)?d=c:(d=c.toString().match(v.RegEx.valueUnwrap),d=d?d[1].replace(/,(\s+)?/g," "):c),d;case"inject":return"rect("+c+")"}},blur:function(a,b,c){switch(a){case"name":return t.State.isFirefox?"filter":"-webkit-filter";case"extract":var d=parseFloat(c);if(!d&&0!==d){var e=c.toString().match(/blur\(([0-9]+[A-z]+)\)/i);d=e?e[1]:0}return d;case"inject":return parseFloat(c)?"blur("+c+")":"none"}},opacity:function(a,b,c){if(8>=n)switch(a){case"name":return"filter";case"extract":var d=c.toString().match(/alpha\(opacity=(.*)\)/i);return c=d?d[1]/100:1;case"inject":return b.style.zoom=1,parseFloat(c)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(c),10)+")"}else switch(a){case"name":return"opacity";case"extract":return c;case"inject":return c}}},register:function(){9>=n||t.State.isGingerbread||(v.Lists.transformsBase=v.Lists.transformsBase.concat(v.Lists.transforms3D));for(var a=0;a<v.Lists.transformsBase.length;a++)!function(){var b=v.Lists.transformsBase[a];v.Normalizations.registered[b]=function(a,c,e){switch(a){case"name":return"transform";case"extract":return g(c)===d||g(c).transformCache[b]===d?/^scale/i.test(b)?1:0:g(c).transformCache[b].replace(/[()]/g,"");case"inject":var f=!1;switch(b.substr(0,b.length-1)){case"translate":f=!/(%|px|em|rem|vw|vh|\d)$/i.test(e);break;case"scal":case"scale":t.State.isAndroid&&g(c).transformCache[b]===d&&1>e&&(e=1),f=!/(\d)$/i.test(e);break;case"skew":f=!/(deg|\d)$/i.test(e);break;case"rotate":f=!/(deg|\d)$/i.test(e)}return f||(g(c).transformCache[b]="("+e+")"),g(c).transformCache[b]}}}();for(var a=0;a<v.Lists.colors.length;a++)!function(){var b=v.Lists.colors[a];v.Normalizations.registered[b]=function(a,c,e){switch(a){case"name":return b;case"extract":var f;if(v.RegEx.wrappedValueAlreadyExtracted.test(e))f=e;else{var g,h={black:"rgb(0, 0, 0)",blue:"rgb(0, 0, 255)",gray:"rgb(128, 128, 128)",green:"rgb(0, 128, 0)",red:"rgb(255, 0, 0)",white:"rgb(255, 255, 255)"};/^[A-z]+$/i.test(e)?g=h[e]!==d?h[e]:h.black:v.RegEx.isHex.test(e)?g="rgb("+v.Values.hexToRgb(e).join(" ")+")":/^rgba?\(/i.test(e)||(g=h.black),f=(g||e).toString().match(v.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g," ")}return 8>=n||3!==f.split(" ").length||(f+=" 1"),f;case"inject":return 8>=n?4===e.split(" ").length&&(e=e.split(/\s+/).slice(0,3).join(" ")):3===e.split(" ").length&&(e+=" 1"),(8>=n?"rgb":"rgba")+"("+e.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(a){return a.replace(/-(\w)/g,function(a,b){return b.toUpperCase()})},SVGAttribute:function(a){var b="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(n||t.State.isAndroid&&!t.State.isChrome)&&(b+="|transform"),new RegExp("^("+b+")$","i").test(a)},prefixCheck:function(a){if(t.State.prefixMatches[a])return[t.State.prefixMatches[a],!0];for(var b=["","Webkit","Moz","ms","O"],c=0,d=b.length;d>c;c++){var e;if(e=0===c?a:b[c]+a.replace(/^\w/,function(a){return a.toUpperCase()}),p.isString(t.State.prefixElement.style[e]))return t.State.prefixMatches[a]=e,[e,!0]}return[a,!1]}},Values:{hexToRgb:function(a){var b,c=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,d=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return a=a.replace(c,function(a,b,c,d){return b+b+c+c+d+d}),b=d.exec(a),b?[parseInt(b[1],16),parseInt(b[2],16),parseInt(b[3],16)]:[0,0,0]},isCSSNullValue:function(a){return 0==a||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(a)},getUnitType:function(a){return/^(rotate|skew)/i.test(a)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(a)?"":"px"},getDisplayType:function(a){var b=a&&a.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(b)?"inline":/^(li)$/i.test(b)?"list-item":/^(tr)$/i.test(b)?"table-row":/^(table)$/i.test(b)?"table":/^(tbody)$/i.test(b)?"table-row-group":"block"},addClass:function(a,b){a.classList?a.classList.add(b):a.className+=(a.className.length?" ":"")+b},removeClass:function(a,b){a.classList?a.classList.remove(b):a.className=a.className.toString().replace(new RegExp("(^|\\s)"+b.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(a,c,e,f){function h(a,c){function e(){j&&v.setPropertyValue(a,"display","none")}var i=0;if(8>=n)i=m.css(a,c);else{var j=!1;if(/^(width|height)$/.test(c)&&0===v.getPropertyValue(a,"display")&&(j=!0,v.setPropertyValue(a,"display",v.Values.getDisplayType(a))),!f){if("height"===c&&"border-box"!==v.getPropertyValue(a,"boxSizing").toString().toLowerCase()){var k=a.offsetHeight-(parseFloat(v.getPropertyValue(a,"borderTopWidth"))||0)-(parseFloat(v.getPropertyValue(a,"borderBottomWidth"))||0)-(parseFloat(v.getPropertyValue(a,"paddingTop"))||0)-(parseFloat(v.getPropertyValue(a,"paddingBottom"))||0);return e(),k}if("width"===c&&"border-box"!==v.getPropertyValue(a,"boxSizing").toString().toLowerCase()){var l=a.offsetWidth-(parseFloat(v.getPropertyValue(a,"borderLeftWidth"))||0)-(parseFloat(v.getPropertyValue(a,"borderRightWidth"))||0)-(parseFloat(v.getPropertyValue(a,"paddingLeft"))||0)-(parseFloat(v.getPropertyValue(a,"paddingRight"))||0);return e(),l}}var o;o=g(a)===d?b.getComputedStyle(a,null):g(a).computedStyle?g(a).computedStyle:g(a).computedStyle=b.getComputedStyle(a,null),"borderColor"===c&&(c="borderTopColor"),i=9===n&&"filter"===c?o.getPropertyValue(c):o[c],(""===i||null===i)&&(i=a.style[c]),e()}if("auto"===i&&/^(top|right|bottom|left)$/i.test(c)){var p=h(a,"position");("fixed"===p||"absolute"===p&&/top|left/i.test(c))&&(i=m(a).position()[c]+"px")}return i}var i;if(v.Hooks.registered[c]){var j=c,k=v.Hooks.getRoot(j);e===d&&(e=v.getPropertyValue(a,v.Names.prefixCheck(k)[0])),v.Normalizations.registered[k]&&(e=v.Normalizations.registered[k]("extract",a,e)),i=v.Hooks.extractValue(j,e)}else if(v.Normalizations.registered[c]){var l,o;l=v.Normalizations.registered[c]("name",a),"transform"!==l&&(o=h(a,v.Names.prefixCheck(l)[0]),v.Values.isCSSNullValue(o)&&v.Hooks.templates[c]&&(o=v.Hooks.templates[c][1])),i=v.Normalizations.registered[c]("extract",a,o)}if(!/^[\d-]/.test(i))if(g(a)&&g(a).isSVG&&v.Names.SVGAttribute(c))if(/^(height|width)$/i.test(c))try{i=a.getBBox()[c]}catch(p){i=0}else i=a.getAttribute(c);else i=h(a,v.Names.prefixCheck(c)[0]);return v.Values.isCSSNullValue(i)&&(i=0),t.debug>=2&&console.log("Get "+c+": "+i),i},setPropertyValue:function(a,c,d,e,f){var h=c;if("scroll"===c)f.container?f.container["scroll"+f.direction]=d:"Left"===f.direction?b.scrollTo(d,f.alternateValue):b.scrollTo(f.alternateValue,d);else if(v.Normalizations.registered[c]&&"transform"===v.Normalizations.registered[c]("name",a))v.Normalizations.registered[c]("inject",a,d),h="transform",d=g(a).transformCache[c];else{if(v.Hooks.registered[c]){var i=c,j=v.Hooks.getRoot(c);e=e||v.getPropertyValue(a,j),d=v.Hooks.injectValue(i,d,e),c=j}if(v.Normalizations.registered[c]&&(d=v.Normalizations.registered[c]("inject",a,d),c=v.Normalizations.registered[c]("name",a)),h=v.Names.prefixCheck(c)[0],8>=n)try{a.style[h]=d}catch(k){t.debug&&console.log("Browser does not support ["+d+"] for ["+h+"]")}else g(a)&&g(a).isSVG&&v.Names.SVGAttribute(c)?a.setAttribute(c,d):a.style[h]=d;t.debug>=2&&console.log("Set "+c+" ("+h+"): "+d)}return[h,d]},flushTransformCache:function(a){function b(b){return parseFloat(v.getPropertyValue(a,b))}var c="";if((n||t.State.isAndroid&&!t.State.isChrome)&&g(a).isSVG){var d={translate:[b("translateX"),b("translateY")],skewX:[b("skewX")],skewY:[b("skewY")],scale:1!==b("scale")?[b("scale"),b("scale")]:[b("scaleX"),b("scaleY")],rotate:[b("rotateZ"),0,0]};m.each(g(a).transformCache,function(a){/^translate/i.test(a)?a="translate":/^scale/i.test(a)?a="scale":/^rotate/i.test(a)&&(a="rotate"),d[a]&&(c+=a+"("+d[a].join(" ")+") ",delete d[a])})}else{var e,f;m.each(g(a).transformCache,function(b){return e=g(a).transformCache[b],"transformPerspective"===b?(f=e,!0):(9===n&&"rotateZ"===b&&(b="rotate"),void(c+=b+e+" "))}),f&&(c="perspective"+f+" "+c)}v.setPropertyValue(a,"transform",c)}};v.Hooks.register(),v.Normalizations.register(),t.hook=function(a,b,c){var e=d;return a=f(a),m.each(a,function(a,f){if(g(f)===d&&t.init(f),c===d)e===d&&(e=t.CSS.getPropertyValue(f,b));else{var h=t.CSS.setPropertyValue(f,b,c);"transform"===h[0]&&t.CSS.flushTransformCache(f),e=h}}),e};var w=function(){function a(){return h?B.promise||null:i}function e(){function a(a){function l(a,b){var c=d,e=d,g=d;return p.isArray(a)?(c=a[0],!p.isArray(a[1])&&/^[\d-]/.test(a[1])||p.isFunction(a[1])||v.RegEx.isHex.test(a[1])?g=a[1]:(p.isString(a[1])&&!v.RegEx.isHex.test(a[1])||p.isArray(a[1]))&&(e=b?a[1]:j(a[1],h.duration),a[2]!==d&&(g=a[2]))):c=a,b||(e=e||h.easing),p.isFunction(c)&&(c=c.call(f,y,x)),p.isFunction(g)&&(g=g.call(f,y,x)),[c||0,e,g]}function n(a,b){var c,d;return d=(b||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(a){return c=a,""}),c||(c=v.Values.getUnitType(a)),[d,c]}function r(){var a={myParent:f.parentNode||c.body,position:v.getPropertyValue(f,"position"),fontSize:v.getPropertyValue(f,"fontSize")},d=a.position===I.lastPosition&&a.myParent===I.lastParent,e=a.fontSize===I.lastFontSize;I.lastParent=a.myParent,I.lastPosition=a.position,I.lastFontSize=a.fontSize;var h=100,i={};if(e&&d)i.emToPx=I.lastEmToPx,i.percentToPxWidth=I.lastPercentToPxWidth,i.percentToPxHeight=I.lastPercentToPxHeight;else{var j=g(f).isSVG?c.createElementNS("http://www.w3.org/2000/svg","rect"):c.createElement("div");t.init(j),a.myParent.appendChild(j),m.each(["overflow","overflowX","overflowY"],function(a,b){t.CSS.setPropertyValue(j,b,"hidden")}),t.CSS.setPropertyValue(j,"position",a.position),t.CSS.setPropertyValue(j,"fontSize",a.fontSize),t.CSS.setPropertyValue(j,"boxSizing","content-box"),m.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(a,b){t.CSS.setPropertyValue(j,b,h+"%")}),t.CSS.setPropertyValue(j,"paddingLeft",h+"em"),i.percentToPxWidth=I.lastPercentToPxWidth=(parseFloat(v.getPropertyValue(j,"width",null,!0))||1)/h,i.percentToPxHeight=I.lastPercentToPxHeight=(parseFloat(v.getPropertyValue(j,"height",null,!0))||1)/h,i.emToPx=I.lastEmToPx=(parseFloat(v.getPropertyValue(j,"paddingLeft"))||1)/h,a.myParent.removeChild(j)}return null===I.remToPx&&(I.remToPx=parseFloat(v.getPropertyValue(c.body,"fontSize"))||16),null===I.vwToPx&&(I.vwToPx=parseFloat(b.innerWidth)/100,I.vhToPx=parseFloat(b.innerHeight)/100),i.remToPx=I.remToPx,i.vwToPx=I.vwToPx,i.vhToPx=I.vhToPx,t.debug>=1&&console.log("Unit ratios: "+JSON.stringify(i),f),i}if(h.begin&&0===y)try{h.begin.call(o,o)}catch(u){setTimeout(function(){throw u},1)}if("scroll"===C){var w,z,A,D=/^x$/i.test(h.axis)?"Left":"Top",E=parseFloat(h.offset)||0;h.container?p.isWrapped(h.container)||p.isNode(h.container)?(h.container=h.container[0]||h.container,w=h.container["scroll"+D],A=w+m(f).position()[D.toLowerCase()]+E):h.container=null:(w=t.State.scrollAnchor[t.State["scrollProperty"+D]],z=t.State.scrollAnchor[t.State["scrollProperty"+("Left"===D?"Top":"Left")]],A=m(f).offset()[D.toLowerCase()]+E),i={scroll:{rootPropertyValue:!1,startValue:w,currentValue:w,endValue:A,unitType:"",easing:h.easing,scrollData:{container:h.container,direction:D,alternateValue:z}},element:f},t.debug&&console.log("tweensContainer (scroll): ",i.scroll,f)}else if("reverse"===C){if(!g(f).tweensContainer)return void m.dequeue(f,h.queue);"none"===g(f).opts.display&&(g(f).opts.display="auto"),"hidden"===g(f).opts.visibility&&(g(f).opts.visibility="visible"),g(f).opts.loop=!1,g(f).opts.begin=null,g(f).opts.complete=null,s.easing||delete h.easing,s.duration||delete h.duration,h=m.extend({},g(f).opts,h);var F=m.extend(!0,{},g(f).tweensContainer);for(var G in F)if("element"!==G){var H=F[G].startValue;F[G].startValue=F[G].currentValue=F[G].endValue,F[G].endValue=H,p.isEmptyObject(s)||(F[G].easing=h.easing),t.debug&&console.log("reverse tweensContainer ("+G+"): "+JSON.stringify(F[G]),f)}i=F}else if("start"===C){var F;g(f).tweensContainer&&g(f).isAnimating===!0&&(F=g(f).tweensContainer),m.each(q,function(a,b){if(RegExp("^"+v.Lists.colors.join("$|^")+"$").test(a)){var c=l(b,!0),e=c[0],f=c[1],g=c[2];if(v.RegEx.isHex.test(e)){for(var h=["Red","Green","Blue"],i=v.Values.hexToRgb(e),j=g?v.Values.hexToRgb(g):d,k=0;k<h.length;k++){var m=[i[k]];f&&m.push(f),j!==d&&m.push(j[k]),q[a+h[k]]=m}delete q[a]}}});for(var K in q){var L=l(q[K]),M=L[0],N=L[1],O=L[2];K=v.Names.camelCase(K);var P=v.Hooks.getRoot(K),Q=!1;if(g(f).isSVG||"tween"===P||v.Names.prefixCheck(P)[1]!==!1||v.Normalizations.registered[P]!==d){(h.display!==d&&null!==h.display&&"none"!==h.display||h.visibility!==d&&"hidden"!==h.visibility)&&/opacity|filter/.test(K)&&!O&&0!==M&&(O=0),h._cacheValues&&F&&F[K]?(O===d&&(O=F[K].endValue+F[K].unitType),Q=g(f).rootPropertyValueCache[P]):v.Hooks.registered[K]?O===d?(Q=v.getPropertyValue(f,P),O=v.getPropertyValue(f,K,Q)):Q=v.Hooks.templates[P][1]:O===d&&(O=v.getPropertyValue(f,K));var R,S,T,U=!1;if(R=n(K,O),O=R[0],T=R[1],R=n(K,M),M=R[0].replace(/^([+-\/*])=/,function(a,b){return U=b,""}),S=R[1],O=parseFloat(O)||0,M=parseFloat(M)||0,"%"===S&&(/^(fontSize|lineHeight)$/.test(K)?(M/=100,S="em"):/^scale/.test(K)?(M/=100,S=""):/(Red|Green|Blue)$/i.test(K)&&(M=M/100*255,S="")),/[\/*]/.test(U))S=T;else if(T!==S&&0!==O)if(0===M)S=T;else{e=e||r();var V=/margin|padding|left|right|width|text|word|letter/i.test(K)||/X$/.test(K)||"x"===K?"x":"y";
+switch(T){case"%":O*="x"===V?e.percentToPxWidth:e.percentToPxHeight;break;case"px":break;default:O*=e[T+"ToPx"]}switch(S){case"%":O*=1/("x"===V?e.percentToPxWidth:e.percentToPxHeight);break;case"px":break;default:O*=1/e[S+"ToPx"]}}switch(U){case"+":M=O+M;break;case"-":M=O-M;break;case"*":M=O*M;break;case"/":M=O/M}i[K]={rootPropertyValue:Q,startValue:O,currentValue:O,endValue:M,unitType:S,easing:N},t.debug&&console.log("tweensContainer ("+K+"): "+JSON.stringify(i[K]),f)}else t.debug&&console.log("Skipping ["+P+"] due to a lack of browser support.")}i.element=f}i.element&&(v.Values.addClass(f,"velocity-animating"),J.push(i),""===h.queue&&(g(f).tweensContainer=i,g(f).opts=h),g(f).isAnimating=!0,y===x-1?(t.State.calls.push([J,o,h,null,B.resolver]),t.State.isTicking===!1&&(t.State.isTicking=!0,k())):y++)}var e,f=this,h=m.extend({},t.defaults,s),i={};switch(g(f)===d&&t.init(f),parseFloat(h.delay)&&h.queue!==!1&&m.queue(f,h.queue,function(a){t.velocityQueueEntryFlag=!0,g(f).delayTimer={setTimeout:setTimeout(a,parseFloat(h.delay)),next:a}}),h.duration.toString().toLowerCase()){case"fast":h.duration=200;break;case"normal":h.duration=r;break;case"slow":h.duration=600;break;default:h.duration=parseFloat(h.duration)||1}t.mock!==!1&&(t.mock===!0?h.duration=h.delay=1:(h.duration*=parseFloat(t.mock)||1,h.delay*=parseFloat(t.mock)||1)),h.easing=j(h.easing,h.duration),h.begin&&!p.isFunction(h.begin)&&(h.begin=null),h.progress&&!p.isFunction(h.progress)&&(h.progress=null),h.complete&&!p.isFunction(h.complete)&&(h.complete=null),h.display!==d&&null!==h.display&&(h.display=h.display.toString().toLowerCase(),"auto"===h.display&&(h.display=t.CSS.Values.getDisplayType(f))),h.visibility!==d&&null!==h.visibility&&(h.visibility=h.visibility.toString().toLowerCase()),h.mobileHA=h.mobileHA&&t.State.isMobile&&!t.State.isGingerbread,h.queue===!1?h.delay?setTimeout(a,h.delay):a():m.queue(f,h.queue,function(b,c){return c===!0?(B.promise&&B.resolver(o),!0):(t.velocityQueueEntryFlag=!0,void a(b))}),""!==h.queue&&"fx"!==h.queue||"inprogress"===m.queue(f)[0]||m.dequeue(f)}var h,i,n,o,q,s,u=arguments[0]&&(arguments[0].p||m.isPlainObject(arguments[0].properties)&&!arguments[0].properties.names||p.isString(arguments[0].properties));if(p.isWrapped(this)?(h=!1,n=0,o=this,i=this):(h=!0,n=1,o=u?arguments[0].elements||arguments[0].e:arguments[0]),o=f(o)){u?(q=arguments[0].properties||arguments[0].p,s=arguments[0].options||arguments[0].o):(q=arguments[n],s=arguments[n+1]);var x=o.length,y=0;if(!/^(stop|finish)$/i.test(q)&&!m.isPlainObject(s)){var z=n+1;s={};for(var A=z;A<arguments.length;A++)p.isArray(arguments[A])||!/^(fast|normal|slow)$/i.test(arguments[A])&&!/^\d/.test(arguments[A])?p.isString(arguments[A])||p.isArray(arguments[A])?s.easing=arguments[A]:p.isFunction(arguments[A])&&(s.complete=arguments[A]):s.duration=arguments[A]}var B={promise:null,resolver:null,rejecter:null};h&&t.Promise&&(B.promise=new t.Promise(function(a,b){B.resolver=a,B.rejecter=b}));var C;switch(q){case"scroll":C="scroll";break;case"reverse":C="reverse";break;case"finish":case"stop":m.each(o,function(a,b){g(b)&&g(b).delayTimer&&(clearTimeout(g(b).delayTimer.setTimeout),g(b).delayTimer.next&&g(b).delayTimer.next(),delete g(b).delayTimer)});var D=[];return m.each(t.State.calls,function(a,b){b&&m.each(b[1],function(c,e){var f=s===d?"":s;return f!==!0&&b[2].queue!==f&&(s!==d||b[2].queue!==!1)||void m.each(o,function(c,d){d===e&&((s===!0||p.isString(s))&&(m.each(m.queue(d,p.isString(s)?s:""),function(a,b){p.isFunction(b)&&b(null,!0)}),m.queue(d,p.isString(s)?s:"",[])),"stop"===q?(g(d)&&g(d).tweensContainer&&f!==!1&&m.each(g(d).tweensContainer,function(a,b){b.endValue=b.currentValue}),D.push(a)):"finish"===q&&(b[2].duration=1))})})}),"stop"===q&&(m.each(D,function(a,b){l(b,!0)}),B.promise&&B.resolver(o)),a();default:if(!m.isPlainObject(q)||p.isEmptyObject(q)){if(p.isString(q)&&t.Redirects[q]){var E=m.extend({},s),F=E.duration,G=E.delay||0;return E.backwards===!0&&(o=m.extend(!0,[],o).reverse()),m.each(o,function(a,b){parseFloat(E.stagger)?E.delay=G+parseFloat(E.stagger)*a:p.isFunction(E.stagger)&&(E.delay=G+E.stagger.call(b,a,x)),E.drag&&(E.duration=parseFloat(F)||(/^(callout|transition)/.test(q)?1e3:r),E.duration=Math.max(E.duration*(E.backwards?1-a/x:(a+1)/x),.75*E.duration,200)),t.Redirects[q].call(b,b,E||{},a,x,o,B.promise?B:d)}),a()}var H="Velocity: First argument ("+q+") was not a property map, a known action, or a registered redirect. Aborting.";return B.promise?B.rejecter(new Error(H)):console.log(H),a()}C="start"}var I={lastParent:null,lastPosition:null,lastFontSize:null,lastPercentToPxWidth:null,lastPercentToPxHeight:null,lastEmToPx:null,remToPx:null,vwToPx:null,vhToPx:null},J=[];m.each(o,function(a,b){p.isNode(b)&&e.call(b)});var K,E=m.extend({},t.defaults,s);if(E.loop=parseInt(E.loop),K=2*E.loop-1,E.loop)for(var L=0;K>L;L++){var M={delay:E.delay,progress:E.progress};L===K-1&&(M.display=E.display,M.visibility=E.visibility,M.complete=E.complete),w(o,"reverse",M)}return a()}};t=m.extend(w,t),t.animate=w;var x=b.requestAnimationFrame||o;return t.State.isMobile||c.hidden===d||c.addEventListener("visibilitychange",function(){c.hidden?(x=function(a){return setTimeout(function(){a(!0)},16)},k()):x=b.requestAnimationFrame||o}),a.Velocity=t,a!==b&&(a.fn.velocity=w,a.fn.velocity.defaults=t.defaults),m.each(["Down","Up"],function(a,b){t.Redirects["slide"+b]=function(a,c,e,f,g,h){var i=m.extend({},c),j=i.begin,k=i.complete,l={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},n={};i.display===d&&(i.display="Down"===b?"inline"===t.CSS.Values.getDisplayType(a)?"inline-block":"block":"none"),i.begin=function(){j&&j.call(g,g);for(var c in l){n[c]=a.style[c];var d=t.CSS.getPropertyValue(a,c);l[c]="Down"===b?[d,0]:[0,d]}n.overflow=a.style.overflow,a.style.overflow="hidden"},i.complete=function(){for(var b in n)a.style[b]=n[b];k&&k.call(g,g),h&&h.resolver(g)},t(a,l,i)}}),m.each(["In","Out"],function(a,b){t.Redirects["fade"+b]=function(a,c,e,f,g,h){var i=m.extend({},c),j={opacity:"In"===b?1:0},k=i.complete;i.complete=e!==f-1?i.begin=null:function(){k&&k.call(g,g),h&&h.resolver(g)},i.display===d&&(i.display="In"===b?"auto":"none"),t(this,j,i)}}),t}(window.jQuery||window.Zepto||window,window,document)})),!function(a,b,c,d){"use strict";function e(a,b,c){return setTimeout(k(a,c),b)}function f(a,b,c){return!!Array.isArray(a)&&(g(a,c[b],c),!0)}function g(a,b,c){var e;if(a)if(a.forEach)a.forEach(b,c);else if(a.length!==d)for(e=0;e<a.length;)b.call(c,a[e],e,a),e++;else for(e in a)a.hasOwnProperty(e)&&b.call(c,a[e],e,a)}function h(a,b,c){for(var e=Object.keys(b),f=0;f<e.length;)(!c||c&&a[e[f]]===d)&&(a[e[f]]=b[e[f]]),f++;return a}function i(a,b){return h(a,b,!0)}function j(a,b,c){var d,e=b.prototype;d=a.prototype=Object.create(e),d.constructor=a,d._super=e,c&&h(d,c)}function k(a,b){return function(){return a.apply(b,arguments)}}function l(a,b){return typeof a==ka?a.apply(b?b[0]||d:d,b):a}function m(a,b){return a===d?b:a}function n(a,b,c){g(r(b),function(b){a.addEventListener(b,c,!1)})}function o(a,b,c){g(r(b),function(b){a.removeEventListener(b,c,!1)})}function p(a,b){for(;a;){if(a==b)return!0;a=a.parentNode}return!1}function q(a,b){return a.indexOf(b)>-1}function r(a){return a.trim().split(/\s+/g)}function s(a,b,c){if(a.indexOf&&!c)return a.indexOf(b);for(var d=0;d<a.length;){if(c&&a[d][c]==b||!c&&a[d]===b)return d;d++}return-1}function t(a){return Array.prototype.slice.call(a,0)}function u(a,b,c){for(var d=[],e=[],f=0;f<a.length;){var g=b?a[f][b]:a[f];s(e,g)<0&&d.push(a[f]),e[f]=g,f++}return c&&(d=b?d.sort(function(a,c){return a[b]>c[b]}):d.sort()),d}function v(a,b){for(var c,e,f=b[0].toUpperCase()+b.slice(1),g=0;g<ia.length;){if(c=ia[g],e=c?c+f:b,e in a)return e;g++}return d}function w(){return oa++}function x(a){var b=a.ownerDocument;return b.defaultView||b.parentWindow}function y(a,b){var c=this;this.manager=a,this.callback=b,this.element=a.element,this.target=a.options.inputTarget,this.domHandler=function(b){l(a.options.enable,[a])&&c.handler(b)},this.init()}function z(a){var b,c=a.options.inputClass;return new(b=c?c:ra?N:sa?Q:qa?S:M)(a,A)}function A(a,b,c){var d=c.pointers.length,e=c.changedPointers.length,f=b&ya&&0===d-e,g=b&(Aa|Ba)&&0===d-e;c.isFirst=!!f,c.isFinal=!!g,f&&(a.session={}),c.eventType=b,B(a,c),a.emit("hammer.input",c),a.recognize(c),a.session.prevInput=c}function B(a,b){var c=a.session,d=b.pointers,e=d.length;c.firstInput||(c.firstInput=E(b)),e>1&&!c.firstMultiple?c.firstMultiple=E(b):1===e&&(c.firstMultiple=!1);var f=c.firstInput,g=c.firstMultiple,h=g?g.center:f.center,i=b.center=F(d);b.timeStamp=na(),b.deltaTime=b.timeStamp-f.timeStamp,b.angle=J(h,i),b.distance=I(h,i),C(c,b),b.offsetDirection=H(b.deltaX,b.deltaY),b.scale=g?L(g.pointers,d):1,b.rotation=g?K(g.pointers,d):0,D(c,b);var j=a.element;p(b.srcEvent.target,j)&&(j=b.srcEvent.target),b.target=j}function C(a,b){var c=b.center,d=a.offsetDelta||{},e=a.prevDelta||{},f=a.prevInput||{};(b.eventType===ya||f.eventType===Aa)&&(e=a.prevDelta={x:f.deltaX||0,y:f.deltaY||0},d=a.offsetDelta={x:c.x,y:c.y}),b.deltaX=e.x+(c.x-d.x),b.deltaY=e.y+(c.y-d.y)}function D(a,b){var c,e,f,g,h=a.lastInterval||b,i=b.timeStamp-h.timeStamp;if(b.eventType!=Ba&&(i>xa||h.velocity===d)){var j=h.deltaX-b.deltaX,k=h.deltaY-b.deltaY,l=G(i,j,k);e=l.x,f=l.y,c=ma(l.x)>ma(l.y)?l.x:l.y,g=H(j,k),a.lastInterval=b}else c=h.velocity,e=h.velocityX,f=h.velocityY,g=h.direction;b.velocity=c,b.velocityX=e,b.velocityY=f,b.direction=g}function E(a){for(var b=[],c=0;c<a.pointers.length;)b[c]={clientX:la(a.pointers[c].clientX),clientY:la(a.pointers[c].clientY)},c++;return{timeStamp:na(),pointers:b,center:F(b),deltaX:a.deltaX,deltaY:a.deltaY}}function F(a){var b=a.length;if(1===b)return{x:la(a[0].clientX),y:la(a[0].clientY)};for(var c=0,d=0,e=0;b>e;)c+=a[e].clientX,d+=a[e].clientY,e++;return{x:la(c/b),y:la(d/b)}}function G(a,b,c){return{x:b/a||0,y:c/a||0}}function H(a,b){return a===b?Ca:ma(a)>=ma(b)?a>0?Da:Ea:b>0?Fa:Ga}function I(a,b,c){c||(c=Ka);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return Math.sqrt(d*d+e*e)}function J(a,b,c){c||(c=Ka);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return 180*Math.atan2(e,d)/Math.PI}function K(a,b){return J(b[1],b[0],La)-J(a[1],a[0],La)}function L(a,b){return I(b[0],b[1],La)/I(a[0],a[1],La)}function M(){this.evEl=Na,this.evWin=Oa,this.allow=!0,this.pressed=!1,y.apply(this,arguments)}function N(){this.evEl=Ra,this.evWin=Sa,y.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function O(){this.evTarget=Ua,this.evWin=Va,this.started=!1,y.apply(this,arguments)}function P(a,b){var c=t(a.touches),d=t(a.changedTouches);return b&(Aa|Ba)&&(c=u(c.concat(d),"identifier",!0)),[c,d]}function Q(){this.evTarget=Xa,this.targetIds={},y.apply(this,arguments)}function R(a,b){var c=t(a.touches),d=this.targetIds;if(b&(ya|za)&&1===c.length)return d[c[0].identifier]=!0,[c,c];var e,f,g=t(a.changedTouches),h=[],i=this.target;if(f=c.filter(function(a){return p(a.target,i)}),b===ya)for(e=0;e<f.length;)d[f[e].identifier]=!0,e++;for(e=0;e<g.length;)d[g[e].identifier]&&h.push(g[e]),b&(Aa|Ba)&&delete d[g[e].identifier],e++;return h.length?[u(f.concat(h),"identifier",!0),h]:void 0}function S(){y.apply(this,arguments);var a=k(this.handler,this);this.touch=new Q(this.manager,a),this.mouse=new M(this.manager,a)}function T(a,b){this.manager=a,this.set(b)}function U(a){if(q(a,bb))return bb;var b=q(a,cb),c=q(a,db);return b&&c?cb+" "+db:b||c?b?cb:db:q(a,ab)?ab:_a}function V(a){this.id=w(),this.manager=null,this.options=i(a||{},this.defaults),this.options.enable=m(this.options.enable,!0),this.state=eb,this.simultaneous={},this.requireFail=[]}function W(a){return a&jb?"cancel":a&hb?"end":a&gb?"move":a&fb?"start":""}function X(a){return a==Ga?"down":a==Fa?"up":a==Da?"left":a==Ea?"right":""}function Y(a,b){var c=b.manager;return c?c.get(a):a}function Z(){V.apply(this,arguments)}function $(){Z.apply(this,arguments),this.pX=null,this.pY=null}function _(){Z.apply(this,arguments)}function aa(){V.apply(this,arguments),this._timer=null,this._input=null}function ba(){Z.apply(this,arguments)}function ca(){Z.apply(this,arguments)}function da(){V.apply(this,arguments),this.pTime=!1,this.pCenter=!1,this._timer=null,this._input=null,this.count=0}function ea(a,b){return b=b||{},b.recognizers=m(b.recognizers,ea.defaults.preset),new fa(a,b)}function fa(a,b){b=b||{},this.options=i(b,ea.defaults),this.options.inputTarget=this.options.inputTarget||a,this.handlers={},this.session={},this.recognizers=[],this.element=a,this.input=z(this),this.touchAction=new T(this,this.options.touchAction),ga(this,!0),g(b.recognizers,function(a){var b=this.add(new a[0](a[1]));a[2]&&b.recognizeWith(a[2]),a[3]&&b.requireFailure(a[3])},this)}function ga(a,b){var c=a.element;g(a.options.cssProps,function(a,d){c.style[v(c.style,d)]=b?a:""})}function ha(a,c){var d=b.createEvent("Event");d.initEvent(a,!0,!0),d.gesture=c,c.target.dispatchEvent(d)}var ia=["","webkit","moz","MS","ms","o"],ja=b.createElement("div"),ka="function",la=Math.round,ma=Math.abs,na=Date.now,oa=1,pa=/mobile|tablet|ip(ad|hone|od)|android/i,qa="ontouchstart"in a,ra=v(a,"PointerEvent")!==d,sa=qa&&pa.test(navigator.userAgent),ta="touch",ua="pen",va="mouse",wa="kinect",xa=25,ya=1,za=2,Aa=4,Ba=8,Ca=1,Da=2,Ea=4,Fa=8,Ga=16,Ha=Da|Ea,Ia=Fa|Ga,Ja=Ha|Ia,Ka=["x","y"],La=["clientX","clientY"];y.prototype={handler:function(){},init:function(){this.evEl&&n(this.element,this.evEl,this.domHandler),this.evTarget&&n(this.target,this.evTarget,this.domHandler),this.evWin&&n(x(this.element),this.evWin,this.domHandler)},destroy:function(){this.evEl&&o(this.element,this.evEl,this.domHandler),this.evTarget&&o(this.target,this.evTarget,this.domHandler),this.evWin&&o(x(this.element),this.evWin,this.domHandler)}};var Ma={mousedown:ya,mousemove:za,mouseup:Aa},Na="mousedown",Oa="mousemove mouseup";j(M,y,{handler:function(a){var b=Ma[a.type];b&ya&&0===a.button&&(this.pressed=!0),b&za&&1!==a.which&&(b=Aa),this.pressed&&this.allow&&(b&Aa&&(this.pressed=!1),this.callback(this.manager,b,{pointers:[a],changedPointers:[a],pointerType:va,srcEvent:a}))}});var Pa={pointerdown:ya,pointermove:za,pointerup:Aa,pointercancel:Ba,pointerout:Ba},Qa={2:ta,3:ua,4:va,5:wa},Ra="pointerdown",Sa="pointermove pointerup pointercancel";a.MSPointerEvent&&(Ra="MSPointerDown",Sa="MSPointerMove MSPointerUp MSPointerCancel"),j(N,y,{handler:function(a){var b=this.store,c=!1,d=a.type.toLowerCase().replace("ms",""),e=Pa[d],f=Qa[a.pointerType]||a.pointerType,g=f==ta,h=s(b,a.pointerId,"pointerId");e&ya&&(0===a.button||g)?0>h&&(b.push(a),h=b.length-1):e&(Aa|Ba)&&(c=!0),0>h||(b[h]=a,this.callback(this.manager,e,{pointers:b,changedPointers:[a],pointerType:f,srcEvent:a}),c&&b.splice(h,1))}});var Ta={touchstart:ya,touchmove:za,touchend:Aa,touchcancel:Ba},Ua="touchstart",Va="touchstart touchmove touchend touchcancel";j(O,y,{handler:function(a){var b=Ta[a.type];if(b===ya&&(this.started=!0),this.started){var c=P.call(this,a,b);b&(Aa|Ba)&&0===c[0].length-c[1].length&&(this.started=!1),this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:ta,srcEvent:a})}}});var Wa={touchstart:ya,touchmove:za,touchend:Aa,touchcancel:Ba},Xa="touchstart touchmove touchend touchcancel";j(Q,y,{handler:function(a){var b=Wa[a.type],c=R.call(this,a,b);c&&this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:ta,srcEvent:a})}}),j(S,y,{handler:function(a,b,c){var d=c.pointerType==ta,e=c.pointerType==va;if(d)this.mouse.allow=!1;else if(e&&!this.mouse.allow)return;b&(Aa|Ba)&&(this.mouse.allow=!0),this.callback(a,b,c)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Ya=v(ja.style,"touchAction"),Za=Ya!==d,$a="compute",_a="auto",ab="manipulation",bb="none",cb="pan-x",db="pan-y";T.prototype={set:function(a){a==$a&&(a=this.compute()),Za&&(this.manager.element.style[Ya]=a),this.actions=a.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var a=[];return g(this.manager.recognizers,function(b){l(b.options.enable,[b])&&(a=a.concat(b.getTouchAction()))}),U(a.join(" "))},preventDefaults:function(a){if(!Za){var b=a.srcEvent,c=a.offsetDirection;if(this.manager.session.prevented)return void b.preventDefault();var d=this.actions,e=q(d,bb),f=q(d,db),g=q(d,cb);return e||f&&c&Ha||g&&c&Ia?this.preventSrc(b):void 0}},preventSrc:function(a){this.manager.session.prevented=!0,a.preventDefault()}};var eb=1,fb=2,gb=4,hb=8,ib=hb,jb=16,kb=32;V.prototype={defaults:{},set:function(a){return h(this.options,a),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(a){if(f(a,"recognizeWith",this))return this;var b=this.simultaneous;return a=Y(a,this),b[a.id]||(b[a.id]=a,a.recognizeWith(this)),this},dropRecognizeWith:function(a){return f(a,"dropRecognizeWith",this)?this:(a=Y(a,this),delete this.simultaneous[a.id],this)},requireFailure:function(a){if(f(a,"requireFailure",this))return this;var b=this.requireFail;return a=Y(a,this),-1===s(b,a)&&(b.push(a),a.requireFailure(this)),this},dropRequireFailure:function(a){if(f(a,"dropRequireFailure",this))return this;a=Y(a,this);var b=s(this.requireFail,a);return b>-1&&this.requireFail.splice(b,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(a){return!!this.simultaneous[a.id]},emit:function(a){function b(b){c.manager.emit(c.options.event+(b?W(d):""),a)}var c=this,d=this.state;hb>d&&b(!0),b(),d>=hb&&b(!0)},tryEmit:function(a){return this.canEmit()?this.emit(a):void(this.state=kb)},canEmit:function(){for(var a=0;a<this.requireFail.length;){if(!(this.requireFail[a].state&(kb|eb)))return!1;a++}return!0},recognize:function(a){var b=h({},a);return l(this.options.enable,[this,b])?(this.state&(ib|jb|kb)&&(this.state=eb),this.state=this.process(b),void(this.state&(fb|gb|hb|jb)&&this.tryEmit(b))):(this.reset(),void(this.state=kb))},process:function(){},getTouchAction:function(){},reset:function(){}},j(Z,V,{defaults:{pointers:1},attrTest:function(a){var b=this.options.pointers;return 0===b||a.pointers.length===b},process:function(a){var b=this.state,c=a.eventType,d=b&(fb|gb),e=this.attrTest(a);return d&&(c&Ba||!e)?b|jb:d||e?c&Aa?b|hb:b&fb?b|gb:fb:kb}}),j($,Z,{defaults:{event:"pan",threshold:10,pointers:1,direction:Ja},getTouchAction:function(){var a=this.options.direction,b=[];return a&Ha&&b.push(db),a&Ia&&b.push(cb),b},directionTest:function(a){var b=this.options,c=!0,d=a.distance,e=a.direction,f=a.deltaX,g=a.deltaY;return e&b.direction||(b.direction&Ha?(e=0===f?Ca:0>f?Da:Ea,c=f!=this.pX,d=Math.abs(a.deltaX)):(e=0===g?Ca:0>g?Fa:Ga,c=g!=this.pY,d=Math.abs(a.deltaY))),a.direction=e,c&&d>b.threshold&&e&b.direction},attrTest:function(a){return Z.prototype.attrTest.call(this,a)&&(this.state&fb||!(this.state&fb)&&this.directionTest(a))},emit:function(a){this.pX=a.deltaX,this.pY=a.deltaY;var b=X(a.direction);b&&this.manager.emit(this.options.event+b,a),this._super.emit.call(this,a)}}),j(_,Z,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[bb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.scale-1)>this.options.threshold||this.state&fb)},emit:function(a){if(this._super.emit.call(this,a),1!==a.scale){var b=a.scale<1?"in":"out";this.manager.emit(this.options.event+b,a)}}}),j(aa,V,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[_a]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,f=a.deltaTime>b.time;if(this._input=a,!d||!c||a.eventType&(Aa|Ba)&&!f)this.reset();else if(a.eventType&ya)this.reset(),this._timer=e(function(){this.state=ib,this.tryEmit()},b.time,this);else if(a.eventType&Aa)return ib;return kb},reset:function(){clearTimeout(this._timer)},emit:function(a){this.state===ib&&(a&&a.eventType&Aa?this.manager.emit(this.options.event+"up",a):(this._input.timeStamp=na(),this.manager.emit(this.options.event,this._input)))}}),j(ba,Z,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[bb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.rotation)>this.options.threshold||this.state&fb)}}),j(ca,Z,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:Ha|Ia,pointers:1},getTouchAction:function(){return $.prototype.getTouchAction.call(this)},attrTest:function(a){var b,c=this.options.direction;return c&(Ha|Ia)?b=a.velocity:c&Ha?b=a.velocityX:c&Ia&&(b=a.velocityY),this._super.attrTest.call(this,a)&&c&a.direction&&a.distance>this.options.threshold&&ma(b)>this.options.velocity&&a.eventType&Aa},emit:function(a){var b=X(a.direction);b&&this.manager.emit(this.options.event+b,a),this.manager.emit(this.options.event,a)}}),j(da,V,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[ab]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,f=a.deltaTime<b.time;if(this.reset(),a.eventType&ya&&0===this.count)return this.failTimeout();if(d&&f&&c){if(a.eventType!=Aa)return this.failTimeout();var g=!this.pTime||a.timeStamp-this.pTime<b.interval,h=!this.pCenter||I(this.pCenter,a.center)<b.posThreshold;this.pTime=a.timeStamp,this.pCenter=a.center,h&&g?this.count+=1:this.count=1,this._input=a;var i=this.count%b.taps;if(0===i)return this.hasRequireFailures()?(this._timer=e(function(){this.state=ib,this.tryEmit()},b.interval,this),fb):ib}return kb},failTimeout:function(){return this._timer=e(function(){this.state=kb},this.options.interval,this),kb},reset:function(){clearTimeout(this._timer)},emit:function(){this.state==ib&&(this._input.tapCount=this.count,this.manager.emit(this.options.event,this._input))}}),ea.VERSION="2.0.4",ea.defaults={domEvents:!1,touchAction:$a,enable:!0,inputTarget:null,inputClass:null,preset:[[ba,{enable:!1}],[_,{enable:!1},["rotate"]],[ca,{direction:Ha}],[$,{direction:Ha},["swipe"]],[da],[da,{event:"doubletap",taps:2},["tap"]],[aa]],cssProps:{userSelect:"default",touchSelect:"none",touchCallout:"none",contentZooming:"none",userDrag:"none",tapHighlightColor:"rgba(0,0,0,0)"}};var lb=1,mb=2;fa.prototype={set:function(a){return h(this.options,a),a.touchAction&&this.touchAction.update(),a.inputTarget&&(this.input.destroy(),this.input.target=a.inputTarget,this.input.init()),this},stop:function(a){this.session.stopped=a?mb:lb},recognize:function(a){var b=this.session;if(!b.stopped){this.touchAction.preventDefaults(a);var c,d=this.recognizers,e=b.curRecognizer;(!e||e&&e.state&ib)&&(e=b.curRecognizer=null);for(var f=0;f<d.length;)c=d[f],b.stopped===mb||e&&c!=e&&!c.canRecognizeWith(e)?c.reset():c.recognize(a),!e&&c.state&(fb|gb|hb)&&(e=b.curRecognizer=c),f++}},get:function(a){if(a instanceof V)return a;for(var b=this.recognizers,c=0;c<b.length;c++)if(b[c].options.event==a)return b[c];return null},add:function(a){if(f(a,"add",this))return this;var b=this.get(a.options.event);return b&&this.remove(b),this.recognizers.push(a),a.manager=this,this.touchAction.update(),a},remove:function(a){if(f(a,"remove",this))return this;var b=this.recognizers;return a=this.get(a),b.splice(s(b,a),1),this.touchAction.update(),this},on:function(a,b){var c=this.handlers;return g(r(a),function(a){c[a]=c[a]||[],c[a].push(b)}),this},off:function(a,b){var c=this.handlers;return g(r(a),function(a){b?c[a].splice(s(c[a],b),1):delete c[a]}),this},emit:function(a,b){this.options.domEvents&&ha(a,b);var c=this.handlers[a]&&this.handlers[a].slice();if(c&&c.length){b.type=a,b.preventDefault=function(){b.srcEvent.preventDefault()};for(var d=0;d<c.length;)c[d](b),d++}},destroy:function(){this.element&&ga(this,!1),this.handlers={},this.session={},this.input.destroy(),this.element=null}},h(ea,{INPUT_START:ya,INPUT_MOVE:za,INPUT_END:Aa,INPUT_CANCEL:Ba,STATE_POSSIBLE:eb,STATE_BEGAN:fb,STATE_CHANGED:gb,STATE_ENDED:hb,STATE_RECOGNIZED:ib,STATE_CANCELLED:jb,STATE_FAILED:kb,DIRECTION_NONE:Ca,DIRECTION_LEFT:Da,DIRECTION_RIGHT:Ea,DIRECTION_UP:Fa,DIRECTION_DOWN:Ga,DIRECTION_HORIZONTAL:Ha,DIRECTION_VERTICAL:Ia,DIRECTION_ALL:Ja,Manager:fa,Input:y,TouchAction:T,TouchInput:Q,MouseInput:M,PointerEventInput:N,TouchMouseInput:S,SingleTouchInput:O,Recognizer:V,AttrRecognizer:Z,Tap:da,Pan:$,Swipe:ca,Pinch:_,Rotate:ba,Press:aa,on:n,off:o,each:g,merge:i,extend:h,inherit:j,bindFn:k,prefixed:v}),typeof define==ka&&define.amd?define(function(){return ea}):"undefined"!=typeof module&&module.exports?module.exports=ea:a[c]=ea}(window,document,"Hammer"),function(a){"function"==typeof define&&define.amd?define(["jquery","hammerjs"],a):"object"==typeof exports?a(require("jquery"),require("hammerjs")):a(jQuery,Hammer)}(function(a,b){function c(c,d){var e=a(c);e.data("hammer")||e.data("hammer",new b(e[0],d))}a.fn.hammer=function(a){return this.each(function(){c(this,a)})},b.Manager.prototype.emit=function(b){return function(c,d){b.call(this,c,d),a(this.element).trigger({type:c,gesture:d})}}(b.Manager.prototype.emit)}),function(a){a.Package?Materialize={}:a.Materialize={}}(window),function(a){for(var b=0,c=["webkit","moz"],d=a.requestAnimationFrame,e=a.cancelAnimationFrame,f=c.length;--f>=0&&!d;)d=a[c[f]+"RequestAnimationFrame"],e=a[c[f]+"CancelRequestAnimationFrame"];d&&e||(d=function(a){var c=+Date.now(),d=Math.max(b+16,c);return setTimeout(function(){a(b=d)},d-c)},e=clearTimeout),a.requestAnimationFrame=d,a.cancelAnimationFrame=e}(window),Materialize.guid=function(){function a(){return Math.floor(65536*(1+Math.random())).toString(16).substring(1)}return function(){return a()+a()+"-"+a()+"-"+a()+"-"+a()+"-"+a()+a()+a()}}(),Materialize.escapeHash=function(a){return a.replace(/(:|\.|\[|\]|,|=)/g,"\\$1")},Materialize.elementOrParentIsFixed=function(a){var b=$(a),c=b.add(b.parents()),d=!1;return c.each(function(){if("fixed"===$(this).css("position"))return d=!0,!1}),d};var getTime=Date.now||function(){return(new Date).getTime()};Materialize.throttle=function(a,b,c){var d,e,f,g=null,h=0;c||(c={});var i=function(){h=c.leading===!1?0:getTime(),g=null,f=a.apply(d,e),d=e=null};return function(){var j=getTime();h||c.leading!==!1||(h=j);var k=b-(j-h);return d=this,e=arguments,k<=0?(clearTimeout(g),g=null,h=j,f=a.apply(d,e),d=e=null):g||c.trailing===!1||(g=setTimeout(i,k)),f}};var Vel;Vel=jQuery?jQuery.Velocity:$?$.Velocity:Velocity,function(a){a.fn.collapsible=function(b){var c={accordion:void 0,onOpen:void 0,onClose:void 0};return b=a.extend(c,b),this.each(function(){function c(b){j=i.find("> li > .collapsible-header"),b.hasClass("active")?b.parent().addClass("active"):b.parent().removeClass("active"),b.parent().hasClass("active")?b.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}}):b.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}}),j.not(b).removeClass("active").parent().removeClass("active"),j.not(b).parent().children(".collapsible-body").stop(!0,!1).each(function(){a(this).is(":visible")&&a(this).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height",""),f(a(this).siblings(".collapsible-header"))}})})}function d(b){b.hasClass("active")?b.parent().addClass("active"):b.parent().removeClass("active"),b.parent().hasClass("active")?b.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}}):b.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}})}function e(a){b.accordion||"accordion"===k||void 0===k?c(a):d(a),f(a)}function f(a){a.hasClass("active")?"function"==typeof b.onOpen&&b.onOpen.call(this,a.parent()):"function"==typeof b.onClose&&b.onClose.call(this,a.parent())}function g(a){var b=h(a);return b.length>0}function h(a){return a.closest("li > .collapsible-header")}var i=a(this),j=a(this).find("> li > .collapsible-header"),k=i.data("collapsible");i.off("click.collapse","> li > .collapsible-header"),j.off("click.collapse"),i.on("click.collapse","> li > .collapsible-header",function(b){var c=a(b.target);g(c)&&(c=h(c)),c.toggleClass("active"),e(c)}),b.accordion||"accordion"===k||void 0===k?e(j.filter(".active").first()):j.filter(".active").each(function(){e(a(this))})})},a(document).ready(function(){a(".collapsible").collapsible()})}(jQuery),function(a){a.fn.scrollTo=function(b){return a(this).scrollTop(a(this).scrollTop()-a(this).offset().top+a(b).offset().top),this},a.fn.dropdown=function(b){var c={inDuration:300,outDuration:225,constrainWidth:!0,hover:!1,gutter:0,belowOrigin:!1,alignment:"left",stopPropagation:!1};return"open"===b?(this.each(function(){a(this).trigger("open")}),!1):"close"===b?(this.each(function(){a(this).trigger("close")}),!1):void this.each(function(){function d(){void 0!==g.data("induration")&&(h.inDuration=g.data("induration")),void 0!==g.data("outduration")&&(h.outDuration=g.data("outduration")),void 0!==g.data("constrainwidth")&&(h.constrainWidth=g.data("constrainwidth")),void 0!==g.data("hover")&&(h.hover=g.data("hover")),void 0!==g.data("gutter")&&(h.gutter=g.data("gutter")),void 0!==g.data("beloworigin")&&(h.belowOrigin=g.data("beloworigin")),void 0!==g.data("alignment")&&(h.alignment=g.data("alignment")),void 0!==g.data("stoppropagation")&&(h.stopPropagation=g.data("stoppropagation"))}function e(b){"focus"===b&&(i=!0),d(),j.addClass("active"),g.addClass("active"),h.constrainWidth===!0?j.css("width",g.outerWidth()):j.css("white-space","nowrap");var c=window.innerHeight,e=g.innerHeight(),k=g.offset().left,l=g.offset().top-a(window).scrollTop(),m=h.alignment,n=0,o=0,p=0;h.belowOrigin===!0&&(p=e);var q=0,r=0,s=g.parent();if(s.is("body")||(s[0].scrollHeight>s[0].clientHeight&&(q=s[0].scrollTop),s[0].scrollWidth>s[0].clientWidth&&(r=s[0].scrollLeft)),k+j.innerWidth()>a(window).width()?m="right":k-j.innerWidth()+g.innerWidth()<0&&(m="left"),l+j.innerHeight()>c)if(l+e-j.innerHeight()<0){var t=c-l-p;j.css("max-height",t)}else p||(p+=e),p-=j.innerHeight();if("left"===m)n=h.gutter,o=g.position().left+n;else if("right"===m){var u=g.position().left+g.outerWidth()-j.outerWidth();n=-h.gutter,o=u+n}j.css({position:"absolute",top:g.position().top+p+q,left:o+r}),j.stop(!0,!0).css("opacity",0).slideDown({queue:!1,duration:h.inDuration,easing:"easeOutCubic",complete:function(){a(this).css("height","")}}).animate({opacity:1},{queue:!1,duration:h.inDuration,easing:"easeOutSine"}),a(document).bind("click."+j.attr("id")+" touchstart."+j.attr("id"),function(b){j.is(b.target)||g.is(b.target)||g.find(b.target).length||(f(),a(document).unbind("click."+j.attr("id")+" touchstart."+j.attr("id")))})}function f(){i=!1,j.fadeOut(h.outDuration),j.removeClass("active"),g.removeClass("active"),a(document).unbind("click."+j.attr("id")+" touchstart."+j.attr("id")),setTimeout(function(){j.css("max-height","")},h.outDuration)}var g=a(this),h=a.extend({},c,b),i=!1,j=a("#"+g.attr("data-activates"));if(d(),g.after(j),h.hover){var k=!1;g.unbind("click."+g.attr("id")),g.on("mouseenter",function(a){k===!1&&(e(),k=!0)}),g.on("mouseleave",function(b){var c=b.toElement||b.relatedTarget;a(c).closest(".dropdown-content").is(j)||(j.stop(!0,!0),f(),k=!1)}),j.on("mouseleave",function(b){var c=b.toElement||b.relatedTarget;a(c).closest(".dropdown-button").is(g)||(j.stop(!0,!0),f(),k=!1)})}else g.unbind("click."+g.attr("id")),g.bind("click."+g.attr("id"),function(b){i||(g[0]!=b.currentTarget||g.hasClass("active")||0!==a(b.target).closest(".dropdown-content").length?g.hasClass("active")&&(f(),a(document).unbind("click."+j.attr("id")+" touchstart."+j.attr("id"))):(b.preventDefault(),h.stopPropagation&&b.stopPropagation(),e("click")))});g.on("open",function(a,b){e(b)}),g.on("close",f)})},a(document).ready(function(){a(".dropdown-button").dropdown()})}(jQuery),function(a){var b=0,c=0,d=function(){return c++,"materialize-modal-overlay-"+c},e={init:function(c){var e={opacity:.5,inDuration:350,outDuration:250,ready:void 0,
+complete:void 0,dismissible:!0,startingTop:"4%",endingTop:"10%"};return c=a.extend(e,c),this.each(function(){var e=a(this),f=a(this).attr("id")||"#"+a(this).data("target"),g=function(){var d=e.data("overlay-id"),f=a("#"+d);e.removeClass("open"),a("body").css({overflow:"",width:""}),e.find(".modal-close").off("click.close"),a(document).off("keyup.modal"+d),f.velocity({opacity:0},{duration:c.outDuration,queue:!1,ease:"easeOutQuart"});var g={duration:c.outDuration,queue:!1,ease:"easeOutCubic",complete:function(){a(this).css({display:"none"}),"function"==typeof c.complete&&c.complete.call(this,e),f.remove(),b--}};e.hasClass("bottom-sheet")?e.velocity({bottom:"-100%",opacity:0},g):e.velocity({top:c.startingTop,opacity:0,scaleX:.7},g)},h=function(f){var h=a("body"),i=h.innerWidth();if(h.css("overflow","hidden"),h.width(i),!e.hasClass("open")){var j=d(),k=a('<div class="modal-overlay"></div>');lStack=++b,k.attr("id",j).css("z-index",1e3+2*lStack),e.data("overlay-id",j).css("z-index",1e3+2*lStack+1),e.addClass("open"),a("body").append(k),c.dismissible&&(k.click(function(){g()}),a(document).on("keyup.modal"+j,function(a){27===a.keyCode&&g()})),e.find(".modal-close").on("click.close",function(a){g()}),k.css({display:"block",opacity:0}),e.css({display:"block",opacity:0}),k.velocity({opacity:c.opacity},{duration:c.inDuration,queue:!1,ease:"easeOutCubic"}),e.data("associated-overlay",k[0]);var l={duration:c.inDuration,queue:!1,ease:"easeOutCubic",complete:function(){"function"==typeof c.ready&&c.ready.call(this,e,f)}};e.hasClass("bottom-sheet")?e.velocity({bottom:"0",opacity:1},l):(a.Velocity.hook(e,"scaleX",.7),e.css({top:c.startingTop}),e.velocity({top:c.endingTop,opacity:1,scaleX:"1"},l))}};a(document).off("click.modalTrigger",'a[href="#'+f+'"], [data-target="'+f+'"]'),a(this).off("openModal"),a(this).off("closeModal"),a(document).on("click.modalTrigger",'a[href="#'+f+'"], [data-target="'+f+'"]',function(b){c.startingTop=(a(this).offset().top-a(window).scrollTop())/1.15,h(a(this)),b.preventDefault()}),a(this).on("openModal",function(){a(this).attr("href")||"#"+a(this).data("target");h()}),a(this).on("closeModal",function(){g()})})},open:function(){a(this).trigger("openModal")},close:function(){a(this).trigger("closeModal")}};a.fn.modal=function(b){return e[b]?e[b].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof b&&b?void a.error("Method "+b+" does not exist on jQuery.modal"):e.init.apply(this,arguments)}}(jQuery),function(a){a.fn.materialbox=function(){return this.each(function(){function b(){f=!1;var b=i.parent(".material-placeholder"),d=(window.innerWidth,window.innerHeight,i.data("width")),g=i.data("height");i.velocity("stop",!0),a("#materialbox-overlay").velocity("stop",!0),a(".materialbox-caption").velocity("stop",!0),a("#materialbox-overlay").velocity({opacity:0},{duration:h,queue:!1,easing:"easeOutQuad",complete:function(){e=!1,a(this).remove()}}),i.velocity({width:d,height:g,left:0,top:0},{duration:h,queue:!1,easing:"easeOutQuad"}),a(".materialbox-caption").velocity({opacity:0},{duration:h,queue:!1,easing:"easeOutQuad",complete:function(){b.css({height:"",width:"",position:"",top:"",left:""}),i.css({height:"",top:"",left:"",width:"","max-width":"",position:"","z-index":"","will-change":""}),i.removeClass("active"),f=!0,a(this).remove(),c&&c.css("overflow","")}})}if(!a(this).hasClass("initialized")){a(this).addClass("initialized");var c,d,e=!1,f=!0,g=275,h=200,i=a(this),j=a("<div></div>").addClass("material-placeholder");i.wrap(j),i.on("click",function(){var h=i.parent(".material-placeholder"),j=window.innerWidth,k=window.innerHeight,l=i.width(),m=i.height();if(f===!1)return b(),!1;if(e&&f===!0)return b(),!1;f=!1,i.addClass("active"),e=!0,h.css({width:h[0].getBoundingClientRect().width,height:h[0].getBoundingClientRect().height,position:"relative",top:0,left:0}),c=void 0,d=h[0].parentNode;for(;null!==d&&!a(d).is(document);){var n=a(d);"visible"!==n.css("overflow")&&(n.css("overflow","visible"),c=void 0===c?n:c.add(n)),d=d.parentNode}i.css({position:"absolute","z-index":1e3,"will-change":"left, top, width, height"}).data("width",l).data("height",m);var o=a('<div id="materialbox-overlay"></div>').css({opacity:0}).click(function(){f===!0&&b()});i.before(o);var p=o[0].getBoundingClientRect();if(o.css({width:j,height:k,left:-1*p.left,top:-1*p.top}),o.velocity({opacity:1},{duration:g,queue:!1,easing:"easeOutQuad"}),""!==i.data("caption")){var q=a('<div class="materialbox-caption"></div>');q.text(i.data("caption")),a("body").append(q),q.css({display:"inline"}),q.velocity({opacity:1},{duration:g,queue:!1,easing:"easeOutQuad"})}var r=0,s=l/j,t=m/k,u=0,v=0;s>t?(r=m/l,u=.9*j,v=.9*j*r):(r=l/m,u=.9*k*r,v=.9*k),i.hasClass("responsive-img")?i.velocity({"max-width":u,width:l},{duration:0,queue:!1,complete:function(){i.css({left:0,top:0}).velocity({height:v,width:u,left:a(document).scrollLeft()+j/2-i.parent(".material-placeholder").offset().left-u/2,top:a(document).scrollTop()+k/2-i.parent(".material-placeholder").offset().top-v/2},{duration:g,queue:!1,easing:"easeOutQuad",complete:function(){f=!0}})}}):i.css("left",0).css("top",0).velocity({height:v,width:u,left:a(document).scrollLeft()+j/2-i.parent(".material-placeholder").offset().left-u/2,top:a(document).scrollTop()+k/2-i.parent(".material-placeholder").offset().top-v/2},{duration:g,queue:!1,easing:"easeOutQuad",complete:function(){f=!0}})}),a(window).scroll(function(){e&&b()}),a(document).keyup(function(a){27===a.keyCode&&f===!0&&e&&b()})}})},a(document).ready(function(){a(".materialboxed").materialbox()})}(jQuery),function(a){a.fn.parallax=function(){var b=a(window).width();return this.each(function(c){function d(c){var d;d=b<601?e.height()>0?e.height():e.children("img").height():e.height()>0?e.height():500;var f=e.children("img").first(),g=f.height(),h=g-d,i=e.offset().top+d,j=e.offset().top,k=a(window).scrollTop(),l=window.innerHeight,m=k+l,n=(m-j)/(d+l),o=Math.round(h*n);c&&f.css("display","block"),i>k&&j<k+l&&f.css("transform","translate3D(-50%,"+o+"px, 0)")}var e=a(this);e.addClass("parallax"),e.children("img").one("load",function(){d(!0)}).each(function(){this.complete&&a(this).trigger("load")}),a(window).scroll(function(){b=a(window).width(),d(!1)}),a(window).resize(function(){b=a(window).width(),d(!1)})})}}(jQuery),function(a){var b={init:function(b){var c={onShow:null,swipeable:!1,responsiveThreshold:1/0};return b=a.extend(c,b),this.each(function(){var c,d,e,f,g,h=a(this),i=a(window).width(),j=h.find("li.tab a"),k=h.width(),l=a(),m=Math.max(k,h[0].scrollWidth)/j.length,n=prev_index=0,o=!1,p=300,q=function(a){return k-a.position().left-a.outerWidth()-h.scrollLeft()},r=function(a){return a.position().left+h.scrollLeft()},s=function(a){n-a>=0?(f.velocity({right:q(c)},{duration:p,queue:!1,easing:"easeOutQuad"}),f.velocity({left:r(c)},{duration:p,queue:!1,easing:"easeOutQuad",delay:90})):(f.velocity({left:r(c)},{duration:p,queue:!1,easing:"easeOutQuad"}),f.velocity({right:q(c)},{duration:p,queue:!1,easing:"easeOutQuad",delay:90}))};b.swipeable&&i>b.responsiveThreshold&&(b.swipeable=!1),c=a(j.filter('[href="'+location.hash+'"]')),0===c.length&&(c=a(this).find("li.tab a.active").first()),0===c.length&&(c=a(this).find("li.tab a").first()),c.addClass("active"),n=j.index(c),n<0&&(n=0),void 0!==c[0]&&(d=a(c[0].hash),d.addClass("active")),h.find(".indicator").length||h.append('<div class="indicator"></div>'),f=h.find(".indicator"),h.append(f),h.is(":visible")&&setTimeout(function(){f.css({right:q(c)}),f.css({left:r(c)})},0),a(window).resize(function(){k=h.width(),m=Math.max(k,h[0].scrollWidth)/j.length,n<0&&(n=0),0!==m&&0!==k&&(f.css({right:q(c)}),f.css({left:r(c)}))}),b.swipeable?(j.each(function(){var b=a(Materialize.escapeHash(this.hash));b.addClass("carousel-item"),l=l.add(b)}),e=l.wrapAll('<div class="tabs-content carousel"></div>'),l.css("display",""),a(".tabs-content.carousel").carousel({fullWidth:!0,noWrap:!0,onCycleTo:function(a){if(!o){var b=n;n=e.index(a),c=j.eq(n),s(b)}}})):j.not(c).each(function(){a(Materialize.escapeHash(this.hash)).hide()}),h.on("click","a",function(e){if(a(this).parent().hasClass("disabled"))return void e.preventDefault();if(!a(this).attr("target")){o=!0,k=h.width(),m=Math.max(k,h[0].scrollWidth)/j.length,c.removeClass("active");var f=d;c=a(this),d=a(Materialize.escapeHash(this.hash)),j=h.find("li.tab a");c.position();c.addClass("active"),prev_index=n,n=j.index(a(this)),n<0&&(n=0),b.swipeable?l.length&&l.carousel("set",n):(void 0!==d&&(d.show(),d.addClass("active"),"function"==typeof b.onShow&&b.onShow.call(this,d)),void 0===f||f.is(d)||(f.hide(),f.removeClass("active"))),g=setTimeout(function(){o=!1},p),s(prev_index),e.preventDefault()}})})},select_tab:function(a){this.find('a[href="#'+a+'"]').trigger("click")}};a.fn.tabs=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.tabs"):b.init.apply(this,arguments)},a(document).ready(function(){a("ul.tabs").tabs()})}(jQuery),function(a){a.fn.tooltip=function(c){var d=5,e={delay:350,tooltip:"",position:"bottom",html:!1};return"remove"===c?(this.each(function(){a("#"+a(this).attr("data-tooltip-id")).remove(),a(this).off("mouseenter.tooltip mouseleave.tooltip")}),!1):(c=a.extend(e,c),this.each(function(){var e=Materialize.guid(),f=a(this);f.attr("data-tooltip-id")&&a("#"+f.attr("data-tooltip-id")).remove(),f.attr("data-tooltip-id",e);var g,h,i,j,k,l,m=function(){g=f.attr("data-html")?"true"===f.attr("data-html"):c.html,h=f.attr("data-delay"),h=void 0===h||""===h?c.delay:h,i=f.attr("data-position"),i=void 0===i||""===i?c.position:i,j=f.attr("data-tooltip"),j=void 0===j||""===j?c.tooltip:j};m();var n=function(){var b=a('<div class="material-tooltip"></div>');return j=g?a("<span></span>").html(j):a("<span></span>").text(j),b.append(j).appendTo(a("body")).attr("id",e),l=a('<div class="backdrop"></div>'),l.appendTo(b),b};k=n(),f.off("mouseenter.tooltip mouseleave.tooltip");var o,p=!1;f.on({"mouseenter.tooltip":function(a){var c=function(){m(),p=!0,k.velocity("stop"),l.velocity("stop"),k.css({visibility:"visible",left:"0px",top:"0px"});var a,c,e,g=f.outerWidth(),h=f.outerHeight(),j=k.outerHeight(),n=k.outerWidth(),o="0px",q="0px",r=l[0].offsetWidth,s=l[0].offsetHeight,t=8,u=8,v=0;"top"===i?