diff options
author | Kumar Rishabh <shailrishabh@gmail.com> | 2017-06-29 11:54:06 +0530 |
---|---|---|
committer | Deepak S <deepak.s@linux.intel.com> | 2017-07-21 06:20:14 +0000 |
commit | 1f6b18a1974c1b53a079b21b6be39af86deb2432 (patch) | |
tree | 7a9eba2bf86ea1ee651836dbf58ac998d4a92933 /VNF_Catalogue/public/3rd_party/materialize/js/materialize.js | |
parent | b8351286a53658bee2471430aaafac4eb72bdfde (diff) |
VNF_Catalogue Codebase
Catalogue of Open Source VNFs consist in helping the end users to get
information of the VNF we can deploy on top of an OPNFV solution
[Deepak]: Removed all swp files.
Change-Id: Ib2ea7330e964f1b684f32aedf631accd580df968
Signed-off-by: Kumar Rishabh <shailrishabh@gmail.com>
Signed-off-by: Deepak S <deepak.s@linux.intel.com>
Diffstat (limited to 'VNF_Catalogue/public/3rd_party/materialize/js/materialize.js')
-rw-r--r-- | VNF_Catalogue/public/3rd_party/materialize/js/materialize.js | 8031 |
1 files changed, 8031 insertions, 0 deletions
diff --git a/VNF_Catalogue/public/3rd_party/materialize/js/materialize.js b/VNF_Catalogue/public/3rd_party/materialize/js/materialize.js new file mode 100644 index 00000000..8c994c46 --- /dev/null +++ b/VNF_Catalogue/public/3rd_party/materialize/js/materialize.js @@ -0,0 +1,8031 @@ +/*! + * Materialize v0.98.0 (http://materializecss.com) + * Copyright 2014-2015 Materialize + * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) + */ +// Check for jQuery. +if (typeof(jQuery) === 'undefined') { + var jQuery; + // Check if require is a defined function. + if (typeof(require) === 'function') { + jQuery = $ = require('jquery'); + // Else use the dollar sign alias. + } else { + jQuery = $; + } +} +;/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright © 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +jQuery.easing['jswing'] = jQuery.easing['swing']; + +jQuery.extend( jQuery.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert(jQuery.easing.default); + return jQuery.easing[jQuery.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - jQuery.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return jQuery.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return jQuery.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright © 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */;// Custom Easing +jQuery.extend( jQuery.easing, +{ + easeInOutMaterial: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return c/4*((t-=2)*t*t + 2) + b; + } +});;/*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */ +/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */ +/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */ +jQuery.Velocity?console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity."):(!function(e){function t(e){var t=e.length,a=r.type(e);return"function"===a||r.isWindow(e)?!1:1===e.nodeType&&t?!0:"array"===a||0===t||"number"==typeof t&&t>0&&t-1 in e}if(!e.jQuery){var r=function(e,t){return new r.fn.init(e,t)};r.isWindow=function(e){return null!=e&&e==e.window},r.type=function(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[i.call(e)]||"object":typeof e},r.isArray=Array.isArray||function(e){return"array"===r.type(e)},r.isPlainObject=function(e){var t;if(!e||"object"!==r.type(e)||e.nodeType||r.isWindow(e))return!1;try{if(e.constructor&&!o.call(e,"constructor")&&!o.call(e.constructor.prototype,"isPrototypeOf"))return!1}catch(a){return!1}for(t in e);return void 0===t||o.call(e,t)},r.each=function(e,r,a){var n,o=0,i=e.length,s=t(e);if(a){if(s)for(;i>o&&(n=r.apply(e[o],a),n!==!1);o++);else for(o in e)if(n=r.apply(e[o],a),n===!1)break}else if(s)for(;i>o&&(n=r.call(e[o],o,e[o]),n!==!1);o++);else for(o in e)if(n=r.call(e[o],o,e[o]),n===!1)break;return e},r.data=function(e,t,n){if(void 0===n){var o=e[r.expando],i=o&&a[o];if(void 0===t)return i;if(i&&t in i)return i[t]}else if(void 0!==t){var o=e[r.expando]||(e[r.expando]=++r.uuid);return a[o]=a[o]||{},a[o][t]=n,n}},r.removeData=function(e,t){var n=e[r.expando],o=n&&a[n];o&&r.each(t,function(e,t){delete o[t]})},r.extend=function(){var e,t,a,n,o,i,s=arguments[0]||{},l=1,u=arguments.length,c=!1;for("boolean"==typeof s&&(c=s,s=arguments[l]||{},l++),"object"!=typeof s&&"function"!==r.type(s)&&(s={}),l===u&&(s=this,l--);u>l;l++)if(null!=(o=arguments[l]))for(n in o)e=s[n],a=o[n],s!==a&&(c&&a&&(r.isPlainObject(a)||(t=r.isArray(a)))?(t?(t=!1,i=e&&r.isArray(e)?e:[]):i=e&&r.isPlainObject(e)?e:{},s[n]=r.extend(c,i,a)):void 0!==a&&(s[n]=a));return s},r.queue=function(e,a,n){function o(e,r){var a=r||[];return null!=e&&(t(Object(e))?!function(e,t){for(var r=+t.length,a=0,n=e.length;r>a;)e[n++]=t[a++];if(r!==r)for(;void 0!==t[a];)e[n++]=t[a++];return e.length=n,e}(a,"string"==typeof e?[e]:e):[].push.call(a,e)),a}if(e){a=(a||"fx")+"queue";var i=r.data(e,a);return n?(!i||r.isArray(n)?i=r.data(e,a,o(n)):i.push(n),i):i||[]}},r.dequeue=function(e,t){r.each(e.nodeType?[e]:e,function(e,a){t=t||"fx";var n=r.queue(a,t),o=n.shift();"inprogress"===o&&(o=n.shift()),o&&("fx"===t&&n.unshift("inprogress"),o.call(a,function(){r.dequeue(a,t)}))})},r.fn=r.prototype={init:function(e){if(e.nodeType)return this[0]=e,this;throw new Error("Not a DOM node.")},offset:function(){var t=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:t.top+(e.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:t.left+(e.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function e(){for(var e=this.offsetParent||document;e&&"html"===!e.nodeType.toLowerCase&&"static"===e.style.position;)e=e.offsetParent;return e||document}var t=this[0],e=e.apply(t),a=this.offset(),n=/^(?:body|html)$/i.test(e.nodeName)?{top:0,left:0}:r(e).offset();return a.top-=parseFloat(t.style.marginTop)||0,a.left-=parseFloat(t.style.marginLeft)||0,e.style&&(n.top+=parseFloat(e.style.borderTopWidth)||0,n.left+=parseFloat(e.style.borderLeftWidth)||0),{top:a.top-n.top,left:a.left-n.left}}};var a={};r.expando="velocity"+(new Date).getTime(),r.uuid=0;for(var n={},o=n.hasOwnProperty,i=n.toString,s="Boolean Number String Function Array Date RegExp Object Error".split(" "),l=0;l<s.length;l++)n["[object "+s[l]+"]"]=s[l].toLowerCase();r.fn.init.prototype=r.fn,e.Velocity={Utilities:r}}}(window),function(e){"object"==typeof module&&"object"==typeof module.exports?module.exports=e():"function"==typeof define&&define.amd?define(e):e()}(function(){return function(e,t,r,a){function n(e){for(var t=-1,r=e?e.length:0,a=[];++t<r;){var n=e[t];n&&a.push(n)}return a}function o(e){return m.isWrapped(e)?e=[].slice.call(e):m.isNode(e)&&(e=[e]),e}function i(e){var t=f.data(e,"velocity");return null===t?a:t}function s(e){return function(t){return Math.round(t*e)*(1/e)}}function l(e,r,a,n){function o(e,t){return 1-3*t+3*e}function i(e,t){return 3*t-6*e}function s(e){return 3*e}function l(e,t,r){return((o(t,r)*e+i(t,r))*e+s(t))*e}function u(e,t,r){return 3*o(t,r)*e*e+2*i(t,r)*e+s(t)}function c(t,r){for(var n=0;m>n;++n){var o=u(r,e,a);if(0===o)return r;var i=l(r,e,a)-t;r-=i/o}return r}function p(){for(var t=0;b>t;++t)w[t]=l(t*x,e,a)}function f(t,r,n){var o,i,s=0;do i=r+(n-r)/2,o=l(i,e,a)-t,o>0?n=i:r=i;while(Math.abs(o)>h&&++s<v);return i}function d(t){for(var r=0,n=1,o=b-1;n!=o&&w[n]<=t;++n)r+=x;--n;var i=(t-w[n])/(w[n+1]-w[n]),s=r+i*x,l=u(s,e,a);return l>=y?c(t,s):0==l?s:f(t,r,r+x)}function g(){V=!0,(e!=r||a!=n)&&p()}var m=4,y=.001,h=1e-7,v=10,b=11,x=1/(b-1),S="Float32Array"in t;if(4!==arguments.length)return!1;for(var P=0;4>P;++P)if("number"!=typeof arguments[P]||isNaN(arguments[P])||!isFinite(arguments[P]))return!1;e=Math.min(e,1),a=Math.min(a,1),e=Math.max(e,0),a=Math.max(a,0);var w=S?new Float32Array(b):new Array(b),V=!1,C=function(t){return V||g(),e===r&&a===n?t:0===t?0:1===t?1:l(d(t),r,n)};C.getControlPoints=function(){return[{x:e,y:r},{x:a,y:n}]};var T="generateBezier("+[e,r,a,n]+")";return C.toString=function(){return T},C}function u(e,t){var r=e;return m.isString(e)?b.Easings[e]||(r=!1):r=m.isArray(e)&&1===e.length?s.apply(null,e):m.isArray(e)&&2===e.length?x.apply(null,e.concat([t])):m.isArray(e)&&4===e.length?l.apply(null,e):!1,r===!1&&(r=b.Easings[b.defaults.easing]?b.defaults.easing:v),r}function c(e){if(e){var t=(new Date).getTime(),r=b.State.calls.length;r>1e4&&(b.State.calls=n(b.State.calls));for(var o=0;r>o;o++)if(b.State.calls[o]){var s=b.State.calls[o],l=s[0],u=s[2],d=s[3],g=!!d,y=null;d||(d=b.State.calls[o][3]=t-16);for(var h=Math.min((t-d)/u.duration,1),v=0,x=l.length;x>v;v++){var P=l[v],V=P.element;if(i(V)){var C=!1;if(u.display!==a&&null!==u.display&&"none"!==u.display){if("flex"===u.display){var T=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];f.each(T,function(e,t){S.setPropertyValue(V,"display",t)})}S.setPropertyValue(V,"display",u.display)}u.visibility!==a&&"hidden"!==u.visibility&&S.setPropertyValue(V,"visibility",u.visibility);for(var k in P)if("element"!==k){var A,F=P[k],j=m.isString(F.easing)?b.Easings[F.easing]:F.easing;if(1===h)A=F.endValue;else{var E=F.endValue-F.startValue;if(A=F.startValue+E*j(h,u,E),!g&&A===F.currentValue)continue}if(F.currentValue=A,"tween"===k)y=A;else{if(S.Hooks.registered[k]){var H=S.Hooks.getRoot(k),N=i(V).rootPropertyValueCache[H];N&&(F.rootPropertyValue=N)}var L=S.setPropertyValue(V,k,F.currentValue+(0===parseFloat(A)?"":F.unitType),F.rootPropertyValue,F.scrollData);S.Hooks.registered[k]&&(i(V).rootPropertyValueCache[H]=S.Normalizations.registered[H]?S.Normalizations.registered[H]("extract",null,L[1]):L[1]),"transform"===L[0]&&(C=!0)}}u.mobileHA&&i(V).transformCache.translate3d===a&&(i(V).transformCache.translate3d="(0px, 0px, 0px)",C=!0),C&&S.flushTransformCache(V)}}u.display!==a&&"none"!==u.display&&(b.State.calls[o][2].display=!1),u.visibility!==a&&"hidden"!==u.visibility&&(b.State.calls[o][2].visibility=!1),u.progress&&u.progress.call(s[1],s[1],h,Math.max(0,d+u.duration-t),d,y),1===h&&p(o)}}b.State.isTicking&&w(c)}function p(e,t){if(!b.State.calls[e])return!1;for(var r=b.State.calls[e][0],n=b.State.calls[e][1],o=b.State.calls[e][2],s=b.State.calls[e][4],l=!1,u=0,c=r.length;c>u;u++){var p=r[u].element;if(t||o.loop||("none"===o.display&&S.setPropertyValue(p,"display",o.display),"hidden"===o.visibility&&S.setPropertyValue(p,"visibility",o.visibility)),o.loop!==!0&&(f.queue(p)[1]===a||!/\.velocityQueueEntryFlag/i.test(f.queue(p)[1]))&&i(p)){i(p).isAnimating=!1,i(p).rootPropertyValueCache={};var d=!1;f.each(S.Lists.transforms3D,function(e,t){var r=/^scale/.test(t)?1:0,n=i(p).transformCache[t];i(p).transformCache[t]!==a&&new RegExp("^\\("+r+"[^.]").test(n)&&(d=!0,delete i(p).transformCache[t])}),o.mobileHA&&(d=!0,delete i(p).transformCache.translate3d),d&&S.flushTransformCache(p),S.Values.removeClass(p,"velocity-animating")}if(!t&&o.complete&&!o.loop&&u===c-1)try{o.complete.call(n,n)}catch(g){setTimeout(function(){throw g},1)}s&&o.loop!==!0&&s(n),i(p)&&o.loop===!0&&!t&&(f.each(i(p).tweensContainer,function(e,t){/^rotate/.test(e)&&360===parseFloat(t.endValue)&&(t.endValue=0,t.startValue=360),/^backgroundPosition/.test(e)&&100===parseFloat(t.endValue)&&"%"===t.unitType&&(t.endValue=0,t.startValue=100)}),b(p,"reverse",{loop:!0,delay:o.delay})),o.queue!==!1&&f.dequeue(p,o.queue)}b.State.calls[e]=!1;for(var m=0,y=b.State.calls.length;y>m;m++)if(b.State.calls[m]!==!1){l=!0;break}l===!1&&(b.State.isTicking=!1,delete b.State.calls,b.State.calls=[])}var f,d=function(){if(r.documentMode)return r.documentMode;for(var e=7;e>4;e--){var t=r.createElement("div");if(t.innerHTML="<!--[if IE "+e+"]><span></span><![endif]-->",t.getElementsByTagName("span").length)return t=null,e}return a}(),g=function(){var e=0;return t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||function(t){var r,a=(new Date).getTime();return r=Math.max(0,16-(a-e)),e=a+r,setTimeout(function(){t(a+r)},r)}}(),m={isString:function(e){return"string"==typeof e},isArray:Array.isArray||function(e){return"[object Array]"===Object.prototype.toString.call(e)},isFunction:function(e){return"[object Function]"===Object.prototype.toString.call(e)},isNode:function(e){return e&&e.nodeType},isNodeList:function(e){return"object"==typeof e&&/^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e))&&e.length!==a&&(0===e.length||"object"==typeof e[0]&&e[0].nodeType>0)},isWrapped:function(e){return e&&(e.jquery||t.Zepto&&t.Zepto.zepto.isZ(e))},isSVG:function(e){return t.SVGElement&&e instanceof t.SVGElement},isEmptyObject:function(e){for(var t in e)return!1;return!0}},y=!1;if(e.fn&&e.fn.jquery?(f=e,y=!0):f=t.Velocity.Utilities,8>=d&&!y)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if(7>=d)return void(jQuery.fn.velocity=jQuery.fn.animate);var h=400,v="swing",b={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:t.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:r.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:f,Redirects:{},Easings:{},Promise:t.Promise,defaults:{queue:"",duration:h,easing:v,begin:a,complete:a,progress:a,display:a,visibility:a,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(e){f.data(e,"velocity",{isSVG:m.isSVG(e),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};t.pageYOffset!==a?(b.State.scrollAnchor=t,b.State.scrollPropertyLeft="pageXOffset",b.State.scrollPropertyTop="pageYOffset"):(b.State.scrollAnchor=r.documentElement||r.body.parentNode||r.body,b.State.scrollPropertyLeft="scrollLeft",b.State.scrollPropertyTop="scrollTop");var x=function(){function e(e){return-e.tension*e.x-e.friction*e.v}function t(t,r,a){var n={x:t.x+a.dx*r,v:t.v+a.dv*r,tension:t.tension,friction:t.friction};return{dx:n.v,dv:e(n)}}function r(r,a){var n={dx:r.v,dv:e(r)},o=t(r,.5*a,n),i=t(r,.5*a,o),s=t(r,a,i),l=1/6*(n.dx+2*(o.dx+i.dx)+s.dx),u=1/6*(n.dv+2*(o.dv+i.dv)+s.dv);return r.x=r.x+l*a,r.v=r.v+u*a,r}return function a(e,t,n){var o,i,s,l={x:-1,v:0,tension:null,friction:null},u=[0],c=0,p=1e-4,f=.016;for(e=parseFloat(e)||500,t=parseFloat(t)||20,n=n||null,l.tension=e,l.friction=t,o=null!==n,o?(c=a(e,t),i=c/n*f):i=f;s=r(s||l,i),u.push(1+s.x),c+=16,Math.abs(s.x)>p&&Math.abs(s.v)>p;);return o?function(e){return u[e*(u.length-1)|0]}:c}}();b.Easings={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},spring:function(e){return 1-Math.cos(4.5*e*Math.PI)*Math.exp(6*-e)}},f.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(e,t){b.Easings[t[0]]=l.apply(null,t[1])});var S=b.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(var e=0;e<S.Lists.colors.length;e++){var t="color"===S.Lists.colors[e]?"0 0 0 1":"255 255 255 1";S.Hooks.templates[S.Lists.colors[e]]=["Red Green Blue Alpha",t]}var r,a,n;if(d)for(r in S.Hooks.templates){a=S.Hooks.templates[r],n=a[0].split(" ");var o=a[1].match(S.RegEx.valueSplit);"Color"===n[0]&&(n.push(n.shift()),o.push(o.shift()),S.Hooks.templates[r]=[n.join(" "),o.join(" ")])}for(r in S.Hooks.templates){a=S.Hooks.templates[r],n=a[0].split(" ");for(var e in n){var i=r+n[e],s=e;S.Hooks.registered[i]=[r,s]}}},getRoot:function(e){var t=S.Hooks.registered[e];return t?t[0]:e},cleanRootPropertyValue:function(e,t){return S.RegEx.valueUnwrap.test(t)&&(t=t.match(S.RegEx.valueUnwrap)[1]),S.Values.isCSSNullValue(t)&&(t=S.Hooks.templates[e][1]),t},extractValue:function(e,t){var r=S.Hooks.registered[e];if(r){var a=r[0],n=r[1];return t=S.Hooks.cleanRootPropertyValue(a,t),t.toString().match(S.RegEx.valueSplit)[n]}return t},injectValue:function(e,t,r){var a=S.Hooks.registered[e];if(a){var n,o,i=a[0],s=a[1];return r=S.Hooks.cleanRootPropertyValue(i,r),n=r.toString().match(S.RegEx.valueSplit),n[s]=t,o=n.join(" ")}return r}},Normalizations:{registered:{clip:function(e,t,r){switch(e){case"name":return"clip";case"extract":var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r)?a=r:(a=r.toString().match(S.RegEx.valueUnwrap),a=a?a[1].replace(/,(\s+)?/g," "):r),a;case"inject":return"rect("+r+")"}},blur:function(e,t,r){switch(e){case"name":return b.State.isFirefox?"filter":"-webkit-filter";case"extract":var a=parseFloat(r);if(!a&&0!==a){var n=r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a=n?n[1]:0}return a;case"inject":return parseFloat(r)?"blur("+r+")":"none"}},opacity:function(e,t,r){if(8>=d)switch(e){case"name":return"filter";case"extract":var a=r.toString().match(/alpha\(opacity=(.*)\)/i);return r=a?a[1]/100:1;case"inject":return t.style.zoom=1,parseFloat(r)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(r),10)+")"}else switch(e){case"name":return"opacity";case"extract":return r;case"inject":return r}}},register:function(){9>=d||b.State.isGingerbread||(S.Lists.transformsBase=S.Lists.transformsBase.concat(S.Lists.transforms3D));for(var e=0;e<S.Lists.transformsBase.length;e++)!function(){var t=S.Lists.transformsBase[e];S.Normalizations.registered[t]=function(e,r,n){switch(e){case"name":return"transform";case"extract":return i(r)===a||i(r).transformCache[t]===a?/^scale/i.test(t)?1:0:i(r).transformCache[t].replace(/[()]/g,"");case"inject":var o=!1;switch(t.substr(0,t.length-1)){case"translate":o=!/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case"scal":case"scale":b.State.isAndroid&&i(r).transformCache[t]===a&&1>n&&(n=1),o=!/(\d)$/i.test(n);break;case"skew":o=!/(deg|\d)$/i.test(n);break;case"rotate":o=!/(deg|\d)$/i.test(n)}return o||(i(r).transformCache[t]="("+n+")"),i(r).transformCache[t]}}}();for(var e=0;e<S.Lists.colors.length;e++)!function(){var t=S.Lists.colors[e];S.Normalizations.registered[t]=function(e,r,n){switch(e){case"name":return t;case"extract":var o;if(S.RegEx.wrappedValueAlreadyExtracted.test(n))o=n;else{var i,s={black:"rgb(0, 0, 0)",blue:"rgb(0, 0, 255)",gray:"rgb(128, 128, 128)",green:"rgb(0, 128, 0)",red:"rgb(255, 0, 0)",white:"rgb(255, 255, 255)"};/^[A-z]+$/i.test(n)?i=s[n]!==a?s[n]:s.black:S.RegEx.isHex.test(n)?i="rgb("+S.Values.hexToRgb(n).join(" ")+")":/^rgba?\(/i.test(n)||(i=s.black),o=(i||n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g," ")}return 8>=d||3!==o.split(" ").length||(o+=" 1"),o;case"inject":return 8>=d?4===n.split(" ").length&&(n=n.split(/\s+/).slice(0,3).join(" ")):3===n.split(" ").length&&(n+=" 1"),(8>=d?"rgb":"rgba")+"("+n.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(e){return e.replace(/-(\w)/g,function(e,t){return t.toUpperCase()})},SVGAttribute:function(e){var t="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(d||b.State.isAndroid&&!b.State.isChrome)&&(t+="|transform"),new RegExp("^("+t+")$","i").test(e)},prefixCheck:function(e){if(b.State.prefixMatches[e])return[b.State.prefixMatches[e],!0];for(var t=["","Webkit","Moz","ms","O"],r=0,a=t.length;a>r;r++){var n;if(n=0===r?e:t[r]+e.replace(/^\w/,function(e){return e.toUpperCase()}),m.isString(b.State.prefixElement.style[n]))return b.State.prefixMatches[e]=n,[n,!0]}return[e,!1]}},Values:{hexToRgb:function(e){var t,r=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,a=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e=e.replace(r,function(e,t,r,a){return t+t+r+r+a+a}),t=a.exec(e),t?[parseInt(t[1],16),parseInt(t[2],16),parseInt(t[3],16)]:[0,0,0]},isCSSNullValue:function(e){return 0==e||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e)},getUnitType:function(e){return/^(rotate|skew)/i.test(e)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e)?"":"px"},getDisplayType:function(e){var t=e&&e.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t)?"inline":/^(li)$/i.test(t)?"list-item":/^(tr)$/i.test(t)?"table-row":/^(table)$/i.test(t)?"table":/^(tbody)$/i.test(t)?"table-row-group":"block"},addClass:function(e,t){e.classList?e.classList.add(t):e.className+=(e.className.length?" ":"")+t},removeClass:function(e,t){e.classList?e.classList.remove(t):e.className=e.className.toString().replace(new RegExp("(^|\\s)"+t.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(e,r,n,o){function s(e,r){function n(){u&&S.setPropertyValue(e,"display","none")}var l=0;if(8>=d)l=f.css(e,r);else{var u=!1;if(/^(width|height)$/.test(r)&&0===S.getPropertyValue(e,"display")&&(u=!0,S.setPropertyValue(e,"display",S.Values.getDisplayType(e))),!o){if("height"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var c=e.offsetHeight-(parseFloat(S.getPropertyValue(e,"borderTopWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderBottomWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingTop"))||0)-(parseFloat(S.getPropertyValue(e,"paddingBottom"))||0);return n(),c}if("width"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var p=e.offsetWidth-(parseFloat(S.getPropertyValue(e,"borderLeftWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderRightWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingLeft"))||0)-(parseFloat(S.getPropertyValue(e,"paddingRight"))||0);return n(),p}}var g;g=i(e)===a?t.getComputedStyle(e,null):i(e).computedStyle?i(e).computedStyle:i(e).computedStyle=t.getComputedStyle(e,null),"borderColor"===r&&(r="borderTopColor"),l=9===d&&"filter"===r?g.getPropertyValue(r):g[r],(""===l||null===l)&&(l=e.style[r]),n()}if("auto"===l&&/^(top|right|bottom|left)$/i.test(r)){var m=s(e,"position");("fixed"===m||"absolute"===m&&/top|left/i.test(r))&&(l=f(e).position()[r]+"px")}return l}var l;if(S.Hooks.registered[r]){var u=r,c=S.Hooks.getRoot(u);n===a&&(n=S.getPropertyValue(e,S.Names.prefixCheck(c)[0])),S.Normalizations.registered[c]&&(n=S.Normalizations.registered[c]("extract",e,n)),l=S.Hooks.extractValue(u,n)}else if(S.Normalizations.registered[r]){var p,g;p=S.Normalizations.registered[r]("name",e),"transform"!==p&&(g=s(e,S.Names.prefixCheck(p)[0]),S.Values.isCSSNullValue(g)&&S.Hooks.templates[r]&&(g=S.Hooks.templates[r][1])),l=S.Normalizations.registered[r]("extract",e,g)}if(!/^[\d-]/.test(l))if(i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r))if(/^(height|width)$/i.test(r))try{l=e.getBBox()[r]}catch(m){l=0}else l=e.getAttribute(r);else l=s(e,S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l)&&(l=0),b.debug>=2&&console.log("Get "+r+": "+l),l},setPropertyValue:function(e,r,a,n,o){var s=r;if("scroll"===r)o.container?o.container["scroll"+o.direction]=a:"Left"===o.direction?t.scrollTo(a,o.alternateValue):t.scrollTo(o.alternateValue,a);else if(S.Normalizations.registered[r]&&"transform"===S.Normalizations.registered[r]("name",e))S.Normalizations.registered[r]("inject",e,a),s="transform",a=i(e).transformCache[r];else{if(S.Hooks.registered[r]){var l=r,u=S.Hooks.getRoot(r);n=n||S.getPropertyValue(e,u),a=S.Hooks.injectValue(l,a,n),r=u}if(S.Normalizations.registered[r]&&(a=S.Normalizations.registered[r]("inject",e,a),r=S.Normalizations.registered[r]("name",e)),s=S.Names.prefixCheck(r)[0],8>=d)try{e.style[s]=a}catch(c){b.debug&&console.log("Browser does not support ["+a+"] for ["+s+"]")}else i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r)?e.setAttribute(r,a):e.style[s]=a;b.debug>=2&&console.log("Set "+r+" ("+s+"): "+a)}return[s,a]},flushTransformCache:function(e){function t(t){return parseFloat(S.getPropertyValue(e,t))}var r="";if((d||b.State.isAndroid&&!b.State.isChrome)&&i(e).isSVG){var a={translate:[t("translateX"),t("translateY")],skewX:[t("skewX")],skewY:[t("skewY")],scale:1!==t("scale")?[t("scale"),t("scale")]:[t("scaleX"),t("scaleY")],rotate:[t("rotateZ"),0,0]};f.each(i(e).transformCache,function(e){/^translate/i.test(e)?e="translate":/^scale/i.test(e)?e="scale":/^rotate/i.test(e)&&(e="rotate"),a[e]&&(r+=e+"("+a[e].join(" ")+") ",delete a[e])})}else{var n,o;f.each(i(e).transformCache,function(t){return n=i(e).transformCache[t],"transformPerspective"===t?(o=n,!0):(9===d&&"rotateZ"===t&&(t="rotate"),void(r+=t+n+" "))}),o&&(r="perspective"+o+" "+r)}S.setPropertyValue(e,"transform",r)}};S.Hooks.register(),S.Normalizations.register(),b.hook=function(e,t,r){var n=a;return e=o(e),f.each(e,function(e,o){if(i(o)===a&&b.init(o),r===a)n===a&&(n=b.CSS.getPropertyValue(o,t));else{var s=b.CSS.setPropertyValue(o,t,r);"transform"===s[0]&&b.CSS.flushTransformCache(o),n=s}}),n};var P=function(){function e(){return s?k.promise||null:l}function n(){function e(e){function p(e,t){var r=a,n=a,i=a;return m.isArray(e)?(r=e[0],!m.isArray(e[1])&&/^[\d-]/.test(e[1])||m.isFunction(e[1])||S.RegEx.isHex.test(e[1])?i=e[1]:(m.isString(e[1])&&!S.RegEx.isHex.test(e[1])||m.isArray(e[1]))&&(n=t?e[1]:u(e[1],s.duration),e[2]!==a&&(i=e[2]))):r=e,t||(n=n||s.easing),m.isFunction(r)&&(r=r.call(o,V,w)),m.isFunction(i)&&(i=i.call(o,V,w)),[r||0,n,i]}function d(e,t){var r,a;return a=(t||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(e){return r=e,""}),r||(r=S.Values.getUnitType(e)),[a,r]}function h(){var e={myParent:o.parentNode||r.body,position:S.getPropertyValue(o,"position"),fontSize:S.getPropertyValue(o,"fontSize")},a=e.position===L.lastPosition&&e.myParent===L.lastParent,n=e.fontSize===L.lastFontSize;L.lastParent=e.myParent,L.lastPosition=e.position,L.lastFontSize=e.fontSize;var s=100,l={};if(n&&a)l.emToPx=L.lastEmToPx,l.percentToPxWidth=L.lastPercentToPxWidth,l.percentToPxHeight=L.lastPercentToPxHeight;else{var u=i(o).isSVG?r.createElementNS("http://www.w3.org/2000/svg","rect"):r.createElement("div");b.init(u),e.myParent.appendChild(u),f.each(["overflow","overflowX","overflowY"],function(e,t){b.CSS.setPropertyValue(u,t,"hidden")}),b.CSS.setPropertyValue(u,"position",e.position),b.CSS.setPropertyValue(u,"fontSize",e.fontSize),b.CSS.setPropertyValue(u,"boxSizing","content-box"),f.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(e,t){b.CSS.setPropertyValue(u,t,s+"%")}),b.CSS.setPropertyValue(u,"paddingLeft",s+"em"),l.percentToPxWidth=L.lastPercentToPxWidth=(parseFloat(S.getPropertyValue(u,"width",null,!0))||1)/s,l.percentToPxHeight=L.lastPercentToPxHeight=(parseFloat(S.getPropertyValue(u,"height",null,!0))||1)/s,l.emToPx=L.lastEmToPx=(parseFloat(S.getPropertyValue(u,"paddingLeft"))||1)/s,e.myParent.removeChild(u)}return null===L.remToPx&&(L.remToPx=parseFloat(S.getPropertyValue(r.body,"fontSize"))||16),null===L.vwToPx&&(L.vwToPx=parseFloat(t.innerWidth)/100,L.vhToPx=parseFloat(t.innerHeight)/100),l.remToPx=L.remToPx,l.vwToPx=L.vwToPx,l.vhToPx=L.vhToPx,b.debug>=1&&console.log("Unit ratios: "+JSON.stringify(l),o),l}if(s.begin&&0===V)try{s.begin.call(g,g)}catch(x){setTimeout(function(){throw x},1)}if("scroll"===A){var P,C,T,F=/^x$/i.test(s.axis)?"Left":"Top",j=parseFloat(s.offset)||0;s.container?m.isWrapped(s.container)||m.isNode(s.container)?(s.container=s.container[0]||s.container,P=s.container["scroll"+F],T=P+f(o).position()[F.toLowerCase()]+j):s.container=null:(P=b.State.scrollAnchor[b.State["scrollProperty"+F]],C=b.State.scrollAnchor[b.State["scrollProperty"+("Left"===F?"Top":"Left")]],T=f(o).offset()[F.toLowerCase()]+j),l={scroll:{rootPropertyValue:!1,startValue:P,currentValue:P,endValue:T,unitType:"",easing:s.easing,scrollData:{container:s.container,direction:F,alternateValue:C}},element:o},b.debug&&console.log("tweensContainer (scroll): ",l.scroll,o)}else if("reverse"===A){if(!i(o).tweensContainer)return void f.dequeue(o,s.queue);"none"===i(o).opts.display&&(i(o).opts.display="auto"),"hidden"===i(o).opts.visibility&&(i(o).opts.visibility="visible"),i(o).opts.loop=!1,i(o).opts.begin=null,i(o).opts.complete=null,v.easing||delete s.easing,v.duration||delete s.duration,s=f.extend({},i(o).opts,s);var E=f.extend(!0,{},i(o).tweensContainer);for(var H in E)if("element"!==H){var N=E[H].startValue;E[H].startValue=E[H].currentValue=E[H].endValue,E[H].endValue=N,m.isEmptyObject(v)||(E[H].easing=s.easing),b.debug&&console.log("reverse tweensContainer ("+H+"): "+JSON.stringify(E[H]),o)}l=E}else if("start"===A){var E;i(o).tweensContainer&&i(o).isAnimating===!0&&(E=i(o).tweensContainer),f.each(y,function(e,t){if(RegExp("^"+S.Lists.colors.join("$|^")+"$").test(e)){var r=p(t,!0),n=r[0],o=r[1],i=r[2];if(S.RegEx.isHex.test(n)){for(var s=["Red","Green","Blue"],l=S.Values.hexToRgb(n),u=i?S.Values.hexToRgb(i):a,c=0;c<s.length;c++){var f=[l[c]];o&&f.push(o),u!==a&&f.push(u[c]),y[e+s[c]]=f}delete y[e]}}});for(var z in y){var O=p(y[z]),q=O[0],$=O[1],M=O[2];z=S.Names.camelCase(z);var I=S.Hooks.getRoot(z),B=!1;if(i(o).isSVG||"tween"===I||S.Names.prefixCheck(I)[1]!==!1||S.Normalizations.registered[I]!==a){(s.display!==a&&null!==s.display&&"none"!==s.display||s.visibility!==a&&"hidden"!==s.visibility)&&/opacity|filter/.test(z)&&!M&&0!==q&&(M=0),s._cacheValues&&E&&E[z]?(M===a&&(M=E[z].endValue+E[z].unitType),B=i(o).rootPropertyValueCache[I]):S.Hooks.registered[z]?M===a?(B=S.getPropertyValue(o,I),M=S.getPropertyValue(o,z,B)):B=S.Hooks.templates[I][1]:M===a&&(M=S.getPropertyValue(o,z));var W,G,Y,D=!1;if(W=d(z,M),M=W[0],Y=W[1],W=d(z,q),q=W[0].replace(/^([+-\/*])=/,function(e,t){return D=t,""}),G=W[1],M=parseFloat(M)||0,q=parseFloat(q)||0,"%"===G&&(/^(fontSize|lineHeight)$/.test(z)?(q/=100,G="em"):/^scale/.test(z)?(q/=100,G=""):/(Red|Green|Blue)$/i.test(z)&&(q=q/100*255,G="")),/[\/*]/.test(D))G=Y;else if(Y!==G&&0!==M)if(0===q)G=Y;else{n=n||h();var Q=/margin|padding|left|right|width|text|word|letter/i.test(z)||/X$/.test(z)||"x"===z?"x":"y";switch(Y){case"%":M*="x"===Q?n.percentToPxWidth:n.percentToPxHeight;break;case"px":break;default:M*=n[Y+"ToPx"]}switch(G){case"%":M*=1/("x"===Q?n.percentToPxWidth:n.percentToPxHeight);break;case"px":break;default:M*=1/n[G+"ToPx"]}}switch(D){case"+":q=M+q;break;case"-":q=M-q;break;case"*":q=M*q;break;case"/":q=M/q}l[z]={rootPropertyValue:B,startValue:M,currentValue:M,endValue:q,unitType:G,easing:$},b.debug&&console.log("tweensContainer ("+z+"): "+JSON.stringify(l[z]),o)}else b.debug&&console.log("Skipping ["+I+"] due to a lack of browser support.")}l.element=o}l.element&&(S.Values.addClass(o,"velocity-animating"),R.push(l),""===s.queue&&(i(o).tweensContainer=l,i(o).opts=s),i(o).isAnimating=!0,V===w-1?(b.State.calls.push([R,g,s,null,k.resolver]),b.State.isTicking===!1&&(b.State.isTicking=!0,c())):V++)}var n,o=this,s=f.extend({},b.defaults,v),l={};switch(i(o)===a&&b.init(o),parseFloat(s.delay)&&s.queue!==!1&&f.queue(o,s.queue,function(e){b.velocityQueueEntryFlag=!0,i(o).delayTimer={setTimeout:setTimeout(e,parseFloat(s.delay)),next:e}}),s.duration.toString().toLowerCase()){case"fast":s.duration=200;break;case"normal":s.duration=h;break;case"slow":s.duration=600;break;default:s.duration=parseFloat(s.duration)||1}b.mock!==!1&&(b.mock===!0?s.duration=s.delay=1:(s.duration*=parseFloat(b.mock)||1,s.delay*=parseFloat(b.mock)||1)),s.easing=u(s.easing,s.duration),s.begin&&!m.isFunction(s.begin)&&(s.begin=null),s.progress&&!m.isFunction(s.progress)&&(s.progress=null),s.complete&&!m.isFunction(s.complete)&&(s.complete=null),s.display!==a&&null!==s.display&&(s.display=s.display.toString().toLowerCase(),"auto"===s.display&&(s.display=b.CSS.Values.getDisplayType(o))),s.visibility!==a&&null!==s.visibility&&(s.visibility=s.visibility.toString().toLowerCase()),s.mobileHA=s.mobileHA&&b.State.isMobile&&!b.State.isGingerbread,s.queue===!1?s.delay?setTimeout(e,s.delay):e():f.queue(o,s.queue,function(t,r){return r===!0?(k.promise&&k.resolver(g),!0):(b.velocityQueueEntryFlag=!0,void e(t))}),""!==s.queue&&"fx"!==s.queue||"inprogress"===f.queue(o)[0]||f.dequeue(o)}var s,l,d,g,y,v,x=arguments[0]&&(arguments[0].p||f.isPlainObject(arguments[0].properties)&&!arguments[0].properties.names||m.isString(arguments[0].properties));if(m.isWrapped(this)?(s=!1,d=0,g=this,l=this):(s=!0,d=1,g=x?arguments[0].elements||arguments[0].e:arguments[0]),g=o(g)){x?(y=arguments[0].properties||arguments[0].p,v=arguments[0].options||arguments[0].o):(y=arguments[d],v=arguments[d+1]);var w=g.length,V=0;if(!/^(stop|finish)$/i.test(y)&&!f.isPlainObject(v)){var C=d+1;v={};for(var T=C;T<arguments.length;T++)m.isArray(arguments[T])||!