diff options
314 files changed, 33992 insertions, 4318 deletions
diff --git a/.gitignore b/.gitignore index 024dfac4b..0aa7b8c09 100644 --- a/.gitignore +++ b/.gitignore @@ -26,3 +26,12 @@ wheels/ .venv/ venv/ ENV/ +node_modules/ +.coverage +=1.3.1 +cover/ +coverage.xml +nosetests.xml +testapi_venv/ +.cache +.tox @@ -22,6 +22,7 @@ Mei Mei (Huawei, meimei@huawei.com) Trevor Bramwell (Linux Foundation, tbramwell@linuxfoundation.org) Serena Feng (ZTE, feng.xiaowei@zte.com.cn) Yolanda Robla Mota (Red Hat, yroblamo@redhat.com) +Markos Chandras (SUSE, mchandras@suse.de) Link to TSC approval of the project: http://ircbot.wl.linuxfoundation.org/meetings/opnfv-meeting/2015/opnfv-meeting.2015-07-14-14.00.html Link to TSC voting for removal of Victor Laza as committer: http://meetbot.opnfv.org/meetings/opnfv-meeting/2016/opnfv-meeting.2016-02-16-14.59.html diff --git a/docs/jenkins-job-builder/opnfv-jjb-usage.rst b/docs/jenkins-job-builder/opnfv-jjb-usage.rst index 73b31b20a..52dbdebe5 100644 --- a/docs/jenkins-job-builder/opnfv-jjb-usage.rst +++ b/docs/jenkins-job-builder/opnfv-jjb-usage.rst @@ -39,11 +39,24 @@ Job Types * Trigger: **remerge** +* Experimental Job + + * Trigger: **check-experimental** + The verify and merge jobs are retriggerable in Gerrit by simply leaving a comment with one of the keywords listed above. This is useful in case you need to re-run one of those jobs in case if build issues or something changed with the environment. +The experimental jobs are not triggered automatically. You need to leave +a comment with the keyword list above to trigger it manually. It is useful +for trying out experimental features. + +Note that, experimental jobs `skip vote`_ for verified status, which means +it will reset the verified status to 0. If you want to keep the verified +status, use **recheck-experimental** in commit message to trigger both +verify and experimental jobs. + You can add below persons as reviewers to your patch in order to get it reviewed and submitted. @@ -57,6 +70,7 @@ reviewed and submitted. * jose.lausuch@ericsson.com * koffirodrigue@gmail.com * r-mibu@cq.jp.nec.com +* tbramwell@linuxfoundation.org Or Add the group releng-contributors @@ -67,3 +81,5 @@ in `releng-jobs.yaml`_. .. _releng-jobs.yaml: https://gerrit.opnfv.org/gerrit/gitweb?p=releng.git;a=blob;f=jjb/releng-jobs.yaml; +.. _skip vote: + https://wiki.jenkins-ci.org/display/JENKINS/Gerrit+Trigger#GerritTrigger-SkipVote diff --git a/jjb-sandbox/releng/releng-sandbox-jobs.yml b/jjb-sandbox/releng/releng-sandbox-jobs.yml index adefe363e..97fea8992 100644 --- a/jjb-sandbox/releng/releng-sandbox-jobs.yml +++ b/jjb-sandbox/releng/releng-sandbox-jobs.yml @@ -13,7 +13,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: 'master' scm: - git-scm-gerrit diff --git a/jjb/3rd_party_ci/create-apex-vms.sh b/jjb/3rd_party_ci/create-apex-vms.sh index 3f5dbd1c4..0744ac89a 100755 --- a/jjb/3rd_party_ci/create-apex-vms.sh +++ b/jjb/3rd_party_ci/create-apex-vms.sh @@ -1,12 +1,8 @@ #!/bin/bash -set -e +set -o errexit +set -o nounset +set -o pipefail -if [ -z ${WORKSPACE} ]; then - echo "WORKSPACE is unset. Please do so." - exit 1 -fi -# wipe the WORKSPACE -/bin/rm -rf $WORKSPACE/* # clone opnfv sdnvpn repo git clone https://gerrit.opnfv.org/gerrit/p/sdnvpn.git $WORKSPACE/sdnvpn diff --git a/jjb/3rd_party_ci/download-netvirt-artifact.sh b/jjb/3rd_party_ci/download-netvirt-artifact.sh index be2d4059a..6aea01d2a 100755 --- a/jjb/3rd_party_ci/download-netvirt-artifact.sh +++ b/jjb/3rd_party_ci/download-netvirt-artifact.sh @@ -1,27 +1,30 @@ #!/bin/bash -set -e +set -o errexit +set -o nounset +set -o pipefail -if [ -z ${WORKSPACE} ]; then - echo "WORKSPACE is unset. Please do so." - exit 1 -fi -# wipe the WORKSPACE -/bin/rm -rf $WORKSPACE/* +ODL_ZIP=distribution-karaf-0.6.0-SNAPSHOT.zip echo "Attempting to fetch the artifact location from ODL Jenkins" CHANGE_DETAILS_URL="https://git.opendaylight.org/gerrit/changes/netvirt~master~$GERRIT_CHANGE_ID/detail" # due to limitation with the Jenkins Gerrit Trigger, we need to use Gerrit REST API to get the change details -ODL_JOB_URL=$(curl -s $CHANGE_DETAILS_URL | grep netvirt-patch-test-current-carbon | tail -1 | \ - sed 's/\\n//g' | awk '{print $6}') -NETVIRT_ARTIFACT_URL="${ODL_JOB_URL}org.opendaylight.integration\$distribution-karaf/artifact/org.opendaylight.integration/distribution-karaf/0.6.0-SNAPSHOT/distribution-karaf-0.6.0-SNAPSHOT.tar.gz" +ODL_BUILD_JOB_NUM=$(curl -s $CHANGE_DETAILS_URL | grep -Eo 'netvirt-distribution-check-carbon/[0-9]+' | tail -1 | grep -Eo [0-9]+) + +NETVIRT_ARTIFACT_URL="https://jenkins.opendaylight.org/releng/job/netvirt-distribution-check-carbon/${ODL_BUILD_JOB_NUM}/artifact/${ODL_ZIP}" echo -e "URL to artifact is\n\t$NETVIRT_ARTIFACT_URL" echo "Downloading the artifact. This could take time..." -wget -q -O $NETVIRT_ARTIFACT $NETVIRT_ARTIFACT_URL +wget -q -O $ODL_ZIP $NETVIRT_ARTIFACT_URL if [[ $? -ne 0 ]]; then echo "The artifact does not exist! Probably removed due to ODL Jenkins artifact retention policy." echo "Rerun netvirt-patch-test-current-carbon to get artifact rebuilt." exit 1 fi + +#TODO(trozet) remove this once odl-pipeline accepts zip files +echo "Converting artifact zip to tar.gz" +unzip $ODL_ZIP +tar czf /tmp/${NETVIRT_ARTIFACT} $(echo $ODL_ZIP | sed -n 's/\.zip//p') + echo "Download complete" -ls -al $NETVIRT_ARTIFACT +ls -al /tmp/${NETVIRT_ARTIFACT} diff --git a/jjb/3rd_party_ci/functest-netvirt.sh b/jjb/3rd_party_ci/functest-netvirt.sh deleted file mode 100755 index adffaf42d..000000000 --- a/jjb/3rd_party_ci/functest-netvirt.sh +++ /dev/null @@ -1,7 +0,0 @@ -#!/bin/bash -set -e - -# wipe the WORKSPACE -/bin/rm -rf $WORKSPACE/* - -echo "Hello World" diff --git a/jjb/3rd_party_ci/install-netvirt.sh b/jjb/3rd_party_ci/install-netvirt.sh index f111d4847..ed1a12bc8 100755 --- a/jjb/3rd_party_ci/install-netvirt.sh +++ b/jjb/3rd_party_ci/install-netvirt.sh @@ -1,15 +1,33 @@ #!/bin/bash -set -e +set -o errexit +set -o nounset +set -o pipefail -if [ -z ${WORKSPACE} ]; then - echo "WORKSPACE is unset. Please do so." - exit 1 -fi -# wipe the WORKSPACE -/bin/rm -rf $WORKSPACE/* +SNAP_CACHE=$HOME/snap_cache # clone opnfv sdnvpn repo git clone https://gerrit.opnfv.org/gerrit/p/sdnvpn.git $WORKSPACE/sdnvpn -. $WORKSPACE/sdnvpn/odl-pipeline/odl-pipeline-common.sh -pushd $LIB -./odl_reinstaller.sh --cloner-info $CLONER_INFO --odl-artifact $NETVIRT_ARTIFACT -popd
\ No newline at end of file + +if [ ! -f "/tmp/${NETVIRT_ARTIFACT}" ]; then + echo "ERROR: /tmp/${NETVIRT_ARTIFACT} specified as NetVirt Artifact, but file does not exist" + exit 1 +fi + +if [ ! -f "${SNAP_CACHE}/node.yaml" ]; then + echo "ERROR: node.yaml pod config missing in ${SNAP_CACHE}" + exit 1 +fi + +if [ ! -f "${SNAP_CACHE}/id_rsa" ]; then + echo "ERROR: id_rsa ssh creds missing in ${SNAP_CACHE}" + exit 1 +fi + +# TODO (trozet) snapshot should have already been unpacked into cache folder +# but we really should check the cache here, and not use a single cache folder +# for when we support multiple jobs on a single slave +pushd sdnvpn/odl-pipeline/lib > /dev/null +# FIXME (trozet) remove this once permissions are fixed in sdnvpn repo +chmod +x odl_reinstaller.sh +./odl_reinstaller.sh --pod-config ${SNAP_CACHE}/node.yaml \ + --odl-artifact /tmp/${NETVIRT_ARTIFACT} --ssh-key-file ${SNAP_CACHE}/id_rsa +popd > /dev/null diff --git a/jjb/3rd_party_ci/odl-netvirt.yml b/jjb/3rd_party_ci/odl-netvirt.yml index ca1936156..470e4335e 100644 --- a/jjb/3rd_party_ci/odl-netvirt.yml +++ b/jjb/3rd_party_ci/odl-netvirt.yml @@ -17,13 +17,11 @@ ##################################### phase: - 'create-apex-vms': - slave-label: 'ericsson-virtual5' + slave-label: 'odl-netvirt-virtual-intel' - 'install-netvirt': - slave-label: 'odl-netvirt-virtual' - - 'functest': - slave-label: 'odl-netvirt-virtual' + slave-label: 'odl-netvirt-virtual-intel' - 'postprocess': - slave-label: 'odl-netvirt-virtual' + slave-label: 'odl-netvirt-virtual-intel' ##################################### # jobs ##################################### @@ -43,30 +41,38 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 5 max-per-node: 1 option: 'project' + scm: + - git: + url: https://gerrit.opnfv.org/gerrit/apex + branches: + - 'origin/master' + timeout: 15 + wipe-workspace: true + parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - string: name: NETVIRT_ARTIFACT - default: $WORKSPACE/distribution-karaf.tar.gz - - 'odl-netvirt-virtual-defaults' + default: distribution-karaf.tar.gz + - 'odl-netvirt-virtual-intel-defaults' triggers: - gerrit: server-name: 'git.opendaylight.org' trigger-on: - - comment-added-contains-event: - comment-contains-value: 'https://jenkins.opendaylight.org/releng/job/netvirt-patch-test-current-carbon/.*?/ : SUCCESS' - - comment-added-contains-event: - comment-contains-value: 'https://jenkins.opendaylight.org/releng/job/netvirt-patch-test-current-carbon/.*?/ : UNSTABLE' + # - comment-added-contains-event: + # comment-contains-value: 'https://jenkins.opendaylight.org/releng/job/netvirt-patch-test-current-carbon/.*?/ : SUCCESS' + # - comment-added-contains-event: + # comment-contains-value: 'https://jenkins.opendaylight.org/releng/job/netvirt-patch-test-current-carbon/.*?/ : UNSTABLE' - comment-added-contains-event: comment-contains-value: 'opnfv-test' projects: @@ -87,7 +93,7 @@ - name: 'odl-netvirt-verify-virtual-create-apex-vms-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_ID=$GERRIT_CHANGE_ID @@ -95,7 +101,7 @@ GERRIT_PATCHSET_REVISION=$GERRIT_PATCHSET_REVISION NETVIRT_ARTIFACT=$NETVIRT_ARTIFACT APEX_ENV_NUMBER=$APEX_ENV_NUMBER - node-parameters: false + node-parameters: true kill-phase-on: FAILURE abort-all-job: true - multijob: @@ -105,7 +111,7 @@ - name: 'odl-netvirt-verify-virtual-install-netvirt-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_ID=$GERRIT_CHANGE_ID @@ -121,9 +127,9 @@ projects: - name: 'functest-netvirt-virtual-suite-{stream}' predefined-parameters: | - FUNCTEST_SUITE_NAME=vping_userdata,bgpvpn - RC_FILE_PATH=/home/jenkins/cloner-info/overcloudrc - DEPLOY_SCENARIO=os-odl_l2-bgpvpn-noha + DEPLOY_SCENARIO=os-odl_l3-nofeature-ha + FUNCTEST_SUITE_NAME=tempest_smoke_serial + RC_FILE_PATH=$HOME/cloner-info/overcloudrc node-parameters: true kill-phase-on: FAILURE abort-all-job: false @@ -134,7 +140,7 @@ - name: 'odl-netvirt-verify-virtual-postprocess-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_ID=$GERRIT_CHANGE_ID @@ -143,7 +149,7 @@ NETVIRT_ARTIFACT=$NETVIRT_ARTIFACT node-parameters: true kill-phase-on: FAILURE - abort-all-job: true + abort-all-job: false - job-template: name: 'odl-netvirt-verify-virtual-{phase}-{stream}' @@ -153,6 +159,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 5 @@ -161,8 +168,9 @@ - build-blocker: use-build-blocker: true blocking-jobs: - - 'odl-netvirt-verify-virtual-install-.*' - - 'odl-netvirt-verify-virtual-functest-.*' + - 'odl-netvirt-verify-virtual-create-apex-vms-.*' + - 'odl-netvirt-verify-virtual-install-netvirt-.*' + - 'functest-netvirt-virtual-suite-.*' - 'odl-netvirt-verify-virtual-postprocess-.*' block-level: 'NODE' @@ -172,13 +180,28 @@ timeout: 360 fail: true + scm: + - git: + url: https://gerrit.opnfv.org/gerrit/apex + branches: + - 'origin/master' + timeout: 15 + wipe-workspace: true + parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{slave-label}-defaults' - '{installer}-defaults' + - string: + name: DEPLOY_SCENARIO + default: 'os-odl_l2-bgpvpn-noha' + description: 'Scenario to deploy and test' + - string: + name: GS_URL + default: artifacts.opnfv.org/apex + description: "URL to Google Storage with snapshot artifacts." builders: - description-setter: @@ -191,7 +214,7 @@ name: 'netvirt-verify-create-apex-vms-builder' builders: - shell: - !include-raw: ./create-apex-vms.sh + !include-raw: ../apex/apex-snapshot-deploy.sh - builder: name: 'netvirt-verify-install-netvirt-builder' builders: @@ -200,11 +223,6 @@ - shell: !include-raw: ./install-netvirt.sh - builder: - name: 'netvirt-verify-functest-builder' - builders: - - shell: - !include-raw: ./functest-netvirt.sh -- builder: name: 'netvirt-verify-postprocess-builder' builders: - shell: diff --git a/jjb/3rd_party_ci/postprocess-netvirt.sh b/jjb/3rd_party_ci/postprocess-netvirt.sh index 5baf378a9..796514259 100755 --- a/jjb/3rd_party_ci/postprocess-netvirt.sh +++ b/jjb/3rd_party_ci/postprocess-netvirt.sh @@ -1,12 +1,8 @@ #!