(a=f.offset().top-j-d,c=f.offset().left+g/2-n/2,e=b(c,a,n,j),o="-10px",l.css({bottom:0,left:0,borderRadius:"14px 14px 0 0",transformOrigin:"50% 100%",marginTop:j,marginLeft:n/2-r/2})):"left"===i?(a=f.offset().top+h/2-j/2,c=f.offset().left-n-d,e=b(c,a,n,j),q="-10px",l.css({top:"-7px",right:0,width:"14px",height:"14px",borderRadius:"14px 0 0 14px",transformOrigin:"95% 50%",marginTop:j/2,marginLeft:n})):"right"===i?(a=f.offset().top+h/2-j/2,c=f.offset().left+g+d,e=b(c,a,n,j),q="+10px",l.css({top:"-7px",left:0,width:"14px",height:"14px",borderRadius:"0 14px 14px 0",transformOrigin:"5% 50%",marginTop:j/2,marginLeft:"0px"})):(a=f.offset().top+f.outerHeight()+d,c=f.offset().left+g/2-n/2,e=b(c,a,n,j),o="+10px",l.css({top:0,left:0,marginLeft:n/2-r/2})),k.css({top:e.y,left:e.x}),t=Math.SQRT2*n/parseInt(r),u=Math.SQRT2*j/parseInt(s),v=Math.max(t,u),k.velocity({translateY:o,translateX:q},{duration:350,queue:!1}).velocity({opacity:1},{duration:300,delay:50,queue:!1}),l.css({visibility:"visible"}).velocity({opacity:1},{duration:55,delay:0,queue:!1}).velocity({scaleX:v,scaleY:v},{duration:300,delay:0,queue:!1,easing:"easeInOutQuad"})};o=setTimeout(c,h)},"mouseleave.tooltip":function(){p=!1,clearTimeout(o),setTimeout(function(){p!==!0&&(k.velocity({opacity:0,translateY:0,translateX:0},{duration:225,queue:!1}),l.velocity({opacity:0,scaleX:1,scaleY:1},{duration:225,queue:!1,complete:function(){l.css({visibility:"hidden"}),k.css({visibility:"hidden"}),p=!1}}))},225)}})}))};var b=function(b,c,d,e){var f=b,g=c;return f<0?f=4:f+d>window.innerWidth&&(f-=f+d-window.innerWidth),g<0?g=4:g+e>window.innerHeight+a(window).scrollTop&&(g-=g+e-window.innerHeight),{x:f,y:g}};a(document).ready(function(){a(".tooltipped").tooltip()})}(jQuery),function(a){"use strict";function b(a){return null!==a&&a===a.window}function c(a){return b(a)?a:9===a.nodeType&&a.defaultView}function d(a){var b,d,e={top:0,left:0},f=a&&a.ownerDocument;return b=f.documentElement,"undefined"!=typeof a.getBoundingClientRect&&(e=a.getBoundingClientRect()),d=c(f),{top:e.top+d.pageYOffset-b.clientTop,left:e.left+d.pageXOffset-b.clientLeft}}function e(a){var b="";for(var c in a)a.hasOwnProperty(c)&&(b+=c+":"+a[c]+";");return b}function f(a){if(k.allowEvent(a)===!1)return null;for(var b=null,c=a.target||a.srcElement;null!==c.parentElement;){if(!(c instanceof SVGElement||c.className.indexOf("waves-effect")===-1)){b=c;break}if(c.classList.contains("waves-effect")){b=c;break}c=c.parentElement}return b}function g(b){var c=f(b);null!==c&&(j.show(b,c),"ontouchstart"in a&&(c.addEventListener("touchend",j.hide,!1),c.addEventListener("touchcancel",j.hide,!1)),c.addEventListener("mouseup",j.hide,!1),c.addEventListener("mouseleave",j.hide,!1))}var h=h||{},i=document.querySelectorAll.bind(document),j={duration:750,show:function(a,b){if(2===a.button)return!1;var c=b||this,f=document.createElement("div");f.className="waves-ripple",c.appendChild(f);var g=d(c),h=a.pageY-g.top,i=a.pageX-g.left,k="scale("+c.clientWidth/100*10+")";"touches"in a&&(h=a.touches[0].pageY-g.top,i=a.touches[0].pageX-g.left),f.setAttribute("data-hold",Date.now()),f.setAttribute("data-scale",k),f.setAttribute("data-x",i),f.setAttribute("data-y",h);var l={top:h+"px",left:i+"px"};f.className=f.className+" waves-notransition",f.setAttribute("style",e(l)),f.className=f.className.replace("waves-notransition",""),l["-webkit-transform"]=k,l["-moz-transform"]=k,l["-ms-transform"]=k,l["-o-transform"]=k,l.transform=k,l.opacity="1",l["-webkit-transition-duration"]=j.duration+"ms",l["-moz-transition-duration"]=j.duration+"ms",l["-o-transition-duration"]=j.duration+"ms",l["transition-duration"]=j.duration+"ms",l["-webkit-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",l["-moz-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",l["-o-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",l["transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",f.setAttribute("style",e(l))},hide:function(a){k.touchup(a);var b=this,c=(1.4*b.clientWidth,null),d=b.getElementsByClassName("waves-ripple");if(!(d.length>0))return!1;c=d[d.length-1];var f=c.getAttribute("data-x"),g=c.getAttribute("data-y"),h=c.getAttribute("data-scale"),i=Date.now()-Number(c.getAttribute("data-hold")),l=350-i;l<0&&(l=0),setTimeout(function(){var a={top:g+"px",left:f+"px",opacity:"0","-webkit-transition-duration":j.duration+"ms","-moz-transition-duration":j.duration+"ms","-o-transition-duration":j.duration+"ms","transition-duration":j.duration+"ms","-webkit-transform":h,"-moz-transform":h,"-ms-transform":h,"-o-transform":h,transform:h};c.setAttribute("style",e(a)),setTimeout(function(){try{b.removeChild(c)}catch(a){return!1}},j.duration)},l)},wrapInput:function(a){for(var b=0;b<a.length;b++){var c=a[b];if("input"===c.tagName.toLowerCase()){var d=c.parentNode;if("i"===d.tagName.toLowerCase()&&d.className.indexOf("waves-effect")!==-1)continue;var e=document.createElement("i");e.className=c.className+" waves-input-wrapper";var f=c.getAttribute("style");f||(f=""),e.setAttribute("style",f),c.className="waves-button-input",c.removeAttribute("style"),d.replaceChild(e,c),e.appendChild(c)}}}},k={touches:0,allowEvent:function(a){var b=!0;return"touchstart"===a.type?k.touches+=1:"touchend"===a.type||"touchcancel"===a.type?setTimeout(function(){k.touches>0&&(k.touches-=1)},500):"mousedown"===a.type&&k.touches>0&&(b=!1),b},touchup:function(a){k.allowEvent(a)}};h.displayEffect=function(b){b=b||{},"duration"in b&&(j.duration=b.duration),j.wrapInput(i(".waves-effect")),"ontouchstart"in a&&document.body.addEventListener("touchstart",g,!1),document.body.addEventListener("mousedown",g,!1)},h.attach=function(b){"input"===b.tagName.toLowerCase()&&(j.wrapInput([b]),b=b.parentElement),"ontouchstart"in a&&b.addEventListener("touchstart",g,!1),b.addEventListener("mousedown",g,!1)},a.Waves=h,document.addEventListener("DOMContentLoaded",function(){h.displayEffect()},!1)}(window),Materialize.toast=function(a,b,c,d){function e(a){var b=document.createElement("div");if(b.classList.add("toast"),c)for(var e=c.split(" "),f=0,g=e.length;f<g;f++)b.classList.add(e[f]);("object"==typeof HTMLElement?a instanceof HTMLElement:a&&"object"==typeof a&&null!==a&&1===a.nodeType&&"string"==typeof a.nodeName)?b.appendChild(a):a instanceof jQuery?b.appendChild(a[0]):b.innerHTML=a;var h=new Hammer(b,{prevent_default:!1});return h.on("pan",function(a){var c=a.deltaX,d=80;b.classList.contains("panning")||b.classList.add("panning");var e=1-Math.abs(c/d);e<0&&(e=0),Vel(b,{left:c,opacity:e},{duration:50,queue:!1,easing:"easeOutQuad"})}),h.on("panend",function(a){var c=a.deltaX,e=80;Math.abs(c)>e?Vel(b,{marginTop:"-40px"},{duration:375,easing:"easeOutExpo",queue:!1,complete:function(){"function"==typeof d&&d(),b.parentNode.removeChild(b)}}):(b.classList.remove("panning"),Vel(b,{left:0,opacity:1},{duration:300,easing:"easeOutExpo",queue:!1}))}),b}c=c||"";var f=document.getElementById("toast-container");null===f&&(f=document.createElement("div"),f.id="toast-container",document.body.appendChild(f));var g=e(a);a&&f.appendChild(g),g.style.opacity=0,Vel(g,{translateY:"-35px",opacity:1},{duration:300,easing:"easeOutCubic",queue:!1});var h,i=b;null!=i&&(h=setInterval(function(){null===g.parentNode&&window.clearInterval(h),g.classList.contains("panning")||(i-=20),i<=0&&(Vel(g,{opacity:0,marginTop:"-40px"},{duration:375,easing:"easeOutExpo",queue:!1,complete:function(){"function"==typeof d&&d(),this[0].parentNode.removeChild(this[0])}}),window.clearInterval(h))},20))},function(a){var b={init:function(b){var c={menuWidth:300,edge:"left",closeOnClick:!1,draggable:!0};b=a.extend(c,b),a(this).each(function(){var c=a(this),d=c.attr("data-activates"),e=a("#"+d);300!=b.menuWidth&&e.css("width",b.menuWidth);var f=a('.drag-target[data-sidenav="'+d+'"]');b.draggable?(f.length&&f.remove(),f=a('<div class="drag-target"></div>').attr("data-sidenav",d),a("body").append(f)):f=a(),"left"==b.edge?(e.css("transform","translateX(-100%)"),f.css({left:0})):(e.addClass("right-aligned").css("transform","translateX(100%)"),f.css({right:0})),e.hasClass("fixed")&&window.innerWidth>992&&e.css("transform","translateX(0)"),e.hasClass("fixed")&&a(window).resize(function(){window.innerWidth>992?0!==a("#sidenav-overlay").length&&i?g(!0):e.css("transform","translateX(0%)"):i===!1&&("left"===b.edge?e.css("transform","translateX(-100%)"):e.css("transform","translateX(100%)"))}),b.closeOnClick===!0&&e.on("click.itemclick","a:not(.collapsible-header)",function(){g()});var g=function(c){h=!1,i=!1,a("body").css({overflow:"",width:""}),a("#sidenav-overlay").velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}}),"left"===b.edge?(f.css({width:"",right:"",left:"0"}),e.velocity({translateX:"-100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){c===!0&&(e.removeAttr("style"),e.css("width",b.menuWidth))}})):(f.css({width:"",right:"0",left:""}),e.velocity({translateX:"100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){c===!0&&(e.removeAttr("style"),e.css("width",b.menuWidth))}}))},h=!1,i=!1;b.draggable&&(f.on("click",function(){i&&g()}),f.hammer({prevent_default:!1}).bind("pan",function(c){if("touch"==c.gesture.pointerType){var d=(c.gesture.direction,c.gesture.center.x),f=(c.gesture.center.y,c.gesture.velocityX,a("body")),h=a("#sidenav-overlay"),j=f.innerWidth();if(f.css("overflow","hidden"),f.width(j),0===h.length&&(h=a('<div id="sidenav-overlay"></div>'),h.css("opacity",0).click(function(){g()}),a("body").append(h)),"left"===b.edge&&(d>b.menuWidth?d=b.menuWidth:d<0&&(d=0)),"left"===b.edge)d<b.menuWidth/2?i=!1:d>=b.menuWidth/2&&(i=!0),e.css("transform","translateX("+(d-b.menuWidth)+"px)");else{d<window.innerWidth-b.menuWidth/2?i=!0:d>=window.innerWidth-b.menuWidth/2&&(i=!1);var k=d-b.menuWidth/2;k<0&&(k=0),e.css("transform","translateX("+k+"px)")}var l;"left"===b.edge?(l=d/b.menuWidth,h.velocity({opacity:l},{duration:10,queue:!1,easing:"easeOutQuad"})):(l=Math.abs((d-window.innerWidth)/b.menuWidth),h.velocity({opacity:l},{duration:10,queue:!1,easing:"easeOutQuad"}))}}).bind("panend",function(c){if("touch"==c.gesture.pointerType){var d=a('<div id="sidenav-overlay"></div>'),g=c.gesture.velocityX,j=c.gesture.center.x,k=j-b.menuWidth,l=j-b.menuWidth/2;k>0&&(k=0),l<0&&(l=0),h=!1,"left"===b.edge?i&&g<=.3||g<-.5?(0!==k&&e.velocity({translateX:[0,k]},{duration:300,queue:!1,easing:"easeOutQuad"}),d.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),f.css({width:"50%",right:0,left:""}),i=!0):(!i||g>.3)&&(a("body").css({overflow:"",width:""}),e.velocity({translateX:[-1*b.menuWidth-10,k]},{duration:200,queue:!1,easing:"easeOutQuad"}),d.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}}),f.css({width:"10px",right:"",left:0})):i&&g>=-.3||g>.5?(0!==l&&e.velocity({translateX:[0,l]},{duration:300,queue:!1,easing:"easeOutQuad"}),d.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),f.css({width:"50%",right:"",left:0}),i=!0):(!i||g<-.3)&&(a("body").css({overflow:"",width:""}),e.velocity({translateX:[b.menuWidth+10,l]},{duration:200,queue:!1,easing:"easeOutQuad"}),d.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}}),f.css({width:"10px",right:0,left:""}))}})),c.off("click.sidenav").on("click.sidenav",function(){if(i===!0)i=!1,h=!1,g();else{var c=a("body"),d=a('<div id="sidenav-overlay"></div>'),j=c.innerWidth();c.css("overflow","hidden"),c.width(j),a("body").append(f),"left"===b.edge?(f.css({width:"50%",right:0,left:""}),e.velocity({translateX:[0,-1*b.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})):(f.css({width:"50%",right:"",left:0}),e.velocity({translateX:[0,b.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})),d.css("opacity",0).click(function(){i=!1,h=!1,g(),d.velocity({opacity:0},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}})}),a("body").append(d),d.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){i=!0,h=!1}})}return!1})})},destroy:function(){var b=a("#sidenav-overlay"),c=a('.drag-target[data-sidenav="'+a(this).attr("data-activates")+'"]');b.trigger("click"),c.remove(),a(this).off("click"),b.remove()},show:function(){this.trigger("click")},hide:function(){a("#sidenav-overlay").trigger("click")}};a.fn.sideNav=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.sideNav"):b.init.apply(this,arguments)}}(jQuery),function(a){function b(b,c,d,e){var g=a();return a.each(f,function(a,f){if(f.height()>0){var h=f.offset().top,i=f.offset().left,j=i+f.width(),k=h+f.height(),l=!(i>c||j<e||h>d||k<b);l&&g.push(f)}}),g}function c(c){++i;var d=e.scrollTop(),f=e.scrollLeft(),h=f+e.width(),k=d+e.height(),l=b(d+j.top+c||200,h+j.right,k+j.bottom,f+j.left);a.each(l,function(a,b){var c=b.data("scrollSpy:ticks");"number"!=typeof c&&b.triggerHandler("scrollSpy:enter"),b.data("scrollSpy:ticks",i)}),a.each(g,function(a,b){var c=b.data("scrollSpy:ticks");"number"==typeof c&&c!==i&&(b.triggerHandler("scrollSpy:exit"),b.data("scrollSpy:ticks",null))}),g=l}function d(){e.trigger("scrollSpy:winSize")}var e=a(window),f=[],g=[],h=!1,i=0,j={top:0,right:0,bottom:0,left:0};a.scrollSpy=function(b,d){var g={throttle:100,scrollOffset:200};d=a.extend(g,d);var i=[];b=a(b),b.each(function(b,c){f.push(a(c)),a(c).data("scrollSpy:id",b),a('a[href="#'+a(c).attr("id")+'"]').click(function(b){b.preventDefault();var c=a(Materialize.escapeHash(this.hash)).offset().top+1;a("html, body").animate({scrollTop:c-d.scrollOffset},{duration:400,queue:!1,easing:"easeOutCubic"})})}),j.top=d.offsetTop||0,j.right=d.offsetRight||0,j.bottom=d.offsetBottom||0,j.left=d.offsetLeft||0;var k=Materialize.throttle(function(){c(d.scrollOffset)},d.throttle||100),l=function(){a(document).ready(k)};return h||(e.on("scroll",l),e.on("resize",l),h=!0),setTimeout(l,0),b.on("scrollSpy:enter",function(){i=a.grep(i,function(a){return 0!=a.height()});var b=a(this);i[0]?(a('a[href="#'+i[0].attr("id")+'"]').removeClass("active"),b.data("scrollSpy:id")<i[0].data("scrollSpy:id")?i.unshift(a(this)):i.push(a(this))):i.push(a(this)),a('a[href="#'+i[0].attr("id")+'"]').addClass("active")}),b.on("scrollSpy:exit",function(){if(i=a.grep(i,function(a){return 0!=a.height()}),i[0]){a('a[href="#'+i[0].attr("id")+'"]').removeClass("active");var b=a(this);i=a.grep(i,function(a){return a.attr("id")!=b.attr("id")}),i[0]&&a('a[href="#'+i[0].attr("id")+'"]').addClass("active")}}),b},a.winSizeSpy=function(b){return a.winSizeSpy=function(){return e},b=b||{throttle:100},e.on("resize",Materialize.throttle(d,b.throttle||100))},a.fn.scrollSpy=function(b){return a.scrollSpy(a(this),b)}}(jQuery),function(a){a(document).ready(function(){function b(b){var c=b.css("font-family"),d=b.css("font-size"),f=b.css("line-height");d&&e.css("font-size",d),c&&e.css("font-family",c),f&&e.css("line-height",f),"off"===b.attr("wrap")&&e.css("overflow-wrap","normal").css("white-space","pre"),e.text(b.val()+"\n");var g=e.html().replace(/\n/g,"<br>");e.html(g),b.is(":visible")?e.css("width",b.width()):e.css("width",a(window).width()/2),b.css("height",e.height())}Materialize.updateTextFields=function(){var b="input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea";a(b).each(function(b,c){var d=a(this);a(c).val().length>0||c.autofocus||void 0!==d.attr("placeholder")?d.siblings("label").addClass("active"):a(c)[0].validity?d.siblings("label").toggleClass("active",a(c)[0].validity.badInput===!0):d.siblings("label").removeClass("active")})};var c="input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea";a(document).on("change",c,function(){0===a(this).val().length&&void 0===a(this).attr("placeholder")||a(this).siblings("label").addClass("active"),validate_field(a(this))}),a(document).ready(function(){Materialize.updateTextFields()}),a(document).on("reset",function(b){var d=a(b.target);d.is("form")&&(d.find(c).removeClass("valid").removeClass("invalid"),d.find(c).each(function(){""===a(this).attr("value")&&a(this).siblings("label").removeClass("active")}),d.find("select.initialized").each(function(){var a=d.find("option[selected]").text();d.siblings("input.select-dropdown").val(a)}))}),a(document).on("focus",c,function(){a(this).siblings("label, .prefix").addClass("active")}),a(document).on("blur",c,function(){var b=a(this),c=".prefix";0===b.val().length&&b[0].validity.badInput!==!0&&void 0===b.attr("placeholder")&&(c+=", label"),b.siblings(c).removeClass("active"),validate_field(b)}),window.validate_field=function(a){var b=void 0!==a.attr("data-length"),c=parseInt(a.attr("data-length")),d=a.val().length;0===a.val().length&&a[0].validity.badInput===!1?a.hasClass("validate")&&(a.removeClass("valid"),a.removeClass("invalid")):a.hasClass("validate")&&(a.is(":valid")&&b&&d<=c||a.is(":valid")&&!b?(a.removeClass("invalid"),a.addClass("valid")):(a.removeClass("valid"),a.addClass("invalid")))};var d="input[type=radio], input[type=checkbox]";a(document).on("keyup.radio",d,function(b){if(9===b.which){a(this).addClass("tabbed");var c=a(this);return void c.one("blur",function(b){a(this).removeClass("tabbed")})}});var e=a(".hiddendiv").first();e.length||(e=a('<div class="hiddendiv common"></div>'),a("body").append(e));var f=".materialize-textarea";a(f).each(function(){var c=a(this);c.val().length&&b(c)}),a("body").on("keyup keydown autoresize",f,function(){b(a(this))}),a(document).on("change",'.file-field input[type="file"]',function(){for(var b=a(this).closest(".file-field"),c=b.find("input.file-path"),d=a(this)[0].files,e=[],f=0;f<d.length;f++)e.push(d[f].name);c.val(e.join(", ")),c.trigger("change")});var g,h="input[type=range]",i=!1;a(h).each(function(){var b=a('<span class="thumb"><span class="value"></span></span>');a(this).after(b)});var j=".range-field";a(document).on("change",h,function(b){var c=a(this).siblings(".thumb");c.find(".value").html(a(this).val())}),a(document).on("input mousedown touchstart",h,function(b){var c=a(this).siblings(".thumb"),d=a(this).outerWidth();c.length<=0&&(c=a('<span class="thumb"><span class="value"></span></span>'),a(this).after(c)),c.find(".value").html(a(this).val()),i=!0,a(this).addClass("active"),c.hasClass("active")||c.velocity({height:"30px",width:"30px",top:"-20px",marginLeft:"-15px"},{duration:300,easing:"easeOutExpo"}),"input"!==b.type&&(g=void 0===b.pageX||null===b.pageX?b.originalEvent.touches[0].pageX-a(this).offset().left:b.pageX-a(this).offset().left,g<0?g=0:g>d&&(g=d),c.addClass("active").css("left",g)),c.find(".value").html(a(this).val())}),a(document).on("mouseup touchend",j,function(){i=!1,a(this).removeClass("active")}),a(document).on("mousemove touchmove",j,function(b){var c,d=a(this).children(".thumb");if(i){d.hasClass("active")||d.velocity({height:"30px",width:"30px",top:"-20px",marginLeft:"-15px"},{duration:300,easing:"easeOutExpo"}),c=void 0===b.pageX||null===b.pageX?b.originalEvent.touches[0].pageX-a(this).offset().left:b.pageX-a(this).offset().left;var e=a(this).outerWidth();c<0?c=0:c>e&&(c=e),d.addClass("active").css("left",c),d.find(".value").html(d.siblings(h).val())}}),a(document).on("mouseout touchleave",j,function(){if(!i){var b=a(this).children(".thumb");b.hasClass("active")&&b.velocity({height:"0",width:"0",top:"10px",marginLeft:"-6px"},{duration:100}),b.removeClass("active")}}),a.fn.autocomplete=function(b){var c={data:{},limit:1/0,onAutocomplete:null};return b=a.extend(c,b),this.each(function(){var c,d=a(this),e=b.data,f=0,g=0,h=d.closest(".input-field");if(!a.isEmptyObject(e)){var i,j=a('<ul class="autocomplete-content dropdown-content"></ul>');h.length?(i=h.children(".autocomplete-content.dropdown-content").first(),i.length||h.append(j)):(i=d.next(".autocomplete-content.dropdown-content"),i.length||d.after(j)),i.length&&(j=i);var k=function(a,b){var c=b.find("img"),d=b.text().toLowerCase().indexOf(""+a.toLowerCase()),e=d+a.length-1,f=b.text().slice(0,d),g=b.text().slice(d,e+1),h=b.text().slice(e+1);b.html("<span>"+f+"<span class='highlight'>"+g+"</span>"+h+"</span>"),c.length&&b.prepend(c)},l=function(){g=0,j.find(".active").removeClass("active")};d.off("keyup.autocomplete").on("keyup.autocomplete",function(g){if(f=0,13!==g.which&&38!==g.which&&40!==g.which){var h=d.val().toLowerCase();if(c!==h&&(j.empty(),l(),""!==h))for(var i in e)if(e.hasOwnProperty(i)&&i.toLowerCase().indexOf(h)!==-1&&i.toLowerCase()!==h){if(f>=b.limit)break;var m=a("<li></li>");e[i]?m.append('<img src="'+e[i]+'" class="right circle"><span>'+i+"</span>"):m.append("<span>"+i+"</span>"),j.append(m),k(h,m),f++}c=h}}),d.off("keydown.autocomplete").on("keydown.autocomplete",function(a){var b,c=a.which,d=j.children("li").length,e=j.children(".active").first();return 13===c?(b=j.children("li").eq(g),void(b.length&&(b.click(),a.preventDefault()))):void(38!==c&&40!==c||(a.preventDefault(),38===c&&g>0&&g--,40===c&&g<d-1&&e.length&&g++,e.removeClass("active"),j.children("li").eq(g).addClass("active")))}),j.on("click","li",function(){var c=a(this).text().trim();d.val(c),d.trigger("change"),j.empty(),l(),"function"==typeof b.onAutocomplete&&b.onAutocomplete.call(this,c)})}})}}),a.fn.material_select=function(b){function c(a,b,c){var e=a.indexOf(b),f=e===-1;return f?a.push(b):a.splice(e,1),c.siblings("ul.dropdown-content").find("li").eq(b).toggleClass("active"),c.find("option").eq(b).prop("selected",f),d(a,c),f}function d(a,b){
+for(var c="",d=0,e=a.length;d<e;d++){var f=b.find("option").eq(a[d]).text();c+=0===d?f:", "+f}""===c&&(c=b.find("option:disabled").eq(0).text()),b.siblings("input.select-dropdown").val(c)}a(this).each(function(){var d=a(this);if(!d.hasClass("browser-default")){var e=!!d.attr("multiple"),f=d.data("select-id");if(f&&(d.parent().find("span.caret").remove(),d.parent().find("input").remove(),d.unwrap(),a("ul#select-options-"+f).remove()),"destroy"===b)return void d.data("select-id",null).removeClass("initialized");var g=Materialize.guid();d.data("select-id",g);var h=a('<div class="select-wrapper"></div>');h.addClass(d.attr("class"));var i=a('<ul id="select-options-'+g+'" class="dropdown-content select-dropdown '+(e?"multiple-select-dropdown":"")+'"></ul>'),j=d.children("option, optgroup"),k=[],l=!1,m=d.find("option:selected").html()||d.find("option:first").html()||"",n=function(b,c,d){var e=c.is(":disabled")?"disabled ":"",f="optgroup-option"===d?"optgroup-option ":"",g=c.data("icon"),h=c.attr("class");if(g){var j="";return h&&(j=' class="'+h+'"'),"multiple"===d?i.append(a('<li class="'+e+'"><img alt="" src="'+g+'"'+j+'><span><input type="checkbox"'+e+"/><label></label>"+c.html()+"</span></li>")):i.append(a('<li class="'+e+f+'"><img alt="" src="'+g+'"'+j+"><span>"+c.html()+"</span></li>")),!0}"multiple"===d?i.append(a('<li class="'+e+'"><span><input type="checkbox"'+e+"/><label></label>"+c.html()+"</span></li>")):i.append(a('<li class="'+e+f+'"><span>'+c.html()+"</span></li>"))};j.length&&j.each(function(){if(a(this).is("option"))e?n(d,a(this),"multiple"):n(d,a(this));else if(a(this).is("optgroup")){var b=a(this).children("option");i.append(a('<li class="optgroup"><span>'+a(this).attr("label")+"</span></li>")),b.each(function(){n(d,a(this),"optgroup-option")})}}),i.find("li:not(.optgroup)").each(function(f){a(this).click(function(g){if(!a(this).hasClass("disabled")&&!a(this).hasClass("optgroup")){var h=!0;e?(a('input[type="checkbox"]',this).prop("checked",function(a,b){return!b}),h=c(k,a(this).index(),d),q.trigger("focus")):(i.find("li").removeClass("active"),a(this).toggleClass("active"),q.val(a(this).text())),r(i,a(this)),d.find("option").eq(f).prop("selected",h),d.trigger("change"),"undefined"!=typeof b&&b()}g.stopPropagation()})}),d.wrap(h);var o=a('<span class="caret">&#9660;</span>');d.is(":disabled")&&o.addClass("disabled");var p=m.replace(/"/g,"&quot;"),q=a('<input type="text" class="select-dropdown" readonly="true" '+(d.is(":disabled")?"disabled":"")+' data-activates="select-options-'+g+'" value="'+p+'"/>');d.before(q),q.before(o),q.after(i),d.is(":disabled")||q.dropdown({hover:!1,closeOnClick:!1}),d.attr("tabindex")&&a(q[0]).attr("tabindex",d.attr("tabindex")),d.addClass("initialized"),q.on({focus:function(){if(a("ul.select-dropdown").not(i[0]).is(":visible")&&a("input.select-dropdown").trigger("close"),!i.is(":visible")){a(this).trigger("open",["focus"]);var b=a(this).val();e&&b.indexOf(",")>=0&&(b=b.split(",")[0]);var c=i.find("li").filter(function(){return a(this).text().toLowerCase()===b.toLowerCase()})[0];r(i,c,!0)}},click:function(a){a.stopPropagation()}}),q.on("blur",function(){e||a(this).trigger("close"),i.find("li.selected").removeClass("selected")}),i.hover(function(){l=!0},function(){l=!1}),a(window).on({click:function(){e&&(l||q.trigger("close"))}}),e&&d.find("option:selected:not(:disabled)").each(function(){var b=a(this).index();c(k,b,d),i.find("li").eq(b).find(":checkbox").prop("checked",!0)});var r=function(b,c,d){if(c){b.find("li.selected").removeClass("selected");var f=a(c);f.addClass("selected"),e&&!d||i.scrollTo(f)}},s=[],t=function(b){if(9==b.which)return void q.trigger("close");if(40==b.which&&!i.is(":visible"))return void q.trigger("open");if(13!=b.which||i.is(":visible")){b.preventDefault();var c=String.fromCharCode(b.which).toLowerCase(),d=[9,13,27,38,40];if(c&&d.indexOf(b.which)===-1){s.push(c);var f=s.join(""),g=i.find("li").filter(function(){return 0===a(this).text().toLowerCase().indexOf(f)})[0];g&&r(i,g)}if(13==b.which){var h=i.find("li.selected:not(.disabled)")[0];h&&(a(h).trigger("click"),e||q.trigger("close"))}40==b.which&&(g=i.find("li.selected").length?i.find("li.selected").next("li:not(.disabled)")[0]:i.find("li:not(.disabled)")[0],r(i,g)),27==b.which&&q.trigger("close"),38==b.which&&(g=i.find("li.selected").prev("li:not(.disabled)")[0],g&&r(i,g)),setTimeout(function(){s=[]},1e3)}};q.on("keydown",t)}})}}(jQuery),function(a){var b={init:function(b){var c={indicators:!0,height:400,transition:500,interval:6e3};return b=a.extend(c,b),this.each(function(){function c(a,b){a.hasClass("center-align")?a.velocity({opacity:0,translateY:-100},{duration:b,queue:!1}):a.hasClass("right-align")?a.velocity({opacity:0,translateX:100},{duration:b,queue:!1}):a.hasClass("left-align")&&a.velocity({opacity:0,translateX:-100},{duration:b,queue:!1})}function d(a){a>=j.length?a=0:a<0&&(a=j.length-1),k=i.find(".active").index(),k!=a&&(e=j.eq(k),$caption=e.find(".caption"),e.removeClass("active"),e.velocity({opacity:0},{duration:b.transition,queue:!1,easing:"easeOutQuad",complete:function(){j.not(".active").velocity({opacity:0,translateX:0,translateY:0},{duration:0,queue:!1})}}),c($caption,b.transition),b.indicators&&f.eq(k).removeClass("active"),j.eq(a).velocity({opacity:1},{duration:b.transition,queue:!1,easing:"easeOutQuad"}),j.eq(a).find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:b.transition,delay:b.transition,queue:!1,easing:"easeOutQuad"}),j.eq(a).addClass("active"),b.indicators&&f.eq(a).addClass("active"))}var e,f,g,h=a(this),i=h.find("ul.slides").first(),j=i.find("> li"),k=i.find(".active").index();k!=-1&&(e=j.eq(k)),h.hasClass("fullscreen")||(b.indicators?h.height(b.height+40):h.height(b.height),i.height(b.height)),j.find(".caption").each(function(){c(a(this),0)}),j.find("img").each(function(){var b="data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==";a(this).attr("src")!==b&&(a(this).css("background-image","url("+a(this).attr("src")+")"),a(this).attr("src",b))}),b.indicators&&(f=a('<ul class="indicators"></ul>'),j.each(function(c){var e=a('<li class="indicator-item"></li>');e.click(function(){var c=i.parent(),e=c.find(a(this)).index();d(e),clearInterval(g),g=setInterval(function(){k=i.find(".active").index(),j.length==k+1?k=0:k+=1,d(k)},b.transition+b.interval)}),f.append(e)}),h.append(f),f=h.find("ul.indicators").find("li.indicator-item")),e?e.show():(j.first().addClass("active").velocity({opacity:1},{duration:b.transition,queue:!1,easing:"easeOutQuad"}),k=0,e=j.eq(k),b.indicators&&f.eq(k).addClass("active")),e.find("img").each(function(){e.find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:b.transition,queue:!1,easing:"easeOutQuad"})}),g=setInterval(function(){k=i.find(".active").index(),d(k+1)},b.transition+b.interval);var l=!1,m=!1,n=!1;h.hammer({prevent_default:!1}).bind("pan",function(a){if("touch"===a.gesture.pointerType){clearInterval(g);var b=a.gesture.direction,c=a.gesture.deltaX,d=a.gesture.velocityX,e=a.gesture.velocityY;$curr_slide=i.find(".active"),Math.abs(d)>Math.abs(e)&&$curr_slide.velocity({translateX:c},{duration:50,queue:!1,easing:"easeOutQuad"}),4===b&&(c>h.innerWidth()/2||d<-.65)?n=!0:2===b&&(c<-1*h.innerWidth()/2||d>.65)&&(m=!0);var f;m&&(f=$curr_slide.next(),0===f.length&&(f=j.first()),f.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"})),n&&(f=$curr_slide.prev(),0===f.length&&(f=j.last()),f.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"}))}}).bind("panend",function(a){"touch"===a.gesture.pointerType&&($curr_slide=i.find(".active"),l=!1,curr_index=i.find(".active").index(),!n&&!m||j.length<=1?$curr_slide.velocity({translateX:0},{duration:300,queue:!1,easing:"easeOutQuad"}):m?(d(curr_index+1),$curr_slide.velocity({translateX:-1*h.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})):n&&(d(curr_index-1),$curr_slide.velocity({translateX:h.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})),m=!1,n=!1,clearInterval(g),g=setInterval(function(){k=i.find(".active").index(),j.length==k+1?k=0:k+=1,d(k)},b.transition+b.interval))}),h.on("sliderPause",function(){clearInterval(g)}),h.on("sliderStart",function(){clearInterval(g),g=setInterval(function(){k=i.find(".active").index(),j.length==k+1?k=0:k+=1,d(k)},b.transition+b.interval)}),h.on("sliderNext",function(){k=i.find(".active").index(),d(k+1)}),h.on("sliderPrev",function(){k=i.find(".active").index(),d(k-1)})})},pause:function(){a(this).trigger("sliderPause")},start:function(){a(this).trigger("sliderStart")},next:function(){a(this).trigger("sliderNext")},prev:function(){a(this).trigger("sliderPrev")}};a.fn.slider=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.tooltip"):b.init.apply(this,arguments)}}(jQuery),function(a){a(document).ready(function(){a(document).on("click.card",".card",function(b){a(this).find("> .card-reveal").length&&(a(b.target).is(a(".card-reveal .card-title"))||a(b.target).is(a(".card-reveal .card-title i"))?a(this).find(".card-reveal").velocity({translateY:0},{duration:225,queue:!1,easing:"easeInOutQuad",complete:function(){a(this).css({display:"none"})}}):(a(b.target).is(a(".card .activator"))||a(b.target).is(a(".card .activator i")))&&(a(b.target).closest(".card").css("overflow","hidden"),a(this).find(".card-reveal").css({display:"block"}).velocity("stop",!1).velocity({translateY:"-100%"},{duration:300,queue:!1,easing:"easeInOutQuad"})))})})}(jQuery),function(a){var b={data:[],placeholder:"",secondaryPlaceholder:"",autocompleteData:{},autocompleteLimit:1/0};a(document).ready(function(){a(document).on("click",".chip .close",function(b){var c=a(this).closest(".chips");c.attr("data-initialized")||a(this).closest(".chip").remove()})}),a.fn.material_chip=function(c){var d=this;if(this.$el=a(this),this.$document=a(document),this.SELS={CHIPS:".chips",CHIP:".chip",INPUT:"input",DELETE:".material-icons",SELECTED_CHIP:".selected"},"data"===c)return this.$el.data("chips");var e=a.extend({},b,c);d.hasAutocomplete=!a.isEmptyObject(e.autocompleteData),this.init=function(){var b=0;d.$el.each(function(){var c=a(this),f=Materialize.guid();d.chipId=f,e.data&&e.data instanceof Array||(e.data=[]),c.data("chips",e.data),c.attr("data-index",b),c.attr("data-initialized",!0),c.hasClass(d.SELS.CHIPS)||c.addClass("chips"),d.chips(c,f),b++})},this.handleEvents=function(){var b=d.SELS;d.$document.off("click.chips-focus",b.CHIPS).on("click.chips-focus",b.CHIPS,function(c){a(c.target).find(b.INPUT).focus()}),d.$document.off("click.chips-select",b.CHIP).on("click.chips-select",b.CHIP,function(c){var e=a(c.target);if(e.length){var f=e.hasClass("selected"),g=e.closest(b.CHIPS);a(b.CHIP).removeClass("selected"),f||d.selectChip(e.index(),g)}}),d.$document.off("keydown.chips").on("keydown.chips",function(c){if(!a(c.target).is("input, textarea")){var e,f=d.$document.find(b.CHIP+b.SELECTED_CHIP),g=f.closest(b.CHIPS),h=f.siblings(b.CHIP).length;if(f.length)if(8===c.which||46===c.which){c.preventDefault(),e=f.index(),d.deleteChip(e,g);var i=null;e+1<h?i=e:e!==h&&e+1!==h||(i=h-1),i<0&&(i=null),null!==i&&d.selectChip(i,g),h||g.find("input").focus()}else if(37===c.which){if(e=f.index()-1,e<0)return;a(b.CHIP).removeClass("selected"),d.selectChip(e,g)}else if(39===c.which){if(e=f.index()+1,a(b.CHIP).removeClass("selected"),e>h)return void g.find("input").focus();d.selectChip(e,g)}}}),d.$document.off("focusin.chips",b.CHIPS+" "+b.INPUT).on("focusin.chips",b.CHIPS+" "+b.INPUT,function(c){var d=a(c.target).closest(b.CHIPS);d.addClass("focus"),d.siblings("label, .prefix").addClass("active"),a(b.CHIP).removeClass("selected")}),d.$document.off("focusout.chips",b.CHIPS+" "+b.INPUT).on("focusout.chips",b.CHIPS+" "+b.INPUT,function(c){var d=a(c.target).closest(b.CHIPS);d.removeClass("focus"),d.data("chips").length||d.siblings("label").removeClass("active"),d.siblings(".prefix").removeClass("active")}),d.$document.off("keydown.chips-add",b.CHIPS+" "+b.INPUT).on("keydown.chips-add",b.CHIPS+" "+b.INPUT,function(c){var e=a(c.target),f=e.closest(b.CHIPS),g=f.children(b.CHIP).length;if(13===c.which){if(d.hasAutocomplete&&f.find(".autocomplete-content.dropdown-content").length&&f.find(".autocomplete-content.dropdown-content").children().length)return;return c.preventDefault(),d.addChip({tag:e.val()},f),void e.val("")}if((8===c.keyCode||37===c.keyCode)&&""===e.val()&&g)return c.preventDefault(),d.selectChip(g-1,f),void e.blur()}),d.$document.off("click.chips-delete",b.CHIPS+" "+b.DELETE).on("click.chips-delete",b.CHIPS+" "+b.DELETE,function(c){var e=a(c.target),f=e.closest(b.CHIPS),g=e.closest(b.CHIP);c.stopPropagation(),d.deleteChip(g.index(),f),f.find("input").focus()})},this.chips=function(b,c){var f="";b.data("chips").forEach(function(a){f+=d.renderChip(a)}),f+='<input id="'+c+'" class="input" placeholder="">',b.html(f),d.setPlaceholder(b);var g=b.next("label");g.length&&(g.attr("for",c),b.data("chips").length&&g.addClass("active"));var h=a("#"+c);d.hasAutocomplete&&h.autocomplete({data:e.autocompleteData,limit:e.autocompleteLimit,onAutocomplete:function(a){d.addChip({tag:a},b),h.val(""),h.focus()}})},this.renderChip=function(a){if(a.tag){var b='<div class="chip">'+a.tag;return a.image&&(b+=' <img src="'+a.image+'"> '),b+='<i class="material-icons close">close</i>',b+="</div>"}},this.setPlaceholder=function(a){a.data("chips").length&&e.placeholder?a.find("input").prop("placeholder",e.placeholder):!a.data("chips").length&&e.secondaryPlaceholder&&a.find("input").prop("placeholder",e.secondaryPlaceholder)},this.isValid=function(a,b){for(var c=a.data("chips"),d=!1,e=0;e<c.length;e++)if(c[e].tag===b.tag)return void(d=!0);return""!==b.tag&&!d},this.addChip=function(b,c){if(d.isValid(c,b)){for(var e=d.renderChip(b),f=[],g=c.data("chips"),h=0;h<g.length;h++)f.push(g[h]);f.push(b),c.data("chips",f),a(e).insertBefore(c.find("input")),c.trigger("chip.add",b),d.setPlaceholder(c)}},this.deleteChip=function(a,b){var c=b.data("chips")[a];b.find(".chip").eq(a).remove();for(var e=[],f=b.data("chips"),g=0;g<f.length;g++)g!==a&&e.push(f[g]);b.data("chips",e),b.trigger("chip.delete",c),d.setPlaceholder(b)},this.selectChip=function(a,b){var c=b.find(".chip").eq(a);c&&!1===c.hasClass("selected")&&(c.addClass("selected"),b.trigger("chip.select",b.data("chips")[a]))},this.getChipsElement=function(a,b){return b.eq(a)},this.init(),this.handleEvents()}}(jQuery),function(a){a.fn.pushpin=function(b){var c={top:0,bottom:1/0,offset:0};return"remove"===b?(this.each(function(){(id=a(this).data("pushpin-id"))&&(a(window).off("scroll."+id),a(this).removeData("pushpin-id").removeClass("pin-top pinned pin-bottom").removeAttr("style"))}),!1):(b=a.extend(c,b),$index=0,this.each(function(){function c(a){a.removeClass("pin-top"),a.removeClass("pinned"),a.removeClass("pin-bottom")}function d(d,e){d.each(function(){b.top<=e&&b.bottom>=e&&!a(this).hasClass("pinned")&&(c(a(this)),a(this).css("top",b.offset),a(this).addClass("pinned")),e<b.top&&!a(this).hasClass("pin-top")&&(c(a(this)),a(this).css("top",0),a(this).addClass("pin-top")),e>b.bottom&&!a(this).hasClass("pin-bottom")&&(c(a(this)),a(this).addClass("pin-bottom"),a(this).css("top",b.bottom-g))})}var e=Materialize.guid(),f=a(this),g=a(this).offset().top;a(this).data("pushpin-id",e),d(f,a(window).scrollTop()),a(window).on("scroll."+e,function(){var c=a(window).scrollTop()+b.offset;d(f,c)})}))}}(jQuery),function(a){a(document).ready(function(){a.fn.reverse=[].reverse,a(document).on("mouseenter.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(c){var d=a(this);b(d)}),a(document).on("mouseleave.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(b){var d=a(this);c(d)}),a(document).on("click.fabClickToggle",".fixed-action-btn.click-to-toggle > a",function(d){var e=a(this),f=e.parent();f.hasClass("active")?c(f):b(f)}),a(document).on("click.fabToolbar",".fixed-action-btn.toolbar > a",function(b){var c=a(this),e=c.parent();d(e)})}),a.fn.extend({openFAB:function(){b(a(this))},closeFAB:function(){c(a(this))},openToolbar:function(){d(a(this))},closeToolbar:function(){e(a(this))}});var b=function(b){var c=b;if(c.hasClass("active")===!1){var d,e,f=c.hasClass("horizontal");f===!0?e=40:d=40,c.addClass("active"),c.find("ul .btn-floating").velocity({scaleY:".4",scaleX:".4",translateY:d+"px",translateX:e+"px"},{duration:0});var g=0;c.find("ul .btn-floating").reverse().each(function(){a(this).velocity({opacity:"1",scaleX:"1",scaleY:"1",translateY:"0",translateX:"0"},{duration:80,delay:g}),g+=40})}},c=function(a){var b,c,d=a,e=d.hasClass("horizontal");e===!0?c=40:b=40,d.removeClass("active");d.find("ul .btn-floating").velocity("stop",!0),d.find("ul .btn-floating").velocity({opacity:"0",scaleX:".4",scaleY:".4",translateY:b+"px",translateX:c+"px"},{duration:80})},d=function(b){if("true"!==b.attr("data-open")){var c,d,f,g=window.innerWidth,h=window.innerHeight,i=b[0].getBoundingClientRect(),j=b.find("> a").first(),k=b.find("> ul").first(),l=a('<div class="fab-backdrop"></div>'),m=j.css("background-color");j.append(l),c=i.left-g/2+i.width/2,d=h-i.bottom,f=g/l.width(),b.attr("data-origin-bottom",i.bottom),b.attr("data-origin-left",i.left),b.attr("data-origin-width",i.width),b.addClass("active"),b.attr("data-open",!0),b.css({"text-align":"center",width:"100%",bottom:0,left:0,transform:"translateX("+c+"px)",transition:"none"}),j.css({transform:"translateY("+-d+"px)",transition:"none"}),l.css({"background-color":m}),setTimeout(function(){b.css({transform:"",transition:"transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s"}),j.css({overflow:"visible",transform:"",transition:"transform .2s"}),setTimeout(function(){b.css({overflow:"hidden","background-color":m}),l.css({transform:"scale("+f+")",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"}),k.find("> li > a").css({opacity:1}),a(window).on("scroll.fabToolbarClose",function(){e(b),a(window).off("scroll.fabToolbarClose"),a(document).off("click.fabToolbarClose")}),a(document).on("click.fabToolbarClose",function(c){a(c.target).closest(k).length||(e(b),a(window).off("scroll.fabToolbarClose"),a(document).off("click.fabToolbarClose"))})},100)},0)}},e=function(a){if("true"===a.attr("data-open")){var b,c,d,e=window.innerWidth,f=window.innerHeight,g=a.attr("data-origin-width"),h=a.attr("data-origin-bottom"),i=a.attr("data-origin-left"),j=a.find("> .btn-floating").first(),k=a.find("> ul").first(),l=a.find(".fab-backdrop"),m=j.css("background-color");b=i-e/2+g/2,c=f-h,d=e/l.width(),a.removeClass("active"),a.attr("data-open",!1),a.css({"background-color":"transparent",transition:"none"}),j.css({transition:"none"}),l.css({transform:"scale(0)","background-color":m}),k.find("> li > a").css({opacity:""}),setTimeout(function(){l.remove(),a.css({"text-align":"",width:"",bottom:"",left:"",overflow:"","background-color":"",transform:"translate3d("+-b+"px,0,0)"}),j.css({overflow:"",transform:"translate3d(0,"+c+"px,0)"}),setTimeout(function(){a.css({transform:"translate3d(0,0,0)",transition:"transform .2s"}),j.css({transform:"translate3d(0,0,0)",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"})},20)},200)}}}(jQuery),function(a){Materialize.fadeInImage=function(b){var c;if("string"==typeof b)c=a(b);else{if("object"!=typeof b)return;c=b}c.css({opacity:0}),a(c).velocity({opacity:1},{duration:650,queue:!1,easing:"easeOutSine"}),a(c).velocity({opacity:1},{duration:1300,queue:!1,easing:"swing",step:function(b,c){c.start=100;var d=b/100,e=150-(100-b)/1.75;e<100&&(e=100),b>=0&&a(this).css({"-webkit-filter":"grayscale("+d+")brightness("+e+"%)",filter:"grayscale("+d+")brightness("+e+"%)"})}})},Materialize.showStaggeredList=function(b){var c;if("string"==typeof b)c=a(b);else{if("object"!=typeof b)return;c=b}var d=0;c.find("li").velocity({translateX:"-100px"},{duration:0}),c.find("li").each(function(){a(this).velocity({opacity:"1",translateX:"0"},{duration:800,delay:d,easing:[60,10]}),d+=120})},a(document).ready(function(){var b=!1,c=!1;a(".dismissable").each(function(){a(this).hammer({prevent_default:!1}).bind("pan",function(d){if("touch"===d.gesture.pointerType){var e=a(this),f=d.gesture.direction,g=d.gesture.deltaX,h=d.gesture.velocityX;e.velocity({translateX:g},{duration:50,queue:!1,easing:"easeOutQuad"}),4===f&&(g>e.innerWidth()/2||h<-.75)&&(b=!0),2===f&&(g<-1*e.innerWidth()/2||h>.75)&&(c=!0)}}).bind("panend",function(d){if(Math.abs(d.gesture.deltaX)<a(this).innerWidth()/2&&(c=!1,b=!1),"touch"===d.gesture.pointerType){var e=a(this);if(b||c){var f;f=b?e.innerWidth():-1*e.innerWidth(),e.velocity({translateX:f},{duration:100,queue:!1,easing:"easeOutQuad",complete:function(){e.css("border","none"),e.velocity({height:0,padding:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){e.remove()}})}})}else e.velocity({translateX:0},{duration:100,queue:!1,easing:"easeOutQuad"});b=!1,c=!1}})})})}(jQuery),function(a){var b=!1;Materialize.scrollFire=function(a){var c=function(){for(var b=window.pageYOffset+window.innerHeight,c=0;c<a.length;c++){var d=a[c],e=d.selector,f=d.offset,g=d.callback,h=document.querySelector(e);if(null!==h){var i=h.getBoundingClientRect().top+window.pageYOffset;if(b>i+f&&d.done!==!0){if("function"==typeof g)g.call(this,h);else if("string"==typeof g){var j=new Function(g);j(h)}d.done=!0}}}},d=Materialize.throttle(function(){c()},a.throttle||100);b||(window.addEventListener("scroll",d),window.addEventListener("resize",d),b=!0),setTimeout(d,0)}}(jQuery),function(a){"function"==typeof define&&define.amd?define("picker",["jquery"],a):"object"==typeof exports?module.exports=a(require("jquery")):this.Picker=a(jQuery)}(function(a){function b(f,g,i,l){function m(){return b._.node("div",b._.node("div",b._.node("div",b._.node("div",y.component.nodes(t.open),v.box),v.wrap),v.frame),v.holder)}function n(){w.data(g,y).addClass(v.input).attr("tabindex",-1).val(w.data("value")?y.get("select",u.format):f.value),u.editable||w.on("focus."+t.id+" click."+t.id,function(a){a.preventDefault(),y.$root.eq(0).focus()}).on("keydown."+t.id,q),e(f,{haspopup:!0,expanded:!1,readonly:!1,owns:f.id+"_root"})}function o(){y.$root.on({keydown:q,focusin:function(a){y.$root.removeClass(v.focused),a.stopPropagation()},"mousedown click":function(b){var c=b.target;c!=y.$root.children()[0]&&(b.stopPropagation(),"mousedown"!=b.type||a(c).is("input, select, textarea, button, option")||(b.preventDefault(),y.$root.eq(0).focus()))}}).on({focus:function(){w.addClass(v.target)},blur:function(){w.removeClass(v.target)}}).on("focus.toOpen",r).on("click","[data-pick], [data-nav], [data-clear], [data-close]",function(){var b=a(this),c=b.data(),d=b.hasClass(v.navDisabled)||b.hasClass(v.disabled),e=h();e=e&&(e.type||e.href),(d||e&&!a.contains(y.$root[0],e))&&y.$root.eq(0).focus(),!d&&c.nav?y.set("highlight",y.component.item.highlight,{nav:c.nav}):!d&&"pick"in c?y.set("select",c.pick):c.clear?y.clear().close(!0):c.close&&y.close(!0)}),e(y.$root[0],"hidden",!0)}function p(){var b;u.hiddenName===!0?(b=f.name,f.name=""):(b=["string"==typeof u.hiddenPrefix?u.hiddenPrefix:"","string"==typeof u.hiddenSuffix?u.hiddenSuffix:"_submit"],b=b[0]+f.name+b[1]),y._hidden=a('<input type=hidden name="'+b+'"'+(w.data("value")||f.value?' value="'+y.get("select",u.formatSubmit)+'"':"")+">")[0],w.on("change."+t.id,function(){y._hidden.value=f.value?y.get("select",u.formatSubmit):""}),u.container?a(u.container).append(y._hidden):w.after(y._hidden)}function q(a){var b=a.keyCode,c=/^(8|46)$/.test(b);return 27==b?(y.close(),!1):void((32==b||c||!t.open&&y.component.key[b])&&(a.preventDefault(),a.stopPropagation(),c?y.clear().close():y.open()))}function r(a){a.stopPropagation(),"focus"==a.type&&y.$root.addClass(v.focused),y.open()}if(!f)return b;var s=!1,t={id:f.id||"P"+Math.abs(~~(Math.random()*new Date))},u=i?a.extend(!0,{},i.defaults,l):l||{},v=a.extend({},b.klasses(),u.klass),w=a(f),x=function(){return this.start()},y=x.prototype={constructor:x,$node:w,start:function(){return t&&t.start?y:(t.methods={},t.start=!0,t.open=!1,t.type=f.type,f.autofocus=f==h(),f.readOnly=!u.editable,f.id=f.id||t.id,"text"!=f.type&&(f.type="text"),y.component=new i(y,u),y.$root=a(b._.node("div",m(),v.picker,'id="'+f.id+'_root" tabindex="0"')),o(),u.formatSubmit&&p(),n(),u.container?a(u.container).append(y.$root):w.after(y.$root),y.on({start:y.component.onStart,render:y.component.onRender,stop:y.component.onStop,open:y.component.onOpen,close:y.component.onClose,set:y.component.onSet}).on({start:u.onStart,render:u.onRender,stop:u.onStop,open:u.onOpen,close:u.onClose,set:u.onSet}),s=c(y.$root.children()[0]),f.autofocus&&y.open(),y.trigger("start").trigger("render"))},render:function(a){return a?y.$root.html(m()):y.$root.find("."+v.box).html(y.component.nodes(t.open)),y.trigger("render")},stop:function(){return t.start?(y.close(),y._hidden&&y._hidden.parentNode.removeChild(y._hidden),y.$root.remove(),w.removeClass(v.input).removeData(g),setTimeout(function(){w.off("."+t.id)},0),f.type=t.type,f.readOnly=!1,y.trigger("stop"),t.methods={},t.start=!1,y):y},open:function(c){return t.open?y:(w.addClass(v.active),e(f,"expanded",!0),setTimeout(function(){y.$root.addClass(v.opened),e(y.$root[0],"hidden",!1)},0),c!==!1&&(t.open=!0,s&&k.css("overflow","hidden").css("padding-right","+="+d()),y.$root.eq(0).focus(),j.on("click."+t.id+" focusin."+t.id,function(a){var b=a.target;b!=f&&b!=document&&3!=a.which&&y.close(b===y.$root.children()[0])}).on("keydown."+t.id,function(c){var d=c.keyCode,e=y.component.key[d],f=c.target;27==d?y.close(!0):f!=y.$root[0]||!e&&13!=d?a.contains(y.$root[0],f)&&13==d&&(c.preventDefault(),f.click()):(c.preventDefault(),e?b._.trigger(y.component.key.go,y,[b._.trigger(e)]):y.$root.find("."+v.highlighted).hasClass(v.disabled)||y.set("select",y.component.item.highlight).close())})),y.trigger("open"))},close:function(a){return a&&(y.$root.off("focus.toOpen").eq(0).focus(),setTimeout(function(){y.$root.on("focus.toOpen",r)},0)),w.removeClass(v.active),e(f,"expanded",!1),setTimeout(function(){y.$root.removeClass(v.opened+" "+v.focused),e(y.$root[0],"hidden",!0)},0),t.open?(t.open=!1,s&&k.css("overflow","").css("padding-right","-="+d()),j.off("."+t.id),y.trigger("close")):y},clear:function(a){return y.set("clear",null,a)},set:function(b,c,d){var e,f,g=a.isPlainObject(b),h=g?b:{};if(d=g&&a.isPlainObject(c)?c:d||{},b){g||(h[b]=c);for(e in h)f=h[e],e in y.component.item&&(void 0===f&&(f=null),y.component.set(e,f,d)),"select"!=e&&"clear"!=e||w.val("clear"==e?"":y.get(e,u.format)).trigger("change");y.render()}return d.muted?y:y.trigger("set",h)},get:function(a,c){if(a=a||"value",null!=t[a])return t[a];if("valueSubmit"==a){if(y._hidden)return y._hidden.value;a="value"}if("value"==a)return f.value;if(a in y.component.item){if("string"==typeof c){var d=y.component.get(a);return d?b._.trigger(y.component.formats.toString,y.component,[c,d]):""}return y.component.get(a)}},on:function(b,c,d){var e,f,g=a.isPlainObject(b),h=g?b:{};if(b){g||(h[b]=c);for(e in h)f=h[e],d&&(e="_"+e),t.methods[e]=t.methods[e]||[],t.methods[e].push(f)}return y},off:function(){var a,b,c=arguments;for(a=0,namesCount=c.length;a<namesCount;a+=1)b=c[a],b in t.methods&&delete t.methods[b];return y},trigger:function(a,c){var d=function(a){var d=t.methods[a];d&&d.map(function(a){b._.trigger(a,y,[c])})};return d("_"+a),d(a),y}};return new x}function c(a){var b,c="position";return a.currentStyle?b=a.currentStyle[c]:window.getComputedStyle&&(b=getComputedStyle(a)[c]),"fixed"==b}function d(){if(k.height()<=i.height())return 0;var b=a('<div style="visibility:hidden;width:100px" />').appendTo("body"),c=b[0].offsetWidth;b.css("overflow","scroll");var d=a('<div style="width:100%" />').appendTo(b),e=d[0].offsetWidth;return b.remove(),c-e}function e(b,c,d){if(a.isPlainObject(c))for(var e in c)f(b,e,c[e]);else f(b,c,d)}function f(a,b,c){a.setAttribute(("role"==b?"":"aria-")+b,c)}function g(b,c){a.isPlainObject(b)||(b={attribute:c}),c="";for(var d in b){var e=("role"==d?"":"aria-")+d,f=b[d];c+=null==f?"":e+'="'+b[d]+'"'}return c}function h(){try{return document.activeElement}catch(a){}}var i=a(window),j=a(document),k=a(document.documentElement);return b.klasses=function(a){return a=a||"picker",{picker:a,opened:a+"--opened",focused:a+"--focused",input:a+"__input",active:a+"__input--active",target:a+"__input--target",holder:a+"__holder",frame:a+"__frame",wrap:a+"__wrap",box:a+"__box"}},b._={group:function(a){for(var c,d="",e=b._.trigger(a.min,a);e<=b._.trigger(a.max,a,[e]);e+=a.i)c=b._.trigger(a.item,a,[e]),d+=b._.node(a.node,c[0],c[1],c[2]);return d},node:function(b,c,d,e){return c?(c=a.isArray(c)?c.join(""):c,d=d?' class="'+d+'"':"",e=e?" "+e:"","<"+b+d+e+">"+c+"</"+b+">"):""},lead:function(a){return(a<10?"0":"")+a},trigger:function(a,b,c){return"function"==typeof a?a.apply(b,c||[]):a},digits:function(a){return/\d/.test(a[1])?2:1},isDate:function(a){return{}.toString.call(a).indexOf("Date")>-1&&this.isInteger(a.getDate())},isInteger:function(a){return{}.toString.call(a).indexOf("Number")>-1&&a%1===0},ariaAttr:g},b.extend=function(c,d){a.fn[c]=function(e,f){var g=this.data(c);return"picker"==e?g:g&&"string"==typeof e?b._.trigger(g[e],g,[f]):this.each(function(){var f=a(this);f.data(c)||new b(this,c,d,e)})},a.fn[c].defaults=d.defaults},b}),function(a){"function"==typeof define&&define.amd?define(["picker","jquery"],a):"object"==typeof exports?module.exports=a(require("./picker.js"),require("jquery")):a(Picker,jQuery)}(function(a,b){function c(a,b){var c=this,d=a.$node[0],e=d.value,f=a.$node.data("value"),g=f||e,h=f?b.formatSubmit:b.format,i=function(){return d.currentStyle?"rtl"==d.currentStyle.direction:"rtl"==getComputedStyle(a.$root[0]).direction};c.settings=b,c.$node=a.$node,c.queue={min:"measure create",max:"measure create",now:"now create",select:"parse create validate",highlight:"parse navigate create validate",view:"parse create validate viewset",disable:"deactivate",enable:"activate"},c.item={},c.item.clear=null,c.item.disable=(b.disable||[]).slice(0),c.item.enable=-function(a){return a[0]===!0?a.shift():-1}(c.item.disable),c.set("min",b.min).set("max",b.max).set("now"),g?c.set("select",g,{format:h}):c.set("select",null).set("highlight",c.item.now),c.key={40:7,38:-7,39:function(){return i()?-1:1},37:function(){return i()?1:-1},go:function(a){var b=c.item.highlight,d=new Date(b.year,b.month,b.date+a);c.set("highlight",d,{interval:a}),this.render()}},a.on("render",function(){a.$root.find("."+b.klass.selectMonth).on("change",function(){var c=this.value;c&&(a.set("highlight",[a.get("view").year,c,a.get("highlight").date]),a.$root.find("."+b.klass.selectMonth).trigger("focus"))}),a.$root.find("."+b.klass.selectYear).on("change",function(){var c=this.value;c&&(a.set("highlight",[c,a.get("view").month,a.get("highlight").date]),a.$root.find("."+b.klass.selectYear).trigger("focus"))})},1).on("open",function(){var d="";c.disabled(c.get("now"))&&(d=":not(."+b.klass.buttonToday+")"),a.$root.find("button"+d+", select").attr("disabled",!1)},1).on("close",function(){a.$root.find("button, select").attr("disabled",!0)},1)}var d=7,e=6,f=a._;c.prototype.set=function(a,b,c){var d=this,e=d.item;return null===b?("clear"==a&&(a="select"),e[a]=b,d):(e["enable"==a?"disable":"flip"==a?"enable":a]=d.queue[a].split(" ").map(function(e){return b=d[e](a,b,c)}).pop(),"select"==a?d.set("highlight",e.select,c):"highlight"==a?d.set("view",e.highlight,c):a.match(/^(flip|min|max|disable|enable)$/)&&(e.select&&d.disabled(e.select)&&d.set("select",e.select,c),e.highlight&&d.disabled(e.highlight)&&d.set("highlight",e.highlight,c)),d)},c.prototype.get=function(a){return this.item[a]},c.prototype.create=function(a,c,d){var e,g=this;return c=void 0===c?a:c,