/^(fast|normal|slow)$/i.test(arguments[T])&&!/^\d/.test(arguments[T])?m.isString(arguments[T])||m.isArray(arguments[T])?v.easing=arguments[T]:m.isFunction(arguments[T])&&(v.complete=arguments[T]):v.duration=arguments[T]}var k={promise:null,resolver:null,rejecter:null};s&&b.Promise&&(k.promise=new b.Promise(function(e,t){k.resolver=e,k.rejecter=t}));var A;switch(y){case"scroll":A="scroll";break;case"reverse":A="reverse";break;case"finish":case"stop":f.each(g,function(e,t){i(t)&&i(t).delayTimer&&(clearTimeout(i(t).delayTimer.setTimeout),i(t).delayTimer.next&&i(t).delayTimer.next(),delete i(t).delayTimer)});var F=[];return f.each(b.State.calls,function(e,t){t&&f.each(t[1],function(r,n){var o=v===a?"":v;return o===!0||t[2].queue===o||v===a&&t[2].queue===!1?void f.each(g,function(r,a){a===n&&((v===!0||m.isString(v))&&(f.each(f.queue(a,m.isString(v)?v:""),function(e,t){ +m.isFunction(t)&&t(null,!0)}),f.queue(a,m.isString(v)?v:"",[])),"stop"===y?(i(a)&&i(a).tweensContainer&&o!==!1&&f.each(i(a).tweensContainer,function(e,t){t.endValue=t.currentValue}),F.push(e)):"finish"===y&&(t[2].duration=1))}):!0})}),"stop"===y&&(f.each(F,function(e,t){p(t,!0)}),k.promise&&k.resolver(g)),e();default:if(!f.isPlainObject(y)||m.isEmptyObject(y)){if(m.isString(y)&&b.Redirects[y]){var j=f.extend({},v),E=j.duration,H=j.delay||0;return j.backwards===!0&&(g=f.extend(!0,[],g).reverse()),f.each(g,function(e,t){parseFloat(j.stagger)?j.delay=H+parseFloat(j.stagger)*e:m.isFunction(j.stagger)&&(j.delay=H+j.stagger.call(t,e,w)),j.drag&&(j.duration=parseFloat(E)||(/^(callout|transition)/.test(y)?1e3:h),j.duration=Math.max(j.duration*(j.backwards?1-e/w:(e+1)/w),.75*j.duration,200)),b.Redirects[y].call(t,t,j||{},e,w,g,k.promise?k:a)}),e()}var N="Velocity: First argument ("+y+") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise?k.rejecter(new Error(N)):console.log(N),e()}A="start"}var L={lastParent:null,lastPosition:null,lastFontSize:null,lastPercentToPxWidth:null,lastPercentToPxHeight:null,lastEmToPx:null,remToPx:null,vwToPx:null,vhToPx:null},R=[];f.each(g,function(e,t){m.isNode(t)&&n.call(t)});var z,j=f.extend({},b.defaults,v);if(j.loop=parseInt(j.loop),z=2*j.loop-1,j.loop)for(var O=0;z>O;O++){var q={delay:j.delay,progress:j.progress};O===z-1&&(q.display=j.display,q.visibility=j.visibility,q.complete=j.complete),P(g,"reverse",q)}return e()}};b=f.extend(P,b),b.animate=P;var w=t.requestAnimationFrame||g;return b.State.isMobile||r.hidden===a||r.addEventListener("visibilitychange",function(){r.hidden?(w=function(e){return setTimeout(function(){e(!0)},16)},c()):w=t.requestAnimationFrame||g}),e.Velocity=b,e!==t&&(e.fn.velocity=P,e.fn.velocity.defaults=b.defaults),f.each(["Down","Up"],function(e,t){b.Redirects["slide"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u=l.begin,c=l.complete,p={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},d={};l.display===a&&(l.display="Down"===t?"inline"===b.CSS.Values.getDisplayType(e)?"inline-block":"block":"none"),l.begin=function(){u&&u.call(i,i);for(var r in p){d[r]=e.style[r];var a=b.CSS.getPropertyValue(e,r);p[r]="Down"===t?[a,0]:[0,a]}d.overflow=e.style.overflow,e.style.overflow="hidden"},l.complete=function(){for(var t in d)e.style[t]=d[t];c&&c.call(i,i),s&&s.resolver(i)},b(e,p,l)}}),f.each(["In","Out"],function(e,t){b.Redirects["fade"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u={opacity:"In"===t?1:0},c=l.complete;l.complete=n!==o-1?l.begin=null:function(){c&&c.call(i,i),s&&s.resolver(i)},l.display===a&&(l.display="In"===t?"auto":"none"),b(this,u,l)}}),b}(window.jQuery||window.Zepto||window,window,document)})); +;!function(a,b,c,d){"use strict";function k(a,b,c){return setTimeout(q(a,c),b)}function l(a,b,c){return Array.isArray(a)?(m(a,c[b],c),!0):!1}function m(a,b,c){var e;if(a)if(a.forEach)a.forEach(b,c);else if(a.length!==d)for(e=0;e<a.length;)b.call(c,a[e],e,a),e++;else for(e in a)a.hasOwnProperty(e)&&b.call(c,a[e],e,a)}function n(a,b,c){for(var e=Object.keys(b),f=0;f<e.length;)(!c||c&&a[e[f]]===d)&&(a[e[f]]=b[e[f]]),f++;return a}function o(a,b){return n(a,b,!0)}function p(a,b,c){var e,d=b.prototype;e=a.prototype=Object.create(d),e.constructor=a,e._super=d,c&&n(e,c)}function q(a,b){return function(){return a.apply(b,arguments)}}function r(a,b){return typeof a==g?a.apply(b?b[0]||d:d,b):a}function s(a,b){return a===d?b:a}function t(a,b,c){m(x(b),function(b){a.addEventListener(b,c,!1)})}function u(a,b,c){m(x(b),function(b){a.removeEventListener(b,c,!1)})}function v(a,b){for(;a;){if(a==b)return!0;a=a.parentNode}return!1}function w(a,b){return a.indexOf(b)>-1}function x(a){return a.trim().split(/\s+/g)}function y(a,b,c){if(a.indexOf&&!c)return a.indexOf(b);for(var d=0;d<a.length;){if(c&&a[d][c]==b||!c&&a[d]===b)return d;d++}return-1}function z(a){return Array.prototype.slice.call(a,0)}function A(a,b,c){for(var d=[],e=[],f=0;f<a.length;){var g=b?a[f][b]:a[f];y(e,g)<0&&d.push(a[f]),e[f]=g,f++}return c&&(d=b?d.sort(function(a,c){return a[b]>c[b]}):d.sort()),d}function B(a,b){for(var c,f,g=b[0].toUpperCase()+b.slice(1),h=0;h<e.length;){if(c=e[h],f=c?c+g:b,f in a)return f;h++}return d}function D(){return C++}function E(a){var b=a.ownerDocument;return b.defaultView||b.parentWindow}function ab(a,b){var c=this;this.manager=a,this.callback=b,this.element=a.element,this.target=a.options.inputTarget,this.domHandler=function(b){r(a.options.enable,[a])&&c.handler(b)},this.init()}function bb(a){var b,c=a.options.inputClass;return b=c?c:H?wb:I?Eb:G?Gb:rb,new b(a,cb)}function cb(a,b,c){var d=c.pointers.length,e=c.changedPointers.length,f=b&O&&0===d-e,g=b&(Q|R)&&0===d-e;c.isFirst=!!f,c.isFinal=!!g,f&&(a.session={}),c.eventType=b,db(a,c),a.emit("hammer.input",c),a.recognize(c),a.session.prevInput=c}function db(a,b){var c=a.session,d=b.pointers,e=d.length;c.firstInput||(c.firstInput=gb(b)),e>1&&!c.firstMultiple?c.firstMultiple=gb(b):1===e&&(c.firstMultiple=!1);var f=c.firstInput,g=c.firstMultiple,h=g?g.center:f.center,i=b.center=hb(d);b.timeStamp=j(),b.deltaTime=b.timeStamp-f.timeStamp,b.angle=lb(h,i),b.distance=kb(h,i),eb(c,b),b.offsetDirection=jb(b.deltaX,b.deltaY),b.scale=g?nb(g.pointers,d):1,b.rotation=g?mb(g.pointers,d):0,fb(c,b);var k=a.element;v(b.srcEvent.target,k)&&(k=b.srcEvent.target),b.target=k}function eb(a,b){var c=b.center,d=a.offsetDelta||{},e=a.prevDelta||{},f=a.prevInput||{};(b.eventType===O||f.eventType===Q)&&(e=a.prevDelta={x:f.deltaX||0,y:f.deltaY||0},d=a.offsetDelta={x:c.x,y:c.y}),b.deltaX=e.x+(c.x-d.x),b.deltaY=e.y+(c.y-d.y)}function fb(a,b){var f,g,h,j,c=a.lastInterval||b,e=b.timeStamp-c.timeStamp;if(b.eventType!=R&&(e>N||c.velocity===d)){var k=c.deltaX-b.deltaX,l=c.deltaY-b.deltaY,m=ib(e,k,l);g=m.x,h=m.y,f=i(m.x)>i(m.y)?m.x:m.y,j=jb(k,l),a.lastInterval=b}else f=c.velocity,g=c.velocityX,h=c.velocityY,j=c.direction;b.velocity=f,b.velocityX=g,b.velocityY=h,b.direction=j}function gb(a){for(var b=[],c=0;c<a.pointers.length;)b[c]={clientX:h(a.pointers[c].clientX),clientY:h(a.pointers[c].clientY)},c++;return{timeStamp:j(),pointers:b,center:hb(b),deltaX:a.deltaX,deltaY:a.deltaY}}function hb(a){var b=a.length;if(1===b)return{x:h(a[0].clientX),y:h(a[0].clientY)};for(var c=0,d=0,e=0;b>e;)c+=a[e].clientX,d+=a[e].clientY,e++;return{x:h(c/b),y:h(d/b)}}function ib(a,b,c){return{x:b/a||0,y:c/a||0}}function jb(a,b){return a===b?S:i(a)>=i(b)?a>0?T:U:b>0?V:W}function kb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return Math.sqrt(d*d+e*e)}function lb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return 180*Math.atan2(e,d)/Math.PI}function mb(a,b){return lb(b[1],b[0],_)-lb(a[1],a[0],_)}function nb(a,b){return kb(b[0],b[1],_)/kb(a[0],a[1],_)}function rb(){this.evEl=pb,this.evWin=qb,this.allow=!0,this.pressed=!1,ab.apply(this,arguments)}function wb(){this.evEl=ub,this.evWin=vb,ab.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function Ab(){this.evTarget=yb,this.evWin=zb,this.started=!1,ab.apply(this,arguments)}function Bb(a,b){var c=z(a.touches),d=z(a.changedTouches);return b&(Q|R)&&(c=A(c.concat(d),"identifier",!0)),[c,d]}function Eb(){this.evTarget=Db,this.targetIds={},ab.apply(this,arguments)}function Fb(a,b){var c=z(a.touches),d=this.targetIds;if(b&(O|P)&&1===c.length)return d[c[0].identifier]=!0,[c,c];var e,f,g=z(a.changedTouches),h=[],i=this.target;if(f=c.filter(function(a){return v(a.target,i)}),b===O)for(e=0;e<f.length;)d[f[e].identifier]=!0,e++;for(e=0;e<g.length;)d[g[e].identifier]&&h.push(g[e]),b&(Q|R)&&delete d[g[e].identifier],e++;return h.length?[A(f.concat(h),"identifier",!0),h]:void 0}function Gb(){ab.apply(this,arguments);var a=q(this.handler,this);this.touch=new Eb(this.manager,a),this.mouse=new rb(this.manager,a)}function Pb(a,b){this.manager=a,this.set(b)}function Qb(a){if(w(a,Mb))return Mb;var b=w(a,Nb),c=w(a,Ob);return b&&c?Nb+" "+Ob:b||c?b?Nb:Ob:w(a,Lb)?Lb:Kb}function Yb(a){this.id=D(),this.manager=null,this.options=o(a||{},this.defaults),this.options.enable=s(this.options.enable,!0),this.state=Rb,this.simultaneous={},this.requireFail=[]}function Zb(a){return a&Wb?"cancel":a&Ub?"end":a&Tb?"move":a&Sb?"start":""}function $b(a){return a==W?"down":a==V?"up":a==T?"left":a==U?"right":""}function _b(a,b){var c=b.manager;return c?c.get(a):a}function ac(){Yb.apply(this,arguments)}function bc(){ac.apply(this,arguments),this.pX=null,this.pY=null}function cc(){ac.apply(this,arguments)}function dc(){Yb.apply(this,arguments),this._timer=null,this._input=null}function ec(){ac.apply(this,arguments)}function fc(){ac.apply(this,arguments)}function gc(){Yb.apply(this,arguments),this.pTime=!1,this.pCenter=!1,this._timer=null,this._input=null,this.count=0}function hc(a,b){return b=b||{},b.recognizers=s(b.recognizers,hc.defaults.preset),new kc(a,b)}function kc(a,b){b=b||{},this.options=o(b,hc.defaults),this.options.inputTarget=this.options.inputTarget||a,this.handlers={},this.session={},this.recognizers=[],this.element=a,this.input=bb(this),this.touchAction=new Pb(this,this.options.touchAction),lc(this,!0),m(b.recognizers,function(a){var b=this.add(new a[0](a[1]));a[2]&&b.recognizeWith(a[2]),a[3]&&b.requireFailure(a[3])},this)}function lc(a,b){var c=a.element;m(a.options.cssProps,function(a,d){c.style[B(c.style,d)]=b?a:""})}function mc(a,c){var d=b.createEvent("Event");d.initEvent(a,!0,!0),d.gesture=c,c.target.dispatchEvent(d)}var e=["","webkit","moz","MS","ms","o"],f=b.createElement("div"),g="function",h=Math.round,i=Math.abs,j=Date.now,C=1,F=/mobile|tablet|ip(ad|hone|od)|android/i,G="ontouchstart"in a,H=B(a,"PointerEvent")!==d,I=G&&F.test(navigator.userAgent),J="touch",K="pen",L="mouse",M="kinect",N=25,O=1,P=2,Q=4,R=8,S=1,T=2,U=4,V=8,W=16,X=T|U,Y=V|W,Z=X|Y,$=["x","y"],_=["clientX","clientY"];ab.prototype={handler:function(){},init:function(){this.evEl&&t(this.element,this.evEl,this.domHandler),this.evTarget&&t(this.target,this.evTarget,this.domHandler),this.evWin&&t(E(this.element),this.evWin,this.domHandler)},destroy:function(){this.evEl&&u(this.element,this.evEl,this.domHandler),this.evTarget&&u(this.target,this.evTarget,this.domHandler),this.evWin&&u(E(this.element),this.evWin,this.domHandler)}};var ob={mousedown:O,mousemove:P,mouseup:Q},pb="mousedown",qb="mousemove mouseup";p(rb,ab,{handler:function(a){var b=ob[a.type];b&O&&0===a.button&&(this.pressed=!0),b&P&&1!==a.which&&(b=Q),this.pressed&&this.allow&&(b&Q&&(this.pressed=!1),this.callback(this.manager,b,{pointers:[a],changedPointers:[a],pointerType:L,srcEvent:a}))}});var sb={pointerdown:O,pointermove:P,pointerup:Q,pointercancel:R,pointerout:R},tb={2:J,3:K,4:L,5:M},ub="pointerdown",vb="pointermove pointerup pointercancel";a.MSPointerEvent&&(ub="MSPointerDown",vb="MSPointerMove MSPointerUp MSPointerCancel"),p(wb,ab,{handler:function(a){var b=this.store,c=!1,d=a.type.toLowerCase().replace("ms",""),e=sb[d],f=tb[a.pointerType]||a.pointerType,g=f==J,h=y(b,a.pointerId,"pointerId");e&O&&(0===a.button||g)?0>h&&(b.push(a),h=b.length-1):e&(Q|R)&&(c=!0),0>h||(b[h]=a,this.callback(this.manager,e,{pointers:b,changedPointers:[a],pointerType:f,srcEvent:a}),c&&b.splice(h,1))}});var xb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},yb="touchstart",zb="touchstart touchmove touchend touchcancel";p(Ab,ab,{handler:function(a){var b=xb[a.type];if(b===O&&(this.started=!0),this.started){var c=Bb.call(this,a,b);b&(Q|R)&&0===c[0].length-c[1].length&&(this.started=!1),this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}});var Cb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},Db="touchstart touchmove touchend touchcancel";p(Eb,ab,{handler:function(a){var b=Cb[a.type],c=Fb.call(this,a,b);c&&this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}),p(Gb,ab,{handler:function(a,b,c){var d=c.pointerType==J,e=c.pointerType==L;if(d)this.mouse.allow=!1;else if(e&&!this.mouse.allow)return;b&(Q|R)&&(this.mouse.allow=!0),this.callback(a,b,c)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Hb=B(f.style,"touchAction"),Ib=Hb!==d,Jb="compute",Kb="auto",Lb="manipulation",Mb="none",Nb="pan-x",Ob="pan-y";Pb.prototype={set:function(a){a==Jb&&(a=this.compute()),Ib&&(this.manager.element.style[Hb]=a),this.actions=a.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var a=[];return m(this.manager.recognizers,function(b){r(b.options.enable,[b])&&(a=a.concat(b.getTouchAction()))}),Qb(a.join(" "))},preventDefaults:function(a){if(!Ib){var b=a.srcEvent,c=a.offsetDirection;if(this.manager.session.prevented)return b.preventDefault(),void 0;var d=this.actions,e=w(d,Mb),f=w(d,Ob),g=w(d,Nb);return e||f&&c&X||g&&c&Y?this.preventSrc(b):void 0}},preventSrc:function(a){this.manager.session.prevented=!0,a.preventDefault()}};var Rb=1,Sb=2,Tb=4,Ub=8,Vb=Ub,Wb=16,Xb=32;Yb.prototype={defaults:{},set:function(a){return n(this.options,a),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(a){if(l(a,"recognizeWith",this))return this;var b=this.simultaneous;return a=_b(a,this),b[a.id]||(b[a.id]=a,a.recognizeWith(this)),this},dropRecognizeWith:function(a){return l(a,"dropRecognizeWith",this)?this:(a=_b(a,this),delete this.simultaneous[a.id],this)},requireFailure:function(a){if(l(a,"requireFailure",this))return this;var b=this.requireFail;return a=_b(a,this),-1===y(b,a)&&(b.push(a),a.requireFailure(this)),this},dropRequireFailure:function(a){if(l(a,"dropRequireFailure",this))return this;a=_b(a,this);var b=y(this.requireFail,a);return b>-1&&this.requireFail.splice(b,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(a){return!!this.simultaneous[a.id]},emit:function(a){function d(d){b.manager.emit(b.options.event+(d?Zb(c):""),a)}var b=this,c=this.state;Ub>c&&d(!0),d(),c>=Ub&&d(!0)},tryEmit:function(a){return this.canEmit()?this.emit(a):(this.state=Xb,void 0)},canEmit:function(){for(var a=0;a<this.requireFail.length;){if(!(this.requireFail[a].state&(Xb|Rb)))return!1;a++}return!0},recognize:function(a){var b=n({},a);return r(this.options.enable,[this,b])?(this.state&(Vb|Wb|Xb)&&(this.state=Rb),this.state=this.process(b),this.state&(Sb|Tb|Ub|Wb)&&this.tryEmit(b),void 0):(this.reset(),this.state=Xb,void 0)},process:function(){},getTouchAction:function(){},reset:function(){}},p(ac,Yb,{defaults:{pointers:1},attrTest:function(a){var b=this.options.pointers;return 0===b||a.pointers.length===b},process:function(a){var b=this.state,c=a.eventType,d=b&(Sb|Tb),e=this.attrTest(a);return d&&(c&R||!e)?b|Wb:d||e?c&Q?b|Ub:b&Sb?b|Tb:Sb:Xb}}),p(bc,ac,{defaults:{event:"pan",threshold:10,pointers:1,direction:Z},getTouchAction:function(){var a=this.options.direction,b=[];return a&X&&b.push(Ob),a&Y&&b.push(Nb),b},directionTest:function(a){var b=this.options,c=!0,d=a.distance,e=a.direction,f=a.deltaX,g=a.deltaY;return e&b.direction||(b.direction&X?(e=0===f?S:0>f?T:U,c=f!=this.pX,d=Math.abs(a.deltaX)):(e=0===g?S:0>g?V:W,c=g!=this.pY,d=Math.abs(a.deltaY))),a.direction=e,c&&d>b.threshold&&e&b.direction},attrTest:function(a){return ac.prototype.attrTest.call(this,a)&&(this.state&Sb||!(this.state&Sb)&&this.directionTest(a))},emit:function(a){this.pX=a.deltaX,this.pY=a.deltaY;var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this._super.emit.call(this,a)}}),p(cc,ac,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.scale-1)>this.options.threshold||this.state&Sb)},emit:function(a){if(this._super.emit.call(this,a),1!==a.scale){var b=a.scale<1?"in":"out";this.manager.emit(this.options.event+b,a)}}}),p(dc,Yb,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[Kb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,e=a.deltaTime>b.time;if(this._input=a,!d||!c||a.eventType&(Q|R)&&!e)this.reset();else if(a.eventType&O)this.reset(),this._timer=k(function(){this.state=Vb,this.tryEmit()},b.time,this);else if(a.eventType&Q)return Vb;return Xb},reset:function(){clearTimeout(this._timer)},emit:function(a){this.state===Vb&&(a&&a.eventType&Q?this.manager.emit(this.options.event+"up",a):(this._input.timeStamp=j(),this.manager.emit(this.options.event,this._input)))}}),p(ec,ac,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.rotation)>this.options.threshold||this.state&Sb)}}),p(fc,ac,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:X|Y,pointers:1},getTouchAction:function(){return bc.prototype.getTouchAction.call(this)},attrTest:function(a){var c,b=this.options.direction;return b&(X|Y)?c=a.velocity:b&X?c=a.velocityX:b&Y&&(c=a.velocityY),this._super.attrTest.call(this,a)&&b&a.direction&&a.distance>this.options.threshold&&i(c)>this.options.velocity&&a.eventType&Q},emit:function(a){var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this.manager.emit(this.options.event,a)}}),p(gc,Yb,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[Lb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,e=a.deltaTime<b.time;if(this.reset(),a.eventType&O&&0===this.count)return this.failTimeout();if(d&&e&&c){if(a.eventType!=Q)return this.failTimeout();var f=this.pTime?a.timeStamp-this.pTime<b.interval:!0,g=!this.pCenter||kb(this.pCenter,a.center)<b.posThreshold;this.pTime=a.timeStamp,this.pCenter=a.center,g&&f?this.count+=1:this.count=1,this._input=a;var h=this.count%b.taps;if(0===h)return this.hasRequireFailures()?(this._timer=k(function(){this.state=Vb,this.tryEmit()},b.interval,this),Sb):Vb}return Xb},failTimeout:function(){return this._timer=k(function(){this.state=Xb},this.options.interval,this),Xb},reset:function(){clearTimeout(this._timer)},emit:function(){this.state==Vb&&(this._input.tapCount=this.count,this.manager.emit(this.options.event,this._input))}}),hc.VERSION="2.0.4",hc.defaults={domEvents:!1,touchAction:Jb,enable:!0,inputTarget:null,inputClass:null,preset:[[ec,{enable:!1}],[cc,{enable:!1},["rotate"]],[fc,{direction:X}],[bc,{direction:X},["swipe"]],[gc],[gc,{event:"doubletap",taps:2},["tap"]],[dc]],cssProps:{userSelect:"default",touchSelect:"none",touchCallout:"none",contentZooming:"none",userDrag:"none",tapHighlightColor:"rgba(0,0,0,0)"}};var ic=1,jc=2;kc.prototype={set:function(a){return n(this.options,a),a.touchAction&&this.touchAction.update(),a.inputTarget&&(this.input.destroy(),this.input.target=a.inputTarget,this.input.init()),this},stop:function(a){this.session.stopped=a?jc:ic},recognize:function(a){var b=this.session;if(!b.stopped){this.touchAction.preventDefaults(a);var c,d=this.recognizers,e=b.curRecognizer;(!e||e&&e.state&Vb)&&(e=b.curRecognizer=null);for(var f=0;f<d.length;)c=d[f],b.stopped===jc||e&&c!=e&&!c.canRecognizeWith(e)?c.reset():c.recognize(a),!e&&c.state&(Sb|Tb|Ub)&&(e=b.curRecognizer=c),f++}},get:function(a){if(a instanceof Yb)return a;for(var b=this.recognizers,c=0;c<b.length;c++)if(b[c].options.event==a)return b[c];return null},add:function(a){if(l(a,"add",this))return this;var b=this.get(a.options.event);return b&&this.remove(b),this.recognizers.push(a),a.manager=this,this.touchAction.update(),a},remove:function(a){if(l(a,"remove",this))return this;var b=this.recognizers;return a=this.get(a),b.splice(y(b,a),1),this.touchAction.update(),this},on:function(a,b){var c=this.handlers;return m(x(a),function(a){c[a]=c[a]||[],c[a].push(b)}),this},off:function(a,b){var c=this.handlers;return m(x(a),function(a){b?c[a].splice(y(c[a],b),1):delete c[a]}),this},emit:function(a,b){this.options.domEvents&&mc(a,b);var c=this.handlers[a]&&this.handlers[a].slice();if(c&&c.length){b.type=a,b.preventDefault=function(){b.srcEvent.preventDefault()};for(var d=0;d<c.length;)c[d](b),d++}},destroy:function(){this.element&&lc(this,!1),this.handlers={},this.session={},this.input.destroy(),this.element=null}},n(hc,{INPUT_START:O,INPUT_MOVE:P,INPUT_END:Q,INPUT_CANCEL:R,STATE_POSSIBLE:Rb,STATE_BEGAN:Sb,STATE_CHANGED:Tb,STATE_ENDED:Ub,STATE_RECOGNIZED:Vb,STATE_CANCELLED:Wb,STATE_FAILED:Xb,DIRECTION_NONE:S,DIRECTION_LEFT:T,DIRECTION_RIGHT:U,DIRECTION_UP:V,DIRECTION_DOWN:W,DIRECTION_HORIZONTAL:X,DIRECTION_VERTICAL:Y,DIRECTION_ALL:Z,Manager:kc,Input:ab,TouchAction:Pb,TouchInput:Eb,MouseInput:rb,PointerEventInput:wb,TouchMouseInput:Gb,SingleTouchInput:Ab,Recognizer:Yb,AttrRecognizer:ac,Tap:gc,Pan:bc,Swipe:fc,Pinch:cc,Rotate:ec,Press:dc,on:t,off:u,each:m,merge:o,extend:n,inherit:p,bindFn:q,prefixed:B}),typeof define==g&&define.amd?define(function(){return hc}):"undefined"!=typeof module&&module.exports?module.exports=hc:a[c]=hc}(window,document,"Hammer");;(function(factory) { + if (typeof define === 'function' && define.amd) { + define(['jquery', 'hammerjs'], factory); + } else if (typeof exports === 'object') { + factory(require('jquery'), require('hammerjs')); + } else { + factory(jQuery, Hammer); + } +}(function($, Hammer) { + function hammerify(el, options) { + var $el = $(el); + if(!$el.data("hammer")) { + $el.data("hammer", new Hammer($el[0], options)); + } + } + + $.fn.hammer = function(options) { + return this.each(function() { + hammerify(this, options); + }); + }; + + // extend the emit method to also trigger jQuery events + Hammer.Manager.prototype.emit = (function(originalEmit) { + return function(type, data) { + originalEmit.call(this, type, data); + $(this.element).trigger({ + type: type, + gesture: data + }); + }; + })(Hammer.Manager.prototype.emit); +})); +;// Required for Meteor package, the use of window prevents export by Meteor +(function(window){ + if(window.Package){ + Materialize = {}; + } else { + window.Materialize = {}; + } +})(window); + + +/* + * raf.js + * https://github.com/ngryman/raf.js + * + * original requestAnimationFrame polyfill by Erik Möller + * inspired from paul_irish gist and post + * + * Copyright (c) 2013 ngryman + * Licensed under the MIT license. + */ +(function(window) { + var lastTime = 0, + vendors = ['webkit', 'moz'], + requestAnimationFrame = window.requestAnimationFrame, + cancelAnimationFrame = window.cancelAnimationFrame, + i = vendors.length; + + // try to un-prefix existing raf + while (--i >= 0 && !requestAnimationFrame) { + requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame']; + cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame']; + } + + // polyfill with setTimeout fallback + // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945 + if (!requestAnimationFrame || !cancelAnimationFrame) { + requestAnimationFrame = function(callback) { + var now = +Date.now(), + nextTime = Math.max(lastTime + 16, now); + return setTimeout(function() { + callback(lastTime = nextTime); + }, nextTime - now); + }; + + cancelAnimationFrame = clearTimeout; + } + + // export to window + window.requestAnimationFrame = requestAnimationFrame; + window.cancelAnimationFrame = cancelAnimationFrame; +}(window)); + + +// Unique ID +Materialize.guid = (function() { + function s4() { + return Math.floor((1 + Math.random()) * 0x10000) + .toString(16) + .substring(1); + } + return function() { + return s4() + s4() + '-' + s4() + '-' + s4() + '-' + + s4() + '-' + s4() + s4() + s4(); + }; +})(); + +/** + * Escapes hash from special characters + * @param {string} hash String returned from this.hash + * @returns {string} + */ +Materialize.escapeHash = function(hash) { + return hash.replace( /(:|\.|\[|\]|,|=)/g, "\\$1" ); +}; + +Materialize.elementOrParentIsFixed = function(element) { + var $element = $(element); + var $checkElements = $element.add($element.parents()); + var isFixed = false; + $checkElements.each(function(){ + if ($(this).css("position") === "fixed") { + isFixed = true; + return false; + } + }); + return isFixed; +}; + + +/** + * Get time in ms + * @license https://raw.github.com/jashkenas/underscore/master/LICENSE + * @type {function} + * @return {number} + */ +var getTime = (Date.now || function () { + return new Date().getTime(); +}); + + +/** + * Returns a function, that, when invoked, will only be triggered at most once + * during a given window of time. Normally, the throttled function will run + * as much as it can, without ever going more than once per `wait` duration; + * but if you'd like to disable the execution on the leading edge, pass + * `{leading: false}`. To disable execution on the trailing edge, ditto. + * @license https://raw.github.com/jashkenas/underscore/master/LICENSE + * @param {function} func + * @param {number} wait + * @param {Object=} options + * @returns {Function} + */ +Materialize.throttle = function(func, wait, options) { + var context, args, result; + var timeout = null; + var previous = 0; + options || (options = {}); + var later = function () { + previous = options.leading === false ? 0 : getTime(); + timeout = null; + result = func.apply(context, args); + context = args = null; + }; + return function () { + var now = getTime(); + if (!previous && options.leading === false) previous = now; + var remaining = wait - (now - previous); + context = this; + args = arguments; + if (remaining <= 0) { + clearTimeout(timeout); + timeout = null; + previous = now; + result = func.apply(context, args); + context = args = null; + } else if (!timeout && options.trailing !== false) { + timeout = setTimeout(later, remaining); + } + return result; + }; +}; + + +// Velocity has conflicts when loaded with jQuery, this will check for it +// First, check if in noConflict mode +var Vel; +if (jQuery) { + Vel = jQuery.Velocity; +} else if ($) { + Vel = $.Velocity; +} else { + Vel = Velocity; +} +;(function ($) { + $.fn.collapsible = function(options) { + var defaults = { + accordion: undefined, + onOpen: undefined, + onClose: undefined + }; + + options = $.extend(defaults, options); + + + return this.each(function() { + + var $this = $(this); + + var $panel_headers = $(this).find('> li > .collapsible-header'); + + var collapsible_type = $this.data("collapsible"); + + // Turn off any existing event handlers + $this.off('click.collapse', '> li > .collapsible-header'); + $panel_headers.off('click.collapse'); + + + /**************** + Helper Functions + ****************/ + + // Accordion Open + function accordionOpen(object) { + $panel_headers = $this.find('> li > .collapsible-header'); + if (object.hasClass('active')) { + object.parent().addClass('active'); + } + else { + object.parent().removeClass('active'); + } + if (object.parent().hasClass('active')){ + object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + else{ + object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + + $panel_headers.not(object).removeClass('active').parent().removeClass('active'); + + // Close previously open accordion elements. + $panel_headers.not(object).parent().children('.collapsible-body').stop(true,false).each(function() { + if ($(this).is(':visible')) { + $(this).slideUp({ + duration: 350, + easing: "easeOutQuart", + queue: false, + complete: + function() { + $(this).css('height', ''); + execCallbacks($(this).siblings('.collapsible-header')); + } + }); + } + }); + } + + // Expandable Open + function expandableOpen(object) { + if (object.hasClass('active')) { + object.parent().addClass('active'); + } + else { + object.parent().removeClass('active'); + } + if (object.parent().hasClass('active')){ + object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + else { + object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + } + + // Open collapsible. object: .collapsible-header + function collapsibleOpen(object) { + if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion + accordionOpen(object); + } else { // Handle Expandables + expandableOpen(object); + } + + execCallbacks(object); + } + + // Handle callbacks + function execCallbacks(object) { + if (object.hasClass('active')) { + if (typeof(options.onOpen) === "function") { + options.onOpen.call(this, object.parent()); + } + } else { + if (typeof(options.onClose) === "function") { + options.onClose.call(this, object.parent()); + } + } + } + + /** + * Check if object is children of panel header + * @param {Object} object Jquery object + * @return {Boolean} true if it is children + */ + function isChildrenOfPanelHeader(object) { + + var panelHeader = getPanelHeader(object); + + return panelHeader.length > 0; + } + + /** + * Get panel header from a children element + * @param {Object} object Jquery object + * @return {Object} panel header object + */ + function getPanelHeader(object) { + + return object.closest('li > .collapsible-header'); + } + + /***** End Helper Functions *****/ + + + + // Add click handler to only direct collapsible header children + $this.on('click.collapse', '> li > .collapsible-header', function(e) { + var element = $(e.target); + + if (isChildrenOfPanelHeader(element)) { + element = getPanelHeader(element); + } + + element.toggleClass('active'); + + collapsibleOpen(element); + }); + + + // Open first active + if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion + collapsibleOpen($panel_headers.filter('.active').first()); + + } else { // Handle Expandables + $panel_headers.filter('.active').each(function() { + collapsibleOpen($(this)); + }); + } + + }); + }; + + $(document).ready(function(){ + $('.collapsible').collapsible(); + }); +}( jQuery ));;(function ($) { + + // Add posibility to scroll to selected option + // usefull for select for example + $.fn.scrollTo = function(elem) { + $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top); + return this; + }; + + $.fn.dropdown = function (options) { + var defaults = { + inDuration: 300, + outDuration: 225, + constrainWidth: true, // Constrains width of dropdown to the activator + hover: false, + gutter: 0, // Spacing from edge + belowOrigin: false, + alignment: 'left', + stopPropagation: false + }; + + // Open dropdown. + if (options === "open") { + this.each(function() { + $(this).trigger('open'); + }); + return false; + } + + // Close dropdown. + if (options === "close") { + this.each(function() { + $(this).trigger('close'); + }); + return false; + } + + this.each(function(){ + var origin = $(this); + var curr_options = $.extend({}, defaults, options); + var isFocused = false; + + // Dropdown menu + var activates = $("#"+ origin.attr('data-activates')); + + function updateOptions() { + if (origin.data('induration') !== undefined) + curr_options.inDuration = origin.data('induration'); + if (origin.data('outduration') !== undefined) + curr_options.outDuration = origin.data('outduration'); + if (origin.data('constrainwidth') !== undefined) + curr_options.constrainWidth = origin.data('constrainwidth'); + if (origin.data('hover') !== undefined) + curr_options.hover = origin.data('hover'); + if (origin.data('gutter') !== undefined) + curr_options.gutter = origin.data('gutter'); + if (origin.data('beloworigin') !