/bin/bash -set -e +set -o errexit +set -o nounset +set -o pipefail -if [ -z ${WORKSPACE} ]; then - echo "WORKSPACE is unset. Please do so." - exit 1 -fi -# wipe the WORKSPACE -/bin/rm -rf $WORKSPACE/* # clone opnfv sdnvpn repo git clone https://gerrit.opnfv.org/gerrit/p/sdnvpn.git $WORKSPACE/sdnvpn . $WORKSPACE/sdnvpn/odl-pipeline/odl-pipeline-common.sh diff --git a/jjb/apex/apex-build.sh b/jjb/apex/apex-build.sh index ee1dfb5d3..220d02435 100755 --- a/jjb/apex/apex-build.sh +++ b/jjb/apex/apex-build.sh @@ -12,6 +12,9 @@ echo if echo $BUILD_TAG | grep "apex-verify" 1> /dev/null; then export OPNFV_ARTIFACT_VERSION=dev${BUILD_NUMBER} export BUILD_ARGS="-r $OPNFV_ARTIFACT_VERSION -c $CACHE_DIRECTORY" +elif echo $BUILD_TAG | grep "csit" 1> /dev/null; then + export OPNFV_ARTIFACT_VERSION=csit${BUILD_NUMBER} + export BUILD_ARGS="-r $OPNFV_ARTIFACT_VERSION -c $CACHE_DIRECTORY" elif [ "$ARTIFACT_VERSION" == "daily" ]; then export OPNFV_ARTIFACT_VERSION=$(date -u +"%Y-%m-%d") export BUILD_ARGS="-r $OPNFV_ARTIFACT_VERSION -c $CACHE_DIRECTORY --iso" diff --git a/jjb/apex/apex-deploy.sh b/jjb/apex/apex-deploy.sh index 8d5c4cb13..c91e3ee82 100755 --- a/jjb/apex/apex-deploy.sh +++ b/jjb/apex/apex-deploy.sh @@ -3,7 +3,7 @@ set -o errexit set -o nounset set -o pipefail -APEX_PKGS="common undercloud onos" +APEX_PKGS="common undercloud" # removed onos for danube IPV6_FLAG=False # log info to console @@ -15,7 +15,7 @@ if ! rpm -q wget > /dev/null; then sudo yum -y install wget fi -if [[ $BUILD_DIRECTORY == *verify* ]]; then +if [[ "$BUILD_DIRECTORY" == *verify* || "$BUILD_DIRECTORY" == *promote* ]]; then # Build is from a verify, use local build artifacts (not RPMs) cd $WORKSPACE/../${BUILD_DIRECTORY} WORKSPACE=$(pwd) @@ -62,10 +62,25 @@ fi if [ -z "$DEPLOY_SCENARIO" ]; then echo "Deploy scenario not set!" exit 1 +elif [[ "$DEPLOY_SCENARIO" == *gate* ]]; then + echo "Detecting Gating scenario..." + if [ -z "$GERRIT_EVENT_COMMENT_TEXT" ]; then + echo "ERROR: Gate job triggered without comment!" + exit 1 + else + DEPLOY_SCENARIO=$(echo ${GERRIT_EVENT_COMMENT_TEXT} | grep start-gate-scenario | grep -Eo 'os-.*$') + if [ -z "$DEPLOY_SCENARIO" ]; then + echo "ERROR: Unable to detect scenario in Gerrit Comment!" + echo "Format of comment to trigger gate should be 'start-gate-scenario: <scenario>'" + exit 1 + else + echo "Gate scenario detected: ${DEPLOY_SCENARIO}" + fi + fi fi -# use local build for verify -if [[ "$BUILD_DIRECTORY" == *verify* ]]; then +# use local build for verify and promote +if [[ "$BUILD_DIRECTORY" == *verify* || "$BUILD_DIRECTORY" == *promote* ]]; then if [ ! -e "${WORKSPACE}/build/lib" ]; then ln -s ${WORKSPACE}/lib ${WORKSPACE}/build/lib fi @@ -144,7 +159,7 @@ if [ "$OPNFV_CLEAN" == 'yes' ]; then else clean_opts='' fi - if [[ "$BUILD_DIRECTORY" == *verify* ]]; then + if [[ "$BUILD_DIRECTORY" == *verify* || "$BUILD_DIRECTORY" == *promote* ]]; then sudo CONFIG=${CONFIG} LIB=${LIB} ./clean.sh ${clean_opts} else sudo CONFIG=${CONFIG} LIB=${LIB} opnfv-clean ${clean_opts} @@ -166,21 +181,19 @@ fi if [[ "$JOB_NAME" == *virtual* ]]; then # settings for virtual deployment - if [ "$IPV6_FLAG" == "True" ]; then - NETWORK_FILE="${NETWORK_SETTINGS_DIR}/network_settings_v6.yaml" - else - NETWORK_FILE="${NETWORK_SETTINGS_DIR}/network_settings.yaml" - fi DEPLOY_CMD="${DEPLOY_CMD} -v" + if [[ "${DEPLOY_SCENARIO}" =~ fdio|ovs ]]; then + DEPLOY_CMD="${DEPLOY_CMD} --virtual-default-ram 14 --virtual-compute-ram 8" + fi + if [[ "$JOB_NAME" == *csit* ]]; then + DEPLOY_CMD="${DEPLOY_CMD} -e csit-environment.yaml" + fi + if [[ "$JOB_NAME" == *promote* ]]; then + DEPLOY_CMD="${DEPLOY_CMD} --virtual-computes 2" + fi else # settings for bare metal deployment - if [ "$IPV6_FLAG" == "True" ]; then - NETWORK_FILE="/root/network/network_settings_v6.yaml" - elif [[ "$JOB_NAME" == *master* ]]; then - NETWORK_FILE="/root/network/network_settings-master.yaml" - else - NETWORK_FILE="/root/network/network_settings.yaml" - fi + NETWORK_SETTINGS_DIR="/root/network" INVENTORY_FILE="/root/inventory/pod_settings.yaml" if ! sudo test -e "$INVENTORY_FILE"; then @@ -191,6 +204,14 @@ else DEPLOY_CMD="${DEPLOY_CMD} -i ${INVENTORY_FILE}" fi +if [ "$IPV6_FLAG" == "True" ]; then + NETWORK_FILE="${NETWORK_SETTINGS_DIR}/network_settings_v6.yaml" +elif echo ${DEPLOY_SCENARIO} | grep fdio; then + NETWORK_FILE="${NETWORK_SETTINGS_DIR}/network_settings_vpp.yaml" +else + NETWORK_FILE="${NETWORK_SETTINGS_DIR}/network_settings.yaml" +fi + # Check that network settings file exists if ! sudo test -e "$NETWORK_FILE"; then echo "ERROR: Required settings file missing: Network Settings file ${NETWORK_FILE}" @@ -200,6 +221,16 @@ fi # start deployment sudo ${DEPLOY_CMD} -d ${DEPLOY_FILE} -n ${NETWORK_FILE} --debug +if [[ "$JOB_NAME" == *csit* ]]; then + echo "CSIT job: setting host route for floating ip routing" + # csit route to allow docker container to reach floating ips + UNDERCLOUD=$(sudo virsh domifaddr undercloud | grep -Eo "[0-9\.]+{3}[0-9]+") + if sudo route | grep 192.168.37.128 > /dev/null; then + sudo route del -net 192.168.37.128 netmask 255.255.255.128 + fi + sudo route add -net 192.168.37.128 netmask 255.255.255.128 gw ${UNDERCLOUD} +fi + echo echo "--------------------------------------------------------" echo "Done!" diff --git a/jjb/apex/apex-snapshot-create.sh b/jjb/apex/apex-snapshot-create.sh new file mode 100644 index 000000000..b2a39449e --- /dev/null +++ b/jjb/apex/apex-snapshot-create.sh @@ -0,0 +1,100 @@ +#!/usr/bin/env bash +############################################################################## +# Copyright (c) 2016 Tim Rozet (Red Hat) and others. +# +# All rights reserved. This program and the accompanying materials +# are made available under the terms of the Apache License, Version 2.0 +# which accompanies this distribution, and is available at +# http://www.apache.org/licenses/LICENSE-2.0 +############################################################################## + +set -o errexit +set -o nounset +set -o pipefail + +SSH_OPTIONS=(-o StrictHostKeyChecking=no -o GlobalKnownHostsFile=/dev/null -o UserKnownHostsFile=/dev/null -o LogLevel=error) +SNAP_TYPE=$(echo ${JOB_NAME} | sed -n 's/^apex-\(.\+\)-promote.*$/\1/p') + +echo "Creating Apex snapshot..." +echo "-------------------------" +echo + +# create tmp directory +tmp_dir=$(pwd)/.tmp +mkdir -p ${tmp_dir} + +# TODO(trozet) remove this after fix goes in for tripleo_inspector to copy these +pushd ${tmp_dir} > /dev/null +echo "Copying overcloudrc and ssh key from Undercloud..." +# Store overcloudrc +UNDERCLOUD=$(sudo virsh domifaddr undercloud | grep -Eo '[0-9]+\.[0-9]+\.[0-9]+\.[0-9]+') +sudo scp ${SSH_OPTIONS[@]} stack@${UNDERCLOUD}:overcloudrc ./ +# Copy out ssh key of stack from undercloud +sudo scp ${SSH_OPTIONS[@]} stack@${UNDERCLOUD}:.ssh/id_rsa ./ +popd > /dev/null + +echo "Gathering introspection information" +git clone https://gerrit.opnfv.org/gerrit/sdnvpn.git +pushd sdnvpn/odl-pipeline/lib > /dev/null +sudo ./tripleo_introspector.sh --out-file ${tmp_dir}/node.yaml +popd > /dev/null +sudo rm -rf sdnvpn + +echo "Shutting down nodes" +# Shut down nodes +nodes=$(sudo virsh list | grep -Eo "baremetal[0-9]") +for node in $nodes; do + sudo virsh shutdown ${node} --mode acpi +done + +for node in $nodes; do + count=0 + while [ "$count" -lt 10 ]; do + sleep 10 + if sudo virsh list | grep ${node}; then + echo "Waiting for $node to shutdown, try $count" + else + break + fi + count=$((count+1)) + done + + if [ "$count" -ge 10 ]; then + echo "Node $node failed to shutdown" + exit 1 + fi +done + +pushd ${tmp_dir} > /dev/null +echo "Gathering virsh definitions" +# copy qcow2s, virsh definitions +for node in $nodes; do + sudo cp -f /var/lib/libvirt/images/${node}.qcow2 ./ + sudo virsh dumpxml ${node} > ${node}.xml +done + +# copy virsh net definitions +for net in admin api external storage tenant; do + sudo virsh net-dumpxml ${net} > ${net}.xml +done + +sudo chown jenkins-ci:jenkins-ci * + +# tar up artifacts +DATE=`date +%Y-%m-%d` +tar czf ../apex-${SNAP_TYPE}-snap-${DATE}.tar.gz . +popd > /dev/null +sudo rm -rf ${tmp_dir} +echo "Snapshot saved as apex-${SNAP_TYPE}-snap-${DATE}.tar.gz" + +# update opnfv properties file +if [ "$SNAP_TYPE" == 'csit' ]; then + curl -O -L http://$GS_URL/snapshot.properties + sed -i '/^OPNFV_SNAP_URL=/{h;s#=.*#='${GS_URL}'/apex-csit-snap-'${DATE}'.tar.gz#};${x;/^$/{s##OPNFV_SNAP_URL='${GS_URL}'/apex-csit-snap-'${DATE}'.tar.gz#;H};x}' snapshot.properties + snap_sha=$(sha512sum apex-csit-snap-${DATE}.tar.gz | cut -d' ' -f1) + sed -i '/^OPNFV_SNAP_SHA512SUM=/{h;s/=.*/='${snap_sha}'/};${x;/^$/{s//OPNFV_SNAP_SHA512SUM='${snap_sha}'/;H};x}' snapshot.properties + echo "OPNFV_SNAP_URL=$GS_URL/apex-csit-snap-${DATE}.tar.gz" + echo "OPNFV_SNAP_SHA512SUM=$(sha512sum apex-csit-snap-${DATE}.tar.gz | cut -d' ' -f1)" + echo "Updated properties file: " + cat snapshot.properties +fi diff --git a/jjb/apex/apex-snapshot-deploy.sh b/jjb/apex/apex-snapshot-deploy.sh new file mode 100644 index 000000000..8274740c8 --- /dev/null +++ b/jjb/apex/apex-snapshot-deploy.sh @@ -0,0 +1,165 @@ +#!/usr/bin/env bash +############################################################################## +# Copyright (c) 2016 Tim Rozet (Red Hat) and others. +# +# All rights reserved. This program and the accompanying materials +# are made available under the terms of the Apache License, Version 2.0 +# which accompanies this distribution, and is available at +# http://www.apache.org/licenses/LICENSE-2.0 +############################################################################## + +set -o errexit +set -o nounset +set -o pipefail + +SSH_OPTIONS=(-o StrictHostKeyChecking=no -o GlobalKnownHostsFile=/dev/null -o UserKnownHostsFile=/dev/null -o LogLevel=error) +SNAP_CACHE=$HOME/snap_cache + + +echo "Deploying Apex snapshot..." +echo "--------------------------" +echo + +echo "Cleaning server" +pushd ci > /dev/null +sudo CONFIG=../build/ LIB=../lib ./clean.sh +popd > /dev/null + +echo "Downloading latest snapshot properties file" +if ! wget -O $WORKSPACE/opnfv.properties http://$GS_URL/snapshot.properties; then + echo "ERROR: Unable to find snapshot.properties at ${GS_URL}...exiting" + exit 1 +fi + +# find latest check sum +latest_snap_checksum=$(cat opnfv.properties | grep OPNFV_SNAP_SHA512SUM | awk -F "=" '{print $2}') +if [ -z "$latest_snap_checksum" ]; then + echo "ERROR: checksum of latest snapshot from snapshot.properties is null!" + exit 1 +fi + +local_snap_checksum="" + +# check snap cache directory exists +# if snapshot cache exists, find the checksum +if [ -d "$SNAP_CACHE" ]; then + latest_snap=$(ls ${SNAP_CACHE} | grep tar.gz | tail -n 1) + if [ -n "$latest_snap" ]; then + local_snap_checksum=$(sha512sum ${SNAP_CACHE}/${latest_snap} | cut -d' ' -f1) + fi +else + mkdir -p ${SNAP_CACHE} +fi + +# compare check sum and download latest snap if not up to date +if [ "$local_snap_checksum" != "$latest_snap_checksum" ]; then + snap_url=$(cat opnfv.properties | grep OPNFV_SNAP_URL | awk -F "=" '{print $2}') + if [ -z "$snap_url" ]; then + echo "ERROR: Snap URL from snapshot.properties is null!" + exit 1 + fi + echo "INFO: SHA mismatch, will download latest snapshot" + # wipe cache + rm -rf ${SNAP_CACHE}/* + wget --directory-prefix=${SNAP_CACHE}/ ${snap_url} + snap_tar=$(basename ${snap_url}) +else + snap_tar=${latest_snap} +fi + +echo "INFO: Snapshot to be used is ${snap_tar}" + +# move to snap cache dir and unpack +pushd ${SNAP_CACHE} > /dev/null +tar xvf ${snap_tar} + +# create each network +virsh_networks=$(ls *.xml | grep -v baremetal) + +if [ -z "$virsh_networks" ]; then + echo "ERROR: no virsh networks found in snapshot unpack" + exit 1 +fi + +echo "Checking overcloudrc" +if ! stat overcloudrc; then + echo "ERROR: overcloudrc does not exist in snap unpack" + exit 1 +fi + +for network_def in ${virsh_networks}; do + sudo virsh net-create ${network_def} + network=$(echo ${network_def} | awk -F '.' '{print $1}') + if ! sudo virsh net-list | grep ${network}; then + sudo virsh net-start ${network} + fi + echo "Checking if OVS bridge is missing for network: ${network}" + if ! sudo ovs-vsctl show | grep "br-${network}"; then + sudo ovs-vsctl add-br br-${network} + echo "OVS Bridge created: br-${network}" + if [ "br-${network}" == 'br-admin' ]; then + echo "Configuring IP 192.0.2.99 on br-admin" + sudo ip addr add 192.0.2.99/24 dev br-admin + sudo ip link set up dev br-admin + elif [ "br-${network}" == 'br-external' ]; then + echo "Configuring IP 192.168.37.1 on br-external" + sudo ip addr add 192.168.37.1/24 dev br-external + sudo ip link set up dev br-external + # Routes for admin network + # The overcloud controller is multi-homed and will fail to respond + # to traffic from the functest container due to reverse-path-filtering + # This route allows reverse traffic, by forcing admin network destined + # traffic through the external network for controller IPs only. + # Compute nodes have no ip on external interfaces. + controller_ips=$(cat overcloudrc | grep -Eo "192.0.2.[0-9]+") + for ip in $controller_ips; do + sudo ip route add ${ip}/32 dev br-external + done + fi + fi +done + +echo "Virsh networks up: $(sudo virsh net-list)" +echo "Bringing up Overcloud VMs..." +virsh_vm_defs=$(ls baremetal*.xml) + +if [ -z "$virsh_vm_defs" ]; then + echo "ERROR: no virsh VMs found in snapshot unpack" + exit 1 +fi + +for node_def in ${virsh_vm_defs}; do + sudo virsh define ${node_def} + node=$(echo ${node_def} | awk -F '.' '{print $1}') + sudo cp -f ${node}.qcow2 /var/lib/libvirt/images/ + sudo virsh start ${node} + echo "Node: ${node} started" +done + +# copy overcloudrc for functest +mkdir -p $HOME/cloner-info +cp -f overcloudrc $HOME/cloner-info/ + +admin_controller_ip=$(cat overcloudrc | grep -Eo -m 1 "192.0.2.