+c==-(1/0)||c==1/0?e=c:b.isPlainObject(c)&&f.isInteger(c.pick)?c=c.obj:b.isArray(c)?(c=new Date(c[0],c[1],c[2]),c=f.isDate(c)?c:g.create().obj):c=f.isInteger(c)||f.isDate(c)?g.normalize(new Date(c),d):g.now(a,c,d),{year:e||c.getFullYear(),month:e||c.getMonth(),date:e||c.getDate(),day:e||c.getDay(),obj:e||c,pick:e||c.getTime()}},c.prototype.createRange=function(a,c){var d=this,e=function(a){return a===!0||b.isArray(a)||f.isDate(a)?d.create(a):a};return f.isInteger(a)||(a=e(a)),f.isInteger(c)||(c=e(c)),f.isInteger(a)&&b.isPlainObject(c)?a=[c.year,c.month,c.date+a]:f.isInteger(c)&&b.isPlainObject(a)&&(c=[a.year,a.month,a.date+c]),{from:e(a),to:e(c)}},c.prototype.withinRange=function(a,b){return a=this.createRange(a.from,a.to),b.pick>=a.from.pick&&b.pick<=a.to.pick},c.prototype.overlapRanges=function(a,b){var c=this;return a=c.createRange(a.from,a.to),b=c.createRange(b.from,b.to),c.withinRange(a,b.from)||c.withinRange(a,b.to)||c.withinRange(b,a.from)||c.withinRange(b,a.to)},c.prototype.now=function(a,b,c){return b=new Date,c&&c.rel&&b.setDate(b.getDate()+c.rel),this.normalize(b,c)},c.prototype.navigate=function(a,c,d){var e,f,g,h,i=b.isArray(c),j=b.isPlainObject(c),k=this.item.view;if(i||j){for(j?(f=c.year,g=c.month,h=c.date):(f=+c[0],g=+c[1],h=+c[2]),d&&d.nav&&k&&k.month!==g&&(f=k.year,g=k.month),e=new Date(f,g+(d&&d.nav?d.nav:0),1),f=e.getFullYear(),g=e.getMonth();new Date(f,g,h).getMonth()!==g;)h-=1;c=[f,g,h]}return c},c.prototype.normalize=function(a){return a.setHours(0,0,0,0),a},c.prototype.measure=function(a,b){var c=this;return b?"string"==typeof b?b=c.parse(a,b):f.isInteger(b)&&(b=c.now(a,b,{rel:b})):b="min"==a?-(1/0):1/0,b},c.prototype.viewset=function(a,b){return this.create([b.year,b.month,1])},c.prototype.validate=function(a,c,d){var e,g,h,i,j=this,k=c,l=d&&d.interval?d.interval:1,m=j.item.enable===-1,n=j.item.min,o=j.item.max,p=m&&j.item.disable.filter(function(a){if(b.isArray(a)){var d=j.create(a).pick;d<c.pick?e=!0:d>c.pick&&(g=!0)}return f.isInteger(a)}).length;if((!d||!d.nav)&&(!m&&j.disabled(c)||m&&j.disabled(c)&&(p||e||g)||!m&&(c.pick<=n.pick||c.pick>=o.pick)))for(m&&!p&&(!g&&l>0||!e&&l<0)&&(l*=-1);j.disabled(c)&&(Math.abs(l)>1&&(c.month<k.month||c.month>k.month)&&(c=k,l=l>0?1:-1),c.pick<=n.pick?(h=!0,l=1,c=j.create([n.year,n.month,n.date+(c.pick===n.pick?0:-1)])):c.pick>=o.pick&&(i=!0,l=-1,c=j.create([o.year,o.month,o.date+(c.pick===o.pick?0:1)])),!h||!i);)c=j.create([c.year,c.month,c.date+l]);return c},c.prototype.disabled=function(a){var c=this,d=c.item.disable.filter(function(d){return f.isInteger(d)?a.day===(c.settings.firstDay?d:d-1)%7:b.isArray(d)||f.isDate(d)?a.pick===c.create(d).pick:b.isPlainObject(d)?c.withinRange(d,a):void 0});return d=d.length&&!d.filter(function(a){return b.isArray(a)&&"inverted"==a[3]||b.isPlainObject(a)&&a.inverted}).length,c.item.enable===-1?!d:d||a.pick<c.item.min.pick||a.pick>c.item.max.pick},c.prototype.parse=function(a,b,c){var d=this,e={};return b&&"string"==typeof b?(c&&c.format||(c=c||{},c.format=d.settings.format),d.formats.toArray(c.format).map(function(a){var c=d.formats[a],g=c?f.trigger(c,d,[b,e]):a.replace(/^!/,"").length;c&&(e[a]=b.substr(0,g)),b=b.substr(g)}),[e.yyyy||e.yy,+(e.mm||e.m)-1,e.dd||e.d]):b},c.prototype.formats=function(){function a(a,b,c){var d=a.match(/\w+/)[0];return c.mm||c.m||(c.m=b.indexOf(d)+1),d.length}function b(a){return a.match(/\w+/)[0].length}return{d:function(a,b){return a?f.digits(a):b.date},dd:function(a,b){return a?2:f.lead(b.date)},ddd:function(a,c){return a?b(a):this.settings.weekdaysShort[c.day]},dddd:function(a,c){return a?b(a):this.settings.weekdaysFull[c.day]},m:function(a,b){return a?f.digits(a):b.month+1},mm:function(a,b){return a?2:f.lead(b.month+1)},mmm:function(b,c){var d=this.settings.monthsShort;return b?a(b,d,c):d[c.month]},mmmm:function(b,c){var d=this.settings.monthsFull;return b?a(b,d,c):d[c.month]},yy:function(a,b){return a?2:(""+b.year).slice(2)},yyyy:function(a,b){return a?4:b.year},toArray:function(a){return a.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)},toString:function(a,b){var c=this;return c.formats.toArray(a).map(function(a){return f.trigger(c.formats[a],c,[0,b])||a.replace(/^!/,"")}).join("")}}}(),c.prototype.isDateExact=function(a,c){var d=this;return f.isInteger(a)&&f.isInteger(c)||"boolean"==typeof a&&"boolean"==typeof c?a===c:(f.isDate(a)||b.isArray(a))&&(f.isDate(c)||b.isArray(c))?d.create(a).pick===d.create(c).pick:!(!b.isPlainObject(a)||!b.isPlainObject(c))&&(d.isDateExact(a.from,c.from)&&d.isDateExact(a.to,c.to))},c.prototype.isDateOverlap=function(a,c){var d=this,e=d.settings.firstDay?1:0;return f.isInteger(a)&&(f.isDate(c)||b.isArray(c))?(a=a%7+e,a===d.create(c).day+1):f.isInteger(c)&&(f.isDate(a)||b.isArray(a))?(c=c%7+e,c===d.create(a).day+1):!(!b.isPlainObject(a)||!b.isPlainObject(c))&&d.overlapRanges(a,c)},c.prototype.flipEnable=function(a){var b=this.item;b.enable=a||(b.enable==-1?1:-1)},c.prototype.deactivate=function(a,c){var d=this,e=d.item.disable.slice(0);return"flip"==c?d.flipEnable():c===!1?(d.flipEnable(1),e=[]):c===!0?(d.flipEnable(-1),e=[]):c.map(function(a){for(var c,g=0;g<e.length;g+=1)if(d.isDateExact(a,e[g])){c=!0;break}c||(f.isInteger(a)||f.isDate(a)||b.isArray(a)||b.isPlainObject(a)&&a.from&&a.to)&&e.push(a)}),e},c.prototype.activate=function(a,c){var d=this,e=d.item.disable,g=e.length;return"flip"==c?d.flipEnable():c===!0?(d.flipEnable(1),e=[]):c===!1?(d.flipEnable(-1),e=[]):c.map(function(a){var c,h,i,j;for(i=0;i<g;i+=1){if(h=e[i],d.isDateExact(h,a)){c=e[i]=null,j=!0;break}if(d.isDateOverlap(h,a)){b.isPlainObject(a)?(a.inverted=!0,c=a):b.isArray(a)?(c=a,c[3]||c.push("inverted")):f.isDate(a)&&(c=[a.getFullYear(),a.getMonth(),a.getDate(),"inverted"]);break}}if(c)for(i=0;i<g;i+=1)if(d.isDateExact(e[i],a)){e[i]=null;break}if(j)for(i=0;i<g;i+=1)if(d.isDateOverlap(e[i],a)){e[i]=null;break}c&&e.push(c)}),e.filter(function(a){return null!=a})},c.prototype.nodes=function(a){var b=this,c=b.settings,g=b.item,h=g.now,i=g.select,j=g.highlight,k=g.view,l=g.disable,m=g.min,n=g.max,o=function(a,b){return c.firstDay&&(a.push(a.shift()),b.push(b.shift())),f.node("thead",f.node("tr",f.group({min:0,max:d-1,i:1,node:"th",item:function(d){return[a[d],c.klass.weekdays,'scope=col title="'+b[d]+'"']}})))}((c.showWeekdaysFull?c.weekdaysFull:c.weekdaysLetter).slice(0),c.weekdaysFull.slice(0)),p=function(a){return f.node("div"," ",c.klass["nav"+(a?"Next":"Prev")]+(a&&k.year>=n.year&&k.month>=n.month||!a&&k.year<=m.year&&k.month<=m.month?" "+c.klass.navDisabled:""),"data-nav="+(a||-1)+" "+f.ariaAttr({role:"button",controls:b.$node[0].id+"_table"})+' title="'+(a?c.labelMonthNext:c.labelMonthPrev)+'"')},q=function(d){var e=c.showMonthsShort?c.monthsShort:c.monthsFull;return"short_months"==d&&(e=c.monthsShort),c.selectMonths&&void 0==d?f.node("select",f.group({min:0,max:11,i:1,node:"option",item:function(a){return[e[a],0,"value="+a+(k.month==a?" selected":"")+(k.year==m.year&&a<m.month||k.year==n.year&&a>n.month?" disabled":"")]}}),c.klass.selectMonth+" browser-default",(a?"":"disabled")+" "+f.ariaAttr({controls:b.$node[0].id+"_table"})+' title="'+c.labelMonthSelect+'"'):"short_months"==d?null!=i?f.node("div",e[i.month]):f.node("div",e[k.month]):f.node("div",e[k.month],c.klass.month)},r=function(d){var e=k.year,g=c.selectYears===!0?5:~~(c.selectYears/2);if(g){var h=m.year,i=n.year,j=e-g,l=e+g;if(h>j&&(l+=h-j,j=h),i<l){var o=j-h,p=l-i;j-=o>p?p:o,l=i}if(c.selectYears&&void 0==d)return f.node("select",f.group({min:j,max:l,i:1,node:"option",item:function(a){return[a,0,"value="+a+(e==a?" selected":"")]}}),c.klass.selectYear+" browser-default",(a?"":"disabled")+" "+f.ariaAttr({controls:b.$node[0].id+"_table"})+' title="'+c.labelYearSelect+'"')}return"raw"==d?f.node("div",e):f.node("div",e,c.klass.year)};return createDayLabel=function(){return null!=i?f.node("div",i.date):f.node("div",h.date)},createWeekdayLabel=function(){var a;a=null!=i?i.day:h.day;var b=c.weekdaysFull[a];return b},f.node("div",f.node("div",createWeekdayLabel(),"picker__weekday-display")+f.node("div",q("short_months"),c.klass.month_display)+f.node("div",createDayLabel(),c.klass.day_display)+f.node("div",r("raw"),c.klass.year_display),c.klass.date_display)+f.node("div",f.node("div",(c.selectYears?q()+r():q()+r())+p()+p(1),c.klass.header)+f.node("table",o+f.node("tbody",f.group({min:0,max:e-1,i:1,node:"tr",item:function(a){var e=c.firstDay&&0===b.create([k.year,k.month,1]).day?-7:0;return[f.group({min:d*a-k.day+e+1,max:function(){return this.min+d-1},i:1,node:"td",item:function(a){a=b.create([k.year,k.month,a+(c.firstDay?1:0)]);var d=i&&i.pick==a.pick,e=j&&j.pick==a.pick,g=l&&b.disabled(a)||a.pick<m.pick||a.pick>n.pick,o=f.trigger(b.formats.toString,b,[c.format,a]);return[f.node("div",a.date,function(b){return b.push(k.month==a.month?c.klass.infocus:c.klass.outfocus),h.pick==a.pick&&b.push(c.klass.now),d&&b.push(c.klass.selected),e&&b.push(c.klass.highlighted),g&&b.push(c.klass.disabled),b.join(" ")}([c.klass.day]),"data-pick="+a.pick+" "+f.ariaAttr({role:"gridcell",label:o,selected:!(!d||b.$node.val()!==o)||null,activedescendant:!!e||null,disabled:!!g||null})),"",f.ariaAttr({role:"presentation"})]}})]}})),c.klass.table,'id="'+b.$node[0].id+'_table" '+f.ariaAttr({role:"grid",controls:b.$node[0].id,readonly:!0})),c.klass.calendar_container)+f.node("div",f.node("button",c.today,"btn-flat picker__today","type=button data-pick="+h.pick+(a&&!b.disabled(h)?"":" disabled")+" "+f.ariaAttr({controls:b.$node[0].id}))+f.node("button",c.clear,"btn-flat picker__clear","type=button data-clear=1"+(a?"":" disabled")+" "+f.ariaAttr({controls:b.$node[0].id}))+f.node("button",c.close,"btn-flat picker__close","type=button data-close=true "+(a?"":" disabled")+" "+f.ariaAttr({controls:b.$node[0].id})),c.klass.footer)},c.defaults=function(a){return{labelMonthNext:"Next month",labelMonthPrev:"Previous month",labelMonthSelect:"Select a month",labelYearSelect:"Select a year",monthsFull:["January","February","March","April","May","June","July","August","September","October","November","December"],monthsShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],weekdaysFull:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],weekdaysShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],weekdaysLetter:["S","M","T","W","T","F","S"],today:"Today",clear:"Clear",close:"Close",format:"d mmmm, yyyy",klass:{table:a+"table",header:a+"header",date_display:a+"date-display",day_display:a+"day-display",month_display:a+"month-display",year_display:a+"year-display",calendar_container:a+"calendar-container",navPrev:a+"nav--prev",navNext:a+"nav--next",navDisabled:a+"nav--disabled",month:a+"month",year:a+"year",selectMonth:a+"select--month",selectYear:a+"select--year",weekdays:a+"weekday",day:a+"day",disabled:a+"day--disabled",selected:a+"day--selected",highlighted:a+"day--highlighted",now:a+"day--today",infocus:a+"day--infocus",outfocus:a+"day--outfocus",footer:a+"footer",buttonClear:a+"button--clear",buttonToday:a+"button--today",buttonClose:a+"button--close"}}}(a.klasses().picker+"__"),a.extend("pickadate",c)}),function(a){function b(){var b=+a(this).attr("data-length"),c=+a(this).val().length,d=c<=b;a(this).parent().find('span[class="character-counter"]').html(c+"/"+b),e(d,a(this))}function c(b){var c=b.parent().find('span[class="character-counter"]');c.length||(c=a("<span/>").addClass("character-counter").css("float","right").css("font-size","12px").css("height",1),b.parent().append(c))}function d(){a(this).parent().find('span[class="character-counter"]').html("")}function e(a,b){var c=b.hasClass("invalid");a&&c?b.removeClass("invalid"):a||c||(b.removeClass("valid"),b.addClass("invalid"))}a.fn.characterCounter=function(){return this.each(function(){var e=a(this),f=e.parent().find('span[class="character-counter"]');if(!f.length){var g=void 0!==e.attr("data-length");g&&(e.on("input",b),e.on("focus",b),e.on("blur",d),c(e))}})},a(document).ready(function(){a("input, textarea").characterCounter()})}(jQuery),function(a){var b={init:function(b){var c={duration:200,dist:-100,shift:0,padding:0,fullWidth:!1,indicators:!1,noWrap:!1,onCycleTo:null};return b=a.extend(c,b),this.each(function(){function c(){"undefined"!=typeof window.ontouchstart&&(J[0].addEventListener("touchstart",l),J[0].addEventListener("touchmove",m),J[0].addEventListener("touchend",n)),J[0].addEventListener("mousedown",l),J[0].addEventListener("mousemove",m),J[0].addEventListener("mouseup",n),J[0].addEventListener("mouseleave",n),J[0].addEventListener("click",j)}function d(a){return a.targetTouches&&a.targetTouches.length>=1?a.targetTouches[0].clientX:a.clientX}function e(a){return a.targetTouches&&a.targetTouches.length>=1?a.targetTouches[0].clientY:a.clientY}function f(a){return a>=v?a%v:a<0?f(v+a%v):a}function g(c){var d,e,g,h,i,j,k,l=s;if(r="number"==typeof c?c:r,s=Math.floor((r+u/2)/u),g=r-s*u,h=g<0?1:-1,i=-h*g*2/u,e=v>>1,b.fullWidth?k="translateX(0)":(k="translateX("+(J[0].clientWidth-p)/2+"px) ",k+="translateY("+(J[0].clientHeight-q)/2+"px)"),K){var m=s%v,n=I.find(".indicator-item.active");n.index()!==m&&(n.removeClass("active"),I.find(".indicator-item").eq(m).addClass("active"))}for((!b.noWrap||s>=0&&s<v)&&(j=o[f(s)],a(j).hasClass("active")||(J.find(".carousel-item").removeClass("active"),a(j).addClass("active")),j.style[C]=k+" translateX("+-g/2+"px) translateX("+h*b.shift*i*d+"px) translateZ("+b.dist*i+"px)",j.style.zIndex=0,b.fullWidth?tweenedOpacity=1:tweenedOpacity=1-.2*i,j.style.opacity=tweenedOpacity,j.style.display="block"),d=1;d<=e;++d)b.fullWidth?(zTranslation=b.dist,tweenedOpacity=d===e&&g<0?1-i:1):(zTranslation=b.dist*(2*d+i*h),tweenedOpacity=1-.2*(2*d+i*h)),(!b.noWrap||s+d<v)&&(j=o[f(s+d)],j.style[C]=k+" translateX("+(b.shift+(u*d-g)/2)+"px) translateZ("+zTranslation+"px)",j.style.zIndex=-d,j.style.opacity=tweenedOpacity,j.style.display="block"),b.fullWidth?(zTranslation=b.dist,tweenedOpacity=d===e&&g>0?1-i:1):(zTranslation=b.dist*(2*d-i*h),tweenedOpacity=1-.2*(2*d-i*h)),(!b.noWrap||s-d>=0)&&(j=o[f(s-d)],j.style[C]=k+" translateX("+(-b.shift+(-u*d-g)/2)+"px) translateZ("+zTranslation+"px)",j.style.zIndex=-d,j.style.opacity=tweenedOpacity,j.style.display="block");if((!b.noWrap||s>=0&&s<v)&&(j=o[f(s)],j.style[C]=k+" translateX("+-g/2+"px) translateX("+h*b.shift*i+"px) translateZ("+b.dist*i+"px)",j.style.zIndex=0,b.fullWidth?tweenedOpacity=1:tweenedOpacity=1-.2*i,j.style.opacity=tweenedOpacity,j.style.display="block"),l!==s&&"function"==typeof b.onCycleTo){var t=J.find(".carousel-item").eq(f(s));b.onCycleTo.call(this,t,G)}}function h(){var a,b,c,d;a=Date.now(),b=a-E,E=a,c=r-D,D=r,d=1e3*c/(1+b),B=.8*d+.2*B}function i(){var a,c;z&&(a=Date.now()-E,c=z*Math.exp(-a/b.duration),c>2||c<-2?(g(A-c),requestAnimationFrame(i)):g(A))}function j(c){if(G)return c.preventDefault(),c.stopPropagation(),!1;if(!b.fullWidth){var d=a(c.target).closest(".carousel-item").index(),e=s%v-d;0!==e&&(c.preventDefault(),c.stopPropagation()),k(d)}}function k(a){var c=s%v-a;b.noWrap||(c<0?Math.abs(c+v)<Math.abs(c)&&(c+=v):c>0&&Math.abs(c-v)<c&&(c-=v)),c<0?J.trigger("carouselNext",[Math.abs(c)]):c>0&&J.trigger("carouselPrev",[c])}function l(a){t=!0,G=!1,H=!1,w=d(a),x=e(a),B=z=0,D=r,E=Date.now(),clearInterval(F),F=setInterval(h,100)}function m(a){var b,c,f;if(t)if(b=d(a),y=e(a),c=w-b,f=Math.abs(x-y),f<30&&!H)(c>2||c<-2)&&(G=!0,w=b,g(r+c));else{if(G)return a.preventDefault(),a.stopPropagation(),!1;H=!0}if(G)return a.preventDefault(),a.stopPropagation(),!1}function n(a){if(t)return t=!1,clearInterval(F),A=r,(B>10||B<-10)&&(z=.9*B,A=r+z),A=Math.round(A/u)*u,b.noWrap&&(A>=u*(v-1)?A=u*(v-1):A<0&&(A=0)),z=A-r,E=Date.now(),requestAnimationFrame(i),G&&(a.preventDefault(),a.stopPropagation()),!1}var o,p,q,r,s,t,u,v,w,x,z,A,B,C,D,E,F,G,H,I=a('<ul class="indicators"></ul>'),J=a(this),K=J.attr("data-indicators")||b.indicators;if(J.hasClass("initialized"))return a(this).trigger("carouselNext",[1e-6]),!0;if(b.fullWidth){b.dist=0;var L=J.find(".carousel-item img").first();L.length?imageHeight=L.on("load",function(){J.css("height",a(this).height())}):(imageHeight=J.find(".carousel-item").first().height(),J.css("height",imageHeight)),K&&J.find(".carousel-fixed-item").addClass("with-indicators")}J.addClass("initialized"),t=!1,r=A=0,o=[],p=J.find(".carousel-item").first().innerWidth(),q=J.find(".carousel-item").first().innerHeight(),u=2*p+b.padding,J.find(".carousel-item").each(function(b){if(o.push(a(this)[0]),K){var c=a('<li class="indicator-item"></li>');0===b&&c.addClass("active"),c.click(function(b){b.stopPropagation();var c=a(this).index();k(c)}),I.append(c)}}),K&&J.append(I),v=o.length,C="transform",["webkit","Moz","O","ms"].every(function(a){var b=a+"Transform";return"undefined"==typeof document.body.style[b]||(C=b,!1)}),a(window).on("resize.carousel",function(){b.fullWidth?(p=J.find(".carousel-item").first().innerWidth(),q=J.find(".carousel-item").first().innerHeight(),u=2*p+b.padding,r=2*s*p,A=r):g()}),c(),g(r),a(this).on("carouselNext",function(a,b){void 0===b&&(b=1),A=u*Math.round(r/u)+u*b,r!==A&&(z=A-r,E=Date.now(),requestAnimationFrame(i))}),a(this).on("carouselPrev",function(a,b){void 0===b&&(b=1),A=u*Math.round(r/u)-u*b,r!==A&&(z=A-r,E=Date.now(),requestAnimationFrame(i))}),a(this).on("carouselSet",function(a,b){void 0===b&&(b=0),k(b)})})},next:function(b){a(this).trigger("carouselNext",[b])},prev:function(b){a(this).trigger("carouselPrev",[b])},set:function(b){a(this).trigger("carouselSet",[b])}};a.fn.carousel=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.carousel"):b.init.apply(this,arguments)}}(jQuery);
\ No newline at end of file
diff --git a/VNF_Catalogue/public/3rd_party/rating/rating.css b/VNF_Catalogue/public/3rd_party/rating/rating.css
new file mode 100755
index 00000000..3be4596a
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/rating/rating.css
@@ -0,0 +1,27 @@
+.star{
+    background-image:url('data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABQAAABQCAYAAAAZQFV3AAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAABOFJREFUeNrsmEFoHFUYx9/MdHfTJRKzUhBaFiL1YghZCFQUIV6UQJuLWCgr8eKpIoiFSqsHQYrmYj14KHqxKAl6MbA5eCgKRVAMBhpCwIJQCETRQzTsNtnO7s74+17fbGc3M7OzZhUsHfjzdvd97/++973vff99Y/m+rwb5WL0Idz60h2nckTc8Nw2hncLmAnhtIB7i3VGan8VD8Dhebh+U8FOaX8Bh4EB48R8TQlai+QnkgMTxD/AYpFt9EULk0EyBD8Dn4BPT9TZ4CrwD6Wos4V+XrUdpXzQk4tUEkAFXwNUu+1fAWWO7anADLDLJTkCYpf0K3DQe3Ui5oUI6B8ShlyBstZfMMiXoX4MV8GZKQgnJcXA6nKPtGJoE/gZ8Cy6mIJPwnIJsL3ZTIB2h+U6WANZjyE6Aj8Cz3WT7TooJ7HUwneDdc+BaFFnc0SuCzQTCTWOT+iwfN6cjWJ6clo9NzOS5Bcb6IZTZj5pU+syEYNV8XzA2Y6lOCptyhGbDeDFPnJa6TlGZ5rxJ/nxkSRPCACR5EUyHf4sCNjOgENVn/ecVe+CEy8vLWgJmZ2fd1IRra2vxSbe5eYlmu1gsXo6zmZycTKcpkEn6vC61kM+FQYiUeDdvauP5Ay0ZjyIlgKVv9bVkiBwQVJRX2YwWkKLxrhxB+qYSPaxUKrESANHVrh2PlQAzqSbskAA6UkkA5B0SICvRSzb5ddrMWu4jh8umSLwckLVjSKClWJ6SwsrM76fwLpCAM4x1I9OGjhrN8+AkAyYSyGTDnhEHjCPxeYhBagmIIvtXJOBQkgSY5Z01/76umAy4lbpiG5IqzQuG6Alz9LLmf+IP5hh+AfmxnoSQdUgAg5a6JuuQgMiSFi7fJHkR9JQAbGbA/SoBi4uLWgLK5XIqCdBpkyQBZne3sTm4BGxsbLQlgM+DkYBsNjucyWQKaSXATvCuZFnWHIQqlxMVUOeMx/0RMsgBWgIgcyBVgqwwIwH0JUvAwsJChwQwuOQ4jrJtO/CsfQBc11We56lWqyXfOySALNgJdlmuWzNSB/P5vBKyyJnxMjxBs9mc2tvbEye+DN1l7uYhuaZvAXg1LaQyOOkRL3d3d8XLishHOEd1DMfHx7UEYLjCrCop2aXP2Mht4QxjoyWADi0BxGddZm80GjpWYSL5TfpkYnHAOBK/yxhoCZAl1et1PbharWrUajX9m/SJBESRJUlAr6fvW0CvZyyxOIQPN4kbnv1mlwQERGPhMbHli/Q5Yv5lSdDnSYelrlLWIQGRJS1cvjk1RdBTArCZAferBPT7IkjvcuP7t3pKADaxEpB5+r10FXv3x3kKqqUlgM+DkQB76OFhKzdycAnAo5KynTlraFTZQ4/gqH3ursd9EjLIAVoC7KGCAxFWNqSjWgLoS5aAfS+C7EzJcrLKOjSkrNwoFu0ToPz6n8pv3dFQXjPyRdA9CbDsk/ZDx5SQxWiAsg4X7vE361NedQsn/P0SELwIgmzaHiZMtpMcKK+pWlUuVF6j0v0iSMcw/+QFLQF+y13xbv/GpF4CWUt5tV+FTEsAY6MlgA4tASxlnaUo362yLGLlh2Lo1iCjj4nFAeNI/H9sDHbYxesEfcK//XvSoq9Fkf0/JCDqDWfV3I+TJGCLne19CzAvgtoS8OBF0APC6OdvAQYAj2xzC/IfXBsAAAAASUVORK5CYII=');
+    background-position:left -2px;
+    display:block;
+    width:20px;
+    height:16px;
+    line-height:16px;
+    float:left;
+    cursor: pointer;
+    zoom:1;
+}
+
+.fullStar{
+    background-position:left -59px;
+}
+
+.stars{
+    overflow: hidden;
+}
+
+.tmp_es{
+    background-position:left -21px;
+}
+
+.tmp_fs{
+    background-position:left -40px;
+}
diff --git a/VNF_Catalogue/public/3rd_party/rating/rating.js b/VNF_Catalogue/public/3rd_party/rating/rating.js
new file mode 100755
index 00000000..2cab1771
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/rating/rating.js
@@ -0,0 +1,131 @@
+/* jQuery Star Rating Plugin
+ * 
+ * @Author
+ * Copyright Nov 02 2010, Irfan Durmus - http://irfandurmus.com/
+ *
+ * @Version
+ * 0.3b
+ *
+ * @License
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ *
+ * Visit the plugin page for more information.
+ * http://irfandurmus.com/projects/jquery-star-rating-plugin/
+ *
+ */
+
+;(function($){
+    $.fn.rating = function(callback){
+        
+        callback = callback || function(){};
+
+        // each for all item
+        this.each(function(i, v){
+            
+            $(v).data('rating', {callback:callback})
+                .bind('init.rating', $.fn.rating.init)
+                .bind('set.rating', $.fn.rating.set)
+                .bind('hover.rating', $.fn.rating.hover)
+                .trigger('init.rating');
+        });
+    };
+    
+    $.extend($.fn.rating, {
+        init: function(e){
+            var el = $(this),
+                list = '',
+                isChecked = null,
+                childs = el.children(),
+                i = 0,
+                l = childs.length;
+            
+            for (; i < l; i++) {
+                list = list + '<a class="star" title="' + $(childs[i]).val() + '" />';
+                if ($(childs[i]).is(':checked')) {
+                    isChecked = $(childs[i]).val();
+                };
+            };
+            
+            childs.hide();
+            
+            el
+                .append('<div class="stars">' + list + '</div>')
+                .trigger('set.rating', isChecked);
+            
+            $('a', el).bind('click', $.fn.rating.click);            
+            el.trigger('hover.rating');
+        },
+        set: function(e, val) {
+            var el = $(this),
+                item = $('a', el),
+                input = undefined;
+            
+            if (val) {
+                item.removeClass('fullStar');
+                
+                input = item.filter(function(i){
+                    if ($(this).attr('title') == val)
+                        return $(this);
+                    else
+                        return false;
+                });
+                
+                input
+                    .addClass('fullStar')
+                    .prevAll()
+                    .addClass('fullStar');
+            }
+            
+            return;
+        },
+        hover: function(e){
+            var el = $(this),
+                stars = $('a', el);
+            
+            stars.bind('mouseenter', function(e){
+                // add tmp class when mouse enter
+                $(this)
+                    .addClass('tmp_fs')
+                    .prevAll()
+                    .addClass('tmp_fs');
+                
+                $(this).nextAll()
+                    .addClass('tmp_es');
+            });
+            
+            stars.bind('mouseleave', function(e){
+                // remove all tmp class when mouse leave
+                $(this)
+                    .removeClass('tmp_fs')
+                    .prevAll()
+                    .removeClass('tmp_fs');
+                
+                $(this).nextAll()
+                    .removeClass('tmp_es');
+            });
+        },
+        click: function(e){
+            e.preventDefault();
+            var el = $(e.target),
+                container = el.parent().parent(),
+                inputs = container.children('input'),
+                rate = el.attr('title');
+                
+            matchInput = inputs.filter(function(i){
+                if ($(this).val() == rate)
+                    return true;
+                else
+                    return false;
+            });
+            
+            matchInput
+                .prop('checked', true)
+				.siblings('input').prop('checked', false);
+            
+            container
+                .trigger('set.rating', matchInput.val())
+                .data('rating').callback(rate, e);
+        }
+    });
+    
+})(jQuery);
diff --git a/VNF_Catalogue/public/3rd_party/typeahead.js b/VNF_Catalogue/public/3rd_party/typeahead.js
new file mode 100644
index 00000000..11235e75
--- /dev/null
+++ b/VNF_Catalogue/public/3rd_party/typeahead.js
@@ -0,0 +1,7 @@
+/*!
+ * typeahead.js 0.10.4
+ * https://github.com/twitter/typeahead.js
+ * Copyright 2013-2014 Twitter, Inc. and other contributors; Licensed MIT
+ */
+
+!function(a){var b=function(){"use strict";return{isMsie:function(){return/(msie|trident)/i.test(navigator.userAgent)?navigator.userAgent.match(/(msie |rv:)(\d+(.\d+)?)/i)[2]:!1},isBlankString:function(a){return!a||/^\s*$/.test(a)},escapeRegExChars:function(a){return a.replace(/[\-\[\]\/\{\}\(\)\*\+\?\.\\\^\$\|]/g,"\\$&")},isString:function(a){return"string"==typeof a},isNumber:function(a){return"number"==typeof a},isArray:a.isArray,isFunction:a.isFunction,isObject:a.isPlainObject,isUndefined:function(a){return"undefined"==typeof a},toStr:function(a){return b.isUndefined(a)||null===a?"":a+""},bind:a.proxy,each:function(b,c){function d(a,b){return c(b,a)}a.each(b,d)},map:a.map,filter:a.grep,every:function(b,c){var d=!0;return b?(a.each(b,function(a,e){return(d=c.call(null,e,a,b))?void 0:!1}),!!d):d},some:function(b,c){var d=!1;return b?(a.each(b,function(a,e){return(d=c.call(null,e,a,b))?!1:void 0}),!!d):d},mixin:a.extend,getUniqueId:function(){var a=0;return function(){return a++}}(),templatify:function(b){function c(){return String(b)}return a.isFunction(b)?b:c},defer:function(a){setTimeout(a,0)},debounce:function(a,b,c){var d,e;return function(){var f,g,h=this,i=arguments;return f=function(){d=null,c||(e=a.apply(h,i))},g=c&&!d,clearTimeout(d),d=setTimeout(f,b),g&&(e=a.apply(h,i)),e}},throttle:function(a,b){var c,d,e,f,g,h;return g=0,h=function(){g=new Date,e=null,f=a.apply(c,d)},function(){var i=new Date,j=b-(i-g);return c=this,d=arguments,0>=j?(clearTimeout(e),e=null,g=i,f=a.apply(c,d)):e||(e=setTimeout(h,j)),f}},noop:function(){}}}(),c="0.10.4",d=function(){"use strict";function a(a){return a=b.toStr(a),a?a.split(/\s+/):[]}function c(a){return a=b.toStr(a),a?a.split(/\W+/):[]}function d(a){return function(){var c=[].slice.call(arguments,0);return function(d){var e=[];return b.each(c,function(c){e=e.concat(a(b.toStr(d[c])))}),e}}}return{nonword:c,whitespace:a,obj:{nonword:d(c),whitespace:d(a)}}}(),e=function(){"use strict";function c(c){this.maxSize=b.isNumber(c)?c:100,this.reset(),this.maxSize<=0&&(this.set=this.get=a.noop)}function d(){this.head=this.tail=null}function e(a,b){this.key=a,this.val=b,this.prev=this.next=null}return b.mixin(c.prototype,{set:function(a,b){var c,d=this.list.tail;this.size>=this.maxSize&&(this.list.remove(d),delete this.hash[d.key]),(c=this.hash[a])?(c.val=b,this.list.moveToFront(c)):(c=new e(a,b),this.list.add(c),this.hash[a]=c,this.size++)},get:function(a){var b=this.hash[a];return b?(this.list.moveToFront(b),b.val):void 0},reset:function(){this.size=0,this.hash={},this.list=new d}}),b.mixin(d.prototype,{add:function(a){this.head&&(a.next=this.head,this.head.prev=a),this.head=a,this.tail=this.tail||a},remove:function(a){a.prev?a.prev.next=a.next:this.head=a.next,a.next?a.next.prev=a.prev:this.tail=a.prev},moveToFront:function(a){this.remove(a),this.add(a)}}),c}(),f=function(){"use strict";function a(a){this.prefix=["__",a,"__"].join(""),this.ttlKey="__ttl__",this.keyMatcher=new RegExp("^"+b.escapeRegExChars(this.prefix))}function c(){return(new Date).getTime()}function d(a){return JSON.stringify(b.isUndefined(a)?null:a)}function e(a){return JSON.parse(a)}var f,g;try{f=window.localStorage,f.setItem("~~~","!"),f.removeItem("~~~")}catch(h){f=null}return g=f&&window.JSON?{_prefix:function(a){return this.prefix+a},_ttlKey:function(a){return this._prefix(a)+this.ttlKey},get:function(a){return this.isExpired(a)&&this.remove(a),e(f.getItem(this._prefix(a)))},set:function(a,e,g){return b.isNumber(g)?f.setItem(this._ttlKey(a),d(c()+g)):f.removeItem(this._ttlKey(a)),f.setItem(this._prefix(a),d(e))},remove:function(a){return f.removeItem(this._ttlKey(a)),f.removeItem(this._prefix(a)),this},clear:function(){var a,b,c=[],d=f.length;for(a=0;d>a;a++)(b=f.key(a)).match(this.keyMatcher)&&c.push(b.replace(this.keyMatcher,""));for(a=c.length;a--;)this.remove(c[a]);return this},isExpired:function(a){var d=e(f.getItem(this._ttlKey(a)));return b.isNumber(d)&&c()>d?!0:!1}}:{get:b.noop,set:b.noop,remove:b.noop,clear:b.noop,isExpired:b.noop},b.mixin(a.prototype,g),a}(),g=function(){"use strict";function c(b){b=b||{},this.cancelled=!1,this.lastUrl=null,this._send=b.transport?d(b.transport):a.ajax,this._get=b.rateLimiter?b.rateLimiter(this._get):this._get,this._cache=b.cache===!1?new e(0):i}function d(c){return function(d,e){function f(a){b.defer(function(){h.resolve(a)})}function g(a){b.defer(function(){h.reject(a)})}var h=a.Deferred();return c(d,e,f,g),h}}var f=0,g={},h=6,i=new e(10);return c.setMaxPendingRequests=function(a){h=a},c.resetCache=function(){i.reset()},b.mixin(c.prototype,{_get:function(a,b,c){function d(b){c&&c(null,b),k._cache.set(a,b)}function e(){c&&c(!0)}function i(){f--,delete g[a],k.onDeckRequestArgs&&(k._get.apply(k,k.onDeckRequestArgs),k.onDeckRequestArgs=null)}var j,k=this;this.cancelled||a!==this.lastUrl||((j=g[a])?j.done(d).fail(e):h>f?(f++,g[a]=this._send(a,b).done(d).fail(e).always(i)):this.onDeckRequestArgs=[].slice.call(arguments,0))},get:function(a,c,d){var e;return b.isFunction(c)&&(d=c,c={}),this.cancelled=!1,this.lastUrl=a,(e=this._cache.get(a))?b.defer(function(){d&&d(null,e)}):this._get(a,c,d),!!e},cancel:function(){this.cancelled=!0}}),c}(),h=function(){"use strict";function c(b){b=b||{},b.datumTokenizer&&b.queryTokenizer||a.error("datumTokenizer and queryTokenizer are both required"),this.datumTokenizer=b.datumTokenizer,this.queryTokenizer=b.queryTokenizer,this.reset()}function d(a){return a=b.filter(a,function(a){return!!a}),a=b.map(a,function(a){return a.toLowerCase()})}function e(){return{ids:[],children:{}}}function f(a){for(var b={},c=[],d=0,e=a.length;e>d;d++)b[a[d]]||(b[a[d]]=!0,c.push(a[d]));return c}function g(a,b){function c(a,b){return a-b}var d=0,e=0,f=[];a=a.sort(c),b=b.sort(c);for(var g=a.length,h=b.length;g>d&&h>e;)a[d]<b[e]?d++:a[d]>b[e]?e++:(f.push(a[d]),d++,e++);return f}return b.mixin(c.prototype,{bootstrap:function(a){this.datums=a.datums,this.trie=a.trie},add:function(a){var c=this;a=b.isArray(a)?a:[a],b.each(a,function(a){var f,g;f=c.datums.push(a)-1,g=d(c.datumTokenizer(a)),b.each(g,function(a){var b,d,g;for(b=c.trie,d=a.split("");g=d.shift();)b=b.children[g]||(b.children[g]=e()),b.ids.push(f)})})},get:function(a){var c,e,h=this;return c=d(this.queryTokenizer(a)),b.each(c,function(a){var b,c,d,f;if(e&&0===e.length)return!1;for(b=h.trie,c=a.split("");b&&(d=c.shift());)b=b.children[d];return b&&0===c.length?(f=b.ids.slice(0),void(e=e?g(e,f):f)):(e=[],!1)}),e?b.map(f(e),function(a){return h.datums[a]}):[]},reset:function(){this.datums=[],this.trie=e()},serialize:function(){return{datums:this.datums,trie:this.trie}}}),c}(),i=function(){"use strict";function d(a){return a.local||null}function e(d){var e,f;return f={url:null,thumbprint:"",ttl:864e5,filter:null,ajax:{}},(e=d.prefetch||null)&&(e=b.isString(e)?{url:e}:e,e=b.mixin(f,e),e.thumbprint=c+e.thumbprint,e.ajax.type=e.ajax.type||"GET",e.ajax.dataType=e.ajax.dataType||"json",!e.url&&a.error("prefetch requires url to be set")),e}function f(c){function d(a){return function(c){return b.debounce(c,a)}}function e(a){return function(c){return b.throttle(c,a)}}var f,g;return g={url:null,cache:!0,wildcard:"%QUERY",replace:null,rateLimitBy:"debounce",rateLimitWait:300,send:null,filter:null,ajax:{}},(f=c.remote||null)&&(f=b.isString(f)?{url:f}:f,f=b.mixin(g,f),f.rateLimiter=/^throttle$/i.test(f.rateLimitBy)?e(f.rateLimitWait):d(f.rateLimitWait),f.ajax.type=f.ajax.type||"GET",f.ajax.dataType=f.ajax.dataType||"json",delete f.rateLimitBy,delete f.rateLimitWait,!f.url&&a.error("remote requires url to be set")),f}return{local:d,prefetch:e,remote:f}}();!function(c){"use strict";function e(b){b&&(b.local||b.prefetch||b.remote)||a.error("one of local, prefetch, or remote is required"),this.limit=b.limit||5,this.sorter=j(b.sorter),this.dupDetector=b.dupDetector||k,this.local=i.local(b),this.prefetch=i.prefetch(b),this.remote=i.remote(b),this.cacheKey=this.prefetch?this.prefetch.cacheKey||this.prefetch.url:null,this.index=new h({datumTokenizer:b.datumTokenizer,queryTokenizer:b.queryTokenizer}),this.storage=this.cacheKey?new f(this.cacheKey):null}function j(a){function c(b){return b.sort(a)}function d(a){return a}return b.isFunction(a)?c:d}function k(){return!1}var l,m;return l=c.Bloodhound,m={data:"data",protocol:"protocol",thumbprint:"thumbprint"},c.Bloodhound=e,e.noConflict=function(){return c.Bloodhound=l,e},e.tokenizers=d,b.mixin(e.prototype,{_loadPrefetch:function(b){function c(a){f.clear(),f.add(b.filter?b.filter(a):a),f._saveToStorage(f.index.serialize(),b.thumbprint,b.ttl)}var d,e,f=this;return(d=this._readFromStorage(b.thumbprint))?(this.index.bootstrap(d),e=a.Deferred().resolve()):e=a.ajax(b.url,b.ajax).done(c),e},_getFromRemote:function(a,b){function c(a,c){b(a?[]:f.remote.filter?f.remote.filter(c):c)}var d,e,f=this;if(this.transport)return a=a||"",e=encodeURIComponent(a),d=this.remote.replace?this.remote.replace(this.remote.url,a):this.remote.url.replace(this.remote.wildcard,e),this.transport.get(d,this.remote.ajax,c)},_cancelLastRemoteRequest:function(){this.transport&&this.transport.cancel()},_saveToStorage:function(a,b,c){this.storage&&(this.storage.set(m.data,a,c),this.storage.set(m.protocol,location.protocol,c),this.storage.set(m.thumbprint,b,c))},_readFromStorage:function(a){var b,c={};return this.storage&&(c.data=this.storage.get(m.data),c.protocol=this.storage.get(m.protocol),c.thumbprint=this.storage.get(m.thumbprint)),b=c.thumbprint!==a||c.protocol!==location.protocol,c.data&&!b?c.data:null},_initialize:function(){function c(){e.add(b.isFunction(f)?f():f)}var d,e=this,f=this.local;return d=this.prefetch?this._loadPrefetch(this.prefetch):a.Deferred().resolve(),f&&d.done(c),this.transport=this.remote?new g(this.remote):null,this.initPromise=d.promise()},initialize:function(a){return!this.initPromise||a?this._initialize():this.initPromise},add:function(a){this.index.add(a)},get:function(a,c){function d(a){var d=f.slice(0);b.each(a,function(a){var c;return c=b.some(d,function(b){return e.dupDetector(a,b)}),!c&&d.push(a),d.length<e.limit}),c&&c(e.sorter(d))}var e=this,f=[],g=!1;f=this.index.get(a),f=this.sorter(f).slice(0,this.limit),f.length<this.limit?g=this._getFromRemote(a,d):this._cancelLastRemoteRequest(),g||(f.length>0||!this.transport)&&c&&c(f)},clear:function(){this.index.reset()},clearPrefetchCache:function(){this.storage&&this.storage.clear()},clearRemoteCache:function(){this.transport&&g.resetCache()},ttAdapter:function(){return b.bind(this.get,this)}}),e}(this);var j=function(){return{wrapper:'<span class="twitter-typeahead"></span>',dropdown:'<span class="tt-dropdown-menu"></span>',dataset:'<div class="tt-dataset-%CLASS%"></div>',suggestions:'<span class="tt-suggestions"></span>',suggestion:'<div class="tt-suggestion"></div>'}}(),k=function(){"use strict";var a={wrapper:{position:"relative",display:"inline-block"},hint:{position:"absolute",top:"0",left:"0",borderColor:"transparent",boxShadow:"none",opacity:"1"},input:{position:"relative",verticalAlign:"top",backgroundColor:"transparent"},inputWithNoHint:{position:"relative",verticalAlign:"top"},dropdown:{position:"absolute",top:"100%",left:"0",zIndex:"100",display:"none"},suggestions:{display:"block"},suggestion:{whiteSpace:"nowrap",cursor:"pointer"},suggestionChild:{whiteSpace:"normal"},ltr:{left:"0",right:"auto"},rtl:{left:"auto",right:" 0"}};return b.isMsie()&&b.mixin(a.input,{backgroundImage:"url(data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7)"}),b.isMsie()&&b.isMsie()<=7&&b.mixin(a.input,{marginTop:"-1px"}),a}(),l=function(){"use strict";function c(b){b&&b.el||a.error("EventBus initialized without el"),this.$el=a(b.el)}var d="typeahead:";return b.mixin(c.prototype,{trigger:function(a){var b=[].slice.call(arguments,1);this.$el.trigger(d+a,b)}}),c}(),m=function(){"use strict";function a(a,b,c,d){var e;if(!c)return this;for(b=b.split(i),c=d?h(c,d):c,this._callbacks=this._callbacks||{};e=b.shift();)this._callbacks[e]=this._callbacks[e]||{sync:[],async:[]},this._callbacks[e][a].push(c);return this}function b(b,c,d){return a.call(this,"async",b,c,d)}function c(b,c,d){return a.call(this,"sync",b,c,d)}function d(a){var b;if(!this._callbacks)return this;for(a=a.split(i);b=a.shift();)delete this._callbacks[b];return this}function e(a){var b,c,d,e,g;if(!this._callbacks)return this;for(a=a.split(i),d=[].slice.call(arguments,1);(b=a.shift())&&(c=this._callbacks[b]);)e=f(c.sync,this,[b].concat(d)),g=f(c.async,this,[b].concat(d)),e()&&j(g);return this}function f(a,b,c){function d(){for(var d,e=0,f=a.length;!d&&f>e;e+=1)d=a[e].apply(b,c)===!1;return!d}return d}function g(){var a;return a=window.setImmediate?function(a){setImmediate(function(){a()})}:function(a){setTimeout(function(){a()},0)}}function h(a,b){return a.bind?a.bind(b):function(){a.apply(b,[].slice.call(arguments,0))}}var i=/\s+/,j=g();return{onSync:c,onAsync:b,off:d,trigger:e}}(),n=function(a){"use strict";function c(a,c,d){for(var e,f=[],g=0,h=a.length;h>g;g++)f.push(b.escapeRegExChars(a[g]));return e=d?"\\b("+f.join("|")+")\\b":"("+f.join("|")+")",c?new RegExp(e):new RegExp(e,"i")}var d={node:null,pattern:null,tagName:"strong",className:null,wordsOnly:!1,caseSensitive:!1};return function(e){function f(b){var c,d,f;return(c=h.exec(b.data))&&(f=a.createElement(e.tagName),e.className&&(f.className=e.className),d=b.splitText(c.index),d.splitText(c[0].length),f.appendChild(d.cloneNode(!0)),b.parentNode.replaceChild(f,d)),!!c}function g(a,b){for(var c,d=3,e=0;e<a.childNodes.length;e++)c=a.childNodes[e],c.nodeType===d?e+=b(c)?1:0:g(c,b)}var h;e=b.mixin({},d,e),e.node&&e.pattern&&(e.pattern=b.isArray(e.pattern)?e.pattern:[e.pattern],h=c(e.pattern,e.caseSensitive,e.wordsOnly),g(e.node,f))}}(window.document),o=function(){"use strict";function c(c){var e,f,h,i,j=this;c=c||{},c.input||a.error("input is missing"),e=b.bind(this._onBlur,this),f=b.bind(this._onFocus,this),h=b.bind(this._onKeydown,this),i=b.bind(this._onInput,this),this.$hint=a(c.hint),this.$input=a(c.input).on("blur.tt",e).on("focus.tt",f).on("keydown.tt",h),0===this.$hint.length&&(this.setHint=this.getHint=this.clearHint=this.clearHintIfInvalid=b.noop),b.isMsie()?this.$input.on("keydown.tt keypress.tt cut.tt paste.tt",function(a){g[a.which||a.keyCode]||b.defer(b.bind(j._onInput,j,a))}):this.$input.on("input.tt",i),this.query=this.$input.val(),this.$overflowHelper=d(this.$input)}function d(b){return a('<pre aria-hidden="true"></pre>').css({position:"absolute",visibility:"hidden",whiteSpace:"pre",fontFamily:b.css("font-family"),fontSize:b.css("font-size"),fontStyle:b.css("font-style"),fontVariant:b.css("font-variant"),fontWeight:b.css("font-weight"),wordSpacing:b.css("word-spacing"),letterSpacing:b.css("letter-spacing"),textIndent:b.css("text-indent"),textRendering:b.css("text-rendering"),textTransform:b.css("text-transform")}).insertAfter(b)}function e(a,b){return c.normalizeQuery(a)===c.normalizeQuery(b)}function f(a){return a.altKey||a.ctrlKey||a.metaKey||a.shiftKey}var g;return g={9:"tab",27:"esc",37:"left",39:"right",13:"enter",38:"up",40:"down"},c.normalizeQuery=function(a){return(a||"").replace(/^\s*/g,"").replace(/\s{2,}/g," ")},b.mixin(c.prototype,m,{_onBlur:function(){this.resetInputValue(),this.trigger("blurred")},_onFocus:function(){this.trigger("focused")},_onKeydown:function(a){var b=g[a.which||a.keyCode];this._managePreventDefault(b,a),b&&this._shouldTrigger(b,a)&&this.trigger(b+"Keyed",a)},_onInput:function(){this._checkInputValue()},_managePreventDefault:function(a,b){var c,d,e;switch(a){case"tab":d=this.getHint(),e=this.getInputValue(),c=d&&d!==e&&!f(b);break;case"up":case"down":c=!f(b);break;default:c=!1}c&&b.preventDefault()},_shouldTrigger:function(a,b){var c;switch(a){case"tab":c=!f(b);break;default:c=!0}return c},_checkInputValue:function(){var a,b,c;a=this.getInputValue(),b=e(a,this.query),c=b?this.query.length!==a.length:!1,this.query=a,b?c&&this.trigger("whitespaceChanged",this.query):this.trigger("queryChanged",this.query)},focus:function(){this.$input.focus()},blur:function(){this.$input.blur()},getQuery:function(){return this.query},setQuery:function(a){this.query=a},getInputValue:function(){return this.$input.val()},setInputValue:function(a,b){this.$input.val(a),b?this.clearHint():this._checkInputValue()},resetInputValue:function(){this.setInputValue(this.query,!0)},getHint:function(){return this.$hint.val()},setHint:function(a){this.$hint.val(a)},clearHint:function(){this.setHint("")},clearHintIfInvalid:function(){var a,b,c,d;a=this.getInputValue(),b=this.getHint(),c=a!==b&&0===b.indexOf(a),d=""!==a&&c&&!this.hasOverflow(),!d&&this.clearHint()},getLanguageDirection:function(){return(this.$input.css("direction")||"ltr").toLowerCase()},hasOverflow:function(){var a=this.$input.width()-2;return this.$overflowHelper.text(this.getInputValue()),this.$overflowHelper.width()>=a},isCursorAtEnd:function(){var a,c,d;return a=this.$input.val().length,c=this.$input[0].selectionStart,b.isNumber(c)?c===a:document.selection?(d=document.selection.createRange(),d.moveStart("character",-a),a===d.text.length):!0},destroy:function(){this.$hint.off(".tt"),this.$input.off(".tt"),this.$hint=this.$input=this.$overflowHelper=null}}),c}(),p=function(){"use strict";function c(c){c=c||{},c.templates=c.templates||{},c.source||a.error("missing source"),c.name&&!f(c.name)&&a.error("invalid dataset name: "+c.name),this.query=null,this.highlight=!!c.highlight,this.name=c.name||b.getUniqueId(),this.source=c.source,this.displayFn=d(c.display||c.displayKey),this.templates=e(c.templates,this.displayFn),this.$el=a(j.dataset.replace("%CLASS%",this.name))}function d(a){function c(b){return b[a]}return a=a||"value",b.isFunction(a)?a:c}function e(a,c){function d(a){return"<p>"+c(a)+"</p>"}return{empty:a.empty&&b.templatify(a.empty),header:a.header&&b.templatify(a.header),footer:a.footer&&b.templatify(a.footer),suggestion:a.suggestion||d}}function f(a){return/^[_a-zA-Z0-9-]+$/.test(a)}var g="ttDataset",h="ttValue",i="ttDatum";return c.extractDatasetName=function(b){return a(b).data(g)},c.extractValue=function(b){return a(b).data(h)},c.extractDatum=function(b){return a(b).data(i)},b.mixin(c.prototype,m,{_render:function(c,d){function e(){return p.templates.empty({query:c,isEmpty:!0})}function f(){function e(b){var c;return c=a(j.suggestion).append(p.templates.suggestion(b)).data(g,p.name).data(h,p.displayFn(b)).data(i,b),c.children().each(function(){a(this).css(k.suggestionChild)}),c}var f,l;return f=a(j.suggestions).css(k.suggestions),l=b.map(d,e),f.append.apply(f,l),p.highlight&&n({className:"tt-highlight",node:f[0],pattern:c}),f}function l(){return p.templates.header({query:c,isEmpty:!o})}function m(){return p.templates.footer({query:c,isEmpty:!o})}if(this.$el){var o,p=this;this.$el.empty(),o=d&&d.length,!o&&this.templates.empty?this.$el.html(e()).prepend(p.templates.header?l():null).append(p.templates.footer?m():null):o&&this.$el.html(f()).prepend(p.templates.header?l():null).append(p.templates.footer?m():null),this.trigger("rendered")}},getRoot:function(){return this.$el},update:function(a){function b(b){c.canceled||a!==c.query||c._render(a,b)}var c=this;this.query=a,this.canceled=!1,this.source(a,b)},cancel:function(){this.canceled=!0},clear:function(){this.cancel(),this.$el.empty(),this.trigger("rendered")},isEmpty:function(){return this.$el.is(":empty")},destroy:function(){this.$el=null}}),c}(),q=function(){"use strict";function c(c){var e,f,g,h=this;c=c||{},c.menu||a.error("menu is required"),this.isOpen=!1,this.isEmpty=!0,this.datasets=b.map(c.datasets,d),e=b.bind(this._onSuggestionClick,this),f=b.bind(this._onSuggestionMouseEnter,this),g=b.bind(this._onSuggestionMouseLeave,this),this.$menu=a(c.menu).on("click.tt",".tt-suggestion",e).on("mouseenter.tt",".tt-suggestion",f).on("mouseleave.tt",".tt-suggestion",g),b.each(this.datasets,function(a){h.$menu.append(a.getRoot()),a.onSync("rendered",h._onRendered,h)})}function d(a){return new p(a)}return b.mixin(c.prototype,m,{_onSuggestionClick:function(b){this.trigger("suggestionClicked",a(b.currentTarget))},_onSuggestionMouseEnter:function(b){this._removeCursor(),this._setCursor(a(b.currentTarget),!0)},_onSuggestionMouseLeave:function(){this._removeCursor()},_onRendered:function(){function a(a){return a.isEmpty()}this.isEmpty=b.every(this.datasets,a),this.isEmpty?this._hide():this.isOpen&&this._show(),this.trigger("datasetRendered")},_hide:function(){this.$menu.hide()},_show:function(){this.$menu.css("display","block")},_getSuggestions:function(){return this.$menu.find(".tt-suggestion")},_getCursor:function(){return this.$menu.find(".tt-cursor").first()},_setCursor:function(a,b){a.first().addClass("tt-cursor"),!b&&this.trigger("cursorMoved")},_removeCursor:function(){this._getCursor().removeClass("tt-cursor")},_moveCursor:function(a){var b,c,d,e;if(this.isOpen){if(c=this._getCursor(),b=this._getSuggestions(),this._removeCursor(),d=b.index(c)+a,d=(d+1)%(b.length+1)-1,-1===d)return void this.trigger("cursorRemoved");-1>d&&(d=b.length-1),this._setCursor(e=b.eq(d)),this._ensureVisible(e)}},_ensureVisible:function(a){var b,c,d,e;b=a.position().top,c=b+a.outerHeight(!0),d=this.$menu.scrollTop(),e=this.$menu.height()+parseInt(this.$menu.css("paddingTop"),10)+parseInt(this.$menu.css("paddingBottom"),10),0>b?this.$menu.scrollTop(d+b):c>e&&this.$menu.scrollTop(d+(c-e))},close:function(){this.isOpen&&(this.isOpen=!1,this._removeCursor(),this._hide(),this.trigger("closed"))},open:function(){this.isOpen||(this.isOpen=!0,!this.isEmpty&&this._show(),this.trigger("opened"))},setLanguageDirection:function(a){this.$menu.css("ltr"===a?k.ltr:k.rtl)},moveCursorUp:function(){this._moveCursor(-1)},moveCursorDown:function(){this._moveCursor(1)},getDatumForSuggestion:function(a){var b=null;return a.length&&(b={raw:p.extractDatum(a),value:p.extractValue(a),datasetName:p.extractDatasetName(a)}),b},getDatumForCursor:function(){return this.getDatumForSuggestion(this._getCursor().first())},getDatumForTopSuggestion:function(){return this.getDatumForSuggestion(this._getSuggestions().first())},update:function(a){function c(b){b.update(a)}b.each(this.datasets,c)},empty:function(){function a(a){a.clear()}b.each(this.datasets,a),this.isEmpty=!0},isVisible:function(){return this.isOpen&&!this.isEmpty},destroy:function(){function a(a){a.destroy()}this.$menu.off(".tt"),this.$menu=null,b.each(this.datasets,a)}}),c}(),r=function(){"use strict";function c(c){var e,f,g;c=c||{},c.input||a.error("missing input"),this.isActivated=!1,this.autoselect=!!c.autoselect,this.minLength=b.isNumber(c.minLength)?c.minLength:1,this.$node=d(c.input,c.withHint),e=this.$node.find(".tt-dropdown-menu"),f=this.$node.find(".tt-input"),g=this.$node.find(".tt-hint"),f.on("blur.tt",function(a){var c,d,g;c=document.activeElement,d=e.is(c),g=e.has(c).length>0,b.isMsie()&&(d||g)&&(a.preventDefault(),a.stopImmediatePropagation(),b.defer(function(){f.focus()}))}),e.on("mousedown.tt",function(a){a.preventDefault()}),this.eventBus=c.eventBus||new l({el:f}),this.dropdown=new q({menu:e,datasets:c.datasets}).onSync("suggestionClicked",this._onSuggestionClicked,this).onSync("cursorMoved",this._onCursorMoved,this).onSync("cursorRemoved",this._onCursorRemoved,this).onSync("opened",this._onOpened,this).onSync("closed",this._onClosed,this).onAsync("datasetRendered",this._onDatasetRendered,this),this.input=new o({input:f,hint:g}).onSync("focused",this._onFocused,this).onSync("blurred",this._onBlurred,this).onSync("enterKeyed",this._onEnterKeyed,this).onSync("tabKeyed",this._onTabKeyed,this).onSync("escKeyed",this._onEscKeyed,this).onSync("upKeyed",this._onUpKeyed,this).onSync("downKeyed",this._onDownKeyed,this).onSync("leftKeyed",this._onLeftKeyed,this).onSync("rightKeyed",this._onRightKeyed,this).onSync("queryChanged",this._onQueryChanged,this).onSync("whitespaceChanged",this._onWhitespaceChanged,this),this._setLanguageDirection()}function d(b,c){var d,f,h,i;d=a(b),f=a(j.wrapper).css(k.wrapper),h=a(j.dropdown).css(k.dropdown),i=d.clone().css(k.hint).css(e(d)),i.val("").removeData().addClass("tt-hint").removeAttr("id name placeholder required").prop("readonly",!0).attr({autocomplete:"off",spellcheck:"false",tabindex:-1}),d.data(g,{dir:d.attr("dir"),autocomplete:d.attr("autocomplete"),spellcheck:d.attr("spellcheck"),style:d.attr("style")}),d.addClass("tt-input").attr({autocomplete:"off",spellcheck:!1}).css(c?k.input:k.inputWithNoHint);try{!d.attr("dir")&&d.attr("dir","auto")}catch(l){}return d.wrap(f).parent().prepend(c?i:null).append(h)}function e(a){return{backgroundAttachment:a.css("background-attachment"),backgroundClip:a.css("background-clip"),backgroundColor:a.css("background-color"),backgroundImage:a.css("background-image"),backgroundOrigin:a.css("background-origin"),backgroundPosition:a.css("background-position"),backgroundRepeat:a.css("background-repeat"),backgroundSize:a.css("background-size")}}function f(a){var c=a.find(".tt-input");b.each(c.data(g),function(a,d){b.isUndefined(a)?c.removeAttr(d):c.attr(d,a)}),c.detach().removeData(g).removeClass("tt-input").insertAfter(a),a.remove()}var g="ttAttrs";return b.mixin(c.prototype,{_onSuggestionClicked:function(a,b){var c;(c=this.dropdown.getDatumForSuggestion(b))&&this._select(c)},_onCursorMoved:function(){var a=this.dropdown.getDatumForCursor();this.input.setInputValue(a.value,!0),this.eventBus.trigger("cursorchanged",a.raw,a.datasetName)},_onCursorRemoved:function(){this.input.resetInputValue(),this._updateHint()},_onDatasetRendered:function(){this._updateHint()},_onOpened:function(){this._updateHint(),this.eventBus.trigger("opened")},_onClosed:function(){this.input.clearHint(),this.eventBus.trigger("closed")},_onFocused:function(){this.isActivated=!0,this.dropdown.open()},_onBlurred:function(){this.isActivated=!1,this.dropdown.empty(),this.dropdown.close()},_onEnterKeyed:function(a,b){var c,d;c=this.dropdown.getDatumForCursor(),d=this.dropdown.getDatumForTopSuggestion(),c?(this._select(c),b.preventDefault()):this.autoselect&&d&&(this._select(d),b.preventDefault())},_onTabKeyed:function(a,b){var c;(c=this.dropdown.getDatumForCursor())?(this._select(c),b.preventDefault()):this._autocomplete(!0)},_onEscKeyed:function(){this.dropdown.close(),this.input.resetInputValue()},_onUpKeyed:function(){var a=this.input.getQuery();this.dropdown.isEmpty&&a.length>=this.minLength?this.dropdown.update(a):this.dropdown.moveCursorUp(),this.dropdown.open()},_onDownKeyed:function(){var a=this.input.getQuery();this.dropdown.isEmpty&&a.length>=this.minLength?this.dropdown.update(a):this.dropdown.moveCursorDown(),this.dropdown.open()},_onLeftKeyed:function(){"rtl"===this.dir&&this._autocomplete()},_onRightKeyed:function(){"ltr"===this.dir&&this._autocomplete()},_onQueryChanged:function(a,b){this.input.clearHintIfInvalid(),b.length>=this.minLength?this.dropdown.update(b):this.dropdown.empty(),this.dropdown.open(),this._setLanguageDirection()},_onWhitespaceChanged:function(){this._updateHint(),this.dropdown.open()},_setLanguageDirection:function(){var a;this.dir!==(a=this.input.getLanguageDirection())&&(this.dir=a,this.$node.css("direction",a),this.dropdown.setLanguageDirection(a))},_updateHint:function(){var a,c,d,e,f,g;a=this.dropdown.getDatumForTopSuggestion(),a&&this.dropdown.isVisible()&&!this.input.hasOverflow()?(c=this.input.getInputValue(),d=o.normalizeQuery(c),e=b.escapeRegExChars(d),f=new RegExp("^(?:"+e+")(.+$)","i"),g=f.exec(a.value),g?this.input.setHint(c+g[1]):this.input.clearHint()):this.input.clearHint()},_autocomplete:function(a){var b,c,d,e;b=this.input.getHint(),c=this.input.getQuery(),d=a||this.input.isCursorAtEnd(),b&&c!==b&&d&&(e=this.dropdown.getDatumForTopSuggestion(),e&&this.input.setInputValue(e.value),this.eventBus.trigger("autocompleted",e.raw,e.datasetName))},_select:function(a){this.input.setQuery(a.value),this.input.setInputValue(a.value,!0),this._setLanguageDirection(),this.eventBus.trigger("selected",a.raw,a.datasetName),this.dropdown.close(),b.defer(b.bind(this.dropdown.empty,this.dropdown))},open:function(){this.dropdown.open()},close:function(){this.dropdown.close()},setVal:function(a){a=b.toStr(a),this.isActivated?this.input.setInputValue(a):(this.input.setQuery(a),this.input.setInputValue(a,!0)),this._setLanguageDirection()},getVal:function(){return this.input.getQuery()},destroy:function(){this.input.destroy(),this.dropdown.destroy(),f(this.$node),this.$node=null}}),c}();!function(){"use strict";var c,d,e;c=a.fn.typeahead,d="ttTypeahead",e={initialize:function(c,e){function f(){var f,g,h=a(this);b.each(e,function(a){a.highlight=!!c.highlight}),g=new r({input:h,eventBus:f=new l({el:h}),withHint:b.isUndefined(c.hint)?!0:!!c.hint,minLength:c.minLength,autoselect:c.autoselect,datasets:e}),h.data(d,g)}return e=b.isArray(e)?e:[].slice.call(arguments,1),c=c||{},this.each(f)},open:function(){function b(){var b,c=a(this);(b=c.data(d))&&b.open()}return this.each(b)},close:function(){function b(){var b,c=a(this);(b=c.data(d))&&b.close()}return this.each(b)},val:function(b){function c(){var c,e=a(this);(c=e.data(d))&&c.setVal(b)}function e(a){var b,c;return(b=a.data(d))&&(c=b.getVal()),c}return arguments.length?this.each(c):e(this.first())},destroy:function(){function b(){var b,c=a(this);(b=c.data(d))&&(b.destroy(),c.removeData(d))}return this.each(b)}},a.fn.typeahead=function(b){var c;return e[b]&&"initialize"!==b?(c=this.filter(function(){return!!a(this).data(d)}),e[b].apply(c,[].slice.call(arguments,1))):e.initialize.apply(this,arguments)},a.fn.typeahead.noConflict=function(){return a.fn.typeahead=c,this}}()}(window.jQuery);
\ No newline at end of file
diff --git a/VNF_Catalogue/public/images/3rd_party/commits.png b/VNF_Catalogue/public/images/3rd_party/commits.png
new file mode 100644
index 00000000..1247621a
--- /dev/null
+++ b/VNF_Catalogue/public/images/3rd_party/commits.png
diff --git a/VNF_Catalogue/public/images/logo.png b/VNF_Catalogue/public/images/logo.png
new file mode 100644
index 00000000..fe18194e
--- /dev/null
+++ b/VNF_Catalogue/public/images/logo.png
diff --git a/VNF_Catalogue/public/javascripts/global.js b/VNF_Catalogue/public/javascripts/global.js
new file mode 100644
index 00000000..13be15a5
--- /dev/null
+++ b/VNF_Catalogue/public/javascripts/global.js
@@ -0,0 +1,110 @@
+/*******************************************************************************