== undefined) + curr_options.belowOrigin = origin.data('beloworigin'); + if (origin.data('alignment') !== undefined) + curr_options.alignment = origin.data('alignment'); + if (origin.data('stoppropagation') !== undefined) + curr_options.stopPropagation = origin.data('stoppropagation'); + } + + updateOptions(); + + // Attach dropdown to its activator + origin.after(activates); + + /* + Helper function to position and resize dropdown. + Used in hover and click handler. + */ + function placeDropdown(eventType) { + // Check for simultaneous focus and click events. + if (eventType === 'focus') { + isFocused = true; + } + + // Check html data attributes + updateOptions(); + + // Set Dropdown state + activates.addClass('active'); + origin.addClass('active'); + + // Constrain width + if (curr_options.constrainWidth === true) { + activates.css('width', origin.outerWidth()); + + } else { + activates.css('white-space', 'nowrap'); + } + + // Offscreen detection + var windowHeight = window.innerHeight; + var originHeight = origin.innerHeight(); + var offsetLeft = origin.offset().left; + var offsetTop = origin.offset().top - $(window).scrollTop(); + var currAlignment = curr_options.alignment; + var gutterSpacing = 0; + var leftPosition = 0; + + // Below Origin + var verticalOffset = 0; + if (curr_options.belowOrigin === true) { + verticalOffset = originHeight; + } + + // Check for scrolling positioned container. + var scrollYOffset = 0; + var scrollXOffset = 0; + var wrapper = origin.parent(); + if (!wrapper.is('body')) { + if (wrapper[0].scrollHeight > wrapper[0].clientHeight) { + scrollYOffset = wrapper[0].scrollTop; + } + if (wrapper[0].scrollWidth > wrapper[0].clientWidth) { + scrollXOffset = wrapper[0].scrollLeft; + } + } + + + if (offsetLeft + activates.innerWidth() > $(window).width()) { + // Dropdown goes past screen on right, force right alignment + currAlignment = 'right'; + + } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) { + // Dropdown goes past screen on left, force left alignment + currAlignment = 'left'; + } + // Vertical bottom offscreen detection + if (offsetTop + activates.innerHeight() > windowHeight) { + // If going upwards still goes offscreen, just crop height of dropdown. + if (offsetTop + originHeight - activates.innerHeight() < 0) { + var adjustedHeight = windowHeight - offsetTop - verticalOffset; + activates.css('max-height', adjustedHeight); + } else { + // Flow upwards. + if (!verticalOffset) { + verticalOffset += originHeight; + } + verticalOffset -= activates.innerHeight(); + } + } + + // Handle edge alignment + if (currAlignment === 'left') { + gutterSpacing = curr_options.gutter; + leftPosition = origin.position().left + gutterSpacing; + } + else if (currAlignment === 'right') { + var offsetRight = origin.position().left + origin.outerWidth() - activates.outerWidth(); + gutterSpacing = -curr_options.gutter; + leftPosition = offsetRight + gutterSpacing; + } + + // Position dropdown + activates.css({ + position: 'absolute', + top: origin.position().top + verticalOffset + scrollYOffset, + left: leftPosition + scrollXOffset + }); + + + // Show dropdown + activates.stop(true, true).css('opacity', 0) + .slideDown({ + queue: false, + duration: curr_options.inDuration, + easing: 'easeOutCubic', + complete: function() { + $(this).css('height', ''); + } + }) + .animate( {opacity: 1}, {queue: false, duration: curr_options.inDuration, easing: 'easeOutSine'}); + + // Add click close handler to document + $(document).bind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id'), function (e) { + if (!activates.is(e.target) && !origin.is(e.target) && (!origin.find(e.target).length) ) { + hideDropdown(); + $(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id')); + } + }); + } + + function hideDropdown() { + // Check for simultaneous focus and click events. + isFocused = false; + activates.fadeOut(curr_options.outDuration); + activates.removeClass('active'); + origin.removeClass('active'); + $(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id')); + setTimeout(function() { activates.css('max-height', ''); }, curr_options.outDuration); + } + + // Hover + if (curr_options.hover) { + var open = false; + origin.unbind('click.' + origin.attr('id')); + // Hover handler to show dropdown + origin.on('mouseenter', function(e){ // Mouse over + if (open === false) { + placeDropdown(); + open = true; + } + }); + origin.on('mouseleave', function(e){ + // If hover on origin then to something other than dropdown content, then close + var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element + if(!$(toEl).closest('.dropdown-content').is(activates)) { + activates.stop(true, true); + hideDropdown(); + open = false; + } + }); + + activates.on('mouseleave', function(e){ // Mouse out + var toEl = e.toElement || e.relatedTarget; + if(!$(toEl).closest('.dropdown-button').is(origin)) { + activates.stop(true, true); + hideDropdown(); + open = false; + } + }); + + // Click + } else { + // Click handler to show dropdown + origin.unbind('click.' + origin.attr('id')); + origin.bind('click.'+origin.attr('id'), function(e){ + if (!isFocused) { + if ( origin[0] == e.currentTarget && + !origin.hasClass('active') && + ($(e.target).closest('.dropdown-content').length === 0)) { + e.preventDefault(); // Prevents button click from moving window + if (curr_options.stopPropagation) { + e.stopPropagation(); + } + placeDropdown('click'); + } + // If origin is clicked and menu is open, close menu + else if (origin.hasClass('active')) { + hideDropdown(); + $(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id')); + } + } + }); + + } // End else + + // Listen to open and close event - useful for select component + origin.on('open', function(e, eventType) { + placeDropdown(eventType); + }); + origin.on('close', hideDropdown); + + + }); + }; // End dropdown plugin + + $(document).ready(function(){ + $('.dropdown-button').dropdown(); + }); +}( jQuery )); +;(function($) { + var _stack = 0, + _lastID = 0, + _generateID = function() { + _lastID++; + return 'materialize-modal-overlay-' + _lastID; + }; + + var methods = { + init : function(options) { + var defaults = { + opacity: 0.5, + inDuration: 350, + outDuration: 250, + ready: undefined, + complete: undefined, + dismissible: true, + startingTop: '4%', + endingTop: '10%' + }; + + // Override defaults + options = $.extend(defaults, options); + + return this.each(function() { + var $modal = $(this); + var modal_id = $(this).attr("id") || '#' + $(this).data('target'); + + var closeModal = function() { + var overlayID = $modal.data('overlay-id'); + var $overlay = $('#' + overlayID); + $modal.removeClass('open'); + + // Enable scrolling + $('body').css({ + overflow: '', + width: '' + }); + + $modal.find('.modal-close').off('click.close'); + $(document).off('keyup.modal' + overlayID); + + $overlay.velocity( { opacity: 0}, {duration: options.outDuration, queue: false, ease: "easeOutQuart"}); + + + // Define Bottom Sheet animation + var exitVelocityOptions = { + duration: options.outDuration, + queue: false, + ease: "easeOutCubic", + // Handle modal ready callback + complete: function() { + $(this).css({display:"none"}); + + // Call complete callback + if (typeof(options.complete) === "function") { + options.complete.call(this, $modal); + } + $overlay.remove(); + _stack--; + } + }; + if ($modal.hasClass('bottom-sheet')) { + $modal.velocity({bottom: "-100%", opacity: 0}, exitVelocityOptions); + } + else { + $modal.velocity( + { top: options.startingTop, opacity: 0, scaleX: 0.7}, + exitVelocityOptions + ); + } + }; + + var openModal = function($trigger) { + var $body = $('body'); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + if ($modal.hasClass('open')) { + return; + } + + var overlayID = _generateID(); + var $overlay = $('<div class="modal-overlay"></div>'); + lStack = (++_stack); + + // Store a reference of the overlay + $overlay.attr('id', overlayID).css('z-index', 1000 + lStack * 2); + $modal.data('overlay-id', overlayID).css('z-index', 1000 + lStack * 2 + 1); + $modal.addClass('open'); + + $("body").append($overlay); + + if (options.dismissible) { + $overlay.click(function() { + closeModal(); + }); + // Return on ESC + $(document).on('keyup.modal' + overlayID, function(e) { + if (e.keyCode === 27) { // ESC key + closeModal(); + } + }); + } + + $modal.find(".modal-close").on('click.close', function(e) { + closeModal(); + }); + + $overlay.css({ display : "block", opacity : 0 }); + + $modal.css({ + display : "block", + opacity: 0 + }); + + $overlay.velocity({opacity: options.opacity}, {duration: options.inDuration, queue: false, ease: "easeOutCubic"}); + $modal.data('associated-overlay', $overlay[0]); + + // Define Bottom Sheet animation + var enterVelocityOptions = { + duration: options.inDuration, + queue: false, + ease: "easeOutCubic", + // Handle modal ready callback + complete: function() { + if (typeof(options.ready) === "function") { + options.ready.call(this, $modal, $trigger); + } + } + }; + if ($modal.hasClass('bottom-sheet')) { + $modal.velocity({bottom: "0", opacity: 1}, enterVelocityOptions); + } + else { + $.Velocity.hook($modal, "scaleX", 0.7); + $modal.css({ top: options.startingTop }); + $modal.velocity({top: options.endingTop, opacity: 1, scaleX: '1'}, enterVelocityOptions); + } + + }; + + // Reset handlers + $(document).off('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]'); + $(this).off('openModal'); + $(this).off('closeModal'); + + // Close Handlers + $(document).on('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]', function(e) { + options.startingTop = ($(this).offset().top - $(window).scrollTop()) /1.15; + openModal($(this)); + e.preventDefault(); + }); // done set on click + + $(this).on('openModal', function() { + var modal_id = $(this).attr("href") || '#' + $(this).data('target'); + openModal(); + }); + + $(this).on('closeModal', function() { + closeModal(); + }); + }); // done return + }, + open : function() { + $(this).trigger('openModal'); + }, + close : function() { + $(this).trigger('closeModal'); + } + }; + + $.fn.modal = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.modal' ); + } + }; +})(jQuery); +;(function ($) { + + $.fn.materialbox = function () { + + return this.each(function() { + + if ($(this).hasClass('initialized')) { + return; + } + + $(this).addClass('initialized'); + + var overlayActive = false; + var doneAnimating = true; + var inDuration = 275; + var outDuration = 200; + var origin = $(this); + var placeholder = $('<div></div>').addClass('material-placeholder'); + var originalWidth = 0; + var originalHeight = 0; + var ancestorsChanged; + var ancestor; + origin.wrap(placeholder); + + + origin.on('click', function(){ + var placeholder = origin.parent('.material-placeholder'); + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var originalWidth = origin.width(); + var originalHeight = origin.height(); + + + // If already modal, return to original + if (doneAnimating === false) { + returnToOriginal(); + return false; + } + else if (overlayActive && doneAnimating===true) { + returnToOriginal(); + return false; + } + + + // Set states + doneAnimating = false; + origin.addClass('active'); + overlayActive = true; + + // Set positioning for placeholder + placeholder.css({ + width: placeholder[0].getBoundingClientRect().width, + height: placeholder[0].getBoundingClientRect().height, + position: 'relative', + top: 0, + left: 0 + }); + + // Find ancestor with overflow: hidden; and remove it + ancestorsChanged = undefined; + ancestor = placeholder[0].parentNode; + var count = 0; + while (ancestor !== null && !$(ancestor).is(document)) { + var curr = $(ancestor); + if (curr.css('overflow') !== 'visible') { + curr.css('overflow', 'visible'); + if (ancestorsChanged === undefined) { + ancestorsChanged = curr; + } + else { + ancestorsChanged = ancestorsChanged.add(curr); + } + } + ancestor = ancestor.parentNode; + } + + // Set css on origin + origin.css({ + position: 'absolute', + 'z-index': 1000, + 'will-change': 'left, top, width, height' + }) + .data('width', originalWidth) + .data('height', originalHeight); + + // Add overlay + var overlay = $('<div id="materialbox-overlay"></div>') + .css({ + opacity: 0 + }) + .click(function(){ + if (doneAnimating === true) + returnToOriginal(); + }); + + // Put before in origin image to preserve z-index layering. + origin.before(overlay); + + // Set dimensions if needed + var overlayOffset = overlay[0].getBoundingClientRect(); + overlay.css({ + width: windowWidth, + height: windowHeight, + left: -1 * overlayOffset.left, + top: -1 * overlayOffset.top + }) + + // Animate Overlay + overlay.velocity({opacity: 1}, + {duration: inDuration, queue: false, easing: 'easeOutQuad'} ); + + // Add and animate caption if it exists + if (origin.data('caption') !== "") { + var $photo_caption = $('<div class="materialbox-caption"></div>'); + $photo_caption.text(origin.data('caption')); + $('body').append($photo_caption); + $photo_caption.css({ "display": "inline" }); + $photo_caption.velocity({opacity: 1}, {duration: inDuration, queue: false, easing: 'easeOutQuad'}); + } + + // Resize Image + var ratio = 0; + var widthPercent = originalWidth / windowWidth; + var heightPercent = originalHeight / windowHeight; + var newWidth = 0; + var newHeight = 0; + + if (widthPercent > heightPercent) { + ratio = originalHeight / originalWidth; + newWidth = windowWidth * 0.9; + newHeight = windowWidth * 0.9 * ratio; + } + else { + ratio = originalWidth / originalHeight; + newWidth = (windowHeight * 0.9) * ratio; + newHeight = windowHeight * 0.9; + } + + // Animate image + set z-index + if(origin.hasClass('responsive-img')) { + origin.velocity({'max-width': newWidth, 'width': originalWidth}, {duration: 0, queue: false, + complete: function(){ + origin.css({left: 0, top: 0}) + .velocity( + { + height: newHeight, + width: newWidth, + left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2, + top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2 + }, + { + duration: inDuration, + queue: false, + easing: 'easeOutQuad', + complete: function(){doneAnimating = true;} + } + ); + } // End Complete + }); // End Velocity + } + else { + origin.css('left', 0) + .css('top', 0) + .velocity( + { + height: newHeight, + width: newWidth, + left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2, + top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2 + }, + { + duration: inDuration, + queue: false, + easing: 'easeOutQuad', + complete: function(){doneAnimating = true;} + } + ); // End Velocity + } + + }); // End origin on click + + + // Return on scroll + $(window).scroll(function() { + if (overlayActive) { + returnToOriginal(); + } + }); + + // Return on ESC + $(document).keyup(function(e) { + + if (e.keyCode === 27 && doneAnimating === true) { // ESC key + if (overlayActive) { + returnToOriginal(); + } + } + }); + + + // This function returns the modaled image to the original spot + function returnToOriginal() { + + doneAnimating = false; + + var placeholder = origin.parent('.material-placeholder'); + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var originalWidth = origin.data('width'); + var originalHeight = origin.data('height'); + + origin.velocity("stop", true); + $('#materialbox-overlay').velocity("stop", true); + $('.materialbox-caption').velocity("stop", true); + + + $('#materialbox-overlay').velocity({opacity: 0}, { + duration: outDuration, // Delay prevents animation overlapping + queue: false, easing: 'easeOutQuad', + complete: function(){ + // Remove Overlay + overlayActive = false; + $(this).remove(); + } + }); + + // Resize Image + origin.velocity( + { + width: originalWidth, + height: originalHeight, + left: 0, + top: 0 + }, + { + duration: outDuration, + queue: false, easing: 'easeOutQuad' + } + ); + + // Remove Caption + reset css settings on image + $('.materialbox-caption').velocity({opacity: 0}, { + duration: outDuration, // Delay prevents animation overlapping + queue: false, easing: 'easeOutQuad', + complete: function(){ + placeholder.css({ + height: '', + width: '', + position: '', + top: '', + left: '' + }); + + origin.css({ + height: '', + top: '', + left: '', + width: '', + 'max-width': '', + position: '', + 'z-index': '', + 'will-change': '' + }); + + // Remove class + origin.removeClass('active'); + doneAnimating = true; + $(this).remove(); + + // Remove overflow overrides on ancestors + if (ancestorsChanged) { + ancestorsChanged.css('overflow', ''); + } + } + }); + + } + }); + }; + + $(document).ready(function(){ + $('.materialboxed').materialbox(); + }); + +}( jQuery )); +;(function ($) { + + $.fn.parallax = function () { + var window_width = $(window).width(); + // Parallax Scripts + return this.each(function(i) { + var $this = $(this); + $this.addClass('parallax'); + + function updateParallax(initial) { + var container_height; + if (window_width < 601) { + container_height = ($this.height() > 0) ? $this.height() : $this.children("img").height(); + } + else { + container_height = ($this.height() > 0) ? $this.height() : 500; + } + var $img = $this.children("img").first(); + var img_height = $img.height(); + var parallax_dist = img_height - container_height; + var bottom = $this.offset().top + container_height; + var top = $this.offset().top; + var scrollTop = $(window).scrollTop(); + var windowHeight = window.innerHeight; + var windowBottom = scrollTop + windowHeight; + var percentScrolled = (windowBottom - top) / (container_height + windowHeight); + var parallax = Math.round((parallax_dist * percentScrolled)); + + if (initial) { + $img.css('display', 'block'); + } + if ((bottom > scrollTop) && (top < (scrollTop + windowHeight))) { + $img.css('transform', "translate3D(-50%," + parallax + "px, 0)"); + } + + } + + // Wait for image load + $this.children("img").one("load", function() { + updateParallax(true); + }).each(function() { + if (this.complete) $(this).trigger("load"); + }); + + $(window).scroll(function() { + window_width = $(window).width(); + updateParallax(false); + }); + + $(window).resize(function() { + window_width = $(window).width(); + updateParallax(false); + }); + + }); + + }; +}( jQuery )); +;(function ($) { + + var methods = { + init : function(options) { + var defaults = { + onShow: null, + swipeable: false, + responsiveThreshold: Infinity, // breakpoint for swipeable + }; + options = $.extend(defaults, options); + + return this.each(function() { + + // For each set of tabs, we want to keep track of + // which tab is active and its associated content + var $this = $(this), + window_width = $(window).width(); + + var $active, $content, $links = $this.find('li.tab a'), + $tabs_width = $this.width(), + $tabs_content = $(), + $tabs_wrapper, + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length, + $indicator, + index = prev_index = 0, + clicked = false, + clickedTimeout, + transition = 300; + + + // Finds right attribute for indicator based on active tab. + // el: jQuery Object + var calcRightPos = function(el) { + return $tabs_width - el.position().left - el.outerWidth() - $this.scrollLeft(); + }; + + // Finds left attribute for indicator based on active tab. + // el: jQuery Object + var calcLeftPos = function(el) { + return el.position().left + $this.scrollLeft(); + }; + + // Animates Indicator to active tab. + // prev_index: Number + var animateIndicator = function(prev_index) { + if ((index - prev_index) >= 0) { + $indicator.velocity({"right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'}); + $indicator.velocity({"left": calcLeftPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90}); + + } else { + $indicator.velocity({"left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'}); + $indicator.velocity({"right": calcRightPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90}); + } + }; + + // Change swipeable according to responsive threshold + if (options.swipeable) { + if (window_width > options.responsiveThreshold) { + options.swipeable = false; + } + } + + + // If the location.hash matches one of the links, use that as the active tab. + $active = $($links.filter('[href="'+location.hash+'"]')); + + // If no match is found, use the first link or any with class 'active' as the initial active tab. + if ($active.length === 0) { + $active = $(this).find('li.tab a.active').first(); + } + if ($active.length === 0) { + $active = $(this).find('li.tab a').first(); + } + + $active.addClass('active'); + index = $links.index($active); + if (index < 0) { + index = 0; + } + + if ($active[0] !== undefined) { + $content = $($active[0].hash); + $content.addClass('active'); + } + + // append indicator then set indicator width to tab width + if (!$this.find('.indicator').length) { + $this.append('<div class="indicator"></div>'); + } + $indicator = $this.find('.indicator'); + + // we make sure that the indicator is at the end of the tabs + $this.append($indicator); + + if ($this.is(":visible")) { + // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)}); + // $indicator.css({"left": index * $tab_width}); + setTimeout(function() { + $indicator.css({"right": calcRightPos($active) }); + $indicator.css({"left": calcLeftPos($active) }); + }, 0); + } + $(window).resize(function () { + $tabs_width = $this.width(); + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; + if (index < 0) { + index = 0; + } + if ($tab_width !== 0 && $tabs_width !== 0) { + $indicator.css({"right": calcRightPos($active) }); + $indicator.css({"left": calcLeftPos($active) }); + } + }); + + // Initialize Tabs Content. + if (options.swipeable) { + // TODO: Duplicate calls with swipeable? handle multiple div wrapping. + $links.each(function () { + var $curr_content = $(Materialize.escapeHash(this.hash)); + $curr_content.addClass('carousel-item'); + $tabs_content = $tabs_content.add($curr_content); + }); + $tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>'); + $tabs_content.css('display', ''); + $('.tabs-content.carousel').carousel({ + fullWidth: true, + noWrap: true, + onCycleTo: function(item) { + if (!clicked) { + var prev_index = index; + index = $tabs_wrapper.index(item); + $active = $links.eq(index); + animateIndicator(prev_index); + } + }, + }); + } else { + // Hide the remaining content + $links.not($active).each(function () { + $(Materialize.escapeHash(this.hash)).hide(); + }); + } + + + // Bind the click event handler + $this.on('click', 'a', function(e) { + if ($(this).parent().hasClass('disabled')) { + e.preventDefault(); + return; + } + + // Act as regular link if target attribute is specified. + if (!!$(this).attr("target")) { + return; + } + + clicked = true; + $tabs_width = $this.width(); + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; + + // Make the old tab inactive. + $active.removeClass('active'); + var $oldContent = $content + + // Update the variables with the new link and content + $active = $(this); + $content = $(Materialize.escapeHash(this.hash)); + $links = $this.find('li.tab a'); + var activeRect = $active.position(); + + // Make the tab active. + $active.addClass('active'); + prev_index = index; + index = $links.index($(this)); + if (index < 0) { + index = 0; + } + // Change url to current tab + // window.location.hash = $active.attr('href'); + + // Swap content + if (options.swipeable) { + if ($tabs_content.length) { + $tabs_content.carousel('set', index); + } + } else { + if ($content !== undefined) { + $content.show(); + $content.addClass('active'); + if (typeof(options.onShow) === "function") { + options.onShow.call(this, $content); + } + } + + if ($oldContent !== undefined && + !$oldContent.is($content)) { + $oldContent.hide(); + $oldContent.removeClass('active'); + } + } + + // Reset clicked state + clickedTimeout = setTimeout(function(){ clicked = false; }, transition); + + // Update indicator + animateIndicator(prev_index); + + // Prevent the anchor's default click action + e.preventDefault(); + }); + }); + + }, + select_tab : function( id ) { + this.find('a[href="#' + id + '"]').trigger('click'); + } + }; + + $.fn.tabs = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tabs' ); + } + }; + + $(document).ready(function(){ + $('ul.tabs').tabs(); + }); +}( jQuery )); +;(function ($) { + $.fn.tooltip = function (options) { + var timeout = null, + margin = 5; + + // Defaults + var defaults = { + delay: 350, + tooltip: '', + position: 'bottom', + html: false + }; + + // Remove tooltip from the activator + if (options === "remove") { + this.each(function() { + $('#' + $(this).attr('data-tooltip-id')).remove(); + $(this).off('mouseenter.tooltip mouseleave.tooltip'); + }); + return false; + } + + options = $.extend(defaults, options); + + return this.each(function() { + var tooltipId = Materialize.guid(); + var origin = $(this); + + // Destroy old tooltip + if (origin.attr('data-tooltip-id')) { + $('#' + origin.attr('data-tooltip-id')).remove(); + } + + origin.attr('data-tooltip-id', tooltipId); + + // Get attributes. + var allowHtml, + tooltipDelay, + tooltipPosition, + tooltipText, + tooltipEl, + backdrop; + var setAttributes = function() { + allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html; + tooltipDelay = origin.attr('data-delay'); + tooltipDelay = (tooltipDelay === undefined || tooltipDelay === '') ? + options.delay : tooltipDelay; + tooltipPosition = origin.attr('data-position'); + tooltipPosition = (tooltipPosition === undefined || tooltipPosition === '') ? + options.position : tooltipPosition; + tooltipText = origin.attr('data-tooltip'); + tooltipText = (tooltipText === undefined || tooltipText === '') ? + options.tooltip : tooltipText; + }; + setAttributes(); + + var renderTooltipEl = function() { + var tooltip = $('<div class="material-tooltip"></div>'); + + // Create Text span + if (allowHtml) { + tooltipText = $('<span></span>').html(tooltipText); + } else{ + tooltipText = $('<span></span>').text(tooltipText); + } + + // Create tooltip + tooltip.append(tooltipText) + .appendTo($('body')) + .attr('id', tooltipId); + + // Create backdrop + backdrop = $('<div class="backdrop"></div>'); + backdrop.appendTo(tooltip); + return tooltip; + }; + tooltipEl = renderTooltipEl(); + + // Destroy previously binded events + origin.off('mouseenter.tooltip mouseleave.tooltip'); + // Mouse In + var started = false, timeoutRef; + origin.on({'mouseenter.tooltip': function(e) { + var showTooltip = function() { + setAttributes(); + started = true; + tooltipEl.velocity('stop'); + backdrop.velocity('stop'); + tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' }); + + // Tooltip positioning + var originWidth = origin.outerWidth(); + var originHeight = origin.outerHeight(); + var tooltipHeight = tooltipEl.outerHeight(); + var tooltipWidth = tooltipEl.outerWidth(); + var tooltipVerticalMovement = '0px'; + var tooltipHorizontalMovement = '0px'; + var backdropOffsetWidth = backdrop[0].offsetWidth; + var backdropOffsetHeight = backdrop[0].offsetHeight; + var scaleXFactor = 8; + var scaleYFactor = 8; + var scaleFactor = 0; + var targetTop, targetLeft, newCoordinates; + + if (tooltipPosition === "top") { + // Top Position + targetTop = origin.offset().top - tooltipHeight - margin; + targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + tooltipVerticalMovement = '-10px'; + backdrop.css({ + bottom: 0, + left: 0, + borderRadius: '14px 14px 0 0', + transformOrigin: '50% 100%', + marginTop: tooltipHeight, + marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2) + }); + } + // Left Position + else if (tooltipPosition === "left") { + targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2; + targetLeft = origin.offset().left - tooltipWidth - margin; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + + tooltipHorizontalMovement = '-10px'; + backdrop.css({ + top: '-7px', + right: 0, + width: '14px', + height: '14px', + borderRadius: '14px 0 0 14px', + transformOrigin: '95% 50%', + marginTop: tooltipHeight/2, + marginLeft: tooltipWidth + }); + } + // Right Position + else if (tooltipPosition === "right") { + targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2; + targetLeft = origin.offset().left + originWidth + margin; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + + tooltipHorizontalMovement = '+10px'; + backdrop.css({ + top: '-7px', + left: 0, + width: '14px', + height: '14px', + borderRadius: '0 14px 14px 0', + transformOrigin: '5% 50%', + marginTop: tooltipHeight/2, + marginLeft: '0px' + }); + } + else { + // Bottom Position + targetTop = origin.offset().top + origin.outerHeight() + margin; + targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + tooltipVerticalMovement = '+10px'; + backdrop.css({ + top: 0, + left: 0, + marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2) + }); + } + + // Set tooptip css placement + tooltipEl.css({ + top: newCoordinates.y, + left: newCoordinates.x + }); + + // Calculate Scale to fill + scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth); + scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight); + scaleFactor = Math.max(scaleXFactor, scaleYFactor); + + tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement}, { duration: 350, queue: false }) + .velocity({opacity: 1}, {duration: 300, delay: 50, queue: false}); + backdrop.css({ visibility: 'visible' }) + .velocity({opacity:1},{duration: 55, delay: 0, queue: false}) + .velocity({scaleX: scaleFactor, scaleY: scaleFactor}, {duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad'}); + }; + + timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval + + // Mouse Out + }, + 'mouseleave.tooltip': function(){ + // Reset State + started = false; + clearTimeout(timeoutRef); + + // Animate back + setTimeout(function() { + if (started !== true) { + tooltipEl.velocity({ + opacity: 0, translateY: 0, translateX: 0}, { duration: 225, queue: false}); + backdrop.velocity({opacity: 0, scaleX: 1, scaleY: 1}, { + duration:225, + queue: false, + complete: function(){ + backdrop.css({ visibility: 'hidden' }); + tooltipEl.css({ visibility: 'hidden' }); + started = false;} + }); + } + },225); + } + }); + }); + }; + + var repositionWithinScreen = function(x, y, width, height) { + var newX = x; + var newY = y; + + if (newX < 0) { + newX = 4; + } else if (newX + width > window.innerWidth) { + newX -= newX + width - window.innerWidth; + } + + if (newY < 0) { + newY = 4; + } else if (newY + height > window.innerHeight + $(window).scrollTop) { + newY -= newY + height - window.innerHeight; + } + + return {x: newX, y: newY}; + }; + + $(document).ready(function(){ + $('.tooltipped').tooltip(); + }); +}( jQuery )); +;/*! + * Waves v0.6.4 + * http://fian.my.id/Waves + * + * Copyright 2014 Alfiana E. Sibuea and other contributors + * Released under the MIT license + * https://github.com/fians/Waves/blob/master/LICENSE + */ + +;(function(window) { + 'use strict'; + + var Waves = Waves || {}; + var $$ = document.querySelectorAll.bind(document); + + // Find exact position of element + function isWindow(obj) { + return obj !== null && obj === obj.window; + } + + function getWindow(elem) { + return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView; + } + + function offset(elem) { + var docElem, win, + box = {top: 0, left: 0}, + doc = elem && elem.ownerDocument; + + docElem = doc.documentElement; + + if (typeof elem.getBoundingClientRect !