[0-9]+") +netvirt_url="http://${admin_controller_ip}:8081/restconf/operational/network-topology:network-topology/topology/netvirt:1" + +source overcloudrc +counter=1 +while [ "$counter" -le 10 ]; do + if curl --fail --silent ${admin_controller_ip}:80 > /dev/null; then + echo "Overcloud Horizon is up...Checking if OpenDaylight NetVirt is up..." + if curl --fail --silent -u admin:admin ${netvirt_url} > /dev/null; then + echo "OpenDaylight is up. Overcloud deployment complete" + exit 0 + else + echo "OpenDaylight not yet up, try ${counter}" + fi + else + echo "Horizon/Apache not yet up, try ${counter}" + fi + counter=$((counter+1)) + sleep 60 +done + +echo "ERROR: Deployment not up after 10 minutes...exiting." +exit 1 diff --git a/jjb/apex/apex-upload-artifact.sh b/jjb/apex/apex-upload-artifact.sh index 64f13f4e6..c2de7d70d 100755 --- a/jjb/apex/apex-upload-artifact.sh +++ b/jjb/apex/apex-upload-artifact.sh @@ -51,13 +51,13 @@ echo "ISO Upload Complete!" RPM_INSTALL_PATH=$BUILD_DIRECTORY/noarch RPM_LIST=$RPM_INSTALL_PATH/$(basename $OPNFV_RPM_URL) VERSION_EXTENSION=$(echo $(basename $OPNFV_RPM_URL) | sed 's/opnfv-apex-//') -for pkg in common undercloud onos; do +for pkg in common undercloud; do # removed onos for danube RPM_LIST+=" ${RPM_INSTALL_PATH}/opnfv-apex-${pkg}-${VERSION_EXTENSION}" done SRPM_INSTALL_PATH=$BUILD_DIRECTORY SRPM_LIST=$SRPM_INSTALL_PATH/$(basename $OPNFV_SRPM_URL) VERSION_EXTENSION=$(echo $(basename $OPNFV_SRPM_URL) | sed 's/opnfv-apex-//') -for pkg in common undercloud onos; do +for pkg in common undercloud; do # removed onos for danube SRPM_LIST+=" ${SRPM_INSTALL_PATH}/opnfv-apex-${pkg}-${VERSION_EXTENSION}" done } @@ -73,7 +73,20 @@ gsutil cp $WORKSPACE/opnfv.properties gs://$GS_URL/opnfv-$OPNFV_ARTIFACT_VERSION gsutil cp $WORKSPACE/opnfv.properties gs://$GS_URL/latest.properties > gsutil.latest.log } -if gpg2 --list-keys | grep "opnfv-helpdesk@rt.linuxfoundation.org"; then +uploadsnap () { + # Uploads snapshot artifact and updated properties file + echo "Uploading snapshot artifacts" + SNAP_TYPE=$(echo ${JOB_NAME} | sed -n 's/^apex-\(.\+\)-promote.*$/\1/p') + gsutil cp $WORKSPACE/apex-${SNAP_TYPE}-snap-`date +%Y-%m-%d`.tar.gz gs://$GS_URL/ > gsutil.iso.log + if [ "$SNAP_TYPE" == 'csit' ]; then + gsutil cp $WORKSPACE/snapshot.properties gs://$GS_URL/snapshot.properties > gsutil.latest.log + fi + echo "Upload complete for Snapshot" +} + +if echo $WORKSPACE | grep promote > /dev/null; then + uploadsnap +elif gpg2 --list-keys | grep "opnfv-helpdesk@rt.linuxfoundation.org"; then echo "Signing Key avaliable" signiso uploadiso diff --git a/jjb/apex/apex.yml b/jjb/apex/apex.yml index 5c1bded4c..9ce83316b 100644 --- a/jjb/apex/apex.yml +++ b/jjb/apex/apex.yml @@ -2,6 +2,7 @@ name: apex jobs: - 'apex-verify-{stream}' + - 'apex-verify-gate-{stream}' - 'apex-verify-unit-tests-{stream}' - 'apex-runner-{platform}-{scenario}-{stream}' - 'apex-runner-cperf-{stream}' @@ -9,9 +10,8 @@ - 'apex-deploy-virtual-{scenario}-{stream}' - 'apex-deploy-baremetal-{scenario}-{stream}' - 'apex-daily-{stream}' - - 'apex-daily-colorado' - - 'apex-build-colorado' - - 'apex-deploy-baremetal-os-odl_l2-fdio-ha-colorado' + - 'apex-csit-promote-daily-{stream}' + - 'apex-fdio-promote-daily-{stream}' # stream: branch with - in place of / (eg. stable-arno) # branch: branch (eg. stable/arno) @@ -22,6 +22,12 @@ slave: 'lf-pod1' verify-slave: 'apex-verify-master' daily-slave: 'apex-daily-master' + - danube: + branch: 'stable/danube' + gs-pathname: '/danube' + slave: 'lf-pod1' + verify-slave: 'apex-verify-master' + daily-slave: 'apex-daily-master' project: 'apex' @@ -32,16 +38,22 @@ - 'os-nosdn-ovs-noha' - 'os-nosdn-fdio-noha' - 'os-nosdn-fdio-ha' + - 'os-nosdn-kvm-ha' + - 'os-nosdn-kvm-noha' + - 'os-odl_l2-fdio-noha' - 'os-odl_l2-fdio-ha' - 'os-odl_l2-netvirt_gbp_fdio-noha' - 'os-odl_l2-sfc-noha' - 'os-odl_l3-nofeature-ha' - - 'os-odl_l3-bgpvpn-ha' + - 'os-odl-bgpvpn-ha' + - 'os-odl-gluon-noha' - 'os-odl_l3-fdio-noha' - 'os-odl_l3-fdio-ha' - 'os-odl_l3-fdio_dvr-noha' - 'os-odl_l3-fdio_dvr-ha' + - 'os-odl_l3-csit-noha' - 'os-onos-nofeature-ha' + - 'gate' platform: - 'baremetal' @@ -60,7 +72,6 @@ gs-pathname: '{gs-pathname}' - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - string: name: GIT_BASE @@ -93,6 +104,7 @@ - compare-type: ANT pattern: 'tests/**' properties: + - logrotate-default - throttle: max-per-node: 1 max-total: 10 @@ -114,7 +126,6 @@ gs-pathname: '{gs-pathname}' - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - string: name: GIT_BASE @@ -154,6 +165,7 @@ pattern: 'config/**' properties: + - logrotate-default - build-blocker: use-build-blocker: true block-level: 'NODE' @@ -172,7 +184,7 @@ - 'apex-unit-test' - 'apex-build' - trigger-builds: - - project: 'apex-deploy-virtual-os-nosdn-nofeature-ha-{stream}' + - project: 'apex-deploy-virtual-os-odl_l3-nofeature-ha-{stream}' predefined-parameters: | BUILD_DIRECTORY=apex-verify-{stream} OPNFV_CLEAN=yes @@ -182,22 +194,87 @@ - trigger-builds: - project: 'functest-apex-{verify-slave}-suite-{stream}' predefined-parameters: | - DEPLOY_SCENARIO=os-nosdn-nofeature-ha + DEPLOY_SCENARIO=os-odl_l3-nofeature-ha FUNCTEST_SUITE_NAME=healthcheck block: true same-node: true + - 'apex-workspace-cleanup' + +# Verify Scenario Gate +- job-template: + name: 'apex-verify-gate-{stream}' + + node: '{verify-slave}' + + concurrent: true + + parameters: + - apex-parameter: + gs-pathname: '{gs-pathname}' + - project-parameter: + project: '{project}' + branch: '{branch}' + - string: + name: GIT_BASE + default: https://gerrit.opnfv.org/gerrit/$PROJECT + description: "Used for overriding the GIT URL coming from parameters macro." + + scm: + - git-scm-gerrit + + triggers: + - gerrit: + server-name: 'gerrit.opnfv.org' + trigger-on: + - comment-added-contains-event: + comment-contains-value: '^Patch Set [0-9]+: Code-Review\+2.*start-gate-scenario:.*' + projects: + - project-compare-type: 'ANT' + project-pattern: 'apex' + branches: + - branch-compare-type: 'ANT' + branch-pattern: '**/{branch}' + file-paths: + - compare-type: ANT + pattern: 'ci/**' + - compare-type: ANT + pattern: 'build/**' + - compare-type: ANT + pattern: 'lib/**' + - compare-type: ANT + pattern: 'config/**' + + properties: + - logrotate-default + - build-blocker: + use-build-blocker: true + block-level: 'NODE' + blocking-jobs: + - 'apex-daily.*' + - 'apex-deploy.*' + - 'apex-build.*' + - 'apex-runner.*' + - 'apex-verify.*' + - throttle: + max-per-node: 1 + max-total: 10 + option: 'project' + + builders: + - 'apex-build' - trigger-builds: - - project: 'apex-deploy-virtual-os-odl_l3-nofeature-ha-{stream}' + - project: 'apex-deploy-virtual-gate-{stream}' predefined-parameters: | - BUILD_DIRECTORY=apex-verify-{stream} + BUILD_DIRECTORY=apex-verify-gate-{stream} OPNFV_CLEAN=yes + current-parameters: true git-revision: false block: true same-node: true - trigger-builds: - project: 'functest-apex-{verify-slave}-suite-{stream}' predefined-parameters: | - DEPLOY_SCENARIO=os-odl_l3-nofeature-ha + DEPLOY_SCENARIO=os-nosdn-nofeature-ha FUNCTEST_SUITE_NAME=healthcheck block: true same-node: true @@ -217,7 +294,6 @@ gs-pathname: '{gs-pathname}' - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - string: name: GIT_BASE @@ -228,11 +304,13 @@ - git-scm properties: + - logrotate-default - build-blocker: use-build-blocker: true blocking-jobs: - 'apex-daily.*' - 'apex-verify.*' + - 'apex-.*-promote.*' builders: - trigger-builds: @@ -274,7 +352,6 @@ gs-pathname: '{gs-pathname}' - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - string: name: GIT_BASE @@ -285,6 +362,7 @@ - git-scm properties: + - logrotate-default - build-blocker: use-build-blocker: false block-level: 'NODE' @@ -327,10 +405,9 @@ parameters: - project-parameter: project: '{project}' + branch: '{branch}' - apex-parameter: gs-pathname: '{gs-pathname}' - - gerrit-parameter: - branch: '{branch}' - string: name: GIT_BASE default: https://gerrit.opnfv.org/gerrit/$PROJECT @@ -340,6 +417,7 @@ - git-scm properties: + - logrotate-default - build-blocker: use-build-blocker: true block-level: 'NODE' @@ -382,7 +460,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - apex-parameter: gs-pathname: '{gs-pathname}' @@ -396,6 +473,7 @@ description: "Use yes in lower case to invoke clean. Indicates if the deploy environment should be cleaned before deployment" properties: + - logrotate-default - build-blocker: use-build-blocker: true block-level: 'NODE' @@ -428,7 +506,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - apex-parameter: gs-pathname: '{gs-pathname}' @@ -438,6 +515,7 @@ description: "Scenario to deploy with." properties: + - logrotate-default - build-blocker: use-build-blocker: true block-level: 'NODE' @@ -470,12 +548,12 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - apex-parameter: gs-pathname: '{gs-pathname}' properties: + - logrotate-default - build-blocker: use-build-blocker: true block-level: 'NODE' @@ -484,6 +562,7 @@ - 'apex-deploy.*' - 'apex-build.*' - 'apex-runner.*' + - 'apex-.*-promote.*' triggers: - 'apex-{stream}' @@ -525,6 +604,23 @@ build-step-failure-threshold: 'never' failure-threshold: 'never' unstable-threshold: 'FAILURE' + # 1.dovetail only master by now, not sync with A/B/C branches + # 2.here the stream means the SUT stream, dovetail stream is defined in its own job + # 3.only debug testsuite here(includes basic testcase, + # i.e. one tempest smoke ipv6, two vping from functest) + # 4.not used for release criteria or compliance, + # only to debug the dovetail tool bugs with apex + - trigger-builds: + - project: 'dovetail-apex-{slave}-debug-{stream}' + current-parameters: false + predefined-parameters: + DEPLOY_SCENARIO=os-nosdn-nofeature-ha + block: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' - trigger-builds: - project: 'apex-deploy-baremetal-os-odl_l3-nofeature-ha-{stream}' predefined-parameters: | @@ -555,64 +651,167 @@ build-step-failure-threshold: 'never' failure-threshold: 'never' unstable-threshold: 'FAILURE' + - trigger-builds: + - project: 'apex-deploy-baremetal-os-odl-bgpvpn-ha-{stream}' + predefined-parameters: | + BUILD_DIRECTORY=apex-build-{stream}/.build + OPNFV_CLEAN=yes + git-revision: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + block: true + - trigger-builds: + - project: 'functest-apex-{daily-slave}-daily-{stream}' + predefined-parameters: + DEPLOY_SCENARIO=os-odl-bgpvpn-ha + block: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' + - trigger-builds: + - project: 'yardstick-apex-{slave}-daily-{stream}' + predefined-parameters: + DEPLOY_SCENARIO=os-odl-bgpvpn-ha + block: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' + - trigger-builds: + - project: 'apex-deploy-baremetal-os-odl-gluon-noha-{stream}' + predefined-parameters: | + BUILD_DIRECTORY=apex-build-{stream}/.build + OPNFV_CLEAN=yes + git-revision: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + block: true + - trigger-builds: + - project: 'functest-apex-{daily-slave}-daily-{stream}' + predefined-parameters: + DEPLOY_SCENARIO=os-odl-gluon-noha + block: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' + - trigger-builds: + - project: 'yardstick-apex-{slave}-daily-{stream}' + predefined-parameters: + DEPLOY_SCENARIO=os-odl-gluon-noha + block: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' + - trigger-builds: + - project: 'apex-deploy-baremetal-os-odl_l2-fdio-noha-{stream}' + predefined-parameters: | + BUILD_DIRECTORY=apex-build-{stream}/.build + OPNFV_CLEAN=yes + git-revision: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + block: true + - trigger-builds: + - project: 'functest-apex-{daily-slave}-daily-{stream}' + predefined-parameters: + DEPLOY_SCENARIO=os-odl_l2-fdio-noha + block: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' + - trigger-builds: + - project: 'yardstick-apex-{slave}-daily-{stream}' + predefined-parameters: + DEPLOY_SCENARIO=os-odl_l2-fdio-noha + block: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' + - trigger-builds: + - project: 'apex-deploy-baremetal-os-odl_l2-fdio-ha-{stream}' + predefined-parameters: | + BUILD_DIRECTORY=apex-build-{stream}/.build + OPNFV_CLEAN=yes + git-revision: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + block: true + - trigger-builds: + - project: 'functest-apex-{daily-slave}-daily-{stream}' + predefined-parameters: + DEPLOY_SCENARIO=os-odl_l2-fdio-ha + block: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' + - trigger-builds: + - project: 'yardstick-apex-{slave}-daily-{stream}' + predefined-parameters: + DEPLOY_SCENARIO=os-odl_l2-fdio-ha + block: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' + - trigger-builds: + - project: 'apex-deploy-baremetal-os-nosdn-kvm-ha-{stream}' + predefined-parameters: | + BUILD_DIRECTORY=apex-build-{stream}/.build + OPNFV_CLEAN=yes + git-revision: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + block: true + - trigger-builds: + - project: 'functest-apex-{daily-slave}-daily-{stream}' + predefined-parameters: + DEPLOY_SCENARIO=os-nosdn-kvm-ha + block: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' + - trigger-builds: + - project: 'yardstick-apex-{slave}-daily-{stream}' + predefined-parameters: + DEPLOY_SCENARIO=os-nosdn-kvm-ha + block: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' - -# Colorado Build -- job-template: - name: 'apex-build-colorado' - - # Job template for builds - # - # Required Variables: - # stream: branch with - in place of / (eg. stable) - # branch: branch (eg. stable) - node: 'apex-daily-colorado' - - disabled: false - - concurrent: true - - parameters: - - project-parameter: - project: '{project}' - - apex-parameter: - gs-pathname: '/colorado' - - gerrit-parameter: - branch: 'stable/colorado' - - string: - name: GIT_BASE - default: https://gerrit.opnfv.org/gerrit/$PROJECT - description: "Used for overriding the GIT URL coming from parameters macro." - - scm: - - git-scm - - properties: - - build-blocker: - use-build-blocker: true - block-level: 'NODE' - blocking-jobs: - - 'apex-deploy.