+ * Copyright (c) 2017 Kumar Rishabh and others.

+ *

+ * All rights reserved. This program and the accompanying materials

+ * are made available under the terms of the Apache License, Version 2.0

+ * which accompanies this distribution, and is available at

+ * http://www.apache.org/licenses/LICENSE-2.0

+ *******************************************************************************/

+

+$(document).ready( function() {

+    $('select').material_select();

+    $('.modal').modal();

+    $(".button-collapse").sideNav();

+    $('.carousel').carousel();

+

+    $('#Search').click(function() {

+        var tags = $('#Tags').val().toLowerCase().split(/[ ,]+/);

+        window.location.href = '/search_projects?tags=' + tags;

+        return false;

+    });

+

+    $('#SearchSpan').click(function(){

+        var tags = $('#Tags').val().toLowerCase().split(/[ ,]+/);

+        window.location.href = '/search_projects?tags=' + tags;

+        return false;

+    });

+

+    $('div.form-group-custom i.material-icons').click(function(e){

+        var tags = $('#Tags').val().toLowerCase().split(/[ ,]+/);

+        window.location.href = '/search_projects?tags=' + tags;

+        return false;

+    });

+

+    $("#add_project_button").on('click',function(){

+        event.preventDefault();

+        var vnf_name = $("#vnf_name").val() ;

+

+        var formData = new FormData($('form#add_project_form')[0]);

+        var license = $('#license option:selected').val();

+        formData.append('license', license);

+        var opnfv_indicator = $('#opnfv_indicator option:selected').val();

+        formData.append('opnfv_indicator', opnfv_indicator);

+

+        $.ajax({

+            url: '/add_project',

+            type: 'post',

+            //dataType: 'json',

+            processData: false,  // tell jQuery not to process the data

+            contentType: false,  // tell jQuery not to set contentType

+            data: formData,

+            success: function(data) {

+                    $('#modal1').modal('close');

+                    $('form#add_project_form').trigger('reset');

+                    Materialize.toast('Successfully submitted the VNF!', 3000, 'rounded');

+            },

+            error: function (error) {

+                if(error['responseJSON']) {

+                    Materialize.toast(error['responseJSON']['error'], 3000, 'rounded');

+                } else if(error['responseText']) {

+                    var response_message = JSON.parse(error['responseText']);

+                    Materialize.toast(response_message['error'], 3000, 'rounded');

+                }

+                //$('#modal1').modal('open');

+            }

+        });

+    });

+    $("#add_tag_button").on('click',function(){

+        event.preventDefault();

+        var tag_name = $("#tag_name").val() ;

+

+        $.ajax({

+            url: '/add_tag',

+            type: 'post',

+            dataType: 'json',

+            data: $('form#add_tag_form').serialize(),

+            success: function(data) {

+                    $('#modal2').modal('close');

+                    $('form#add_tag_form').trigger('reset');

+                    Materialize.toast('Successfully submitted the TAG!', 3000, 'rounded');

+            },

+            error: function (error) {

+                Materialize.toast(error['responseJSON']['error'], 3000, 'rounded');

+            }

+        });

+    });

+

+    var QueryString = function () {

+        // This function is anonymous, is executed immediately and 

+        // the return value is assigned to QueryString!

+        var query_string = {};

+        var query = window.location.search.substring(1);

+        var vars = query.split("&");

+        for (var i=0;i<vars.length;i++) {

+        var pair = vars[i].split("=");

+        // If first entry with this name

+        if (typeof query_string[pair[0]] === "undefined") {

+            query_string[pair[0]] = decodeURIComponent(pair[1]);

+            // If second entry with this name

+        } else if (typeof query_string[pair[0]] === "string") {

+            var arr = [ query_string[pair[0]],decodeURIComponent(pair[1]) ];

+            query_string[pair[0]] = arr;

+        // If third or later entry with this name

+        } else {

+                query_string[pair[0]].push(decodeURIComponent(pair[1]));

+            }

+        } 

+        return query_string;

+    };

+

+});

diff --git a/VNF_Catalogue/public/javascripts/index.js b/VNF_Catalogue/public/javascripts/index.js
new file mode 100644
index 00000000..0e5ea7ff
--- /dev/null
+++ b/VNF_Catalogue/public/javascripts/index.js
@@ -0,0 +1,109 @@
+/*******************************************************************************

+ * Copyright (c) 2017 Kumar Rishabh and others.

+ *

+ * All rights reserved. This program and the accompanying materials

+ * are made available under the terms of the Apache License, Version 2.0

+ * which accompanies this distribution, and is available at

+ * http://www.apache.org/licenses/LICENSE-2.0

+ *******************************************************************************/

+

+$(document).ready( function() {

+    $('select').material_select();

+    $('.modal').modal();

+    $(".button-collapse").sideNav();

+    $('.carousel').carousel();

+

+    $('#Search').click(function() {

+        var tags = $('#Tags').val().toLowerCase().split(/[ ,]+/);

+        window.location.href = '/search_projects?tags=' + tags;

+        return false;

+    });

+

+    $('#SearchSpan').click(function(){

+        var tags = $('#Tags').val().toLowerCase().split(/[ ,]+/);

+        window.location.href = '/search_projects?tags=' + tags;

+        return false;

+    });

+

+    $('div.form-group-custom i.material-icons').click(function(e){

+        var tags = $('#Tags').val().toLowerCase().split(/[ ,]+/);

+        window.location.href = '/search_projects?tags=' + tags;

+        return false;

+    });

+

+    $("#add_project_button").on('click',function(){

+        event.preventDefault();

+        var vnf_name = $("#vnf_name").val() ;

+

+        var formData = new FormData($('form#add_project_form')[0]);

+        var license = $('#license option:selected').val();

+        formData.append('license', license);

+        var opnfv_indicator = $('#opnfv_indicator option:selected').val();

+        formData.append('opnfv_indicator', opnfv_indicator);

+

+        $.ajax({

+            url: '/add_project',

+            type: 'post',

+            //dataType: 'json',

+            processData: false,  // tell jQuery not to process the data

+            contentType: false,  // tell jQuery not to set contentType

+            data: formData,

+            success: function(data) {

+                    $('#modal1').modal('close');

+                    $('form#add_project_form').trigger('reset');

+                    Materialize.toast('Successfully submitted the VNF!', 3000, 'rounded');

+            },

+            error: function (error) {

+                if(error['responseJSON']) {

+                    Materialize.toast(error['responseJSON']['error'], 3000, 'rounded');

+                } else if(error['responseText']) {

+                    var response_message = JSON.parse(error['responseText']);

+                    Materialize.toast(response_message['error'], 3000, 'rounded');

+                }

+                //$('#modal1').modal('open');

+            }

+        });

+    });

+    $("#add_tag_button").on('click',function(){

+        event.preventDefault();

+        var tag_name = $("#tag_name").val() ;

+

+        $.ajax({

+            url: '/add_tag',

+            type: 'post',

+            dataType: 'json',

+            data: $('form#add_tag_form').serialize(),

+            success: function(data) {

+                    $('#modal2').modal('close');

+                    $('form#add_tag_form').trigger('reset');

+                    Materialize.toast('Successfully submitted the TAG!', 3000, 'rounded');

+            },

+            error: function (error) {

+                Materialize.toast(error['responseJSON']['error'], 3000, 'rounded');

+            }

+        });

+    });

+

+    $("#lines_of_code").on('click',function(){

+        event.preventDefault();

+        var json_data = {};

+        json_data['order_key'] = 'lines_of_code';

+        alert('here');

+        $.ajax({

+            url: '/search_max',

+            type: 'post',

+            dataType: 'json',

+            data: 'lines_of_code',

+            success: function(data) {

+                    $('#modal2').modal('close');

+                    $('form#add_tag_form').trigger('reset');

+                    Materialize.toast('Successfully submitted the TAG!', 3000, 'rounded');

+            },

+            error: function (error) {

+                Materialize.toast(error['responseJSON']['error'], 3000, 'rounded');

+            }

+        });

+    });

+

+

+});

diff --git a/VNF_Catalogue/public/javascripts/index_search_max.js b/VNF_Catalogue/public/javascripts/index_search_max.js
new file mode 100644
index 00000000..b9693117
--- /dev/null
+++ b/VNF_Catalogue/public/javascripts/index_search_max.js
@@ -0,0 +1,145 @@
+/*******************************************************************************

+ * Copyright (c) 2017 Kumar Rishabh and others.

+ *

+ * All rights reserved. This program and the accompanying materials

+ * are made available under the terms of the Apache License, Version 2.0

+ * which accompanies this distribution, and is available at

+ * http://www.apache.org/licenses/LICENSE-2.0

+ *******************************************************************************/

+

+$(document).ready( function() {

+    //alert('index saeerch max ....');

+    var lines_of_code_string = `

+        <div class="box-container">

+          <div class="col-md-3">

+            <div class="content-box">

+              <div class="content-data">

+                <h1 class="content-title"><a href="/project_profile?vnf_id=%vnf_id">%vnf_name%</a></h1>

+                <div class="box"><img class="img-size commit-icon" src="/uploads/%photo_url%"/>

+                  <h3 class="commits">%lines_of_code%<br/>Lines Of Code</h3>

+                </div>

+              </div>

+            </div>

+          </div>

+        </div>

+    `;

+

+    var no_of_developers_string = `

+        <div class="box-container">

+          <div class="col-md-3">

+            <div class="content-box">

+              <div class="content-data">

+                <h1 class="content-title"><a href="/project_profile?vnf_id=%vnf_id">%vnf_name%</a></h1>

+                <div class="box"><img class="img-size commit-icon" src="/uploads/%photo_url%"/>

+                  <h3 class="commits">%no_of_developers%<br/>No Of Developers</h3>

+                </div>

+              </div>

+            </div>

+          </div>

+        </div>

+    `;

+

+    var no_of_stars_string = `

+        <div class="box-container">

+          <div class="col-md-3">

+            <div class="content-box">

+              <div class="content-data">

+                <h1 class="content-title"><a href="/project_profile?vnf_id=%vnf_id">%vnf_name%</a></h1>

+                <div class="box"><img class="img-size commit-icon" src="/uploads/%photo_url%"/>

+                  <h3 class="commits">%no_of_stars%<br/>No Of Stars</h3>

+                </div>

+              </div>

+            </div>

+          </div>

+        </div>

+    `;

+

+    var search_max_result = function(string1, result) {

+        var string_replacement = {};

+        //alert(JSON.stringify(result));

+        

+        for (var k in result) {

+            if (result.hasOwnProperty(k)) {

+                string_replacement['%' + k + '%'] = result[k];

+                if(!string_replacement['%' + k + '%']) {

+                    string_replacement['%' + k + '%'] = -1;

+                }

+            }

+        }

+        //alert(JSON.stringify(string_replacement));

+        

+        string1 = string1.replace(/%\w+%/g, function(all) {

+            return string_replacement[all] || all;

+        });

+        //alert(JSON.stringify(string1));

+        return string1;

+    };

+

+    $("#lines_of_code").on('click',function(){

+        event.preventDefault();

+        var json_data = {};

+        json_data['order_key'] = 'lines_of_code';

+        $.ajax({

+            url: '/search_max',

+            type: 'post',

+            dataType: 'json',

+            data: json_data,

+            success: function(data) {

+                    html_string = '';

+                    for(var result in data) {

+                        html_string += search_max_result(lines_of_code_string, data[result]);

+                    }

+                    $('#content').html(html_string);

+

+            },

+            error: function (error) {

+                Materialize.toast(error['responseJSON']['error'], 3000, 'rounded');

+            }

+        });

+    });

+

+    $("#no_of_developers").on('click',function(){

+        event.preventDefault();

+        var json_data = {};

+        json_data['order_key'] = 'no_of_developers';

+        $.ajax({

+            url: '/search_max',

+            type: 'post',

+            dataType: 'json',

+            data: json_data,

+            success: function(data) {

+                    html_string = '';

+                    for(var result in data) {

+                        html_string += search_max_result(no_of_developers_string, data[result]);

+                    }

+                    $('#content').html(html_string);

+            },

+            error: function (error) {

+                Materialize.toast('', 3000, 'rounded');

+            }

+        });

+    });

+

+    $("#no_of_stars").on('click',function(){

+        event.preventDefault();

+        var json_data = {};

+        json_data['order_key'] = 'no_of_stars';

+        $.ajax({

+            url: '/search_max',

+            type: 'post',

+            dataType: 'json',

+            data: json_data,

+            success: function(data) {

+                    html_string = '';

+                    for(var result in data) {

+                        html_string += search_max_result(no_of_stars_string, data[result]);

+                    }

+                    $('#content').html(html_string);

+            },

+            error: function (error) {

+                Materialize.toast('', 3000, 'rounded');

+            }

+        });

+    });

+

+});

diff --git a/VNF_Catalogue/public/javascripts/mode_edit.js b/VNF_Catalogue/public/javascripts/mode_edit.js
new file mode 100644
index 00000000..2047a92a
--- /dev/null
+++ b/VNF_Catalogue/public/javascripts/mode_edit.js
@@ -0,0 +1,82 @@
+/*******************************************************************************

+ * Copyright (c) 2017 Kumar Rishabh and others.

+ *

+ * All rights reserved. This program and the accompanying materials

+ * are made available under the terms of the Apache License, Version 2.0

+ * which accompanies this distribution, and is available at

+ * http://www.apache.org/licenses/LICENSE-2.0

+ *******************************************************************************/

+

+$(document).ready( function() {

+

+    //getVnfs : get 5 main VNFs using typeahead

+    var getVnfs = new Bloodhound({

+        datumTokenizer: Bloodhound.tokenizers.obj.whitespace('vnf_name'),

+        queryTokenizer: Bloodhound.tokenizers.obj.whitespace('vnf_name'),

+        remote: {

+            url: '/search_vnf?key=%QUERY',

+            wildcard: '%QUERY'

+        },

+        limit: 5

+    });

+

+    getVnfs.initialize();

+    $('#scrollable-dropdown-menu #vnf_name.typeahead').typeahead(

+    {

+        hint: true,

+        highlight: true,

+        minLength: 1

+    },

+    {

+        name: 'vnf_name',

+        display: 'vnf_name',

+        limit: 5,

+        source: getVnfs.ttAdapter()

+    });

+

+    //getTags : get 5 main tags using typeahead

+    var getTags = new Bloodhound({

+        datumTokenizer: Bloodhound.tokenizers.obj.whitespace('tag_name'),

+        queryTokenizer: Bloodhound.tokenizers.obj.whitespace('tag_name'),

+        remote: {

+            url: '/search_tag?key=%QUERY',

+            wildcard: '%QUERY'

+        },

+        limit: 5

+    });

+

+    getTags.initialize();

+    $('#scrollable-dropdown-menu #tag_name.typeahead').typeahead(

+    {

+        hint: true,

+        highlight: true,

+        minLength: 1

+    },

+    {

+        name: 'tag_name',

+        display: 'tag_name',

+        limit: 5,

+        source: getTags.ttAdapter()

+    });

+

+    $("#add_vnf_tag_association_button").on('click',function(){

+        event.preventDefault();

+        var vnf_name = $("#vnf_name").val() ;

+

+        $.ajax({

+            url: '/vnf_tag_association',

+            type: 'post',

+            dataType: 'json',

+            data: $('form#add_vnf_tag_association_form').serialize(),

+            success: function(data) {

+                    $('#modal3').modal('close');

+                    $('form#add_vnf_tag_association_form').trigger('reset');

+                    Materialize.toast('Successfully added the TAG to the VNF!', 3000, 'rounded');

+            },

+            error: function (error) {

+                Materialize.toast(error['responseJSON']['error'], 3000, 'rounded');

+            }

+        });

+    });

+

+});

diff --git a/VNF_Catalogue/public/javascripts/mode_edit_project.js b/VNF_Catalogue/public/javascripts/mode_edit_project.js
new file mode 100644
index 00000000..cb457385
--- /dev/null
+++ b/VNF_Catalogue/public/javascripts/mode_edit_project.js
@@ -0,0 +1,105 @@
+/*******************************************************************************

+ * Copyright (c) 2017 Kumar Rishabh and others.

+ *

+ * All rights reserved. This program and the accompanying materials

+ * are made available under the terms of the Apache License, Version 2.0

+ * which accompanies this distribution, and is available at

+ * http://www.apache.org/licenses/LICENSE-2.0

+ *******************************************************************************/

+

+$(document).ready( function() {

+

+    //getVnfs : get 5 main VNFs using typeahead

+    var getVnfs = new Bloodhound({

+        datumTokenizer: Bloodhound.tokenizers.obj.whitespace('vnf_name'),

+        queryTokenizer: Bloodhound.tokenizers.obj.whitespace('vnf_name'),

+        remote: {

+            url: '/search_vnf?key=%QUERY',

+            wildcard: '%QUERY'

+        },

+        limit: 5

+    });

+

+    getVnfs.initialize();

+    $('#scrollable-dropdown-menu #vnf_name.typeahead').typeahead(

+    {

+        hint: true,

+        highlight: true,

+        minLength: 1

+    },

+    {

+        name: 'vnf_name',

+        display: 'vnf_name',

+        limit: 5,

+        source: getVnfs.ttAdapter()

+    });

+

+    //getTags : get 5 main tags using typeahead

+    var getTags = new Bloodhound({

+        datumTokenizer: Bloodhound.tokenizers.obj.whitespace('tag_name'),

+        queryTokenizer: Bloodhound.tokenizers.obj.whitespace('tag_name'),

+        remote: {

+            url: '/search_tag?key=%QUERY',

+            wildcard: '%QUERY'

+        },

+        limit: 5

+    });

+

+    getTags.initialize();

+    $('#scrollable-dropdown-menu #tag_name.typeahead').typeahead(

+    {

+        hint: true,

+        highlight: true,

+        minLength: 1

+    },

+    {

+        name: 'tag_name',

+        display: 'tag_name',

+        limit: 5,

+        source: getTags.ttAdapter()

+    });

+

+    $("#add_vnf_tag_association_button").on('click',function(){

+        event.preventDefault();

+        var vnf_name = $("#vnf_name").val() ;

+

+        $.ajax({

+            url: '/vnf_tag_association',

+            type: 'post',

+            dataType: 'json',

+            data: $('form#add_vnf_tag_association_form').serialize(),

+            success: function(data) {

+                    $('#modal3').modal('close');

+                    $('form#add_vnf_tag_association_form').trigger('reset');

+                    Materialize.toast('Successfully added the TAG to the VNF!', 3000, 'rounded');

+            },

+            error: function (error) {

+                Materialize.toast(error['responseJSON']['error'], 3000, 'rounded');

+            }

+        });

+    });

+    alert('here');

+    $("#modal_href").click(function() {

+        //Do stuff when clicked

+        var json_data = {};

+        json_data['vnf_id'] = QueryString()['vnf_id'];

+

+        alert('here here');

+

+        $.ajax({

+            url: '/project_profile',

+            type: 'post',

+            dataType: 'json',

+            data: json_data,

+            success: function(data) {

+                    Materialize.toast(data, 3000, 'rounded');

+            },

+            error: function (error) {

+                Materialize.toast('', 3000, 'rounded');

+            }

+        });

+    });

+    var openSolution = function() {

+        alert('here');

+    };

+});

diff --git a/VNF_Catalogue/public/javascripts/search_results.js b/VNF_Catalogue/public/javascripts/search_results.js
new file mode 100644
index 00000000..4dfb921b
--- /dev/null
+++ b/VNF_Catalogue/public/javascripts/search_results.js
@@ -0,0 +1,227 @@
+/*******************************************************************************

+ * Copyright (c) 2017 Kumar Rishabh and others.

+ *

+ * All rights reserved. This program and the accompanying materials

+ * are made available under the terms of the Apache License, Version 2.0

+ * which accompanies this distribution, and is available at

+ * http://www.apache.org/licenses/LICENSE-2.0

+ *******************************************************************************/

+

+$(document).ready( function() {

+	var search_result_string_1 = `

+		<div class = "container container-custom">

+		<div class="card card-shadow-custom horizontal">

+		  <div class="row row-custom">

+		    

+		    <div class="col s5 card-title-div-custom">

+		      <span class="card-title card-title-span-custom">

+		        <a class="custom-href" href="/project_profile?vnf_id=%vnf_id%">%vnf_name%</a>

+		      </span>

+		    </div>

+		    

+		    <div class="col s5 card-title-div-custom">

+		      <i class="material-icons">grade</i>

+		      <span class="card-title">PenguinScore: 42</span>

+		    </div>

+		    

+		    <div class="col s2 card-title-div-custom-right">

+		      <form action="#">

+		        <input id="search_result_1" type="checkbox" name="%vnf_name%"/>

+		        <label for="search_result_1">Compare</label>

+		      </form>

+		    </div>

+		    

+		    <div class="col s4 card-image card-image-custom">

+		      <img class="img-size card-image-picture-custom" src="/uploads/%photo_url%"/>

+		    </div>

+		    

+		    <div class="col s8 card-stacked">

+		      <div class="card-content">

+		        <p>

+		          <div class="collection collection-custom">

+		            <a class="collection-item" href="#!">

+		              <span>

+		                <i class="material-icons">code</i>                            

+		                Lines Of Code: %lines_of_code%

+		              </span>

+		            </a>

+		            <a class="collection-item" href="#!">

+		              <span>

+		                <i class="material-icons">person</i>

+		                Number of Developers: %no_of_developers%;

+		              </span>

+		            </a>

+		            <a class="collection-item" href="#!">

+		              <span>

+		                <i class="material-icons">star</i>

+		                Number of Stars: %no_of_stars%

+		              </span>

+		            </a>

+		            <a class="collection-item" href="#!">

+		              <span>

+		                <i class="material-icons">description</i>

+		                Number of Versions: %versions%

+		              </span>

+		            </a>

+		          </div>

+		        </p>

+		      </div>

+		      <div class="card-action">

+		        Tags:

+		    `;

+    var search_result_string_2 = `

+		        <div class="chip"><a class="a-custom" href="#!">tag1</a></div>

+		        <div class="chip"><a class="a-custom" href="#!">Tag2</a></div>

+		        <div class="chip"><a class="a-custom" href="#!">Tag3</a></div>

+		        <div class="chip"><a class="a-custom" href="#!">Tag4</a></div>

+		        <div class="chip"><a class="a-custom" href="#!">Tag5</a></div>

+		`;

+	var search_result_string_3 = `

+		        <a class="a-custom-more" href="/project_profile?vnf_id=%vnf_id%">

+		          more

+		        </a>

+		      </div>

+		    </div>

+		    

+		    <div class="divider"></div>

+		    

+		    <div class="card-action-custom col s12 card-action">

+		      License: <a href="#">%license%</a>

+		      Complexity: <a href="#">Atomic</a>

+		      Activity: <a href="#">Medium</a>

+		      OPNFV Indicator: <a href="#">%opnfv_indicator%</a>

+		    </div>

+		    

+		  </div>

+		</div></div>

+		`;

+

+	//var replace_search_result_string = function(search_result_string, 

+	var search_result = function(string1, string3, result) {

+		var string_replacement = {};

+		//alert(JSON.stringify(result));

+		

+		for (var k in result) {

+        	if (result.hasOwnProperty(k)) {

+           		string_replacement['%' + k + '%'] = result[k];

+           		if(!string_replacement['%' + k + '%']) {

+           			string_replacement['%' + k + '%'] = -1;

+           		}

+        	}

+    	}

+    	//alert(JSON.stringify(string_replacement));

+		

+		string1 = string1.replace(/%\w+%/g, function(all) {

+   			return string_replacement[all] || all;

+		});

+

+		for(index in string_replacement['%tags%']) {

+			string1 += '<div class="chip"><a class="a-custom" href="#!">';

+			string1 += string_replacement['%tags%'][index]['tag_name'];

+			string1 += '</a></div>';

+		}

+

+		string3 = string3.replace(/%\w+%/g, function(all) {

+   			return string_replacement[all] || all;

+		});

+

+		return string1 + string3;

+	};

+

+

+

+	var QueryString = function () {

+  		// This function is anonymous, is executed immediately and 

+  		// the return value is assigned to QueryString!

+  		var query_string = {};

+  		var query = window.location.search.substring(1);

+  		var vars = query.split("&");

+  		for (var i=0;i<vars.length;i++) {

+    	var pair = vars[i].split("=");

+        // If first entry with this name

+    	if (typeof query_string[pair[0]] === "undefined") {

+      		query_string[pair[0]] = decodeURIComponent(pair[1]);

+        	// If second entry with this name

+    	} else if (typeof query_string[pair[0]] === "string") {

+      		var arr = [ query_string[pair[0]],decodeURIComponent(pair[1]) ];

+      		query_string[pair[0]] = arr;

+        // If third or later entry with this name

+    	} else {

+      			query_string[pair[0]].push(decodeURIComponent(pair[1]));

+    		}

+  		} 

+  		return query_string;

+	};

+

+	$('#pagination-long').materializePagination({

+      align: 'center',

+      lastPage:  5,

+      firstPage:  1,

+      urlParameter: 'page',

+      useUrlParameter: true,

+      onClickCallback: function(requestedPage){

+        	var json_data = {};

+        	json_data['tags'] = QueryString()['tags'];

+        	json_data['page'] = requestedPage;

+  			

+  			console.log(json_data);

+

+  			$.ajax({

+            	url: '/search_projects_results',

+            	type: 'post',

+            	dataType: 'json',

+            	data: json_data,

+            	success: function(data) {

+            		//alert(JSON.stringify(data));

+            		html_string = '';

+            		for(var result in data) {

+            			html_string += search_result(search_result_string_1, search_result_string_3, data[result]);

+            		}

+            		$('#content').html(html_string);

+                    //Materialize.toast(data, 3000, 'rounded');

+            	},

+            	error: function (error) {

+                	Materialize.toast('', 3000, 'rounded');

+            	}

+        	});

+

+        	//window.location.href = '/search_projects?tags=' + parameters['tags'] + '&page=' + requestedPage;

+    		//return false;

+      }

+  	});

+	

+	/*$('#pagination-long').pagination({

+      align: 'center',

+      lastPage:  5,

+      firstPage:  1,

+      //urlParameter: 'page',

+      useUrlParameter: false,

+      onClickCallback: function(requestedPage){

+        	var query_string = {};

+  			var query = window.location.search.substring(1);

+  			console.log(query);

+  			var vars = query.split("&");

+  			console.log(vars);

+  			vars['page'] = requestedPage;

+  			console.log(vars);

+  			var parameters = QueryString();

+  			

+  			console.log(parameters);

+

+

+        	window.location.href = '/search_projects?tags=' + parameters['tags'];

+    		//return false;

+      }

+      var query_string = {};

+  			var query = window.location.search.substring(1);

+  			console.log(query);

+  			var vars = query.split("&");

+  			console.log(vars);

+  			vars['page'] = requestedPage;

+  			console.log(vars);

+  			

+  	});*/

+

+

+

+});