== typeof undefined) { + box = elem.getBoundingClientRect(); + } + win = getWindow(doc); + return { + top: box.top + win.pageYOffset - docElem.clientTop, + left: box.left + win.pageXOffset - docElem.clientLeft + }; + } + + function convertStyle(obj) { + var style = ''; + + for (var a in obj) { + if (obj.hasOwnProperty(a)) { + style += (a + ':' + obj[a] + ';'); + } + } + + return style; + } + + var Effect = { + + // Effect delay + duration: 750, + + show: function(e, element) { + + // Disable right click + if (e.button === 2) { + return false; + } + + var el = element || this; + + // Create ripple + var ripple = document.createElement('div'); + ripple.className = 'waves-ripple'; + el.appendChild(ripple); + + // Get click coordinate and element witdh + var pos = offset(el); + var relativeY = (e.pageY - pos.top); + var relativeX = (e.pageX - pos.left); + var scale = 'scale('+((el.clientWidth / 100) * 10)+')'; + + // Support for touch devices + if ('touches' in e) { + relativeY = (e.touches[0].pageY - pos.top); + relativeX = (e.touches[0].pageX - pos.left); + } + + // Attach data to element + ripple.setAttribute('data-hold', Date.now()); + ripple.setAttribute('data-scale', scale); + ripple.setAttribute('data-x', relativeX); + ripple.setAttribute('data-y', relativeY); + + // Set ripple position + var rippleStyle = { + 'top': relativeY+'px', + 'left': relativeX+'px' + }; + + ripple.className = ripple.className + ' waves-notransition'; + ripple.setAttribute('style', convertStyle(rippleStyle)); + ripple.className = ripple.className.replace('waves-notransition', ''); + + // Scale the ripple + rippleStyle['-webkit-transform'] = scale; + rippleStyle['-moz-transform'] = scale; + rippleStyle['-ms-transform'] = scale; + rippleStyle['-o-transform'] = scale; + rippleStyle.transform = scale; + rippleStyle.opacity = '1'; + + rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['-o-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['transition-duration'] = Effect.duration + 'ms'; + + rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + + ripple.setAttribute('style', convertStyle(rippleStyle)); + }, + + hide: function(e) { + TouchHandler.touchup(e); + + var el = this; + var width = el.clientWidth * 1.4; + + // Get first ripple + var ripple = null; + var ripples = el.getElementsByClassName('waves-ripple'); + if (ripples.length > 0) { + ripple = ripples[ripples.length - 1]; + } else { + return false; + } + + var relativeX = ripple.getAttribute('data-x'); + var relativeY = ripple.getAttribute('data-y'); + var scale = ripple.getAttribute('data-scale'); + + // Get delay beetween mousedown and mouse leave + var diff = Date.now() - Number(ripple.getAttribute('data-hold')); + var delay = 350 - diff; + + if (delay < 0) { + delay = 0; + } + + // Fade out ripple after delay + setTimeout(function() { + var style = { + 'top': relativeY+'px', + 'left': relativeX+'px', + 'opacity': '0', + + // Duration + '-webkit-transition-duration': Effect.duration + 'ms', + '-moz-transition-duration': Effect.duration + 'ms', + '-o-transition-duration': Effect.duration + 'ms', + 'transition-duration': Effect.duration + 'ms', + '-webkit-transform': scale, + '-moz-transform': scale, + '-ms-transform': scale, + '-o-transform': scale, + 'transform': scale, + }; + + ripple.setAttribute('style', convertStyle(style)); + + setTimeout(function() { + try { + el.removeChild(ripple); + } catch(e) { + return false; + } + }, Effect.duration); + }, delay); + }, + + // Little hack to make <input> can perform waves effect + wrapInput: function(elements) { + for (var a = 0; a < elements.length; a++) { + var el = elements[a]; + + if (el.tagName.toLowerCase() === 'input') { + var parent = el.parentNode; + + // If input already have parent just pass through + if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) { + continue; + } + + // Put element class and style to the specified parent + var wrapper = document.createElement('i'); + wrapper.className = el.className + ' waves-input-wrapper'; + + var elementStyle = el.getAttribute('style'); + + if (!elementStyle) { + elementStyle = ''; + } + + wrapper.setAttribute('style', elementStyle); + + el.className = 'waves-button-input'; + el.removeAttribute('style'); + + // Put element as child + parent.replaceChild(wrapper, el); + wrapper.appendChild(el); + } + } + } + }; + + + /** + * Disable mousedown event for 500ms during and after touch + */ + var TouchHandler = { + /* uses an integer rather than bool so there's no issues with + * needing to clear timeouts if another touch event occurred + * within the 500ms. Cannot mouseup between touchstart and + * touchend, nor in the 500ms after touchend. */ + touches: 0, + allowEvent: function(e) { + var allow = true; + + if (e.type === 'touchstart') { + TouchHandler.touches += 1; //push + } else if (e.type === 'touchend' || e.type === 'touchcancel') { + setTimeout(function() { + if (TouchHandler.touches > 0) { + TouchHandler.touches -= 1; //pop after 500ms + } + }, 500); + } else if (e.type === 'mousedown' && TouchHandler.touches > 0) { + allow = false; + } + + return allow; + }, + touchup: function(e) { + TouchHandler.allowEvent(e); + } + }; + + + /** + * Delegated click handler for .waves-effect element. + * returns null when .waves-effect element not in "click tree" + */ + function getWavesEffectElement(e) { + if (TouchHandler.allowEvent(e) === false) { + return null; + } + + var element = null; + var target = e.target || e.srcElement; + + while (target.parentElement !== null) { + if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) { + element = target; + break; + } else if (target.classList.contains('waves-effect')) { + element = target; + break; + } + target = target.parentElement; + } + + return element; + } + + /** + * Bubble the click and show effect if .waves-effect elem was found + */ + function showEffect(e) { + var element = getWavesEffectElement(e); + + if (element !== null) { + Effect.show(e, element); + + if ('ontouchstart' in window) { + element.addEventListener('touchend', Effect.hide, false); + element.addEventListener('touchcancel', Effect.hide, false); + } + + element.addEventListener('mouseup', Effect.hide, false); + element.addEventListener('mouseleave', Effect.hide, false); + } + } + + Waves.displayEffect = function(options) { + options = options || {}; + + if ('duration' in options) { + Effect.duration = options.duration; + } + + //Wrap input inside <i> tag + Effect.wrapInput($$('.waves-effect')); + + if ('ontouchstart' in window) { + document.body.addEventListener('touchstart', showEffect, false); + } + + document.body.addEventListener('mousedown', showEffect, false); + }; + + /** + * Attach Waves to an input element (or any element which doesn't + * bubble mouseup/mousedown events). + * Intended to be used with dynamically loaded forms/inputs, or + * where the user doesn't want a delegated click handler. + */ + Waves.attach = function(element) { + //FUTURE: automatically add waves classes and allow users + // to specify them with an options param? Eg. light/classic/button + if (element.tagName.toLowerCase() === 'input') { + Effect.wrapInput([element]); + element = element.parentElement; + } + + if ('ontouchstart' in window) { + element.addEventListener('touchstart', showEffect, false); + } + + element.addEventListener('mousedown', showEffect, false); + }; + + window.Waves = Waves; + + document.addEventListener('DOMContentLoaded', function() { + Waves.displayEffect(); + }, false); + +})(window); +;Materialize.toast = function (message, displayLength, className, completeCallback) { + className = className || ""; + + var container = document.getElementById('toast-container'); + + // Create toast container if it does not exist + if (container === null) { + // create notification container + container = document.createElement('div'); + container.id = 'toast-container'; + document.body.appendChild(container); + } + + // Select and append toast + var newToast = createToast(message); + + // only append toast if message is not undefined + if(message){ + container.appendChild(newToast); + } + + newToast.style.opacity = 0; + + // Animate toast in + Vel(newToast, {translateY: '-35px', opacity: 1 }, {duration: 300, + easing: 'easeOutCubic', + queue: false}); + + // Allows timer to be pause while being panned + var timeLeft = displayLength; + var counterInterval; + if (timeLeft != null) { + counterInterval = setInterval (function(){ + if (newToast.parentNode === null) + window.clearInterval(counterInterval); + + // If toast is not being dragged, decrease its time remaining + if (!newToast.classList.contains('panning')) { + timeLeft -= 20; + } + + if (timeLeft <= 0) { + // Animate toast out + Vel(newToast, {"opacity": 0, marginTop: '-40px'}, { duration: 375, + easing: 'easeOutExpo', + queue: false, + complete: function(){ + // Call the optional callback + if(typeof(completeCallback) === "function") + completeCallback(); + // Remove toast after it times out + this[0].parentNode.removeChild(this[0]); + } + }); + window.clearInterval(counterInterval); + } + }, 20); + } + + + + function createToast(html) { + + // Create toast + var toast = document.createElement('div'); + toast.classList.add('toast'); + if (className) { + var classes = className.split(' '); + + for (var i = 0, count = classes.length; i < count; i++) { + toast.classList.add(classes[i]); + } + } + // If type of parameter is HTML Element + if ( typeof HTMLElement === "object" ? html instanceof HTMLElement : html && typeof html === "object" && html !== null && html.nodeType === 1 && typeof html.nodeName==="string" +) { + toast.appendChild(html); + } + else if (html instanceof jQuery) { + // Check if it is jQuery object + toast.appendChild(html[0]); + } + else { + // Insert as text; + toast.innerHTML = html; + } + // Bind hammer + var hammerHandler = new Hammer(toast, {prevent_default: false}); + hammerHandler.on('pan', function(e) { + var deltaX = e.deltaX; + var activationDistance = 80; + + // Change toast state + if (!toast.classList.contains('panning')){ + toast.classList.add('panning'); + } + + var opacityPercent = 1-Math.abs(deltaX / activationDistance); + if (opacityPercent < 0) + opacityPercent = 0; + + Vel(toast, {left: deltaX, opacity: opacityPercent }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + + }); + + hammerHandler.on('panend', function(e) { + var deltaX = e.deltaX; + var activationDistance = 80; + + // If toast dragged past activation point + if (Math.abs(deltaX) > activationDistance) { + Vel(toast, {marginTop: '-40px'}, { duration: 375, + easing: 'easeOutExpo', + queue: false, + complete: function(){ + if(typeof(completeCallback) === "function") { + completeCallback(); + } + toast.parentNode.removeChild(toast); + } + }); + + } else { + toast.classList.remove('panning'); + // Put toast back into original position + Vel(toast, { left: 0, opacity: 1 }, { duration: 300, + easing: 'easeOutExpo', + queue: false + }); + + } + }); + + return toast; + } +}; +;(function ($) { + + var methods = { + init : function(options) { + var defaults = { + menuWidth: 300, + edge: 'left', + closeOnClick: false, + draggable: true + }; + options = $.extend(defaults, options); + + $(this).each(function(){ + var $this = $(this); + var menuId = $this.attr('data-activates'); + var menu = $("#"+ menuId); + + // Set to width + if (options.menuWidth != 300) { + menu.css('width', options.menuWidth); + } + + // Add Touch Area + var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]'); + if (options.draggable) { + // Regenerate dragTarget + if ($dragTarget.length) { + $dragTarget.remove(); + } + + $dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId); + $('body').append($dragTarget); + } else { + $dragTarget = $(); + } + + if (options.edge == 'left') { + menu.css('transform', 'translateX(-100%)'); + $dragTarget.css({'left': 0}); // Add Touch Area + } + else { + menu.addClass('right-aligned') // Change text-alignment to right + .css('transform', 'translateX(100%)'); + $dragTarget.css({'right': 0}); // Add Touch Area + } + + // If fixed sidenav, bring menu out + if (menu.hasClass('fixed')) { + if (window.innerWidth > 992) { + menu.css('transform', 'translateX(0)'); + } + } + + // Window resize to reset on large screens fixed + if (menu.hasClass('fixed')) { + $(window).resize( function() { + if (window.innerWidth > 992) { + // Close menu if window is resized bigger than 992 and user has fixed sidenav + if ($('#sidenav-overlay').length !== 0 && menuOut) { + removeMenu(true); + } + else { + // menu.removeAttr('style'); + menu.css('transform', 'translateX(0%)'); + // menu.css('width', options.menuWidth); + } + } + else if (menuOut === false){ + if (options.edge === 'left') { + menu.css('transform', 'translateX(-100%)'); + } else { + menu.css('transform', 'translateX(100%)'); + } + + } + + }); + } + + // if closeOnClick, then add close event for all a tags in side sideNav + if (options.closeOnClick === true) { + menu.on("click.itemclick", "a:not(.collapsible-header)", function(){ + removeMenu(); + }); + } + + var removeMenu = function(restoreNav) { + panning = false; + menuOut = false; + // Reenable scrolling + $('body').css({ + overflow: '', + width: '' + }); + + $('#sidenav-overlay').velocity({opacity: 0}, {duration: 200, + queue: false, easing: 'easeOutQuad', + complete: function() { + $(this).remove(); + } }); + if (options.edge === 'left') { + // Reset phantom div + $dragTarget.css({width: '', right: '', left: '0'}); + menu.velocity( + {'translateX': '-100%'}, + { duration: 200, + queue: false, + easing: 'easeOutCubic', + complete: function() { + if (restoreNav === true) { + // Restore Fixed sidenav + menu.removeAttr('style'); + menu.css('width', options.menuWidth); + } + } + + }); + } + else { + // Reset phantom div + $dragTarget.css({width: '', right: '0', left: ''}); + menu.velocity( + {'translateX': '100%'}, + { duration: 200, + queue: false, + easing: 'easeOutCubic', + complete: function() { + if (restoreNav === true) { + // Restore Fixed sidenav + menu.removeAttr('style'); + menu.css('width', options.menuWidth); + } + } + }); + } + }; + + + + // Touch Event + var panning = false; + var menuOut = false; + + if (options.draggable) { + $dragTarget.on('click', function(){ + if (menuOut) { + removeMenu(); + } + }); + + $dragTarget.hammer({ + prevent_default: false + }).bind('pan', function(e) { + + if (e.gesture.pointerType == "touch") { + + var direction = e.gesture.direction; + var x = e.gesture.center.x; + var y = e.gesture.center.y; + var velocityX = e.gesture.velocityX; + + // Disable Scrolling + var $body = $('body'); + var $overlay = $('#sidenav-overlay'); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + // If overlay does not exist, create one and if it is clicked, close menu + if ($overlay.length === 0) { + $overlay = $('<div id="sidenav-overlay"></div>'); + $overlay.css('opacity', 0).click( function(){ + removeMenu(); + }); + $('body').append($overlay); + } + + // Keep within boundaries + if (options.edge === 'left') { + if (x > options.menuWidth) { x = options.menuWidth; } + else if (x < 0) { x = 0; } + } + + if (options.edge === 'left') { + // Left Direction + if (x < (options.menuWidth / 2)) { menuOut = false; } + // Right Direction + else if (x >= (options.menuWidth / 2)) { menuOut = true; } + menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)'); + } + else { + // Left Direction + if (x < (window.innerWidth - options.menuWidth / 2)) { + menuOut = true; + } + // Right Direction + else if (x >= (window.innerWidth - options.menuWidth / 2)) { + menuOut = false; + } + var rightPos = (x - options.menuWidth / 2); + if (rightPos < 0) { + rightPos = 0; + } + + menu.css('transform', 'translateX(' + rightPos + 'px)'); + } + + + // Percentage overlay + var overlayPerc; + if (options.edge === 'left') { + overlayPerc = x / options.menuWidth; + $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'}); + } + else { + overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth); + $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'}); + } + } + + }).bind('panend', function(e) { + + if (e.gesture.pointerType == "touch") { + var $overlay = $('<div id="sidenav-overlay"></div>'); + var velocityX = e.gesture.velocityX; + var x = e.gesture.center.x; + var leftPos = x - options.menuWidth; + var rightPos = x - options.menuWidth / 2; + if (leftPos > 0 ) { + leftPos = 0; + } + if (rightPos < 0) { + rightPos = 0; + } + panning = false; + + if (options.edge === 'left') { + // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut + if ((menuOut && velocityX <= 0.3) || velocityX < -0.5) { + // Return menu to open + if (leftPos !== 0) { + menu.velocity({'translateX': [0, leftPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + $dragTarget.css({width: '50%', right: 0, left: ''}); + menuOut = true; + } + else if (!menuOut || velocityX > 0.3) { + // Enable Scrolling + $('body').css({ + overflow: '', + width: '' + }); + // Slide menu closed + menu.velocity({'translateX': [-1 * options.menuWidth - 10, leftPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'}); + $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad', + complete: function () { + $(this).remove(); + }}); + $dragTarget.css({width: '10px', right: '', left: 0}); + } + } + else { + if ((menuOut && velocityX >= -0.3) || velocityX > 0.5) { + // Return menu to open + if (rightPos !== 0) { + menu.velocity({'translateX': [0, rightPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + $dragTarget.css({width: '50%', right: '', left: 0}); + menuOut = true; + } + else if (!menuOut || velocityX < -0.3) { + // Enable Scrolling + $('body').css({ + overflow: '', + width: '' + }); + + // Slide menu closed + menu.velocity({'translateX': [options.menuWidth + 10, rightPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'}); + $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad', + complete: function () { + $(this).remove(); + }}); + $dragTarget.css({width: '10px', right: 0, left: ''}); + } + } + + } + }); + } + + $this.off('click.sidenav').on('click.sidenav', function() { + if (menuOut === true) { + menuOut = false; + panning = false; + removeMenu(); + } + else { + + // Disable Scrolling + var $body = $('body'); + var $overlay = $('<div id="sidenav-overlay"></div>'); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + // Push current drag target on top of DOM tree + $('body').append($dragTarget); + + if (options.edge === 'left') { + $dragTarget.css({width: '50%', right: 0, left: ''}); + menu.velocity({'translateX': [0, -1 * options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + else { + $dragTarget.css({width: '50%', right: '', left: 0}); + menu.velocity({'translateX': [0, options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + $overlay.css('opacity', 0) + .click(function(){ + menuOut = false; + panning = false; + removeMenu(); + $overlay.velocity({opacity: 0}, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function() { + $(this).remove(); + } }); + + }); + $('body').append($overlay); + $overlay.velocity({opacity: 1}, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + menuOut = true; + panning = false; + } + }); + } + + return false; + }); + }); + + + }, + destroy: function () { + var $overlay = $('#sidenav-overlay'); + var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]'); + $overlay.trigger('click'); + $dragTarget.remove(); + $(this).off('click'); + $overlay.remove(); + }, + show : function() { + this.trigger('click'); + }, + hide : function() { + $('#sidenav-overlay').trigger('click'); + } + }; + + + $.fn.sideNav = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.sideNav' ); + } + }; // Plugin end +}( jQuery )); +;/** + * Extend jquery with a scrollspy plugin. + * This watches the window scroll and fires events when elements are scrolled into viewport. + * + * throttle() and getTime() taken from Underscore.js + * https://github.com/jashkenas/underscore + * + * @author Copyright 2013 John Smart + * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE + * @see https://github.com/thesmart + * @version 0.1.2 + */ +(function($) { + + var jWindow = $(window); + var elements = []; + var elementsInView = []; + var isSpying = false; + var ticks = 0; + var unique_id = 1; + var offset = { + top : 0, + right : 0, + bottom : 0, + left : 0, + } + + /** + * Find elements that are within the boundary + * @param {number} top + * @param {number} right + * @param {number} bottom + * @param {number} left + * @return {jQuery} A collection of elements + */ + function findElements(top, right, bottom, left) { + var hits = $(); + $.each(elements, function(i, element) { + if (element.height() > 0) { + var elTop = element.offset().top, + elLeft = element.offset().left, + elRight = elLeft + element.width(), + elBottom = elTop + element.height(); + + var isIntersect = !(elLeft > right || + elRight < left || + elTop > bottom || + elBottom < top); + + if (isIntersect) { + hits.push(element); + } + } + }); + + return hits; + } + + + /** + * Called when the user scrolls the window + */ + function onScroll(scrollOffset) { + // unique tick id + ++ticks; + + // viewport rectangle + var top = jWindow.scrollTop(), + left = jWindow.scrollLeft(), + right = left + jWindow.width(), + bottom = top + jWindow.height(); + + // determine which elements are in view + var intersections = findElements(top+offset.top + scrollOffset || 200, right+offset.right, bottom+offset.bottom, left+offset.left); + $.each(intersections, function(i, element) { + + var lastTick = element.data('scrollSpy:ticks'); + if (typeof lastTick != 'number') { + // entered into view + element.triggerHandler('scrollSpy:enter'); + } + + // update tick id + element.data('scrollSpy:ticks', ticks); + }); + + // determine which elements are no longer in view + $.each(elementsInView, function(i, element) { + var lastTick = element.data('scrollSpy:ticks'); + if (typeof lastTick == 'number' && lastTick !== ticks) { + // exited from view + element.triggerHandler('scrollSpy:exit'); + element.data('scrollSpy:ticks', null); + } + }); + + // remember elements in view for next tick + elementsInView = intersections; + } + + /** + * Called when window is resized + */ + function onWinSize() { + jWindow.trigger('scrollSpy:winSize'); + } + + + /** + * Enables ScrollSpy using a selector + * @param {jQuery|string} selector The elements collection, or a selector + * @param {Object=} options Optional. + throttle : number -> scrollspy throttling. Default: 100 ms + offsetTop : number -> offset from top. Default: 0 + offsetRight : number -> offset from right. Default: 0 + offsetBottom : number -> offset from bottom. Default: 0 + offsetLeft : number -> offset from left. Default: 0 + * @returns {jQuery} + */ + $.scrollSpy = function(selector, options) { + var defaults = { + throttle: 100, + scrollOffset: 200 // offset - 200 allows elements near bottom of page to scroll + }; + options = $.extend(defaults, options); + + var visible = []; + selector = $(selector); + selector.each(function(i, element) { + elements.push($(element)); + $(element).data("scrollSpy:id", i); + // Smooth scroll to section + $('a[href="#' + $(element).attr('id') + '"]').click(function(e) { + e.preventDefault(); + var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1; + $('html, body').animate({ scrollTop: offset - options.scrollOffset }, {duration: 400, queue: false, easing: 'easeOutCubic'}); + }); + }); + + offset.top = options.offsetTop || 0; + offset.right = options.offsetRight || 0; + offset.bottom = options.offsetBottom || 0; + offset.left = options.offsetLeft || 0; + + var throttledScroll = Materialize.throttle(function() { + onScroll(options.scrollOffset); + }, options.throttle || 100); + var readyScroll = function(){ + $(document).ready(throttledScroll); + }; + + if (!isSpying) { + jWindow.on('scroll', readyScroll); + jWindow.on('resize', readyScroll); + isSpying = true; + } + + // perform a scan once, after current execution context, and after dom is ready + setTimeout(readyScroll, 0); + + + selector.on('scrollSpy:enter', function() { + visible = $.grep(visible, function(value) { + return value.height() != 0; + }); + + var $this = $(this); + + if (visible[0]) { + $('a[href="#' + visible[0].attr('id') + '"]').removeClass('active'); + if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) { + visible.unshift($(this)); + } + else { + visible.push($(this)); + } + } + else { + visible.push($(this)); + } + + + $('a[href="#' + visible[0].attr('id') + '"]').addClass('active'); + }); + selector.on('scrollSpy:exit', function() { + visible = $.grep(visible, function(value) { + return value.height() != 0; + }); + + if (visible[0]) { + $('a[href="#' + visible[0].attr('id') + '"]').removeClass('active'); + var $this = $(this); + visible = $.grep(visible, function(value) { + return value.attr('id') != $this.attr('id'); + }); + if (visible[0]) { // Check if empty + $('a[href="#' + visible[0].attr('id') + '"]').addClass('active'); + } + } + }); + + return selector; + }; + + /** + * Listen for window resize events + * @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms + * @returns {jQuery} $(window) + */ + $.winSizeSpy = function(options) { + $.winSizeSpy = function() { return jWindow; }; // lock from multiple calls + options = options || { + throttle: 100 + }; + return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100)); + }; + + /** + * Enables ScrollSpy on a collection of elements + * e.g. $('.scrollSpy').scrollSpy() + * @param {Object=} options Optional. + throttle : number -> scrollspy throttling. Default: 100 ms + offsetTop : number -> offset from top. Default: 0 + offsetRight : number -> offset from right. Default: 0 + offsetBottom : number -> offset from bottom. Default: 0 + offsetLeft : number -> offset from left. Default: 0 + * @returns {jQuery} + */ + $.fn.scrollSpy = function(options) { + return $.scrollSpy($(this), options); + }; + +})(jQuery); +;(function ($) { + $(document).ready(function() { + + // Function to update labels of text fields + Materialize.updateTextFields = function() { + var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; + $(input_selector).each(function(index, element) { + var $this = $(this); + if ($(element).val().length > 0 || element.autofocus || $this.attr('placeholder') !== undefined) { + $this.siblings('label').addClass('active'); + } else if ($(element)[0].validity) { + $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true); + } else { + $this.siblings('label').removeClass('active'); + } + }); + }; + + // Text based inputs + var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; + + // Add active if form auto complete + $(document).on('change', input_selector, function () { + if($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) { + $(this).siblings('label').addClass('active'); + } + validate_field($(this)); + }); + + // Add active if input element has been pre-populated on document ready + $(document).ready(function() { + Materialize.updateTextFields(); + }); + + // HTML DOM FORM RESET handling + $(document).on('reset', function(e) { + var formReset = $(e.target); + if (formReset.is('form')) { + formReset.find(input_selector).removeClass('valid').removeClass('invalid'); + formReset.find(input_selector).each(function () { + if ($(this).attr('value') === '') { + $(this).siblings('label').removeClass('active'); + } + }); + + // Reset select + formReset.find('select.initialized').each(function () { + var reset_text = formReset.find('option[selected]').text(); + formReset.siblings('input.select-dropdown').val(reset_text); + }); + } + }); + + // Add active when element has focus + $(document).on('focus', input_selector, function () { + $(this).siblings('label, .prefix').addClass('active'); + }); + + $(document).on('blur', input_selector, function () { + var $inputElement = $(this); + var selector = ".prefix"; + + if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) { + selector += ", label"; + } + + $inputElement.siblings(selector).removeClass('active'); + + validate_field($inputElement); + }); + + window.validate_field = function(object) { + var hasLength = object.attr('data-length') !== undefined; + var lenAttr = parseInt(object.attr('data-length')); + var len = object.val().length; + + if (object.val().length === 0 && object[0].validity.badInput === false) { + if (object.hasClass('validate')) { + object.removeClass('valid'); + object.removeClass('invalid'); + } + } + else { + if (object.hasClass('validate')) { + // Check for character counter attributes + if ((object.is(':valid') && hasLength && (len <= lenAttr)) || (object.is(':valid') && !hasLength)) { + object.removeClass('invalid'); + object.addClass('valid'); + } + else { + object.removeClass('valid'); + object.addClass('invalid'); + } + } + } + }; + + // Radio and Checkbox focus class + var radio_checkbox = 'input[type=radio], input[type=checkbox]'; + $(document).on('keyup.radio', radio_checkbox, function(e) { + // TAB, check if tabbing to radio or checkbox. + if (e.which === 9) { + $(this).addClass('tabbed'); + var $this = $(this); + $this.one('blur', function(e) { + + $(this).removeClass('tabbed'); + }); + return; + } + }); + + // Textarea Auto Resize + var hiddenDiv = $('.hiddendiv').first(); + if (!hiddenDiv.length) { + hiddenDiv = $('<div class="hiddendiv common"></div>'); + $('body').append(hiddenDiv); + } + var text_area_selector = '.materialize-textarea'; + + function textareaAutoResize($textarea) { + // Set font properties of hiddenDiv + + var fontFamily = $textarea.css('font-family'); + var fontSize = $textarea.css('font-size'); + var lineHeight = $textarea.css('line-height'); + + if (fontSize) { hiddenDiv.css('font-size', fontSize); } + if (fontFamily) { hiddenDiv.css('font-family', fontFamily); } + if (lineHeight) { hiddenDiv.css('line-height', lineHeight); } + + if ($textarea.attr('wrap') === "off") { + hiddenDiv.css('overflow-wrap', "normal") + .css('white-space', "pre"); + } + + hiddenDiv.text($textarea.val() + '\n'); + var content = hiddenDiv.html().replace(/\n/g, '<br>'); + hiddenDiv.html(content); + + + // When textarea is hidden, width goes crazy. + // Approximate with half of window size + + if ($textarea.is(':visible')) { + hiddenDiv.css('width', $textarea.width()); + } + else { + hiddenDiv.css('width', $(window).width()/2); + } + + $textarea.css('height', hiddenDiv.height()); + } + + $(text_area_selector).each(function () { + var $textarea = $(this); + if ($textarea.val().length) { + textareaAutoResize($textarea); + } + }); + + $('body').on('keyup keydown autoresize', text_area_selector, function () { + textareaAutoResize($(this)); + }); + + // File Input Path + $(document).on('change', '.file-field input[type="file"]', function () { + var file_field = $(this).closest('.file-field'); + var path_input = file_field.find('input.file-path'); + var files = $(this)[0].files; + var file_names = []; + for (var i = 0; i < files.length; i++) { + file_names.push(files[i].name); + } + path_input.val(file_names.join(", ")); + path_input.trigger('change'); + }); + + /**************** + * Range Input * + ****************/ + + var range_type = 'input[type=range]'; + var range_mousedown = false; + var left; + + $(range_type).each(function () { + var thumb = $('<span class="thumb"><span class="value"></span></span>'); + $(this).after(thumb); + }); + + var range_wrapper = '.range-field'; + $(document).on('change', range_type, function(e) { + var thumb = $(this).siblings('.thumb'); + thumb.find('.value').html($(this).val()); + }); + + $(document).on('input mousedown touchstart', range_type, function(e) { + var thumb = $(this).siblings('.thumb'); + var width = $(this).outerWidth(); + + // If thumb indicator does not exist yet, create it + if (thumb.length <= 0) { + thumb = $('<span class="thumb"><span class="value"></span></span>'); + $(this).after(thumb); + } + + // Set indicator value + thumb.find('.value').html($(this).val()); + + range_mousedown = true; + $(this).addClass('active'); + + if (!thumb.hasClass('active')) { + thumb.velocity({ height: "30px", width: "30px", top: "-20px", marginLeft: "-15px"}, { duration: 300, easing: 'easeOutExpo' }); + } + + if (e.type !