*' - - throttle: - max-per-node: 1 - max-total: 10 - option: 'project' - - builders: - - 'apex-build' - - 'apex-upload-artifact' - - -# Colorado FDIO Deploy +# CSIT promote - job-template: - name: 'apex-deploy-baremetal-os-odl_l2-fdio-ha-colorado' + name: 'apex-csit-promote-daily-{stream}' - # Job template for baremetal deployment + # Job template for promoting CSIT Snapshots # # Required Variables: # stream: branch with - in place of / (eg. stable) # branch: branch (eg. stable) - node: 'lf-pod1' + node: '{daily-slave}' disabled: false @@ -622,14 +821,9 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: - branch: 'stable/colorado' + branch: '{branch}' - apex-parameter: - gs-pathname: '/colorado' - - string: - name: DEPLOY_SCENARIO - default: 'os-odl_l2-fdio-ha' - description: "Scenario to deploy with." + gs-pathname: '{gs-pathname}' properties: - build-blocker: @@ -639,22 +833,44 @@ - 'apex-verify.*' - 'apex-deploy.*' - 'apex-build.*' + - 'apex-runner.*' + - 'apex-daily.*' + triggers: + - timed: '0 12 * * 0' builders: - - 'apex-deploy' - - 'apex-workspace-cleanup' + - 'apex-build' + - trigger-builds: + - project: 'apex-deploy-virtual-os-odl_l3-csit-noha-{stream}' + predefined-parameters: | + BUILD_DIRECTORY=apex-csit-promote-daily-{stream} + OPNFV_CLEAN=yes + git-revision: false + block: true + same-node: true + - trigger-builds: + - project: 'functest-apex-{daily-slave}-suite-{stream}' + predefined-parameters: | + DEPLOY_SCENARIO=os-odl_l3-nofeature-noha + FUNCTEST_SUITE_NAME=tempest_smoke_serial + block: true + same-node: true + - shell: + !include-raw-escape: ./apex-snapshot-create.sh + - shell: + !include-raw-escape: ./apex-upload-artifact.sh -# Colorado FDIO Daily +# FDIO promote - job-template: - name: 'apex-daily-colorado' + name: 'apex-fdio-promote-daily-{stream}' - # Job template for daily build + # Job template for promoting CSIT Snapshots # # Required Variables: # stream: branch with - in place of / (eg. stable) # branch: branch (eg. stable) - node: 'apex-daily-colorado' + node: '{daily-slave}' disabled: false @@ -664,10 +880,9 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: - branch: 'stable/colorado' + branch: '{branch}' - apex-parameter: - gs-pathname: '/colorado' + gs-pathname: '{gs-pathname}' properties: - build-blocker: @@ -678,37 +893,22 @@ - 'apex-deploy.*' - 'apex-build.*' - 'apex-runner.*' - - triggers: - - 'apex-colorado' + - 'apex-daily.*' builders: + - 'apex-build' - trigger-builds: - - project: 'apex-build-colorado' - git-revision: true - current-parameters: true - same-node: true - block: true - - trigger-builds: - - project: 'apex-deploy-baremetal-os-odl_l2-fdio-ha-colorado' + - project: 'apex-deploy-virtual-os-odl_l2-fdio-noha-{stream}' predefined-parameters: | - BUILD_DIRECTORY=apex-build-colorado/.build + BUILD_DIRECTORY=apex-fdio-promote-daily-{stream} OPNFV_CLEAN=yes - git-revision: true - same-node: true - block-thresholds: - build-step-failure-threshold: 'never' - block: true - - trigger-builds: - - project: 'functest-apex-apex-daily-colorado-daily-colorado' - predefined-parameters: - DEPLOY_SCENARIO=os-odl_l2-fdio-ha + git-revision: false block: true same-node: true - block-thresholds: - build-step-failure-threshold: 'never' - failure-threshold: 'never' - unstable-threshold: 'FAILURE' + - shell: + !include-raw-escape: ./apex-snapshot-create.sh + - shell: + !include-raw-escape: ./apex-upload-artifact.sh - job-template: name: 'apex-gs-clean-{stream}' @@ -724,6 +924,7 @@ parameters: - project-parameter: project: '{project}' + branch: '{branch}' - apex-parameter: gs-pathname: '{gs-pathname}' @@ -815,9 +1016,9 @@ - trigger: name: 'apex-master' triggers: - - timed: '0 3 * * *' + - timed: '0 3 * * 7' - trigger: - name: 'apex-colorado' + name: 'apex-danube' triggers: - timed: '0 12 * * *' - trigger: diff --git a/jjb/armband/armband-ci-jobs.yml b/jjb/armband/armband-ci-jobs.yml index 4e88678b4..4cb58d916 100644 --- a/jjb/armband/armband-ci-jobs.yml +++ b/jjb/armband/armband-ci-jobs.yml @@ -104,6 +104,7 @@ concurrent: false properties: + - logrotate-default - throttle: enabled: true max-total: 4 @@ -125,6 +126,7 @@ parameters: - project-parameter: project: '{project}' + branch: '{branch}' - '{installer}-defaults' - '{slave-label}-defaults': installer: '{installer}' @@ -188,6 +190,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 4 @@ -203,7 +206,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{installer}-defaults' - '{slave-label}-defaults': diff --git a/jjb/armband/armband-deploy.sh b/jjb/armband/armband-deploy.sh index 4df9acfd8..adabfcaeb 100755 --- a/jjb/armband/armband-deploy.sh +++ b/jjb/armband/armband-deploy.sh @@ -8,7 +8,6 @@ # which accompanies this distribution, and is available at # http://www.apache.org/licenses/LICENSE-2.0 ############################################################################## -set -o errexit set -o nounset set -o pipefail @@ -49,8 +48,8 @@ mkdir -p $TMPDIR cd $WORKSPACE if [[ $LAB_CONFIG_URL =~ ^(git|ssh):// ]]; then - echo "Cloning securedlab repo ${GIT_BRANCH##origin/}" - git clone --quiet --branch ${GIT_BRANCH##origin/} $LAB_CONFIG_URL lab-config + echo "Cloning securedlab repo $BRANCH" + git clone --quiet --branch $BRANCH $LAB_CONFIG_URL lab-config LAB_CONFIG_URL=file://${WORKSPACE}/lab-config # Source local_env if present, which contains POD-specific config @@ -73,7 +72,7 @@ FUEL_LOG_FILENAME="${JOB_NAME}_${BUILD_NUMBER}.log.tar.gz" # Deploy Cache (to enable just create the deploy-cache subdir) # NOTE: Only available when ISO files are cached using ISOSTORE mechanism -DEPLOY_CACHE=${ISOSTORE:-/iso_mount/opnfv_ci}/${GIT_BRANCH##*/}/deploy-cache +DEPLOY_CACHE=${ISOSTORE:-/iso_mount/opnfv_ci}/${BRANCH##*/}/deploy-cache if [[ -d "${DEPLOY_CACHE}" ]]; then echo "Deploy cache dir present." echo "--------------------------------------------------------" diff --git a/jjb/armband/armband-download-artifact.sh b/jjb/armband/armband-download-artifact.sh index ed7897b8e..e2dd097b6 100755 --- a/jjb/armband/armband-download-artifact.sh +++ b/jjb/armband/armband-download-artifact.sh @@ -38,7 +38,7 @@ ISO_FILE=${WORKSPACE}/opnfv.iso # using ISOs for verify & merge jobs from local storage will be enabled later if [[ ! "$JOB_NAME" =~ (verify|merge) ]]; then # check if we already have the ISO to avoid redownload - ISOSTORE=${ISOSTORE:-/iso_mount/opnfv_ci}/${GIT_BRANCH##*/} + ISOSTORE=${ISOSTORE:-/iso_mount/opnfv_ci}/${BRANCH##*/} if [[ -f "$ISOSTORE/$OPNFV_ARTIFACT" ]]; then echo "ISO exists locally. Skipping the download and using the file from ISO store" ln -s $ISOSTORE/$OPNFV_ARTIFACT ${ISO_FILE} diff --git a/jjb/armband/armband-project-jobs.yml b/jjb/armband/armband-project-jobs.yml index 981f509c7..fd37c5af6 100644 --- a/jjb/armband/armband-project-jobs.yml +++ b/jjb/armband/armband-project-jobs.yml @@ -30,6 +30,7 @@ concurrent: false properties: + - logrotate-default - throttle: enabled: true max-total: 1 @@ -39,9 +40,8 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - - 'opnfv-build-arm-defaults' + - 'opnfv-build-enea-defaults' - '{installer}-defaults' - armband-project-parameter: gs-pathname: '{gs-pathname}' diff --git a/jjb/armband/armband-verify-jobs.yml b/jjb/armband/armband-verify-jobs.yml index d5333eb07..3486718e4 100644 --- a/jjb/armband/armband-verify-jobs.yml +++ b/jjb/armband/armband-verify-jobs.yml @@ -21,13 +21,13 @@ ##################################### phase: - 'basic': - slave-label: 'opnfv-build-arm' + slave-label: 'opnfv-build-enea' - 'build': - slave-label: 'opnfv-build-arm' + slave-label: 'opnfv-build-enea' - 'deploy-virtual': - slave-label: 'opnfv-build-arm' + slave-label: 'opnfv-build-enea' - 'smoke-test': - slave-label: 'opnfv-build-arm' + slave-label: 'opnfv-build-enea' ##################################### # jobs ##################################### @@ -47,6 +47,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 4 @@ -93,9 +94,8 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - - 'opnfv-build-arm-defaults' + - 'opnfv-build-enea-defaults' - 'armband-verify-defaults': gs-pathname: '{gs-pathname}' @@ -109,7 +109,7 @@ - name: 'armband-verify-basic-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -123,7 +123,7 @@ - name: 'armband-verify-build-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -137,7 +137,7 @@ - name: 'armband-verify-deploy-virtual-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -151,7 +151,7 @@ - name: 'armband-verify-smoke-test-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -167,6 +167,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 6 @@ -189,7 +190,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{slave-label}-defaults' - '{installer}-defaults' diff --git a/jjb/armband/build.sh b/jjb/armband/build.sh index a058ca158..a71cf1112 100755 --- a/jjb/armband/build.sh +++ b/jjb/armband/build.sh @@ -96,6 +96,7 @@ ls -al $BUILD_DIRECTORY echo "OPNFV_GIT_URL=$(git config --get remote.origin.url)" echo "OPNFV_GIT_SHA1=$(git rev-parse HEAD)" echo "OPNFV_ARTIFACT_URL=$GS_URL/opnfv-$OPNFV_ARTIFACT_VERSION.iso" + echo "OPNFV_ARTIFACT_SHA512SUM=$(sha512sum $BUILD_DIRECTORY/opnfv-$OPNFV_ARTIFACT_VERSION.iso | cut -d' ' -f1)" echo "OPNFV_BUILD_URL=$BUILD_URL" ) > $WORKSPACE/opnfv.properties diff --git a/jjb/armband/upload-artifacts.sh b/jjb/armband/upload-artifacts.sh index 7059ac344..97987e2c5 100755 --- a/jjb/armband/upload-artifacts.sh +++ b/jjb/armband/upload-artifacts.sh @@ -28,7 +28,7 @@ if [[ ! "$JOB_NAME" =~ (verify|merge) ]]; then # store ISO locally on NFS first ISOSTORE=${ISOSTORE:-/iso_mount/opnfv_ci} if [[ -d "$ISOSTORE" ]]; then - ISOSTORE=${ISOSTORE}/${GIT_BRANCH##*/} + ISOSTORE=${ISOSTORE}/${BRANCH##*/} mkdir -p $ISOSTORE # remove all but most recent 3 ISOs first to keep iso_mount clean & tidy diff --git a/jjb/availability/availability.yml b/jjb/availability/availability.yml index c3603a65f..9cb7f8899 100644 --- a/jjb/availability/availability.yml +++ b/jjb/availability/availability.yml @@ -28,7 +28,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' diff --git a/jjb/barometer/barometer.yml b/jjb/barometer/barometer.yml index e789b7f7a..6a17e1706 100644 --- a/jjb/barometer/barometer.yml +++ b/jjb/barometer/barometer.yml @@ -30,7 +30,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' @@ -77,6 +76,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 3 @@ -86,7 +86,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' @@ -128,6 +127,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 3 @@ -137,7 +137,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' diff --git a/jjb/bottlenecks/bottlenecks-ci-jobs.yml b/jjb/bottlenecks/bottlenecks-ci-jobs.yml index 92ec2d866..2779e316b 100644 --- a/jjb/bottlenecks/bottlenecks-ci-jobs.yml +++ b/jjb/bottlenecks/bottlenecks-ci-jobs.yml @@ -72,6 +72,8 @@ suite: - 'rubbos' - 'vstf' + - 'posca_stress_traffic' + - 'posca_stress_ping' jobs: - 'bottlenecks-{installer}-{suite}-{pod}-daily-{stream}' @@ -95,7 +97,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{slave-label}-defaults' - '{installer}-defaults' @@ -137,65 +138,14 @@ - builder: name: bottlenecks-env-cleanup builders: - - shell: | - #!/bin/bash - set -e - [[ $GERRIT_REFSPEC_DEBUG == true ]] && redirect="/dev/stdout" || redirect="/dev/null" - - echo "Bottlenecks: docker containers/images cleaning up" - if [[ ! -z $(docker ps -a | grep opnfv/bottlenecks) ]]; then - echo "removing existing opnfv/bottlenecks containers" - docker ps -a | grep opnfv/bottlenecks | awk '{print $1}' | xargs docker rm -f >$redirect - fi - - if [[ ! -z $(docker images | grep opnfv/bottlenecks) ]]; then - echo "Bottlenecks: docker images to remove:" - docker images | head -1 && docker images | grep opnfv/bottlenecks - image_tags=($(docker images | grep opnfv/bottlenecks | awk '{print $2}')) - for tag in "${image_tags[@]}"; do - echo "Removing docker image opnfv/bottlenecks:$tag..." - docker rmi opnfv/bottlenecks:$tag >$redirect - done - fi + - shell: + !include-raw: ./bottlenecks-cleanup.sh - builder: name: bottlenecks-run-suite builders: - - shell: | - #!/bin/bash - set -e - [[ $GERRIT_REFSPEC_DEBUG == true ]] && redirect="/dev/stdout" || redirect="/dev/null" - - echo "Bottlenecks: to pull image opnfv/bottlenecks:${DOCKER_TAG}" - docker pull opnfv/bottlenecks:$DOCKER_TAG >${redirect} - - echo "Bottlenecks: docker start running" - opts="--privileged=true -id" - envs="-e INSTALLER_TYPE=${INSTALLER_TYPE} -e INSTALLER_IP=${INSTALLER_IP} \ - -e NODE_NAME=${NODE_NAME} -e EXTERNAL_NET=${EXTERNAL_NETWORK} \ - -e BOTTLENECKS_BRANCH=${BOTTLENECKS_BRANCH} -e GERRIT_REFSPEC_DEBUG=${GERRIT_REFSPEC_DEBUG} \ - -e BOTTLENECKS_DB_TARGET=${BOTTLENECKS_DB_TARGET} -e PACKAGE_URL=${PACKAGE_URL}" - cmd="sudo docker run ${opts} ${envs} opnfv/bottlenecks:${DOCKER_TAG} /bin/bash" - echo "Bottlenecks: docker cmd running ${cmd}" - ${cmd} >${redirect} - - echo "Bottlenecks: obtain docker id" - container_id=$(docker ps | grep "opnfv/bottlenecks:${DOCKER_TAG}" | awk '{print $1}' | head -1) - if [ -z ${container_id} ]; then - echo "Cannot find opnfv/bottlenecks container ID ${container_id}. Please check if it exists." - docker ps -a - exit 1 - fi - - echo "Bottlenecks: to prepare openstack environment" - prepare_env="${REPO_DIR}/ci/prepare_env.sh" - echo "Bottlenecks: docker cmd running: ${prepare_env}" - sudo docker exec ${container_id} ${prepare_env} - - echo "Bottlenecks: to run testsuite ${SUITE_NAME}" - run_testsuite="${REPO_DIR}/run_tests.sh -s ${SUITE_NAME}" - echo "Bottlenecks: docker cmd running: ${run_testsuite}" - sudo docker exec ${container_id} ${run_testsuite} + - shell: + !include-raw: ./bottlenecks-run-suite.sh #################### # parameter macros diff --git a/jjb/bottlenecks/bottlenecks-cleanup.sh b/jjb/bottlenecks/bottlenecks-cleanup.sh new file mode 100644 index 000000000..0ba042318 --- /dev/null +++ b/jjb/bottlenecks/bottlenecks-cleanup.sh @@ -0,0 +1,111 @@ +#!