diff --git a/VNF_Catalogue/public/stylesheets/3rd_party/bootstrap.css b/VNF_Catalogue/public/stylesheets/3rd_party/bootstrap.css
new file mode 100755
index 00000000..6167622c
--- /dev/null
+++ b/VNF_Catalogue/public/stylesheets/3rd_party/bootstrap.css
@@ -0,0 +1,6757 @@
+/*!
+ * Bootstrap v3.3.7 (http://getbootstrap.com)
+ * Copyright 2011-2016 Twitter, Inc.
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ */
+/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */
+html {
+  font-family: sans-serif;
+  -webkit-text-size-adjust: 100%;
+      -ms-text-size-adjust: 100%;
+}
+body {
+  margin: 0;
+}
+article,
+aside,
+details,
+figcaption,
+figure,
+footer,
+header,
+hgroup,
+main,
+menu,
+nav,
+section,
+summary {
+  display: block;
+}
+audio,
+canvas,
+progress,
+video {
+  display: inline-block;
+  vertical-align: baseline;
+}
+audio:not([controls]) {
+  display: none;
+  height: 0;
+}
+[hidden],
+template {
+  display: none;
+}
+a {
+  background-color: transparent;
+}
+a:active,
+a:hover {
+  outline: 0;
+}
+abbr[title] {
+  border-bottom: 1px dotted;
+}
+b,
+strong {
+  font-weight: bold;
+}
+dfn {
+  font-style: italic;
+}
+h1 {
+  margin: .67em 0;
+  font-size: 2em;
+}
+mark {
+  color: #000;
+  background: #ff0;
+}
+small {
+  font-size: 80%;
+}
+sub,
+sup {
+  position: relative;
+  font-size: 75%;
+  line-height: 0;
+  vertical-align: baseline;
+}
+sup {
+  top: -.5em;
+}
+sub {
+  bottom: -.25em;
+}
+img {
+  border: 0;
+}
+svg:not(:root) {
+  overflow: hidden;
+}
+figure {
+  margin: 1em 40px;
+}
+hr {
+  height: 0;
+  -webkit-box-sizing: content-box;
+     -moz-box-sizing: content-box;
+          box-sizing: content-box;
+}
+pre {
+  overflow: auto;
+}
+code,
+kbd,
+pre,
+samp {
+  font-family: monospace, monospace;
+  font-size: 1em;
+}
+button,
+input,
+optgroup,
+select,
+textarea {
+  margin: 0;
+  font: inherit;
+  color: inherit;
+}
+button {
+  overflow: visible;
+}
+button,
+select {
+  text-transform: none;
+}
+button,
+html input[type="button"],
+input[type="reset"],
+input[type="submit"] {
+  -webkit-appearance: button;
+  cursor: pointer;
+}
+button[disabled],
+html input[disabled] {
+  cursor: default;
+}
+button::-moz-focus-inner,
+input::-moz-focus-inner {
+  padding: 0;
+  border: 0;
+}
+input {
+  line-height: normal;
+}
+input[type="checkbox"],
+input[type="radio"] {
+  -webkit-box-sizing: border-box;
+     -moz-box-sizing: border-box;
+          box-sizing: border-box;
+  padding: 0;
+}
+input[type="number"]::-webkit-inner-spin-button,
+input[type="number"]::-webkit-outer-spin-button {
+  height: auto;
+}
+input[type="search"] {
+  -webkit-box-sizing: content-box;
+     -moz-box-sizing: content-box;
+          box-sizing: content-box;
+  -webkit-appearance: textfield;
+}
+input[type="search"]::-webkit-search-cancel-button,
+input[type="search"]::-webkit-search-decoration {
+  -webkit-appearance: none;
+}
+fieldset {
+  padding: .35em .625em .75em;
+  margin: 0 2px;
+  border: 1px solid #c0c0c0;
+}
+legend {
+  padding: 0;
+  border: 0;
+}
+textarea {
+  overflow: auto;
+}
+optgroup {
+  font-weight: bold;
+}
+table {
+  border-spacing: 0;
+  border-collapse: collapse;
+}
+td,
+th {
+  padding: 0;
+}
+/*! Source: https://github.com/h5bp/html5-boilerplate/blob/master/src/css/main.css */
+@media print {
+  *,
+  *:before,
+  *:after {
+    color: #000 !important;
+    text-shadow: none !important;
+    background: transparent !important;
+    -webkit-box-shadow: none !important;
+            box-shadow: none !important;
+  }
+  a,
+  a:visited {
+    text-decoration: underline;
+  }
+  a[href]:after {
+    content: " (" attr(href) ")";
+  }
+  abbr[title]:after {
+    content: " (" attr(title) ")";
+  }
+  a[href^="#"]:after,
+  a[href^="javascript:"]:after {
+    content: "";
+  }
+  pre,
+  blockquote {
+    border: 1px solid #999;
+
+    page-break-inside: avoid;
+  }
+  thead {
+    display: table-header-group;
+  }
+  tr,
+  img {
+    page-break-inside: avoid;
+  }
+  img {
+    max-width: 100% !important;
+  }
+  p,
+  h2,
+  h3 {
+    orphans: 3;
+    widows: 3;
+  }
+  h2,
+  h3 {
+    page-break-after: avoid;
+  }
+  .navbar {
+    display: none;
+  }
+  .btn > .caret,
+  .dropup > .btn > .caret {
+    border-top-color: #000 !important;
+  }
+  .label {
+    border: 1px solid #000;
+  }
+  .table {
+    border-collapse: collapse !important;
+  }
+  .table td,
+  .table th {
+    background-color: #fff !important;
+  }
+  .table-bordered th,
+  .table-bordered td {
+    border: 1px solid #ddd !important;
+  }
+}
+@font-face {
+  font-family: 'Glyphicons Halflings';
+
+  src: url('../fonts/glyphicons-halflings-regular.eot');
+  src: url('../fonts/glyphicons-halflings-regular.eot?#iefix') format('embedded-opentype'), url('../fonts/glyphicons-halflings-regular.woff2') format('woff2'), url('../fonts/glyphicons-halflings-regular.woff') format('woff'), url('../fonts/glyphicons-halflings-regular.ttf') format('truetype'), url('../fonts/glyphicons-halflings-regular.svg#glyphicons_halflingsregular') format('svg');
+}
+.glyphicon {
+  position: relative;
+  top: 1px;
+  display: inline-block;
+  font-family: 'Glyphicons Halflings';
+  font-style: normal;
+  font-weight: normal;
+  line-height: 1;
+
+  -webkit-font-smoothing: antialiased;
+  -moz-osx-font-smoothing: grayscale;
+}
+.glyphicon-asterisk:before {
+  content: "\002a";
+}
+.glyphicon-plus:before {
+  content: "\002b";
+}
+.glyphicon-euro:before,
+.glyphicon-eur:before {
+  content: "\20ac";
+}
+.glyphicon-minus:before {
+  content: "\2212";
+}
+.glyphicon-cloud:before {
+  content: "\2601";
+}
+.glyphicon-envelope:before {
+  content: "\2709";
+}
+.glyphicon-pencil:before {
+  content: "\270f";
+}
+.glyphicon-glass:before {
+  content: "\e001";
+}
+.glyphicon-music:before {
+  content: "\e002";
+}
+.glyphicon-search:before {
+  content: "\e003";
+}
+.glyphicon-heart:before {
+  content: "\e005";
+}
+.glyphicon-star:before {
+  content: "\e006";
+}
+.glyphicon-star-empty:before {
+  content: "\e007";
+}
+.glyphicon-user:before {
+  content: "\e008";
+}
+.glyphicon-film:before {
+  content: "\e009";
+}
+.glyphicon-th-large:before {
+  content: "\e010";
+}
+.glyphicon-th:before {
+  content: "\e011";
+}
+.glyphicon-th-list:before {
+  content: "\e012";
+}
+.glyphicon-ok:before {
+  content: "\e013";
+}
+.glyphicon-remove:before {
+  content: "\e014";
+}
+.glyphicon-zoom-in:before {
+  content: "\e015";
+}
+.glyphicon-zoom-out:before {
+  content: "\e016";
+}
+.glyphicon-off:before {
+  content: "\e017";
+}
+.glyphicon-signal:before {
+  content: "\e018";
+}
+.glyphicon-cog:before {
+  content: "\e019";
+}
+.glyphicon-trash:before {
+  content: "\e020";
+}
+.glyphicon-home:before {
+  content: "\e021";
+}
+.glyphicon-file:before {
+  content: "\e022";
+}
+.glyphicon-time:before {
+  content: "\e023";
+}
+.glyphicon-road:before {
+  content: "\e024";
+}
+.glyphicon-download-alt:before {
+  content: "\e025";
+}
+.glyphicon-download:before {
+  content: "\e026";
+}
+.glyphicon-upload:before {
+  content: "\e027";
+}
+.glyphicon-inbox:before {
+  content: "\e028";
+}
+.glyphicon-play-circle:before {
+  content: "\e029";
+}
+.glyphicon-repeat:before {
+  content: "\e030";
+}
+.glyphicon-refresh:before {
+  content: "\e031";
+}
+.glyphicon-list-alt:before {
+  content: "\e032";
+}
+.glyphicon-lock:before {
+  content: "\e033";
+}
+.glyphicon-flag:before {
+  content: "\e034";
+}
+.glyphicon-headphones:before {
+  content: "\e035";
+}
+.glyphicon-volume-off:before {
+  content: "\e036";
+}
+.glyphicon-volume-down:before {
+  content: "\e037";
+}
+.glyphicon-volume-up:before {
+  content: "\e038";
+}
+.glyphicon-qrcode:before {
+  content: "\e039";
+}
+.glyphicon-barcode:before {
+  content: "\e040";
+}
+.glyphicon-tag:before {
+  content: "\e041";
+}
+.glyphicon-tags:before {
+  content: "\e042";
+}
+.glyphicon-book:before {
+  content: "\e043";
+}
+.glyphicon-bookmark:before {
+  content: "\e044";
+}
+.glyphicon-print:before {
+  content: "\e045";
+}
+.glyphicon-camera:before {
+  content: "\e046";
+}
+.glyphicon-font:before {
+  content: "\e047";
+}
+.glyphicon-bold:before {
+  content: "\e048";
+}
+.glyphicon-italic:before {
+  content: "\e049";
+}
+.glyphicon-text-height:before {
+  content: "\e050";
+}
+.glyphicon-text-width:before {
+  content: "\e051";
+}
+.glyphicon-align-left:before {
+  content: "\e052";
+}
+.glyphicon-align-center:before {
+  content: "\e053";
+}
+.glyphicon-align-right:before {
+  content: "\e054";
+}
+.glyphicon-align-justify:before {
+  content: "\e055";
+}
+.glyphicon-list:before {
+  content: "\e056";
+}
+.glyphicon-indent-left:before {
+  content: "\e057";
+}
+.glyphicon-indent-right:before {
+  content: "\e058";
+}
+.glyphicon-facetime-video:before {
+  content: "\e059";
+}
+.glyphicon-picture:before {
+  content: "\e060";
+}
+.glyphicon-map-marker:before {
+  content: "\e062";
+}
+.glyphicon-adjust:before {
+  content: "\e063";
+}
+.glyphicon-tint:before {
+  content: "\e064";
+}
+.glyphicon-edit:before {
+  content: "\e065";
+}
+.glyphicon-share:before {
+  content: "\e066";
+}
+.glyphicon-check:before {
+  content: "\e067";
+}
+.glyphicon-move:before {
+  content: "\e068";
+}
+.glyphicon-step-backward:before {
+  content: "\e069";
+}
+.glyphicon-fast-backward:before {
+  content: "\e070";
+}
+.glyphicon-backward:before {
+  content: "\e071";
+}
+.glyphicon-play:before {
+  content: "\e072";
+}
+.glyphicon-pause:before {
+  content: "\e073";
+}
+.glyphicon-stop:before {
+  content: "\e074";
+}
+.glyphicon-forward:before {
+  content: "\e075";
+}
+.glyphicon-fast-forward:before {
+  content: "\e076";
+}
+.glyphicon-step-forward:before {
+  content: "\e077";
+}
+.glyphicon-eject:before {
+  content: "\e078";
+}
+.glyphicon-chevron-left:before {
+  content: "\e079";
+}
+.glyphicon-chevron-right:before {
+  content: "\e080";
+}
+.glyphicon-plus-sign:before {
+  content: "\e081";
+}
+.glyphicon-minus-sign:before {
+  content: "\e082";
+}
+.glyphicon-remove-sign:before {
+  content: "\e083";
+}
+.glyphicon-ok-sign:before {
+  content: "\e084";
+}
+.glyphicon-question-sign:before {
+  content: "\e085";
+}
+.glyphicon-info-sign:before {
+  content: "\e086";
+}
+.glyphicon-screenshot:before {
+  content: "\e087";
+}
+.glyphicon-remove-circle:before {
+  content: "\e088";
+}
+.glyphicon-ok-circle:before {
+  content: "\e089";
+}
+.glyphicon-ban-circle:before {
+  content: "\e090";
+}
+.glyphicon-arrow-left:before {
+  content: "\e091";
+}
+.glyphicon-arrow-right:before {
+  content: "\e092";
+}
+.glyphicon-arrow-up:before {
+  content: "\e093";
+}
+.glyphicon-arrow-down:before {
+  content: "\e094";
+}
+.glyphicon-share-alt:before {
+  content: "\e095";
+}
+.glyphicon-resize-full:before {
+  content: "\e096";
+}
+.glyphicon-resize-small:before {
+  content: "\e097";
+}
+.glyphicon-exclamation-sign:before {
+  content: "\e101";
+}
+.glyphicon-gift:before {
+  content: "\e102";
+}
+.glyphicon-leaf:before {
+  content: "\e103";
+}
+.glyphicon-fire:before {
+  content: "\e104";
+}
+.glyphicon-eye-open:before {
+  content: "\e105";
+}
+.glyphicon-eye-close:before {
+  content: "\e106";
+}
+.glyphicon-warning-sign:before {
+  content: "\e107";
+}
+.glyphicon-plane:before {
+  content: "\e108";
+}
+.glyphicon-calendar:before {
+  content: "\e109";
+}
+.glyphicon-random:before {
+  content: "\e110";
+}
+.glyphicon-comment:before {
+  content: "\e111";
+}
+.glyphicon-magnet:before {
+  content: "\e112";
+}
+.glyphicon-chevron-up:before {
+  content: "\e113";
+}
+.glyphicon-chevron-down:before {
+  content: "\e114";
+}
+.glyphicon-retweet:before {
+  content: "\e115";
+}
+.glyphicon-shopping-cart:before {
+  content: "\e116";
+}
+.glyphicon-folder-close:before {
+  content: "\e117";
+}
+.glyphicon-folder-open:before {
+  content: "\e118";
+}
+.glyphicon-resize-vertical:before {
+  content: "\e119";
+}
+.glyphicon-resize-horizontal:before {
+  content: "\e120";
+}
+.glyphicon-hdd:before {
+  content: "\e121";
+}
+.glyphicon-bullhorn:before {
+  content: "\e122";
+}
+.glyphicon-bell:before {
+  content: "\e123";
+}
+.glyphicon-certificate:before {
+  content: "\e124";
+}
+.glyphicon-thumbs-up:before {
+  content: "\e125";
+}
+.glyphicon-thumbs-down:before {
+  content: "\e126";
+}
+.glyphicon-hand-right:before {
+  content: "\e127";
+}
+.glyphicon-hand-left:before {
+  content: "\e128";
+}
+.glyphicon-hand-up:before {
+  content: "\e129";
+}
+.glyphicon-hand-down:before {
+  content: "\e130";
+}
+.glyphicon-circle-arrow-right:before {
+  content: "\e131";
+}
+.glyphicon-circle-arrow-left:before {
+  content: "\e132";
+}
+.glyphicon-circle-arrow-up:before {
+  content: "\e133";
+}
+.glyphicon-circle-arrow-down:before {
+  content: "\e134";
+}
+.glyphicon-globe:before {
+  content: "\e135";
+}
+.glyphicon-wrench:before {
+  content: "\e136";
+}
+.glyphicon-tasks:before {
+  content: "\e137";
+}
+.glyphicon-filter:before {
+  content: "\e138";
+}
+.glyphicon-briefcase:before {
+  content: "\e139";
+}
+.glyphicon-fullscreen:before {
+  content: "\e140";
+}
+.glyphicon-dashboard:before {
+  content: "\e141";
+}
+.glyphicon-paperclip:before {
+  content: "\e142";
+}
+.glyphicon-heart-empty:before {
+  content: "\e143";
+}
+.glyphicon-link:before {
+  content: "\e144";
+}
+.glyphicon-phone:before {
+  content: "\e145";
+}
+.glyphicon-pushpin:before {
+  content: "\e146";
+}
+.glyphicon-usd:before {
+  content: "\e148";
+}
+.glyphicon-gbp:before {
+  content: "\e149";
+}
+.glyphicon-sort:before {
+  content: "\e150";
+}
+.glyphicon-sort-by-alphabet:before {
+  content: "\e151";
+}
+.glyphicon-sort-by-alphabet-alt:before {
+  content: "\e152";
+}
+.glyphicon-sort-by-order:before {
+  content: "\e153";
+}
+.glyphicon-sort-by-order-alt:before {
+  content: "\e154";
+}
+.glyphicon-sort-by-attributes:before {
+  content: "\e155";
+}
+.glyphicon-sort-by-attributes-alt:before {
+  content: "\e156";
+}
+.glyphicon-unchecked:before {
+  content: "\e157";
+}
+.glyphicon-expand:before {
+  content: "\e158";
+}
+.glyphicon-collapse-down:before {
+  content: "\e159";
+}
+.glyphicon-collapse-up:before {
+  content: "\e160";
+}
+.glyphicon-log-in:before {
+  content: "\e161";
+}
+.glyphicon-flash:before {
+  content: "\e162";
+}
+.glyphicon-log-out:before {
+  content: "\e163";
+}
+.glyphicon-new-window:before {
+  content: "\e164";
+}
+.glyphicon-record:before {
+  content: "\e165";
+}
+.glyphicon-save:before {
+  content: "\e166";
+}
+.glyphicon-open:before {
+  content: "\e167";
+}
+.glyphicon-saved:before {
+  content: "\e168";
+}
+.glyphicon-import:before {
+  content: "\e169";
+}
+.glyphicon-export:before {
+  content: "\e170";
+}
+.glyphicon-send:before {
+  content: "\e171";
+}
+.glyphicon-floppy-disk:before {
+  content: "\e172";
+}
+.glyphicon-floppy-saved:before {
+  content: "\e173";
+}
+.glyphicon-floppy-remove:before {
+  content: "\e174";
+}
+.glyphicon-floppy-save:before {
+  content: "\e175";
+}
+.glyphicon-floppy-open:before {
+  content: "\e176";
+}
+.glyphicon-credit-card:before {
+  content: "\e177";
+}
+.glyphicon-transfer:before {
+  content: "\e178";
+}
+.glyphicon-cutlery:before {
+  content: "\e179";
+}
+.glyphicon-header:before {
+  content: "\e180";
+}
+.glyphicon-compressed:before {
+  content: "\e181";
+}
+.glyphicon-earphone:before {
+  content: "\e182";
+}
+.glyphicon-phone-alt:before {
+  content: "\e183";
+}
+.glyphicon-tower:before {
+  content: "\e184";
+}
+.glyphicon-stats:before {
+  content: "\e185";
+}
+.glyphicon-sd-video:before {
+  content: "\e186";
+}
+.glyphicon-hd-video:before {
+  content: "\e187";
+}
+.glyphicon-subtitles:before {
+  content: "\e188";
+}
+.glyphicon-sound-stereo:before {
+  content: "\e189";
+}
+.glyphicon-sound-dolby:before {
+  content: "\e190";
+}
+.glyphicon-sound-5-1:before {
+  content: "\e191";
+}
+.glyphicon-sound-6-1:before {
+  content: "\e192";
+}
+.glyphicon-sound-7-1:before {
+  content: "\e193";
+}
+.glyphicon-copyright-mark:before {
+  content: "\e194";
+}
+.glyphicon-registration-mark:before {
+  content: "\e195";
+}
+.glyphicon-cloud-download:before {
+  content: "\e197";
+}
+.glyphicon-cloud-upload:before {
+  content: "\e198";
+}
+.glyphicon-tree-conifer:before {
+  content: "\e199";
+}
+.glyphicon-tree-deciduous:before {
+  content: "\e200";
+}
+.glyphicon-cd:before {
+  content: "\e201";
+}
+.glyphicon-save-file:before {
+  content: "\e202";
+}
+.glyphicon-open-file:before {
+  content: "\e203";
+}
+.glyphicon-level-up:before {
+  content: "\e204";
+}
+.glyphicon-copy:before {
+  content: "\e205";
+}
+.glyphicon-paste:before {
+  content: "\e206";
+}
+.glyphicon-alert:before {
+  content: "\e209";
+}
+.glyphicon-equalizer:before {
+  content: "\e210";
+}
+.glyphicon-king:before {
+  content: "\e211";
+}
+.glyphicon-queen:before {
+  content: "\e212";
+}
+.glyphicon-pawn:before {
+  content: "\e213";
+}
+.glyphicon-bishop:before {
+  content: "\e214";
+}
+.glyphicon-knight:before {
+  content: "\e215";
+}
+.glyphicon-baby-formula:before {
+  content: "\e216";
+}
+.glyphicon-tent:before {
+  content: "\26fa";
+}
+.glyphicon-blackboard:before {
+  content: "\e218";
+}
+.glyphicon-bed:before {
+  content: "\e219";
+}
+.glyphicon-apple:before {
+  content: "\f8ff";
+}
+.glyphicon-erase:before {
+  content: "\e221";
+}
+.glyphicon-hourglass:before {
+  content: "\231b";
+}
+.glyphicon-lamp:before {
+  content: "\e223";
+}
+.glyphicon-duplicate:before {
+  content: "\e224";
+}
+.glyphicon-piggy-bank:before {
+  content: "\e225";
+}
+.glyphicon-scissors:before {
+  content: "\e226";
+}
+.glyphicon-bitcoin:before {
+  content: "\e227";
+}
+.glyphicon-btc:before {
+  content: "\e227";
+}
+.glyphicon-xbt:before {
+  content: "\e227";
+}
+.glyphicon-yen:before {
+  content: "\00a5";
+}
+.glyphicon-jpy:before {
+  content: "\00a5";
+}
+.glyphicon-ruble:before {
+  content: "\20bd";
+}
+.glyphicon-rub:before {
+  content: "\20bd";
+}
+.glyphicon-scale:before {
+  content: "\e230";
+}
+.glyphicon-ice-lolly:before {
+  content: "\e231";
+}
+.glyphicon-ice-lolly-tasted:before {
+  content: "\e232";
+}
+.glyphicon-education:before {
+  content: "\e233";
+}
+.glyphicon-option-horizontal:before {
+  content: "\e234";
+}
+.glyphicon-option-vertical:before {
+  content: "\e235";
+}
+.glyphicon-menu-hamburger:before {
+  content: "\e236";
+}
+.glyphicon-modal-window:before {
+  content: "\e237";
+}
+.glyphicon-oil:before {
+  content: "\e238";
+}
+.glyphicon-grain:before {
+  content: "\e239";
+}
+.glyphicon-sunglasses:before {
+  content: "\e240";
+}
+.glyphicon-text-size:before {
+  content: "\e241";
+}
+.glyphicon-text-color:before {
+  content: "\e242";
+}
+.glyphicon-text-background:before {
+  content: "\e243";
+}
+.glyphicon-object-align-top:before {
+  content: "\e244";
+}
+.glyphicon-object-align-bottom:before {
+  content: "\e245";
+}
+.glyphicon-object-align-horizontal:before {
+  content: "\e246";
+}
+.glyphicon-object-align-left:before {
+  content: "\e247";
+}
+.glyphicon-object-align-vertical:before {
+  content: "\e248";
+}
+.glyphicon-object-align-right:before {
+  content: "\e249";
+}
+.glyphicon-triangle-right:before {
+  content: "\e250";
+}
+.glyphicon-triangle-left:before {
+  content: "\e251";
+}
+.glyphicon-triangle-bottom:before {
+  content: "\e252";
+}
+.glyphicon-triangle-top:before {
+  content: "\e253";
+}
+.glyphicon-console:before {
+  content: "\e254";
+}
+.glyphicon-superscript:before {
+  content: "\e255";
+}
+.glyphicon-subscript:before {
+  content: "\e256";
+}
+.glyphicon-menu-left:before {
+  content: "\e257";
+}
+.glyphicon-menu-right:before {
+  content: "\e258";
+}
+.glyphicon-menu-down:before {
+  content: "\e259";
+}
+.glyphicon-menu-up:before {
+  content: "\e260";
+}
+* {
+  -webkit-box-sizing: border-box;
+     -moz-box-sizing: border-box;
+          box-sizing: border-box;
+}
+*:before,
+*:after {
+  -webkit-box-sizing: border-box;
+     -moz-box-sizing: border-box;
+          box-sizing: border-box;
+}
+html {
+  font-size: 10px;
+
+  -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
+}
+body {
+  font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
+  font-size: 14px;
+  line-height: 1.42857143;
+  color: #333;
+  background-color: #fff;
+}
+input,
+button,
+select,
+textarea {
+  font-family: inherit;
+  font-size: inherit;
+  line-height: inherit;
+}
+a {
+  color: #337ab7;
+  text-decoration: none;
+}
+a:hover,
+a:focus {
+  color: #23527c;
+  text-decoration: underline;
+}
+a:focus {
+  outline: 5px auto -webkit-focus-ring-color;
+  outline-offset: -2px;
+}
+figure {
+  margin: 0;
+}
+img {
+  vertical-align: middle;
+}
+.img-responsive,
+.thumbnail > img,
+.thumbnail a > img,
+.carousel-inner > .item > img,
+.carousel-inner > .item > a > img {
+  display: block;
+  max-width: 100%;
+  height: auto;
+}
+.img-rounded {
+  border-radius: 6px;
+}
+.img-thumbnail {
+  display: inline-block;
+  max-width: 100%;
+  height: auto;
+  padding: 4px;
+  line-height: 1.42857143;
+  background-color: #fff;
+  border: 1px solid #ddd;
+  border-radius: 4px;
+  -webkit-transition: all .2s ease-in-out;
+       -o-transition: all .2s ease-in-out;
+          transition: all .2s ease-in-out;
+}
+.img-circle {
+  border-radius: 50%;
+}
+hr {
+  margin-top: 20px;
+  margin-bottom: 20px;
+  border: 0;
+  border-top: 1px solid #eee;
+}
+.sr-only {
+  position: absolute;
+  width: 1px;
+  height: 1px;
+  padding: 0;
+  margin: -1px;
+  overflow: hidden;
+  clip: rect(0, 0, 0, 0);
+  border: 0;
+}
+.sr-only-focusable:active,
+.sr-only-focusable:focus {
+  position: static;
+  width: auto;
+  height: auto;
+  margin: 0;
+  overflow: visible;
+  clip: auto;
+}
+[role="button"] {
+  cursor: pointer;
+}
+h1,
+h2,
+h3,
+h4,
+h5,
+h6,
+.h1,
+.h2,
+.h3,
+.h4,
+.h5,
+.h6 {
+  font-family: inherit;
+  font-weight: 500;
+  line-height: 1.1;
+  color: inherit;
+}
+h1 small,
+h2 small,
+h3 small,
+h4 small,
+h5 small,
+h6 small,
+.h1 small,
+.h2 small,
+.h3 small,
+.h4 small,
+.h5 small,
+.h6 small,
+h1 .small,
+h2 .small,
+h3 .small,
+h4 .small,
+h5 .small,
+h6 .small,
+.h1 .small,
+.h2 .small,
+.h3 .small,
+.h4 .small,
+.h5 .small,
+.h6 .small {
+  font-weight: normal;
+  line-height: 1;
+  color: #777;
+}
+h1,
+.h1,
+h2,
+.h2,
+h3,
+.h3 {
+  margin-top: 20px;
+  margin-bottom: 10px;
+}
+h1 small,
+.h1 small,
+h2 small,
+.h2 small,
+h3 small,
+.h3 small,
+h1 .small,
+.h1 .small,
+h2 .small,
+.h2 .small,
+h3 .small,
+.h3 .small {
+  font-size: 65%;
+}
+h4,
+.h4,
+h5,
+.h5,
+h6,
+.h6 {
+  margin-top: 10px;
+  margin-bottom: 10px;
+}
+h4 small,
+.h4 small,
+h5 small,
+.h5 small,
+h6 small,
+.h6 small,
+h4 .small,
+.h4 .small,
+h5 .small,
+.h5 .small,
+h6 .small,
+.h6 .small {
+  font-size: 75%;
+}
+h1,
+.h1 {
+  font-size: 36px;
+}
+h2,
+.h2 {
+  font-size: 30px;
+}
+h3,
+.h3 {
+  font-size: 24px;
+}
+h4,
+.h4 {
+  font-size: 18px;
+}
+h5,
+.h5 {
+  font-size: 14px;
+}
+h6,
+.h6 {
+  font-size: 12px;
+}
+p {
+  margin: 0 0 10px;
+}
+.lead {
+  margin-bottom: 20px;
+  font-size: 16px;
+  font-weight: 300;
+  line-height: 1.4;
+}
+@media (min-width: 768px) {
+  .lead {
+    font-size: 21px;
+  }
+}
+small,
+.small {
+  font-size: 85%;
+}
+mark,
+.mark {
+  padding: .2em;
+  background-color: #fcf8e3;
+}
+.text-left {
+  text-align: left;
+}
+.text-right {
+  text-align: right;
+}
+.text-center {
+  text-align: center;
+}
+.text-justify {
+  text-align: justify;
+}
+.text-nowrap {
+  white-space: nowrap;
+}
+.text-lowercase {
+  text-transform: lowercase;
+}
+.text-uppercase {
+  text-transform: uppercase;
+}
+.text-capitalize {
+  text-transform: capitalize;
+}
+.text-muted {
+  color: #777;
+}
+.text-primary {
+  color: #337ab7;
+}
+a.text-primary:hover,
+a.text-primary:focus {
+  color: #286090;
+}
+.text-success {
+  color: #3c763d;
+}
+a.text-success:hover,
+a.text-success:focus {
+  color: #2b542c;
+}
+.text-info {
+  color: #31708f;
+}
+a.text-info:hover,
+a.text-info:focus {
+  color: #245269;
+}
+.text-warning {
+  color: #8a6d3b;
+}
+a.text-warning:hover,
+a.text-warning:focus {
+  color: #66512c;
+}
+.text-danger {
+  color: #a94442;
+}
+a.text-danger:hover,
+a.text-danger:focus {
+  color: #843534;
+}
+.bg-primary {
+  color: #fff;
+  background-color: #337ab7;
+}
+a.bg-primary:hover,
+a.bg-primary:focus {
+  background-color: #286090;
+}
+.bg-success {
+  background-color: #dff0d8;
+}
+a.bg-success:hover,
+a.bg-success:focus {
+  background-color: #c1e2b3;
+}
+.bg-info {
+  background-color: #d9edf7;
+}
+a.bg-info:hover,
+a.bg-info:focus {
+  background-color: #afd9ee;
+}
+.bg-warning {
+  background-color: #fcf8e3;
+}
+a.bg-warning:hover,
+a.bg-warning:focus {
+  background-color: #f7ecb5;
+}
+.bg-danger {
+  background-color: #f2dede;
+}
+a.bg-danger:hover,
+a.bg-danger:focus {
+  background-color: #e4b9b9;
+}
+.page-header {
+  padding-bottom: 9px;
+  margin: 40px 0 20px;
+  border-bottom: 1px solid #eee;
+}
+ul,
+ol {
+  margin-top: 0;
+  margin-bottom: 10px;
+}
+ul ul,
+ol ul,
+ul ol,
+ol ol {
+  margin-bottom: 0;
+}
+.list-unstyled {
+  padding-left: 0;
+  list-style: none;
+}
+.list-inline {
+  padding-left: 0;
+  margin-left: -5px;
+  list-style: none;
+}
+.list-inline > li {
+  display: inline-block;
+  padding-right: 5px;
+  padding-left: 5px;
+}
+dl {
+  margin-top: 0;
+  margin-bottom: 20px;
+}
+dt,
+dd {
+  line-height: 1.42857143;
+}
+dt {
+  font-weight: bold;
+}
+dd {
+  margin-left: 0;
+}
+@media (min-width: 768px) {
+  .dl-horizontal dt {
+    float: left;
+    width: 160px;
+    overflow: hidden;
+    clear: left;
+    text-align: right;
+    text-overflow: ellipsis;
+    white-space: nowrap;
+  }
+  .dl-horizontal dd {
+    margin-left: 180px;
+  }
+}
+abbr[title],
+abbr[data-original-title] {
+  cursor: help;
+  border-bottom: 1px dotted #777;
+}
+.initialism {
+  font-size: 90%;
+  text-transform: uppercase;
+}
+blockquote {
+  padding: 10px 20px;
+  margin: 0 0 20px;
+  font-size: 17.5px;
+  border-left: 5px solid #eee;
+}
+blockquote p:last-child,
+blockquote ul:last-child,
+blockquote ol:last-child {
+  margin-bottom: 0;
+}
+blockquote footer,
+blockquote small,
+blockquote .small {
+  display: block;
+  font-size: 80%;
+  line-height: 1.42857143;
+  color: #777;
+}
+blockquote footer:before,
+blockquote small:before,
+blockquote .small:before {
+  content: '\2014 \00A0';
+}
+.blockquote-reverse,
+blockquote.pull-right {
+  padding-right: 15px;
+  padding-left: 0;
+  text-align: right;
+  border-right: 5px solid #eee;
+  border-left: 0;
+}
+.blockquote-reverse footer:before,
+blockquote.pull-right footer:before,
+.blockquote-reverse small:before,
+blockquote.pull-right small:before,
+.blockquote-reverse .small:before,
+blockquote.pull-right .small:before {
+  content: '';
+}
+.blockquote-reverse footer:after,
+blockquote.pull-right footer:after,
+.blockquote-reverse small:after,
+blockquote.pull-right small:after,
+.blockquote-reverse .small:after,
+blockquote.pull-right .small:after {
+  content: '\00A0 \2014';
+}
+address {
+  margin-bottom: 20px;
+  font-style: normal;
+  line-height: 1.42857143;
+}
+code,
+kbd,
+pre,
+samp {
+  font-family: Menlo, Monaco, Consolas, "Courier New", monospace;
+}
+code {
+  padding: 2px 4px;
+  font-size: 90%;
+  color: #c7254e;
+  background-color: #f9f2f4;
+  border-radius: 4px;
+}
+kbd {
+  padding: 2px 4px;
+  font-size: 90%;
+  color: #fff;
+  background-color: #333;
+  border-radius: 3px;
+  -webkit-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, .25);
+          box-shadow: inset 0 -1px 0 rgba(0, 0, 0, .25);
+}
+kbd kbd {
+  padding: 0;
+  font-size: 100%;
+  font-weight: bold;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+pre {
+  display: block;
+  padding: 9.5px;
+  margin: 0 0 10px;
+  font-size: 13px;
+  line-height: 1.42857143;
+  color: #333;
+  word-break: break-all;
+  word-wrap: break-word;
+  background-color: #f5f5f5;
+  border: 1px solid #ccc;
+  border-radius: 4px;
+}
+pre code {
+  padding: 0;
+  font-size: inherit;
+  color: inherit;
+  white-space: pre-wrap;
+  background-color: transparent;
+  border-radius: 0;
+}
+.pre-scrollable {
+  max-height: 340px;
+  overflow-y: scroll;
+}
+.container {
+  padding-right: 15px;
+  padding-left: 15px;
+  margin-right: auto;
+  margin-left: auto;
+}
+@media (min-width: 768px) {
+  .container {
+    width: 750px;
+  }
+}
+@media (min-width: 992px) {
+  .container {
+    width: 970px;
+  }
+}
+@media (min-width: 1200px) {
+  .container {
+    width: 1170px;
+  }
+}
+.container-fluid {
+  padding-right: 15px;
+  padding-left: 15px;
+  margin-right: auto;
+  margin-left: auto;
+}
+.row {
+  margin-right: -15px;
+  margin-left: -15px;
+}
+.col-xs-1, .col-sm-1, .col-md-1, .col-lg-1, .col-xs-2, .col-sm-2, .col-md-2, .col-lg-2, .col-xs-3, .col-sm-3, .col-md-3, .col-lg-3, .col-xs-4, .col-sm-4, .col-md-4, .col-lg-4, .col-xs-5, .col-sm-5, .col-md-5, .col-lg-5, .col-xs-6, .col-sm-6, .col-md-6, .col-lg-6, .col-xs-7, .col-sm-7, .col-md-7, .col-lg-7, .col-xs-8, .col-sm-8, .col-md-8, .col-lg-8, .col-xs-9, .col-sm-9, .col-md-9, .col-lg-9, .col-xs-10, .col-sm-10, .col-md-10, .col-lg-10, .col-xs-11, .col-sm-11, .col-md-11, .col-lg-11, .col-xs-12, .col-sm-12, .col-md-12, .col-lg-12 {
+  position: relative;
+  min-height: 1px;
+  padding-right: 15px;
+  padding-left: 15px;
+}
+.col-xs-1, .col-xs-2, .col-xs-3, .col-xs-4, .col-xs-5, .col-xs-6, .col-xs-7, .col-xs-8, .col-xs-9, .col-xs-10, .col-xs-11, .col-xs-12 {
+  float: left;
+}
+.col-xs-12 {
+  width: 100%;
+}
+.col-xs-11 {
+  width: 91.66666667%;
+}
+.col-xs-10 {
+  width: 83.33333333%;
+}
+.col-xs-9 {
+  width: 75%;
+}
+.col-xs-8 {
+  width: 66.66666667%;
+}
+.col-xs-7 {
+  width: 58.33333333%;
+}
+.col-xs-6 {
+  width: 50%;
+}
+.col-xs-5 {
+  width: 41.66666667%;
+}
+.col-xs-4 {
+  width: 33.33333333%;
+}
+.col-xs-3 {
+  width: 25%;
+}
+.col-xs-2 {
+  width: 16.66666667%;
+}
+.col-xs-1 {
+  width: 8.33333333%;
+}
+.col-xs-pull-12 {
+  right: 100%;
+}
+.col-xs-pull-11 {
+  right: 91.66666667%;
+}
+.col-xs-pull-10 {
+  right: 83.33333333%;
+}
+.col-xs-pull-9 {
+  right: 75%;
+}
+.col-xs-pull-8 {
+  right: 66.66666667%;
+}
+.col-xs-pull-7 {
+  right: 58.33333333%;
+}
+.col-xs-pull-6 {
+  right: 50%;
+}
+.col-xs-pull-5 {
+  right: 41.66666667%;
+}
+.col-xs-pull-4 {
+  right: 33.33333333%;
+}
+.col-xs-pull-3 {
+  right: 25%;
+}
+.col-xs-pull-2 {
+  right: 16.66666667%;
+}
+.col-xs-pull-1 {
+  right: 8.33333333%;
+}
+.col-xs-pull-0 {
+  right: auto;
+}
+.col-xs-push-12 {
+  left: 100%;
+}
+.col-xs-push-11 {
+  left: 91.66666667%;
+}
+.col-xs-push-10 {
+  left: 83.33333333%;
+}
+.col-xs-push-9 {
+  left: 75%;
+}
+.col-xs-push-8 {
+  left: 66.66666667%;
+}
+.col-xs-push-7 {
+  left: 58.33333333%;
+}
+.col-xs-push-6 {
+  left: 50%;
+}
+.col-xs-push-5 {
+  left: 41.66666667%;
+}
+.col-xs-push-4 {
+  left: 33.33333333%;
+}
+.col-xs-push-3 {
+  left: 25%;
+}
+.col-xs-push-2 {
+  left: 16.66666667%;
+}
+.col-xs-push-1 {
+  left: 8.33333333%;
+}
+.col-xs-push-0 {
+  left: auto;
+}
+.col-xs-offset-12 {
+  margin-left: 100%;
+}
+.col-xs-offset-11 {
+  margin-left: 91.66666667%;
+}
+.col-xs-offset-10 {
+  margin-left: 83.33333333%;
+}
+.col-xs-offset-9 {
+  margin-left: 75%;
+}
+.col-xs-offset-8 {
+  margin-left: 66.66666667%;
+}
+.col-xs-offset-7 {
+  margin-left: 58.33333333%;
+}
+.col-xs-offset-6 {
+  margin-left: 50%;
+}
+.col-xs-offset-5 {
+  margin-left: 41.66666667%;
+}
+.col-xs-offset-4 {
+  margin-left: 33.33333333%;
+}
+.col-xs-offset-3 {
+  margin-left: 25%;
+}
+.col-xs-offset-2 {
+  margin-left: 16.66666667%;
+}
+.col-xs-offset-1 {
+  margin-left: 8.33333333%;
+}
+.col-xs-offset-0 {
+  margin-left: 0;
+}
+@media (min-width: 768px) {
+  .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12 {
+    float: left;
+  }
+  .col-sm-12 {
+    width: 100%;
+  }
+  .col-sm-11 {
+    width: 91.66666667%;
+  }
+  .col-sm-10 {
+    width: 83.33333333%;
+  }
+  .col-sm-9 {
+    width: 75%;
+  }
+  .col-sm-8 {
+    width: 66.66666667%;
+  }
+  .col-sm-7 {
+    width: 58.33333333%;
+  }
+  .col-sm-6 {
+    width: 50%;
+  }
+  .col-sm-5 {
+    width: 41.66666667%;
+  }
+  .col-sm-4 {
+    width: 33.33333333%;
+  }
+  .col-sm-3 {
+    width: 25%;
+  }
+  .col-sm-2 {
+    width: 16.66666667%;
+  }
+  .col-sm-1 {
+    width: 8.33333333%;
+  }
+  .col-sm-pull-12 {
+    right: 100%;
+  }
+  .col-sm-pull-11 {
+    right: 91.66666667%;
+  }
+  .col-sm-pull-10 {
+    right: 83.33333333%;
+  }
+  .col-sm-pull-9 {
+    right: 75%;
+  }
+  .col-sm-pull-8 {
+    right: 66.66666667%;
+  }
+  .col-sm-pull-7 {
+    right: 58.33333333%;
+  }
+  .col-sm-pull-6 {
+    right: 50%;
+  }
+  .col-sm-pull-5 {
+    right: 41.66666667%;
+  }
+  .col-sm-pull-4 {
+    right: 33.33333333%;
+  }
+  .col-sm-pull-3 {
+    right: 25%;
+  }
+  .col-sm-pull-2 {
+    right: 16.66666667%;
+  }
+  .col-sm-pull-1 {
+    right: 8.33333333%;
+  }
+  .col-sm-pull-0 {
+    right: auto;
+  }
+  .col-sm-push-12 {
+    left: 100%;
+  }
+  .col-sm-push-11 {
+    left: 91.66666667%;
+  }
+  .col-sm-push-10 {
+    left: 83.33333333%;
+  }
+  .col-sm-push-9 {
+    left: 75%;
+  }
+  .col-sm-push-8 {
+    left: 66.66666667%;
+  }
+  .col-sm-push-7 {
+    left: 58.33333333%;
+  }
+  .col-sm-push-6 {
+    left: 50%;
+  }
+  .col-sm-push-5 {
+    left: 41.66666667%;
+  }
+  .col-sm-push-4 {
+    left: 33.33333333%;
+  }
+  .col-sm-push-3 {
+    left: 25%;
+  }
+  .col-sm-push-2 {
+    left: 16.66666667%;
+  }
+  .col-sm-push-1 {
+    left: 8.33333333%;
+  }
+  .col-sm-push-0 {
+    left: auto;
+  }
+  .col-sm-offset-12 {
+    margin-left: 100%;
+  }
+  .col-sm-offset-11 {
+    margin-left: 91.66666667%;
+  }
+  .col-sm-offset-10 {
+    margin-left: 83.33333333%;
+  }
+  .col-sm-offset-9 {
+    margin-left: 75%;
+  }
+  .col-sm-offset-8 {
+    margin-left: 66.66666667%;
+  }
+  .col-sm-offset-7 {
+    margin-left: 58.33333333%;
+  }
+  .col-sm-offset-6 {
+    margin-left: 50%;
+  }
+  .col-sm-offset-5 {
+    margin-left: 41.66666667%;
+  }
+  .col-sm-offset-4 {
+    margin-left: 33.33333333%;
+  }
+  .col-sm-offset-3 {
+    margin-left: 25%;
+  }
+  .col-sm-offset-2 {
+    margin-left: 16.66666667%;
+  }
+  .col-sm-offset-1 {
+    margin-left: 8.33333333%;
+  }
+  .col-sm-offset-0 {
+    margin-left: 0;
+  }
+}
+@media (min-width: 992px) {
+  .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12 {
+    float: left;
+  }
+  .col-md-12 {
+    width: 100%;
+  }
+  .col-md-11 {
+    width: 91.66666667%;
+  }
+  .col-md-10 {
+    width: 83.33333333%;
+  }
+  .col-md-9 {
+    width: 75%;
+  }
+  .col-md-8 {
+    width: 66.66666667%;
+  }
+  .col-md-7 {
+    width: 58.33333333%;
+  }
+  .col-md-6 {
+    width: 50%;
+  }
+  .col-md-5 {
+    width: 41.66666667%;
+  }
+  .col-md-4 {
+    width: 33.33333333%;
+  }
+  .col-md-3 {
+    width: 25%;
+  }
+  .col-md-2 {
+    width: 16.66666667%;
+  }
+  .col-md-1 {
+    width: 8.33333333%;
+  }
+  .col-md-pull-12 {
+    right: 100%;
+  }
+  .col-md-pull-11 {
+    right: 91.66666667%;
+  }
+  .col-md-pull-10 {
+    right: 83.33333333%;
+  }
+  .col-md-pull-9 {
+    right: 75%;
+  }
+  .col-md-pull-8 {
+    right: 66.66666667%;
+  }
+  .col-md-pull-7 {
+    right: 58.33333333%;
+  }
+  .col-md-pull-6 {
+    right: 50%;
+  }
+  .col-md-pull-5 {
+    right: 41.66666667%;
+  }
+  .col-md-pull-4 {
+    right: 33.33333333%;
+  }
+  .col-md-pull-3 {
+    right: 25%;
+  }
+  .col-md-pull-2 {
+    right: 16.66666667%;
+  }
+  .col-md-pull-1 {
+    right: 8.33333333%;
+  }
+  .col-md-pull-0 {
+    right: auto;
+  }
+  .col-md-push-12 {
+    left: 100%;
+  }
+  .col-md-push-11 {
+    left: 91.66666667%;
+  }
+  .col-md-push-10 {
+    left: 83.33333333%;
+  }
+  .col-md-push-9 {
+    left: 75%;
+  }
+  .col-md-push-8 {
+    left: 66.66666667%;
+  }
+  .col-md-push-7 {
+    left: 58.33333333%;
+  }
+  .col-md-push-6 {
+    left: 50%;
+  }
+  .col-md-push-5 {
+    left: 41.66666667%;
+  }
+  .col-md-push-4 {
+    left: 33.33333333%;
+  }
+  .col-md-push-3 {
+    left: 25%;
+  }
+  .col-md-push-2 {
+    left: 16.66666667%;
+  }
+  .col-md-push-1 {
+    left: 8.33333333%;
+  }
+  .col-md-push-0 {
+    left: auto;
+  }
+  .col-md-offset-12 {
+    margin-left: 100%;
+  }
+  .col-md-offset-11 {
+    margin-left: 91.66666667%;
+  }
+  .col-md-offset-10 {
+    margin-left: 83.33333333%;
+  }
+  .col-md-offset-9 {
+    margin-left: 75%;
+  }
+  .col-md-offset-8 {
+    margin-left: 66.66666667%;
+  }
+  .col-md-offset-7 {
+    margin-left: 58.33333333%;
+  }
+  .col-md-offset-6 {
+    margin-left: 50%;
+  }
+  .col-md-offset-5 {
+    margin-left: 41.66666667%;
+  }
+  .col-md-offset-4 {
+    margin-left: 33.33333333%;
+  }
+  .col-md-offset-3 {
+    margin-left: 25%;
+  }
+  .col-md-offset-2 {
+    margin-left: 16.66666667%;
+  }
+  .col-md-offset-1 {
+    margin-left: 8.33333333%;
+  }
+  .col-md-offset-0 {
+    margin-left: 0;
+  }
+}
+@media (min-width: 1200px) {
+  .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12 {
+    float: left;
+  }
+  .col-lg-12 {
+    width: 100%;
+  }
+  .col-lg-11 {
+    width: 91.66666667%;
+  }
+  .col-lg-10 {
+    width: 83.33333333%;
+  }
+  .col-lg-9 {
+    width: 75%;
+  }
+  .col-lg-8 {
+    width: 66.66666667%;
+  }
+  .col-lg-7 {
+    width: 58.33333333%;
+  }
+  .col-lg-6 {
+    width: 50%;
+  }
+  .col-lg-5 {
+    width: 41.66666667%;
+  }
+  .col-lg-4 {
+    width: 33.33333333%;
+  }
+  .col-lg-3 {
+    width: 25%;
+  }
+  .col-lg-2 {
+    width: 16.66666667%;
+  }
+  .col-lg-1 {
+    width: 8.33333333%;
+  }
+  .col-lg-pull-12 {
+    right: 100%;
+  }
+  .col-lg-pull-11 {
+    right: 91.66666667%;
+  }
+  .col-lg-pull-10 {
+    right: 83.33333333%;
+  }
+  .col-lg-pull-9 {
+    right: 75%;
+  }
+  .col-lg-pull-8 {
+    right: 66.66666667%;
+  }
+  .col-lg-pull-7 {
+    right: 58.33333333%;
+  }
+  .col-lg-pull-6 {
+    right: 50%;
+  }
+  .col-lg-pull-5 {
+    right: 41.66666667%;
+  }
+  .col-lg-pull-4 {
+    right: 33.33333333%;
+  }
+  .col-lg-pull-3 {
+    right: 25%;
+  }
+  .col-lg-pull-2 {
+    right: 16.66666667%;
+  }
+  .col-lg-pull-1 {
+    right: 8.33333333%;
+  }
+  .col-lg-pull-0 {
+    right: auto;
+  }
+  .col-lg-push-12 {
+    left: 100%;
+  }
+  .col-lg-push-11 {
+    left: 91.66666667%;
+  }
+  .col-lg-push-10 {
+    left: 83.33333333%;
+  }
+  .col-lg-push-9 {
+    left: 75%;
+  }
+  .col-lg-push-8 {
+    left: 66.66666667%;
+  }
+  .col-lg-push-7 {
+    left: 58.33333333%;
+  }
+  .col-lg-push-6 {
+    left: 50%;
+  }
+  .col-lg-push-5 {
+    left: 41.66666667%;
+  }
+  .col-lg-push-4 {
+    left: 33.33333333%;
+  }
+  .col-lg-push-3 {
+    left: 25%;
+  }
+  .col-lg-push-2 {
+    left: 16.66666667%;
+  }
+  .col-lg-push-1 {
+    left: 8.33333333%;
+  }
+  .col-lg-push-0 {
+    left: auto;
+  }
+  .col-lg-offset-12 {
+    margin-left: 100%;
+  }
+  .col-lg-offset-11 {
+    margin-left: 91.66666667%;
+  }
+  .col-lg-offset-10 {
+    margin-left: 83.33333333%;
+  }
+  .col-lg-offset-9 {
+    margin-left: 75%;
+  }
+  .col-lg-offset-8 {
+    margin-left: 66.66666667%;
+  }
+  .col-lg-offset-7 {
+    margin-left: 58.33333333%;
+  }
+  .col-lg-offset-6 {
+    margin-left: 50%;
+  }
+  .col-lg-offset-5 {
+    margin-left: 41.66666667%;
+  }
+  .col-lg-offset-4 {
+    margin-left: 33.33333333%;
+  }
+  .col-lg-offset-3 {
+    margin-left: 25%;
+  }
+  .col-lg-offset-2 {
+    margin-left: 16.66666667%;
+  }
+  .col-lg-offset-1 {
+    margin-left: 8.33333333%;
+  }
+  .col-lg-offset-0 {
+    margin-left: 0;
+  }
+}
+table {
+  background-color: transparent;
+}
+caption {
+  padding-top: 8px;
+  padding-bottom: 8px;
+  color: #777;
+  text-align: left;
+}
+th {
+  text-align: left;
+}
+.table {
+  width: 100%;
+  max-width: 100%;
+  margin-bottom: 20px;
+}
+.table > thead > tr > th,
+.table > tbody > tr > th,
+.table > tfoot > tr > th,
+.table > thead > tr > td,
+.table > tbody > tr > td,
+.table > tfoot > tr > td {
+  padding: 8px;
+  line-height: 1.42857143;
+  vertical-align: top;
+  border-top: 1px solid #ddd;
+}
+.table > thead > tr > th {
+  vertical-align: bottom;
+  border-bottom: 2px solid #ddd;
+}
+.table > caption + thead > tr:first-child > th,
+.table > colgroup + thead > tr:first-child > th,
+.table > thead:first-child > tr:first-child > th,
+.table > caption + thead > tr:first-child > td,
+.table > colgroup + thead > tr:first-child > td,
+.table > thead:first-child > tr:first-child > td {
+  border-top: 0;
+}
+.table > tbody + tbody {
+  border-top: 2px solid #ddd;
+}
+.table .table {
+  background-color: #fff;
+}
+.table-condensed > thead > tr > th,
+.table-condensed > tbody > tr > th,
+.table-condensed > tfoot > tr > th,
+.table-condensed > thead > tr > td,
+.table-condensed > tbody > tr > td,
+.table-condensed > tfoot > tr > td {
+  padding: 5px;
+}
+.table-bordered {
+  border: 1px solid #ddd;
+}
+.table-bordered > thead > tr > th,
+.table-bordered > tbody > tr > th,
+.table-bordered > tfoot > tr > th,
+.table-bordered > thead > tr > td,
+.table-bordered > tbody > tr > td,
+.table-bordered > tfoot > tr > td {
+  border: 1px solid #ddd;
+}
+.table-bordered > thead > tr > th,
+.table-bordered > thead > tr > td {
+  border-bottom-width: 2px;
+}
+.table-striped > tbody > tr:nth-of-type(odd) {
+  background-color: #f9f9f9;
+}
+.table-hover > tbody > tr:hover {
+  background-color: #f5f5f5;
+}
+table col[class*="col-"] {
+  position: static;
+  display: table-column;
+  float: none;
+}
+table td[class*="col-"],
+table th[class*="col-"] {
+  position: static;
+  display: table-cell;
+  float: none;
+}
+.table > thead > tr > td.active,
+.table > tbody > tr > td.active,
+.table > tfoot > tr > td.active,
+.table > thead > tr > th.active,
+.table > tbody > tr > th.active,
+.table > tfoot > tr > th.active,
+.table > thead > tr.active > td,
+.table > tbody > tr.active > td,
+.table > tfoot > tr.active > td,
+.table > thead > tr.active > th,
+.table > tbody > tr.active > th,
+.table > tfoot > tr.active > th {
+  background-color: #f5f5f5;
+}
+.table-hover > tbody > tr > td.active:hover,
+.table-hover > tbody > tr > th.active:hover,
+.table-hover > tbody > tr.active:hover > td,
+.table-hover > tbody > tr:hover > .active,
+.table-hover > tbody > tr.active:hover > th {
+  background-color: #e8e8e8;
+}
+.table > thead > tr > td.success,
+.table > tbody > tr > td.success,
+.table > tfoot > tr > td.success,
+.table > thead > tr > th.success,
+.table > tbody > tr > th.success,
+.table > tfoot > tr > th.success,
+.table > thead > tr.success > td,
+.table > tbody > tr.success > td,
+.table > tfoot > tr.success > td,
+.table > thead > tr.success > th,
+.table > tbody > tr.success > th,
+.table > tfoot > tr.success > th {
+  background-color: #dff0d8;
+}
+.table-hover > tbody > tr > td.success:hover,
+.table-hover > tbody > tr > th.success:hover,
+.table-hover > tbody > tr.success:hover > td,
+.table-hover > tbody > tr:hover > .success,
+.table-hover > tbody > tr.success:hover > th {
+  background-color: #d0e9c6;
+}
+.table > thead > tr > td.info,
+.table > tbody > tr > td.info,
+.table > tfoot > tr > td.info,
+.table > thead > tr > th.info,
+.table > tbody > tr > th.info,
+.table > tfoot > tr > th.info,
+.table > thead > tr.info > td,
+.table > tbody > tr.info > td,
+.table > tfoot > tr.info > td,
+.table > thead > tr.info > th,
+.table > tbody > tr.info > th,
+.table > tfoot > tr.info > th {
+  background-color: #d9edf7;
+}
+.table-hover > tbody > tr > td.info:hover,
+.table-hover > tbody > tr > th.info:hover,
+.table-hover > tbody > tr.info:hover > td,
+.table-hover > tbody > tr:hover > .info,
+.table-hover > tbody > tr.info:hover > th {
+  background-color: #c4e3f3;
+}
+.table > thead > tr > td.warning,
+.table > tbody > tr > td.warning,
+.table > tfoot > tr > td.warning,
+.table > thead > tr > th.warning,
+.table > tbody > tr > th.warning,
+.table > tfoot > tr > th.warning,
+.table > thead > tr.warning > td,
+.table > tbody > tr.warning > td,
+.table > tfoot > tr.warning > td,
+.table > thead > tr.warning > th,
+.table > tbody > tr.warning > th,
+.table > tfoot > tr.warning > th {
+  background-color: #fcf8e3;
+}
+.table-hover > tbody > tr > td.warning:hover,
+.table-hover > tbody > tr > th.warning:hover,
+.table-hover > tbody > tr.warning:hover > td,
+.table-hover > tbody > tr:hover > .warning,
+.table-hover > tbody > tr.warning:hover > th {
+  background-color: #faf2cc;
+}
+.table > thead > tr > td.danger,
+.table > tbody > tr > td.danger,
+.table > tfoot > tr > td.danger,
+.table > thead > tr > th.danger,
+.table > tbody > tr > th.danger,
+.table > tfoot > tr > th.danger,
+.table > thead > tr.danger > td,
+.table > tbody > tr.danger > td,
+.table > tfoot > tr.danger > td,
+.table > thead > tr.danger > th,
+.table > tbody > tr.danger > th,
+.table > tfoot > tr.danger > th {
+  background-color: #f2dede;
+}
+.table-hover > tbody > tr > td.danger:hover,
+.table-hover > tbody > tr > th.danger:hover,
+.table-hover > tbody > tr.danger:hover > td,
+.table-hover > tbody > tr:hover > .danger,
+.table-hover > tbody > tr.danger:hover > th {
+  background-color: #ebcccc;
+}
+.table-responsive {
+  min-height: .01%;
+  overflow-x: auto;
+}
+@media screen and (max-width: 767px) {
+  .table-responsive {
+    width: 100%;
+    margin-bottom: 15px;
+    overflow-y: hidden;
+    -ms-overflow-style: -ms-autohiding-scrollbar;
+    border: 1px solid #ddd;
+  }
+  .table-responsive > .table {
+    margin-bottom: 0;
+  }
+  .table-responsive > .table > thead > tr > th,
+  .table-responsive > .table > tbody > tr > th,
+  .table-responsive > .table > tfoot > tr > th,
+  .table-responsive > .table > thead > tr > td,
+  .table-responsive > .table > tbody > tr > td,
+  .table-responsive > .table > tfoot > tr > td {
+    white-space: nowrap;
+  }
+  .table-responsive > .table-bordered {
+    border: 0;
+  }
+  .table-responsive > .table-bordered > thead > tr > th:first-child,
+  .table-responsive > .table-bordered > tbody > tr > th:first-child,
+  .table-responsive > .table-bordered > tfoot > tr > th:first-child,
+  .table-responsive > .table-bordered > thead > tr > td:first-child,
+  .table-responsive > .table-bordered > tbody > tr > td:first-child,
+  .table-responsive > .table-bordered > tfoot > tr > td:first-child {
+    border-left: 0;
+  }
+  .table-responsive > .table-bordered > thead > tr > th:last-child,
+  .table-responsive > .table-bordered > tbody > tr > th:last-child,
+  .table-responsive > .table-bordered > tfoot > tr > th:last-child,
+  .table-responsive > .table-bordered > thead > tr > td:last-child,
+  .table-responsive > .table-bordered > tbody > tr > td:last-child,
+  .table-responsive > .table-bordered > tfoot > tr > td:last-child {
+    border-right: 0;
+  }
+  .table-responsive > .table-bordered > tbody > tr:last-child > th,
+  .table-responsive > .table-bordered > tfoot > tr:last-child > th,
+  .table-responsive > .table-bordered > tbody > tr:last-child > td,
+  .table-responsive > .table-bordered > tfoot > tr:last-child > td {
+    border-bottom: 0;
+  }
+}
+fieldset {
+  min-width: 0;
+  padding: 0;
+  margin: 0;
+  border: 0;
+}
+legend {
+  display: block;
+  width: 100%;
+  padding: 0;
+  margin-bottom: 20px;
+  font-size: 21px;
+  line-height: inherit;
+  color: #333;
+  border: 0;
+  border-bottom: 1px solid #e5e5e5;
+}
+label {
+  display: inline-block;
+  max-width: 100%;
+  margin-bottom: 5px;
+  font-weight: bold;
+}
+input[type="search"] {
+  -webkit-box-sizing: border-box;
+     -moz-box-sizing: border-box;
+          box-sizing: border-box;
+}
+input[type="radio"],
+input[type="checkbox"] {
+  margin: 4px 0 0;
+  margin-top: 1px \9;
+  line-height: normal;
+}
+input[type="file"] {
+  display: block;
+}
+input[type="range"] {
+  display: block;
+  width: 100%;
+}
+select[multiple],
+select[size] {
+  height: auto;
+}
+input[type="file"]:focus,
+input[type="radio"]:focus,
+input[type="checkbox"]:focus {
+  outline: 5px auto -webkit-focus-ring-color;
+  outline-offset: -2px;
+}
+output {
+  display: block;
+  padding-top: 7px;
+  font-size: 14px;
+  line-height: 1.42857143;
+  color: #555;
+}
+.form-control {
+  display: block;
+  width: 100%;
+  height: 34px;
+  padding: 6px 12px;
+  font-size: 14px;
+  line-height: 1.42857143;
+  color: #555;
+  background-color: #fff;
+  background-image: none;
+  border: 1px solid #ccc;
+  border-radius: 4px;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+  -webkit-transition: border-color ease-in-out .15s, -webkit-box-shadow ease-in-out .15s;
+       -o-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s;
+          transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s;
+}
+.form-control:focus {
+  border-color: #66afe9;
+  outline: 0;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, .6);
+          box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, .6);
+}
+.form-control::-moz-placeholder {
+  color: #999;
+  opacity: 1;
+}
+.form-control:-ms-input-placeholder {
+  color: #999;
+}
+.form-control::-webkit-input-placeholder {
+  color: #999;
+}
+.form-control::-ms-expand {
+  background-color: transparent;
+  border: 0;
+}
+.form-control[disabled],
+.form-control[readonly],
+fieldset[disabled] .form-control {
+  background-color: #eee;
+  opacity: 1;
+}
+.form-control[disabled],
+fieldset[disabled] .form-control {
+  cursor: not-allowed;
+}
+textarea.form-control {
+  height: auto;
+}
+input[type="search"] {
+  -webkit-appearance: none;
+}
+@media screen and (-webkit-min-device-pixel-ratio: 0) {
+  input[type="date"].form-control,
+  input[type="time"].form-control,
+  input[type="datetime-local"].form-control,
+  input[type="month"].form-control {
+    line-height: 34px;
+  }
+  input[type="date"].input-sm,
+  input[type="time"].input-sm,
+  input[type="datetime-local"].input-sm,
+  input[type="month"].input-sm,
+  .input-group-sm input[type="date"],
+  .input-group-sm input[type="time"],
+  .input-group-sm input[type="datetime-local"],
+  .input-group-sm input[type="month"] {
+    line-height: 30px;
+  }
+  input[type="date"].input-lg,
+  input[type="time"].input-lg,
+  input[type="datetime-local"].input-lg,
+  input[type="month"].input-lg,
+  .input-group-lg input[type="date"],
+  .input-group-lg input[type="time"],
+  .input-group-lg input[type="datetime-local"],
+  .input-group-lg input[type="month"] {
+    line-height: 46px;
+  }
+}
+.form-group {
+  margin-bottom: 15px;
+}
+.radio,
+.checkbox {
+  position: relative;
+  display: block;
+  margin-top: 10px;
+  margin-bottom: 10px;
+}
+.radio label,
+.checkbox label {
+  min-height: 20px;
+  padding-left: 20px;
+  margin-bottom: 0;
+  font-weight: normal;
+  cursor: pointer;
+}
+.radio input[type="radio"],
+.radio-inline input[type="radio"],
+.checkbox input[type="checkbox"],
+.checkbox-inline input[type="checkbox"] {
+  position: absolute;
+  margin-top: 4px \9;
+  margin-left: -20px;
+}
+.radio + .radio,
+.checkbox + .checkbox {
+  margin-top: -5px;
+}
+.radio-inline,
+.checkbox-inline {
+  position: relative;
+  display: inline-block;
+  padding-left: 20px;
+  margin-bottom: 0;
+  font-weight: normal;
+  vertical-align: middle;
+  cursor: pointer;
+}
+.radio-inline + .radio-inline,
+.checkbox-inline + .checkbox-inline {
+  margin-top: 0;
+  margin-left: 10px;
+}
+input[type="radio"][disabled],
+input[type="checkbox"][disabled],
+input[type="radio"].disabled,
+input[type="checkbox"].disabled,
+fieldset[disabled] input[type="radio"],
+fieldset[disabled] input[type="checkbox"] {
+  cursor: not-allowed;
+}
+.radio-inline.disabled,
+.checkbox-inline.disabled,
+fieldset[disabled] .radio-inline,
+fieldset[disabled] .checkbox-inline {
+  cursor: not-allowed;
+}
+.radio.disabled label,
+.checkbox.disabled label,
+fieldset[disabled] .radio label,
+fieldset[disabled] .checkbox label {
+  cursor: not-allowed;
+}
+.form-control-static {
+  min-height: 34px;
+  padding-top: 7px;
+  padding-bottom: 7px;
+  margin-bottom: 0;
+}
+.form-control-static.input-lg,
+.form-control-static.input-sm {
+  padding-right: 0;
+  padding-left: 0;
+}
+.input-sm {
+  height: 30px;
+  padding: 5px 10px;
+  font-size: 12px;
+  line-height: 1.5;
+  border-radius: 3px;
+}
+select.input-sm {
+  height: 30px;
+  line-height: 30px;
+}
+textarea.input-sm,
+select[multiple].input-sm {
+  height: auto;
+}
+.form-group-sm .form-control {
+  height: 30px;
+  padding: 5px 10px;
+  font-size: 12px;
+  line-height: 1.5;
+  border-radius: 3px;
+}
+.form-group-sm select.form-control {
+  height: 30px;
+  line-height: 30px;
+}
+.form-group-sm textarea.form-control,
+.form-group-sm select[multiple].form-control {
+  height: auto;
+}
+.form-group-sm .form-control-static {
+  height: 30px;
+  min-height: 32px;
+  padding: 6px 10px;
+  font-size: 12px;
+  line-height: 1.5;
+}
+.input-lg {
+  height: 46px;
+  padding: 10px 16px;
+  font-size: 18px;
+  line-height: 1.3333333;
+  border-radius: 6px;
+}
+select.input-lg {
+  height: 46px;
+  line-height: 46px;
+}
+textarea.input-lg,
+select[multiple].input-lg {
+  height: auto;
+}
+.form-group-lg .form-control {
+  height: 46px;
+  padding: 10px 16px;
+  font-size: 18px;
+  line-height: 1.3333333;
+  border-radius: 6px;
+}
+.form-group-lg select.form-control {
+  height: 46px;
+  line-height: 46px;
+}
+.form-group-lg textarea.form-control,
+.form-group-lg select[multiple].form-control {
+  height: auto;
+}
+.form-group-lg .form-control-static {
+  height: 46px;
+  min-height: 38px;
+  padding: 11px 16px;
+  font-size: 18px;
+  line-height: 1.3333333;
+}
+.has-feedback {
+  position: relative;
+}
+.has-feedback .form-control {
+  padding-right: 42.5px;
+}
+.form-control-feedback {
+  position: absolute;
+  top: 0;
+  right: 0;
+  z-index: 2;
+  display: block;
+  width: 34px;
+  height: 34px;
+  line-height: 34px;
+  text-align: center;
+  pointer-events: none;
+}
+.input-lg + .form-control-feedback,
+.input-group-lg + .form-control-feedback,
+.form-group-lg .form-control + .form-control-feedback {
+  width: 46px;
+  height: 46px;
+  line-height: 46px;
+}
+.input-sm + .form-control-feedback,
+.input-group-sm + .form-control-feedback,
+.form-group-sm .form-control + .form-control-feedback {
+  width: 30px;
+  height: 30px;
+  line-height: 30px;
+}
+.has-success .help-block,
+.has-success .control-label,
+.has-success .radio,
+.has-success .checkbox,
+.has-success .radio-inline,
+.has-success .checkbox-inline,
+.has-success.radio label,
+.has-success.checkbox label,
+.has-success.radio-inline label,
+.has-success.checkbox-inline label {
+  color: #3c763d;
+}
+.has-success .form-control {
+  border-color: #3c763d;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+}
+.has-success .form-control:focus {
+  border-color: #2b542c;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #67b168;
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #67b168;
+}
+.has-success .input-group-addon {
+  color: #3c763d;
+  background-color: #dff0d8;
+  border-color: #3c763d;
+}
+.has-success .form-control-feedback {
+  color: #3c763d;
+}
+.has-warning .help-block,
+.has-warning .control-label,
+.has-warning .radio,
+.has-warning .checkbox,
+.has-warning .radio-inline,
+.has-warning .checkbox-inline,
+.has-warning.radio label,
+.has-warning.checkbox label,
+.has-warning.radio-inline label,
+.has-warning.checkbox-inline label {
+  color: #8a6d3b;
+}
+.has-warning .form-control {
+  border-color: #8a6d3b;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+}
+.has-warning .form-control:focus {
+  border-color: #66512c;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #c0a16b;
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #c0a16b;
+}
+.has-warning .input-group-addon {
+  color: #8a6d3b;
+  background-color: #fcf8e3;
+  border-color: #8a6d3b;
+}
+.has-warning .form-control-feedback {
+  color: #8a6d3b;
+}
+.has-error .help-block,
+.has-error .control-label,
+.has-error .radio,
+.has-error .checkbox,
+.has-error .radio-inline,
+.has-error .checkbox-inline,
+.has-error.radio label,
+.has-error.checkbox label,
+.has-error.radio-inline label,
+.has-error.checkbox-inline label {
+  color: #a94442;
+}
+.has-error .form-control {
+  border-color: #a94442;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075);
+}
+.has-error .form-control:focus {
+  border-color: #843534;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #ce8483;
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #ce8483;
+}
+.has-error .input-group-addon {
+  color: #a94442;
+  background-color: #f2dede;
+  border-color: #a94442;
+}
+.has-error .form-control-feedback {
+  color: #a94442;
+}
+.has-feedback label ~ .form-control-feedback {
+  top: 25px;
+}
+.has-feedback label.sr-only ~ .form-control-feedback {
+  top: 0;
+}
+.help-block {
+  display: block;
+  margin-top: 5px;
+  margin-bottom: 10px;
+  color: #737373;
+}
+@media (min-width: 768px) {
+  .form-inline .form-group {
+    display: inline-block;
+    margin-bottom: 0;
+    vertical-align: middle;
+  }
+  .form-inline .form-control {
+    display: inline-block;
+    width: auto;
+    vertical-align: middle;
+  }
+  .form-inline .form-control-static {
+    display: inline-block;
+  }
+  .form-inline .input-group {
+    display: inline-table;
+    vertical-align: middle;
+  }
+  .form-inline .input-group .input-group-addon,
+  .form-inline .input-group .input-group-btn,
+  .form-inline .input-group .form-control {
+    width: auto;
+  }
+  .form-inline .input-group > .form-control {
+    width: 100%;
+  }
+  .form-inline .control-label {
+    margin-bottom: 0;
+    vertical-align: middle;
+  }
+  .form-inline .radio,
+  .form-inline .checkbox {
+    display: inline-block;
+    margin-top: 0;
+    margin-bottom: 0;
+    vertical-align: middle;
+  }
+  .form-inline .radio label,
+  .form-inline .checkbox label {
+    padding-left: 0;
+  }
+  .form-inline .radio input[type="radio"],
+  .form-inline .checkbox input[type="checkbox"] {
+    position: relative;
+    margin-left: 0;
+  }
+  .form-inline .has-feedback .form-control-feedback {
+    top: 0;
+  }
+}
+.form-horizontal .radio,
+.form-horizontal .checkbox,
+.form-horizontal .radio-inline,
+.form-horizontal .checkbox-inline {
+  padding-top: 7px;
+  margin-top: 0;
+  margin-bottom: 0;
+}
+.form-horizontal .radio,
+.form-horizontal .checkbox {
+  min-height: 27px;
+}
+.form-horizontal .form-group {
+  margin-right: -15px;
+  margin-left: -15px;
+}
+@media (min-width: 768px) {
+  .form-horizontal .control-label {
+    padding-top: 7px;
+    margin-bottom: 0;
+    text-align: right;
+  }
+}
+.form-horizontal .has-feedback .form-control-feedback {
+  right: 15px;
+}
+@media (min-width: 768px) {
+  .form-horizontal .form-group-lg .control-label {
+    padding-top: 11px;
+    font-size: 18px;
+  }
+}
+@media (min-width: 768px) {
+  .form-horizontal .form-group-sm .control-label {
+    padding-top: 6px;
+    font-size: 12px;
+  }
+}
+.btn {
+  display: inline-block;
+  padding: 6px 12px;
+  margin-bottom: 0;
+  font-size: 14px;
+  font-weight: normal;
+  line-height: 1.42857143;
+  text-align: center;
+  white-space: nowrap;
+  vertical-align: middle;
+  -ms-touch-action: manipulation;
+      touch-action: manipulation;
+  cursor: pointer;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+  background-image: none;
+  border: 1px solid transparent;
+  border-radius: 4px;
+}
+.btn:focus,
+.btn:active:focus,
+.btn.active:focus,
+.btn.focus,
+.btn:active.focus,
+.btn.active.focus {
+  outline: 5px auto -webkit-focus-ring-color;
+  outline-offset: -2px;
+}
+.btn:hover,
+.btn:focus,
+.btn.focus {
+  color: #333;
+  text-decoration: none;
+}
+.btn:active,
+.btn.active {
+  background-image: none;
+  outline: 0;
+  -webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, .125);
+          box-shadow: inset 0 3px 5px rgba(0, 0, 0, .125);
+}
+.btn.disabled,
+.btn[disabled],
+fieldset[disabled] .btn {
+  cursor: not-allowed;
+  filter: alpha(opacity=65);
+  -webkit-box-shadow: none;
+          box-shadow: none;
+  opacity: .65;
+}
+a.btn.disabled,
+fieldset[disabled] a.btn {
+  pointer-events: none;
+}
+.btn-default {