== 'input') { + if(e.pageX === undefined || e.pageX === null){//mobile + left = e.originalEvent.touches[0].pageX - $(this).offset().left; + } + else{ // desktop + left = e.pageX - $(this).offset().left; + } + if (left < 0) { + left = 0; + } + else if (left > width) { + left = width; + } + thumb.addClass('active').css('left', left); + } + + thumb.find('.value').html($(this).val()); + }); + + $(document).on('mouseup touchend', range_wrapper, function() { + range_mousedown = false; + $(this).removeClass('active'); + }); + + $(document).on('mousemove touchmove', range_wrapper, function(e) { + var thumb = $(this).children('.thumb'); + var left; + if (range_mousedown) { + if (!thumb.hasClass('active')) { + thumb.velocity({ height: '30px', width: '30px', top: '-20px', marginLeft: '-15px'}, { duration: 300, easing: 'easeOutExpo' }); + } + if (e.pageX === undefined || e.pageX === null) { //mobile + left = e.originalEvent.touches[0].pageX - $(this).offset().left; + } + else{ // desktop + left = e.pageX - $(this).offset().left; + } + var width = $(this).outerWidth(); + + if (left < 0) { + left = 0; + } + else if (left > width) { + left = width; + } + thumb.addClass('active').css('left', left); + thumb.find('.value').html(thumb.siblings(range_type).val()); + } + }); + + $(document).on('mouseout touchleave', range_wrapper, function() { + if (!range_mousedown) { + + var thumb = $(this).children('.thumb'); + + if (thumb.hasClass('active')) { + thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: '-6px'}, { duration: 100 }); + } + thumb.removeClass('active'); + } + }); + + /************************** + * Auto complete plugin * + *************************/ + $.fn.autocomplete = function (options) { + // Defaults + var defaults = { + data: {}, + limit: Infinity, + onAutocomplete: null + }; + + options = $.extend(defaults, options); + + return this.each(function() { + var $input = $(this); + var data = options.data, + count = 0, + activeIndex = 0, + oldVal, + $inputDiv = $input.closest('.input-field'); // Div to append on + + // Check if data isn't empty + if (!$.isEmptyObject(data)) { + var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>'); + var $oldAutocomplete; + + // Append autocomplete element. + // Prevent double structure init. + if ($inputDiv.length) { + $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first(); + if (!$oldAutocomplete.length) { + $inputDiv.append($autocomplete); // Set ul in body + } + } else { + $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content'); + if (!$oldAutocomplete.length) { + $input.after($autocomplete); + } + } + if ($oldAutocomplete.length) { + $autocomplete = $oldAutocomplete; + } + + // Highlight partial match. + var highlight = function(string, $el) { + var img = $el.find('img'); + var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""), + matchEnd = matchStart + string.length - 1, + beforeMatch = $el.text().slice(0, matchStart), + matchText = $el.text().slice(matchStart, matchEnd + 1), + afterMatch = $el.text().slice(matchEnd + 1); + $el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>"); + if (img.length) { + $el.prepend(img); + } + }; + + // Reset current element position + var resetCurrentElement = function() { + activeIndex = 0; + $autocomplete.find('.active').removeClass('active'); + } + + // Perform search + $input.off('keyup.autocomplete').on('keyup.autocomplete', function (e) { + // Reset count. + count = 0; + + // Don't capture enter or arrow key usage. + if (e.which === 13 || + e.which === 38 || + e.which === 40) { + return; + } + + var val = $input.val().toLowerCase(); + + // Check if the input isn't empty + if (oldVal !== val) { + $autocomplete.empty(); + resetCurrentElement(); + + if (val !== '') { + for(var key in data) { + if (data.hasOwnProperty(key) && + key.toLowerCase().indexOf(val) !== -1 && + key.toLowerCase() !== val) { + // Break if past limit + if (count >= options.limit) { + break; + } + + var autocompleteOption = $('<li></li>'); + if (!!data[key]) { + autocompleteOption.append('<img src="'+ data[key] +'" class="right circle"><span>'+ key +'</span>'); + } else { + autocompleteOption.append('<span>'+ key +'</span>'); + } + + $autocomplete.append(autocompleteOption); + highlight(val, autocompleteOption); + count++; + } + } + } + } + + // Update oldVal + oldVal = val; + }); + + $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) { + // Arrow keys and enter key usage + var keyCode = e.which, + liElement, + numItems = $autocomplete.children('li').length, + $active = $autocomplete.children('.active').first(); + + // select element on Enter + if (keyCode === 13) { + liElement = $autocomplete.children('li').eq(activeIndex); + if (liElement.length) { + liElement.click(); + e.preventDefault(); + } + return; + } + + // Capture up and down key + if ( keyCode === 38 || keyCode === 40 ) { + e.preventDefault(); + + if (keyCode === 38 && + activeIndex > 0) { + activeIndex--; + } + + if (keyCode === 40 && + activeIndex < (numItems - 1) && + $active.length) { + activeIndex++; + } + + $active.removeClass('active'); + $autocomplete.children('li').eq(activeIndex).addClass('active'); + } + }); + + // Set input value + $autocomplete.on('click', 'li', function () { + var text = $(this).text().trim(); + $input.val(text); + $input.trigger('change'); + $autocomplete.empty(); + resetCurrentElement(); + + // Handle onAutocomplete callback. + if (typeof(options.onAutocomplete) === "function") { + options.onAutocomplete.call(this, text); + } + }); + } + }); + }; + + }); // End of $(document).ready + + /******************* + * Select Plugin * + ******************/ + $.fn.material_select = function (callback) { + $(this).each(function(){ + var $select = $(this); + + if ($select.hasClass('browser-default')) { + return; // Continue to next (return false breaks out of entire loop) + } + + var multiple = $select.attr('multiple') ? true : false, + lastID = $select.data('select-id'); // Tear down structure if Select needs to be rebuilt + + if (lastID) { + $select.parent().find('span.caret').remove(); + $select.parent().find('input').remove(); + + $select.unwrap(); + $('ul#select-options-'+lastID).remove(); + } + + // If destroying the select, remove the selelct-id and reset it to it's uninitialized state. + if(callback === 'destroy') { + $select.data('select-id', null).removeClass('initialized'); + return; + } + + var uniqueID = Materialize.guid(); + $select.data('select-id', uniqueID); + var wrapper = $('<div class="select-wrapper"></div>'); + wrapper.addClass($select.attr('class')); + var options = $('<ul id="select-options-' + uniqueID +'" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'), + selectChildren = $select.children('option, optgroup'), + valuesSelected = [], + optionsHover = false; + + var label = $select.find('option:selected').html() || $select.find('option:first').html() || ""; + + // Function that renders and appends the option taking into + // account type and possible image icon. + var appendOptionWithIcon = function(select, option, type) { + // Add disabled attr if disabled + var disabledClass = (option.is(':disabled')) ? 'disabled ' : ''; + var optgroupClass = (type === 'optgroup-option') ? 'optgroup-option ' : ''; + + // add icons + var icon_url = option.data('icon'); + var classes = option.attr('class'); + if (!!icon_url) { + var classString = ''; + if (!!classes) classString = ' class="' + classes + '"'; + + // Check for multiple type. + if (type === 'multiple') { + options.append($('<li class="' + disabledClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span><input type="checkbox"' + disabledClass + '/><label></label>' + option.html() + '</span></li>')); + } else { + options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + option.html() + '</span></li>')); + } + return true; + } + + // Check for multiple type. + if (type === 'multiple') { + options.append($('<li class="' + disabledClass + '"><span><input type="checkbox"' + disabledClass + '/><label></label>' + option.html() + '</span></li>')); + } else { + options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + option.html() + '</span></li>')); + } + }; + + /* Create dropdown structure. */ + if (selectChildren.length) { + selectChildren.each(function() { + if ($(this).is('option')) { + // Direct descendant option. + if (multiple) { + appendOptionWithIcon($select, $(this), 'multiple'); + + } else { + appendOptionWithIcon($select, $(this)); + } + } else if ($(this).is('optgroup')) { + // Optgroup. + var selectOptions = $(this).children('option'); + options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>')); + + selectOptions.each(function() { + appendOptionWithIcon($select, $(this), 'optgroup-option'); + }); + } + }); + } + + options.find('li:not(.optgroup)').each(function (i) { + $(this).click(function (e) { + // Check if option element is disabled + if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) { + var selected = true; + + if (multiple) { + $('input[type="checkbox"]', this).prop('checked', function(i, v) { return !v; }); + selected = toggleEntryFromArray(valuesSelected, $(this).index(), $select); + $newSelect.trigger('focus'); + } else { + options.find('li').removeClass('active'); + $(this).toggleClass('active'); + $newSelect.val($(this).text()); + } + + activateOption(options, $(this)); + $select.find('option').eq(i).prop('selected', selected); + // Trigger onchange() event + $select.trigger('change'); + if (typeof callback !== 'undefined') callback(); + } + + e.stopPropagation(); + }); + }); + + // Wrap Elements + $select.wrap(wrapper); + // Add Select Display Element + var dropdownIcon = $('<span class="caret">▼</span>'); + if ($select.is(':disabled')) + dropdownIcon.addClass('disabled'); + + // escape double quotes + var sanitizedLabelHtml = label.replace(/"/g, '"'); + + var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + (($select.is(':disabled')) ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID +'" value="'+ sanitizedLabelHtml +'"/>'); + $select.before($newSelect); + $newSelect.before(dropdownIcon); + + $newSelect.after(options); + // Check if section element is disabled + if (!$select.is(':disabled')) { + $newSelect.dropdown({'hover': false, 'closeOnClick': false}); + } + + // Copy tabindex + if ($select.attr('tabindex')) { + $($newSelect[0]).attr('tabindex', $select.attr('tabindex')); + } + + $select.addClass('initialized'); + + $newSelect.on({ + 'focus': function (){ + if ($('ul.select-dropdown').not(options[0]).is(':visible')) { + $('input.select-dropdown').trigger('close'); + } + if (!options.is(':visible')) { + $(this).trigger('open', ['focus']); + var label = $(this).val(); + if (multiple && label.indexOf(',') >= 0) { + label = label.split(',')[0]; + } + + var selectedOption = options.find('li').filter(function() { + return $(this).text().toLowerCase() === label.toLowerCase(); + })[0]; + activateOption(options, selectedOption, true); + } + }, + 'click': function (e){ + e.stopPropagation(); + } + }); + + $newSelect.on('blur', function() { + if (!multiple) { + $(this).trigger('close'); + } + options.find('li.selected').removeClass('selected'); + }); + + options.hover(function() { + optionsHover = true; + }, function () { + optionsHover = false; + }); + + $(window).on({ + 'click': function () { + multiple && (optionsHover || $newSelect.trigger('close')); + } + }); + + // Add initial multiple selections. + if (multiple) { + $select.find("option:selected:not(:disabled)").each(function () { + var index = $(this).index(); + + toggleEntryFromArray(valuesSelected, index, $select); + options.find("li").eq(index).find(":checkbox").prop("checked", true); + }); + } + + /** + * Make option as selected and scroll to selected position + * @param {jQuery} collection Select options jQuery element + * @param {Element} newOption element of the new option + * @param {Boolean} firstActivation If on first activation of select + */ + var activateOption = function(collection, newOption, firstActivation) { + if (newOption) { + collection.find('li.selected').removeClass('selected'); + var option = $(newOption); + option.addClass('selected'); + if (!multiple || !!firstActivation) { + options.scrollTo(option); + } + } + }; + + // Allow user to search by typing + // this array is cleared after 1 second + var filterQuery = [], + onKeyDown = function(e){ + // TAB - switch to another input + if(e.which == 9){ + $newSelect.trigger('close'); + return; + } + + // ARROW DOWN WHEN SELECT IS CLOSED - open select options + if(e.which == 40 && !options.is(':visible')){ + $newSelect.trigger('open'); + return; + } + + // ENTER WHEN SELECT IS CLOSED - submit form + if(e.which == 13 && !options.is(':visible')){ + return; + } + + e.preventDefault(); + + // CASE WHEN USER TYPE LETTERS + var letter = String.fromCharCode(e.which).toLowerCase(), + nonLetters = [9,13,27,38,40]; + if (letter && (nonLetters.indexOf(e.which) === -1)) { + filterQuery.push(letter); + + var string = filterQuery.join(''), + newOption = options.find('li').filter(function() { + return $(this).text().toLowerCase().indexOf(string) === 0; + })[0]; + + if (newOption) { + activateOption(options, newOption); + } + } + + // ENTER - select option and close when select options are opened + if (e.which == 13) { + var activeOption = options.find('li.selected:not(.disabled)')[0]; + if(activeOption){ + $(activeOption).trigger('click'); + if (!multiple) { + $newSelect.trigger('close'); + } + } + } + + // ARROW DOWN - move to next not disabled option + if (e.which == 40) { + if (options.find('li.selected').length) { + newOption = options.find('li.selected').next('li:not(.disabled)')[0]; + } else { + newOption = options.find('li:not(.disabled)')[0]; + } + activateOption(options, newOption); + } + + // ESC - close options + if (e.which == 27) { + $newSelect.trigger('close'); + } + + // ARROW UP - move to previous not disabled option + if (e.which == 38) { + newOption = options.find('li.selected').prev('li:not(.disabled)')[0]; + if(newOption) + activateOption(options, newOption); + } + + // Automaticaly clean filter query so user can search again by starting letters + setTimeout(function(){ filterQuery = []; }, 1000); + }; + + $newSelect.on('keydown', onKeyDown); + }); + + function toggleEntryFromArray(entriesArray, entryIndex, select) { + var index = entriesArray.indexOf(entryIndex), + notAdded = index === -1; + + if (notAdded) { + entriesArray.push(entryIndex); + } else { + entriesArray.splice(index, 1); + } + + select.siblings('ul.dropdown-content').find('li').eq(entryIndex).toggleClass('active'); + + // use notAdded instead of true (to detect if the option is selected or not) + select.find('option').eq(entryIndex).prop('selected', notAdded); + setValueToInput(entriesArray, select); + + return notAdded; + } + + function setValueToInput(entriesArray, select) { + var value = ''; + + for (var i = 0, count = entriesArray.length; i < count; i++) { + var text = select.find('option').eq(entriesArray[i]).text(); + + i === 0 ? value += text : value += ', ' + text; + } + + if (value === '') { + value = select.find('option:disabled').eq(0).text(); + } + + select.siblings('input.select-dropdown').val(value); + } + }; + +}( jQuery )); +;(function ($) { + + var methods = { + + init : function(options) { + var defaults = { + indicators: true, + height: 400, + transition: 500, + interval: 6000 + }; + options = $.extend(defaults, options); + + return this.each(function() { + + // For each slider, we want to keep track of + // which slide is active and its associated content + var $this = $(this); + var $slider = $this.find('ul.slides').first(); + var $slides = $slider.find('> li'); + var $active_index = $slider.find('.active').index(); + var $active, $indicators, $interval; + if ($active_index != -1) { $active = $slides.eq($active_index); } + + // Transitions the caption depending on alignment + function captionTransition(caption, duration) { + if (caption.hasClass("center-align")) { + caption.velocity({opacity: 0, translateY: -100}, {duration: duration, queue: false}); + } + else if (caption.hasClass("right-align")) { + caption.velocity({opacity: 0, translateX: 100}, {duration: duration, queue: false}); + } + else if (caption.hasClass("left-align")) { + caption.velocity({opacity: 0, translateX: -100}, {duration: duration, queue: false}); + } + } + + // This function will transition the slide to any index of the next slide + function moveToSlide(index) { + // Wrap around indices. + if (index >= $slides.length) index = 0; + else if (index < 0) index = $slides.length -1; + + $active_index = $slider.find('.active').index(); + + // Only do if index changes + if ($active_index != index) { + $active = $slides.eq($active_index); + $caption = $active.find('.caption'); + + $active.removeClass('active'); + $active.velocity({opacity: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad', + complete: function() { + $slides.not('.active').velocity({opacity: 0, translateX: 0, translateY: 0}, {duration: 0, queue: false}); + } }); + captionTransition($caption, options.transition); + + + // Update indicators + if (options.indicators) { + $indicators.eq($active_index).removeClass('active'); + } + + $slides.eq(index).velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'}); + $slides.eq(index).find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad'}); + $slides.eq(index).addClass('active'); + + + // Update indicators + if (options.indicators) { + $indicators.eq(index).addClass('active'); + } + } + } + + // Set height of slider + // If fullscreen, do nothing + if (!$this.hasClass('fullscreen')) { + if (options.indicators) { + // Add height if indicators are present + $this.height(options.height + 40); + } + else { + $this.height(options.height); + } + $slider.height(options.height); + } + + + // Set initial positions of captions + $slides.find('.caption').each(function () { + captionTransition($(this), 0); + }); + + // Move img src into background-image + $slides.find('img').each(function () { + var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw=='; + if ($(this).attr('src') !== placeholderBase64) { + $(this).css('background-image', 'url(' + $(this).attr('src') + ')' ); + $(this).attr('src', placeholderBase64); + } + }); + + // dynamically add indicators + if (options.indicators) { + $indicators = $('<ul class="indicators"></ul>'); + $slides.each(function( index ) { + var $indicator = $('<li class="indicator-item"></li>'); + + // Handle clicks on indicators + $indicator.click(function () { + var $parent = $slider.parent(); + var curr_index = $parent.find($(this)).index(); + moveToSlide(curr_index); + + // reset interval + clearInterval($interval); + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + + }, options.transition + options.interval + ); + }); + $indicators.append($indicator); + }); + $this.append($indicators); + $indicators = $this.find('ul.indicators').find('li.indicator-item'); + } + + if ($active) { + $active.show(); + } + else { + $slides.first().addClass('active').velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'}); + + $active_index = 0; + $active = $slides.eq($active_index); + + // Update indicators + if (options.indicators) { + $indicators.eq($active_index).addClass('active'); + } + } + + // Adjust height to current slide + $active.find('img').each(function() { + $active.find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad'}); + }); + + // auto scroll + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + moveToSlide($active_index + 1); + + }, options.transition + options.interval + ); + + + // HammerJS, Swipe navigation + + // Touch Event + var panning = false; + var swipeLeft = false; + var swipeRight = false; + + $this.hammer({ + prevent_default: false + }).bind('pan', function(e) { + if (e.gesture.pointerType === "touch") { + + // reset interval + clearInterval($interval); + + var direction = e.gesture.direction; + var x = e.gesture.deltaX; + var velocityX = e.gesture.velocityX; + var velocityY = e.gesture.velocityY; + + $curr_slide = $slider.find('.active'); + if (Math.abs(velocityX) > Math.abs(velocityY)) { + $curr_slide.velocity({ translateX: x + }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + } + + // Swipe Left + if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.65)) { + swipeRight = true; + } + // Swipe Right + else if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.65)) { + swipeLeft = true; + } + + // Make Slide Behind active slide visible + var next_slide; + if (swipeLeft) { + next_slide = $curr_slide.next(); + if (next_slide.length === 0) { + next_slide = $slides.first(); + } + next_slide.velocity({ opacity: 1 + }, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + if (swipeRight) { + next_slide = $curr_slide.prev(); + if (next_slide.length === 0) { + next_slide = $slides.last(); + } + next_slide.velocity({ opacity: 1 + }, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + + } + + }).bind('panend', function(e) { + if (e.gesture.pointerType === "touch") { + + $curr_slide = $slider.find('.active'); + panning = false; + curr_index = $slider.find('.active').index(); + + if (!swipeRight && !swipeLeft || $slides.length <=1) { + // Return to original spot + $curr_slide.velocity({ translateX: 0 + }, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + else if (swipeLeft) { + moveToSlide(curr_index + 1); + $curr_slide.velocity({translateX: -1 * $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function() { + $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false}); + } }); + } + else if (swipeRight) { + moveToSlide(curr_index - 1); + $curr_slide.velocity({translateX: $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function() { + $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false}); + } }); + } + swipeLeft = false; + swipeRight = false; + + // Restart interval + clearInterval($interval); + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + + }, options.transition + options.interval + ); + } + }); + + $this.on('sliderPause', function() { + clearInterval($interval); + }); + + $this.on('sliderStart', function() { + clearInterval($interval); + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + + }, options.transition + options.interval + ); + }); + + $this.on('sliderNext', function() { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index + 1); + }); + + $this.on('sliderPrev', function() { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index - 1); + }); + + }); + + + + }, + pause : function() { + $(this).trigger('sliderPause'); + }, + start : function() { + $(this).trigger('sliderStart'); + }, + next : function() { + $(this).trigger('sliderNext'); + }, + prev : function() { + $(this).trigger('sliderPrev'); + } + }; + + + $.fn.slider = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tooltip' ); + } + }; // Plugin end +}( jQuery )); +;(function ($) { + $(document).ready(function() { + + $(document).on('click.card', '.card', function (e) { + if ($(this).find('> .card-reveal').length) { + if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) { + // Make Reveal animate down and display none + $(this).find('.card-reveal').velocity( + {translateY: 0}, { + duration: 225, + queue: false, + easing: 'easeInOutQuad', + complete: function() { $(this).css({ display: 'none'}); } + } + ); + } + else if ($(e.target).is($('.card .activator')) || + $(e.target).is($('.card .activator i')) ) { + $(e.target).closest('.card').css('overflow', 'hidden'); + $(this).find('.card-reveal').css({ display: 'block'}).velocity("stop", false).velocity({translateY: '-100%'}, {duration: 300, queue: false, easing: 'easeInOutQuad'}); + } + } + }); + + }); +}( jQuery ));;(function ($) { + var materialChipsDefaults = { + data: [], + placeholder: '', + secondaryPlaceholder: '', + autocompleteData: {}, + autocompleteLimit: Infinity, + }; + + $(document).ready(function() { + // Handle removal of static chips. + $(document).on('click', '.chip .close', function(e){ + var $chips = $(this).closest('.chips'); + if ($chips.attr('data-initialized')) { + return; + } + $(this).closest('.chip').remove(); + }); + }); + + $.fn.material_chip = function (options) { + var self = this; + this.$el = $(this); + this.$document = $(document); + this.SELS = { + CHIPS: '.chips', + CHIP: '.chip', + INPUT: 'input', + DELETE: '.material-icons', + SELECTED_CHIP: '.selected', + }; + + if ('data' === options) { + return this.$el.data('chips'); + } + + var curr_options = $.extend({}, materialChipsDefaults, options); + self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteData); + + // Initialize + this.init = function() { + var i = 0; + var chips; + self.$el.each(function(){ + var $chips = $(this); + var chipId = Materialize.guid(); + self.chipId = chipId; + + if (!curr_options.data || !(curr_options.data instanceof Array)) { + curr_options.data = []; + } + $chips.data('chips', curr_options.data); + $chips.attr('data-index', i); + $chips.attr('data-initialized', true); + + if (!$chips.hasClass(self.SELS.CHIPS)) { + $chips.addClass('chips'); + } + + self.chips($chips, chipId); + i++; + }); + }; + + this.handleEvents = function() { + var SELS = self.SELS; + + self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function(e){ + $(e.target).find(SELS.INPUT).focus(); + }); + + self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function(e){ + var $chip = $(e.target); + if ($chip.length) { + var wasSelected = $chip.hasClass('selected'); + var $chips = $chip.closest(SELS.CHIPS); + $(SELS.CHIP).removeClass('selected'); + + if (!wasSelected) { + self.selectChip($chip.index(), $chips); + } + } + }); + + self.$document.off('keydown.chips').on('keydown.chips', function(e){ + if ($(e.target).is('input, textarea')) { + return; + } + + // delete + var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP); + var $chips = $chip.closest(SELS.CHIPS); + var length = $chip.siblings(SELS.CHIP).length; + var index; + + if (!$chip.length) { + return; + } + + if (e.which === 8 || e.which === 46) { + e.preventDefault(); + + index = $chip.index(); + self.deleteChip(index, $chips); + + var selectIndex = null; + if ((index + 1) < length) { + selectIndex = index; + } else if (index === length || (index + 1) === length) { + selectIndex = length - 1; + } + + if (selectIndex < 0) selectIndex = null; + + if (null !== selectIndex) { + self.selectChip(selectIndex, $chips); + } + if (!length) $chips.find('input').focus(); + + // left + } else if (e.which === 37) { + index = $chip.index() - 1; + if (index < 0) { + return; + } + $(SELS.CHIP).removeClass('selected'); + self.selectChip(index, $chips); + + // right + } else if (e.which === 39) { + index = $chip.index() + 1; + $(SELS.CHIP).removeClass('selected'); + if (index > length) { + $chips.find('input').focus(); + return; + } + self.selectChip(index, $chips); + } + }); + + self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){ + var $currChips = $(e.target).closest(SELS.CHIPS); + $currChips.addClass('focus'); + $currChips.siblings('label, .prefix').addClass('active'); + $(SELS.CHIP).removeClass('selected'); + }); + + self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){ + var $currChips = $(e.target).closest(SELS.CHIPS); + $currChips.removeClass('focus'); + + // Remove active if empty + if (!$currChips.data('chips').length) { + $currChips.siblings('label').removeClass('active'); + } + $currChips.siblings('.prefix').removeClass('active'); + }); + + self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function(e){ + var $target = $(e.target); + var $chips = $target.closest(SELS.CHIPS); + var chipsLength = $chips.children(SELS.CHIP).length; + + // enter + if (13 === e.which) { + // Override enter if autocompleting. + if (self.hasAutocomplete && + $chips.find('.autocomplete-content.dropdown-content').length && + $chips.find('.autocomplete-content.dropdown-content').children().length) { + return; + } + + e.preventDefault(); + self.addChip({tag: $target.val()}, $chips); + $target.val(''); + return; + } + + // delete or left + if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) { + e.preventDefault(); + self.selectChip(chipsLength - 1, $chips); + $target.blur(); + return; + } + }); + + // Click on delete icon in chip. + self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function(e) { + var $target = $(e.target); + var $chips = $target.closest(SELS.CHIPS); + var $chip = $target.closest(SELS.CHIP); + e.stopPropagation(); + self.deleteChip($chip.index(), $chips); + $chips.find('input').focus(); + }); + }; + + this.chips = function($chips, chipId) { + var html = ''; + $chips.data('chips').forEach(function(elem){ + html += self.renderChip(elem); + }); + html += '<input id="' + chipId +'" class="input" placeholder="">'; + $chips.html(html); + self.setPlaceholder($chips); + + // Set for attribute for label + var label = $chips.next('label'); + if (label.length) { + label.attr('for', chipId); + + if ($chips.data('chips').length) { + label.addClass('active'); + } + } + + // Setup autocomplete if needed. + var input = $('#' + chipId); + if (self.hasAutocomplete) { + input.autocomplete({ + data: curr_options.autocompleteData, + limit: curr_options.autocompleteLimit, + onAutocomplete: function(val) { + self.addChip({tag: val}, $chips); + input.val(''); + input.focus(); + }, + }) + } + }; + + this.renderChip = function(elem) { + if (!elem.tag) return; + + var html = '<div class="chip">' + elem.tag; + if (elem.image) { + html += ' <img src="' + elem.image + '"> '; + } + html += '<i class="material-icons close">close</i>'; + html += '</div>'; + return html; + }; + + this.setPlaceholder = function($chips) { + if ($chips.data('chips').length && curr_options.placeholder) { + $chips.find('input').prop('placeholder', curr_options.placeholder); + + } else if (!$chips.data('chips').length && curr_options.secondaryPlaceholder) { + $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder); + } + }; + + this.isValid = function($chips, elem) { + var chips = $chips.data('chips'); + var exists = false; + for (var i=0; i < chips.length; i++) { + if (chips[i].tag === elem.tag) { + exists = true; + return; + } + } + return '' !