/bin/bash +set -e +[[ $GERRIT_REFSPEC_DEBUG == true ]] && redirect="/dev/stdout" || redirect="/dev/null" + +BOTTLENECKS_IMAGE=opnfv/bottlenecks +echo "Bottlenecks: docker containers/images cleaning up" + +dangling_images=($(docker images -f "dangling=true" | grep $BOTTLENECKS_IMAGE | awk '{print $3}')) +if [[ -n $dangling_images ]]; then + echo "Removing $BOTTLENECKS_IMAGE:<none> dangling images and their containers" + docker images | head -1 && docker images | grep $dangling_images + for image_id in "${dangling_images[@]}"; do + echo "Bottlenecks: Removing dangling image $image_id" + docker rmi -f $image_id >${redirect} + done +fi + +for image_id in "${dangling_images[@]}"; do + if [[ -n $(docker ps -a | grep $image_id) ]]; then + echo "Bottlenecks: Removing containers associated with dangling image: $image_id" + docker ps -a | head -1 && docker ps -a | grep $image_id + docker ps -a | grep $image_id | awk '{print $1}'| xargs docker rm -f >${redirect} + fi +done + +if [[ -n $(docker ps -a | grep $BOTTLENECKS_IMAGE) ]]; then + echo "Removing existing $BOTTLENECKS_IMAGE containers" + docker ps -a | grep $BOTTLENECKS_IMAGE | awk '{print $1}' | xargs docker rm -f >$redirect +fi + +if [[ -n $(docker images | grep $BOTTLENECKS_IMAGE) ]]; then + echo "Bottlenecks: docker images to remove:" + docker images | head -1 && docker images | grep $BOTTLENECKS_IMAGE + image_tags=($(docker images | grep $BOTTLENECKS_IMAGE | awk '{print $2}')) + for tag in "${image_tags[@]}"; do + echo "Removing docker image $BOTTLENECKS_IMAGE:$tag..." + docker rmi $BOTTLENECKS_IMAGE:$tag >$redirect + done +fi + +echo "Yardstick: docker containers/images cleaning up" +YARDSTICK_IMAGE=opnfv/yardstick + +dangling_images=($(docker images -f "dangling=true" | grep $YARDSTICK_IMAGE | awk '{print $3}')) +if [[ -n $dangling_images ]]; then + echo "Removing $YARDSTICK_IMAGE:<none> dangling images and their containers" + docker images | head -1 && docker images | grep $dangling_images + for image_id in "${dangling_images[@]}"; do + echo "Yardstick: Removing dangling image $image_id" + docker rmi -f $image_id >${redirect} + done +fi + +for image_id in "${dangling_images[@]}"; do + if [[ -n $(docker ps -a | grep $image_id) ]]; then + echo "Yardstick: Removing containers associated with dangling image: $image_id" + docker ps -a | head -1 && docker ps -a | grep $image_id + docker ps -a | grep $image_id | awk '{print $1}'| xargs docker rm -f >${redirect} + fi +done + +if [[ -n $(docker ps -a | grep $YARDSTICK_IMAGE) ]]; then + echo "Removing existing $YARDSTICK_IMAGE containers" + docker ps -a | grep $YARDSTICK_IMAGE | awk '{print $1}' | xargs docker rm -f >$redirect +fi + +if [[ -n $(docker images | grep $YARDSTICK_IMAGE) ]]; then + echo "Yardstick: docker images to remove:" + docker images | head -1 && docker images | grep $YARDSTICK_IMAGE + image_tags=($(docker images | grep $YARDSTICK_IMAGE | awk '{print $2}')) + for tag in "${image_tags[@]}"; do + echo "Removing docker image $YARDSTICK_IMAGE:$tag..." + docker rmi $YARDSTICK_IMAGE:$tag >$redirect + done +fi + +echo "InfluxDB: docker containers/images cleaning up" +INFLUXDB_IMAGE=tutum/influxdb + +dangling_images=($(docker images -f "dangling=true" | grep $INFLUXDB_IMAGE | awk '{print $3}')) +if [[ -n $dangling_images ]]; then + echo "Removing $INFLUXDB_IMAGE:<none> dangling images and their containers" + docker images | head -1 && docker images | grep $dangling_images + for image_id in "${dangling_images[@]}"; do + echo "InfluxDB: Removing dangling image $image_id" + docker rmi -f $image_id >${redirect} + done +fi + +for image_id in "${dangling_images[@]}"; do + if [[ -n $(docker ps -a | grep $image_id) ]]; then + echo "InfluxDB: Removing containers associated with dangling image: $image_id" + docker ps -a | head -1 && docker ps -a | grep $image_id + docker ps -a | grep $image_id | awk '{print $1}'| xargs docker rm -f >${redirect} + fi +done + +if [[ -n $(docker ps -a | grep $INFLUXDB_IMAGE) ]]; then + echo "Removing existing $INFLUXDB_IMAGE containers" + docker ps -a | grep $INFLUXDB_IMAGE | awk '{print $1}' | xargs docker rm -f >$redirect +fi + +if [[ -n $(docker images | grep $INFLUXDB_IMAGE) ]]; then + echo "InfluxDB: docker images to remove:" + docker images | head -1 && docker images | grep $INFLUXDB_IMAGE + image_tags=($(docker images | grep $INFLUXDB_IMAGE | awk '{print $2}')) + for tag in "${image_tags[@]}"; do + echo "Removing docker image $INFLUXDB_IMAGE:$tag..." + docker rmi $INFLUXDB_IMAGE:$tag >$redirect + done +fi
\ No newline at end of file diff --git a/jjb/bottlenecks/bottlenecks-project-jobs.yml b/jjb/bottlenecks/bottlenecks-project-jobs.yml index 03e40dc0e..a0abb9331 100644 --- a/jjb/bottlenecks/bottlenecks-project-jobs.yml +++ b/jjb/bottlenecks/bottlenecks-project-jobs.yml @@ -29,6 +29,8 @@ suite: - 'rubbos' - 'vstf' + - 'posca_stress_traffic' + - 'posca_stress_ping' ################################ # job templates @@ -42,7 +44,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' @@ -80,7 +81,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' @@ -114,6 +114,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 1 @@ -123,7 +124,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' - bottlenecks-parameter: diff --git a/jjb/bottlenecks/bottlenecks-run-suite.sh b/jjb/bottlenecks/bottlenecks-run-suite.sh new file mode 100644 index 000000000..f69463fc2 --- /dev/null +++ b/jjb/bottlenecks/bottlenecks-run-suite.sh @@ -0,0 +1,65 @@ +#!/bin/bash +#set -e +[[ $GERRIT_REFSPEC_DEBUG == true ]] && redirect="/dev/stdout" || redirect="/dev/null" +BOTTLENECKS_IMAGE=opnfv/bottlenecks + +if [[ $SUITE_NAME == rubbos || $SUITE_NAME == vstf ]]; then + echo "Bottlenecks: to pull image $BOTTLENECKS_IMAGE:${DOCKER_TAG}" + docker pull $BOTTLENECKS_IMAGE:$DOCKER_TAG >${redirect} + + echo "Bottlenecks: docker start running" + opts="--privileged=true -id" + envs="-e INSTALLER_TYPE=${INSTALLER_TYPE} -e INSTALLER_IP=${INSTALLER_IP} \ + -e NODE_NAME=${NODE_NAME} -e EXTERNAL_NET=${EXTERNAL_NETWORK} \ + -e BOTTLENECKS_BRANCH=${BOTTLENECKS_BRANCH} -e GERRIT_REFSPEC_DEBUG=${GERRIT_REFSPEC_DEBUG} \ + -e BOTTLENECKS_DB_TARGET=${BOTTLENECKS_DB_TARGET} -e PACKAGE_URL=${PACKAGE_URL}" + cmd="sudo docker run ${opts} ${envs} $BOTTLENECKS_IMAGE:${DOCKER_TAG} /bin/bash" + echo "Bottlenecks: docker cmd running ${cmd}" + ${cmd} >${redirect} + + echo "Bottlenecks: obtain docker id" + container_id=$(docker ps | grep "$BOTTLENECKS_IMAGE:${DOCKER_TAG}" | awk '{print $1}' | head -1) + if [ -z ${container_id} ]; then + echo "Cannot find $BOTTLENECKS_IMAGE container ID ${container_id}. Please check if it exists." + docker ps -a + exit 1 + fi + + echo "Bottlenecks: to prepare openstack environment" + prepare_env="${REPO_DIR}/ci/prepare_env.sh" + echo "Bottlenecks: docker cmd running: ${prepare_env}" + sudo docker exec ${container_id} ${prepare_env} + + echo "Bottlenecks: to run testsuite ${SUITE_NAME}" + run_testsuite="${REPO_DIR}/run_tests.sh -s ${SUITE_NAME}" + echo "Bottlenecks: docker cmd running: ${run_testsuite}" + sudo docker exec ${container_id} ${run_testsuite} +else + echo "Bottlenecks: installing POSCA docker-compose" + if [ -d usr/local/bin/docker-compose ]; then + rm -rf usr/local/bin/docker-compose + fi + curl -L https://github.com/docker/compose/releases/download/1.11.0/docker-compose-`uname -s`-`uname -m` > /usr/local/bin/docker-compose + chmod +x /usr/local/bin/docker-compose + + echo "Bottlenecks: composing up dockers" + cd $WORKSPACE + docker-compose -f $WORKSPACE/docker/bottleneck-compose/docker-compose.yml up -d + + echo "Bottlenecks: running traffic stress/factor testing in posca testsuite " + POSCA_SCRIPT=/home/opnfv/bottlenecks/testsuites/posca + if [[ $SUITE_NAME == posca_stress_traffic ]]; then + TEST_CASE=posca_factor_system_bandwidth + echo "Bottlenecks: pulling tutum/influxdb for yardstick" + docker pull tutum/influxdb:0.13 + sleep 5 + docker exec bottleneckcompose_bottlenecks_1 python ${POSCA_SCRIPT}/run_posca.py testcase $TEST_CASE + elif [[ $SUITE_NAME == posca_stress_ping ]]; then + TEST_CASE=posca_stress_ping + sleep 5 + docker exec bottleneckcompose_bottlenecks_1 python ${POSCA_SCRIPT}/run_posca.py testcase $TEST_CASE + fi + + echo "Bottlenecks: cleaning up docker-compose images and dockers" + docker-compose -f $WORKSPACE/docker/bottleneck-compose/docker-compose.yml down --rmi all +fi
\ No newline at end of file diff --git a/jjb/compass4nfv/compass-ci-jobs.yml b/jjb/compass4nfv/compass-ci-jobs.yml index 8800a155f..5ccd4b56f 100644 --- a/jjb/compass4nfv/compass-ci-jobs.yml +++ b/jjb/compass4nfv/compass-ci-jobs.yml @@ -41,8 +41,8 @@ #-------------------------------- # master #-------------------------------- - - huawei-pod5: - slave-label: '{pod}' + - baremetal-centos: + slave-label: 'intel-pod8' os-version: 'centos7' <<: *master @@ -71,6 +71,10 @@ - 'os-nosdn-kvm-ha': disabled: false auto-trigger-name: 'compass-{scenario}-{pod}-{stream}-trigger' + - 'os-nosdn-openo-ha': + disabled: false + auto-trigger-name: 'compass-{scenario}-{pod}-{stream}-trigger' + jobs: - 'compass-{scenario}-{pod}-daily-{stream}' @@ -87,6 +91,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-per-node: 1 @@ -106,6 +111,7 @@ parameters: - project-parameter: project: '{project}' + branch: '{branch}' - compass-ci-parameter: installer: '{installer}' gs-pathname: '{gs-pathname}' @@ -173,6 +179,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-per-node: 1 @@ -194,7 +201,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - compass-ci-parameter: installer: '{installer}' @@ -218,12 +224,6 @@ - shell: !include-raw-escape: ./compass-deploy.sh - publishers: - - archive: - artifacts: 'ansible.log' - allow-empty: 'true' - fingerprint: true - ######################## # parameter macros ######################## @@ -247,35 +247,39 @@ # trigger macros ######################## - trigger: - name: 'compass-os-nosdn-nofeature-ha-huawei-pod5-master-trigger' + name: 'compass-os-nosdn-nofeature-ha-baremetal-centos-master-trigger' triggers: - timed: '0 19 * * *' - trigger: - name: 'compass-os-odl_l2-nofeature-ha-huawei-pod5-master-trigger' + name: 'compass-os-nosdn-openo-ha-baremetal-centos-master-trigger' + triggers: + - timed: '' +- trigger: + name: 'compass-os-odl_l2-nofeature-ha-baremetal-centos-master-trigger' triggers: - timed: '0 23 * * *' - trigger: - name: 'compass-os-odl_l3-nofeature-ha-huawei-pod5-master-trigger' + name: 'compass-os-odl_l3-nofeature-ha-baremetal-centos-master-trigger' triggers: - timed: '0 15 * * *' - trigger: - name: 'compass-os-onos-nofeature-ha-huawei-pod5-master-trigger' + name: 'compass-os-onos-nofeature-ha-baremetal-centos-master-trigger' triggers: - timed: '0 7 * * *' - trigger: - name: 'compass-os-ocl-nofeature-ha-huawei-pod5-master-trigger' + name: 'compass-os-ocl-nofeature-ha-baremetal-centos-master-trigger' triggers: - timed: '0 11 * * *' - trigger: - name: 'compass-os-onos-sfc-ha-huawei-pod5-master-trigger' + name: 'compass-os-onos-sfc-ha-baremetal-centos-master-trigger' triggers: - timed: '0 3 * * *' - trigger: - name: 'compass-os-odl_l2-moon-ha-huawei-pod5-master-trigger' + name: 'compass-os-odl_l2-moon-ha-baremetal-centos-master-trigger' triggers: - timed: '' - trigger: - name: 'compass-os-nosdn-kvm-ha-huawei-pod5-master-trigger' + name: 'compass-os-nosdn-kvm-ha-baremetal-centos-master-trigger' triggers: - timed: '' @@ -284,6 +288,10 @@ triggers: - timed: '0 2 * * *' - trigger: + name: 'compass-os-nosdn-openo-ha-baremetal-master-trigger' + triggers: + - timed: '0 3 * * *' +- trigger: name: 'compass-os-odl_l2-nofeature-ha-baremetal-master-trigger' triggers: - timed: '0 22 * * *' @@ -317,6 +325,10 @@ triggers: - timed: '' - trigger: + name: 'compass-os-nosdn-openo-ha-baremetal-danube-trigger' + triggers: + - timed: '' +- trigger: name: 'compass-os-odl_l2-nofeature-ha-baremetal-danube-trigger' triggers: - timed: '' @@ -350,6 +362,10 @@ triggers: - timed: '0 21 * * *' - trigger: + name: 'compass-os-nosdn-openo-ha-virtual-master-trigger' + triggers: + - timed: '0 22 * * *' +- trigger: name: 'compass-os-odl_l2-nofeature-ha-virtual-master-trigger' triggers: - timed: '0 20 * * *' @@ -383,6 +399,10 @@ triggers: - timed: '0 21 * * *' - trigger: + name: 'compass-os-nosdn-openo-ha-virtual-danube-trigger' + triggers: + - timed: '0 22 * * *' +- trigger: name: 'compass-os-odl_l2-nofeature-ha-virtual-danube-trigger' triggers: - timed: '0 20 * * *' diff --git a/jjb/compass4nfv/compass-deploy.sh b/jjb/compass4nfv/compass-deploy.sh index f89d04e6d..534e17e62 100644 --- a/jjb/compass4nfv/compass-deploy.sh +++ b/jjb/compass4nfv/compass-deploy.sh @@ -34,6 +34,8 @@ if [[ "${DEPLOY_SCENARIO}" =~ "-ocl" ]]; then export NETWORK_CONF_FILE=network_ocl.yml elif [[ "${DEPLOY_SCENARIO}" =~ "-onos" ]]; then export NETWORK_CONF_FILE=network_onos.yml +elif [[ "${DEPLOY_SCENARIO}" =~ "-openo" ]]; then + export NETWORK_CONF_FILE=network_openo.yml else export NETWORK_CONF_FILE=network.yml fi @@ -65,7 +67,4 @@ echo echo "--------------------------------------------------------" echo "Done!" -ssh_options="-o UserKnownHostsFile=/dev/null -o StrictHostKeyChecking=no" -sshpass -p root scp 2>/dev/null $ssh_options root@${INSTALLER_IP}:/var/ansible/run/openstack_${OPENSTACK_VERSION}-opnfv2/ansible.log ./ &> /dev/null - exit $deploy_ret diff --git a/jjb/compass4nfv/compass-dovetail-jobs.yml b/jjb/compass4nfv/compass-dovetail-jobs.yml new file mode 100644 index 000000000..d49d0ec5f --- /dev/null +++ b/jjb/compass4nfv/compass-dovetail-jobs.yml @@ -0,0 +1,208 @@ +- project: + + name: 'compass-dovetail-jobs' + installer: 'compass' + project: 'compass4nfv' +#---------------------------------- +# BRANCH ANCHORS +#---------------------------------- + colorado: &colorado + stream: colorado + branch: 'stable/{stream}' + gs-pathname: '/{stream}' + disabled: false + dovetail-branch: master +#------------------------------------ +# POD, INSTALLER, AND BRANCH MAPPING +#------------------------------------ +# CI PODs +#------------------------------------ + pod: + - baremetal: + slave-label: compass-baremetal + os-version: 'trusty' + <<: *colorado +#----------------------------------- +# scenarios +#----------------------------------- + scenario: + - 'os-nosdn-nofeature-ha': + disabled: false + auto-trigger-name: 'compass-{scenario}-{pod}-weekly-{stream}-trigger' + + jobs: + - 'compass-{scenario}-{pod}-weekly-{stream}' + - 'compass-deploy-{pod}-weekly-{stream}' + +######################## +# job templates +######################## +- job-template: + name: 'compass-{scenario}-{pod}-weekly-{stream}' + + disabled: '{obj:disabled}' + + concurrent: false + + properties: + - build-blocker: + use-build-blocker: true + blocking-jobs: + - 'compass-os-.