+  color: #333;
+  background-color: #fff;
+  border-color: #ccc;
+}
+.btn-default:focus,
+.btn-default.focus {
+  color: #333;
+  background-color: #e6e6e6;
+  border-color: #8c8c8c;
+}
+.btn-default:hover {
+  color: #333;
+  background-color: #e6e6e6;
+  border-color: #adadad;
+}
+.btn-default:active,
+.btn-default.active,
+.open > .dropdown-toggle.btn-default {
+  color: #333;
+  background-color: #e6e6e6;
+  border-color: #adadad;
+}
+.btn-default:active:hover,
+.btn-default.active:hover,
+.open > .dropdown-toggle.btn-default:hover,
+.btn-default:active:focus,
+.btn-default.active:focus,
+.open > .dropdown-toggle.btn-default:focus,
+.btn-default:active.focus,
+.btn-default.active.focus,
+.open > .dropdown-toggle.btn-default.focus {
+  color: #333;
+  background-color: #d4d4d4;
+  border-color: #8c8c8c;
+}
+.btn-default:active,
+.btn-default.active,
+.open > .dropdown-toggle.btn-default {
+  background-image: none;
+}
+.btn-default.disabled:hover,
+.btn-default[disabled]:hover,
+fieldset[disabled] .btn-default:hover,
+.btn-default.disabled:focus,
+.btn-default[disabled]:focus,
+fieldset[disabled] .btn-default:focus,
+.btn-default.disabled.focus,
+.btn-default[disabled].focus,
+fieldset[disabled] .btn-default.focus {
+  background-color: #fff;
+  border-color: #ccc;
+}
+.btn-default .badge {
+  color: #fff;
+  background-color: #333;
+}
+.btn-primary {
+  color: #fff;
+  background-color: #337ab7;
+  border-color: #2e6da4;
+}
+.btn-primary:focus,
+.btn-primary.focus {
+  color: #fff;
+  background-color: #286090;
+  border-color: #122b40;
+}
+.btn-primary:hover {
+  color: #fff;
+  background-color: #286090;
+  border-color: #204d74;
+}
+.btn-primary:active,
+.btn-primary.active,
+.open > .dropdown-toggle.btn-primary {
+  color: #fff;
+  background-color: #286090;
+  border-color: #204d74;
+}
+.btn-primary:active:hover,
+.btn-primary.active:hover,
+.open > .dropdown-toggle.btn-primary:hover,
+.btn-primary:active:focus,
+.btn-primary.active:focus,
+.open > .dropdown-toggle.btn-primary:focus,
+.btn-primary:active.focus,
+.btn-primary.active.focus,
+.open > .dropdown-toggle.btn-primary.focus {
+  color: #fff;
+  background-color: #204d74;
+  border-color: #122b40;
+}
+.btn-primary:active,
+.btn-primary.active,
+.open > .dropdown-toggle.btn-primary {
+  background-image: none;
+}
+.btn-primary.disabled:hover,
+.btn-primary[disabled]:hover,
+fieldset[disabled] .btn-primary:hover,
+.btn-primary.disabled:focus,
+.btn-primary[disabled]:focus,
+fieldset[disabled] .btn-primary:focus,
+.btn-primary.disabled.focus,
+.btn-primary[disabled].focus,
+fieldset[disabled] .btn-primary.focus {
+  background-color: #337ab7;
+  border-color: #2e6da4;
+}
+.btn-primary .badge {
+  color: #337ab7;
+  background-color: #fff;
+}
+.btn-success {
+  color: #fff;
+  background-color: #5cb85c;
+  border-color: #4cae4c;
+}
+.btn-success:focus,
+.btn-success.focus {
+  color: #fff;
+  background-color: #449d44;
+  border-color: #255625;
+}
+.btn-success:hover {
+  color: #fff;
+  background-color: #449d44;
+  border-color: #398439;
+}
+.btn-success:active,
+.btn-success.active,
+.open > .dropdown-toggle.btn-success {
+  color: #fff;
+  background-color: #449d44;
+  border-color: #398439;
+}
+.btn-success:active:hover,
+.btn-success.active:hover,
+.open > .dropdown-toggle.btn-success:hover,
+.btn-success:active:focus,
+.btn-success.active:focus,
+.open > .dropdown-toggle.btn-success:focus,
+.btn-success:active.focus,
+.btn-success.active.focus,
+.open > .dropdown-toggle.btn-success.focus {
+  color: #fff;
+  background-color: #398439;
+  border-color: #255625;
+}
+.btn-success:active,
+.btn-success.active,
+.open > .dropdown-toggle.btn-success {
+  background-image: none;
+}
+.btn-success.disabled:hover,
+.btn-success[disabled]:hover,
+fieldset[disabled] .btn-success:hover,
+.btn-success.disabled:focus,
+.btn-success[disabled]:focus,
+fieldset[disabled] .btn-success:focus,
+.btn-success.disabled.focus,
+.btn-success[disabled].focus,
+fieldset[disabled] .btn-success.focus {
+  background-color: #5cb85c;
+  border-color: #4cae4c;
+}
+.btn-success .badge {
+  color: #5cb85c;
+  background-color: #fff;
+}
+.btn-info {
+  color: #fff;
+  background-color: #5bc0de;
+  border-color: #46b8da;
+}
+.btn-info:focus,
+.btn-info.focus {
+  color: #fff;
+  background-color: #31b0d5;
+  border-color: #1b6d85;
+}
+.btn-info:hover {
+  color: #fff;
+  background-color: #31b0d5;
+  border-color: #269abc;
+}
+.btn-info:active,
+.btn-info.active,
+.open > .dropdown-toggle.btn-info {
+  color: #fff;
+  background-color: #31b0d5;
+  border-color: #269abc;
+}
+.btn-info:active:hover,
+.btn-info.active:hover,
+.open > .dropdown-toggle.btn-info:hover,
+.btn-info:active:focus,
+.btn-info.active:focus,
+.open > .dropdown-toggle.btn-info:focus,
+.btn-info:active.focus,
+.btn-info.active.focus,
+.open > .dropdown-toggle.btn-info.focus {
+  color: #fff;
+  background-color: #269abc;
+  border-color: #1b6d85;
+}
+.btn-info:active,
+.btn-info.active,
+.open > .dropdown-toggle.btn-info {
+  background-image: none;
+}
+.btn-info.disabled:hover,
+.btn-info[disabled]:hover,
+fieldset[disabled] .btn-info:hover,
+.btn-info.disabled:focus,
+.btn-info[disabled]:focus,
+fieldset[disabled] .btn-info:focus,
+.btn-info.disabled.focus,
+.btn-info[disabled].focus,
+fieldset[disabled] .btn-info.focus {
+  background-color: #5bc0de;
+  border-color: #46b8da;
+}
+.btn-info .badge {
+  color: #5bc0de;
+  background-color: #fff;
+}
+.btn-warning {
+  color: #fff;
+  background-color: #f0ad4e;
+  border-color: #eea236;
+}
+.btn-warning:focus,
+.btn-warning.focus {
+  color: #fff;
+  background-color: #ec971f;
+  border-color: #985f0d;
+}
+.btn-warning:hover {
+  color: #fff;
+  background-color: #ec971f;
+  border-color: #d58512;
+}
+.btn-warning:active,
+.btn-warning.active,
+.open > .dropdown-toggle.btn-warning {
+  color: #fff;
+  background-color: #ec971f;
+  border-color: #d58512;
+}
+.btn-warning:active:hover,
+.btn-warning.active:hover,
+.open > .dropdown-toggle.btn-warning:hover,
+.btn-warning:active:focus,
+.btn-warning.active:focus,
+.open > .dropdown-toggle.btn-warning:focus,
+.btn-warning:active.focus,
+.btn-warning.active.focus,
+.open > .dropdown-toggle.btn-warning.focus {
+  color: #fff;
+  background-color: #d58512;
+  border-color: #985f0d;
+}
+.btn-warning:active,
+.btn-warning.active,
+.open > .dropdown-toggle.btn-warning {
+  background-image: none;
+}
+.btn-warning.disabled:hover,
+.btn-warning[disabled]:hover,
+fieldset[disabled] .btn-warning:hover,
+.btn-warning.disabled:focus,
+.btn-warning[disabled]:focus,
+fieldset[disabled] .btn-warning:focus,
+.btn-warning.disabled.focus,
+.btn-warning[disabled].focus,
+fieldset[disabled] .btn-warning.focus {
+  background-color: #f0ad4e;
+  border-color: #eea236;
+}
+.btn-warning .badge {
+  color: #f0ad4e;
+  background-color: #fff;
+}
+.btn-danger {
+  color: #fff;
+  background-color: #d9534f;
+  border-color: #d43f3a;
+}
+.btn-danger:focus,
+.btn-danger.focus {
+  color: #fff;
+  background-color: #c9302c;
+  border-color: #761c19;
+}
+.btn-danger:hover {
+  color: #fff;
+  background-color: #c9302c;
+  border-color: #ac2925;
+}
+.btn-danger:active,
+.btn-danger.active,
+.open > .dropdown-toggle.btn-danger {
+  color: #fff;
+  background-color: #c9302c;
+  border-color: #ac2925;
+}
+.btn-danger:active:hover,
+.btn-danger.active:hover,
+.open > .dropdown-toggle.btn-danger:hover,
+.btn-danger:active:focus,
+.btn-danger.active:focus,
+.open > .dropdown-toggle.btn-danger:focus,
+.btn-danger:active.focus,
+.btn-danger.active.focus,
+.open > .dropdown-toggle.btn-danger.focus {
+  color: #fff;
+  background-color: #ac2925;
+  border-color: #761c19;
+}
+.btn-danger:active,
+.btn-danger.active,
+.open > .dropdown-toggle.btn-danger {
+  background-image: none;
+}
+.btn-danger.disabled:hover,
+.btn-danger[disabled]:hover,
+fieldset[disabled] .btn-danger:hover,
+.btn-danger.disabled:focus,
+.btn-danger[disabled]:focus,
+fieldset[disabled] .btn-danger:focus,
+.btn-danger.disabled.focus,
+.btn-danger[disabled].focus,
+fieldset[disabled] .btn-danger.focus {
+  background-color: #d9534f;
+  border-color: #d43f3a;
+}
+.btn-danger .badge {
+  color: #d9534f;
+  background-color: #fff;
+}
+.btn-link {
+  font-weight: normal;
+  color: #337ab7;
+  border-radius: 0;
+}
+.btn-link,
+.btn-link:active,
+.btn-link.active,
+.btn-link[disabled],
+fieldset[disabled] .btn-link {
+  background-color: transparent;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+.btn-link,
+.btn-link:hover,
+.btn-link:focus,
+.btn-link:active {
+  border-color: transparent;
+}
+.btn-link:hover,
+.btn-link:focus {
+  color: #23527c;
+  text-decoration: underline;
+  background-color: transparent;
+}
+.btn-link[disabled]:hover,
+fieldset[disabled] .btn-link:hover,
+.btn-link[disabled]:focus,
+fieldset[disabled] .btn-link:focus {
+  color: #777;
+  text-decoration: none;
+}
+.btn-lg,
+.btn-group-lg > .btn {
+  padding: 10px 16px;
+  font-size: 18px;
+  line-height: 1.3333333;
+  border-radius: 6px;
+}
+.btn-sm,
+.btn-group-sm > .btn {
+  padding: 5px 10px;
+  font-size: 12px;
+  line-height: 1.5;
+  border-radius: 3px;
+}
+.btn-xs,
+.btn-group-xs > .btn {
+  padding: 1px 5px;
+  font-size: 12px;
+  line-height: 1.5;
+  border-radius: 3px;
+}
+.btn-block {
+  display: block;
+  width: 100%;
+}
+.btn-block + .btn-block {
+  margin-top: 5px;
+}
+input[type="submit"].btn-block,
+input[type="reset"].btn-block,
+input[type="button"].btn-block {
+  width: 100%;
+}
+.fade {
+  opacity: 0;
+  -webkit-transition: opacity .15s linear;
+       -o-transition: opacity .15s linear;
+          transition: opacity .15s linear;
+}
+.fade.in {
+  opacity: 1;
+}
+.collapse {
+  display: none;
+}
+.collapse.in {
+  display: block;
+}
+tr.collapse.in {
+  display: table-row;
+}
+tbody.collapse.in {
+  display: table-row-group;
+}
+.collapsing {
+  position: relative;
+  height: 0;
+  overflow: hidden;
+  -webkit-transition-timing-function: ease;
+       -o-transition-timing-function: ease;
+          transition-timing-function: ease;
+  -webkit-transition-duration: .35s;
+       -o-transition-duration: .35s;
+          transition-duration: .35s;
+  -webkit-transition-property: height, visibility;
+       -o-transition-property: height, visibility;
+          transition-property: height, visibility;
+}
+.caret {
+  display: inline-block;
+  width: 0;
+  height: 0;
+  margin-left: 2px;
+  vertical-align: middle;
+  border-top: 4px dashed;
+  border-top: 4px solid \9;
+  border-right: 4px solid transparent;
+  border-left: 4px solid transparent;
+}
+.dropup,
+.dropdown {
+  position: relative;
+}
+.dropdown-toggle:focus {
+  outline: 0;
+}
+.dropdown-menu {
+  position: absolute;
+  top: 100%;
+  left: 0;
+  z-index: 1000;
+  display: none;
+  float: left;
+  min-width: 160px;
+  padding: 5px 0;
+  margin: 2px 0 0;
+  font-size: 14px;
+  text-align: left;
+  list-style: none;
+  background-color: #fff;
+  -webkit-background-clip: padding-box;
+          background-clip: padding-box;
+  border: 1px solid #ccc;
+  border: 1px solid rgba(0, 0, 0, .15);
+  border-radius: 4px;
+  -webkit-box-shadow: 0 6px 12px rgba(0, 0, 0, .175);
+          box-shadow: 0 6px 12px rgba(0, 0, 0, .175);
+}
+.dropdown-menu.pull-right {
+  right: 0;
+  left: auto;
+}
+.dropdown-menu .divider {
+  height: 1px;
+  margin: 9px 0;
+  overflow: hidden;
+  background-color: #e5e5e5;
+}
+.dropdown-menu > li > a {
+  display: block;
+  padding: 3px 20px;
+  clear: both;
+  font-weight: normal;
+  line-height: 1.42857143;
+  color: #333;
+  white-space: nowrap;
+}
+.dropdown-menu > li > a:hover,
+.dropdown-menu > li > a:focus {
+  color: #262626;
+  text-decoration: none;
+  background-color: #f5f5f5;
+}
+.dropdown-menu > .active > a,
+.dropdown-menu > .active > a:hover,
+.dropdown-menu > .active > a:focus {
+  color: #fff;
+  text-decoration: none;
+  background-color: #337ab7;
+  outline: 0;
+}
+.dropdown-menu > .disabled > a,
+.dropdown-menu > .disabled > a:hover,
+.dropdown-menu > .disabled > a:focus {
+  color: #777;
+}
+.dropdown-menu > .disabled > a:hover,
+.dropdown-menu > .disabled > a:focus {
+  text-decoration: none;
+  cursor: not-allowed;
+  background-color: transparent;
+  background-image: none;
+  filter: progid:DXImageTransform.Microsoft.gradient(enabled = false);
+}
+.open > .dropdown-menu {
+  display: block;
+}
+.open > a {
+  outline: 0;
+}
+.dropdown-menu-right {
+  right: 0;
+  left: auto;
+}
+.dropdown-menu-left {
+  right: auto;
+  left: 0;
+}
+.dropdown-header {
+  display: block;
+  padding: 3px 20px;
+  font-size: 12px;
+  line-height: 1.42857143;
+  color: #777;
+  white-space: nowrap;
+}
+.dropdown-backdrop {
+  position: fixed;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 990;
+}
+.pull-right > .dropdown-menu {
+  right: 0;
+  left: auto;
+}
+.dropup .caret,
+.navbar-fixed-bottom .dropdown .caret {
+  content: "";
+  border-top: 0;
+  border-bottom: 4px dashed;
+  border-bottom: 4px solid \9;
+}
+.dropup .dropdown-menu,
+.navbar-fixed-bottom .dropdown .dropdown-menu {
+  top: auto;
+  bottom: 100%;
+  margin-bottom: 2px;
+}
+@media (min-width: 768px) {
+  .navbar-right .dropdown-menu {
+    right: 0;
+    left: auto;
+  }
+  .navbar-right .dropdown-menu-left {
+    right: auto;
+    left: 0;
+  }
+}
+.btn-group,
+.btn-group-vertical {
+  position: relative;
+  display: inline-block;
+  vertical-align: middle;
+}
+.btn-group > .btn,
+.btn-group-vertical > .btn {
+  position: relative;
+  float: left;
+}
+.btn-group > .btn:hover,
+.btn-group-vertical > .btn:hover,
+.btn-group > .btn:focus,
+.btn-group-vertical > .btn:focus,
+.btn-group > .btn:active,
+.btn-group-vertical > .btn:active,
+.btn-group > .btn.active,
+.btn-group-vertical > .btn.active {
+  z-index: 2;
+}
+.btn-group .btn + .btn,
+.btn-group .btn + .btn-group,
+.btn-group .btn-group + .btn,
+.btn-group .btn-group + .btn-group {
+  margin-left: -1px;
+}
+.btn-toolbar {
+  margin-left: -5px;
+}
+.btn-toolbar .btn,
+.btn-toolbar .btn-group,
+.btn-toolbar .input-group {
+  float: left;
+}
+.btn-toolbar > .btn,
+.btn-toolbar > .btn-group,
+.btn-toolbar > .input-group {
+  margin-left: 5px;
+}
+.btn-group > .btn:not(:first-child):not(:last-child):not(.dropdown-toggle) {
+  border-radius: 0;
+}
+.btn-group > .btn:first-child {
+  margin-left: 0;
+}
+.btn-group > .btn:first-child:not(:last-child):not(.dropdown-toggle) {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+.btn-group > .btn:last-child:not(:first-child),
+.btn-group > .dropdown-toggle:not(:first-child) {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+.btn-group > .btn-group {
+  float: left;
+}
+.btn-group > .btn-group:not(:first-child):not(:last-child) > .btn {
+  border-radius: 0;
+}
+.btn-group > .btn-group:first-child:not(:last-child) > .btn:last-child,
+.btn-group > .btn-group:first-child:not(:last-child) > .dropdown-toggle {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+.btn-group > .btn-group:last-child:not(:first-child) > .btn:first-child {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+.btn-group .dropdown-toggle:active,
+.btn-group.open .dropdown-toggle {
+  outline: 0;
+}
+.btn-group > .btn + .dropdown-toggle {
+  padding-right: 8px;
+  padding-left: 8px;
+}
+.btn-group > .btn-lg + .dropdown-toggle {
+  padding-right: 12px;
+  padding-left: 12px;
+}
+.btn-group.open .dropdown-toggle {
+  -webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, .125);
+          box-shadow: inset 0 3px 5px rgba(0, 0, 0, .125);
+}
+.btn-group.open .dropdown-toggle.btn-link {
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+.btn .caret {
+  margin-left: 0;
+}
+.btn-lg .caret {
+  border-width: 5px 5px 0;
+  border-bottom-width: 0;
+}
+.dropup .btn-lg .caret {
+  border-width: 0 5px 5px;
+}
+.btn-group-vertical > .btn,
+.btn-group-vertical > .btn-group,
+.btn-group-vertical > .btn-group > .btn {
+  display: block;
+  float: none;
+  width: 100%;
+  max-width: 100%;
+}
+.btn-group-vertical > .btn-group > .btn {
+  float: none;
+}
+.btn-group-vertical > .btn + .btn,
+.btn-group-vertical > .btn + .btn-group,
+.btn-group-vertical > .btn-group + .btn,
+.btn-group-vertical > .btn-group + .btn-group {
+  margin-top: -1px;
+  margin-left: 0;
+}
+.btn-group-vertical > .btn:not(:first-child):not(:last-child) {
+  border-radius: 0;
+}
+.btn-group-vertical > .btn:first-child:not(:last-child) {
+  border-top-left-radius: 4px;
+  border-top-right-radius: 4px;
+  border-bottom-right-radius: 0;
+  border-bottom-left-radius: 0;
+}
+.btn-group-vertical > .btn:last-child:not(:first-child) {
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 4px;
+  border-bottom-left-radius: 4px;
+}
+.btn-group-vertical > .btn-group:not(:first-child):not(:last-child) > .btn {
+  border-radius: 0;
+}
+.btn-group-vertical > .btn-group:first-child:not(:last-child) > .btn:last-child,
+.btn-group-vertical > .btn-group:first-child:not(:last-child) > .dropdown-toggle {
+  border-bottom-right-radius: 0;
+  border-bottom-left-radius: 0;
+}
+.btn-group-vertical > .btn-group:last-child:not(:first-child) > .btn:first-child {
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+.btn-group-justified {
+  display: table;
+  width: 100%;
+  table-layout: fixed;
+  border-collapse: separate;
+}
+.btn-group-justified > .btn,
+.btn-group-justified > .btn-group {
+  display: table-cell;
+  float: none;
+  width: 1%;
+}
+.btn-group-justified > .btn-group .btn {
+  width: 100%;
+}
+.btn-group-justified > .btn-group .dropdown-menu {
+  left: auto;
+}
+[data-toggle="buttons"] > .btn input[type="radio"],
+[data-toggle="buttons"] > .btn-group > .btn input[type="radio"],
+[data-toggle="buttons"] > .btn input[type="checkbox"],
+[data-toggle="buttons"] > .btn-group > .btn input[type="checkbox"] {
+  position: absolute;
+  clip: rect(0, 0, 0, 0);
+  pointer-events: none;
+}
+.input-group {
+  position: relative;
+  display: table;
+  border-collapse: separate;
+}
+.input-group[class*="col-"] {
+  float: none;
+  padding-right: 0;
+  padding-left: 0;
+}
+.input-group .form-control {
+  position: relative;
+  z-index: 2;
+  float: left;
+  width: 100%;
+  margin-bottom: 0;
+}
+.input-group .form-control:focus {
+  z-index: 3;
+}
+.input-group-lg > .form-control,
+.input-group-lg > .input-group-addon,
+.input-group-lg > .input-group-btn > .btn {
+  height: 46px;
+  padding: 10px 16px;
+  font-size: 18px;
+  line-height: 1.3333333;
+  border-radius: 6px;
+}
+select.input-group-lg > .form-control,
+select.input-group-lg > .input-group-addon,
+select.input-group-lg > .input-group-btn > .btn {
+  height: 46px;
+  line-height: 46px;
+}
+textarea.input-group-lg > .form-control,
+textarea.input-group-lg > .input-group-addon,
+textarea.input-group-lg > .input-group-btn > .btn,
+select[multiple].input-group-lg > .form-control,
+select[multiple].input-group-lg > .input-group-addon,
+select[multiple].input-group-lg > .input-group-btn > .btn {
+  height: auto;
+}
+.input-group-sm > .form-control,
+.input-group-sm > .input-group-addon,
+.input-group-sm > .input-group-btn > .btn {
+  height: 30px;
+  padding: 5px 10px;
+  font-size: 12px;
+  line-height: 1.5;
+  border-radius: 3px;
+}
+select.input-group-sm > .form-control,
+select.input-group-sm > .input-group-addon,
+select.input-group-sm > .input-group-btn > .btn {
+  height: 30px;
+  line-height: 30px;
+}
+textarea.input-group-sm > .form-control,
+textarea.input-group-sm > .input-group-addon,
+textarea.input-group-sm > .input-group-btn > .btn,
+select[multiple].input-group-sm > .form-control,
+select[multiple].input-group-sm > .input-group-addon,
+select[multiple].input-group-sm > .input-group-btn > .btn {
+  height: auto;
+}
+.input-group-addon,
+.input-group-btn,
+.input-group .form-control {
+  display: table-cell;
+}
+.input-group-addon:not(:first-child):not(:last-child),
+.input-group-btn:not(:first-child):not(:last-child),
+.input-group .form-control:not(:first-child):not(:last-child) {
+  border-radius: 0;
+}
+.input-group-addon,
+.input-group-btn {
+  width: 1%;
+  white-space: nowrap;
+  vertical-align: middle;
+}
+.input-group-addon {
+  padding: 6px 12px;
+  font-size: 14px;
+  font-weight: normal;
+  line-height: 1;
+  color: #555;
+  text-align: center;
+  background-color: #eee;
+  border: 1px solid #ccc;
+  border-radius: 4px;
+}
+.input-group-addon.input-sm {
+  padding: 5px 10px;
+  font-size: 12px;
+  border-radius: 3px;
+}
+.input-group-addon.input-lg {
+  padding: 10px 16px;
+  font-size: 18px;
+  border-radius: 6px;
+}
+.input-group-addon input[type="radio"],
+.input-group-addon input[type="checkbox"] {
+  margin-top: 0;
+}
+.input-group .form-control:first-child,
+.input-group-addon:first-child,
+.input-group-btn:first-child > .btn,
+.input-group-btn:first-child > .btn-group > .btn,
+.input-group-btn:first-child > .dropdown-toggle,
+.input-group-btn:last-child > .btn:not(:last-child):not(.dropdown-toggle),
+.input-group-btn:last-child > .btn-group:not(:last-child) > .btn {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+.input-group-addon:first-child {
+  border-right: 0;
+}
+.input-group .form-control:last-child,
+.input-group-addon:last-child,
+.input-group-btn:last-child > .btn,
+.input-group-btn:last-child > .btn-group > .btn,
+.input-group-btn:last-child > .dropdown-toggle,
+.input-group-btn:first-child > .btn:not(:first-child),
+.input-group-btn:first-child > .btn-group:not(:first-child) > .btn {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+.input-group-addon:last-child {
+  border-left: 0;
+}
+.input-group-btn {
+  position: relative;
+  font-size: 0;
+  white-space: nowrap;
+}
+.input-group-btn > .btn {
+  position: relative;
+}
+.input-group-btn > .btn + .btn {
+  margin-left: -1px;
+}
+.input-group-btn > .btn:hover,
+.input-group-btn > .btn:focus,
+.input-group-btn > .btn:active {
+  z-index: 2;
+}
+.input-group-btn:first-child > .btn,
+.input-group-btn:first-child > .btn-group {
+  margin-right: -1px;
+}
+.input-group-btn:last-child > .btn,
+.input-group-btn:last-child > .btn-group {
+  z-index: 2;
+  margin-left: -1px;
+}
+.nav {
+  padding-left: 0;
+  margin-bottom: 0;
+  list-style: none;
+}
+.nav > li {
+  position: relative;
+  display: block;
+}
+.nav > li > a {
+  position: relative;
+  display: block;
+  padding: 10px 15px;
+}
+.nav > li > a:hover,
+.nav > li > a:focus {
+  text-decoration: none;
+  background-color: #eee;
+}
+.nav > li.disabled > a {
+  color: #777;
+}
+.nav > li.disabled > a:hover,
+.nav > li.disabled > a:focus {
+  color: #777;
+  text-decoration: none;
+  cursor: not-allowed;
+  background-color: transparent;
+}
+.nav .open > a,
+.nav .open > a:hover,
+.nav .open > a:focus {
+  background-color: #eee;
+  border-color: #337ab7;
+}
+.nav .nav-divider {
+  height: 1px;
+  margin: 9px 0;
+  overflow: hidden;
+  background-color: #e5e5e5;
+}
+.nav > li > a > img {
+  max-width: none;
+}
+.nav-tabs {
+  border-bottom: 1px solid #ddd;
+}
+.nav-tabs > li {
+  float: left;
+  margin-bottom: -1px;
+}
+.nav-tabs > li > a {
+  margin-right: 2px;
+  line-height: 1.42857143;
+  border: 1px solid transparent;
+  border-radius: 4px 4px 0 0;
+}
+.nav-tabs > li > a:hover {
+  border-color: #eee #eee #ddd;
+}
+.nav-tabs > li.active > a,
+.nav-tabs > li.active > a:hover,
+.nav-tabs > li.active > a:focus {
+  color: #555;
+  cursor: default;
+  background-color: #fff;
+  border: 1px solid #ddd;
+  border-bottom-color: transparent;
+}
+.nav-tabs.nav-justified {
+  width: 100%;
+  border-bottom: 0;
+}
+.nav-tabs.nav-justified > li {
+  float: none;
+}
+.nav-tabs.nav-justified > li > a {
+  margin-bottom: 5px;
+  text-align: center;
+}
+.nav-tabs.nav-justified > .dropdown .dropdown-menu {
+  top: auto;
+  left: auto;
+}
+@media (min-width: 768px) {
+  .nav-tabs.nav-justified > li {
+    display: table-cell;
+    width: 1%;
+  }
+  .nav-tabs.nav-justified > li > a {
+    margin-bottom: 0;
+  }
+}
+.nav-tabs.nav-justified > li > a {
+  margin-right: 0;
+  border-radius: 4px;
+}
+.nav-tabs.nav-justified > .active > a,
+.nav-tabs.nav-justified > .active > a:hover,
+.nav-tabs.nav-justified > .active > a:focus {
+  border: 1px solid #ddd;
+}
+@media (min-width: 768px) {
+  .nav-tabs.nav-justified > li > a {
+    border-bottom: 1px solid #ddd;
+    border-radius: 4px 4px 0 0;
+  }
+  .nav-tabs.nav-justified > .active > a,
+  .nav-tabs.nav-justified > .active > a:hover,
+  .nav-tabs.nav-justified > .active > a:focus {
+    border-bottom-color: #fff;
+  }
+}
+.nav-pills > li {
+  float: left;
+}
+.nav-pills > li > a {
+  border-radius: 4px;
+}
+.nav-pills > li + li {
+  margin-left: 2px;
+}
+.nav-pills > li.active > a,
+.nav-pills > li.active > a:hover,
+.nav-pills > li.active > a:focus {
+  color: #fff;
+  background-color: #337ab7;
+}
+.nav-stacked > li {
+  float: none;
+}
+.nav-stacked > li + li {
+  margin-top: 2px;
+  margin-left: 0;
+}
+.nav-justified {
+  width: 100%;
+}
+.nav-justified > li {
+  float: none;
+}
+.nav-justified > li > a {
+  margin-bottom: 5px;
+  text-align: center;
+}
+.nav-justified > .dropdown .dropdown-menu {
+  top: auto;
+  left: auto;
+}
+@media (min-width: 768px) {
+  .nav-justified > li {
+    display: table-cell;
+    width: 1%;
+  }
+  .nav-justified > li > a {
+    margin-bottom: 0;
+  }
+}
+.nav-tabs-justified {
+  border-bottom: 0;
+}
+.nav-tabs-justified > li > a {
+  margin-right: 0;
+  border-radius: 4px;
+}
+.nav-tabs-justified > .active > a,
+.nav-tabs-justified > .active > a:hover,
+.nav-tabs-justified > .active > a:focus {
+  border: 1px solid #ddd;
+}
+@media (min-width: 768px) {
+  .nav-tabs-justified > li > a {
+    border-bottom: 1px solid #ddd;
+    border-radius: 4px 4px 0 0;
+  }
+  .nav-tabs-justified > .active > a,
+  .nav-tabs-justified > .active > a:hover,
+  .nav-tabs-justified > .active > a:focus {
+    border-bottom-color: #fff;
+  }
+}
+.tab-content > .tab-pane {
+  display: none;
+}
+.tab-content > .active {
+  display: block;
+}
+.nav-tabs .dropdown-menu {
+  margin-top: -1px;
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+.navbar {
+  position: relative;
+  min-height: 50px;
+  margin-bottom: 20px;
+  border: 1px solid transparent;
+}
+@media (min-width: 768px) {
+  .navbar {
+    border-radius: 4px;
+  }
+}
+@media (min-width: 768px) {
+  .navbar-header {
+    float: left;
+  }
+}
+.navbar-collapse {
+  padding-right: 15px;
+  padding-left: 15px;
+  overflow-x: visible;
+  -webkit-overflow-scrolling: touch;
+  border-top: 1px solid transparent;
+  -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, .1);
+          box-shadow: inset 0 1px 0 rgba(255, 255, 255, .1);
+}
+.navbar-collapse.in {
+  overflow-y: auto;
+}
+@media (min-width: 768px) {
+  .navbar-collapse {
+    width: auto;
+    border-top: 0;
+    -webkit-box-shadow: none;
+            box-shadow: none;
+  }
+  .navbar-collapse.collapse {
+    display: block !important;
+    height: auto !important;
+    padding-bottom: 0;
+    overflow: visible !important;
+  }
+  .navbar-collapse.in {
+    overflow-y: visible;
+  }
+  .navbar-fixed-top .navbar-collapse,
+  .navbar-static-top .navbar-collapse,
+  .navbar-fixed-bottom .navbar-collapse {
+    padding-right: 0;
+    padding-left: 0;
+  }
+}
+.navbar-fixed-top .navbar-collapse,
+.navbar-fixed-bottom .navbar-collapse {
+  max-height: 340px;
+}
+@media (max-device-width: 480px) and (orientation: landscape) {
+  .navbar-fixed-top .navbar-collapse,
+  .navbar-fixed-bottom .navbar-collapse {
+    max-height: 200px;
+  }
+}
+.container > .navbar-header,
+.container-fluid > .navbar-header,
+.container > .navbar-collapse,
+.container-fluid > .navbar-collapse {
+  margin-right: -15px;
+  margin-left: -15px;
+}
+@media (min-width: 768px) {
+  .container > .navbar-header,
+  .container-fluid > .navbar-header,
+  .container > .navbar-collapse,
+  .container-fluid > .navbar-collapse {
+    margin-right: 0;
+    margin-left: 0;
+  }
+}
+.navbar-static-top {
+  z-index: 1000;
+  border-width: 0 0 1px;
+}
+@media (min-width: 768px) {
+  .navbar-static-top {
+    border-radius: 0;
+  }
+}
+.navbar-fixed-top,
+.navbar-fixed-bottom {
+  position: fixed;
+  right: 0;
+  left: 0;
+  z-index: 1030;
+}
+@media (min-width: 768px) {
+  .navbar-fixed-top,
+  .navbar-fixed-bottom {
+    border-radius: 0;
+  }
+}
+.navbar-fixed-top {
+  top: 0;
+  border-width: 0 0 1px;
+}
+.navbar-fixed-bottom {
+  bottom: 0;
+  margin-bottom: 0;
+  border-width: 1px 0 0;
+}
+.navbar-brand {
+  float: left;
+  height: 50px;
+  padding: 15px 15px;
+  font-size: 18px;
+  line-height: 20px;
+}
+.navbar-brand:hover,
+.navbar-brand:focus {
+  text-decoration: none;
+}
+.navbar-brand > img {
+  display: block;
+}
+@media (min-width: 768px) {
+  .navbar > .container .navbar-brand,
+  .navbar > .container-fluid .navbar-brand {
+    margin-left: -15px;
+  }
+}
+.navbar-toggle {
+  position: relative;
+  float: right;
+  padding: 9px 10px;
+  margin-top: 8px;
+  margin-right: 15px;
+  margin-bottom: 8px;
+  background-color: transparent;
+  background-image: none;
+  border: 1px solid transparent;
+  border-radius: 4px;
+}
+.navbar-toggle:focus {
+  outline: 0;
+}
+.navbar-toggle .icon-bar {
+  display: block;
+  width: 22px;
+  height: 2px;
+  border-radius: 1px;
+}
+.navbar-toggle .icon-bar + .icon-bar {
+  margin-top: 4px;
+}
+@media (min-width: 768px) {
+  .navbar-toggle {
+    display: none;
+  }
+}
+.navbar-nav {
+  margin: 7.5px -15px;
+}
+.navbar-nav > li > a {
+  padding-top: 10px;
+  padding-bottom: 10px;
+  line-height: 20px;
+}
+@media (max-width: 767px) {
+  .navbar-nav .open .dropdown-menu {
+    position: static;
+    float: none;
+    width: auto;
+    margin-top: 0;
+    background-color: transparent;
+    border: 0;
+    -webkit-box-shadow: none;
+            box-shadow: none;
+  }
+  .navbar-nav .open .dropdown-menu > li > a,
+  .navbar-nav .open .dropdown-menu .dropdown-header {
+    padding: 5px 15px 5px 25px;
+  }
+  .navbar-nav .open .dropdown-menu > li > a {
+    line-height: 20px;
+  }
+  .navbar-nav .open .dropdown-menu > li > a:hover,
+  .navbar-nav .open .dropdown-menu > li > a:focus {
+    background-image: none;
+  }
+}
+@media (min-width: 768px) {
+  .navbar-nav {
+    float: left;
+    margin: 0;
+  }
+  .navbar-nav > li {
+    float: left;
+  }
+  .navbar-nav > li > a {
+    padding-top: 15px;
+    padding-bottom: 15px;
+  }
+}
+.navbar-form {
+  padding: 10px 15px;
+  margin-top: 8px;
+  margin-right: -15px;
+  margin-bottom: 8px;
+  margin-left: -15px;
+  border-top: 1px solid transparent;
+  border-bottom: 1px solid transparent;
+  -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, .1), 0 1px 0 rgba(255, 255, 255, .1);
+          box-shadow: inset 0 1px 0 rgba(255, 255, 255, .1), 0 1px 0 rgba(255, 255, 255, .1);
+}
+@media (min-width: 768px) {
+  .navbar-form .form-group {
+    display: inline-block;
+    margin-bottom: 0;
+    vertical-align: middle;
+  }
+  .navbar-form .form-control {
+    display: inline-block;
+    width: auto;
+    vertical-align: middle;
+  }
+  .navbar-form .form-control-static {
+    display: inline-block;
+  }
+  .navbar-form .input-group {
+    display: inline-table;
+    vertical-align: middle;
+  }
+  .navbar-form .input-group .input-group-addon,
+  .navbar-form .input-group .input-group-btn,
+  .navbar-form .input-group .form-control {
+    width: auto;
+  }
+  .navbar-form .input-group > .form-control {
+    width: 100%;
+  }
+  .navbar-form .control-label {
+    margin-bottom: 0;
+    vertical-align: middle;
+  }
+  .navbar-form .radio,
+  .navbar-form .checkbox {
+    display: inline-block;
+    margin-top: 0;
+    margin-bottom: 0;
+    vertical-align: middle;
+  }
+  .navbar-form .radio label,
+  .navbar-form .checkbox label {
+    padding-left: 0;
+  }
+  .navbar-form .radio input[type="radio"],
+  .navbar-form .checkbox input[type="checkbox"] {
+    position: relative;
+    margin-left: 0;
+  }
+  .navbar-form .has-feedback .form-control-feedback {
+    top: 0;
+  }
+}
+@media (max-width: 767px) {
+  .navbar-form .form-group {
+    margin-bottom: 5px;
+  }
+  .navbar-form .form-group:last-child {
+    margin-bottom: 0;
+  }
+}
+@media (min-width: 768px) {
+  .navbar-form {
+    width: auto;
+    padding-top: 0;
+    padding-bottom: 0;
+    margin-right: 0;
+    margin-left: 0;
+    border: 0;
+    -webkit-box-shadow: none;
+            box-shadow: none;
+  }
+}
+.navbar-nav > li > .dropdown-menu {
+  margin-top: 0;
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+.navbar-fixed-bottom .navbar-nav > li > .dropdown-menu {
+  margin-bottom: 0;
+  border-top-left-radius: 4px;
+  border-top-right-radius: 4px;
+  border-bottom-right-radius: 0;
+  border-bottom-left-radius: 0;
+}
+.navbar-btn {
+  margin-top: 8px;
+  margin-bottom: 8px;
+}
+.navbar-btn.btn-sm {
+  margin-top: 10px;
+  margin-bottom: 10px;
+}
+.navbar-btn.btn-xs {
+  margin-top: 14px;
+  margin-bottom: 14px;
+}
+.navbar-text {
+  margin-top: 15px;
+  margin-bottom: 15px;
+}
+@media (min-width: 768px) {
+  .navbar-text {
+    float: left;
+    margin-right: 15px;
+    margin-left: 15px;
+  }
+}
+@media (min-width: 768px) {
+  .navbar-left {
+    float: left !important;
+  }
+  .navbar-right {
+    float: right !important;
+    margin-right: -15px;
+  }
+  .navbar-right ~ .navbar-right {
+    margin-right: 0;
+  }
+}
+.navbar-default {
+  background-color: #f8f8f8;
+  border-color: #e7e7e7;
+}
+.navbar-default .navbar-brand {
+  color: #777;
+}
+.navbar-default .navbar-brand:hover,
+.navbar-default .navbar-brand:focus {
+  color: #5e5e5e;
+  background-color: transparent;
+}
+.navbar-default .navbar-text {
+  color: #777;
+}
+.navbar-default .navbar-nav > li > a {
+  color: #777;
+}
+.navbar-default .navbar-nav > li > a:hover,
+.navbar-default .navbar-nav > li > a:focus {
+  color: #333;
+  background-color: transparent;
+}
+.navbar-default .navbar-nav > .active > a,
+.navbar-default .navbar-nav > .active > a:hover,
+.navbar-default .navbar-nav > .active > a:focus {
+  color: #555;
+  background-color: #e7e7e7;
+}
+.navbar-default .navbar-nav > .disabled > a,
+.navbar-default .navbar-nav > .disabled > a:hover,
+.navbar-default .navbar-nav > .disabled > a:focus {
+  color: #ccc;
+  background-color: transparent;
+}
+.navbar-default .navbar-toggle {
+  border-color: #ddd;
+}
+.navbar-default .navbar-toggle:hover,
+.navbar-default .navbar-toggle:focus {
+  background-color: #ddd;
+}
+.navbar-default .navbar-toggle .icon-bar {
+  background-color: #888;
+}
+.navbar-default .navbar-collapse,
+.navbar-default .navbar-form {
+  border-color: #e7e7e7;
+}
+.navbar-default .navbar-nav > .open > a,
+.navbar-default .navbar-nav > .open > a:hover,
+.navbar-default .navbar-nav > .open > a:focus {
+  color: #555;
+  background-color: #e7e7e7;
+}
+@media (max-width: 767px) {
+  .navbar-default .navbar-nav .open .dropdown-menu > li > a {
+    color: #777;
+  }
+  .navbar-default .navbar-nav .open .dropdown-menu > li > a:hover,
+  .navbar-default .navbar-nav .open .dropdown-menu > li > a:focus {
+    color: #333;
+    background-color: transparent;
+  }
+  .navbar-default .navbar-nav .open .dropdown-menu > .active > a,
+  .navbar-default .navbar-nav .open .dropdown-menu > .active > a:hover,
+  .navbar-default .navbar-nav .open .dropdown-menu > .active > a:focus {
+    color: #555;
+    background-color: #e7e7e7;
+  }
+  .navbar-default .navbar-nav .open .dropdown-menu > .disabled > a,
+  .navbar-default .navbar-nav .open .dropdown-menu > .disabled > a:hover,
+  .navbar-default .navbar-nav .open .dropdown-menu > .disabled > a:focus {
+    color: #ccc;
+    background-color: transparent;
+  }
+}
+.navbar-default .navbar-link {
+  color: #777;
+}
+.navbar-default .navbar-link:hover {
+  color: #333;
+}
+.navbar-default .btn-link {
+  color: #777;
+}
+.navbar-default .btn-link:hover,
+.navbar-default .btn-link:focus {
+  color: #333;
+}
+.navbar-default .btn-link[disabled]:hover,
+fieldset[disabled] .navbar-default .btn-link:hover,
+.navbar-default .btn-link[disabled]:focus,
+fieldset[disabled] .navbar-default .btn-link:focus {
+  color: #ccc;
+}
+.navbar-inverse {
+  background-color: #222;
+  border-color: #080808;
+}
+.navbar-inverse .navbar-brand {
+  color: #9d9d9d;
+}
+.navbar-inverse .navbar-brand:hover,
+.navbar-inverse .navbar-brand:focus {
+  color: #fff;
+  background-color: transparent;
+}
+.navbar-inverse .navbar-text {
+  color: #9d9d9d;
+}
+.navbar-inverse .navbar-nav > li > a {
+  color: #9d9d9d;
+}
+.navbar-inverse .navbar-nav > li > a:hover,
+.navbar-inverse .navbar-nav > li > a:focus {
+  color: #fff;
+  background-color: transparent;
+}
+.navbar-inverse .navbar-nav > .active > a,
+.navbar-inverse .navbar-nav > .active > a:hover,
+.navbar-inverse .navbar-nav > .active > a:focus {
+  color: #fff;
+  background-color: #080808;
+}
+.navbar-inverse .navbar-nav > .disabled > a,
+.navbar-inverse .navbar-nav > .disabled > a:hover,
+.navbar-inverse .navbar-nav > .disabled > a:focus {
+  color: #444;
+  background-color: transparent;
+}
+.navbar-inverse .navbar-toggle {
+  border-color: #333;
+}
+.navbar-inverse .navbar-toggle:hover,
+.navbar-inverse .navbar-toggle:focus {
+  background-color: #333;
+}
+.navbar-inverse .navbar-toggle .icon-bar {
+  background-color: #fff;
+}
+.navbar-inverse .navbar-collapse,
+.navbar-inverse .navbar-form {
+  border-color: #101010;
+}
+.navbar-inverse .navbar-nav > .open > a,
+.navbar-inverse .navbar-nav > .open > a:hover,
+.navbar-inverse .navbar-nav > .open > a:focus {
+  color: #fff;
+  background-color: #080808;
+}
+@media (max-width: 767px) {
+  .navbar-inverse .navbar-nav .open .dropdown-menu > .dropdown-header {
+    border-color: #080808;
+  }
+  .navbar-inverse .navbar-nav .open .dropdown-menu .divider {
+    background-color: #080808;
+  }
+  .navbar-inverse .navbar-nav .open .dropdown-menu > li > a {
+    color: #9d9d9d;
+  }
+  .navbar-inverse .navbar-nav .open .dropdown-menu > li > a:hover,
+  .navbar-inverse .navbar-nav .open .dropdown-menu > li > a:focus {
+    color: #fff;
+    background-color: transparent;
+  }
+  .navbar-inverse .navbar-nav .open .dropdown-menu > .active > a,
+  .navbar-inverse .navbar-nav .open .dropdown-menu > .active > a:hover,
+  .navbar-inverse .navbar-nav .open .dropdown-menu > .active > a:focus {
+    color: #fff;
+    background-color: #080808;
+  }
+  .navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a,
+  .navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a:hover,
+  .navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a:focus {
+    color: #444;
+    background-color: transparent;
+  }
+}
+.navbar-inverse .navbar-link {
+  color: #9d9d9d;
+}
+.navbar-inverse .navbar-link:hover {
+  color: #fff;
+}
+.navbar-inverse .btn-link {
+  color: #9d9d9d;
+}
+.navbar-inverse .btn-link:hover,
+.navbar-inverse .btn-link:focus {
+  color: #fff;
+}
+.navbar-inverse .btn-link[disabled]:hover,
+fieldset[disabled] .navbar-inverse .btn-link:hover,
+.navbar-inverse .btn-link[disabled]:focus,
+fieldset[disabled] .navbar-inverse .btn-link:focus {
+  color: #444;
+}
+.breadcrumb {
+  padding: 8px 15px;
+  margin-bottom: 20px;
+  list-style: none;
+  background-color: #f5f5f5;
+  border-radius: 4px;
+}
+.breadcrumb > li {
+  display: inline-block;
+}
+.breadcrumb > li + li:before {
+  padding: 0 5px;
+  color: #ccc;
+  content: "/\00a0";
+}
+.breadcrumb > .active {
+  color: #777;
+}
+.pagination {
+  display: inline-block;
+  padding-left: 0;
+  margin: 20px 0;
+  border-radius: 4px;
+}
+.pagination > li {
+  display: inline;
+}
+.pagination > li > a,
+.pagination > li > span {
+  position: relative;
+  float: left;
+  padding: 6px 12px;
+  margin-left: -1px;
+  line-height: 1.42857143;
+  color: #337ab7;
+  text-decoration: none;
+  background-color: #fff;
+  border: 1px solid #ddd;
+}
+.pagination > li:first-child > a,
+.pagination > li:first-child > span {
+  margin-left: 0;
+  border-top-left-radius: 4px;
+  border-bottom-left-radius: 4px;
+}
+.pagination > li:last-child > a,
+.pagination > li:last-child > span {
+  border-top-right-radius: 4px;
+  border-bottom-right-radius: 4px;
+}
+.pagination > li > a:hover,
+.pagination > li > span:hover,
+.pagination > li > a:focus,
+.pagination > li > span:focus {
+  z-index: 2;
+  color: #23527c;
+  background-color: #eee;
+  border-color: #ddd;
+}
+.pagination > .active > a,
+.pagination > .active > span,
+.pagination > .active > a:hover,
+.pagination > .active > span:hover,
+.pagination > .active > a:focus,
+.pagination > .active > span:focus {
+  z-index: 3;
+  color: #fff;
+  cursor: default;
+  background-color: #337ab7;
+  border-color: #337ab7;
+}
+.pagination > .disabled > span,
+.pagination > .disabled > span:hover,
+.pagination > .disabled > span:focus,
+.pagination > .disabled > a,
+.pagination > .disabled > a:hover,
+.pagination > .disabled > a:focus {
+  color: #777;
+  cursor: not-allowed;
+  background-color: #fff;
+  border-color: #ddd;
+}
+.pagination-lg > li > a,
+.pagination-lg > li > span {
+  padding: 10px 16px;
+  font-size: 18px;
+  line-height: 1.3333333;
+}
+.pagination-lg > li:first-child > a,
+.pagination-lg > li:first-child > span {
+  border-top-left-radius: 6px;
+  border-bottom-left-radius: 6px;
+}
+.pagination-lg > li:last-child > a,
+.pagination-lg > li:last-child > span {
+  border-top-right-radius: 6px;
+  border-bottom-right-radius: 6px;
+}
+.pagination-sm > li > a,
+.pagination-sm > li > span {
+  padding: 5px 10px;
+  font-size: 12px;
+  line-height: 1.5;
+}
+.pagination-sm > li:first-child > a,
+.pagination-sm > li:first-child > span {
+  border-top-left-radius: 3px;
+  border-bottom-left-radius: 3px;
+}
+.pagination-sm > li:last-child > a,
+.pagination-sm > li:last-child > span {
+  border-top-right-radius: 3px;
+  border-bottom-right-radius: 3px;
+}
+.pager {
+  padding-left: 0;
+  margin: 20px 0;
+  text-align: center;
+  list-style: none;
+}
+.pager li {
+  display: inline;
+}
+.pager li > a,
+.pager li > span {
+  display: inline-block;
+  padding: 5px 14px;
+  background-color: #fff;
+  border: 1px solid #ddd;
+  border-radius: 15px;
+}
+.pager li > a:hover,
+.pager li > a:focus {
+  text-decoration: none;
+  background-color: #eee;
+}
+.pager .next > a,
+.pager .next > span {
+  float: right;
+}
+.pager .previous > a,
+.pager .previous > span {
+  float: left;
+}
+.pager .disabled > a,
+.pager .disabled > a:hover,
+.pager .disabled > a:focus,
+.pager .disabled > span {
+  color: #777;
+  cursor: not-allowed;
+  background-color: #fff;
+}
+.label {
+  display: inline;
+  padding: .2em .6em .3em;
+  font-size: 75%;
+  font-weight: bold;
+  line-height: 1;
+  color: #fff;
+  text-align: center;
+  white-space: nowrap;
+  vertical-align: baseline;
+  border-radius: .25em;
+}
+a.label:hover,
+a.label:focus {
+  color: #fff;
+  text-decoration: none;
+  cursor: pointer;
+}
+.label:empty {
+  display: none;
+}
+.btn .label {
+  position: relative;
+  top: -1px;
+}
+.label-default {
+  background-color: #777;
+}
+.label-default[href]:hover,
+.label-default[href]:focus {
+  background-color: #5e5e5e;
+}
+.label-primary {
+  background-color: #337ab7;
+}
+.label-primary[href]:hover,
+.label-primary[href]:focus {
+  background-color: #286090;
+}
+.label-success {
+  background-color: #5cb85c;
+}
+.label-success[href]:hover,
+.label-success[href]:focus {
+  background-color: #449d44;
+}
+.label-info {
+  background-color: #5bc0de;
+}
+.label-info[href]:hover,
+.label-info[href]:focus {
+  background-color: #31b0d5;
+}
+.label-warning {
+  background-color: #f0ad4e;
+}
+.label-warning[href]:hover,
+.label-warning[href]:focus {
+  background-color: #ec971f;
+}
+.label-danger {
+  background-color: #d9534f;
+}
+.label-danger[href]:hover,
+.label-danger[href]:focus {
+  background-color: #c9302c;
+}
+.badge {
+  display: inline-block;
+  min-width: 10px;
+  padding: 3px 7px;
+  font-size: 12px;
+  font-weight: bold;
+  line-height: 1;
+  color: #fff;
+  text-align: center;
+  white-space: nowrap;
+  vertical-align: middle;
+  background-color: #777;
+  border-radius: 10px;
+}
+.badge:empty {
+  display: none;
+}
+.btn .badge {
+  position: relative;
+  top: -1px;
+}
+.btn-xs .badge,
+.btn-group-xs > .btn .badge {
+  top: 0;
+  padding: 1px 5px;
+}
+a.badge:hover,
+a.badge:focus {
+  color: #fff;
+  text-decoration: none;
+  cursor: pointer;
+}
+.list-group-item.active > .badge,
+.nav-pills > .active > a > .badge {
+  color: #337ab7;
+  background-color: #fff;
+}
+.list-group-item > .badge {
+  float: right;
+}
+.list-group-item > .badge + .badge {
+  margin-right: 5px;
+}
+.nav-pills > li > a > .badge {
+  margin-left: 3px;
+}
+.jumbotron {
+  padding-top: 30px;
+  padding-bottom: 30px;
+  margin-bottom: 30px;
+  color: inherit;
+  background-color: #eee;
+}
+.jumbotron h1,
+.jumbotron .h1 {
+  color: inherit;
+}
+.jumbotron p {
+  margin-bottom: 15px;
+  font-size: 21px;
+  font-weight: 200;
+}
+.jumbotron > hr {
+  border-top-color: #d5d5d5;
+}
+.container .jumbotron,
+.container-fluid .jumbotron {
+  padding-right: 15px;
+  padding-left: 15px;
+  border-radius: 6px;
+}
+.jumbotron .container {
+  max-width: 100%;
+}
+@media screen and (min-width: 768px) {
+  .jumbotron {
+    padding-top: 48px;
+    padding-bottom: 48px;
+  }
+  .container .jumbotron,
+  .container-fluid .jumbotron {
+    padding-right: 60px;
+    padding-left: 60px;
+  }
+  .jumbotron h1,
+  .jumbotron .h1 {
+    font-size: 63px;
+  }
+}
+.thumbnail {
+  display: block;
+  padding: 4px;
+  margin-bottom: 20px;
+  line-height: 1.42857143;
+  background-color: #fff;
+  border: 1px solid #ddd;
+  border-radius: 4px;
+  -webkit-transition: border .2s ease-in-out;
+       -o-transition: border .2s ease-in-out;
+          transition: border .2s ease-in-out;
+}
+.thumbnail > img,
+.thumbnail a > img {
+  margin-right: auto;
+  margin-left: auto;
+}
+a.thumbnail:hover,
+a.thumbnail:focus,
+a.thumbnail.active {
+  border-color: #337ab7;
+}
+.thumbnail .caption {
+  padding: 9px;
+  color: #333;
+}
+.alert {
+  padding: 15px;
+  margin-bottom: 20px;
+  border: 1px solid transparent;
+  border-radius: 4px;
+}
+.alert h4 {
+  margin-top: 0;
+  color: inherit;
+}
+.alert .alert-link {
+  font-weight: bold;
+}
+.alert > p,
+.alert > ul {
+  margin-bottom: 0;
+}
+.alert > p + p {
+  margin-top: 5px;
+}
+.alert-dismissable,
+.alert-dismissible {
+  padding-right: 35px;
+}
+.alert-dismissable .close,
+.alert-dismissible .close {
+  position: relative;
+  top: -2px;
+  right: -21px;
+  color: inherit;
+}
+.alert-success {
+  color: #3c763d;
+  background-color: #dff0d8;
+  border-color: #d6e9c6;
+}
+.alert-success hr {
+  border-top-color: #c9e2b3;
+}
+.alert-success .alert-link {
+  color: #2b542c;
+}
+.alert-info {
+  color: #31708f;
+  background-color: #d9edf7;
+  border-color: #bce8f1;
+}
+.alert-info hr {
+  border-top-color: #a6e1ec;
+}
+.alert-info .alert-link {
+  color: #245269;
+}
+.alert-warning {
+  color: #8a6d3b;
+  background-color: #fcf8e3;
+  border-color: #faebcc;
+}
+.alert-warning hr {
+  border-top-color: #f7e1b5;
+}
+.alert-warning .alert-link {
+  color: #66512c;
+}
+.alert-danger {
+  color: #a94442;
+  background-color: #f2dede;
+  border-color: #ebccd1;
+}
+.alert-danger hr {
+  border-top-color: #e4b9c0;
+}
+.alert-danger .alert-link {
+  color: #843534;
+}
+@-webkit-keyframes progress-bar-stripes {
+  from {
+    background-position: 40px 0;
+  }
+  to {
+    background-position: 0 0;
+  }
+}
+@-o-keyframes progress-bar-stripes {
+  from {
+    background-position: 40px 0;
+  }
+  to {
+    background-position: 0 0;
+  }
+}
+@keyframes progress-bar-stripes {
+  from {
+    background-position: 40px 0;
+  }
+  to {
+    background-position: 0 0;
+  }
+}
+.progress {
+  height: 20px;
+  margin-bottom: 20px;
+  overflow: hidden;
+  background-color: #f5f5f5;
+  border-radius: 4px;
+  -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, .1);
+          box-shadow: inset 0 1px 2px rgba(0, 0, 0, .1);
+}
+.progress-bar {
+  float: left;
+  width: 0;
+  height: 100%;
+  font-size: 12px;
+  line-height: 20px;
+  color: #fff;
+  text-align: center;
+  background-color: #337ab7;
+  -webkit-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, .15);
+          box-shadow: inset 0 -1px 0 rgba(0, 0, 0, .15);
+  -webkit-transition: width .6s ease;
+       -o-transition: width .6s ease;
+          transition: width .6s ease;
+}
+.progress-striped .progress-bar,
+.progress-bar-striped {
+  background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:      -o-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:         linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  -webkit-background-size: 40px 40px;
+          background-size: 40px 40px;
+}
+.progress.active .progress-bar,
+.progress-bar.active {
+  -webkit-animation: progress-bar-stripes 2s linear infinite;
+       -o-animation: progress-bar-stripes 2s linear infinite;
+          animation: progress-bar-stripes 2s linear infinite;
+}
+.progress-bar-success {
+  background-color: #5cb85c;
+}
+.progress-striped .progress-bar-success {
+  background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:      -o-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:         linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+}
+.progress-bar-info {
+  background-color: #5bc0de;
+}
+.progress-striped .progress-bar-info {
+  background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:      -o-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:         linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+}
+.progress-bar-warning {
+  background-color: #f0ad4e;
+}
+.progress-striped .progress-bar-warning {
+  background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:      -o-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:         linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+}
+.progress-bar-danger {
+  background-color: #d9534f;
+}
+.progress-striped .progress-bar-danger {
+  background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:      -o-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+  background-image:         linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent);
+}
+.media {
+  margin-top: 15px;
+}
+.media:first-child {
+  margin-top: 0;
+}
+.media,
+.media-body {
+  overflow: hidden;
+  zoom: 1;
+}
+.media-body {
+  width: 10000px;
+}
+.media-object {
+  display: block;
+}
+.media-object.img-thumbnail {
+  max-width: none;
+}
+.media-right,
+.media > .pull-right {
+  padding-left: 10px;
+}
+.media-left,
+.media > .pull-left {
+  padding-right: 10px;
+}
+.media-left,
+.media-right,
+.media-body {
+  display: table-cell;
+  vertical-align: top;
+}
+.media-middle {
+  vertical-align: middle;
+}
+.media-bottom {
+  vertical-align: bottom;
+}
+.media-heading {
+  margin-top: 0;
+  margin-bottom: 5px;
+}
+.media-list {
+  padding-left: 0;
+  list-style: none;
+}
+.list-group {
+  padding-left: 0;
+  margin-bottom: 20px;
+}
+.list-group-item {
+  position: relative;
+  display: block;
+  padding: 10px 15px;
+  margin-bottom: -1px;
+  background-color: #fff;
+  border: 1px solid #ddd;
+}
+.list-group-item:first-child {
+  border-top-left-radius: 4px;
+  border-top-right-radius: 4px;
+}
+.list-group-item:last-child {
+  margin-bottom: 0;
+  border-bottom-right-radius: 4px;
+  border-bottom-left-radius: 4px;
+}
+a.list-group-item,
+button.list-group-item {
+  color: #555;
+}
+a.list-group-item .list-group-item-heading,
+button.list-group-item .list-group-item-heading {
+  color: #333;
+}
+a.list-group-item:hover,
+button.list-group-item:hover,
+a.list-group-item:focus,
+button.list-group-item:focus {
+  color: #555;
+  text-decoration: none;
+  background-color: #f5f5f5;
+}
+button.list-group-item {
+  width: 100%;
+  text-align: left;
+}
+.list-group-item.disabled,
+.list-group-item.disabled:hover,
+.list-group-item.disabled:focus {
+  color: #777;
+  cursor: not-allowed;
+  background-color: #eee;
+}
+.list-group-item.disabled .list-group-item-heading,
+.list-group-item.disabled:hover .list-group-item-heading,
+.list-group-item.disabled:focus .list-group-item-heading {
+  color: inherit;
+}
+.list-group-item.disabled .list-group-item-text,
+.list-group-item.disabled:hover .list-group-item-text,
+.list-group-item.disabled:focus .list-group-item-text {
+  color: #777;
+}
+.list-group-item.active,
+.list-group-item.active:hover,
+.list-group-item.active:focus {
+  z-index: 2;
+  color: #fff;
+  background-color: #337ab7;
+  border-color: #337ab7;
+}
+.list-group-item.active .list-group-item-heading,
+.list-group-item.active:hover .list-group-item-heading,
+.list-group-item.active:focus .list-group-item-heading,
+.list-group-item.active .list-group-item-heading > small,
+.list-group-item.active:hover .list-group-item-heading > small,
+.list-group-item.active:focus .list-group-item-heading > small,
+.list-group-item.active .list-group-item-heading > .small,
+.list-group-item.active:hover .list-group-item-heading > .small,
+.list-group-item.active:focus .list-group-item-heading > .small {
+  color: inherit;
+}
+.list-group-item.active .list-group-item-text,
+.list-group-item.active:hover .list-group-item-text,
+.list-group-item.active:focus .list-group-item-text {
+  color: #c7ddef;
+}
+.list-group-item-success {
+  color: #3c763d;
+  background-color: #dff0d8;
+}
+a.list-group-item-success,
+button.list-group-item-success {
+  color: #3c763d;
+}
+a.list-group-item-success .list-group-item-heading,
+button.list-group-item-success .list-group-item-heading {
+  color: inherit;
+}
+a.list-group-item-success:hover,
+button.list-group-item-success:hover,
+a.list-group-item-success:focus,
+button.list-group-item-success:focus {
+  color: #3c763d;
+  background-color: #d0e9c6;
+}
+a.list-group-item-success.active,
+button.list-group-item-success.active,
+a.list-group-item-success.active:hover,
+button.list-group-item-success.active:hover,
+a.list-group-item-success.active:focus,
+button.list-group-item-success.active:focus {
+  color: #fff;
+  background-color: #3c763d;
+  border-color: #3c763d;
+}
+.list-group-item-info {
+  color: #31708f;
+  background-color: #d9edf7;
+}
+a.list-group-item-info,
+button.list-group-item-info {
+  color: #31708f;
+}
+a.list-group-item-info .list-group-item-heading,
+button.list-group-item-info .list-group-item-heading {
+  color: inherit;
+}
+a.list-group-item-info:hover,
+button.list-group-item-info:hover,
+a.list-group-item-info:focus,
+button.list-group-item-info:focus {
+  color: #31708f;
+  background-color: #c4e3f3;
+}
+a.list-group-item-info.active,
+button.list-group-item-info.active,
+a.list-group-item-info.active:hover,
+button.list-group-item-info.active:hover,
+a.list-group-item-info.active:focus,
+button.list-group-item-info.active:focus {
+  color: #fff;
+  background-color: #31708f;
+  border-color: #31708f;
+}
+.list-group-item-warning {
+  color: #8a6d3b;
+  background-color: #fcf8e3;
+}
+a.list-group-item-warning,
+button.list-group-item-warning {
+  color: #8a6d3b;
+}
+a.list-group-item-warning .list-group-item-heading,
+button.list-group-item-warning .list-group-item-heading {
+  color: inherit;
+}
+a.list-group-item-warning:hover,
+button.list-group-item-warning:hover,
+a.list-group-item-warning:focus,
+button.list-group-item-warning:focus {
+  color: #8a6d3b;
+  background-color: #faf2cc;
+}
+a.list-group-item-warning.active,
+button.list-group-item-warning.active,
+a.list-group-item-warning.active:hover,
+button.list-group-item-warning.active:hover,
+a.list-group-item-warning.active:focus,
+button.list-group-item-warning.active:focus {
+  color: #fff;
+  background-color: #8a6d3b;
+  border-color: #8a6d3b;
+}
+.list-group-item-danger {
+  color: #a94442;
+  background-color: #f2dede;
+}
+a.list-group-item-danger,
+button.list-group-item-danger {
+  color: #a94442;
+}
+a.list-group-item-danger .list-group-item-heading,
+button.list-group-item-danger .list-group-item-heading {
+  color: inherit;
+}
+a.list-group-item-danger:hover,
+button.list-group-item-danger:hover,
+a.list-group-item-danger:focus,
+button.list-group-item-danger:focus {
+  color: #a94442;
+  background-color: #ebcccc;
+}
+a.list-group-item-danger.active,
+button.list-group-item-danger.active,
+a.list-group-item-danger.active:hover,
+button.list-group-item-danger.active:hover,
+a.list-group-item-danger.active:focus,
+button.list-group-item-danger.active:focus {
+  color: #fff;
+  background-color: #a94442;
+  border-color: #a94442;
+}
+.list-group-item-heading {
+  margin-top: 0;
+  margin-bottom: 5px;
+}
+.list-group-item-text {
+  margin-bottom: 0;
+  line-height: 1.3;
+}
+.panel {
+  margin-bottom: 20px;
+  background-color: #fff;
+  border: 1px solid transparent;
+  border-radius: 4px;
+  -webkit-box-shadow: 0 1px 1px rgba(0, 0, 0, .05);
+          box-shadow: 0 1px 1px rgba(0, 0, 0, .05);
+}
+.panel-body {
+  padding: 15px;
+}
+.panel-heading {
+  padding: 10px 15px;
+  border-bottom: 1px solid transparent;
+  border-top-left-radius: 3px;
+  border-top-right-radius: 3px;
+}
+.panel-heading > .dropdown .dropdown-toggle {
+  color: inherit;
+}
+.panel-title {
+  margin-top: 0;
+  margin-bottom: 0;
+  font-size: 16px;
+  color: inherit;
+}
+.panel-title > a,
+.panel-title > small,
+.panel-title > .small,
+.panel-title > small > a,
+.panel-title > .small > a {
+  color: inherit;
+}
+.panel-footer {
+  padding: 10px 15px;
+  background-color: #f5f5f5;
+  border-top: 1px solid #ddd;
+  border-bottom-right-radius: 3px;
+  border-bottom-left-radius: 3px;
+}
+.panel > .list-group,
+.panel > .panel-collapse > .list-group {
+  margin-bottom: 0;
+}
+.panel > .list-group .list-group-item,
+.panel > .panel-collapse > .list-group .list-group-item {
+  border-width: 1px 0;
+  border-radius: 0;
+}
+.panel > .list-group:first-child .list-group-item:first-child,
+.panel > .panel-collapse > .list-group:first-child .list-group-item:first-child {
+  border-top: 0;
+  border-top-left-radius: 3px;
+  border-top-right-radius: 3px;
+}
+.panel > .list-group:last-child .list-group-item:last-child,
+.panel > .panel-collapse > .list-group:last-child .list-group-item:last-child {
+  border-bottom: 0;
+  border-bottom-right-radius: 3px;
+  border-bottom-left-radius: 3px;
+}
+.panel > .panel-heading + .panel-collapse > .list-group .list-group-item:first-child {
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+.panel-heading + .list-group .list-group-item:first-child {
+  border-top-width: 0;
+}
+.list-group + .panel-footer {
+  border-top-width: 0;
+}
+.panel > .table,
+.panel > .table-responsive > .table,
+.panel > .panel-collapse > .table {
+  margin-bottom: 0;
+}
+.panel > .table caption,
+.panel > .table-responsive > .table caption,
+.panel > .panel-collapse > .table caption {
+  padding-right: 15px;
+  padding-left: 15px;
+}
+.panel > .table:first-child,
+.panel > .table-responsive:first-child > .table:first-child {
+  border-top-left-radius: 3px;
+  border-top-right-radius: 3px;
+}
+.panel > .table:first-child > thead:first-child > tr:first-child,
+.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child,
+.panel > .table:first-child > tbody:first-child > tr:first-child,
+.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child {
+  border-top-left-radius: 3px;
+  border-top-right-radius: 3px;
+}
+.panel > .table:first-child > thead:first-child > tr:first-child td:first-child,
+.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child td:first-child,
+.panel > .table:first-child > tbody:first-child > tr:first-child td:first-child,
+.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child td:first-child,
+.panel > .table:first-child > thead:first-child > tr:first-child th:first-child,
+.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child th:first-child,
+.panel > .table:first-child > tbody:first-child > tr:first-child th:first-child,