== elem.tag && !exists; + }; + + this.addChip = function(elem, $chips) { + if (!self.isValid($chips, elem)) { + return; + } + var chipHtml = self.renderChip(elem); + var newData = []; + var oldData = $chips.data('chips'); + for (var i = 0; i < oldData.length; i++) { + newData.push(oldData[i]); + } + newData.push(elem); + + $chips.data('chips', newData); + $(chipHtml).insertBefore($chips.find('input')); + $chips.trigger('chip.add', elem); + self.setPlaceholder($chips); + }; + + this.deleteChip = function(chipIndex, $chips) { + var chip = $chips.data('chips')[chipIndex]; + $chips.find('.chip').eq(chipIndex).remove(); + + var newData = []; + var oldData = $chips.data('chips'); + for (var i = 0; i < oldData.length; i++) { + if (i !== chipIndex) { + newData.push(oldData[i]); + } + } + + $chips.data('chips', newData); + $chips.trigger('chip.delete', chip); + self.setPlaceholder($chips); + }; + + this.selectChip = function(chipIndex, $chips) { + var $chip = $chips.find('.chip').eq(chipIndex); + if ($chip && false === $chip.hasClass('selected')) { + $chip.addClass('selected'); + $chips.trigger('chip.select', $chips.data('chips')[chipIndex]); + } + }; + + this.getChipsElement = function(index, $chips) { + return $chips.eq(index); + }; + + // init + this.init(); + + this.handleEvents(); + }; +}( jQuery )); +;(function ($) { + $.fn.pushpin = function (options) { + // Defaults + var defaults = { + top: 0, + bottom: Infinity, + offset: 0 + }; + + // Remove pushpin event and classes + if (options === "remove") { + this.each(function () { + if (id = $(this).data('pushpin-id')) { + $(window).off('scroll.' + id); + $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style'); + } + }); + return false; + } + + options = $.extend(defaults, options); + + + $index = 0; + return this.each(function() { + var $uniqueId = Materialize.guid(), + $this = $(this), + $original_offset = $(this).offset().top; + + function removePinClasses(object) { + object.removeClass('pin-top'); + object.removeClass('pinned'); + object.removeClass('pin-bottom'); + } + + function updateElements(objects, scrolled) { + objects.each(function () { + // Add position fixed (because its between top and bottom) + if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) { + removePinClasses($(this)); + $(this).css('top', options.offset); + $(this).addClass('pinned'); + } + + // Add pin-top (when scrolled position is above top) + if (scrolled < options.top && !$(this).hasClass('pin-top')) { + removePinClasses($(this)); + $(this).css('top', 0); + $(this).addClass('pin-top'); + } + + // Add pin-bottom (when scrolled position is below bottom) + if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) { + removePinClasses($(this)); + $(this).addClass('pin-bottom'); + $(this).css('top', options.bottom - $original_offset); + } + }); + } + + $(this).data('pushpin-id', $uniqueId); + updateElements($this, $(window).scrollTop()); + $(window).on('scroll.' + $uniqueId, function () { + var $scrolled = $(window).scrollTop() + options.offset; + updateElements($this, $scrolled); + }); + + }); + + }; +}( jQuery ));;(function ($) { + $(document).ready(function() { + + // jQuery reverse + $.fn.reverse = [].reverse; + + // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs! + $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) { + var $this = $(this); + openFABMenu($this); + }); + $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) { + var $this = $(this); + closeFABMenu($this); + }); + + // Toggle-on-click behaviour. + $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function(e) { + var $this = $(this); + var $menu = $this.parent(); + if ($menu.hasClass('active')) { + closeFABMenu($menu); + } else { + openFABMenu($menu); + } + }); + + // Toolbar transition behaviour. + $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function(e) { + var $this = $(this); + var $menu = $this.parent(); + FABtoToolbar($menu); + }); + + }); + + $.fn.extend({ + openFAB: function() { + openFABMenu($(this)); + }, + closeFAB: function() { + closeFABMenu($(this)); + }, + openToolbar: function() { + FABtoToolbar($(this)); + }, + closeToolbar: function() { + toolbarToFAB($(this)); + } + }); + + + var openFABMenu = function (btn) { + var $this = btn; + if ($this.hasClass('active') === false) { + + // Get direction option + var horizontal = $this.hasClass('horizontal'); + var offsetY, offsetX; + + if (horizontal === true) { + offsetX = 40; + } else { + offsetY = 40; + } + + $this.addClass('active'); + $this.find('ul .btn-floating').velocity( + { scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'}, + { duration: 0 }); + + var time = 0; + $this.find('ul .btn-floating').reverse().each( function () { + $(this).velocity( + { opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0'}, + { duration: 80, delay: time }); + time += 40; + }); + } + }; + + var closeFABMenu = function (btn) { + var $this = btn; + // Get direction option + var horizontal = $this.hasClass('horizontal'); + var offsetY, offsetX; + + if (horizontal === true) { + offsetX = 40; + } else { + offsetY = 40; + } + + $this.removeClass('active'); + var time = 0; + $this.find('ul .btn-floating').velocity("stop", true); + $this.find('ul .btn-floating').velocity( + { opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'}, + { duration: 80 } + ); + }; + + + /** + * Transform FAB into toolbar + * @param {Object} object jQuery object + */ + var FABtoToolbar = function(btn) { + if (btn.attr('data-open') === "true") { + return; + } + + var offsetX, offsetY, scaleFactor; + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var btnRect = btn[0].getBoundingClientRect(); + var anchor = btn.find('> a').first(); + var menu = btn.find('> ul').first(); + var backdrop = $('<div class="fab-backdrop"></div>'); + var fabColor = anchor.css('background-color'); + anchor.append(backdrop); + + offsetX = btnRect.left - (windowWidth / 2) + (btnRect.width / 2); + offsetY = windowHeight - btnRect.bottom; + scaleFactor = windowWidth / backdrop.width(); + btn.attr('data-origin-bottom', btnRect.bottom); + btn.attr('data-origin-left', btnRect.left); + btn.attr('data-origin-width', btnRect.width); + + // Set initial state + btn.addClass('active'); + btn.attr('data-open', true); + btn.css({ + 'text-align': 'center', + width: '100%', + bottom: 0, + left: 0, + transform: 'translateX(' + offsetX + 'px)', + transition: 'none' + }); + anchor.css({ + transform: 'translateY(' + -offsetY + 'px)', + transition: 'none' + }); + backdrop.css({ + 'background-color': fabColor + }); + + + setTimeout(function() { + btn.css({ + transform: '', + transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s' + }); + anchor.css({ + overflow: 'visible', + transform: '', + transition: 'transform .2s' + }); + + setTimeout(function() { + btn.css({ + overflow: 'hidden', + 'background-color': fabColor + }); + backdrop.css({ + transform: 'scale(' + scaleFactor + ')', + transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' + }); + menu.find('> li > a').css({ + opacity: 1 + }); + + // Scroll to close. + $(window).on('scroll.fabToolbarClose', function() { + toolbarToFAB(btn); + $(window).off('scroll.fabToolbarClose'); + $(document).off('click.fabToolbarClose'); + }); + + $(document).on('click.fabToolbarClose', function(e) { + if (!$(e.target).closest(menu).length) { + toolbarToFAB(btn); + $(window).off('scroll.fabToolbarClose'); + $(document).off('click.fabToolbarClose'); + } + }); + }, 100); + }, 0); + }; + + /** + * Transform toolbar back into FAB + * @param {Object} object jQuery object + */ + var toolbarToFAB = function(btn) { + if (btn.attr('data-open') !== "true") { + return; + } + + var offsetX, offsetY, scaleFactor; + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var btnWidth = btn.attr('data-origin-width'); + var btnBottom = btn.attr('data-origin-bottom'); + var btnLeft = btn.attr('data-origin-left'); + var anchor = btn.find('> .btn-floating').first(); + var menu = btn.find('> ul').first(); + var backdrop = btn.find('.fab-backdrop'); + var fabColor = anchor.css('background-color'); + + offsetX = btnLeft - (windowWidth / 2) + (btnWidth / 2); + offsetY = windowHeight - btnBottom; + scaleFactor = windowWidth / backdrop.width(); + + + // Hide backdrop + btn.removeClass('active'); + btn.attr('data-open', false); + btn.css({ + 'background-color': 'transparent', + transition: 'none' + }); + anchor.css({ + transition: 'none' + }); + backdrop.css({ + transform: 'scale(0)', + 'background-color': fabColor + }); + menu.find('> li > a').css({ + opacity: '' + }); + + setTimeout(function() { + backdrop.remove(); + + // Set initial state. + btn.css({ + 'text-align': '', + width: '', + bottom: '', + left: '', + overflow: '', + 'background-color': '', + transform: 'translate3d(' + -offsetX + 'px,0,0)' + }); + anchor.css({ + overflow: '', + transform: 'translate3d(0,' + offsetY + 'px,0)' + }); + + setTimeout(function() { + btn.css({ + transform: 'translate3d(0,0,0)', + transition: 'transform .2s' + }); + anchor.css({ + transform: 'translate3d(0,0,0)', + transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' + }); + }, 20); + }, 200); + }; + + +}( jQuery )); +;(function ($) { + // Image transition function + Materialize.fadeInImage = function(selectorOrEl) { + var element; + if (typeof(selectorOrEl) === 'string') { + element = $(selectorOrEl); + } else if (typeof(selectorOrEl) === 'object') { + element = selectorOrEl; + } else { + return; + } + element.css({opacity: 0}); + $(element).velocity({opacity: 1}, { + duration: 650, + queue: false, + easing: 'easeOutSine' + }); + $(element).velocity({opacity: 1}, { + duration: 1300, + queue: false, + easing: 'swing', + step: function(now, fx) { + fx.start = 100; + var grayscale_setting = now/100; + var brightness_setting = 150 - (100 - now)/1.75; + + if (brightness_setting < 100) { + brightness_setting = 100; + } + if (now >= 0) { + $(this).css({ + "-webkit-filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)", + "filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)" + }); + } + } + }); + }; + + // Horizontal staggered list + Materialize.showStaggeredList = function(selectorOrEl) { + var element; + if (typeof(selectorOrEl) === 'string') { + element = $(selectorOrEl); + } else if (typeof(selectorOrEl) === 'object') { + element = selectorOrEl; + } else { + return; + } + var time = 0; + element.find('li').velocity( + { translateX: "-100px"}, + { duration: 0 }); + + element.find('li').each(function() { + $(this).velocity( + { opacity: "1", translateX: "0"}, + { duration: 800, delay: time, easing: [60, 10] }); + time += 120; + }); + }; + + + $(document).ready(function() { + // Hardcoded .staggered-list scrollFire + // var staggeredListOptions = []; + // $('ul.staggered-list').each(function (i) { + + // var label = 'scrollFire-' + i; + // $(this).addClass(label); + // staggeredListOptions.push( + // {selector: 'ul.staggered-list.' + label, + // offset: 200, + // callback: 'showStaggeredList("ul.staggered-list.' + label + '")'}); + // }); + // scrollFire(staggeredListOptions); + + // HammerJS, Swipe navigation + + // Touch Event + var swipeLeft = false; + var swipeRight = false; + + + // Dismissible Collections + $('.dismissable').each(function() { + $(this).hammer({ + prevent_default: false + }).bind('pan', function(e) { + if (e.gesture.pointerType === "touch") { + var $this = $(this); + var direction = e.gesture.direction; + var x = e.gesture.deltaX; + var velocityX = e.gesture.velocityX; + + $this.velocity({ translateX: x + }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + + // Swipe Left + if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.75)) { + swipeLeft = true; + } + + // Swipe Right + if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.75)) { + swipeRight = true; + } + } + }).bind('panend', function(e) { + // Reset if collection is moved back into original position + if (Math.abs(e.gesture.deltaX) < ($(this).innerWidth() / 2)) { + swipeRight = false; + swipeLeft = false; + } + + if (e.gesture.pointerType === "touch") { + var $this = $(this); + if (swipeLeft || swipeRight) { + var fullWidth; + if (swipeLeft) { fullWidth = $this.innerWidth(); } + else { fullWidth = -1 * $this.innerWidth(); } + + $this.velocity({ translateX: fullWidth, + }, {duration: 100, queue: false, easing: 'easeOutQuad', complete: + function() { + $this.css('border', 'none'); + $this.velocity({ height: 0, padding: 0, + }, {duration: 200, queue: false, easing: 'easeOutQuad', complete: + function() { $this.remove(); } + }); + } + }); + } + else { + $this.velocity({ translateX: 0, + }, {duration: 100, queue: false, easing: 'easeOutQuad'}); + } + swipeLeft = false; + swipeRight = false; + } + }); + + }); + + + // time = 0 + // // Vertical Staggered list + // $('ul.staggered-list.vertical li').velocity( + // { translateY: "100px"}, + // { duration: 0 }); + + // $('ul.staggered-list.vertical li').each(function() { + // $(this).velocity( + // { opacity: "1", translateY: "0"}, + // { duration: 800, delay: time, easing: [60, 25] }); + // time += 120; + // }); + + // // Fade in and Scale + // $('.fade-in.scale').velocity( + // { scaleX: .4, scaleY: .4, translateX: -600}, + // { duration: 0}); + // $('.fade-in').each(function() { + // $(this).velocity( + // { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0}, + // { duration: 800, easing: [60, 10] }); + // }); + }); +}( jQuery )); +;(function($) { + + var scrollFireEventsHandled = false; + + // Input: Array of JSON objects {selector, offset, callback} + Materialize.scrollFire = function(options) { + var onScroll = function() { + var windowScroll = window.pageYOffset + window.innerHeight; + + for (var i = 0 ; i < options.length; i++) { + // Get options from each line + var value = options[i]; + var selector = value.selector, + offset = value.offset, + callback = value.callback; + + var currentElement = document.querySelector(selector); + if ( currentElement !== null) { + var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset; + + if (windowScroll > (elementOffset + offset)) { + if (value.done !== true) { + if (typeof(callback) === 'function') { + callback.call(this, currentElement); + } else if (typeof(callback) === 'string') { + var callbackFunc = new Function(callback); + callbackFunc(currentElement); + } + value.done = true; + } + } + } + } + }; + + + var throttledScroll = Materialize.throttle(function() { + onScroll(); + }, options.throttle || 100); + + if (!scrollFireEventsHandled) { + window.addEventListener("scroll", throttledScroll); + window.addEventListener("resize", throttledScroll); + scrollFireEventsHandled = true; + } + + // perform a scan once, after current execution context, and after dom is ready + setTimeout(throttledScroll, 0); + }; + +})(jQuery); +;/*! + * pickadate.js v3.5.0, 2014/04/13 + * By Amsul, http://amsul.ca + * Hosted on http://amsul.github.io/pickadate.js + * Licensed under MIT + */ + +(function ( factory ) { + + // AMD. + if ( typeof define == 'function' && define.amd ) + define( 'picker', ['jquery'], factory ) + + // Node.js/browserify. + else if ( typeof exports == 'object' ) + module.exports = factory( require('jquery') ) + + // Browser globals. + else this.Picker = factory( jQuery ) + +}(function( $ ) { + +var $window = $( window ) +var $document = $( document ) +var $html = $( document.documentElement ) + + +/** + * The picker constructor that creates a blank picker. + */ +function PickerConstructor( ELEMENT, NAME, COMPONENT, OPTIONS ) { + + // If there’s no element, return the picker constructor. + if ( !ELEMENT ) return PickerConstructor + + + var + IS_DEFAULT_THEME = false, + + + // The state of the picker. + STATE = { + id: ELEMENT.id || 'P' + Math.abs( ~~(Math.random() * new Date()) ) + }, + + + // Merge the defaults and options passed. + SETTINGS = COMPONENT ? $.extend( true, {}, COMPONENT.defaults, OPTIONS ) : OPTIONS || {}, + + + // Merge the default classes with the settings classes. + CLASSES = $.extend( {}, PickerConstructor.klasses(), SETTINGS.klass ), + + + // The element node wrapper into a jQuery object. + $ELEMENT = $( ELEMENT ), + + + // Pseudo picker constructor. + PickerInstance = function() { + return this.start() + }, + + + // The picker prototype. + P = PickerInstance.prototype = { + + constructor: PickerInstance, + + $node: $ELEMENT, + + + /** + * Initialize everything + */ + start: function() { + + // If it’s already started, do nothing. + if ( STATE && STATE.start ) return P + + + // Update the picker states. + STATE.methods = {} + STATE.start = true + STATE.open = false + STATE.type = ELEMENT.type + + + // Confirm focus state, convert into text input to remove UA stylings, + // and set as readonly to prevent keyboard popup. + ELEMENT.autofocus = ELEMENT == getActiveElement() + ELEMENT.readOnly = !SETTINGS.editable + ELEMENT.id = ELEMENT.id || STATE.id + if ( ELEMENT.type != 'text' ) { + ELEMENT.type = 'text' + } + + + // Create a new picker component with the settings. + P.component = new COMPONENT(P, SETTINGS) + + + // Create the picker root with a holder and then prepare it. + P.$root = $( PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"') ) + prepareElementRoot() + + + // If there’s a format for the hidden input element, create the element. + if ( SETTINGS.formatSubmit ) { + prepareElementHidden() + } + + + // Prepare the input element. + prepareElement() + + + // Insert the root as specified in the settings. + if ( SETTINGS.container ) $( SETTINGS.container ).append( P.$root ) + else $ELEMENT.after( P.$root ) + + + // Bind the default component and settings events. + P.on({ + start: P.component.onStart, + render: P.component.onRender, + stop: P.component.onStop, + open: P.component.onOpen, + close: P.component.onClose, + set: P.component.onSet + }).on({ + start: SETTINGS.onStart, + render: SETTINGS.onRender, + stop: SETTINGS.onStop, + open: SETTINGS.onOpen, + close: SETTINGS.onClose, + set: SETTINGS.onSet + }) + + + // Once we’re all set, check the theme in use. + IS_DEFAULT_THEME = isUsingDefaultTheme( P.$root.children()[ 0 ] ) + + + // If the element has autofocus, open the picker. + if ( ELEMENT.autofocus ) { + P.open() + } + + + // Trigger queued the “start” and “render” events. + return P.trigger( 'start' ).trigger( 'render' ) + }, //start + + + /** + * Render a new picker + */ + render: function( entireComponent ) { + + // Insert a new component holder in the root or box. + if ( entireComponent ) P.$root.html( createWrappedComponent() ) + else P.$root.find( '.' + CLASSES.box ).html( P.component.nodes( STATE.open ) ) + + // Trigger the queued “render” events. + return P.trigger( 'render' ) + }, //render + + + /** + * Destroy everything + */ + stop: function() { + + // If it’s already stopped, do nothing. + if ( !STATE.start ) return P + + // Then close the picker. + P.close() + + // Remove the hidden field. + if ( P._hidden ) { + P._hidden.parentNode.removeChild( P._hidden ) + } + + // Remove the root. + P.$root.remove() + + // Remove the input class, remove the stored data, and unbind + // the events (after a tick for IE - see `P.close`). + $ELEMENT.removeClass( CLASSES.input ).removeData( NAME ) + setTimeout( function() { + $ELEMENT.off( '.' + STATE.id ) + }, 0) + + // Restore the element state + ELEMENT.type = STATE.type + ELEMENT.readOnly = false + + // Trigger the queued “stop” events. + P.trigger( 'stop' ) + + // Reset the picker states. + STATE.methods = {} + STATE.start = false + + return P + }, //stop + + + /** + * Open up the picker + */ + open: function( dontGiveFocus ) { + + // If it’s already open, do nothing. + if ( STATE.open ) return P + + // Add the “active” class. + $ELEMENT.addClass( CLASSES.active ) + aria( ELEMENT, 'expanded', true ) + + // * A Firefox bug, when `html` has `overflow:hidden`, results in + // killing transitions :(. So add the “opened” state on the next tick. + // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 + setTimeout( function() { + + // Add the “opened” class to the picker root. + P.$root.addClass( CLASSES.opened ) + aria( P.$root[0], 'hidden', false ) + + }, 0 ) + + // If we have to give focus, bind the element and doc events. + if ( dontGiveFocus !== false ) { + + // Set it as open. + STATE.open = true + + // Prevent the page from scrolling. + if ( IS_DEFAULT_THEME ) { + $html. + css( 'overflow', 'hidden' ). + css( 'padding-right', '+=' + getScrollbarWidth() ) + } + + // Pass focus to the root element’s jQuery object. + // * Workaround for iOS8 to bring the picker’s root into view. + P.$root.eq(0).focus() + + // Bind the document events. + $document.on( 'click.' + STATE.id + ' focusin.' + STATE.id, function( event ) { + + var target = event.target + + // If the target of the event is not the element, close the picker picker. + // * Don’t worry about clicks or focusins on the root because those don’t bubble up. + // Also, for Firefox, a click on an `option` element bubbles up directly + // to the doc. So make sure the target wasn't the doc. + // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling, + // which causes the picker to unexpectedly close when right-clicking it. So make + // sure the event wasn’t a right-click. + if ( target != ELEMENT && target != document && event.which != 3 ) { + + // If the target was the holder that covers the screen, + // keep the element focused to maintain tabindex. + P.close( target === P.$root.children()[0] ) + } + + }).on( 'keydown.' + STATE.id, function( event ) { + + var + // Get the keycode. + keycode = event.keyCode, + + // Translate that to a selection change. + keycodeToMove = P.component.key[ keycode ], + + // Grab the target. + target = event.target + + + // On escape, close the picker and give focus. + if ( keycode == 27 ) { + P.close( true ) + } + + + // Check if there is a key movement or “enter” keypress on the element. + else if ( target == P.$root[0] && ( keycodeToMove || keycode == 13 ) ) { + + // Prevent the default action to stop page movement. + event.preventDefault() + + // Trigger the key movement action. + if ( keycodeToMove ) { + PickerConstructor._.trigger( P.component.key.go, P, [ PickerConstructor._.trigger( keycodeToMove ) ] ) + } + + // On “enter”, if the highlighted item isn’t disabled, set the value and close. + else if ( !P.$root.find( '.' + CLASSES.highlighted ).hasClass( CLASSES.disabled ) ) { + P.set( 'select', P.component.item.highlight ).close() + } + } + + + // If the target is within the root and “enter” is pressed, + // prevent the default action and trigger a click on the target instead. + else if ( $.contains( P.$root[0], target ) && keycode == 13 ) { + event.preventDefault() + target.click() + } + }) + } + + // Trigger the queued “open” events. + return P.trigger( 'open' ) + }, //open + + + /** + * Close the picker + */ + close: function( giveFocus ) { + + // If we need to give focus, do it before changing states. + if ( giveFocus ) { + // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :| + // The focus is triggered *after* the close has completed - causing it + // to open again. So unbind and rebind the event at the next tick. + P.$root.off( 'focus.toOpen' ).eq(0).focus() + setTimeout( function() { + P.$root.on( 'focus.toOpen', handleFocusToOpenEvent ) + }, 0 ) + } + + // Remove the “active” class. + $ELEMENT.removeClass( CLASSES.active ) + aria( ELEMENT, 'expanded', false ) + + // * A Firefox bug, when `html` has `overflow:hidden`, results in + // killing transitions :(. So remove the “opened” state on the next tick. + // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 + setTimeout( function() { + + // Remove the “opened” and “focused” class from the picker root. + P.$root.removeClass( CLASSES.opened + ' ' + CLASSES.focused ) + aria( P.$root[0], 'hidden', true ) + + }, 0 ) + + // If it’s already closed, do nothing more. + if ( !STATE.open ) return P + + // Set it as closed. + STATE.open = false + + // Allow the page to scroll. + if ( IS_DEFAULT_THEME ) { + $html. + css( 'overflow', '' ). + css( 'padding-right', '-=' + getScrollbarWidth() ) + } + + // Unbind the document events. + $document.off( '.' + STATE.id ) + + // Trigger the queued “close” events. + return P.trigger( 'close' ) + }, //close + + + /** + * Clear the values + */ + clear: function( options ) { + return P.set( 'clear', null, options ) + }, //clear + + + /** + * Set something + */ + set: function( thing, value, options ) { + + var thingItem, thingValue, + thingIsObject = $.isPlainObject( thing ), + thingObject = thingIsObject ? thing : {} + + // Make sure we have usable options. + options = thingIsObject && $.isPlainObject( value ) ? value : options || {} + + if ( thing ) { + + // If the thing isn’t an object, make it one. + if ( !thingIsObject ) { + thingObject[ thing ] = value + } + + // Go through the things of items to set. + for ( thingItem in thingObject ) { + + // Grab the value of the thing. + thingValue = thingObject[ thingItem ] + + // First, if the item exists and there’s a value, set it. + if ( thingItem in P.component.item ) { + if ( thingValue === undefined ) thingValue = null + P.component.set( thingItem, thingValue, options ) + } + + // Then, check to update the element value and broadcast a change. + if ( thingItem == 'select' || thingItem == 'clear' ) { + $ELEMENT. + val( thingItem == 'clear' ? '' : P.get( thingItem, SETTINGS.format ) ). + trigger( 'change' ) + } + } + + // Render a new picker. + P.render() + } + + // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`. + return options.muted ? P : P.trigger( 'set', thingObject ) + }, //set + + + /** + * Get something + */ + get: function( thing, format ) { + + // Make sure there’s something to get. + thing = thing || 'value' + + // If a picker state exists, return that. + if ( STATE[ thing ] != null ) { + return STATE[ thing ] + } + + // Return the submission value, if that. + if ( thing == 'valueSubmit' ) { + if ( P._hidden ) { + return P._hidden.value + } + thing = 'value' + } + + // Return the value, if that. + if ( thing == 'value' ) { + return ELEMENT.value + } + + // Check if a component item exists, return that. + if ( thing in P.component.item ) { + if ( typeof format == 'string' ) { + var thingValue = P.component.get( thing ) + return thingValue ? + PickerConstructor._.trigger( + P.component.formats.toString, + P.component, + [ format, thingValue ] + ) : '' + } + return P.component.get( thing ) + } + }, //get + + + + /** + * Bind events on the things. + */ + on: function( thing, method, internal ) { + + var thingName, thingMethod, + thingIsObject = $.isPlainObject( thing ), + thingObject = thingIsObject ? thing : {} + + if ( thing ) { + + // If the thing isn’t an object, make it one. + if ( !thingIsObject ) { + thingObject[ thing ] = method + } + + // Go through the things to bind to. + for ( thingName in thingObject ) { + + // Grab the method of the thing. + thingMethod = thingObject[ thingName ] + + // If it was an internal binding, prefix it. + if ( internal ) { + thingName = '_' + thingName + } + + // Make sure the thing methods collection exists. + STATE.methods[ thingName ] = STATE.methods[ thingName ] || [] + + // Add the method to the relative method collection. + STATE.methods[ thingName ].push( thingMethod ) + } + } + + return P + }, //on + + + + /** + * Unbind events on the things. + */ + off: function() { + var i, thingName, + names = arguments; + for ( i = 0, namesCount = names.length; i < namesCount; i += 1 ) { + thingName = names[i] + if ( thingName in STATE.methods ) { + delete STATE.methods[thingName] + } + } + return P + }, + + + /** + * Fire off method events. + */ + trigger: function( name, data ) { + var _trigger = function( name ) { + var methodList = STATE.methods[ name ] + if ( methodList ) { + methodList.map( function( method ) { + PickerConstructor._.trigger( method, P, [ data ] ) + }) + } + } + _trigger( '_' + name ) + _trigger( name ) + return P + } //trigger + } //PickerInstance.prototype + + + /** + * Wrap the picker holder components together. + */ + function createWrappedComponent() { + + // Create a picker wrapper holder + return PickerConstructor._.node( 'div', + + // Create a picker wrapper node + PickerConstructor._.node( 'div', + + // Create a picker frame + PickerConstructor._.node( 'div', + + // Create a picker box node + PickerConstructor._.node( 'div', + + // Create the components nodes. + P.component.nodes( STATE.open ), + + // The picker box class + CLASSES.box + ), + + // Picker wrap class + CLASSES.wrap + ), + + // Picker frame class + CLASSES.frame + ), + + // Picker holder class + CLASSES.holder + ) //endreturn + } //createWrappedComponent + + + + /** + * Prepare the input element with all bindings. + */ + function prepareElement() { + + $ELEMENT. + + // Store the picker data by component name. + data(NAME, P). + + // Add the “input” class name. + addClass(CLASSES.input). + + // Remove the tabindex. + attr('tabindex', -1). + + // If there’s a `data-value`, update the value of the element. + val( $ELEMENT.data('value') ? + P.get('select', SETTINGS.format) : + ELEMENT.value + ) + + + // Only bind keydown events if the element isn’t editable. + if ( !SETTINGS.editable ) { + + $ELEMENT. + + // On focus/click, focus onto the root to open it up. + on( 'focus.' + STATE.id + ' click.' + STATE.id, function( event ) { + event.preventDefault() + P.$root.eq(0).focus() + }). + + // Handle keyboard event based on the picker being opened or not. + on( 'keydown.' + STATE.id, handleKeydownEvent ) + } + + + // Update the aria attributes. + aria(ELEMENT, { + haspopup: true, + expanded: false, + readonly: false, + owns: ELEMENT.id + '_root' + }) + } + + + /** + * Prepare the root picker element with all bindings. + */ + function prepareElementRoot() { + + P.$root. + + on({ + + // For iOS8. + keydown: handleKeydownEvent, + + // When something within the root is focused, stop from bubbling + // to the doc and remove the “focused” state from the root. + focusin: function( event ) { + P.$root.removeClass( CLASSES.focused ) + event.stopPropagation() + }, + + // When something within the root holder is clicked, stop it + // from bubbling to the doc. + 'mousedown click': function( event ) { + + var target = event.target + + // Make sure the target isn’t the root holder so it can bubble up. + if ( target != P.$root.children()[ 0 ] ) { + + event.stopPropagation() + + // * For mousedown events, cancel the default action in order to + // prevent cases where focus is shifted onto external elements + // when using things like jQuery mobile or MagnificPopup (ref: #249 & #120). + // Also, for Firefox, don’t prevent action on the `option` element. + if ( event.type == 'mousedown' && !$( target ).is( 'input, select, textarea, button, option' )) { + + event.preventDefault() + + // Re-focus onto the root so that users can click away + // from elements focused within the picker. + P.$root.eq(0).focus() + } + } + } + }). + + // Add/remove the “target” class on focus and blur. + on({ + focus: function() { + $ELEMENT.addClass( CLASSES.target ) + }, + blur: function() { + $ELEMENT.removeClass( CLASSES.target ) + } + }). + + // Open the picker and adjust the root “focused” state + on( 'focus.toOpen', handleFocusToOpenEvent ). + + // If there’s a click on an actionable element, carry out the actions. + on( 'click', '[data-pick], [data-nav], [data-clear], [data-close]', function() { + + var $target = $( this ), + targetData = $target.data(), + targetDisabled = $target.hasClass( CLASSES.navDisabled ) || $target.hasClass( CLASSES.disabled ), + + // * For IE, non-focusable elements can be active elements as well + // (http://stackoverflow.com/a/2684561). + activeElement = getActiveElement() + activeElement = activeElement && ( activeElement.type || activeElement.href ) + + // If it’s disabled or nothing inside is actively focused, re-focus the element. + if ( targetDisabled || activeElement && !