*?-{pod}-daily-.*?' + - 'compass-os-.*?-{pod}-weekly-.*?' + block-level: 'NODE' + + wrappers: + - build-name: + name: '$BUILD_NUMBER - Scenario: $DEPLOY_SCENARIO' + + triggers: + - '{auto-trigger-name}' + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - compass-dovetail-parameter: + installer: '{installer}' + gs-pathname: '{gs-pathname}' + - string: + name: DEPLOY_SCENARIO + default: '{scenario}' + - '{slave-label}-defaults' + - '{installer}-defaults' + + triggers: + - '{auto-trigger-name}' + + builders: + - description-setter: + description: "POD: $NODE_NAME" + - trigger-builds: + - project: 'compass-deploy-{pod}-weekly-{stream}' + current-parameters: false + predefined-parameters: | + DEPLOY_SCENARIO={scenario} + COMPASS_OS_VERSION={os-version} + same-node: true + block: true + - trigger-builds: + - project: 'dovetail-compass-{pod}-compliance_set-weekly-{stream}' + current-parameters: false + predefined-parameters: + DEPLOY_SCENARIO={scenario} + block: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' + - trigger-builds: + - project: 'dovetail-compass-{pod}-debug-weekly-{stream}' + current-parameters: false + predefined-parameters: + DEPLOY_SCENARIO={scenario} + block: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' + - trigger-builds: + - project: 'dovetail-compass-{pod}-proposed_tests-weekly-{stream}' + current-parameters: false + predefined-parameters: + DEPLOY_SCENARIO={scenario} + block: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' + +- job-template: + name: 'compass-deploy-{pod}-weekly-{stream}' + + disabled: false + + concurrent: true + + properties: + - logrotate-default + - throttle: + enabled: true + max-total: 4 + max-per-node: 1 + option: 'project' + - build-blocker: + use-build-blocker: true + blocking-jobs: + - 'compass-deploy-{pod}-daily-.*?' + - 'compass-deploy-{pod}-weekly-.*' + - 'compass-verify-deploy-.*?' + block-level: 'NODE' + + wrappers: + - build-name: + name: '$BUILD_NUMBER - Scenario: $DEPLOY_SCENARIO' + - timeout: + timeout: 120 + abort: true + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - compass-dovetail-parameter: + installer: '{installer}' + gs-pathname: '{gs-pathname}' + - '{slave-label}-defaults' + - '{installer}-defaults' + + scm: + - git-scm + + wrappers: + - build-name: + name: '$BUILD_NUMBER - Scenario: $DEPLOY_SCENARIO' + + + builders: + - description-setter: + description: "POD: $NODE_NAME" + - shell: + !include-raw-escape: ./compass-download-artifact.sh + - shell: + !include-raw-escape: ./compass-deploy.sh + +######################## +# parameter macros +######################## +- parameter: + name: compass-dovetail-parameter + parameters: + - string: + name: BUILD_DIRECTORY + default: $WORKSPACE/build_output + description: "Directory where the build artifact will be located upon the completion of the build." + - string: + name: GS_URL + default: '$GS_BASE{gs-pathname}' + description: "URL to Google Storage." + - choice: + name: COMPASS_OPENSTACK_VERSION + choices: + - 'mitaka' + +######################## +# trigger macros +######################## +- trigger: + name: 'compass-os-nosdn-nofeature-ha-baremetal-weekly-colorado-trigger' + triggers: + - timed: 'H H * * 0' + +- trigger: + name: 'dovetail-weekly-trigger' + triggers: + - timed: 'H H * * 0' diff --git a/jjb/compass4nfv/compass-project-jobs.yml b/jjb/compass4nfv/compass-project-jobs.yml index 6b4080384..ed0fee6c0 100644 --- a/jjb/compass4nfv/compass-project-jobs.yml +++ b/jjb/compass4nfv/compass-project-jobs.yml @@ -33,6 +33,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 1 @@ -42,7 +43,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - compass-project-parameter: installer: '{installer}' @@ -76,6 +76,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 1 @@ -85,7 +86,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - compass-project-parameter: installer: '{installer}' diff --git a/jjb/compass4nfv/compass-verify-jobs.yml b/jjb/compass4nfv/compass-verify-jobs.yml index 6ef5fbb67..039b30a69 100644 --- a/jjb/compass4nfv/compass-verify-jobs.yml +++ b/jjb/compass4nfv/compass-verify-jobs.yml @@ -22,6 +22,10 @@ disabled: false os-version: 'xenial' openstack-os-version: '' + - 'centos7': + disabled: false + os-version: 'centos7' + openstack-os-version: '' ##################################### # patch verification phases ##################################### @@ -47,6 +51,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 4 @@ -98,7 +103,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'compass-virtual-defaults' - '{installer}-defaults' @@ -121,6 +125,11 @@ node-parameters: true kill-phase-on: FAILURE abort-all-job: true + - name: 'opnfv-yamllint-verify-{stream}' + current-parameters: true + node-parameters: true + kill-phase-on: FAILURE + abort-all-job: true - multijob: name: deploy-virtual condition: SUCCESSFUL @@ -159,6 +168,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-per-node: 1 @@ -185,11 +195,6 @@ description: "Built on $NODE_NAME" - '{project}-verify-{phase}-macro' - publishers: - - archive: - artifacts: 'ansible.log' - allow-empty: 'true' - fingerprint: true ##################################### # builder macros ##################################### @@ -240,3 +245,4 @@ name: COMPASS_OS_VERSION choices: - 'xenial' + - 'centos7' diff --git a/jjb/conductor/conductor.yml b/jjb/conductor/conductor.yml index fccd53e7f..1d47624e1 100644 --- a/jjb/conductor/conductor.yml +++ b/jjb/conductor/conductor.yml @@ -28,7 +28,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' diff --git a/jjb/copper/copper.yml b/jjb/copper/copper.yml index 24f65a358..e380fd555 100644 --- a/jjb/copper/copper.yml +++ b/jjb/copper/copper.yml @@ -28,7 +28,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' @@ -60,4 +59,9 @@ builders: - shell: | - echo "Nothing to verify!" + #!/bin/bash + set -o errexit + set -o nounset + set -o pipefail + + # shellcheck -f tty tests/*.sh diff --git a/jjb/cperf/cperf-ci-jobs.yml b/jjb/cperf/cperf-ci-jobs.yml index 4ffc3b013..125937e80 100644 --- a/jjb/cperf/cperf-ci-jobs.yml +++ b/jjb/cperf/cperf-ci-jobs.yml @@ -42,6 +42,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-per-node: 1 @@ -57,7 +58,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{pod}-defaults' - '{installer}-defaults' diff --git a/jjb/daisy4nfv/daisy-daily-jobs.yml b/jjb/daisy4nfv/daisy-daily-jobs.yml new file mode 100644 index 000000000..ffae70f8f --- /dev/null +++ b/jjb/daisy4nfv/daisy-daily-jobs.yml @@ -0,0 +1,199 @@ +# jenkins job templates for Daisy +# TODO +# [ ] enable baremetal jobs after baremetal deployment finish +# [ ] enable jobs in danuble +# [ ] add more scenarios +# [ ] integration with yardstick + +- project: + + name: 'daisy' + project: '{name}' + installer: '{name}' + +#-------------------------------- +# BRANCH ANCHORS +#-------------------------------- + master: &master + stream: master + branch: '{stream}' + disabled: false + gs-pathname: '' +#-------------------------------- +# POD, INSTALLER, AND BRANCH MAPPING +#-------------------------------- +# CI PODs +#-------------------------------- + pod: + - baremetal: + slave-label: daisy-baremetal + <<: *master + - virtual: + slave-label: daisy-virtual + <<: *master +#-------------------------------- +# None-CI PODs +#-------------------------------- + +#-------------------------------- +# scenarios +#-------------------------------- + scenario: + # HA scenarios + - 'os-nosdn-nofeature-ha': + auto-trigger-name: 'daisy-{scenario}-{pod}-daily-{stream}-trigger' + # NOHA scenarios + - 'os-nosdn-nofeature-noha': + auto-trigger-name: 'daisy-{scenario}-{pod}-daily-{stream}-trigger' + + jobs: + - '{project}-{scenario}-{pod}-daily-{stream}' + - '{project}-deploy-{pod}-daily-{stream}' + +######################## +# job templates +######################## +- job-template: + name: '{project}-{scenario}-{pod}-daily-{stream}' + + disabled: '{obj:disabled}' + + concurrent: false + + properties: + - logrotate-default + - throttle: + enabled: true + max-total: 4 + max-per-node: 1 + option: 'project' + - build-blocker: + use-build-blocker: true + blocking-jobs: + - 'daisy.*-deploy-({pod})?-daily-.*' + block-level: 'NODE' + + wrappers: + - build-name: + name: '$BUILD_NUMBER - Scenario: $DEPLOY_SCENARIO' + + triggers: + - '{auto-trigger-name}' + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - '{installer}-defaults' + - '{slave-label}-defaults': + installer: '{installer}' + - string: + name: DEPLOY_SCENARIO + default: '{scenario}' + - 'daisy-project-parameter': + gs-pathname: '{gs-pathname}' + + builders: + - description-setter: + description: "POD: $NODE_NAME" + - trigger-builds: + - project: 'daisy-deploy-{pod}-daily-{stream}' + current-parameters: false + predefined-parameters: + DEPLOY_SCENARIO={scenario} + same-node: true + block: true + - trigger-builds: + - project: 'functest-daisy-{pod}-daily-{stream}' + current-parameters: false + predefined-parameters: + DEPLOY_SCENARIO={scenario} + same-node: true + block: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' + +- job-template: + name: '{project}-deploy-{pod}-daily-{stream}' + + disabled: '{obj:disabled}' + + concurrent: true + + properties: + - logrotate-default + - throttle: + enabled: true + max-total: 4 + max-per-node: 1 + option: 'project' + - build-blocker: + use-build-blocker: true + blocking-jobs: + - 'daisy.*-deploy-({pod})?-daily-.*' + block-level: 'NODE' + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - '{installer}-defaults' + - '{slave-label}-defaults': + installer: '{installer}' + - string: + name: DEPLOY_SCENARIO + default: 'os-nosdn-nofeature-ha' + - 'daisy-project-parameter': + gs-pathname: '{gs-pathname}' + - string: + name: DEPLOY_TIMEOUT + default: '150' + description: 'Deployment timeout in minutes' + + scm: + - git-scm + + wrappers: + - build-name: + name: '$BUILD_NUMBER - Scenario: $DEPLOY_SCENARIO' + + builders: + - description-setter: + description: "POD: $NODE_NAME" + - shell: + !include-raw-escape: ./daisy4nfv-download-artifact.sh + - shell: + !include-raw-escape: ./daisy-deploy.sh + + +######################## +# trigger macros +######################## +#----------------------------------------------- +# Triggers for job running on daisy-baremetal against master branch +#----------------------------------------------- +# HA Scenarios +- trigger: + name: 'daisy-os-nosdn-nofeature-ha-baremetal-daily-master-trigger' + triggers: + - timed: '' +# NOHA Scenarios +- trigger: + name: 'daisy-os-nosdn-nofeature-noha-baremetal-daily-master-trigger' + triggers: + - timed: '' +#----------------------------------------------- +# Triggers for job running on daisy-virtual against master branch +#----------------------------------------------- +- trigger: + name: 'daisy-os-nosdn-nofeature-ha-virtual-daily-master-trigger' + triggers: + - timed: '' +# NOHA Scenarios +- trigger: + name: 'daisy-os-nosdn-nofeature-noha-virtual-daily-master-trigger' + triggers: + - timed: 'H 8,22 * * *' + diff --git a/jjb/daisy4nfv/daisy-deploy.sh b/jjb/daisy4nfv/daisy-deploy.sh new file mode 100755 index 000000000..b512e3f60 --- /dev/null +++ b/jjb/daisy4nfv/daisy-deploy.sh @@ -0,0 +1,63 @@ +#!