+.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child th:first-child {
+  border-top-left-radius: 3px;
+}
+.panel > .table:first-child > thead:first-child > tr:first-child td:last-child,
+.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child td:last-child,
+.panel > .table:first-child > tbody:first-child > tr:first-child td:last-child,
+.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child td:last-child,
+.panel > .table:first-child > thead:first-child > tr:first-child th:last-child,
+.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child th:last-child,
+.panel > .table:first-child > tbody:first-child > tr:first-child th:last-child,
+.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child th:last-child {
+  border-top-right-radius: 3px;
+}
+.panel > .table:last-child,
+.panel > .table-responsive:last-child > .table:last-child {
+  border-bottom-right-radius: 3px;
+  border-bottom-left-radius: 3px;
+}
+.panel > .table:last-child > tbody:last-child > tr:last-child,
+.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child,
+.panel > .table:last-child > tfoot:last-child > tr:last-child,
+.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child {
+  border-bottom-right-radius: 3px;
+  border-bottom-left-radius: 3px;
+}
+.panel > .table:last-child > tbody:last-child > tr:last-child td:first-child,
+.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child td:first-child,
+.panel > .table:last-child > tfoot:last-child > tr:last-child td:first-child,
+.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child td:first-child,
+.panel > .table:last-child > tbody:last-child > tr:last-child th:first-child,
+.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child th:first-child,
+.panel > .table:last-child > tfoot:last-child > tr:last-child th:first-child,
+.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child th:first-child {
+  border-bottom-left-radius: 3px;
+}
+.panel > .table:last-child > tbody:last-child > tr:last-child td:last-child,
+.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child td:last-child,
+.panel > .table:last-child > tfoot:last-child > tr:last-child td:last-child,
+.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child td:last-child,
+.panel > .table:last-child > tbody:last-child > tr:last-child th:last-child,
+.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child th:last-child,
+.panel > .table:last-child > tfoot:last-child > tr:last-child th:last-child,
+.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child th:last-child {
+  border-bottom-right-radius: 3px;
+}
+.panel > .panel-body + .table,
+.panel > .panel-body + .table-responsive,
+.panel > .table + .panel-body,
+.panel > .table-responsive + .panel-body {
+  border-top: 1px solid #ddd;
+}
+.panel > .table > tbody:first-child > tr:first-child th,
+.panel > .table > tbody:first-child > tr:first-child td {
+  border-top: 0;
+}
+.panel > .table-bordered,
+.panel > .table-responsive > .table-bordered {
+  border: 0;
+}
+.panel > .table-bordered > thead > tr > th:first-child,
+.panel > .table-responsive > .table-bordered > thead > tr > th:first-child,
+.panel > .table-bordered > tbody > tr > th:first-child,
+.panel > .table-responsive > .table-bordered > tbody > tr > th:first-child,
+.panel > .table-bordered > tfoot > tr > th:first-child,
+.panel > .table-responsive > .table-bordered > tfoot > tr > th:first-child,
+.panel > .table-bordered > thead > tr > td:first-child,
+.panel > .table-responsive > .table-bordered > thead > tr > td:first-child,
+.panel > .table-bordered > tbody > tr > td:first-child,
+.panel > .table-responsive > .table-bordered > tbody > tr > td:first-child,
+.panel > .table-bordered > tfoot > tr > td:first-child,
+.panel > .table-responsive > .table-bordered > tfoot > tr > td:first-child {
+  border-left: 0;
+}
+.panel > .table-bordered > thead > tr > th:last-child,
+.panel > .table-responsive > .table-bordered > thead > tr > th:last-child,
+.panel > .table-bordered > tbody > tr > th:last-child,
+.panel > .table-responsive > .table-bordered > tbody > tr > th:last-child,
+.panel > .table-bordered > tfoot > tr > th:last-child,
+.panel > .table-responsive > .table-bordered > tfoot > tr > th:last-child,
+.panel > .table-bordered > thead > tr > td:last-child,
+.panel > .table-responsive > .table-bordered > thead > tr > td:last-child,
+.panel > .table-bordered > tbody > tr > td:last-child,
+.panel > .table-responsive > .table-bordered > tbody > tr > td:last-child,
+.panel > .table-bordered > tfoot > tr > td:last-child,
+.panel > .table-responsive > .table-bordered > tfoot > tr > td:last-child {
+  border-right: 0;
+}
+.panel > .table-bordered > thead > tr:first-child > td,
+.panel > .table-responsive > .table-bordered > thead > tr:first-child > td,
+.panel > .table-bordered > tbody > tr:first-child > td,
+.panel > .table-responsive > .table-bordered > tbody > tr:first-child > td,
+.panel > .table-bordered > thead > tr:first-child > th,
+.panel > .table-responsive > .table-bordered > thead > tr:first-child > th,
+.panel > .table-bordered > tbody > tr:first-child > th,
+.panel > .table-responsive > .table-bordered > tbody > tr:first-child > th {
+  border-bottom: 0;
+}
+.panel > .table-bordered > tbody > tr:last-child > td,
+.panel > .table-responsive > .table-bordered > tbody > tr:last-child > td,
+.panel > .table-bordered > tfoot > tr:last-child > td,
+.panel > .table-responsive > .table-bordered > tfoot > tr:last-child > td,
+.panel > .table-bordered > tbody > tr:last-child > th,
+.panel > .table-responsive > .table-bordered > tbody > tr:last-child > th,
+.panel > .table-bordered > tfoot > tr:last-child > th,
+.panel > .table-responsive > .table-bordered > tfoot > tr:last-child > th {
+  border-bottom: 0;
+}
+.panel > .table-responsive {
+  margin-bottom: 0;
+  border: 0;
+}
+.panel-group {
+  margin-bottom: 20px;
+}
+.panel-group .panel {
+  margin-bottom: 0;
+  border-radius: 4px;
+}
+.panel-group .panel + .panel {
+  margin-top: 5px;
+}
+.panel-group .panel-heading {
+  border-bottom: 0;
+}
+.panel-group .panel-heading + .panel-collapse > .panel-body,
+.panel-group .panel-heading + .panel-collapse > .list-group {
+  border-top: 1px solid #ddd;
+}
+.panel-group .panel-footer {
+  border-top: 0;
+}
+.panel-group .panel-footer + .panel-collapse .panel-body {
+  border-bottom: 1px solid #ddd;
+}
+.panel-default {
+  border-color: #ddd;
+}
+.panel-default > .panel-heading {
+  color: #333;
+  background-color: #f5f5f5;
+  border-color: #ddd;
+}
+.panel-default > .panel-heading + .panel-collapse > .panel-body {
+  border-top-color: #ddd;
+}
+.panel-default > .panel-heading .badge {
+  color: #f5f5f5;
+  background-color: #333;
+}
+.panel-default > .panel-footer + .panel-collapse > .panel-body {
+  border-bottom-color: #ddd;
+}
+.panel-primary {
+  border-color: #337ab7;
+}
+.panel-primary > .panel-heading {
+  color: #fff;
+  background-color: #337ab7;
+  border-color: #337ab7;
+}
+.panel-primary > .panel-heading + .panel-collapse > .panel-body {
+  border-top-color: #337ab7;
+}
+.panel-primary > .panel-heading .badge {
+  color: #337ab7;
+  background-color: #fff;
+}
+.panel-primary > .panel-footer + .panel-collapse > .panel-body {
+  border-bottom-color: #337ab7;
+}
+.panel-success {
+  border-color: #d6e9c6;
+}
+.panel-success > .panel-heading {
+  color: #3c763d;
+  background-color: #dff0d8;
+  border-color: #d6e9c6;
+}
+.panel-success > .panel-heading + .panel-collapse > .panel-body {
+  border-top-color: #d6e9c6;
+}
+.panel-success > .panel-heading .badge {
+  color: #dff0d8;
+  background-color: #3c763d;
+}
+.panel-success > .panel-footer + .panel-collapse > .panel-body {
+  border-bottom-color: #d6e9c6;
+}
+.panel-info {
+  border-color: #bce8f1;
+}
+.panel-info > .panel-heading {
+  color: #31708f;
+  background-color: #d9edf7;
+  border-color: #bce8f1;
+}
+.panel-info > .panel-heading + .panel-collapse > .panel-body {
+  border-top-color: #bce8f1;
+}
+.panel-info > .panel-heading .badge {
+  color: #d9edf7;
+  background-color: #31708f;
+}
+.panel-info > .panel-footer + .panel-collapse > .panel-body {
+  border-bottom-color: #bce8f1;
+}
+.panel-warning {
+  border-color: #faebcc;
+}
+.panel-warning > .panel-heading {
+  color: #8a6d3b;
+  background-color: #fcf8e3;
+  border-color: #faebcc;
+}
+.panel-warning > .panel-heading + .panel-collapse > .panel-body {
+  border-top-color: #faebcc;
+}
+.panel-warning > .panel-heading .badge {
+  color: #fcf8e3;
+  background-color: #8a6d3b;
+}
+.panel-warning > .panel-footer + .panel-collapse > .panel-body {
+  border-bottom-color: #faebcc;
+}
+.panel-danger {
+  border-color: #ebccd1;
+}
+.panel-danger > .panel-heading {
+  color: #a94442;
+  background-color: #f2dede;
+  border-color: #ebccd1;
+}
+.panel-danger > .panel-heading + .panel-collapse > .panel-body {
+  border-top-color: #ebccd1;
+}
+.panel-danger > .panel-heading .badge {
+  color: #f2dede;
+  background-color: #a94442;
+}
+.panel-danger > .panel-footer + .panel-collapse > .panel-body {
+  border-bottom-color: #ebccd1;
+}
+.embed-responsive {
+  position: relative;
+  display: block;
+  height: 0;
+  padding: 0;
+  overflow: hidden;
+}
+.embed-responsive .embed-responsive-item,
+.embed-responsive iframe,
+.embed-responsive embed,
+.embed-responsive object,
+.embed-responsive video {
+  position: absolute;
+  top: 0;
+  bottom: 0;
+  left: 0;
+  width: 100%;
+  height: 100%;
+  border: 0;
+}
+.embed-responsive-16by9 {
+  padding-bottom: 56.25%;
+}
+.embed-responsive-4by3 {
+  padding-bottom: 75%;
+}
+.well {
+  min-height: 20px;
+  padding: 19px;
+  margin-bottom: 20px;
+  background-color: #f5f5f5;
+  border: 1px solid #e3e3e3;
+  border-radius: 4px;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .05);
+          box-shadow: inset 0 1px 1px rgba(0, 0, 0, .05);
+}
+.well blockquote {
+  border-color: #ddd;
+  border-color: rgba(0, 0, 0, .15);
+}
+.well-lg {
+  padding: 24px;
+  border-radius: 6px;
+}
+.well-sm {
+  padding: 9px;
+  border-radius: 3px;
+}
+.close {
+  float: right;
+  font-size: 21px;
+  font-weight: bold;
+  line-height: 1;
+  color: #000;
+  text-shadow: 0 1px 0 #fff;
+  filter: alpha(opacity=20);
+  opacity: .2;
+}
+.close:hover,
+.close:focus {
+  color: #000;
+  text-decoration: none;
+  cursor: pointer;
+  filter: alpha(opacity=50);
+  opacity: .5;
+}
+button.close {
+  -webkit-appearance: none;
+  padding: 0;
+  cursor: pointer;
+  background: transparent;
+  border: 0;
+}
+.modal-open {
+  overflow: hidden;
+}
+.modal {
+  position: fixed;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 1050;
+  display: none;
+  overflow: hidden;
+  -webkit-overflow-scrolling: touch;
+  outline: 0;
+}
+.modal.fade .modal-dialog {
+  -webkit-transition: -webkit-transform .3s ease-out;
+       -o-transition:      -o-transform .3s ease-out;
+          transition:         transform .3s ease-out;
+  -webkit-transform: translate(0, -25%);
+      -ms-transform: translate(0, -25%);
+       -o-transform: translate(0, -25%);
+          transform: translate(0, -25%);
+}
+.modal.in .modal-dialog {
+  -webkit-transform: translate(0, 0);
+      -ms-transform: translate(0, 0);
+       -o-transform: translate(0, 0);
+          transform: translate(0, 0);
+}
+.modal-open .modal {
+  overflow-x: hidden;
+  overflow-y: auto;
+}
+.modal-dialog {
+  position: relative;
+  width: auto;
+  margin: 10px;
+}
+.modal-content {
+  position: relative;
+  background-color: #fff;
+  -webkit-background-clip: padding-box;
+          background-clip: padding-box;
+  border: 1px solid #999;
+  border: 1px solid rgba(0, 0, 0, .2);
+  border-radius: 6px;
+  outline: 0;
+  -webkit-box-shadow: 0 3px 9px rgba(0, 0, 0, .5);
+          box-shadow: 0 3px 9px rgba(0, 0, 0, .5);
+}
+.modal-backdrop {
+  position: fixed;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 1040;
+  background-color: #000;
+}
+.modal-backdrop.fade {
+  filter: alpha(opacity=0);
+  opacity: 0;
+}
+.modal-backdrop.in {
+  filter: alpha(opacity=50);
+  opacity: .5;
+}
+.modal-header {
+  padding: 15px;
+  border-bottom: 1px solid #e5e5e5;
+}
+.modal-header .close {
+  margin-top: -2px;
+}
+.modal-title {
+  margin: 0;
+  line-height: 1.42857143;
+}
+.modal-body {
+  position: relative;
+  padding: 15px;
+}
+.modal-footer {
+  padding: 15px;
+  text-align: right;
+  border-top: 1px solid #e5e5e5;
+}
+.modal-footer .btn + .btn {
+  margin-bottom: 0;
+  margin-left: 5px;
+}
+.modal-footer .btn-group .btn + .btn {
+  margin-left: -1px;
+}
+.modal-footer .btn-block + .btn-block {
+  margin-left: 0;
+}
+.modal-scrollbar-measure {
+  position: absolute;
+  top: -9999px;
+  width: 50px;
+  height: 50px;
+  overflow: scroll;
+}
+@media (min-width: 768px) {
+  .modal-dialog {
+    width: 600px;
+    margin: 30px auto;
+  }
+  .modal-content {
+    -webkit-box-shadow: 0 5px 15px rgba(0, 0, 0, .5);
+            box-shadow: 0 5px 15px rgba(0, 0, 0, .5);
+  }
+  .modal-sm {
+    width: 300px;
+  }
+}
+@media (min-width: 992px) {
+  .modal-lg {
+    width: 900px;
+  }
+}
+.tooltip {
+  position: absolute;
+  z-index: 1070;
+  display: block;
+  font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
+  font-size: 12px;
+  font-style: normal;
+  font-weight: normal;
+  line-height: 1.42857143;
+  text-align: left;
+  text-align: start;
+  text-decoration: none;
+  text-shadow: none;
+  text-transform: none;
+  letter-spacing: normal;
+  word-break: normal;
+  word-spacing: normal;
+  word-wrap: normal;
+  white-space: normal;
+  filter: alpha(opacity=0);
+  opacity: 0;
+
+  line-break: auto;
+}
+.tooltip.in {
+  filter: alpha(opacity=90);
+  opacity: .9;
+}
+.tooltip.top {
+  padding: 5px 0;
+  margin-top: -3px;
+}
+.tooltip.right {
+  padding: 0 5px;
+  margin-left: 3px;
+}
+.tooltip.bottom {
+  padding: 5px 0;
+  margin-top: 3px;
+}
+.tooltip.left {
+  padding: 0 5px;
+  margin-left: -3px;
+}
+.tooltip-inner {
+  max-width: 200px;
+  padding: 3px 8px;
+  color: #fff;
+  text-align: center;
+  background-color: #000;
+  border-radius: 4px;
+}
+.tooltip-arrow {
+  position: absolute;
+  width: 0;
+  height: 0;
+  border-color: transparent;
+  border-style: solid;
+}
+.tooltip.top .tooltip-arrow {
+  bottom: 0;
+  left: 50%;
+  margin-left: -5px;
+  border-width: 5px 5px 0;
+  border-top-color: #000;
+}
+.tooltip.top-left .tooltip-arrow {
+  right: 5px;
+  bottom: 0;
+  margin-bottom: -5px;
+  border-width: 5px 5px 0;
+  border-top-color: #000;
+}
+.tooltip.top-right .tooltip-arrow {
+  bottom: 0;
+  left: 5px;
+  margin-bottom: -5px;
+  border-width: 5px 5px 0;
+  border-top-color: #000;
+}
+.tooltip.right .tooltip-arrow {
+  top: 50%;
+  left: 0;
+  margin-top: -5px;
+  border-width: 5px 5px 5px 0;
+  border-right-color: #000;
+}
+.tooltip.left .tooltip-arrow {
+  top: 50%;
+  right: 0;
+  margin-top: -5px;
+  border-width: 5px 0 5px 5px;
+  border-left-color: #000;
+}
+.tooltip.bottom .tooltip-arrow {
+  top: 0;
+  left: 50%;
+  margin-left: -5px;
+  border-width: 0 5px 5px;
+  border-bottom-color: #000;
+}
+.tooltip.bottom-left .tooltip-arrow {
+  top: 0;
+  right: 5px;
+  margin-top: -5px;
+  border-width: 0 5px 5px;
+  border-bottom-color: #000;
+}
+.tooltip.bottom-right .tooltip-arrow {
+  top: 0;
+  left: 5px;
+  margin-top: -5px;
+  border-width: 0 5px 5px;
+  border-bottom-color: #000;
+}
+.popover {
+  position: absolute;
+  top: 0;
+  left: 0;
+  z-index: 1060;
+  display: none;
+  max-width: 276px;
+  padding: 1px;
+  font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
+  font-size: 14px;
+  font-style: normal;
+  font-weight: normal;
+  line-height: 1.42857143;
+  text-align: left;
+  text-align: start;
+  text-decoration: none;
+  text-shadow: none;
+  text-transform: none;
+  letter-spacing: normal;
+  word-break: normal;
+  word-spacing: normal;
+  word-wrap: normal;
+  white-space: normal;
+  background-color: #fff;
+  -webkit-background-clip: padding-box;
+          background-clip: padding-box;
+  border: 1px solid #ccc;
+  border: 1px solid rgba(0, 0, 0, .2);
+  border-radius: 6px;
+  -webkit-box-shadow: 0 5px 10px rgba(0, 0, 0, .2);
+          box-shadow: 0 5px 10px rgba(0, 0, 0, .2);
+
+  line-break: auto;
+}
+.popover.top {
+  margin-top: -10px;
+}
+.popover.right {
+  margin-left: 10px;
+}
+.popover.bottom {
+  margin-top: 10px;
+}
+.popover.left {
+  margin-left: -10px;
+}
+.popover-title {
+  padding: 8px 14px;
+  margin: 0;
+  font-size: 14px;
+  background-color: #f7f7f7;
+  border-bottom: 1px solid #ebebeb;
+  border-radius: 5px 5px 0 0;
+}
+.popover-content {
+  padding: 9px 14px;
+}
+.popover > .arrow,
+.popover > .arrow:after {
+  position: absolute;
+  display: block;
+  width: 0;
+  height: 0;
+  border-color: transparent;
+  border-style: solid;
+}
+.popover > .arrow {
+  border-width: 11px;
+}
+.popover > .arrow:after {
+  content: "";
+  border-width: 10px;
+}
+.popover.top > .arrow {
+  bottom: -11px;
+  left: 50%;
+  margin-left: -11px;
+  border-top-color: #999;
+  border-top-color: rgba(0, 0, 0, .25);
+  border-bottom-width: 0;
+}
+.popover.top > .arrow:after {
+  bottom: 1px;
+  margin-left: -10px;
+  content: " ";
+  border-top-color: #fff;
+  border-bottom-width: 0;
+}
+.popover.right > .arrow {
+  top: 50%;
+  left: -11px;
+  margin-top: -11px;
+  border-right-color: #999;
+  border-right-color: rgba(0, 0, 0, .25);
+  border-left-width: 0;
+}
+.popover.right > .arrow:after {
+  bottom: -10px;
+  left: 1px;
+  content: " ";
+  border-right-color: #fff;
+  border-left-width: 0;
+}
+.popover.bottom > .arrow {
+  top: -11px;
+  left: 50%;
+  margin-left: -11px;
+  border-top-width: 0;
+  border-bottom-color: #999;
+  border-bottom-color: rgba(0, 0, 0, .25);
+}
+.popover.bottom > .arrow:after {
+  top: 1px;
+  margin-left: -10px;
+  content: " ";
+  border-top-width: 0;
+  border-bottom-color: #fff;
+}
+.popover.left > .arrow {
+  top: 50%;
+  right: -11px;
+  margin-top: -11px;
+  border-right-width: 0;
+  border-left-color: #999;
+  border-left-color: rgba(0, 0, 0, .25);
+}
+.popover.left > .arrow:after {
+  right: 1px;
+  bottom: -10px;
+  content: " ";
+  border-right-width: 0;
+  border-left-color: #fff;
+}
+.carousel {
+  position: relative;
+}
+.carousel-inner {
+  position: relative;
+  width: 100%;
+  overflow: hidden;
+}
+.carousel-inner > .item {
+  position: relative;
+  display: none;
+  -webkit-transition: .6s ease-in-out left;
+       -o-transition: .6s ease-in-out left;
+          transition: .6s ease-in-out left;
+}
+.carousel-inner > .item > img,
+.carousel-inner > .item > a > img {
+  line-height: 1;
+}
+@media all and (transform-3d), (-webkit-transform-3d) {
+  .carousel-inner > .item {
+    -webkit-transition: -webkit-transform .6s ease-in-out;
+         -o-transition:      -o-transform .6s ease-in-out;
+            transition:         transform .6s ease-in-out;
+
+    -webkit-backface-visibility: hidden;
+            backface-visibility: hidden;
+    -webkit-perspective: 1000px;
+            perspective: 1000px;
+  }
+  .carousel-inner > .item.next,
+  .carousel-inner > .item.active.right {
+    left: 0;
+    -webkit-transform: translate3d(100%, 0, 0);
+            transform: translate3d(100%, 0, 0);
+  }
+  .carousel-inner > .item.prev,
+  .carousel-inner > .item.active.left {
+    left: 0;
+    -webkit-transform: translate3d(-100%, 0, 0);
+            transform: translate3d(-100%, 0, 0);
+  }
+  .carousel-inner > .item.next.left,
+  .carousel-inner > .item.prev.right,
+  .carousel-inner > .item.active {
+    left: 0;
+    -webkit-transform: translate3d(0, 0, 0);
+            transform: translate3d(0, 0, 0);
+  }
+}
+.carousel-inner > .active,
+.carousel-inner > .next,
+.carousel-inner > .prev {
+  display: block;
+}
+.carousel-inner > .active {
+  left: 0;
+}
+.carousel-inner > .next,
+.carousel-inner > .prev {
+  position: absolute;
+  top: 0;
+  width: 100%;
+}
+.carousel-inner > .next {
+  left: 100%;
+}
+.carousel-inner > .prev {
+  left: -100%;
+}
+.carousel-inner > .next.left,
+.carousel-inner > .prev.right {
+  left: 0;
+}
+.carousel-inner > .active.left {
+  left: -100%;
+}
+.carousel-inner > .active.right {
+  left: 100%;
+}
+.carousel-control {
+  position: absolute;
+  top: 0;
+  bottom: 0;
+  left: 0;
+  width: 15%;
+  font-size: 20px;
+  color: #fff;
+  text-align: center;
+  text-shadow: 0 1px 2px rgba(0, 0, 0, .6);
+  background-color: rgba(0, 0, 0, 0);
+  filter: alpha(opacity=50);
+  opacity: .5;
+}
+.carousel-control.left {
+  background-image: -webkit-linear-gradient(left, rgba(0, 0, 0, .5) 0%, rgba(0, 0, 0, .0001) 100%);
+  background-image:      -o-linear-gradient(left, rgba(0, 0, 0, .5) 0%, rgba(0, 0, 0, .0001) 100%);
+  background-image: -webkit-gradient(linear, left top, right top, from(rgba(0, 0, 0, .5)), to(rgba(0, 0, 0, .0001)));
+  background-image:         linear-gradient(to right, rgba(0, 0, 0, .5) 0%, rgba(0, 0, 0, .0001) 100%);
+  filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#80000000', endColorstr='#00000000', GradientType=1);
+  background-repeat: repeat-x;
+}
+.carousel-control.right {
+  right: 0;
+  left: auto;
+  background-image: -webkit-linear-gradient(left, rgba(0, 0, 0, .0001) 0%, rgba(0, 0, 0, .5) 100%);
+  background-image:      -o-linear-gradient(left, rgba(0, 0, 0, .0001) 0%, rgba(0, 0, 0, .5) 100%);
+  background-image: -webkit-gradient(linear, left top, right top, from(rgba(0, 0, 0, .0001)), to(rgba(0, 0, 0, .5)));
+  background-image:         linear-gradient(to right, rgba(0, 0, 0, .0001) 0%, rgba(0, 0, 0, .5) 100%);
+  filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#00000000', endColorstr='#80000000', GradientType=1);
+  background-repeat: repeat-x;
+}
+.carousel-control:hover,
+.carousel-control:focus {
+  color: #fff;
+  text-decoration: none;
+  filter: alpha(opacity=90);
+  outline: 0;
+  opacity: .9;
+}
+.carousel-control .icon-prev,
+.carousel-control .icon-next,
+.carousel-control .glyphicon-chevron-left,
+.carousel-control .glyphicon-chevron-right {
+  position: absolute;
+  top: 50%;
+  z-index: 5;
+  display: inline-block;
+  margin-top: -10px;
+}
+.carousel-control .icon-prev,
+.carousel-control .glyphicon-chevron-left {
+  left: 50%;
+  margin-left: -10px;
+}
+.carousel-control .icon-next,
+.carousel-control .glyphicon-chevron-right {
+  right: 50%;
+  margin-right: -10px;
+}
+.carousel-control .icon-prev,
+.carousel-control .icon-next {
+  width: 20px;
+  height: 20px;
+  font-family: serif;
+  line-height: 1;
+}
+.carousel-control .icon-prev:before {
+  content: '\2039';
+}
+.carousel-control .icon-next:before {
+  content: '\203a';
+}
+.carousel-indicators {
+  position: absolute;
+  bottom: 10px;
+  left: 50%;
+  z-index: 15;
+  width: 60%;
+  padding-left: 0;
+  margin-left: -30%;
+  text-align: center;
+  list-style: none;
+}
+.carousel-indicators li {
+  display: inline-block;
+  width: 10px;
+  height: 10px;
+  margin: 1px;
+  text-indent: -999px;
+  cursor: pointer;
+  background-color: #000 \9;
+  background-color: rgba(0, 0, 0, 0);
+  border: 1px solid #fff;
+  border-radius: 10px;
+}
+.carousel-indicators .active {
+  width: 12px;
+  height: 12px;
+  margin: 0;
+  background-color: #fff;
+}
+.carousel-caption {
+  position: absolute;
+  right: 15%;
+  bottom: 20px;
+  left: 15%;
+  z-index: 10;
+  padding-top: 20px;
+  padding-bottom: 20px;
+  color: #fff;
+  text-align: center;
+  text-shadow: 0 1px 2px rgba(0, 0, 0, .6);
+}
+.carousel-caption .btn {
+  text-shadow: none;
+}
+@media screen and (min-width: 768px) {
+  .carousel-control .glyphicon-chevron-left,
+  .carousel-control .glyphicon-chevron-right,
+  .carousel-control .icon-prev,
+  .carousel-control .icon-next {
+    width: 30px;
+    height: 30px;
+    margin-top: -10px;
+    font-size: 30px;
+  }
+  .carousel-control .glyphicon-chevron-left,
+  .carousel-control .icon-prev {
+    margin-left: -10px;
+  }
+  .carousel-control .glyphicon-chevron-right,
+  .carousel-control .icon-next {
+    margin-right: -10px;
+  }
+  .carousel-caption {
+    right: 20%;
+    left: 20%;
+    padding-bottom: 30px;
+  }
+  .carousel-indicators {
+    bottom: 20px;
+  }
+}
+.clearfix:before,
+.clearfix:after,
+.dl-horizontal dd:before,
+.dl-horizontal dd:after,
+.container:before,
+.container:after,
+.container-fluid:before,
+.container-fluid:after,
+.row:before,
+.row:after,
+.form-horizontal .form-group:before,
+.form-horizontal .form-group:after,
+.btn-toolbar:before,
+.btn-toolbar:after,
+.btn-group-vertical > .btn-group:before,
+.btn-group-vertical > .btn-group:after,
+.nav:before,
+.nav:after,
+.navbar:before,
+.navbar:after,
+.navbar-header:before,
+.navbar-header:after,
+.navbar-collapse:before,
+.navbar-collapse:after,
+.pager:before,
+.pager:after,
+.panel-body:before,
+.panel-body:after,
+.modal-header:before,
+.modal-header:after,
+.modal-footer:before,
+.modal-footer:after {
+  display: table;
+  content: " ";
+}
+.clearfix:after,
+.dl-horizontal dd:after,
+.container:after,
+.container-fluid:after,
+.row:after,
+.form-horizontal .form-group:after,
+.btn-toolbar:after,
+.btn-group-vertical > .btn-group:after,
+.nav:after,
+.navbar:after,
+.navbar-header:after,
+.navbar-collapse:after,
+.pager:after,
+.panel-body:after,
+.modal-header:after,
+.modal-footer:after {
+  clear: both;
+}
+.center-block {
+  display: block;
+  margin-right: auto;
+  margin-left: auto;
+}
+.pull-right {
+  float: right !important;
+}
+.pull-left {
+  float: left !important;
+}
+.hide {
+  display: none !important;
+}
+.show {
+  display: block !important;
+}
+.invisible {
+  visibility: hidden;
+}
+.text-hide {
+  font: 0/0 a;
+  color: transparent;
+  text-shadow: none;
+  background-color: transparent;
+  border: 0;
+}
+.hidden {
+  display: none !important;
+}
+.affix {
+  position: fixed;
+}
+@-ms-viewport {
+  width: device-width;
+}
+.visible-xs,
+.visible-sm,
+.visible-md,
+.visible-lg {
+  display: none !important;
+}
+.visible-xs-block,
+.visible-xs-inline,
+.visible-xs-inline-block,
+.visible-sm-block,
+.visible-sm-inline,
+.visible-sm-inline-block,
+.visible-md-block,
+.visible-md-inline,
+.visible-md-inline-block,
+.visible-lg-block,
+.visible-lg-inline,
+.visible-lg-inline-block {
+  display: none !important;
+}
+@media (max-width: 767px) {
+  .visible-xs {
+    display: block !important;
+  }
+  table.visible-xs {
+    display: table !important;
+  }
+  tr.visible-xs {
+    display: table-row !important;
+  }
+  th.visible-xs,
+  td.visible-xs {
+    display: table-cell !important;
+  }
+}
+@media (max-width: 767px) {
+  .visible-xs-block {
+    display: block !important;
+  }
+}
+@media (max-width: 767px) {
+  .visible-xs-inline {
+    display: inline !important;
+  }
+}
+@media (max-width: 767px) {
+  .visible-xs-inline-block {
+    display: inline-block !important;
+  }
+}
+@media (min-width: 768px) and (max-width: 991px) {
+  .visible-sm {
+    display: block !important;
+  }
+  table.visible-sm {
+    display: table !important;
+  }
+  tr.visible-sm {
+    display: table-row !important;
+  }
+  th.visible-sm,
+  td.visible-sm {
+    display: table-cell !important;
+  }
+}
+@media (min-width: 768px) and (max-width: 991px) {
+  .visible-sm-block {
+    display: block !important;
+  }
+}
+@media (min-width: 768px) and (max-width: 991px) {
+  .visible-sm-inline {
+    display: inline !important;
+  }
+}
+@media (min-width: 768px) and (max-width: 991px) {
+  .visible-sm-inline-block {
+    display: inline-block !important;
+  }
+}
+@media (min-width: 992px) and (max-width: 1199px) {
+  .visible-md {
+    display: block !important;
+  }
+  table.visible-md {
+    display: table !important;
+  }
+  tr.visible-md {
+    display: table-row !important;
+  }
+  th.visible-md,
+  td.visible-md {
+    display: table-cell !important;
+  }
+}
+@media (min-width: 992px) and (max-width: 1199px) {
+  .visible-md-block {
+    display: block !important;
+  }
+}
+@media (min-width: 992px) and (max-width: 1199px) {
+  .visible-md-inline {
+    display: inline !important;
+  }
+}
+@media (min-width: 992px) and (max-width: 1199px) {
+  .visible-md-inline-block {
+    display: inline-block !important;
+  }
+}
+@media (min-width: 1200px) {
+  .visible-lg {
+    display: block !important;
+  }
+  table.visible-lg {
+    display: table !important;
+  }
+  tr.visible-lg {
+    display: table-row !important;
+  }
+  th.visible-lg,
+  td.visible-lg {
+    display: table-cell !important;
+  }
+}
+@media (min-width: 1200px) {
+  .visible-lg-block {
+    display: block !important;
+  }
+}
+@media (min-width: 1200px) {
+  .visible-lg-inline {
+    display: inline !important;
+  }
+}
+@media (min-width: 1200px) {
+  .visible-lg-inline-block {
+    display: inline-block !important;
+  }
+}
+@media (max-width: 767px) {
+  .hidden-xs {
+    display: none !important;
+  }
+}
+@media (min-width: 768px) and (max-width: 991px) {
+  .hidden-sm {
+    display: none !important;
+  }
+}
+@media (min-width: 992px) and (max-width: 1199px) {
+  .hidden-md {
+    display: none !important;
+  }
+}
+@media (min-width: 1200px) {
+  .hidden-lg {
+    display: none !important;
+  }
+}
+.visible-print {
+  display: none !important;
+}
+@media print {
+  .visible-print {
+    display: block !important;
+  }
+  table.visible-print {
+    display: table !important;
+  }
+  tr.visible-print {
+    display: table-row !important;
+  }
+  th.visible-print,
+  td.visible-print {
+    display: table-cell !important;
+  }
+}
+.visible-print-block {
+  display: none !important;
+}
+@media print {
+  .visible-print-block {
+    display: block !important;
+  }
+}
+.visible-print-inline {
+  display: none !important;
+}
+@media print {
+  .visible-print-inline {
+    display: inline !important;
+  }
+}
+.visible-print-inline-block {
+  display: none !important;
+}
+@media print {
+  .visible-print-inline-block {
+    display: inline-block !important;
+  }
+}
+@media print {
+  .hidden-print {
+    display: none !important;
+  }
+}
+/*# sourceMappingURL=bootstrap.css.map */
diff --git a/VNF_Catalogue/public/stylesheets/project_profile.css b/VNF_Catalogue/public/stylesheets/project_profile.css
new file mode 100644
index 00000000..03527f08
--- /dev/null
+++ b/VNF_Catalogue/public/stylesheets/project_profile.css
@@ -0,0 +1,12 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+.container-custom {
+  max-width: 100% !important;
+}
diff --git a/VNF_Catalogue/public/stylesheets/search_form.css b/VNF_Catalogue/public/stylesheets/search_form.css
new file mode 100644
index 00000000..4598cffe
--- /dev/null
+++ b/VNF_Catalogue/public/stylesheets/search_form.css
@@ -0,0 +1,58 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+input.search-input-rest
+{
+  font-weight: 400;
+  margin: 0px 0;
+  height: 30px;
+  padding: 10px 30px;
+    min-width: 90%;
+    max-width: 90%;
+  /*max-width: 500px;
+  */
+  border-radius: 5px;
+  border: 2px solid #333333;
+  box-shadow: 0 0 15px 1px rgba(0,0,0,0.50);
+  color: #333333;
+  font-size: 22px;
+}
+.material-search-custom {
+  left : -30px;
+
+  padding-left: 10px;
+}
+.form-group-custom {
+  width : 400px;
+  position: relative;
+  float: right;
+  left: -40%;
+}
+.form-control-custom {
+  padding-top: 10px;
+  padding-left: 50px;
+}
+input[type="search"]:focus:not([readonly]) {
+  transition: all 0s !important;
+  border-radius: 5px;
+  border: 2px solid #333333;
+  box-shadow: 0 0 15px 1px rgba(0,0,0,0.50);
+  color: #333333;
+}
+.gray {
+  background: rgb(249,249,249);
+}
+span.glyphicon.glyphicon-search.form-control-feedback,
+    div.form-group-custom i.material-icons {
+      top: 0.5em;
+      left: 16.0em;
+      cursor:pointer;
+      z-index: 30;
+      position: absolute;
+}
diff --git a/VNF_Catalogue/public/stylesheets/search_projects.css b/VNF_Catalogue/public/stylesheets/search_projects.css
new file mode 100644
index 00000000..7e4a6212
--- /dev/null
+++ b/VNF_Catalogue/public/stylesheets/search_projects.css
@@ -0,0 +1,116 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+.card-shadow-custom {
+  box-shadow: 0 2px 3px 0 rgba(0,0,0,0.50);
+  border-bottom: 2px solid #8B19A2;
+}
+.row-custom {
+  display: flex;
+  flex-flow: row wrap;
+  width: 100%;
+  margin: 1em 1em 1em 1em;
+  padding-right: 20px;
+}
+.card-title-div-custom {
+  margin: 0.5em 0 0.5em 0;
+  text-align: left;
+  display: inline-block;
+}
+.card-title-span-custom {
+  margin: 0 0 0 2em;
+  display: inline-block;
+}
+.card-title-div-custom-right {
+  margin: 0.5em 0em 0.5em 0;
+  text-align: right;
+  display: inline-block;
+}
+.card-image-picture-custom {
+  margin: auto;
+}
+.collection .collection-item.active {
+  background-color: rgb(255,245,114);
+  text-decoration: none;
+  transition: none;
+}
+.collection a.collection-item:not(.active):hover {
+  background-color: rgb(255,245,114);
+  text-decoration: none;
+  transition: none;
+}
+.collection .collection-item {
+  padding: 1px 25px;
+  border-bottom: 0px;
+  transition: none;
+}
+.chip > a {
+  display: block;
+  text-decoration: none;
+  text-align: center;
+  display:inline-block;
+    font-size:13px;
+    font-weight:500;
+    color:rgba(0, 0, 0, 0.6) !important;
+    margin-right: 15px !important;
+    margin-left: 15px !important;
+    text-transform: none !important;
+}
+.chip > a:hover {
+  background-color: transparent;
+  text-decoration: none;
+  transition: none;
+}
+a.a-custom-more {
+  display: block;
+  text-decoration: none;
+  text-align: center;
+  display:inline-block;
+    font-size: 20px;
+    font-weight:500;
+    color:rgba(0, 0, 0, 0.6) !important;
+    margin-right: 15px !important;
+    text-transform: none !important;
+}
+a.a-custom-more:hover {
+  background-color: transparent;
+}
+.collection-custom {
+  margin: 0em 0em 0em 1em;
+}
+.card .row .card-action-custom {
+  margin-left: 20px;
+}
+.rating {
+  color: rgb(253,225,109) !important;
+}
+.filled-stars .star i {
+  color: rgb(253,225,109) !important;
+}
+.glyphicon-star-empty {
+  color: rgb(221,221,221);
+}
+.star {
+}
+span.glyphicon.glyphicon-search.form-control-feedback,
+    div.form-group-custom i.material-icons {
+      top: 0.5em;
+      left: 16.0em;
+      cursor:pointer;
+      z-index: 30;
+      position: absolute;
+}
+.card-image-custom {
+  display: flex;
+  flex-flow: column wrap;
+}
+.img-size{
+  max-width:200px;
+  max-height:200px;
+}
diff --git a/VNF_Catalogue/public/stylesheets/style.css b/VNF_Catalogue/public/stylesheets/style.css
new file mode 100644
index 00000000..289f1d4d
--- /dev/null
+++ b/VNF_Catalogue/public/stylesheets/style.css
@@ -0,0 +1,329 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+@import url('https://fonts.googleapis.com/css?family=Muli:300,400,600,700,800');
+*
+{
+  color: #333333;
+  font-family: 'Muli', sans-serif;
+}
+*:focus
+{
+    outline: none;
+}
+html,
+body
+{
+  margin: 0;
+  padding: 0;
+  background: #ffffff;
+  font-family: 'Muli', sans-serif;
+}
+header
+{
+  padding: 10px 35px 0 0px;
+}
+header ul
+{
+  list-style: none;
+  display: inline-block;
+}
+header ul li
+{
+  display: inline-block;
+}
+header .logo
+{
+  background: url(../images/logo.png) no-repeat;
+  background-size: cover;
+
+}
+header .brand-logo-extends
+{
+  background: url(../images/logo.png) no-repeat;
+  background-size: cover;
+  width: 154px;
+  height: 34px;
+  margin-top: 11%;
+  margin-right: 0%;
+  padding: 0;
+  position: relative !important;
+  /*margin-right: 20px;
+  margin-left: 0;
+  float: left;*/
+  /*display: inline-block;
+  */
+}
+
+nav
+{
+  height: 10px;
+}
+
+header ul li.links
+{
+  margin: 7px 10px 0 0;
+}
+header ul li > a,
+.content ul.most-menu li.items a
+{
+  color: #333333;
+  font-weight: 800;
+  font-size: 14px;
+  letter-spacing: 0.6px;
+  font-family: 'Muli', sans-serif;
+}
+header ul.navigation-right
+{
+  float: right;
+  padding-top: 8px;
+}
+header li.signup > a
+{
+  border: 2px solid #333333;
+  border-radius: 4px;
+  font-size: 14px;
+  font-weigt: 700;
+  padding: 2px 10px;
+}
+header li.signin > a
+{
+  border-bottom: 2px solid #333333;
+  font-size: 13px;
+  font-weight: 700;
+  padding: 0px 2px;
+}
+header li.option
+{
+  font-weight: 800;
+  padding: 0 10px;
+}
+header ul li > a:hover,
+header li.signin > a:hover,
+header li.signup > a:hover,
+header ul li > a:focus,
+header li.signin > a:focus,
+header li.signup > a:focus,
+.content ul.most-menu li a:hover,
+.content ul.most-menu li a:focus
+{
+  text-decoration: none;
+  cursor: pointer;
+  color: #333333;
+}
+.content-title a {
+  color: #333333;
+  font-weight: 800;
+  font-size: 14px;
+  letter-spacing: 0.6px;
+  font-family: 'Muli', sans-serif;
+}
+.content-title a:hover,
+.content-title a:focus {
+  text-decoration: none;
+  cursor: pointer;
+  color: #333333;
+}
+header li.signup > a:hover
+{
+  background: #333333;
+  color: #ffffff;
+}
+.search-box
+{
+  text-align: center;
+  padding: 100px 0;
+}
+.search-box h1
+{
+  font-size: 30px;
+  letter-spacing: 2px;
+  color: #333333;
+  font-weight: 600;
+}
+form.search-form
+{
+  padding: 10px 20px;
+}
+form.search-form input.search-input
+{
+  font-weight: 400;
+  margin: 30px 0;
+  height: 80px;
+  padding: 10px 30px;
+  max-width: 800px;
+  width: 70%;
+  border-radius: 5px;
+  border: 2px solid #333333;
+  box-shadow: 0 0 15px 1px rgba(0,0,0,0.50);
+  color: #333333;
+  font-size: 22px;
+}
+
+form.search-form button.search-button
+{
+  padding: 18px 35px;
+  background: #FFF572;
+  border: 0;
+  box-shadow: 0 0 15px 1px #958F40;
+  border-radius: 1px;
+  font-size: 20px;
+  color: #393E41;
+  letter-spacing: 1px;
+  border-radius: 5px;
+  font-weight: 600;
+}
+form.search-form input:focus
+{
+  outline: none;
+}
+form.search-form input::-webkit-input-placeholder
+{
+  font-weight: 400;
+  letter-spacing: 1px;
+    color: #333333;
+}
+form.search-form input::-moz-placeholder
+{
+  font-weight: 400;
+  letter-spacing: 1px;
+    color: #333333;
+}
+form.search-form input:-moz-placeholder
+{
+  font-weight: 400;
+  letter-spacing: 5px;
+    color: #333333;
+}
+form.search-form input:-ms-input-placeholder
+{
+  font-weight: 400;
+  letter-spacing: 1px;
+    color: #333333;
+}
+.content
+{
+  height: 500px;
+  background: #f9f9f9;
+  padding: 10px 0;
+}
+.content ul.most-menu
+{
+  list-style: none;
+  text-align: center;
+  padding-bottom: 10px;
+}
+.content ul.most-menu li.items
+{
+  display: inline-block;
+  margin-right: 5px;
+  padding: 15px 25px;
+}
+.content ul.most-menu li.active
+{
+  /*background: #FFF572;*/
+}
+.content-box
+{
+  overflow: hidden;
+  padding: 20px 0 50px 0;
+  display: flex;
+  justify-content: center;
+  background: #FFFFFF;
+  box-shadow: 0 2px 3px 0 rgba(0,0,0,0.50);
+  border-bottom: 2px solid #8B19A2;
+  margin-bottom: 30px;
+}
+.content-data
+{
+  align-self: center;
+}
+.content-data h1.content-title
+{
+  font-size: 25px;
+  color: #000000;
+  letter-spacing: 1.2px;
+}
+.content-data .box
+{
+  padding: 6px 0;
+  height: 90px;
+  text-align: center;
+  border: 2px solid #4D4D4D;
+  border-radius: 2px;
+}
+.content-data .commit-icon
+{
+  width: 50px;
+  height: 50px;
+}
+.content-data .box h3.commits
+{
+  text-align: center;
+  font-size: 12px;
+  color: #333333;
+  letter-spacing: 0.03px;
+  margin-top: 1px !important;
+}
+.content-height-overwrite
+{
+  height: 110px;
+}
+.float-center-magic
+{
+  float: right;
+  position: relative;
+  left: -30%;
+}
+nav ul li:hover, nav ul li.active, nav ul li a.active, nav ul li a:hover {
+  background-color: rgb(255,245,114);
+}
+a:hover, a.active {
+  background-color: rgb(255,245,114);
+}
+footer
+{
+  font-size: 12px;
+  font-weight: 800;
+  color: #333333;
+  text-align: center;
+  padding: 20px;
+}
+.space-10
+{
+  height: 10px;
+}
+.space-30
+{
+  height: 100px;
+}
+input[type="search"]:focus:not([readonly]) {
+  transition: all 0s !important;
+  border-radius: 5px;
+  border: 2px solid #333333;
+  box-shadow: 0 0 15px 1px rgba(0,0,0,0.50);
+  color: #333333;
+}
+.gray {
+  background: rgb(249,249,249);
+}
+.custom-href
+{
+  color: #333333 !important;
+  font-family: 'Muli', sans-serif !important;
+}
+.card-title a:hover, a.active {
+  background: rgb(255,245,114);;
+}
+.dotted
+{
+  border-bottom: 1px dotted #8B19A2;
+  line-height: 250%;
+  color: #8B19A2;
+}
\ No newline at end of file
diff --git a/VNF_Catalogue/public/stylesheets/style_project.css b/VNF_Catalogue/public/stylesheets/style_project.css
new file mode 100644
index 00000000..895c8727
--- /dev/null
+++ b/VNF_Catalogue/public/stylesheets/style_project.css
@@ -0,0 +1,238 @@
+.content
+{
+  background: #f9f9f9;
+  padding: 10px 0;
+}
+.content-dummy
+{
+  height: 65px;
+}
+.content ul.most-menu
+{
+  list-style: none;
+  text-align: center;
+  padding-bottom: 10px;
+}
+.content ul.most-menu li.items
+{
+  display: inline-block;
+  margin-right: 5px;
+  padding: 15px 25px;
+}
+.content ul.most-menu li.active
+{
+  /*background: #FFF572;*/
+}
+.content-box
+{
+    overflow: hidden;
+    padding: 20px 0 50px 0;
+    display: flex;
+    justify-content: center;
+    background: #FFFFFF;
+    box-shadow: 0 2px 3px 0 rgba(0,0,0,0.50);
+    border-bottom: 1px solid #8B19A2;
+    margin: 0 8px 50px 8px;
+}
+.content-data
+{
+  align-self: center;
+}
+.content-data h1.content-title
+{
+  font-size: 25px;
+  color: #000000;
+  letter-spacing: 1.2px;
+}
+.content-data .box
+{
+  padding: 10px 0;
+  height: 90px;
+  text-align: center;
+  border: 2px solid #4D4D4D;
+  border-radius: 2px;
+}
+.content-data .commit-icon
+{
+  width: 23px;
+  height: 16px;
+}
+.content-data .box h3.commits
+{
+  text-align: center;
+  font-size: 12px;
+  color: #333333;
+  letter-spacing: 0.03px;
+}
+.content-height-overwrite
+{
+  height: 110px;
+}
+.float-center-magic
+{
+  float: right;
+  position: relative;
+  left: -30%;
+}
+nav ul li:hover, nav ul li.active, nav ul li a.active, nav ul li a:hover {
+  background-color: rgb(255,245,114);
+}
+a:hover, a.active {
+  background-color: rgb(255,245,114); 
+}
+footer
+{
+  font-size: 12px;
+  font-weight: 800;
+  color: #333333;
+  text-align: center;
+  padding: 165px;
+}
+.container-grey
+{
+  background: #f9f9f9;
+}
+.container .row
+{
+  margin-left: 0;
+  margin-right: 0;
+}
+ul.card-highlights
+{
+  padding: 0;
+  margin: 0;
+  list-style: disc;
+}
+ul.card-highlights li
+{
+    padding: 0px 30px;
+    font-weight: 700;
+    font-size: 12px;
+}
+ul.card-highlights .dotted
+{
+  border-bottom: 1px dotted #8B19A2;
+  line-height: 250%;
+  color: #8B19A2;
+}
+.tags
+{
+    padding: 10px 12px;
+    letter-spacing: 0.8px;
+    font-weight: 700;
+    font-size: 12px;
+}
+.chip
+{
+    display: inline-block;
+    height: 32px;
+    letter-spacing: 1.2px;
+    font-size: 10px;
+    font-weight: 700;
+    color: rgba(0, 0, 0, 0.6);
+    line-height: 33px;
+    padding: 0px 12px;
+    border-radius: 5px;
+    background-color: #e4e4e4;
+    margin-bottom: 9px;
+    margin-right: 5px;
+}
+.meta-data
+{
+    padding: 10px 15px 0px 15px;
+    letter-spacing: 0.7px;
+    font-size: 12px;
+}
+.show-more
+{
+  text-align: center;
+}
+.show-more a
+{
+  padding: 12px 15px;
+    background: #FFF572;
+    color: #393E41;
+    font-weight: 800;
+    font-size: 13px;
+    letter-spacing: 0.6px;
+}
+.show-more a:hover,
+.show-more a:focus
+{
+  cursor: pointer;
+  text-decoration: none;
+}
+.rating-box
+{
+  margin: 8px 0 0px 0;
+  padding-left: 12px;
+  display: inline-block;
+}
+.count
+{
+  display: inline-block;
+  font-weight: 800;
+  letter-spacing: 1px;
+  font-size: 10px;
+}
+.profile-picture img
+{
+  max-width: 400px;
+  width: 100%;
+  display: block;
+  margin: 0 auto;
+}
+#profile-page .content-title
+{
+  font-weight: 800;
+  font-size: 18px;
+  letter-spacing: 0.8px;
+  display: inline;
+}
+#profile-page .user-content
+{
+  padding-left: 30px;
+  margin-top: -10px;
+}
+#profile-page .description
+{
+  letter-spacing: 0.6px;
+  line-height: 180%;
+  font-size: 14px;
+  padding: 10px 10px 0 0;
+}
+#profile-page .tags
+{
+  padding: 0;
+}
+.clearfix
+{
+  clear: both;
+}
+.space-10
+{
+  height: 10px;
+}
+.space-30
+{
+  height: 100px;
+}
+#profile-page .content-box
+{
+    display: block;
+    padding: 10px 0px;
+}
+#profile-page .content-box img 
+{
+    display: inline-block;
+}
+.img-size
+{
+  max-width:50px;
+  max-height:50px;
+}
+.custom-href
+{
+  color: #333333 !important;
+  font-family: 'Muli', sans-serif !important;
+}
diff --git a/VNF_Catalogue/public/uploads/logo.png b/VNF_Catalogue/public/uploads/logo.png
new file mode 100644
index 00000000..fe18194e
--- /dev/null
+++ b/VNF_Catalogue/public/uploads/logo.png
diff --git a/VNF_Catalogue/routes/add_project.js b/VNF_Catalogue/routes/add_project.js
new file mode 100644
index 00000000..113d19b6
--- /dev/null
+++ b/VNF_Catalogue/routes/add_project.js
@@ -0,0 +1,185 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+var express = require('express');
+var router = express.Router();
+var multer = require('multer');
+var async = require('async');
+
+var max_size = 1 * 1000 * 1000; // image size_limit
+
+var storage =   multer.diskStorage({
+  destination: function (req, file, callback) {
+    callback(null, './public/uploads');
+  },
+  filename: function (req, file, callback) {
+    console.log(file);
+    console.log(req.body);
+    callback(null, file.fieldname + '-' + Date.now() + '.png');
+  }
+});
+
+var fileFilter = function (req, file, cb) {
+  if (file.mimetype !== 'image/png') {
+    //req.fileValidationError = 'goes wrong on the mimetype';
+    cb(null, false);
+  } else {
+    cb(null, true);
+  }
+}
+
+var upload = multer({ fileFilter: fileFilter, limits: { fileSize: max_size }, storage : storage}).single('file_upload');
+
+var renderer = function(res, error, results) {
+    //res.render('project_profile', { title: 'Express', json: results });
+    if(error) {
+      res.status(500);
+      res.send({'error': 'Adding VNF did not succeed'});
+      return;
+    } else {
+      res.end('{"success" : "Updated Successfully", "status" : 200}');
+      return;
+    }
+}
+
+
+var add_vnf_name_tag = function(vnf_name, vnf_id, cb) {
+  db_pool.getConnection(function(err, connection) {
+    sql_query = 'INSERT INTO tag(tag_name, is_vnf_name) values(\'' + vnf_name + '\', 1)\;SELECT LAST_INSERT_ID() tag_id';
+    connection.query(sql_query, function (error, results, fields) {
+        tag_id = results[1][0].tag_id;
+        connection.release();
+        if(error) {
+            cb(null, error, -1, -1);
+        } else {
+            cb(null, null, vnf_id, tag_id);
+        }
+      });
+  });
+}
+
+var add_vnf_tag_relationship = function(err, vnf_id, tag_id, cb) {
+  console.log('here');
+  console.log(err); console.log(vnf_id); console.log(tag_id); console.log(cb);
+  if(err) cb(null, err, -1); // err propagated from add_vnf_name_tag
+  db_pool.getConnection(function(err, connection) {
+    sql_query = 'INSERT INTO vnf_tags(tag_id, vnf_id) values(' + tag_id + ', ' + vnf_id + ')\;';
+    console.log(sql_query);
+    connection.query(sql_query, function (error, results, fields) {
+        connection.release();
+        console.log('here');
+        if(error) {
+            cb(null, error, -1);
+        } else {
+            cb(null, null, results);
+        }
+      });
+  });
+}
+
+
+router.post('/', function(req, res) {
+  upload(req,res,function(err) {
+        console.log(req.body);
+        console.log(req.file)
+        if(req.file == null && req.body['file_url'] != '') {
+            response = 'File Upload error: wrong Filetype, only png supported as of now';
+            res.status(500);
+            res.end(JSON.stringify({'error': response}));
+            return;
+        }
+        console.log(err);
+        if(err) {
+            console.log(err);
+            response = 'File Upload error: ' + err;
+            console.log(response);
+            //return res.end(req.fileValidationError);
+            res.status(500);
+            res.end(JSON.stringify({'error': response}));
+            console.log('here here here here');
+            return;
+        }
+        console.log('here here');
+
+        console.log(req.file);
+        req.body['photo_url'] = (req.file) ? req.file['filename'] : 'logo.png';
+        console.log(req.body);
+
+        req.checkBody("vnf_name", "VNF Name must not be empty").notEmpty();
+        req.checkBody("repo_url", "Repository URL must not be empty").notEmpty();
+        req.checkBody("license", "Please select a License").notEmpty();
+        req.checkBody("opnfv_indicator", "Please select an OPNFV Indicator").notEmpty();
+        //req.checkBody("repo_url", "Must be a Github URL").matches('.*github\.com.*');
+
+        var errors = req.validationErrors();
+        console.log(errors);
+
+        var response = '';  for(var i = 0; i < errors.length; i++) {
+            console.log(errors[i]['msg']);
+            response = response + errors[i]['msg'] + '; ';
+        }
+
+        if(errors) {    res.status(500);
+            res.send({'error': response});
+            return;
+        }
+
+        req.body['vnf_name'] = req.body['vnf_name'].toLowerCase();
+
+        var vnf_details = req.body;
+        delete vnf_details.file_url;
+
+        db_pool.getConnection(function(err, connection) {
+            // Use the connection
+
+          sql_query = 'INSERT INTO photo(photo_url) values(\'' + req.body['photo_url'] + '\')\;SELECT LAST_INSERT_ID() photo_id';
+          // TODO look above query prone to sql_injections
+
+          console.log(sql_query);
+          connection.query(sql_query, function (error, results, fields) {
+             console.log('hola');
+             console.log(results[1][0].photo_id);
+             //connection.query(sql_query, vnf_details, function (error, results, fields) {
+             delete vnf_details.photo_url;
+             vnf_details['photo_id'] = results[1][0].photo_id;
+             sql_query = 'INSERT INTO vnf SET ?; select last_insert_id() vnf_id;'
+
+             connection.query(sql_query, vnf_details, function (error, results, fields) {
+                // And done with the connection.
+                connection.release();
+                //if (error) throw error;
+                if(error) {
+                    res.status(500);
+                    res.send({'error': 'Adding VNF did not succeed'});
+                    return;
+                } else {
+
+                        console.log(results);
+                        console.log(results[1][0].vnf_id);
+                        vnf_id = results[1][0].vnf_id;
+                        async.waterfall([                                                          
+                          async.apply(add_vnf_name_tag, vnf_details['vnf_name'], vnf_id),
+                          add_vnf_tag_relationship,
+                        ], renderer.bind(null, res));
+
+                    // Handle error after the release.
+                    //res.end('{"success" : "Updated Successfully", "status" : 200}');
+                    //return;
+                }
+                // Don't use the connection here, it has been returned to the pool.
+            });
+          });
+        });
+
+
+  });
+
+});
+
+module.exports = router;
diff --git a/VNF_Catalogue/routes/add_tag.js b/VNF_Catalogue/routes/add_tag.js
new file mode 100644
index 00000000..574e67e6
--- /dev/null
+++ b/VNF_Catalogue/routes/add_tag.js
@@ -0,0 +1,60 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+var express = require('express');
+var router = express.Router();
+
+router.post('/', function(req, res) {
+  console.log(req.body);
+  req.checkBody("tag_name", "TAG Name must not be empty").notEmpty();
+
+  var errors = req.validationErrors();
+  console.log(errors);
+
+  var response = '';  for(var i = 0; i < errors.length; i++) {
+    console.log(errors[i]['msg']);
+    response = response + errors[i]['msg'] + '; ';
+  }
+
+  if(errors) {  res.status(500);
+    res.send({'error': response});
+    return;
+  }
+
+  req.body['tag_name'] = req.body['tag_name'].toLowerCase();
+  var tag_details = req.body;
+
+  db_pool.getConnection(function(err, connection) {
+    // Use the connection
+    sql_query = 'INSERT INTO tag SET ?'
+    connection.query(sql_query, tag_details, function (error, results, fields) {
+        // And done with the connection.
+        // Handle error after the release.
+        console.log('here');
+        if(error) {
+            res.end('{"error" : "Adding tag did not succeed", "status" : 500}');
+            connection.release();
+            return;
+        } else {
+            res.end('{"success" : "Updated Successfully", "status" : 200}'); 
+            connection.release();
+            return;
+        }
+        //if (error) throw error;
+        // Don't use the connection here, it has been returned to the pool.
+    });
+  });
+
+
+  //res.end('{"success" : "Updated Successfully", "status" : 200}');
+  //return;
+
+});
+
+module.exports = router;
diff --git a/VNF_Catalogue/routes/edit_project.js b/VNF_Catalogue/routes/edit_project.js
new file mode 100644
index 00000000..75e586f0
--- /dev/null
+++ b/VNF_Catalogue/routes/edit_project.js
@@ -0,0 +1,117 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+var express = require('express');
+var router = express.Router();
+var multer = require('multer');
+
+var max_size = 1 * 1000 * 1000; // image size_limit
+
+var storage =   multer.diskStorage({
+  destination: function (req, file, callback) {
+    callback(null, './public/uploads');
+  },
+  filename: function (req, file, callback) {
+    console.log(file);
+    console.log(req.body);
+    callback(null, file.fieldname + '-' + Date.now() + '.png');
+  }
+});
+
+var fileFilter = function (req, file, cb) {
+  if (file.mimetype !== 'image/png') {
+    //req.fileValidationError = 'goes wrong on the mimetype';
+    cb(null, false);
+  } else {
+    cb(null, true);
+  }
+}
+
+var upload = multer({ fileFilter: fileFilter, limits: { fileSize: max_size }, storage : storage}).single('file_upload');
+
+
+router.post('/', function(req, res) {
+  upload(req,res,function(err) {
+        console.log(req.body);
+        console.log(req.file)
+        if(req.file == null && req.body['file_url'] != '') {
+            response = 'File Upload error: wrong Filetype, only png supported as of now';
+            res.status(500);
+            res.end(JSON.stringify({'error': response}));
+
+        }
+        if(err) {
+            console.log(err);
+            response = 'File Upload error: ' + err;
+            console.log(response);
+            //return res.end(req.fileValidationError);
+            res.status(500);
+            res.end(JSON.stringify({'error': response}));
+            return;
+        }
+
+        console.log(req.file);
+        req.body['photo_url'] = (req.file) ? req.file['filename'] : 'logo.png';
+        console.log(req.body);
+
+        req.checkBody("vnf_name", "VNF Name must not be empty").notEmpty();
+        req.checkBody("repo_url", "Repository URL must not be empty").notEmpty();
+        req.checkBody("license", "Please select a License").notEmpty();
+        req.checkBody("opnfv_indicator", "Please select an OPNFV Indicator").notEmpty();
+        req.checkBody("repo_url", "Must be a Github URL").matches('.*github\.com.*');
+
+        var errors = req.validationErrors();
+        console.log(errors);
+
+        var response = '';  for(var i = 0; i < errors.length; i++) {
+            console.log(errors[i]['msg']);
+            response = response + errors[i]['msg'] + '; ';
+        }
+
+        if(errors) {    res.status(500);
+            res.send({'error': response});
+            return;
+        }
+
+        var vnf_details = req.body;
+        delete vnf_details.file_url;
+
+        db_pool.getConnection(function(err, connection) {
+            // Use the connection
+
+          sql_query = 'INSERT INTO photo(photo_url) values(\'' + req.body['photo_url'] + '\')\;SELECT LAST_INSERT_ID() photo_id';
+          // TODO look above query prone to sql_injections
+
+          console.log(sql_query);
+          connection.query(sql_query, function (error, results, fields) {
+             console.log('hola');
+             console.log(results[1][0].photo_id);
+              //connection.query(sql_query, vnf_details, function (error, results, fields) {
+             delete vnf_details.photo_url;
+             vnf_details['photo_id'] = results[1][0].photo_id;
+             sql_query = 'INSERT INTO vnf SET ?'
+               connection.query(sql_query, vnf_details, function (error, results, fields) {
+             // And done with the connection.
+             connection.release();
+             if (error) throw error;
+
+             // Handle error after the release.
+             res.end('{"success" : "Updated Successfully", "status" : 200}');
+             return;
+               // Don't use the connection here, it has been returned to the pool.
+               });
+          });
+        });
+
+
+  });
+
+});
+
+module.exports = router;
diff --git a/VNF_Catalogue/routes/index.js b/VNF_Catalogue/routes/index.js
new file mode 100644
index 00000000..e22f7c29
--- /dev/null
+++ b/VNF_Catalogue/routes/index.js
@@ -0,0 +1,58 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+var express = require('express');
+var router = express.Router();
+var async = require('async');
+
+var renderer = function(res, err, results) {
+    console.log(results);
+    res.render('index', { title: 'Express', json: results });
+}
+
+var get_images = function(result, callback) {
+    db_pool.getConnection(function(err, connection) {
+        sql_query = 'select photo_url from photo where photo_id = ' + result['photo_id'];
+        // TODO find why it works here and not when declared outside the method
+        console.log(sql_query);
+        connection.query(sql_query, function (error, results, fields) {
+            console.log(results[0].photo_url);
+            //result['photo_url'] = results[0].photo_url;
+            connection.release();
+            if (error) {
+                result['photo_url'] = false;
+                //throw error;
+            } else {
+                result['photo_url'] = results[0].photo_url;
+            }
+            callback(null, result);
+            //if (error) throw error;
+        });
+    });
+}
+
+/* GET VNF_Catalogue Home Page. */
+router.get('/', function(req, res) {
+    db_pool.getConnection(function(err, connection) {
+        sql_query = 'select * from vnf order by lines_of_code desc limit 8';
+        // TODO find why it works and not above
+        connection.query(sql_query, function (error, results, fields) {
+            //console.log(results);
+            connection.release();
+            if (error) {
+            	res.render('index', { title: 'Express', json: false});
+            } else {
+            	async.map(results, get_images, renderer.bind(null, res));
+            	//res.render('index', { title: 'Express', json: results});    
+            }
+        });
+    });
+});
+
+module.exports = router;
diff --git a/VNF_Catalogue/routes/project_profile.js b/VNF_Catalogue/routes/project_profile.js
new file mode 100644
index 00000000..20af2256
--- /dev/null
+++ b/VNF_Catalogue/routes/project_profile.js
@@ -0,0 +1,115 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+var express = require('express');
+var router = express.Router();
+var async = require('async');
+
+
+var renderer = function(res, err, results) {
+    console.log(results);
+    res.render('project_profile', { title: 'Express', json: results });
+}
+
+var renderer_post = function(res, err, results) {
+    console.log(results);
+    res.end(JSON.stringify(results));
+}
+
+var get_tags = function(result, callback) {
+    db_pool.getConnection(function(err, connection) {