$.contains( P.$root[0], activeElement ) ) { + P.$root.eq(0).focus() + } + + // If something is superficially changed, update the `highlight` based on the `nav`. + if ( !targetDisabled && targetData.nav ) { + P.set( 'highlight', P.component.item.highlight, { nav: targetData.nav } ) + } + + // If something is picked, set `select` then close with focus. + else if ( !targetDisabled && 'pick' in targetData ) { + P.set( 'select', targetData.pick ) + } + + // If a “clear” button is pressed, empty the values and close with focus. + else if ( targetData.clear ) { + P.clear().close( true ) + } + + else if ( targetData.close ) { + P.close( true ) + } + + }) //P.$root + + aria( P.$root[0], 'hidden', true ) + } + + + /** + * Prepare the hidden input element along with all bindings. + */ + function prepareElementHidden() { + + var name + + if ( SETTINGS.hiddenName === true ) { + name = ELEMENT.name + ELEMENT.name = '' + } + else { + name = [ + typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', + typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit' + ] + name = name[0] + ELEMENT.name + name[1] + } + + P._hidden = $( + '<input ' + + 'type=hidden ' + + + // Create the name using the original input’s with a prefix and suffix. + 'name="' + name + '"' + + + // If the element has a value, set the hidden value as well. + ( + $ELEMENT.data('value') || ELEMENT.value ? + ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' : + '' + ) + + '>' + )[0] + + $ELEMENT. + + // If the value changes, update the hidden input with the correct format. + on('change.' + STATE.id, function() { + P._hidden.value = ELEMENT.value ? + P.get('select', SETTINGS.formatSubmit) : + '' + }) + + + // Insert the hidden input as specified in the settings. + if ( SETTINGS.container ) $( SETTINGS.container ).append( P._hidden ) + else $ELEMENT.after( P._hidden ) + } + + + // For iOS8. + function handleKeydownEvent( event ) { + + var keycode = event.keyCode, + + // Check if one of the delete keys was pressed. + isKeycodeDelete = /^(8|46)$/.test(keycode) + + // For some reason IE clears the input value on “escape”. + if ( keycode == 27 ) { + P.close() + return false + } + + // Check if `space` or `delete` was pressed or the picker is closed with a key movement. + if ( keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode] ) { + + // Prevent it from moving the page and bubbling to doc. + event.preventDefault() + event.stopPropagation() + + // If `delete` was pressed, clear the values and close the picker. + // Otherwise open the picker. + if ( isKeycodeDelete ) { P.clear().close() } + else { P.open() } + } + } + + + // Separated for IE + function handleFocusToOpenEvent( event ) { + + // Stop the event from propagating to the doc. + event.stopPropagation() + + // If it’s a focus event, add the “focused” class to the root. + if ( event.type == 'focus' ) { + P.$root.addClass( CLASSES.focused ) + } + + // And then finally open the picker. + P.open() + } + + + // Return a new picker instance. + return new PickerInstance() +} //PickerConstructor + + + +/** + * The default classes and prefix to use for the HTML classes. + */ +PickerConstructor.klasses = function( prefix ) { + prefix = prefix || 'picker' + return { + + picker: prefix, + opened: prefix + '--opened', + focused: prefix + '--focused', + + input: prefix + '__input', + active: prefix + '__input--active', + target: prefix + '__input--target', + + holder: prefix + '__holder', + + frame: prefix + '__frame', + wrap: prefix + '__wrap', + + box: prefix + '__box' + } +} //PickerConstructor.klasses + + + +/** + * Check if the default theme is being used. + */ +function isUsingDefaultTheme( element ) { + + var theme, + prop = 'position' + + // For IE. + if ( element.currentStyle ) { + theme = element.currentStyle[prop] + } + + // For normal browsers. + else if ( window.getComputedStyle ) { + theme = getComputedStyle( element )[prop] + } + + return theme == 'fixed' +} + + + +/** + * Get the width of the browser’s scrollbar. + * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js + */ +function getScrollbarWidth() { + + if ( $html.height() <= $window.height() ) { + return 0 + } + + var $outer = $( '<div style="visibility:hidden;width:100px" />' ). + appendTo( 'body' ) + + // Get the width without scrollbars. + var widthWithoutScroll = $outer[0].offsetWidth + + // Force adding scrollbars. + $outer.css( 'overflow', 'scroll' ) + + // Add the inner div. + var $inner = $( '<div style="width:100%" />' ).appendTo( $outer ) + + // Get the width with scrollbars. + var widthWithScroll = $inner[0].offsetWidth + + // Remove the divs. + $outer.remove() + + // Return the difference between the widths. + return widthWithoutScroll - widthWithScroll +} + + + +/** + * PickerConstructor helper methods. + */ +PickerConstructor._ = { + + /** + * Create a group of nodes. Expects: + * ` + { + min: {Integer}, + max: {Integer}, + i: {Integer}, + node: {String}, + item: {Function} + } + * ` + */ + group: function( groupObject ) { + + var + // Scope for the looped object + loopObjectScope, + + // Create the nodes list + nodesList = '', + + // The counter starts from the `min` + counter = PickerConstructor._.trigger( groupObject.min, groupObject ) + + + // Loop from the `min` to `max`, incrementing by `i` + for ( ; counter <= PickerConstructor._.trigger( groupObject.max, groupObject, [ counter ] ); counter += groupObject.i ) { + + // Trigger the `item` function within scope of the object + loopObjectScope = PickerConstructor._.trigger( groupObject.item, groupObject, [ counter ] ) + + // Splice the subgroup and create nodes out of the sub nodes + nodesList += PickerConstructor._.node( + groupObject.node, + loopObjectScope[ 0 ], // the node + loopObjectScope[ 1 ], // the classes + loopObjectScope[ 2 ] // the attributes + ) + } + + // Return the list of nodes + return nodesList + }, //group + + + /** + * Create a dom node string + */ + node: function( wrapper, item, klass, attribute ) { + + // If the item is false-y, just return an empty string + if ( !item ) return '' + + // If the item is an array, do a join + item = $.isArray( item ) ? item.join( '' ) : item + + // Check for the class + klass = klass ? ' class="' + klass + '"' : '' + + // Check for any attributes + attribute = attribute ? ' ' + attribute : '' + + // Return the wrapped item + return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>' + }, //node + + + /** + * Lead numbers below 10 with a zero. + */ + lead: function( number ) { + return ( number < 10 ? '0': '' ) + number + }, + + + /** + * Trigger a function otherwise return the value. + */ + trigger: function( callback, scope, args ) { + return typeof callback == 'function' ? callback.apply( scope, args || [] ) : callback + }, + + + /** + * If the second character is a digit, length is 2 otherwise 1. + */ + digits: function( string ) { + return ( /\d/ ).test( string[ 1 ] ) ? 2 : 1 + }, + + + /** + * Tell if something is a date object. + */ + isDate: function( value ) { + return {}.toString.call( value ).indexOf( 'Date' ) > -1 && this.isInteger( value.getDate() ) + }, + + + /** + * Tell if something is an integer. + */ + isInteger: function( value ) { + return {}.toString.call( value ).indexOf( 'Number' ) > -1 && value % 1 === 0 + }, + + + /** + * Create ARIA attribute strings. + */ + ariaAttr: ariaAttr +} //PickerConstructor._ + + + +/** + * Extend the picker with a component and defaults. + */ +PickerConstructor.extend = function( name, Component ) { + + // Extend jQuery. + $.fn[ name ] = function( options, action ) { + + // Grab the component data. + var componentData = this.data( name ) + + // If the picker is requested, return the data object. + if ( options == 'picker' ) { + return componentData + } + + // If the component data exists and `options` is a string, carry out the action. + if ( componentData && typeof options == 'string' ) { + return PickerConstructor._.trigger( componentData[ options ], componentData, [ action ] ) + } + + // Otherwise go through each matched element and if the component + // doesn’t exist, create a new picker using `this` element + // and merging the defaults and options with a deep copy. + return this.each( function() { + var $this = $( this ) + if ( !$this.data( name ) ) { + new PickerConstructor( this, name, Component, options ) + } + }) + } + + // Set the defaults. + $.fn[ name ].defaults = Component.defaults +} //PickerConstructor.extend + + + +function aria(element, attribute, value) { + if ( $.isPlainObject(attribute) ) { + for ( var key in attribute ) { + ariaSet(element, key, attribute[key]) + } + } + else { + ariaSet(element, attribute, value) + } +} +function ariaSet(element, attribute, value) { + element.setAttribute( + (attribute == 'role' ? '' : 'aria-') + attribute, + value + ) +} +function ariaAttr(attribute, data) { + if ( !$.isPlainObject(attribute) ) { + attribute = { attribute: data } + } + data = '' + for ( var key in attribute ) { + var attr = (key == 'role' ? '' : 'aria-') + key, + attrVal = attribute[key] + data += attrVal == null ? '' : attr + '="' + attribute[key] + '"' + } + return data +} + +// IE8 bug throws an error for activeElements within iframes. +function getActiveElement() { + try { + return document.activeElement + } catch ( err ) { } +} + + + +// Expose the picker constructor. +return PickerConstructor + + +})); + + +;/*! + * Date picker for pickadate.js v3.5.0 + * http://amsul.github.io/pickadate.js/date.htm + */ + +(function ( factory ) { + + // AMD. + if ( typeof define == 'function' && define.amd ) + define( ['picker', 'jquery'], factory ) + + // Node.js/browserify. + else if ( typeof exports == 'object' ) + module.exports = factory( require('./picker.js'), require('jquery') ) + + // Browser globals. + else factory( Picker, jQuery ) + +}(function( Picker, $ ) { + + +/** + * Globals and constants + */ +var DAYS_IN_WEEK = 7, + WEEKS_IN_CALENDAR = 6, + _ = Picker._ + + + +/** + * The date picker constructor + */ +function DatePicker( picker, settings ) { + + var calendar = this, + element = picker.$node[ 0 ], + elementValue = element.value, + elementDataValue = picker.$node.data( 'value' ), + valueString = elementDataValue || elementValue, + formatString = elementDataValue ? settings.formatSubmit : settings.format, + isRTL = function() { + + return element.currentStyle ? + + // For IE. + element.currentStyle.direction == 'rtl' : + + // For normal browsers. + getComputedStyle( picker.$root[0] ).direction == 'rtl' + } + + calendar.settings = settings + calendar.$node = picker.$node + + // The queue of methods that will be used to build item objects. + calendar.queue = { + min: 'measure create', + max: 'measure create', + now: 'now create', + select: 'parse create validate', + highlight: 'parse navigate create validate', + view: 'parse create validate viewset', + disable: 'deactivate', + enable: 'activate' + } + + // The component's item object. + calendar.item = {} + + calendar.item.clear = null + calendar.item.disable = ( settings.disable || [] ).slice( 0 ) + calendar.item.enable = -(function( collectionDisabled ) { + return collectionDisabled[ 0 ] === true ? collectionDisabled.shift() : -1 + })( calendar.item.disable ) + + calendar. + set( 'min', settings.min ). + set( 'max', settings.max ). + set( 'now' ) + + // When there’s a value, set the `select`, which in turn + // also sets the `highlight` and `view`. + if ( valueString ) { + calendar.set( 'select', valueString, { format: formatString }) + } + + // If there’s no value, default to highlighting “today”. + else { + calendar. + set( 'select', null ). + set( 'highlight', calendar.item.now ) + } + + + // The keycode to movement mapping. + calendar.key = { + 40: 7, // Down + 38: -7, // Up + 39: function() { return isRTL() ? -1 : 1 }, // Right + 37: function() { return isRTL() ? 1 : -1 }, // Left + go: function( timeChange ) { + var highlightedObject = calendar.item.highlight, + targetDate = new Date( highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange ) + calendar.set( + 'highlight', + targetDate, + { interval: timeChange } + ) + this.render() + } + } + + + // Bind some picker events. + picker. + on( 'render', function() { + picker.$root.find( '.' + settings.klass.selectMonth ).on( 'change', function() { + var value = this.value + if ( value ) { + picker.set( 'highlight', [ picker.get( 'view' ).year, value, picker.get( 'highlight' ).date ] ) + picker.$root.find( '.' + settings.klass.selectMonth ).trigger( 'focus' ) + } + }) + picker.$root.find( '.' + settings.klass.selectYear ).on( 'change', function() { + var value = this.value + if ( value ) { + picker.set( 'highlight', [ value, picker.get( 'view' ).month, picker.get( 'highlight' ).date ] ) + picker.$root.find( '.' + settings.klass.selectYear ).trigger( 'focus' ) + } + }) + }, 1 ). + on( 'open', function() { + var includeToday = '' + if ( calendar.disabled( calendar.get('now') ) ) { + includeToday = ':not(.' + settings.klass.buttonToday + ')' + } + picker.$root.find( 'button' + includeToday + ', select' ).attr( 'disabled', false ) + }, 1 ). + on( 'close', function() { + picker.$root.find( 'button, select' ).attr( 'disabled', true ) + }, 1 ) + +} //DatePicker + + +/** + * Set a datepicker item object. + */ +DatePicker.prototype.set = function( type, value, options ) { + + var calendar = this, + calendarItem = calendar.item + + // If the value is `null` just set it immediately. + if ( value === null ) { + if ( type == 'clear' ) type = 'select' + calendarItem[ type ] = value + return calendar + } + + // Otherwise go through the queue of methods, and invoke the functions. + // Update this as the time unit, and set the final value as this item. + // * In the case of `enable`, keep the queue but set `disable` instead. + // And in the case of `flip`, keep the queue but set `enable` instead. + calendarItem[ ( type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type ) ] = calendar.queue[ type ].split( ' ' ).map( function( method ) { + value = calendar[ method ]( type, value, options ) + return value + }).pop() + + // Check if we need to cascade through more updates. + if ( type == 'select' ) { + calendar.set( 'highlight', calendarItem.select, options ) + } + else if ( type == 'highlight' ) { + calendar.set( 'view', calendarItem.highlight, options ) + } + else if ( type.match( /^(flip|min|max|disable|enable)$/ ) ) { + if ( calendarItem.select && calendar.disabled( calendarItem.select ) ) { + calendar.set( 'select', calendarItem.select, options ) + } + if ( calendarItem.highlight && calendar.disabled( calendarItem.highlight ) ) { + calendar.set( 'highlight', calendarItem.highlight, options ) + } + } + + return calendar +} //DatePicker.prototype.set + + +/** + * Get a datepicker item object. + */ +DatePicker.prototype.get = function( type ) { + return this.item[ type ] +} //DatePicker.prototype.get + + +/** + * Create a picker date object. + */ +DatePicker.prototype.create = function( type, value, options ) { + + var isInfiniteValue, + calendar = this + + // If there’s no value, use the type as the value. + value = value === undefined ? type : value + + + // If it’s infinity, update the value. + if ( value == -Infinity || value == Infinity ) { + isInfiniteValue = value + } + + // If it’s an object, use the native date object. + else if ( $.isPlainObject( value ) && _.isInteger( value.pick ) ) { + value = value.obj + } + + // If it’s an array, convert it into a date and make sure + // that it’s a valid date – otherwise default to today. + else if ( $.isArray( value ) ) { + value = new Date( value[ 0 ], value[ 1 ], value[ 2 ] ) + value = _.isDate( value ) ? value : calendar.create().obj + } + + // If it’s a number or date object, make a normalized date. + else if ( _.isInteger( value ) || _.isDate( value ) ) { + value = calendar.normalize( new Date( value ), options ) + } + + // If it’s a literal true or any other case, set it to now. + else /*if ( value === true )*/ { + value = calendar.now( type, value, options ) + } + + // Return the compiled object. + return { + year: isInfiniteValue || value.getFullYear(), + month: isInfiniteValue || value.getMonth(), + date: isInfiniteValue || value.getDate(), + day: isInfiniteValue || value.getDay(), + obj: isInfiniteValue || value, + pick: isInfiniteValue || value.getTime() + } +} //DatePicker.prototype.create + + +/** + * Create a range limit object using an array, date object, + * literal “true”, or integer relative to another time. + */ +DatePicker.prototype.createRange = function( from, to ) { + + var calendar = this, + createDate = function( date ) { + if ( date === true || $.isArray( date ) || _.isDate( date ) ) { + return calendar.create( date ) + } + return date + } + + // Create objects if possible. + if ( !_.isInteger( from ) ) { + from = createDate( from ) + } + if ( !_.isInteger( to ) ) { + to = createDate( to ) + } + + // Create relative dates. + if ( _.isInteger( from ) && $.isPlainObject( to ) ) { + from = [ to.year, to.month, to.date + from ]; + } + else if ( _.isInteger( to ) && $.isPlainObject( from ) ) { + to = [ from.year, from.month, from.date + to ]; + } + + return { + from: createDate( from ), + to: createDate( to ) + } +} //DatePicker.prototype.createRange + + +/** + * Check if a date unit falls within a date range object. + */ +DatePicker.prototype.withinRange = function( range, dateUnit ) { + range = this.createRange(range.from, range.to) + return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick +} + + +/** + * Check if two date range objects overlap. + */ +DatePicker.prototype.overlapRanges = function( one, two ) { + + var calendar = this + + // Convert the ranges into comparable dates. + one = calendar.createRange( one.from, one.to ) + two = calendar.createRange( two.from, two.to ) + + return calendar.withinRange( one, two.from ) || calendar.withinRange( one, two.to ) || + calendar.withinRange( two, one.from ) || calendar.withinRange( two, one.to ) +} + + +/** + * Get the date today. + */ +DatePicker.prototype.now = function( type, value, options ) { + value = new Date() + if ( options && options.rel ) { + value.setDate( value.getDate() + options.rel ) + } + return this.normalize( value, options ) +} + + +/** + * Navigate to next/prev month. + */ +DatePicker.prototype.navigate = function( type, value, options ) { + + var targetDateObject, + targetYear, + targetMonth, + targetDate, + isTargetArray = $.isArray( value ), + isTargetObject = $.isPlainObject( value ), + viewsetObject = this.item.view/*, + safety = 100*/ + + + if ( isTargetArray || isTargetObject ) { + + if ( isTargetObject ) { + targetYear = value.year + targetMonth = value.month + targetDate = value.date + } + else { + targetYear = +value[0] + targetMonth = +value[1] + targetDate = +value[2] + } + + // If we’re navigating months but the view is in a different + // month, navigate to the view’s year and month. + if ( options && options.nav && viewsetObject && viewsetObject.month !== targetMonth ) { + targetYear = viewsetObject.year + targetMonth = viewsetObject.month + } + + // Figure out the expected target year and month. + targetDateObject = new Date( targetYear, targetMonth + ( options && options.nav ? options.nav : 0 ), 1 ) + targetYear = targetDateObject.getFullYear() + targetMonth = targetDateObject.getMonth() + + // If the month we’re going to doesn’t have enough days, + // keep decreasing the date until we reach the month’s last date. + while ( /*safety &&*/ new Date( targetYear, targetMonth, targetDate ).getMonth() !== targetMonth ) { + targetDate -= 1 + /*safety -= 1 + if ( !safety ) { + throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.' + }*/ + } + + value = [ targetYear, targetMonth, targetDate ] + } + + return value +} //DatePicker.prototype.navigate + + +/** + * Normalize a date by setting the hours to midnight. + */ +DatePicker.prototype.normalize = function( value/*, options*/ ) { + value.setHours( 0, 0, 0, 0 ) + return value +} + + +/** + * Measure the range of dates. + */ +DatePicker.prototype.measure = function( type, value/*, options*/ ) { + + var calendar = this + + // If it’s anything false-y, remove the limits. + if ( !value ) { + value = type == 'min' ? -Infinity : Infinity + } + + // If it’s a string, parse it. + else if ( typeof value == 'string' ) { + value = calendar.parse( type, value ) + } + + // If it's an integer, get a date relative to today. + else if ( _.isInteger( value ) ) { + value = calendar.now( type, value, { rel: value } ) + } + + return value +} ///DatePicker.prototype.measure + + +/** + * Create a viewset object based on navigation. + */ +DatePicker.prototype.viewset = function( type, dateObject/*, options*/ ) { + return this.create([ dateObject.year, dateObject.month, 1 ]) +} + + +/** + * Validate a date as enabled and shift if needed. + */ +DatePicker.prototype.validate = function( type, dateObject, options ) { + + var calendar = this, + + // Keep a reference to the original date. + originalDateObject = dateObject, + + // Make sure we have an interval. + interval = options && options.interval ? options.interval : 1, + + // Check if the calendar enabled dates are inverted. + isFlippedBase = calendar.item.enable === -1, + + // Check if we have any enabled dates after/before now. + hasEnabledBeforeTarget, hasEnabledAfterTarget, + + // The min & max limits. + minLimitObject = calendar.item.min, + maxLimitObject = calendar.item.max, + + // Check if we’ve reached the limit during shifting. + reachedMin, reachedMax, + + // Check if the calendar is inverted and at least one weekday is enabled. + hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter( function( value ) { + + // If there’s a date, check where it is relative to the target. + if ( $.isArray( value ) ) { + var dateTime = calendar.create( value ).pick + if ( dateTime < dateObject.pick ) hasEnabledBeforeTarget = true + else if ( dateTime > dateObject.pick ) hasEnabledAfterTarget = true + } + + // Return only integers for enabled weekdays. + return _.isInteger( value ) + }).length/*, + + safety = 100*/ + + + + // Cases to validate for: + // [1] Not inverted and date disabled. + // [2] Inverted and some dates enabled. + // [3] Not inverted and out of range. + // + // Cases to **not** validate for: + // • Navigating months. + // • Not inverted and date enabled. + // • Inverted and all dates disabled. + // • ..and anything else. + if ( !options || !options.nav ) if ( + /* 1 */ ( !isFlippedBase && calendar.disabled( dateObject ) ) || + /* 2 */ ( isFlippedBase && calendar.disabled( dateObject ) && ( hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget ) ) || + /* 3 */ ( !isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick) ) + ) { + + + // When inverted, flip the direction if there aren’t any enabled weekdays + // and there are no enabled dates in the direction of the interval. + if ( isFlippedBase && !hasEnabledWeekdays && ( ( !hasEnabledAfterTarget && interval > 0 ) || ( !hasEnabledBeforeTarget && interval < 0 ) ) ) { + interval *= -1 + } + + + // Keep looping until we reach an enabled date. + while ( /*safety &&*/ calendar.disabled( dateObject ) ) { + + /*safety -= 1 + if ( !safety ) { + throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.' + }*/ + + + // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval. + if ( Math.abs( interval ) > 1 && ( dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month ) ) { + dateObject = originalDateObject + interval = interval > 0 ? 1 : -1 + } + + + // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit. + if ( dateObject.pick <= minLimitObject.pick ) { + reachedMin = true + interval = 1 + dateObject = calendar.create([ + minLimitObject.year, + minLimitObject.month, + minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1) + ]) + } + else if ( dateObject.pick >= maxLimitObject.pick ) { + reachedMax = true + interval = -1 + dateObject = calendar.create([ + maxLimitObject.year, + maxLimitObject.month, + maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1) + ]) + } + + + // If we’ve reached both limits, just break out of the loop. + if ( reachedMin && reachedMax ) { + break + } + + + // Finally, create the shifted date using the interval and keep looping. + dateObject = calendar.create([ dateObject.year, dateObject.month, dateObject.date + interval ]) + } + + } //endif + + + // Return the date object settled on. + return dateObject +} //DatePicker.prototype.validate + + +/** + * Check if a date is disabled. + */ +DatePicker.prototype.disabled = function( dateToVerify ) { + + var + calendar = this, + + // Filter through the disabled dates to check if this is one. + isDisabledMatch = calendar.item.disable.filter( function( dateToDisable ) { + + // If the date is a number, match the weekday with 0index and `firstDay` check. + if ( _.isInteger( dateToDisable ) ) { + return dateToVerify.day === ( calendar.settings.firstDay ? dateToDisable : dateToDisable - 1 ) % 7 + } + + // If it’s an array or a native JS date, create and match the exact date. + if ( $.isArray( dateToDisable ) || _.isDate( dateToDisable ) ) { + return dateToVerify.pick === calendar.create( dateToDisable ).pick + } + + // If it’s an object, match a date within the “from” and “to” range. + if ( $.isPlainObject( dateToDisable ) ) { + return calendar.withinRange( dateToDisable, dateToVerify ) + } + }) + + // If this date matches a disabled date, confirm it’s not inverted. + isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function( dateToDisable ) { + return $.isArray( dateToDisable ) && dateToDisable[3] == 'inverted' || + $.isPlainObject( dateToDisable ) && dateToDisable.inverted + }).length + + // Check the calendar “enabled” flag and respectively flip the + // disabled state. Then also check if it’s beyond the min/max limits. + return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || + dateToVerify.pick < calendar.item.min.pick || + dateToVerify.pick > calendar.item.max.pick + +} //DatePicker.prototype.disabled + + +/** + * Parse a string into a usable type. + */ +DatePicker.prototype.parse = function( type, value, options ) { + + var calendar = this, + parsingObject = {} + + // If it’s already parsed, we’re good. + if ( !value || typeof value != 'string' ) { + return value + } + + // We need a `.format` to parse the value with. + if ( !( options && options.format ) ) { + options = options || {} + options.format = calendar.settings.format + } + + // Convert the format into an array and then map through it. + calendar.formats.toArray( options.format ).map( function( label ) { + + var + // Grab the formatting label. + formattingLabel = calendar.formats[ label ], + + // The format length is from the formatting label function or the + // label length without the escaping exclamation (!) mark. + formatLength = formattingLabel ? _.trigger( formattingLabel, calendar, [ value, parsingObject ] ) : label.replace( /^!/, '' ).length + + // If there's a format label, split the value up to the format length. + // Then add it to the parsing object with appropriate label. + if ( formattingLabel ) { + parsingObject[ label ] = value.substr( 0, formatLength ) + } + + // Update the value as the substring from format length to end. + value = value.substr( formatLength ) + }) + + // Compensate for month 0index. + return [ + parsingObject.yyyy || parsingObject.yy, + +( parsingObject.mm || parsingObject.m ) - 1, + parsingObject.dd || parsingObject.d + ] +} //DatePicker.prototype.parse + + +/** + * Various formats to display the object in. + */ +DatePicker.prototype.formats = (function() { + + // Return the length of the first word in a collection. + function getWordLengthFromCollection( string, collection, dateObject ) { + + // Grab the first word from the string. + var word = string.match( /\w+/ )[ 0 ] + + // If there's no month index, add it to the date object + if ( !dateObject.mm && !dateObject.m ) { + dateObject.m = collection.indexOf( word ) + 1 + } + + // Return the length of the word. + return word.length + } + + // Get the length of the first word in a string. + function getFirstWordLength( string ) { + return string.match( /\w+/ )[ 0 ].length + } + + return { + + d: function( string, dateObject ) { + + // If there's string, then get the digits length. + // Otherwise return the selected date. + return string ? _.digits( string ) : dateObject.date + }, + dd: function( string, dateObject ) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected date with a leading zero. + return string ? 2 : _.lead( dateObject.date ) + }, + ddd: function( string, dateObject ) { + + // If there's a string, then get the length of the first word. + // Otherwise return the short selected weekday. + return string ? getFirstWordLength( string ) : this.settings.weekdaysShort[ dateObject.day ] + }, + dddd: function( string, dateObject ) { + + // If there's a string, then get the length of the first word. + // Otherwise return the full selected weekday. + return string ? getFirstWordLength( string ) : this.settings.weekdaysFull[ dateObject.day ] + }, + m: function( string, dateObject ) { + + // If there's a string, then get the length of the digits + // Otherwise return the selected month with 0index compensation. + return string ? _.digits( string ) : dateObject.month + 1 + }, + mm: function( string, dateObject ) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected month with 0index and leading zero. + return string ? 2 : _.lead( dateObject.month + 1 ) + }, + mmm: function( string, dateObject ) { + + var collection = this.settings.monthsShort + + // If there's a string, get length of the relevant month from the short + // months collection. Otherwise return the selected month from that collection. + return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ] + }, + mmmm: function( string, dateObject ) { + + var collection = this.settings.monthsFull + + // If there's a string, get length of the relevant month from the full + // months collection. Otherwise return the selected month from that collection. + return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ] + }, + yy: function( string, dateObject ) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected year by slicing out the first 2 digits. + return string ? 2 : ( '' + dateObject.year ).slice( 2 ) + }, + yyyy: function( string, dateObject ) { + + // If there's a string, then the length is always 4. + // Otherwise return the selected year. + return string ? 4 : dateObject.year + }, + + // Create an array by splitting the formatting string passed. + toArray: function( formatString ) { return formatString.split( /(d{1,4}|m{1,4}|y{4}|yy|!.)