/bin/bash +set -o nounset +set -o pipefail + +echo "--------------------------------------------------------" +echo "This is $INSTALLER_TYPE deploy job!" +echo "--------------------------------------------------------" + +DEPLOY_SCENARIO=${DEPLOY_SCENARIO:-"os-nosdn-nofeature-ha"} +BRIDGE=${BRIDGE:-pxebr} +LAB_NAME=${NODE_NAME/-*} +POD_NAME=${NODE_NAME/*-} +deploy_ret=0 + +if [[ ! "$NODE_NAME" =~ "-virtual" ]] && [[ ! "$LAB_NAME" =~ (zte) ]]; then + echo "Unsupported lab $LAB_NAME for now, Cannot continue!" + exit $deploy_ret +fi + +# clone the securedlab repo +cd $WORKSPACE +BASE_DIR=$(cd ./;pwd) + +echo "Cloning securedlab repo $BRANCH" +git clone ssh://jenkins-zte@gerrit.opnfv.org:29418/securedlab --quiet \ + --branch $BRANCH + +# daisy ci/deploy/deploy.sh use $BASE_DIR/labs dir +cp -r securedlab/labs . + +DEPLOY_COMMAND="sudo ./ci/deploy/deploy.sh -b $BASE_DIR \ + -l $LAB_NAME -p $POD_NAME -B $BRIDGE" + +# log info to console +echo """ +Deployment parameters +-------------------------------------------------------- +Scenario: $DEPLOY_SCENARIO +LAB: $LAB_NAME +POD: $POD_NAME +BRIDGE: $BRIDGE +BASE_DIR: $BASE_DIR + +Starting the deployment using $INSTALLER_TYPE. This could take some time... +-------------------------------------------------------- +Issuing command +$DEPLOY_COMMAND +""" + +# start the deployment +$DEPLOY_COMMAND + +if [ $? -ne 0 ]; then + echo + echo "Depolyment failed!" + deploy_ret=1 +else + echo + echo "--------------------------------------------------------" + echo "Deployment done!" +fi + +exit $deploy_ret diff --git a/jjb/daisy4nfv/daisy-project-jobs.yml b/jjb/daisy4nfv/daisy-project-jobs.yml new file mode 100644 index 000000000..0127ed094 --- /dev/null +++ b/jjb/daisy4nfv/daisy-project-jobs.yml @@ -0,0 +1,232 @@ +###################################################################### +# Add daily jobs, for buidoing, deploying and testing +# TODO: +# - [ ] Add yardstick and functest for test stage +# - [x] Use daisy-baremetal-defauls for choosing baremetal deployment +###################################################################### + +############################# +# Job configuration for daisy +############################# +- project: + name: daisy-project-jobs + + project: 'daisy' + + installer: 'daisy' + + stream: + - master: + branch: '{stream}' + gs-pathname: '' + disabled: false + - danube: + branch: 'stable/{stream}' + gs-pathname: '/{stream}' + disabled: true + + phase: + - 'build': + slave-label: 'opnfv-build-centos' + - 'deploy': + slave-label: 'daisy-baremetal' + - 'test': + slave-label: 'opnfv-build-centos' + jobs: + - '{installer}-daily-{stream}' + - '{installer}-{phase}-daily-{stream}' + +######################## +# job templates +######################## +- job-template: + name: '{installer}-daily-{stream}' + + project-type: multijob + + disabled: false + + concurrent: true + + properties: + - logrotate-default + - throttle: + enabled: true + max-total: 4 + option: 'project' + + scm: + - git-scm + + triggers: + - timed: '0 H/8 * * *' + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - 'opnfv-build-centos-defaults' + - 'daisy-defaults' + - '{installer}-project-parameter': + gs-pathname: '{gs-pathname}' + + wrappers: + - ssh-agent-wrapper + - timeout: + timeout: 360 + fail: true + + builders: + - description-setter: + description: "Built on $NODE_NAME" + - multijob: + name: build + condition: SUCCESSFUL + projects: + - name: '{installer}-build-daily-{stream}' + current-parameters: false + predefined-parameters: | + BRANCH=$BRANCH + GERRIT_REFSPEC=$GERRIT_REFSPEC + GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER + GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE + node-parameters: false + kill-phase-on: FAILURE + abort-all-job: true + - multijob: + name: deploy + condition: SUCCESSFUL + projects: + - name: '{installer}-deploy-daily-{stream}' + current-parameters: false + predefined-parameters: | + BRANCH=$BRANCH + GERRIT_REFSPEC=$GERRIT_REFSPEC + GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER + GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE + node-parameters: false + kill-phase-on: FAILURE + abort-all-job: true + - multijob: + name: test + condition: SUCCESSFUL + projects: + - name: '{installer}-test-daily-{stream}' + current-parameters: false + predefined-parameters: | + BRANCH=$BRANCH + GERRIT_REFSPEC=$GERRIT_REFSPEC + GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER + GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE + node-parameters: false + kill-phase-on: FAILURE + abort-all-job: true + + publishers: + - '{installer}-recipients' + +- job-template: + name: '{installer}-{phase}-daily-{stream}' + + disabled: '{obj:disabled}' + + concurrent: true + + properties: + - logrotate-default + - throttle: + enabled: true + max-total: 6 + option: 'project' + - build-blocker: + use-build-blocker: true + blocking-jobs: + - '{installer}-.*deploy-.*' + block-level: 'NODE' + + scm: + - git-scm + + wrappers: + - ssh-agent-wrapper + - timeout: + timeout: 360 + fail: true + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - 'daisy-defaults' + - string: + name: GIT_BASE + default: https://gerrit.opnfv.org/gerrit/$PROJECT + description: 'Git URL to use on this Jenkins Slave' + - string: + name: DEPLOY_SCENARIO + default: 'os-nosdn-nofeature-ha' + - 'daisy-defaults' + - '{slave-label}-defaults' + - '{installer}-project-parameter': + gs-pathname: '{gs-pathname}' + + builders: + - description-setter: + description: "Built on $NODE_NAME" + - '{installer}-{phase}-daily-macro' + +##################################### +# builder macros +##################################### +- builder: + name: 'daisy-build-daily-macro' + builders: + - shell: + !include-raw: ./daisy4nfv-basic.sh + - shell: + !include-raw: ./daisy4nfv-build.sh + - shell: + !include-raw: ./daisy4nfv-upload-artifact.sh + - shell: + !include-raw: ./daisy4nfv-workspace-cleanup.sh + +- builder: + name: 'daisy-deploy-daily-macro' + builders: + - shell: + !include-raw: ./daisy4nfv-download-artifact.sh + - shell: + !include-raw: ./daisy-deploy.sh + +- builder: + name: 'daisy-test-daily-macro' + builders: + - shell: | + #!/bin/bash + + echo "Not activated!" + +##################################### +# parameter macros +##################################### +- publisher: + name: 'daisy-recipients' + publishers: + - email: + recipients: hu.zhijiang@zte.com.cn lu.yao135@zte.com.cn zhou.ya@zte.com.cn yangyang1@zte.com.cn julienjut@gmail.com + +- parameter: + name: 'daisy-project-parameter' + parameters: + - string: + name: BUILD_DIRECTORY + default: $WORKSPACE/build_output + description: "Directory where the build artifact will be located upon the completion of the build." + - string: + name: CACHE_DIRECTORY + default: $HOME/opnfv/cache/$INSTALLER_TYPE + description: "Directory where the cache to be used during the build is located." + - string: + name: GS_URL + default: artifacts.opnfv.org/$PROJECT{gs-pathname} + description: "URL to Google Storage." diff --git a/jjb/daisy4nfv/daisy4nfv-build.sh b/jjb/daisy4nfv/daisy4nfv-build.sh index eb29fed72..375d80733 100755 --- a/jjb/daisy4nfv/daisy4nfv-build.sh +++ b/jjb/daisy4nfv/daisy4nfv-build.sh @@ -26,6 +26,7 @@ cd $WORKSPACE echo "OPNFV_GIT_URL=$(git config --get remote.origin.url)" echo "OPNFV_GIT_SHA1=$(git rev-parse HEAD)" echo "OPNFV_ARTIFACT_URL=$GS_URL/opnfv-$OPNFV_ARTIFACT_VERSION.bin" + echo "OPNFV_ARTIFACT_SHA512SUM=$(sha512sum $OUTPUT_DIR/opnfv-$OPNFV_ARTIFACT_VERSION.bin | cut -d' ' -f1)" echo "OPNFV_BUILD_URL=$BUILD_URL" ) > $WORKSPACE/opnfv.properties diff --git a/jjb/daisy4nfv/daisy4nfv-download-artifact.sh b/jjb/daisy4nfv/daisy4nfv-download-artifact.sh index 90b5fa62f..1cc0443ad 100755 --- a/jjb/daisy4nfv/daisy4nfv-download-artifact.sh +++ b/jjb/daisy4nfv/daisy4nfv-download-artifact.sh @@ -12,7 +12,7 @@ set -o errexit set -o pipefail # use proxy url to replace the nomral URL, for googleusercontent.com will be blocked randomly -[[ "$NODE_NAME" =~ (zte) ]] && GS_URL=$GS_BASE_PROXY +[[ "$NODE_NAME" =~ (zte) ]] && GS_URL=${GS_BASE_PROXY%%/*}/$GS_URL if [[ "$JOB_NAME" =~ "merge" ]]; then echo "Downloading http://$GS_URL/opnfv-gerrit-$GERRIT_CHANGE_NUMBER.properties" @@ -36,6 +36,25 @@ echo "Using $OPNFV_ARTIFACT for deployment" [[ "$NODE_NAME" =~ (zte) ]] && OPNFV_ARTIFACT_URL=${GS_BASE_PROXY%%/*}/$OPNFV_ARTIFACT_URL +if [[ ! "$JOB_NAME" =~ (verify|merge) ]]; then + # check if we already have the image to avoid redownload + BINSTORE="/bin_mount/opnfv_ci/${BRANCH##*/}" + if [[ -f "$BINSTORE/$OPNFV_ARTIFACT" && ! -z $OPNFV_ARTIFACT_SHA512SUM ]]; then + echo "BIN exists locally. Starting to check the sha512sum." + if [[ $OPNFV_ARTIFACT_SHA512SUM = $(sha512sum -b $BINSTORE/$OPNFV_ARTIFACT | cut -d' ' -f1) ]]; then + echo "Sha512sum is verified. Skipping the download and using the file from BIN store." + ln -s $BINSTORE/$OPNFV_ARTIFACT $WORKSPACE/opnfv.bin + echo "--------------------------------------------------------" + echo + ls -al $WORKSPACE/opnfv.bin + echo + echo "--------------------------------------------------------" + echo "Done!" + exit 0 + fi + fi +fi + # log info to console echo "Downloading the $INSTALLER_TYPE artifact using URL http://$OPNFV_ARTIFACT_URL" echo "This could take some time..." @@ -43,7 +62,7 @@ echo "--------------------------------------------------------" echo # download the file -curl -s -o $WORKSPACE/opnfv.bin http://$OPNFV_ARTIFACT_URL > gsutil.bin.log 2>&1 +curl -L -s -o $WORKSPACE/opnfv.bin http://$OPNFV_ARTIFACT_URL > gsutil.bin.log 2>&1 # list the file ls -al $WORKSPACE/opnfv.bin diff --git a/jjb/daisy4nfv/daisy4nfv-merge-jobs.yml b/jjb/daisy4nfv/daisy4nfv-merge-jobs.yml index b7a5fec92..95d851cca 100644 --- a/jjb/daisy4nfv/daisy4nfv-merge-jobs.yml +++ b/jjb/daisy4nfv/daisy4nfv-merge-jobs.yml @@ -2,6 +2,14 @@ name: 'daisy4nfv-merge-jobs' project: 'daisy' + + installer: 'daisy' + +########################################################### +# use alias to keep the jobs'name existed already unchanged +########################################################### + alias: 'daisy4nfv' + ##################################### # branch definitions ##################################### @@ -10,31 +18,29 @@ branch: '{stream}' gs-pathname: '' disabled: false + - danube: + branch: 'stable/{stream}' + gs-pathname: '/{stream}' + disabled: true ##################################### # patch merge phases ##################################### phase: - - 'basic': - slave-label: 'opnfv-build-centos' - 'build': slave-label: 'opnfv-build-centos' - 'deploy-virtual': slave-label: 'opnfv-build-centos' - - 'smoke-test': - slave-label: 'opnfv-build-centos' - - 'promote': - slave-label: 'opnfv-build-centos' ##################################### # jobs ##################################### jobs: - - 'daisy4nfv-merge-{stream}' - - 'daisy4nfv-merge-{phase}-{stream}' + - '{alias}-merge-{stream}' + - '{alias}-merge-{phase}-{stream}' ##################################### # job templates ##################################### - job-template: - name: 'daisy4nfv-merge-{stream}' + name: '{alias}-merge-{stream}' project-type: multijob @@ -43,13 +49,14 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 4 option: 'project' scm: - - git-scm-gerrit + - git-scm wrappers: - ssh-agent-wrapper @@ -65,50 +72,44 @@ - comment-added-contains-event: comment-contains-value: 'remerge' projects: - - project-compare-type: 'ANT' - project-pattern: '{project}' - branches: - - branch-compare-type: 'ANT' - branch-pattern: '**/{branch}' - forbidden-file-paths: - - compare-type: ANT - pattern: 'docs/**|.gitignore' + - project-compare-type: 'ANT' + project-pattern: '{project}' + branches: + - branch-compare-type: 'ANT' + branch-pattern: '**/{branch}' + file-paths: + - compare-type: ANT + pattern: 'ci/**' + - compare-type: ANT + pattern: 'code/**' + - compare-type: ANT + pattern: 'deploy/**' + forbidden-file-paths: + - compare-type: ANT + pattern: 'docs/**' + - compare-type: ANT + pattern: '.gitignore' readable-message: true parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - - 'opnfv-build-defaults' - - 'daisy4nfv-merge-defaults': + - 'opnfv-build-centos-defaults' + - '{alias}-merge-defaults': gs-pathname: '{gs-pathname}' builders: - description-setter: description: "Built on $NODE_NAME" - multijob: - name: basic - condition: SUCCESSFUL - projects: - - name: 'daisy4nfv-merge-basic-{stream}' - current-parameters: false - predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH - GERRIT_REFSPEC=$GERRIT_REFSPEC - GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER - GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE - node-parameters: false - kill-phase-on: FAILURE - abort-all-job: true - - multijob: name: build condition: SUCCESSFUL projects: - - name: 'daisy4nfv-merge-build-{stream}' + - name: '{alias}-merge-build-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -119,38 +120,10 @@ name: deploy-virtual condition: SUCCESSFUL projects: - - name: 'daisy4nfv-merge-deploy-virtual-{stream}' - current-parameters: false - predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH - GERRIT_REFSPEC=$GERRIT_REFSPEC - GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER - GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE - node-parameters: false - kill-phase-on: FAILURE - abort-all-job: true - - multijob: - name: smoke-test - condition: SUCCESSFUL - projects: - - name: 'daisy4nfv-merge-smoke-test-{stream}' + - name: '{alias}-merge-deploy-virtual-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH - GERRIT_REFSPEC=$GERRIT_REFSPEC - GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER - GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE - node-parameters: false - kill-phase-on: FAILURE - abort-all-job: true - - multijob: - name: promote - condition: SUCCESSFUL - projects: - - name: 'daisy4nfv-merge-promote-{stream}' - current-parameters: false - predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -159,26 +132,26 @@ abort-all-job: true - job-template: - name: 'daisy4nfv-merge-{phase}-{stream}' + name: '{alias}-merge-{phase}-{stream}' disabled: '{obj:disabled}' concurrent: true properties: + - logrotate-default - throttle: enabled: true - max-total: 6 + max-total: 4 option: 'project' - build-blocker: use-build-blocker: true blocking-jobs: - - 'daisy4nfv-merge-deploy-.