+        sql_query = 'select tag_name from tag where tag_id in (select tag_id from vnf_tags where vnf_id = ' + result['vnf_id'] + ') limit 5';
+        // TODO find why it works and not above
+        connection.query(sql_query, function (error, results, fields) {
+            console.log(results);
+            result['tags'] = results;
+            connection.release();
+            if (error) {
+                result['tags'] = {};
+                //throw error;
+            } else {
+                result['tags'] = results;
+            }
+            callback(null, result);
+            //if (error) throw error;
+        });
+    });
+}
+
+
+var get_images = function(result, callback) {
+    db_pool.getConnection(function(err, connection) {
+        sql_query = 'select photo_url from photo where photo_id = ' + result['photo_id'];
+        // TODO find why it works here and not when declared outside the method
+        console.log(sql_query);
+        connection.query(sql_query, function (error, results, fields) {
+            console.log(results[0].photo_url);
+            //result['photo_url'] = results[0].photo_url;
+            connection.release();
+            if (error) {
+                result['photo_url'] = false;
+                //throw error;
+            } else {
+                result['photo_url'] = results[0].photo_url;
+            }
+            callback(null, result);
+            //if (error) throw error;
+        });
+    });
+}
+
+var sql_data = function(vnf_id, renderer, res) {
+    db_pool.getConnection(function(err, connection) {
+        sql_query = 'select * from vnf where vnf_id = '+ vnf_id;
+        connection.query(sql_query, function (error, results, fields) {
+            console.log(results);
+            connection.release();
+            if (error) {
+                console.log('connection error occurred');
+            } else {
+                async.map(results, get_images, function(error, results) {
+                    async.map(results, get_tags, renderer.bind(null, res));
+                });
+            }   
+            //connection.release();
+            //if (error) throw error;
+        });
+    });
+
+}
+
+router.get('/', function(req, res) {
+    console.log(typeof(req.param('vnf_id')));
+    var vnf_id = req.param('vnf_id');
+
+    if(vnf_id) {
+        //tags = tags.toLowerCase().split(/[ ,]+/);
+        //console.log(tags);
+        sql_data(vnf_id, renderer, res);
+    } else {
+        res.render('project_profile', { title: 'Express', json: false});
+    }
+});
+
+router.post('/', function(req, res) {
+    console.log(typeof(req.param('vnf_id')));
+    var vnf_id = req.param('vnf_id');
+
+    if(vnf_id) {
+        //tags = tags.toLowerCase().split(/[ ,]+/);
+        //console.log(tags);
+        sql_data(vnf_id, renderer_post, res);
+    } else {
+        res.end('{"error" : "VNF Project could not get loaded", "status" : 500}');
+
+    }
+});
+
+
+module.exports = router;
diff --git a/VNF_Catalogue/routes/search_max.js b/VNF_Catalogue/routes/search_max.js
new file mode 100644
index 00000000..5fdca19e
--- /dev/null
+++ b/VNF_Catalogue/routes/search_max.js
@@ -0,0 +1,36 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+var express = require('express');
+var router = express.Router();
+
+/* Post Controller for Tag autocomplete form */
+router.post('/', function(req, res) {
+    console.log('here here here here');
+    order_key = req.param('order_key');
+    db_pool.getConnection(function(err, connection) {
+
+        sql_query = 'select * from vnf order by ' + order_key + ' desc limit 8';
+        // TODO find why it works and not above
+        console.log(sql_query);
+        connection.query(sql_query, function (error, results, fields) {
+            console.log(results);
+
+            console.log(results);
+            connection.release();
+            if (error) {
+                res.end(JSON.stringify({}));
+            } else {
+                res.end(JSON.stringify(results));    
+            }
+        });
+    });
+});
+
+module.exports = router;
diff --git a/VNF_Catalogue/routes/search_projects.js b/VNF_Catalogue/routes/search_projects.js
new file mode 100644
index 00000000..71a6dfa7
--- /dev/null
+++ b/VNF_Catalogue/routes/search_projects.js
@@ -0,0 +1,119 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+var express = require('express');
+var router = express.Router();
+var async = require('async');
+
+
+var renderer = function(res, err, results) {
+    //console.log(results);
+    //console.log(results.length);
+    if(results.length >= 1)
+        res.render('search_projects', { title: 'Express', json: results });
+    else
+        res.render('search_projects', { title: 'Express', json: false });
+}
+
+var get_tags = function(result, callback) {
+    db_pool.getConnection(function(err, connection) {
+        sql_query = 'select tag_name from tag where tag_id in (select tag_id from vnf_tags where vnf_id = ' + result['vnf_id'] + ') and is_vnf_name = 0 limit 5';
+        // TODO find why it works and not above
+        connection.query(sql_query, function (error, results, fields) {
+            //console.log(results);
+            connection.release();
+            if (error) {
+                result['tags'] = false;
+                //throw error;
+            } else {
+                result['tags'] = results;
+            }
+            callback(null, result);
+        });
+    });
+}
+
+
+var get_images = function(result, callback) {
+    db_pool.getConnection(function(err, connection) {
+        sql_query = 'select photo_url from photo where photo_id = ' + result['photo_id'];
+        // TODO find why it works here and not when declared outside the method
+        //console.log(sql_query);
+        connection.query(sql_query, function (error, results, fields) {
+            //console.log(results[0].photo_url);
+            //callback(null, result);
+            connection.release();
+            if (error) {
+                result['photo_url'] = false;
+                //throw error;
+            } else {
+                result['photo_url'] = results[0].photo_url;
+            }
+            callback(null, result);
+            
+        });
+    });
+}
+
+var sql_data = function(tags, renderer, res) {
+    var tag_array = "\'" + tags.map(function (item) { return item; }).join("\',\'") + "\'";
+    console.log(tag_array);
+    var condition = '';
+    db_pool.getConnection(function(err, connection) {
+        sql_query = 'select tag_id from tag where tag_name in (' + tag_array + ')';
+        connection.query(sql_query, function (error, results, fields) {
+            console.log('tag_id');
+            console.log(results);
+            condition = 'SELECT * FROM vnf as v';
+            orig_condition = condition;
+            for (var i in results) {
+                condition += (i == 0) ? ' WHERE ' : ' AND ';
+                condition += 'v.vnf_id IN (SELECT vnf_id from vnf_tags where tag_id = ' + results[i]['tag_id'] + ')';
+            }
+            if (condition === orig_condition)
+                condition += ' WHERE v.vnf_id = -1';
+            condition += ' limit 5';
+            console.log(condition);
+
+            connection.query(condition, function (error, results, fields) {
+                    //console.log(results);
+                    connection.release();
+                    if (error) {
+                        //throw error;
+                        console.log('connection error occurred');
+                    } else {
+                        async.map(results, get_images, function(error, results) {
+                            async.map(results, get_tags, renderer.bind(null, res));
+                        });
+                    }
+            });
+
+            //connection.release();
+            //if (error) throw error;
+        });
+    });
+
+}
+
+router.get('/', function(req, res) {
+
+  console.log(typeof(req.param('tags')));
+  var tags = req.param('tags');
+
+  if(tags) {
+    tags = tags.toLowerCase().split(/[ ,]+/);
+    console.log(tags);
+    sql_data(tags, renderer, res);
+  } else {
+    res.render('search_projects', { title: 'Express', json: false});
+  }
+
+});
+
+module.exports = router;
diff --git a/VNF_Catalogue/routes/search_projects_results.js b/VNF_Catalogue/routes/search_projects_results.js
new file mode 100644
index 00000000..dd5423b6
--- /dev/null
+++ b/VNF_Catalogue/routes/search_projects_results.js
@@ -0,0 +1,120 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+var express = require('express');
+var router = express.Router();
+var async = require('async');
+
+
+var renderer = function(res, err, results) {
+    //console.log(results);
+    //console.log(results.length);
+    if(results.length >= 1)
+        res.end(JSON.stringify(results));
+    else
+        res.end(JSON.stringify({}));
+}
+
+var get_tags = function(result, callback) {
+    db_pool.getConnection(function(err, connection) {
+        sql_query = 'select tag_name from tag where tag_id in (select tag_id from vnf_tags where vnf_id = ' + result['vnf_id'] + ') and is_vnf_name = 0 limit 5';
+        // TODO find why it works and not above
+        connection.query(sql_query, function (error, results, fields) {
+            //console.log(results);
+            connection.release();
+            if (error) {
+                result['tags'] = false;
+                //throw error;
+            } else {
+                result['tags'] = results;
+            }
+            callback(null, result);
+        });
+    });
+}
+
+
+var get_images = function(result, callback) {
+    db_pool.getConnection(function(err, connection) {
+        sql_query = 'select photo_url from photo where photo_id = ' + result['photo_id'];
+        // TODO find why it works here and not when declared outside the method
+        //console.log(sql_query);
+        connection.query(sql_query, function (error, results, fields) {
+            //console.log(results[0].photo_url);
+            //callback(null, result);
+            connection.release();
+            if (error) {
+                result['photo_url'] = false;
+                //throw error;
+            } else {
+                result['photo_url'] = results[0].photo_url;
+            }
+            callback(null, result);
+            
+        });
+    });
+}
+
+var sql_data = function(tags, previous_elements, renderer, res) {
+    var tag_array = "\'" + tags.map(function (item) { return item; }).join("\',\'") + "\'";
+    console.log(tag_array);
+    var condition = '';
+    db_pool.getConnection(function(err, connection) {
+        sql_query = 'select tag_id from tag where tag_name in (' + tag_array + ')';
+        connection.query(sql_query, function (error, results, fields) {
+            console.log('tag_id');
+            console.log(results);
+            condition = 'SELECT * FROM vnf as v';
+            orig_condition = condition;
+            for (var i in results) {
+                condition += (i == 0) ? ' WHERE ' : ' AND ';
+                condition += 'v.vnf_id IN (SELECT vnf_id from vnf_tags where tag_id = ' + results[i]['tag_id'] + ')';
+            }
+            if (condition === orig_condition)
+                condition += ' WHERE v.vnf_id = -1'
+            condition += ' limit ' + previous_elements.toString() + ', 5';             
+            console.log(condition);
+
+            connection.query(condition, function (error, results, fields) {
+                    //console.log(results);
+                    connection.release();
+                    if (error) {
+                        //throw error;
+                        console.log('connection error occurred');
+                    } else {
+                        async.map(results, get_images, function(error, results) {
+                            async.map(results, get_tags, renderer.bind(null, res));
+                        });
+                    }
+            });
+
+            //connection.release();
+            //if (error) throw error;
+        });
+    });
+
+}
+
+router.post('/', function(req, res) {
+  console.log(typeof(req.param('tags')));
+  var tags = req.param('tags');
+  var previous_elements = (parseInt(req.param('page')) - 1) * 5;
+  console.log(previous_elements);
+
+  if(tags) {
+    tags = tags.toLowerCase().split(/[ ,]+/);
+    console.log(tags);
+    sql_data(tags, previous_elements, renderer, res);
+  } else {
+    res.render('search_projects', { title: 'Express', json: false});
+  }
+
+});
+
+module.exports = router;
diff --git a/VNF_Catalogue/routes/search_tag.js b/VNF_Catalogue/routes/search_tag.js
new file mode 100644
index 00000000..a3a4b946
--- /dev/null
+++ b/VNF_Catalogue/routes/search_tag.js
@@ -0,0 +1,41 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+var express = require('express');
+var router = express.Router();
+
+/* Post Controller for Tag autocomplete form */
+router.get('/', function(req, res) {
+    tag_partial = req.param('key');
+    db_pool.getConnection(function(err, connection) {
+
+        sql_query = 'select tag_name from tag where tag_name like "%'+ tag_partial + '%" and is_vnf_name = false limit 5';
+        // TODO find why it works and not above
+        console.log(sql_query);
+        connection.query(sql_query, function (error, results, fields) {
+            console.log(results);
+
+            if(results == null) {
+                connection.release();
+                res.end(JSON.stringify({}));
+            } else {
+                var data=[];
+                for(i = 0; i < results.length; i++) {
+                    data.push(results[i].tag_name.replace(/\r?\n|\r/g, ''));
+                }
+                console.log(results);
+                connection.release();
+                res.end(JSON.stringify(results));
+            }
+            //if (error) throw error;
+        });
+    });
+});
+
+module.exports = router;
diff --git a/VNF_Catalogue/routes/search_vnf.js b/VNF_Catalogue/routes/search_vnf.js
new file mode 100644
index 00000000..da524f58
--- /dev/null
+++ b/VNF_Catalogue/routes/search_vnf.js
@@ -0,0 +1,39 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+var express = require('express');
+var router = express.Router();
+
+/* Post Controller for Search Vnf autocomplete form */
+router.get('/', function(req, res) {
+    tag_partial = req.param('key');
+    db_pool.getConnection(function(err, connection) {
+
+        sql_query = 'select vnf_name from vnf where vnf_name like "%'+ tag_partial + '%" limit 5';
+        // TODO find why it works and not above
+        connection.query(sql_query, function (error, results, fields) {
+            console.log(results);
+            if(results == null) {
+                connection.release();
+                res.end(JSON.stringify({}));
+            } else {
+                var data=[];
+                for(i = 0; i < results.length; i++) {
+                    data.push(results[i].vnf_name.replace(/\r?\n|\r/g, ''));
+                }
+                console.log(results);
+                connection.release();
+                res.end(JSON.stringify(results));
+            }
+            //if (error) throw error;
+        });
+    });
+});
+
+module.exports = router;
diff --git a/VNF_Catalogue/routes/vnf_tag_association.js b/VNF_Catalogue/routes/vnf_tag_association.js
new file mode 100644
index 00000000..24ad5995
--- /dev/null
+++ b/VNF_Catalogue/routes/vnf_tag_association.js
@@ -0,0 +1,75 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+var express = require('express');
+var router = express.Router();
+
+/* Post controller for VNF_TAG Association */
+router.post('/', function(req, res) {
+  req.checkBody("tag_name", "TAG Name must not be empty").notEmpty();
+  req.checkBody("vnf_name", "VNF Name must not be empty").notEmpty();
+
+  var errors = req.validationErrors();
+  console.log(errors);
+
+  var response = '';  for(var i = 0; i < errors.length; i++) {
+    console.log(errors[i]['msg']);
+    response = response + errors[i]['msg'] + '; ';
+  }
+
+  if(errors) {  res.status(500);
+    res.send({'error': response});
+    return;
+  }
+
+  var tag_name = req.param('tag_name').toLowerCase();
+  var vnf_name = req.param('vnf_name').toLowerCase();
+
+  db_pool.getConnection(function(err, connection) {
+    sql_query = 'select vnf_tag_id from vnf_tags where vnf_id = (select vnf_id from vnf where vnf_name = \'' + vnf_name + '\' limit 1) and tag_id = (select tag_id from tag where tag_name = \'' + tag_name + '\' and is_vnf_name = 0 limit 1)';
+    console.log(sql_query);
+    connection.query(sql_query, function (error, results, fields) {
+        console.log(results);
+        if (results.length >= 1) {
+            connection.release();
+            res.status(500);
+            res.send('{"error" : "Tag VNF connection already exists...."}');
+            return;
+        } else {
+            // Use the connection
+            //sql_query = 'INSERT INTO tag SET ?'
+            sql_query = 'insert into vnf_tags(vnf_id, tag_id) values ((select vnf_id from vnf where vnf_name = \'' + vnf_name + '\' limit 1), (select tag_id from tag where tag_name = \'' + tag_name + '\' and is_vnf_name = 0 limit 1))';
+            console.log(sql_query);
+            connection.query(sql_query, function (error, results, fields) {
+                // And done with the connection.
+
+                connection.release();
+
+                // Handle error after the release.
+                if (error) {
+                    console.log(error);
+                    res.status(500);
+                    res.send({'error' : 'Adding vnf tag association did not succeed, Check names(rely on autocomplete)'});
+                    return;
+                } else {
+                    res.end('{"success" : "Updated Successfully", "status" : 200}');
+                    return;
+                }
+                // Don't use the connection here, it has been returned to the pool.
+            });
+        }
+    });
+
+  });
+
+  //res.end('{"success" : "Updated Successfully", "status" : 200}');
+  //res.render('vnf_tag_association', { title: 'Express' });
+});
+
+module.exports = router;
diff --git a/VNF_Catalogue/style.css b/VNF_Catalogue/style.css
new file mode 100644
index 00000000..343408fd
--- /dev/null
+++ b/VNF_Catalogue/style.css
@@ -0,0 +1,316 @@
+/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+@import url('https://fonts.googleapis.com/css?family=Muli:300,400,600,700,800');
+*
+{
+  color: #333333;
+  font-family: 'Muli', sans-serif;
+}
+*:focus
+{
+    outline: none;
+}
+html,
+body
+{
+  margin: 0;
+  padding: 0;
+  background: #ffffff;
+  font-family: 'Muli', sans-serif;
+}
+header
+{
+  padding: 10px 35px 0 0px;
+}
+header ul
+{
+  list-style: none;
+  display: inline-block;
+}
+header ul li
+{
+  display: inline-block;
+}
+header .logo
+{
+  background: url(../images/logo.png) no-repeat;
+  background-size: cover;
+
+}
+header .brand-logo-extends
+{
+  background: url(../images/logo.png) no-repeat;
+  background-size: cover;
+  width: 154px;
+  height: 34px;
+  margin-top: 11%;
+  margin-right: 0%;
+  padding: 0;
+  position: relative !important;
+  /*margin-right: 20px;
+  margin-left: 0;
+  float: left;*/
+  /*display: inline-block;
+  */
+}
+
+nav
+{
+  height: 10px;
+}
+
+header ul li.links
+{
+  margin: 7px 10px 0 0;
+}
+header ul li > a,
+.content ul.most-menu li.items a
+{
+  color: #333333;
+  font-weight: 800;
+  font-size: 14px;
+  letter-spacing: 0.6px;
+  font-family: 'Muli', sans-serif;
+}
+header ul.navigation-right
+{
+  float: right;
+  padding-top: 8px;
+}
+header li.signup > a
+{
+  border: 2px solid #333333;
+  border-radius: 4px;
+  font-size: 14px;
+  font-weigt: 700;
+  padding: 2px 10px;
+}
+header li.signin > a
+{
+  border-bottom: 2px solid #333333;
+  font-size: 13px;
+  font-weight: 700;
+  padding: 0px 2px;
+}
+header li.option
+{
+  font-weight: 800;
+  padding: 0 10px;
+}
+header ul li > a:hover,
+header li.signin > a:hover,
+header li.signup > a:hover,
+header ul li > a:focus,
+header li.signin > a:focus,
+header li.signup > a:focus,
+.content ul.most-menu li a:hover,
+.content ul.most-menu li a:focus
+{
+  text-decoration: none;
+  cursor: pointer;
+  color: #333333;
+}
+header li.signup > a:hover
+{
+  background: #333333;
+  color: #ffffff;
+}
+.search-box
+{
+  text-align: center;
+  padding: 100px 0;
+}
+.search-box h1
+{
+  font-size: 30px;
+  letter-spacing: 2px;
+  color: #333333;
+  font-weight: 600;
+}
+form.search-form
+{
+  padding: 10px 20px;
+}
+form.search-form input.search-input
+{
+  font-weight: 400;
+  margin: 30px 0;
+  height: 80px;
+  padding: 10px 30px;
+  max-width: 800px;
+  width: 70%;
+  border-radius: 5px;
+  border: 2px solid #333333;
+  box-shadow: 0 0 15px 1px rgba(0,0,0,0.50);
+  color: #333333;
+  font-size: 22px;
+}
+
+form.search-form button.search-button
+{
+  padding: 18px 35px;
+  background: #FFF572;
+  border: 0;
+  box-shadow: 0 0 15px 1px #958F40;
+  border-radius: 1px;
+  font-size: 20px;
+  color: #393E41;
+  letter-spacing: 1px;
+  border-radius: 5px;
+  font-weight: 600;
+}
+form.search-form input:focus
+{
+  outline: none;
+}
+form.search-form input::-webkit-input-placeholder
+{
+  font-weight: 400;
+  letter-spacing: 1px;
+    color: #333333;
+}
+form.search-form input::-moz-placeholder
+{
+  font-weight: 400;
+  letter-spacing: 1px;
+    color: #333333;
+}
+form.search-form input:-moz-placeholder
+{
+  font-weight: 400;
+  letter-spacing: 5px;
+    color: #333333;
+}
+form.search-form input:-ms-input-placeholder
+{
+  font-weight: 400;
+  letter-spacing: 1px;
+    color: #333333;
+}
+.content
+{
+  height: 500px;
+  background: #f9f9f9;
+  padding: 10px 0;
+}
+.content ul.most-menu
+{
+  list-style: none;
+  text-align: center;
+  padding-bottom: 10px;
+}
+.content ul.most-menu li.items
+{
+  display: inline-block;
+  margin-right: 5px;
+  padding: 15px 25px;
+}
+.content ul.most-menu li.active
+{
+  /*background: #FFF572;*/
+}
+.content-box
+{
+  overflow: hidden;
+  padding: 20px 0 50px 0;
+  display: flex;
+  justify-content: center;
+  background: #FFFFFF;
+  box-shadow: 0 2px 3px 0 rgba(0,0,0,0.50);
+  border-bottom: 2px solid #8B19A2;
+  margin-bottom: 30px;
+}
+.content-data
+{
+  align-self: center;
+}
+.content-data h1.content-title
+{
+  font-size: 25px;
+  color: #000000;
+  letter-spacing: 1.2px;
+}
+.content-data .box
+{
+  padding: 6px 0;
+  height: 90px;
+  text-align: center;
+  border: 2px solid #4D4D4D;
+  border-radius: 2px;
+}
+.content-data .commit-icon
+{
+  width: 50px;
+  height: 50px;
+}
+.content-data .box h3.commits
+{
+  text-align: center;
+  font-size: 12px;
+  color: #333333;
+  letter-spacing: 0.03px;
+  margin-top: 1px !important;
+}
+.content-height-overwrite
+{
+  height: 110px;
+}
+.float-center-magic
+{
+  float: right;
+  position: relative;
+  left: -30%;
+}
+nav ul li:hover, nav ul li.active, nav ul li a.active, nav ul li a:hover {
+  background-color: rgb(255,245,114);
+}
+a:hover, a.active {
+  background-color: rgb(255,245,114);
+}
+footer
+{
+  font-size: 12px;
+  font-weight: 800;
+  color: #333333;
+  text-align: center;
+  padding: 20px;
+}
+.space-10
+{
+  height: 10px;
+}
+.space-30
+{
+  height: 100px;
+}
+input[type="search"]:focus:not([readonly]) {
+  transition: all 0s !important;
+  border-radius: 5px;
+  border: 2px solid #333333;
+  box-shadow: 0 0 15px 1px rgba(0,0,0,0.50);
+  color: #333333;
+}
+.gray {
+  background: rgb(249,249,249);
+}
+.custom-href
+{
+  color: #333333 !important;
+  font-family: 'Muli', sans-serif !important;
+}
+.card-title a:hover, a.active {
+  background: rgb(255,245,114);;
+}
+.dotted
+{
+  border-bottom: 1px dotted #8B19A2;
+  line-height: 250%;
+  color: #8B19A2;
+}
\ No newline at end of file
diff --git a/VNF_Catalogue/views/add_project.jade b/VNF_Catalogue/views/add_project.jade
new file mode 100644
index 00000000..c537c666
--- /dev/null
+++ b/VNF_Catalogue/views/add_project.jade
@@ -0,0 +1,164 @@
+
+.search-box-placeholder
+  script(src='/3rd_party/typeahead.js')
+  script(type='text/javascript', src='/javascripts/mode_edit.js')
+  .fixed-action-btn.fixed-action-btn_custom
+    a.btn-floating.btn-large.red
+      i.large.material-icons mode_edit
+    ul
+      li
+        a.btn-floating.red.tooltipped(href='#modal2', data-position='left', data-delay='50', data-tooltip='Add a TAG')
+          i.large.material-icons attach_file
+      li
+        a.btn-floating.green.tooltipped(href='#modal1', data-position='left', data-delay='50', data-tooltip='Add a VNF')
+          i.large.material-icons add
+      li
+        a.btn-floating.blue.tooltipped(href='#modal3', data-position='left', data-delay='50', data-tooltip='Add a TAG to a VNF')
+          i.large.material-icons share
+  #modal1.modal
+    .modal-content
+      h4.center
+        i.material-icons library_add
+        |         Add a VNF
+      .row
+        form#add_project_form.col.s12(action='/add_project', enctype='multipart/form-data', method='post')
+          .row.modal-form-row
+            .input-field.col.s12
+              input#vnf_name.validate(type='text', name='vnf_name')
+              label.left-align(for='vnf_name') Name
+          .row
+            .input-field.col.s12
+              input#repo_url.validate(type='text', name='repo_url')
+              label.left-align(for='repo_url') Github URL
+          .row
+            .input-field.col.s12
+              select#license
+                option(value='', name='license', disabled='', selected='') Choose the License
+                option(value='MIT') MIT
+                option(value='GPL') GPL
+                option(value='GPL_V2') GPL_V2
+                option(value='BSD') BSD
+                option(value='APACHE') APACHE
+              label License
+          .row
+            .input-field.col.s12
+              select#opnfv_indicator
+                option(value='', name='opnfv_indicator', disabled='', selected='') Choose the OPNFV Indicator
+                option(value='silver') silver
+                option(value='gold') gold
+                option(value='platinum') platinum
+              label OPNFV Indicator
+
+          .row
+            .file-field.input-field
+              .btn
+                span Photo (Optional)
+                input#file_upload(type='file', name='file_upload')
+              .file-path-wrapper
+                input.file-path.validate(type='text', name='file_url')
+
+          .row
+            .input-field.col.s12
+              input#submitter_id.validate(type='hidden', name='submitter_id', value=1)
+
+          .row
+            button#add_project_button.modal-action.modal-close.waves-effect.waves-light.btn.right
+              | Submit VNF
+              i.material-icons.right send
+  #modal2.modal
+    .modal-content
+      h4.center
+        i.material-icons library_add
+        |         Add a TAG
+      .row
+        form#add_tag_form.col.s12(action='/add_tag', method='post')
+          .row.modal-form-row
+            .input-field.col.s12
+              input#tag_name.validate(type='text', name='tag_name')
+              label.left-align(for='tag_name') Name
+          button#add_tag_button.modal-action.modal-close.waves-effect.waves-light.btn.right
+            | Submit TAG
+            i.material-icons.right send
+  #modal3.modal
+      h4.center
+        i.material-icons library_add
+        |         Add a TAG to a VNF
+      .row
+        form#add_vnf_tag_association_form.col.s12(action='/vnf_tag_association', method='post')
+
+          .row.modal-form-row.modal-form-row-custom
+            .input-field.col.s2 VNF Name
+            #scrollable-dropdown-menu.input-field.col.s4
+              input#vnf_name.typeahead(type='text', name='vnf_name')
+              //
+                label.left-align(for='tag_name') VNF Name
+            .input-field.col.s2 TAG Name
+            #scrollable-dropdown-menu.input-field.col.s4
+              input#tag_name.validate.typeahead(type='text', name='tag_name')
+              //
+                label.left-align(for='tag_name') TAG Name
+
+          button#add_vnf_tag_association_button.modal-action.modal-close.waves-effect.waves-light.btn.right
+            | Submit
+            i.material-icons.right send
+  style.
+    .select-dropdown{
+        overflow-y: auto !important;
+    }
+    .dropdown-content {
+        max-height: 200px !important;
+    }
+    .backdrop{
+       background-color: rgb(253,225,109);
+    }
+    .bg {
+    }
+    .modal-form-row-custom {
+      min-height: 200px !important;
+    }
+    #scrollable-dropdown-menu .tt-menu {
+      max-height: 150px;
+      overflow-y: auto;
+    }
+
+    .typeahead, .tt-query, .tt-hint {
+        border: 2px solid #CCCCCC;
+        border-radius: 8px 8px 8px 8px;
+        font-size: 24px;
+        height: 30px;
+        line-height: 30px;
+        outline: medium none;
+        padding: 8px 12px;
+        width: 396px;
+    }
+
+    .tt-query {
+        box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075) inset;
+    }
+    .tt-hint {
+        color: #999999;
+    }
+    .tt-dropdown-menu {
+        background-color: #FFFFFF;
+        border: 1px solid rgba(0, 0, 0, 0.2);
+        border-radius: 8px 8px 8px 8px;
+        box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
+        margin-top: 12px;
+        padding: 8px 0;
+        width: 200px;
+    }
+    .tt-suggestion {
+        font-size: 18px;
+        line-height: 24px;
+        padding: 3px 20px;
+    }
+    .tt-suggestion.tt-cursor {
+        background-color: #0097CF;
+        color: #FFFFFF;
+    }
+    .tt-suggestion p {
+        margin: 0;
+    }
+    .tt-dropdown-menu, .gist {
+        text-align: left;
+    }
diff --git a/VNF_Catalogue/views/edit_project.jade b/VNF_Catalogue/views/edit_project.jade
new file mode 100644
index 00000000..c5f6fbbb
--- /dev/null
+++ b/VNF_Catalogue/views/edit_project.jade
@@ -0,0 +1,159 @@
+
+.search-box-placeholder
+  script(src='/3rd_party/typeahead.js')
+  script(type='text/javascript', src='/javascripts/mode_edit_project.js')
+  .fixed-action-btn.fixed-action-btn_custom
+    a.btn-floating.btn-large.red
+      i.large.material-icons dashboard
+    ul
+      
+      li
+        a#modal_href.btn-floating.green.tooltipped(href='#modal1', data-position='left', data-delay='50', data-tooltip='Edit project details')
+          i.large.material-icons mode_edit
+  #modal1.modal
+    .modal-content
+      h4.center
+        i.material-icons library_add
+        |         Edit VNF_details
+      .row
+        form#add_project_form.col.s12(action='/add_project', enctype='multipart/form-data', method='post')
+          .row.modal-form-row
+            .input-field.col.s12
+              input#vnf_name.validate(type='text', name='vnf_name')
+              label.left-align(for='vnf_name') Name
+          .row
+            .input-field.col.s12
+              input#repo_url.validate(type='text', name='repo_url')
+              label.left-align(for='repo_url') Github URL
+          .row
+            .input-field.col.s12
+              select#license
+                option(value='', name='license', disabled='', selected='') Choose the License
+                option(value='MIT') MIT
+                option(value='GPL') GPL
+                option(value='GPL_V2') GPL_V2
+                option(value='BSD') BSD
+                option(value='APACHE') APACHE
+              label License
+          .row
+            .input-field.col.s12
+              select#opnfv_indicator
+                option(value='', name='opnfv_indicator', disabled='', selected='') Choose the OPNFV Indicator
+                option(value='silver') silver
+                option(value='gold') gold
+                option(value='platinum') platinum
+              label OPNFV Indicator
+
+          .row
+            .file-field.input-field
+              .btn
+                span Photo (Optional)
+                input#file_upload(type='file', name='file_upload')
+              .file-path-wrapper
+                input.file-path.validate(type='text', name='file_url')
+
+          .row
+            .input-field.col.s12
+              input#submitter_id.validate(type='hidden', name='submitter_id', value=1)
+
+          .row
+            button#add_project_button.modal-action.modal-close.waves-effect.waves-light.btn.right
+              | Submit VNF
+              i.material-icons.right send
+  #modal2.modal
+    .modal-content
+      h4.center
+        i.material-icons library_add
+        |         Add a TAG
+      .row
+        form#add_tag_form.col.s12(action='/add_tag', method='post')
+          .row.modal-form-row
+            .input-field.col.s12
+              input#tag_name.validate(type='text', name='tag_name')
+              label.left-align(for='tag_name') Name
+          button#add_tag_button.modal-action.modal-close.waves-effect.waves-light.btn.right
+            | Submit TAG
+            i.material-icons.right send
+  #modal3.modal
+      h4.center
+        i.material-icons library_add
+        |         Add a TAG to a VNF
+      .row
+        form#add_vnf_tag_association_form.col.s12(action='/vnf_tag_association', method='post')
+
+          .row.modal-form-row.modal-form-row-custom
+            .input-field.col.s2 VNF Name
+            #scrollable-dropdown-menu.input-field.col.s4
+              input#vnf_name.typeahead(type='text', name='vnf_name')
+              //
+                label.left-align(for='tag_name') VNF Name
+            .input-field.col.s2 TAG Name
+            #scrollable-dropdown-menu.input-field.col.s4
+              input#tag_name.validate.typeahead(type='text', name='tag_name')
+              //
+                label.left-align(for='tag_name') TAG Name
+
+          button#add_vnf_tag_association_button.modal-action.modal-close.waves-effect.waves-light.btn.right
+            | Submit
+            i.material-icons.right send
+  style.
+    .select-dropdown{
+        overflow-y: auto !important;
+    }
+    .dropdown-content {
+        max-height: 200px !important;
+    }
+    .backdrop{
+       background-color: rgb(253,225,109);
+    }
+    .bg {
+    }
+    .modal-form-row-custom {
+      min-height: 200px !important;
+    }
+    #scrollable-dropdown-menu .tt-menu {
+      max-height: 150px;
+      overflow-y: auto;
+    }
+
+    .typeahead, .tt-query, .tt-hint {
+        border: 2px solid #CCCCCC;
+        border-radius: 8px 8px 8px 8px;
+        font-size: 24px;
+        height: 30px;
+        line-height: 30px;
+        outline: medium none;
+        padding: 8px 12px;
+        width: 396px;
+    }
+
+    .tt-query {
+        box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075) inset;
+    }
+    .tt-hint {
+        color: #999999;
+    }
+    .tt-dropdown-menu {
+        background-color: #FFFFFF;
+        border: 1px solid rgba(0, 0, 0, 0.2);
+        border-radius: 8px 8px 8px 8px;
+        box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
+        margin-top: 12px;
+        padding: 8px 0;
+        width: 200px;
+    }
+    .tt-suggestion {
+        font-size: 18px;
+        line-height: 24px;
+        padding: 3px 20px;
+    }
+    .tt-suggestion.tt-cursor {
+        background-color: #0097CF;
+        color: #FFFFFF;
+    }
+    .tt-suggestion p {
+        margin: 0;
+    }
+    .tt-dropdown-menu, .gist {
+        text-align: left;
+    }
diff --git a/VNF_Catalogue/views/error.jade b/VNF_Catalogue/views/error.jade
new file mode 100644
index 00000000..4f7fbcae
--- /dev/null
+++ b/VNF_Catalogue/views/error.jade
@@ -0,0 +1,12 @@
+// 
+  Copyright (c) 2017 Kumar Rishabh and others.
+  All rights reserved. This program and the accompanying materials
+  are made available under the terms of the Apache License, Version 2.0
+  which accompanies this distribution, and is available at
+  http://www.apache.org/licenses/LICENSE-2.0
+extends layout
+
+block content
+  h1= message
+  h2= error.status
+  pre #{error.stack}
diff --git a/VNF_Catalogue/views/index.jade b/VNF_Catalogue/views/index.jade
new file mode 100644
index 00000000..8cb91615
--- /dev/null
+++ b/VNF_Catalogue/views/index.jade
@@ -0,0 +1,67 @@
+extends layout
+
+//
+  Copyright (c) 2017 Kumar Rishabh and others.
+  All rights reserved. This program and the accompanying materials
+  are made available under the terms of the Apache License, Version 2.0
+  which accompanies this distribution, and is available at
+  http://www.apache.org/licenses/LICENSE-2.0
+block content
+  link(rel='stylesheet', href='/stylesheets/3rd_party/bootstrap.css')
+  .search-box
+    h1 VNF Catalogue
+    form.search-form
+      input.search-input(type='search', placeholder='Search...', id='Tags')
+      .space-10
+      button.search-button(type='submit', value='Search', id='Search') Search
+  .content.content-height-overwrite
+    nav.z-depth-0.transparent
+      .nav-wrapper
+        ul#nav-mobile.center.float-center-magic.hide-on-med-and-down.most-menu
+          li#lines_of_code.items
+            b Most Lines of Code
+          li#no_of_developers.items
+            b Most Developers
+          li#no_of_stars.items
+            b Most Stars 
+  .content
+    .container
+      .row#content
+        each key, index in json
+          .box-container
+            .col-md-3
+              .content-box
+                .content-data
+                  h1.content-title
+                    a(href='/project_profile?vnf_id=#{key.vnf_id}') #{key.vnf_name}
+                  .box
+                    img.img-size.commit-icon(src='/uploads/#{key.photo_url}')
+                    h3.commits
+                      | #{key.lines_of_code}
+                      br
+                      | Lines Of Code
+
+    footer
+      | © 2017 XYZ Company
+      script(src='/javascripts/index_search_max.js')
+  style(type='text/css').
+    input[type="text"]:focus:not([readonly]) {
+      transition: all 0s !important;
+      border-radius: 5px;
+      border: 2px solid #333333;
+      box-shadow: 0 0 15px 1px rgba(0,0,0,0.50);
+      color: #333333;
+    }
+    .gray {
+      background: rgb(249,249,249);
+    }
+    .img-size {
+      max-width:50px;
+      max-height:50px;
+    }
+    ul#nav-mobile li {
+      display: inline;
+    }
+    .float-center-magic {
+      left: -40%;
+    }
diff --git a/VNF_Catalogue/views/index_back.jade b/VNF_Catalogue/views/index_back.jade
new file mode 100644
index 00000000..a01fd54b
--- /dev/null
+++ b/VNF_Catalogue/views/index_back.jade
@@ -0,0 +1,136 @@
+extends layout
+
+//
+  Copyright (c) 2017 Kumar Rishabh and others.
+  All rights reserved. This program and the accompanying materials
+  are made available under the terms of the Apache License, Version 2.0
+  which accompanies this distribution, and is available at
+  http://www.apache.org/licenses/LICENSE-2.0
+block content
+  link(rel='stylesheet', href='/stylesheets/3rd_party/bootstrap.css')
+  .search-box
+    h1 VNF Catalogue
+    form.search-form
+      input.search-input(type='search', placeholder='Search...', id='Tags')
+      .space-10
+      button.search-button(type='submit', value='Search', id='Search') Search
+  .content.content-height-overwrite
+    nav.z-depth-0.transparent
+      .nav-wrapper
+        ul#nav-mobile.float-center-magic.hide-on-med-and-down.most-menu
+          li.items
+            a(href='#') Most Lines of Code
+          li.items
+            a(href='#') Most Active
+          li.items
+            a(href='#') Most Active Contributions
+  .content
+    .container
+      .row
+        each key, index in json
+          .box-container
+            .col-md-3
+              .content-box
+                .content-data
+                  h1.content-title Beacon
+                  .box
+                    img.commit-icon(src='/images/3rd_party/commits.png')
+                    h3.commits
+                      | 4,845
+                      br
+                      | commits
+        //
+          .box-container
+            .col-md-3
+              .content-box
+                .content-data
+                  h1.content-title Beacon
+                  .box
+                    img.commit-icon(src='/images/3rd_party/commits.png')
+                    h3.commits
+                      | 4,845
+                      br
+                      | commits
+          .col-md-3
+            .content-box
+              .content-data
+                h1.content-title Beacon
+                .box
+                  img.commit-icon(src='/images/3rd_party/commits.png')
+                  h3.commits
+                    | 4,845
+                    br
+                    | commits
+          .col-md-3
+            .content-box
+              .content-data
+                h1.content-title Beacon
+                .box
+                  img.commit-icon(src='/images/3rd_party/commits.png')
+                  h3.commits
+                    | 4,845
+                    br
+                    | commits
+          .col-md-3
+            .content-box
+              .content-data
+                h1.content-title Beacon
+                .box
+                  img.commit-icon(src='/images/3rd_party/commits.png')
+                  h3.commits
+                    | 4,845
+                    br
+                    | commits
+          .col-md-3
+            .content-box
+              .content-data
+                h1.content-title Beacon
+                .box
+                  img.commit-icon(src='/images/3rd_party/commits.png')
+                  h3.commits
+                    | 4,845
+                    br
+                    | commits
+          .col-md-3
+            .content-box
+              .content-data
+                h1.content-title Beacon
+                .box
+                  img.commit-icon(src='/images/3rd_party/commits.png')
+                  h3.commits
+                    | 4,845
+                    br
+                    | commits
+          .col-md-3
+            .content-box
+              .content-data
+                h1.content-title Beacon
+                .box
+                  img.commit-icon(src='/images/3rd_party/commits.png')
+                  h3.commits
+                    | 4,845
+                    br
+                    | commits
+          .col-md-3
+            .content-box
+              .content-data
+                h1.content-title Beacon
+                .box
+                  img.commit-icon(src='/images/3rd_party/commits.png')
+                  h3.commits
+                    | 4,845
+                    br
+                    | commits
+    footer
+      | © 2017 XYZ Company
+  style(type='text/css').
+    input[type="text"]:focus:not([readonly]) {
+      transition: all 0s !important;
+      border-radius: 5px;
+      border: 2px solid #333333;
+      box-shadow: 0 0 15px 1px rgba(0,0,0,0.50);
+      color: #333333;
+    }
+    .gray {
+      background: rgb(249,249,249);
+    }
diff --git a/VNF_Catalogue/views/layout.jade b/VNF_Catalogue/views/layout.jade
new file mode 100644
index 00000000..33c09e33
--- /dev/null
+++ b/VNF_Catalogue/views/layout.jade
@@ -0,0 +1,54 @@
+doctype html
+//
+  Copyright (c) 2017 Kumar Rishabh and others.
+  All rights reserved. This program and the accompanying materials
+  are made available under the terms of the Apache License, Version 2.0
+  which accompanies this distribution, and is available at
+  http://www.apache.org/licenses/LICENSE-2.0
+html(lang='en')
+html
+    head
+        title= title
+        link(rel='stylesheet', href='/3rd_party/materialize/css/materialize.css')
+        script(type='text/javascript', src='https://code.jquery.com/jquery-3.1.1.min.js')
+        script(src='/javascripts/global.js')
+        script(src='/3rd_party/materialize/js/materialize.js')
+        link(href='https://fonts.googleapis.com/icon?family=Material+Icons', rel='stylesheet')
+        link(rel='stylesheet', href='/stylesheets/style.css')
+    body
+        header
+          nav.transparent.z-depth-0
+            .nav-wrapper
+              a.button-collapse(href='#', data-activates='mobile-demo')
+                i.material-icons menu
+              ul#nav-mobile.left.hide-on-med-and-down
+                li
+                  a(href='#')
+                    img.left.brand-logo.brand-logo-extends
+                li
+                  a(href='#') Projects
+                li
+                  a(href='#') People
+                li
+                  a(href='#') About
+              ul#nav-mobile.right.hide-on-med-and-down
+                li.signup
+                  a(href='#') Sign up
+                li.option or
+                li.signin
+                  a(href='#') Sign in
+              ul#mobile-demo.side-nav
+                li
+                  a(href='#') Projects
+                li
+                  a(href='#') People
+                li
+                  a(href='#') About
+                li.signup
+                  a(href='#') Sign up
+                li.signin
+                  a(href='#') Sign in
+        block search
+        block add_project
+        block content
+
diff --git a/VNF_Catalogue/views/project_profile.jade b/VNF_Catalogue/views/project_profile.jade
new file mode 100644
index 00000000..ef42a8e8
--- /dev/null
+++ b/VNF_Catalogue/views/project_profile.jade
@@ -0,0 +1,122 @@
+extends layout
+
+//
+  Copyright (c) 2017 Kumar Rishabh and others.
+  All rights reserved. This program and the accompanying materials
+  are made available under the terms of the Apache License, Version 2.0
+  which accompanies this distribution, and is available at
+  http://www.apache.org/licenses/LICENSE-2.0
+block search
+  .container-dummy
+block add_project
+  .content-dummy
+      include edit_project
+block content
+  .content.container-grey
+    each key, index in json
+      #profile-page.container
+        .row
+          .box-container
+            .col.m12
+              .content-box
+                .col.s1
+                  img.img-size(src='/uploads/#{key.photo_url}')
+                .col.s11
+                  .user-content
+                    .content-title #{key.vnf_name}
+                    .rating-box
+                      input.rating(type='radio', name='example', value='1')
+                      input.rating(type='radio', name='example', value='2')
+                      input.rating(type='radio', name='example', value='3')
+                      input.rating(type='radio', name='example', value='4')
+                      input.rating(type='radio', name='example', value='5')
+                    p.description
+                      | Github_URL:
+                      //
+                        var repo_url =  #{key.repo_url} 
+                      a(href='#{key.repo_url}') 
+                        | #{key.repo_url} 
+                      //
+                        Pellentesque sit amet leo ut tortor ultrices commodo eu id ex. Pellentesque a odio sem. Curabitur placerat a risus sed blandit. Nulla non condimentum risus. Maecenas porta lacus nec tincidunt fringilla. Integer varius augue et sem scelerisque interdum quis mollis metus. Nunc porta dui nec felis egestas, ut posuere massa blandit. Vivamus non nisi vulputate diam pharetra molestie eu ac ex. Praesent sit amet felis lacinia, bibendum ipsum ac, cursus erat.
+                    .tags
+                      each tag, index in key.tags
+                        .chip #{tag.tag_name}
+                      //
+                        .chip Varius
+                        .chip Nullam
+                        .chip Curabitur
+                        .chip Maecena
+                        .chip Varius
+                        .chip Nullam
+                        .chip Curabitur
+                        .chip Maecena
+                        .chip Varius
+                        .chip Nullam
+                        .chip Curabitur
+                        .chip Maecena
+              .col.m6
+                .card.card-shadow-custom
+                  .row
+                    ul.card-highlights
+                      li.space-10
+                      li
+                        i.material-icons code
+                        span.dotted #{key.lines_of_code}
+                        |  Lines Of Code
+                        
+                      li
+                        i.material-icons person
+                        span.dotted #{key.no_of_developers}
+                        |  Number of Developers
+                      li
+                        i.material-icons star
+                        span.dotted #{key.no_of_stars}
+                        |  Number of Stars
+                      li
+                        i.material-icons description
+                        span.dotted #{key.versions}
+                        |  Number of Versions
+              .col.m6
+                .card.card-shadow-custom
+                  .row
+                    ul.card-highlights
+                      li.space-10
+                      li
+                        span.dotted #{key.license}
+                        |  License
+                      li
+                        span.dotted #{key.opnfv_indicator}
+                        |  OPNFV Indicator
+                      li
+                        span.dotted #{key.complexity}
+                        |  Complexity
+                      li
+                        span.dotted #{key.activity}
+                        |  Activity
+              .col.m12
+                .card.card-shadow-custom
+                  .row
+                    h4 Chart goes here
+  footer
+    | © 2017 XYZ Company
+  //
+    link(rel='stylesheet', href='/stylesheets/search_projects.css')
+  style(type='text/css').
+    /*    input[type="text"]:focus:not([readonly]) {
+    transition: all 0s !important;
+    border-radius: 5px;
+    border: 2px solid #333333;
+    box-shadow: 0 0 15px 1px rgba(0,0,0,0.50);
+    color: #333333;
+    }*/
+    .gray {
+      background: rgb(249,249,249);
+    }
+  link(rel='stylesheet', href='/3rd_party/rating/rating.css', type='text/css', media='screen', title='Rating CSS')  
+  script(type='text/javascript', src='/3rd_party/rating/rating.js')
+  link(rel='stylesheet', href='/stylesheets/style_project.css', type='text/css', media='screen', title='Rating CSS')  
+  
+  script(type='text/javascript').
+    $('.rating-box').rating(function(vote, event){
+    });
+
diff --git a/VNF_Catalogue/views/search.jade b/VNF_Catalogue/views/search.jade
new file mode 100644
index 00000000..77b24881
--- /dev/null
+++ b/VNF_Catalogue/views/search.jade
@@ -0,0 +1,5 @@
+.search-box
+    link(rel='stylesheet', href='/stylesheets/search_form.css')
+    .form-group-custom.form-group.has-feedback
+      input.search-input-rest.form-control(type='search', placeholder='Search...', id='Tags')
+      i.material-icons search
\ No newline at end of file
diff --git a/VNF_Catalogue/views/search_projects.jade b/VNF_Catalogue/views/search_projects.jade
new file mode 100644
index 00000000..0a8655e9
--- /dev/null
+++ b/VNF_Catalogue/views/search_projects.jade
@@ -0,0 +1,96 @@
+extends layout
+
+//
+  Copyright (c) 2017 Kumar Rishabh and others.
+  All rights reserved. This program and the accompanying materials
+  are made available under the terms of the Apache License, Version 2.0
+  which accompanies this distribution, and is available at
+  http://www.apache.org/licenses/LICENSE-2.0
+block search
+  include search
+block add_project
+  include add_project
+block content
+  .col.s12.pagination
+    #pagination-long
+  .content#content
+    each key, index in json
+      .container.container-custom
+        .card.card-shadow-custom.horizontal
+          .row.row-custom
+            .col.s5.card-title-div-custom
+              span.card-title.card-title-span-custom 
+                a.custom-href(href='/project_profile?vnf_id=#{key.vnf_id}') 
+                  | #{key.vnf_name}
+            .col.s5.card-title-div-custom
+              i.material-icons grade
+              span.card-title PenguinScore: 42
+            .col.s2.card-title-div-custom-right
+              form(action='#')
+                input#search_result_1(type='checkbox', name='#{key.vnf_name}')
+                label(for='search_result_1') Compare
+            //
+              <div class="card-action">
+              <a href="#">This is a link</a>
+              </div>
+            .col.s4.card-image.card-image-custom
+              img.img-size.card-image-picture-custom(src='/uploads/#{key.photo_url}')
+            .col.s8.card-stacked
+              .card-content
+                p
+                  .collection.collection-custom
+                    a.collection-item(href='#!')
+                      span
+                        i.material-icons code
+                        |                             Lines Of Code: #{key.lines_of_code}
+                    a.collection-item(href='#!')
+                      span
+                        i.material-icons person
+                        |                             Number of Developers: #{key.no_of_developers}
+                    a.collection-item(href='#!')
+                      span
+                        i.material-icons star
+                        |                             Number of Stars: #{key.no_of_stars}
+                    a.collection-item(href='#!')
+                      span
+                        i.material-icons description
+                        |                             Number of Versions: #{key.versions}
+              .card-action
+                | Tags: 
+                each tag, index in key.tags
+                  .chip
+                    a.a-custom(href='/search_projects?tags=#{tag.tag_name}') #{tag.tag_name}
+                //
+                  .chip
+                    a.a-custom(href='#!') tag1
+                  .chip
+                    a.a-custom(href='#!') Tag2
+                  .chip
+                    a.a-custom(href='#!') Tag3
+                  .chip
+                    a.a-custom(href='#!') Tag4
+                  .chip
+                    a.a-custom(href='#!') Tag5
+                a.a-custom-more(href='/project_profile?vnf_id=#{key.vnf_id}') more
+            .divider
+            .card-action-custom.col.s12.card-action
+              | License: 
+              a(href='#') #{key.license}
+              | Complexity: 
+              a(href='#') Atomic
+              | Activity: 
+              a(href='#') Medium
+              | OPNFV Indicator: 
+              a(href='#') #{key.opnfv_indicator}
+  footer
+    | © 2017 XYZ Company
+    link(rel='stylesheet', href='/stylesheets/search_projects.css')
+    script(type='text/javascript', src='/3rd_party/materialize-pagination.js')
+    script(type='text/javascript', src='/javascripts/search_results.js')
+    style(type='text/css').
+      div.pagination{
+        margin-top: 1em;
+      }
+      div.pagination li {
+        width: 40px;
+      }
diff --git a/VNF_Catalogue/views/vnf_tag_association.jade b/VNF_Catalogue/views/vnf_tag_association.jade
new file mode 100644
index 00000000..c2e11601
--- /dev/null
+++ b/VNF_Catalogue/views/vnf_tag_association.jade
@@ -0,0 +1,167 @@
+doctype html
+//
+  Copyright (c) 2017 Kumar Rishabh and others.
+  All rights reserved. This program and the accompanying materials
+  are made available under the terms of the Apache License, Version 2.0
+  which accompanies this distribution, and is available at
+  http://www.apache.org/licenses/LICENSE-2.0
+html(lang='en')
+html
+  head
+    title= title
+    //
+      link(rel='stylesheet', href='/3rd_party/materialize/css/materialize.css')
+    script(type='text/javascript', src='https://code.jquery.com/jquery-3.1.1.min.js')
+    //
+      script(src='/javascripts/global.js')
+    //
+      script(src='/3rd_party/materialize/js/materialize.js')
+    link(href='https://fonts.googleapis.com/icon?family=Material+Icons', rel='stylesheet')
+    link(rel='stylesheet', href='/stylesheets/style.css')
+    script(src='/3rd_party/typeahead.js')
+    script(src='/javascripts/mode_edit.js')
+  body
+    h4.center
+    i.material-icons library_add
+    |         Add a TAG to a VNF
+    .row
+    form#add_tag_form.col.s12(action='/add_tag', method='post')
+      .row.modal-form-row
+          .input-field.col.s6 VNF Name
+          .input-field.col.s6 TAG Name
+      .row.modal-form-row
+        #scrollable-dropdown-menu.input-field.col.s6
+          input#tag_name.typeahead(type='text', name='tag_name')
+          //
+            label.left-align(for='tag_name') VNF Name
+
+        .input-field.col.s6
+          input#tag_name.validate(type='text', name='vnf_name')
+          //
+            label.left-align(for='tag_name') TAG Name
+      .row.modal-form-row
+          .input-field.col.s6
+          .input-field.col.s6
+      .row.modal-form-row
+      button#add_tag_button.modal-action.modal-close.waves-effect.waves-light.btn.right
+        | Submit
+        i.material-icons.right send
+style.
+  #scrollable-dropdown-menu .tt-menu {
+    max-height: 150px;
+    overflow-y: auto;
+  }
+
+  .typeahead, .tt-query, .tt-hint {
+      border: 2px solid #CCCCCC;
+      border-radius: 8px 8px 8px 8px;
+      font-size: 24px;
+      height: 30px;
+      line-height: 30px;
+      outline: medium none;
+      padding: 8px 12px;
+      width: 396px;
+  }
+  .typeahead {
+      background-color: #FFFFFF;
+  }
+  .typeahead:focus {
+      border: 2px solid #0097CF;
+  }
+  .tt-query {
+      box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075) inset;
+  }
+  .tt-hint {
+      color: #999999;
+  }
+  .tt-dropdown-menu {
+      background-color: #FFFFFF;
+      border: 1px solid rgba(0, 0, 0, 0.2);
+      border-radius: 8px 8px 8px 8px;
+      box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
+      margin-top: 12px;
+      padding: 8px 0;
+      width: 422px;
+  }
+  .tt-suggestion {
+      font-size: 18px;
+      line-height: 24px;
+      padding: 3px 20px;
+  }
+  .tt-suggestion.tt-cursor {
+      background-color: #0097CF;
+      color: #FFFFFF;
+  }
+  .tt-suggestion p {
+      margin: 0;
+  }
+  .tt-dropdown-menu, .gist {
+      text-align: left;
+  }
+  /*
+  html {
+      overflow-y: scroll;
+  }
+  .container {
+      margin: 0 auto;
+      max-width: 750px;
+      text-align: center;
+  }
+
+  html {
+      color: #333333;
+      font-family:"Helvetica Neue", Helvetica, Arial, sans-serif;
+      font-size: 18px;
+      line-height: 1.2;
+  }
+  .title, .example-name {
+      font-family: Prociono;
+  }
+  p {
+      margin: 0 0 10px;
+  }
+  .title {
+      font-size: 64px;
+      margin: 20px 0 0;
+  }
+  .example {
+      padding: 30px 0;
+  }
+  .example-name {
+      font-size: 32px;
+      margin: 20px 0;
+  }
+  .demo {
+      margin: 50px 0;
+      position: relative;
+  }
+  */
+  /*
+  .gist {
+      font-size: 14px;
+  }
+  .example-twitter-oss .tt-suggestion {
+      padding: 8px 20px;
+  }
+  .example-twitter-oss .tt-suggestion + .tt-suggestion {
+      border-top: 1px solid #CCCCCC;
+  }
+  .example-twitter-oss .repo-language {
+      float: right;
+      font-style: italic;
+  }
+  .example-twitter-oss .repo-name {
+      font-weight: bold;
+  }
+  .example-twitter-oss .repo-description {
+      font-size: 14px;
+  }
+  .example-sports .league-name {
+      border-bottom: 1px solid #CCCCCC;
+      margin: 0 20px 5px;
+      padding: 3px 0;
+  }
+  .example-arabic .tt-dropdown-menu {
+      text-align: right;
+  }
+  */