/g ) }, + + // Format an object into a string using the formatting options. + toString: function ( formatString, itemObject ) { + var calendar = this + return calendar.formats.toArray( formatString ).map( function( label ) { + return _.trigger( calendar.formats[ label ], calendar, [ 0, itemObject ] ) || label.replace( /^!/, '' ) + }).join( '' ) + } + } +})() //DatePicker.prototype.formats + + + + +/** + * Check if two date units are the exact. + */ +DatePicker.prototype.isDateExact = function( one, two ) { + + var calendar = this + + // When we’re working with weekdays, do a direct comparison. + if ( + ( _.isInteger( one ) && _.isInteger( two ) ) || + ( typeof one == 'boolean' && typeof two == 'boolean' ) + ) { + return one === two + } + + // When we’re working with date representations, compare the “pick” value. + if ( + ( _.isDate( one ) || $.isArray( one ) ) && + ( _.isDate( two ) || $.isArray( two ) ) + ) { + return calendar.create( one ).pick === calendar.create( two ).pick + } + + // When we’re working with range objects, compare the “from” and “to”. + if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) { + return calendar.isDateExact( one.from, two.from ) && calendar.isDateExact( one.to, two.to ) + } + + return false +} + + +/** + * Check if two date units overlap. + */ +DatePicker.prototype.isDateOverlap = function( one, two ) { + + var calendar = this, + firstDay = calendar.settings.firstDay ? 1 : 0 + + // When we’re working with a weekday index, compare the days. + if ( _.isInteger( one ) && ( _.isDate( two ) || $.isArray( two ) ) ) { + one = one % 7 + firstDay + return one === calendar.create( two ).day + 1 + } + if ( _.isInteger( two ) && ( _.isDate( one ) || $.isArray( one ) ) ) { + two = two % 7 + firstDay + return two === calendar.create( one ).day + 1 + } + + // When we’re working with range objects, check if the ranges overlap. + if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) { + return calendar.overlapRanges( one, two ) + } + + return false +} + + +/** + * Flip the “enabled” state. + */ +DatePicker.prototype.flipEnable = function(val) { + var itemObject = this.item + itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1) +} + + +/** + * Mark a collection of dates as “disabled”. + */ +DatePicker.prototype.deactivate = function( type, datesToDisable ) { + + var calendar = this, + disabledItems = calendar.item.disable.slice(0) + + + // If we’re flipping, that’s all we need to do. + if ( datesToDisable == 'flip' ) { + calendar.flipEnable() + } + + else if ( datesToDisable === false ) { + calendar.flipEnable(1) + disabledItems = [] + } + + else if ( datesToDisable === true ) { + calendar.flipEnable(-1) + disabledItems = [] + } + + // Otherwise go through the dates to disable. + else { + + datesToDisable.map(function( unitToDisable ) { + + var matchFound + + // When we have disabled items, check for matches. + // If something is matched, immediately break out. + for ( var index = 0; index < disabledItems.length; index += 1 ) { + if ( calendar.isDateExact( unitToDisable, disabledItems[index] ) ) { + matchFound = true + break + } + } + + // If nothing was found, add the validated unit to the collection. + if ( !matchFound ) { + if ( + _.isInteger( unitToDisable ) || + _.isDate( unitToDisable ) || + $.isArray( unitToDisable ) || + ( $.isPlainObject( unitToDisable ) && unitToDisable.from && unitToDisable.to ) + ) { + disabledItems.push( unitToDisable ) + } + } + }) + } + + // Return the updated collection. + return disabledItems +} //DatePicker.prototype.deactivate + + +/** + * Mark a collection of dates as “enabled”. + */ +DatePicker.prototype.activate = function( type, datesToEnable ) { + + var calendar = this, + disabledItems = calendar.item.disable, + disabledItemsCount = disabledItems.length + + // If we’re flipping, that’s all we need to do. + if ( datesToEnable == 'flip' ) { + calendar.flipEnable() + } + + else if ( datesToEnable === true ) { + calendar.flipEnable(1) + disabledItems = [] + } + + else if ( datesToEnable === false ) { + calendar.flipEnable(-1) + disabledItems = [] + } + + // Otherwise go through the disabled dates. + else { + + datesToEnable.map(function( unitToEnable ) { + + var matchFound, + disabledUnit, + index, + isExactRange + + // Go through the disabled items and try to find a match. + for ( index = 0; index < disabledItemsCount; index += 1 ) { + + disabledUnit = disabledItems[index] + + // When an exact match is found, remove it from the collection. + if ( calendar.isDateExact( disabledUnit, unitToEnable ) ) { + matchFound = disabledItems[index] = null + isExactRange = true + break + } + + // When an overlapped match is found, add the “inverted” state to it. + else if ( calendar.isDateOverlap( disabledUnit, unitToEnable ) ) { + if ( $.isPlainObject( unitToEnable ) ) { + unitToEnable.inverted = true + matchFound = unitToEnable + } + else if ( $.isArray( unitToEnable ) ) { + matchFound = unitToEnable + if ( !matchFound[3] ) matchFound.push( 'inverted' ) + } + else if ( _.isDate( unitToEnable ) ) { + matchFound = [ unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted' ] + } + break + } + } + + // If a match was found, remove a previous duplicate entry. + if ( matchFound ) for ( index = 0; index < disabledItemsCount; index += 1 ) { + if ( calendar.isDateExact( disabledItems[index], unitToEnable ) ) { + disabledItems[index] = null + break + } + } + + // In the event that we’re dealing with an exact range of dates, + // make sure there are no “inverted” dates because of it. + if ( isExactRange ) for ( index = 0; index < disabledItemsCount; index += 1 ) { + if ( calendar.isDateOverlap( disabledItems[index], unitToEnable ) ) { + disabledItems[index] = null + break + } + } + + // If something is still matched, add it into the collection. + if ( matchFound ) { + disabledItems.push( matchFound ) + } + }) + } + + // Return the updated collection. + return disabledItems.filter(function( val ) { return val != null }) +} //DatePicker.prototype.activate + + +/** + * Create a string for the nodes in the picker. + */ +DatePicker.prototype.nodes = function( isOpen ) { + + var + calendar = this, + settings = calendar.settings, + calendarItem = calendar.item, + nowObject = calendarItem.now, + selectedObject = calendarItem.select, + highlightedObject = calendarItem.highlight, + viewsetObject = calendarItem.view, + disabledCollection = calendarItem.disable, + minLimitObject = calendarItem.min, + maxLimitObject = calendarItem.max, + + + // Create the calendar table head using a copy of weekday labels collection. + // * We do a copy so we don't mutate the original array. + tableHead = (function( collection, fullCollection ) { + + // If the first day should be Monday, move Sunday to the end. + if ( settings.firstDay ) { + collection.push( collection.shift() ) + fullCollection.push( fullCollection.shift() ) + } + + // Create and return the table head group. + return _.node( + 'thead', + _.node( + 'tr', + _.group({ + min: 0, + max: DAYS_IN_WEEK - 1, + i: 1, + node: 'th', + item: function( counter ) { + return [ + collection[ counter ], + settings.klass.weekdays, + 'scope=col title="' + fullCollection[ counter ] + '"' + ] + } + }) + ) + ) //endreturn + + // Materialize modified + })( ( settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter ).slice( 0 ), settings.weekdaysFull.slice( 0 ) ), //tableHead + + + // Create the nav for next/prev month. + createMonthNav = function( next ) { + + // Otherwise, return the created month tag. + return _.node( + 'div', + ' ', + settings.klass[ 'nav' + ( next ? 'Next' : 'Prev' ) ] + ( + + // If the focused month is outside the range, disabled the button. + ( next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month ) || + ( !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ) ? + ' ' + settings.klass.navDisabled : '' + ), + 'data-nav=' + ( next || -1 ) + ' ' + + _.ariaAttr({ + role: 'button', + controls: calendar.$node[0].id + '_table' + }) + ' ' + + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev ) + '"' + ) //endreturn + }, //createMonthNav + + + // Create the month label. + //Materialize modified + createMonthLabel = function(override) { + + var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull + + // Materialize modified + if (override == "short_months") { + monthsCollection = settings.monthsShort; + } + + // If there are months to select, add a dropdown menu. + if ( settings.selectMonths && override == undefined) { + + return _.node( 'select', + _.group({ + min: 0, + max: 11, + i: 1, + node: 'option', + item: function( loopedMonth ) { + + return [ + + // The looped month and no classes. + monthsCollection[ loopedMonth ], 0, + + // Set the value and selected index. + 'value=' + loopedMonth + + ( viewsetObject.month == loopedMonth ? ' selected' : '' ) + + ( + ( + ( viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month ) || + ( viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ) + ) ? + ' disabled' : '' + ) + ] + } + }), + settings.klass.selectMonth + ' browser-default', + ( isOpen ? '' : 'disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + + 'title="' + settings.labelMonthSelect + '"' + ) + } + + // Materialize modified + if (override == "short_months") + if (selectedObject != null) + return _.node( 'div', monthsCollection[ selectedObject.month ] ); + else return _.node( 'div', monthsCollection[ viewsetObject.month ] ); + + // If there's a need for a month selector + return _.node( 'div', monthsCollection[ viewsetObject.month ], settings.klass.month ) + }, //createMonthLabel + + + // Create the year label. + // Materialize modified + createYearLabel = function(override) { + + var focusedYear = viewsetObject.year, + + // If years selector is set to a literal "true", set it to 5. Otherwise + // divide in half to get half before and half after focused year. + numberYears = settings.selectYears === true ? 5 : ~~( settings.selectYears / 2 ) + + // If there are years to select, add a dropdown menu. + if ( numberYears ) { + + var + minYear = minLimitObject.year, + maxYear = maxLimitObject.year, + lowestYear = focusedYear - numberYears, + highestYear = focusedYear + numberYears + + // If the min year is greater than the lowest year, increase the highest year + // by the difference and set the lowest year to the min year. + if ( minYear > lowestYear ) { + highestYear += minYear - lowestYear + lowestYear = minYear + } + + // If the max year is less than the highest year, decrease the lowest year + // by the lower of the two: available and needed years. Then set the + // highest year to the max year. + if ( maxYear < highestYear ) { + + var availableYears = lowestYear - minYear, + neededYears = highestYear - maxYear + + lowestYear -= availableYears > neededYears ? neededYears : availableYears + highestYear = maxYear + } + + if ( settings.selectYears && override == undefined ) { + return _.node( 'select', + _.group({ + min: lowestYear, + max: highestYear, + i: 1, + node: 'option', + item: function( loopedYear ) { + return [ + + // The looped year and no classes. + loopedYear, 0, + + // Set the value and selected index. + 'value=' + loopedYear + ( focusedYear == loopedYear ? ' selected' : '' ) + ] + } + }), + settings.klass.selectYear + ' browser-default', + ( isOpen ? '' : 'disabled' ) + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + + 'title="' + settings.labelYearSelect + '"' + ) + } + } + + // Materialize modified + if (override == "raw") + return _.node( 'div', focusedYear ) + + // Otherwise just return the year focused + return _.node( 'div', focusedYear, settings.klass.year ) + } //createYearLabel + + + // Materialize modified + createDayLabel = function() { + if (selectedObject != null) + return _.node( 'div', selectedObject.date) + else return _.node( 'div', nowObject.date) + } + createWeekdayLabel = function() { + var display_day; + + if (selectedObject != null) + display_day = selectedObject.day; + else + display_day = nowObject.day; + var weekday = settings.weekdaysFull[ display_day ] + return weekday + } + + + // Create and return the entire calendar. +return _.node( + // Date presentation View + 'div', + _.node( + 'div', + createWeekdayLabel(), + "picker__weekday-display" + )+ + _.node( + // Div for short Month + 'div', + createMonthLabel("short_months"), + settings.klass.month_display + )+ + _.node( + // Div for Day + 'div', + createDayLabel() , + settings.klass.day_display + )+ + _.node( + // Div for Year + 'div', + createYearLabel("raw") , + settings.klass.year_display + ), + settings.klass.date_display + )+ + // Calendar container + _.node('div', + _.node('div', + ( settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel() ) + + createMonthNav() + createMonthNav( 1 ), + settings.klass.header + ) + _.node( + 'table', + tableHead + + _.node( + 'tbody', + _.group({ + min: 0, + max: WEEKS_IN_CALENDAR - 1, + i: 1, + node: 'tr', + item: function( rowCounter ) { + + // If Monday is the first day and the month starts on Sunday, shift the date back a week. + var shiftDateBy = settings.firstDay && calendar.create([ viewsetObject.year, viewsetObject.month, 1 ]).day === 0 ? -7 : 0 + + return [ + _.group({ + min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index + max: function() { + return this.min + DAYS_IN_WEEK - 1 + }, + i: 1, + node: 'td', + item: function( targetDate ) { + + // Convert the time date from a relative date to a target date. + targetDate = calendar.create([ viewsetObject.year, viewsetObject.month, targetDate + ( settings.firstDay ? 1 : 0 ) ]) + + var isSelected = selectedObject && selectedObject.pick == targetDate.pick, + isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick, + isDisabled = disabledCollection && calendar.disabled( targetDate ) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick, + formattedDate = _.trigger( calendar.formats.toString, calendar, [ settings.format, targetDate ] ) + + return [ + _.node( + 'div', + targetDate.date, + (function( klasses ) { + + // Add the `infocus` or `outfocus` classes based on month in view. + klasses.push( viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus ) + + // Add the `today` class if needed. + if ( nowObject.pick == targetDate.pick ) { + klasses.push( settings.klass.now ) + } + + // Add the `selected` class if something's selected and the time matches. + if ( isSelected ) { + klasses.push( settings.klass.selected ) + } + + // Add the `highlighted` class if something's highlighted and the time matches. + if ( isHighlighted ) { + klasses.push( settings.klass.highlighted ) + } + + // Add the `disabled` class if something's disabled and the object matches. + if ( isDisabled ) { + klasses.push( settings.klass.disabled ) + } + + return klasses.join( ' ' ) + })([ settings.klass.day ]), + 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({ + role: 'gridcell', + label: formattedDate, + selected: isSelected && calendar.$node.val() === formattedDate ? true : null, + activedescendant: isHighlighted ? true : null, + disabled: isDisabled ? true : null + }) + ), + '', + _.ariaAttr({ role: 'presentation' }) + ] //endreturn + } + }) + ] //endreturn + } + }) + ), + settings.klass.table, + 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({ + role: 'grid', + controls: calendar.$node[0].id, + readonly: true + }) + ) + , settings.klass.calendar_container) // end calendar + + + + + // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”. + _.node( + 'div', + _.node( 'button', settings.today, "btn-flat picker__today", + 'type=button data-pick=' + nowObject.pick + + ( isOpen && !calendar.disabled(nowObject) ? '' : ' disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id }) ) + + _.node( 'button', settings.clear, "btn-flat picker__clear", + 'type=button data-clear=1' + + ( isOpen ? '' : ' disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id }) ) + + _.node('button', settings.close, "btn-flat picker__close", + 'type=button data-close=true ' + + ( isOpen ? '' : ' disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id }) ), + settings.klass.footer + ) //endreturn +} //DatePicker.prototype.nodes + + + + +/** + * The date picker defaults. + */ +DatePicker.defaults = (function( prefix ) { + + return { + + // The title label to use for the month nav buttons + labelMonthNext: 'Next month', + labelMonthPrev: 'Previous month', + + // The title label to use for the dropdown selectors + labelMonthSelect: 'Select a month', + labelYearSelect: 'Select a year', + + // Months and weekdays + monthsFull: [ 'January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December' ], + monthsShort: [ 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec' ], + weekdaysFull: [ 'Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday' ], + weekdaysShort: [ 'Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat' ], + + // Materialize modified + weekdaysLetter: [ 'S', 'M', 'T', 'W', 'T', 'F', 'S' ], + + // Today and clear + today: 'Today', + clear: 'Clear', + close: 'Close', + + // The format to show on the `input` element + format: 'd mmmm, yyyy', + + // Classes + klass: { + + table: prefix + 'table', + + header: prefix + 'header', + + + // Materialize Added klasses + date_display: prefix + 'date-display', + day_display: prefix + 'day-display', + month_display: prefix + 'month-display', + year_display: prefix + 'year-display', + calendar_container: prefix + 'calendar-container', + // end + + + + navPrev: prefix + 'nav--prev', + navNext: prefix + 'nav--next', + navDisabled: prefix + 'nav--disabled', + + month: prefix + 'month', + year: prefix + 'year', + + selectMonth: prefix + 'select--month', + selectYear: prefix + 'select--year', + + weekdays: prefix + 'weekday', + + day: prefix + 'day', + disabled: prefix + 'day--disabled', + selected: prefix + 'day--selected', + highlighted: prefix + 'day--highlighted', + now: prefix + 'day--today', + infocus: prefix + 'day--infocus', + outfocus: prefix + 'day--outfocus', + + footer: prefix + 'footer', + + buttonClear: prefix + 'button--clear', + buttonToday: prefix + 'button--today', + buttonClose: prefix + 'button--close' + } + } +})( Picker.klasses().picker + '__' ) + + + + + +/** + * Extend the picker to add the date picker. + */ +Picker.extend( 'pickadate', DatePicker ) + + +})); + + +;(function ($) { + + $.fn.characterCounter = function(){ + return this.each(function(){ + var $input = $(this); + var $counterElement = $input.parent().find('span[class="character-counter"]'); + + // character counter has already been added appended to the parent container + if ($counterElement.length) { + return; + } + + var itHasLengthAttribute = $input.attr('data-length') !== undefined; + + if(itHasLengthAttribute){ + $input.on('input', updateCounter); + $input.on('focus', updateCounter); + $input.on('blur', removeCounterElement); + + addCounterElement($input); + } + + }); + }; + + function updateCounter(){ + var maxLength = +$(this).attr('data-length'), + actualLength = +$(this).val().length, + isValidLength = actualLength <= maxLength; + + $(this).parent().find('span[class="character-counter"]') + .html( actualLength + '/' + maxLength); + + addInputStyle(isValidLength, $(this)); + } + + function addCounterElement($input) { + var $counterElement = $input.parent().find('span[class="character-counter"]'); + + if ($counterElement.length) { + return; + } + + $counterElement = $('<span/>') + .addClass('character-counter') + .css('float','right') + .css('font-size','12px') + .css('height', 1); + + $input.parent().append($counterElement); + } + + function removeCounterElement(){ + $(this).parent().find('span[class="character-counter"]').html(''); + } + + function addInputStyle(isValidLength, $input){ + var inputHasInvalidClass = $input.hasClass('invalid'); + if (isValidLength && inputHasInvalidClass) { + $input.removeClass('invalid'); + } + else if(!isValidLength && !inputHasInvalidClass){ + $input.removeClass('valid'); + $input.addClass('invalid'); + } + } + + $(document).ready(function(){ + $('input, textarea').characterCounter(); + }); + +}( jQuery )); +;(function ($) { + + var methods = { + + init : function(options) { + var defaults = { + duration: 200, // ms + dist: -100, // zoom scale TODO: make this more intuitive as an option + shift: 0, // spacing for center image + padding: 0, // Padding between non center items + fullWidth: false, // Change to full width styles + indicators: false, // Toggle indicators + noWrap: false, // Don't wrap around and cycle through items. + onCycleTo: null // Callback for when a new slide is cycled to. + }; + options = $.extend(defaults, options); + + return this.each(function() { + + var images, item_width, item_height, offset, center, pressed, dim, count, + reference, referenceY, amplitude, target, velocity, + xform, frame, timestamp, ticker, dragged, vertical_dragged; + var $indicators = $('<ul class="indicators"></ul>'); + + + // Initialize + var view = $(this); + var showIndicators = view.attr('data-indicators') || options.indicators; + + // Don't double initialize. + if (view.hasClass('initialized')) { + // Redraw carousel. + $(this).trigger('carouselNext', [0.000001]); + return true; + } + + + // Options + if (options.fullWidth) { + options.dist = 0; + var firstImage = view.find('.carousel-item img').first(); + if (firstImage.length) { + imageHeight = firstImage.on('load', function(){ + view.css('height', $(this).height()); + }); + } else { + imageHeight = view.find('.carousel-item').first().height(); + view.css('height', imageHeight); + } + + // Offset fixed items when indicators. + if (showIndicators) { + view.find('.carousel-fixed-item').addClass('with-indicators'); + } + } + + + view.addClass('initialized'); + pressed = false; + offset = target = 0; + images = []; + item_width = view.find('.carousel-item').first().innerWidth(); + item_height = view.find('.carousel-item').first().innerHeight(); + dim = item_width * 2 + options.padding; + + view.find('.carousel-item').each(function (i) { + images.push($(this)[0]); + if (showIndicators) { + var $indicator = $('<li class="indicator-item"></li>'); + + // Add active to first by default. + if (i === 0) { + $indicator.addClass('active'); + } + + // Handle clicks on indicators. + $indicator.click(function (e) { + e.stopPropagation(); + + var index = $(this).index(); + cycleTo(index); + }); + $indicators.append($indicator); + } + }); + + if (showIndicators) { + view.append($indicators); + } + count = images.length; + + + function setupEvents() { + if (typeof window.ontouchstart !== 'undefined') { + view[0].addEventListener('touchstart', tap); + view[0].addEventListener('touchmove', drag); + view[0].addEventListener('touchend', release); + } + view[0].addEventListener('mousedown', tap); + view[0].addEventListener('mousemove', drag); + view[0].addEventListener('mouseup', release); + view[0].addEventListener('mouseleave', release); + view[0].addEventListener('click', click); + } + + function xpos(e) { + // touch event + if (e.targetTouches && (e.targetTouches.length >= 1)) { + return e.targetTouches[0].clientX; + } + + // mouse event + return e.clientX; + } + + function ypos(e) { + // touch event + if (e.targetTouches && (e.targetTouches.length >= 1)) { + return e.targetTouches[0].clientY; + } + + // mouse event + return e.clientY; + } + + function wrap(x) { + return (x >= count) ? (x % count) : (x < 0) ? wrap(count + (x % count)) : x; + } + + function scroll(x) { + var i, half, delta, dir, tween, el, alignment, xTranslation; + var lastCenter = center; + + offset = (typeof x === 'number') ? x : offset; + center = Math.floor((offset + dim / 2) / dim); + delta = offset - center * dim; + dir = (delta < 0) ? 1 : -1; + tween = -dir * delta * 2 / dim; + half = count >> 1; + + if (!options.fullWidth) { + alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) '; + alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)'; + } else { + alignment = 'translateX(0)'; + } + + // Set indicator active + if (showIndicators) { + var diff = (center % count); + var activeIndicator = $indicators.find('.indicator-item.active'); + if (activeIndicator.index() !== diff) { + activeIndicator.removeClass('active'); + $indicators.find('.indicator-item').eq(diff).addClass('active'); + } + } + + // center + // Don't show wrapped items. + if (!options.noWrap || (center >= 0 && center < count)) { + el = images[wrap(center)]; + + // Add active class to center item. + if (!$(el).hasClass('active')) { + view.find('.carousel-item').removeClass('active'); + $(el).addClass('active'); + } + el.style[xform] = alignment + + ' translateX(' + (-delta / 2) + 'px)' + + ' translateX(' + (dir * options.shift * tween * i) + 'px)' + + ' translateZ(' + (options.dist * tween) + 'px)'; + el.style.zIndex = 0; + if (options.fullWidth) { tweenedOpacity = 1; } + else { tweenedOpacity = 1 - 0.2 * tween; } + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + for (i = 1; i <= half; ++i) { + // right side + if (options.fullWidth) { + zTranslation = options.dist; + tweenedOpacity = (i === half && delta < 0) ? 1 - tween : 1; + } else { + zTranslation = options.dist * (i * 2 + tween * dir); + tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir); + } + // Don't show wrapped items. + if (!options.noWrap || center + i < count) { + el = images[wrap(center + i)]; + el.style[xform] = alignment + + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + + ' translateZ(' + zTranslation + 'px)'; + el.style.zIndex = -i; + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + + // left side + if (options.fullWidth) { + zTranslation = options.dist; + tweenedOpacity = (i === half && delta > 0) ? 1 - tween : 1; + } else { + zTranslation = options.dist * (i * 2 - tween * dir); + tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir); + } + // Don't show wrapped items. + if (!options.noWrap || center - i >= 0) { + el = images[wrap(center - i)]; + el.style[xform] = alignment + + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + + ' translateZ(' + zTranslation + 'px)'; + el.style.zIndex = -i; + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + } + + // center + // Don't show wrapped items. + if (!options.noWrap || (center >= 0 && center < count)) { + el = images[wrap(center)]; + el.style[xform] = alignment + + ' translateX(' + (-delta / 2) + 'px)' + + ' translateX(' + (dir * options.shift * tween) + 'px)' + + ' translateZ(' + (options.dist * tween) + 'px)'; + el.style.zIndex = 0; + if (options.fullWidth) { tweenedOpacity = 1; } + else { tweenedOpacity = 1 - 0.2 * tween; } + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + // onCycleTo callback + if (lastCenter !== center && + typeof(options.onCycleTo) === "function") { + var $curr_item = view.find('.carousel-item').eq(wrap(center)); + options.onCycleTo.call(this, $curr_item, dragged); + } + } + + function track() { + var now, elapsed, delta, v; + + now = Date.now(); + elapsed = now - timestamp; + timestamp = now; + delta = offset - frame; + frame = offset; + + v = 1000 * delta / (1 + elapsed); + velocity = 0.8 * v + 0.2 * velocity; + } + + function autoScroll() { + var elapsed, delta; + + if (amplitude) { + elapsed = Date.now() - timestamp; + delta = amplitude * Math.exp(-elapsed / options.duration); + if (delta > 2 || delta < -2) { + scroll(target - delta); + requestAnimationFrame(autoScroll); + } else { + scroll(target); + } + } + } + + function click(e) { + // Disable clicks if carousel was dragged. + if (dragged) { + e.preventDefault(); + e.stopPropagation(); + return false; + + } else if (!options.fullWidth) { + var clickedIndex = $(e.target).closest('.carousel-item').index(); + var diff = (center % count) - clickedIndex; + + // Disable clicks if carousel was shifted by click + if (diff !== 0) { + e.preventDefault(); + e.stopPropagation(); + } + cycleTo(clickedIndex); + } + } + + function cycleTo(n) { + var diff = (center % count) - n; + + // Account for wraparound. + if (!options.noWrap) { + if (diff < 0) { + if (Math.abs(diff + count) < Math.abs(diff)) { diff += count; } + + } else if (diff > 0) { + if (Math.abs(diff - count) < diff) { diff -= count; } + } + } + + // Call prev or next accordingly. + if (diff < 0) { + view.trigger('carouselNext', [Math.abs(diff)]); + + } else if (diff > 0) { + view.trigger('carouselPrev', [diff]); + } + } + + function tap(e) { + pressed = true; + dragged = false; + vertical_dragged = false; + reference = xpos(e); + referenceY = ypos(e); + + velocity = amplitude = 0; + frame = offset; + timestamp = Date.now(); + clearInterval(ticker); + ticker = setInterval(track, 100); + + } + + function drag(e) { + var x, delta, deltaY; + if (pressed) { + x = xpos(e); + y = ypos(e); + delta = reference - x; + deltaY = Math.abs(referenceY - y); + if (deltaY < 30 && !vertical_dragged) { + // If vertical scrolling don't allow dragging. + if (delta > 2 || delta < -2) { + dragged = true; + reference = x; + scroll(offset + delta); + } + + } else if (dragged) { + // If dragging don't allow vertical scroll. + e.preventDefault(); + e.stopPropagation(); + return false; + + } else { + // Vertical scrolling. + vertical_dragged = true; + } + } + + if (dragged) { + // If dragging don't allow vertical scroll. + e.preventDefault(); + e.stopPropagation(); + return false; + } + } + + function release(e) { + if (pressed) { + pressed = false; + } else { + return; + } + + clearInterval(ticker); + target = offset; + if (velocity > 10 || velocity < -10) { + amplitude = 0.9 * velocity; + target = offset + amplitude; + } + target = Math.round(target / dim) * dim; + + // No wrap of items. + if (options.noWrap) { + if (target >= dim * (count - 1)) { + target = dim * (count - 1); + } else if (target < 0) { + target = 0; + } + } + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + + if (dragged) { + e.preventDefault(); + e.stopPropagation(); + } + return false; + } + + xform = 'transform'; + ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) { + var e = prefix + 'Transform'; + if (typeof document.body.style[e] !== 'undefined') { + xform = e; + return false; + } + return true; + }); + + + $(window).on('resize.carousel', function() { + if (options.fullWidth) { + item_width = view.find('.carousel-item').first().innerWidth(); + item_height = view.find('.carousel-item').first().innerHeight(); + dim = item_width * 2 + options.padding; + offset = center * 2 * item_width; + target = offset; + } else { + scroll(); + } + }); + + setupEvents(); + scroll(offset); + + $(this).on('carouselNext', function(e, n) { + if (n === undefined) { + n = 1; + } + target = (dim * Math.round(offset / dim)) + (dim * n); + if (offset !== target) { + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + } + }); + + $(this).on('carouselPrev', function(e, n) { + if (n === undefined) { + n = 1; + } + target = (dim * Math.round(offset / dim)) - (dim * n); + if (offset !== target) { + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + } + }); + + $(this).on('carouselSet', function(e, n) { + if (n === undefined) { + n = 0; + } + cycleTo(n); + }); + + }); + + + + }, + next : function(n) { + $(this).trigger('carouselNext', [n]); + }, + prev : function(n) { + $(this).trigger('carouselPrev', [n]); + }, + set : function(n) { + $(this).trigger('carouselSet', [n]); + } + }; + + + $.fn.carousel = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.carousel' ); + } + }; // Plugin end +}( jQuery ));
\ No newline at end of file |