*' - - 'daisy4nfv-merge-test-.*' + - '{alias}-merge-deploy-.*' block-level: 'NODE' scm: - - git-scm-gerrit + - git-scm wrappers: - ssh-agent-wrapper @@ -189,58 +162,41 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{slave-label}-defaults' - - 'daisy4nfv-merge-defaults': + - '{alias}-merge-defaults': gs-pathname: '{gs-pathname}' builders: - description-setter: description: "Built on $NODE_NAME" - '{project}-merge-{phase}-macro' + ##################################### # builder macros ##################################### - builder: - name: 'daisy-merge-basic-macro' + name: 'daisy-merge-build-macro' builders: - shell: !include-raw: ./daisy4nfv-basic.sh - -- builder: - name: 'daisy-merge-build-macro' - builders: - shell: - !include-raw: - - ./daisy4nfv-build.sh - - ./daisy4nfv-upload-artifact.sh - - ./daisy4nfv-workspace-cleanup.sh + !include-raw: ./daisy4nfv-build.sh + - shell: + !include-raw: ./daisy4nfv-upload-artifact.sh + - shell: + !include-raw: ./daisy4nfv-workspace-cleanup.sh - builder: name: 'daisy-merge-deploy-virtual-macro' builders: - shell: - !include-raw: - - ./daisy4nfv-download-artifact.sh - - ./daisy4nfv-virtual-deploy.sh - - ./daisy4nfv-workspace-cleanup.sh - -- builder: - name: 'daisy-merge-smoke-test-macro' - builders: - - shell: | - #!/bin/bash - - echo "Not activated!" - -- builder: - name: 'daisy-merge-promote-macro' - builders: - - shell: | - #!/bin/bash + !include-raw: ./daisy4nfv-download-artifact.sh + - shell: + !include-raw: ./daisy-deploy.sh + - shell: + !include-raw: ./daisy4nfv-workspace-cleanup.sh - echo "Not activated!" ##################################### # parameter macros ##################################### diff --git a/jjb/daisy4nfv/daisy4nfv-verify-jobs.yml b/jjb/daisy4nfv/daisy4nfv-verify-jobs.yml index cba22643c..ee82c14b2 100644 --- a/jjb/daisy4nfv/daisy4nfv-verify-jobs.yml +++ b/jjb/daisy4nfv/daisy4nfv-verify-jobs.yml @@ -2,6 +2,14 @@ name: 'daisy4nfv-verify-jobs' project: 'daisy' + + installer: 'daisy' + +########################################################## +# use alias to keep the jobs'name existed alread unchanged +########################################################## + alias: 'daisy4nfv' + ##################################### # branch definitions ##################################### @@ -10,29 +18,27 @@ branch: '{stream}' gs-pathname: '' disabled: false + - danube: + branch: 'stable/{stream}' + gs-pathname: '/{stream}' + disabled: true ##################################### # patch verification phases ##################################### phase: - - 'basic': - slave-label: 'opnfv-build-centos' - 'build': slave-label: 'opnfv-build-centos' - - 'deploy-virtual': - slave-label: 'opnfv-build' - - 'smoke-test': - slave-label: 'opnfv-build' ##################################### # jobs ##################################### jobs: - - 'daisy4nfv-verify-{stream}' - - 'daisy4nfv-verify-{phase}-{stream}' + - '{alias}-verify-{stream}' + - '{alias}-verify-{phase}-{stream}' ##################################### # job templates ##################################### - job-template: - name: 'daisy4nfv-verify-{stream}' + name: '{alias}-verify-{stream}' project-type: multijob @@ -41,13 +47,14 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 4 option: 'project' scm: - - git-scm-gerrit + - git-scm wrappers: - ssh-agent-wrapper @@ -69,78 +76,44 @@ - comment-added-contains-event: comment-contains-value: 'reverify' projects: - - project-compare-type: 'ANT' - project-pattern: '{project}' - branches: - - branch-compare-type: 'ANT' - branch-pattern: '**/{branch}' - forbidden-file-paths: - - compare-type: ANT - pattern: 'docs/**|.gitignore' + - project-compare-type: 'ANT' + project-pattern: '{project}' + branches: + - branch-compare-type: 'ANT' + branch-pattern: '**/{branch}' + file-paths: + - compare-type: ANT + pattern: 'ci/**' + - compare-type: ANT + pattern: 'code/**' + - compare-type: ANT + pattern: 'deploy/**' + forbidden-file-paths: + - compare-type: ANT + pattern: 'docs/**' + - compare-type: ANT + pattern: '.gitignore' readable-message: true parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - - 'opnfv-build-defaults' - - 'daisy4nfv-verify-defaults': + - 'opnfv-build-centos-defaults' + - '{alias}-verify-defaults': gs-pathname: '{gs-pathname}' builders: - description-setter: description: "Built on $NODE_NAME" - multijob: - name: basic - condition: SUCCESSFUL - projects: - - name: 'daisy4nfv-verify-basic-{stream}' - current-parameters: false - predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH - GERRIT_REFSPEC=$GERRIT_REFSPEC - GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER - GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE - node-parameters: false - kill-phase-on: FAILURE - abort-all-job: true - - multijob: name: build condition: SUCCESSFUL projects: - - name: 'daisy4nfv-verify-build-{stream}' + - name: '{alias}-verify-build-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH - GERRIT_REFSPEC=$GERRIT_REFSPEC - GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER - GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE - node-parameters: false - kill-phase-on: FAILURE - abort-all-job: true - - multijob: - name: deploy-virtual - condition: SUCCESSFUL - projects: - - name: 'daisy4nfv-verify-deploy-virtual-{stream}' - current-parameters: false - predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH - GERRIT_REFSPEC=$GERRIT_REFSPEC - GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER - GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE - node-parameters: false - kill-phase-on: FAILURE - abort-all-job: true - - multijob: - name: smoke-test - condition: SUCCESSFUL - projects: - - name: 'daisy4nfv-verify-smoke-test-{stream}' - current-parameters: false - predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -149,13 +122,14 @@ abort-all-job: true - job-template: - name: 'daisy4nfv-verify-{phase}-{stream}' + name: '{alias}-verify-{phase}-{stream}' disabled: '{obj:disabled}' concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 6 @@ -163,12 +137,11 @@ - build-blocker: use-build-blocker: true blocking-jobs: - - 'daisy4nfv-verify-deploy-.*' - - 'daisy4nfv-verify-test-.*' + - '{alias}-verify-deploy-.*' block-level: 'NODE' scm: - - git-scm-gerrit + - git-scm wrappers: - ssh-agent-wrapper @@ -179,44 +152,29 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{slave-label}-defaults' - - 'daisy4nfv-verify-defaults': + - '{alias}-verify-defaults': gs-pathname: '{gs-pathname}' builders: - description-setter: description: "Built on $NODE_NAME" - '{project}-verify-{phase}-macro' + ##################################### # builder macros ##################################### - builder: - name: 'daisy-verify-basic-macro' + name: 'daisy-verify-build-macro' builders: - shell: !include-raw: ./daisy4nfv-basic.sh - -- builder: - name: 'daisy-verify-build-macro' - builders: - shell: !include-raw: ./daisy4nfv-build.sh - -- builder: - name: 'daisy-verify-deploy-virtual-macro' - builders: - shell: - !include-raw: ./daisy4nfv-virtual-deploy.sh - -- builder: - name: 'daisy-verify-smoke-test-macro' - builders: - - shell: | - #!/bin/bash + !include-raw: ./daisy4nfv-workspace-cleanup.sh - echo "Not activated!" ##################################### # parameter macros ##################################### diff --git a/jjb/daisy4nfv/daisy4nfv-virtual-deploy.sh b/jjb/daisy4nfv/daisy4nfv-virtual-deploy.sh deleted file mode 100755 index 4aa7b0bd5..000000000 --- a/jjb/daisy4nfv/daisy4nfv-virtual-deploy.sh +++ /dev/null @@ -1,29 +0,0 @@ -#!/bin/bash - -echo "--------------------------------------------------------" -echo "This is diasy4nfv virtual deploy job!" -echo "--------------------------------------------------------" - -cd $WORKSPACE - -if [[ "$NODE_NAME" =~ "-virtual" ]]; then - export NETWORK_CONF=./deploy/config/vm_environment/$NODE_NAME/network.yml - export DHA_CONF=./deploy/config/vm_environment/$NODE_NAME/deploy.yml -else - # TODO: For the time being, we need to pass this script to let contributors merge their work. - echo "No support for non-virtual node" - exit 0 -fi - -./ci/deploy/deploy.sh ${DHA_CONF} ${NETWORK_CONF} - -if [ $? -ne 0 ]; then - echo "depolyment failed!" - deploy_ret=1 -fi - -echo -echo "--------------------------------------------------------" -echo "Done!" - -exit $deploy_ret diff --git a/jjb/doctor/doctor.yml b/jjb/doctor/doctor.yml index ab9ef8f6c..c677ef96e 100644 --- a/jjb/doctor/doctor.yml +++ b/jjb/doctor/doctor.yml @@ -7,7 +7,7 @@ - master: branch: '{stream}' gs-pathname: '' - docker-tag: 'master' + docker-tag: 'latest' disabled: false - danube: branch: 'stable/{stream}' @@ -19,15 +19,28 @@ - apex: slave-label: 'ool-virtual1' pod: 'ool-virtual1' + - fuel: + slave-label: 'ool-virtual2' + pod: 'ool-virtual2' + #- joid: + # slave-label: 'ool-virtual3' + # pod: 'ool-virtual3' inspector: - 'sample' - 'congress' + task: + - verify: + profiler: 'none' + auto-trigger-name: 'doctor-verify' + - profiling: + profiler: 'poc' + auto-trigger-name: 'experimental' + jobs: - 'doctor-verify-{stream}' - - 'doctor-verify-{installer}-{inspector}-{stream}' - - 'doctor-profiling-{stream}' + - 'doctor-{task}-{installer}-{inspector}-{stream}' - job-template: name: 'doctor-verify-{stream}' @@ -37,7 +50,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' @@ -71,24 +83,20 @@ - shell: "[ -e tests/run.sh ] && bash -n ./tests/run.sh" - job-template: - name: 'doctor-verify-{installer}-{inspector}-{stream}' + name: 'doctor-{task}-{installer}-{inspector}-{stream}' node: '{slave-label}' parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - string: name: OS_CREDS default: /home/jenkins/openstack.creds description: 'OpenStack credentials' - '{slave-label}-defaults' - - string: - name: INSTALLER_TYPE - default: '{installer}' - description: 'Installer used for deploying OPNFV on this POD' + - '{installer}-defaults' - string: name: DOCKER_TAG default: '{docker-tag}' @@ -107,7 +115,7 @@ default: '{project}' - string: name: TESTCASE_OPTIONS - default: '-e INSPECTOR_TYPE={inspector} -v $WORKSPACE:/home/opnfv/repos/doctor' + default: '-e INSPECTOR_TYPE={inspector} -e PROFILER_TYPE={profiler} -v $WORKSPACE:/home/opnfv/repos/doctor' description: 'Addtional parameters specific to test case(s)' # functest-parameter - string: @@ -131,39 +139,22 @@ - git-scm-gerrit triggers: - - gerrit: - server-name: 'gerrit.opnfv.org' - trigger-on: - - patchset-created-event: - exclude-drafts: 'false' - exclude-trivial-rebase: 'false' - exclude-no-code-change: 'false' - - draft-published-event - - comment-added-contains-event: - comment-contains-value: 'recheck' - - comment-added-contains-event: - comment-contains-value: 'reverify' - projects: - - project-compare-type: 'ANT' - project-pattern: '{project}' - branches: - - branch-compare-type: 'ANT' - branch-pattern: '**/{branch}' - file-paths: - - compare-type: ANT - pattern: 'tests/**' - skip-vote: - successful: true - failed: true - unstable: true - notbuilt: true + - '{auto-trigger-name}': + project: '{project}' + branch: '{branch}' builders: + - 'clean-workspace-log' + - shell: | + # NOTE: Create symbolic link, so that we can archive file outside + # of $WORKSPACE . + # NOTE: We are printing all logs under 'tests/' during test run, + # so this symbolic link should not be in 'tests/'. Otherwise, + # we'll have the same log twice in jenkins console log. + ln -sfn $HOME/opnfv/functest/results/{stream} functest_results - 'functest-suite-builder' - shell: | functest_log="$HOME/opnfv/functest/results/{stream}/{project}.log" - to_be_archived="$WORKSPACE/tests/functest-{project}.log" - cp $functest_log $to_be_archived # NOTE: checking the test result, as the previous job could return # 0 regardless the result of doctor test scenario. grep -e ' OK$' $functest_log || exit 1 @@ -171,66 +162,39 @@ publishers: - archive: artifacts: 'tests/*.log' + - archive: + artifacts: 'functest_results/{project}.log' -- job-template: - name: 'doctor-profiling-{stream}' - - disabled: '{obj:disabled}' - - parameters: - - 'doctor-defaults': - project: '{project}' - branch: '{branch}' - - string: - name: PROFILER - default: poc - description: "Profiler to be used" - - scm: - - git-scm-gerrit - - triggers: - - 'experimental': - project: '{project}' - branch: '{branch}' - -##################################### -# parameter macros -##################################### -# TODO(yujunz) replace common parameter in doctor-verify-{stream} with macro -- parameter: - name: 'doctor-defaults' - parameters: - - project-parameter: - project: '{project}' - - gerrit-parameter: - branch: '{branch}' - - 'opnfv-build-ubuntu-defaults' ##################################### # trigger macros ##################################### -# TODO(yujunz) move to opnfv commom - trigger: - name: 'experimental' + name: 'doctor-verify' triggers: - gerrit: server-name: 'gerrit.opnfv.org' trigger-on: + - patchset-created-event: + exclude-drafts: 'false' + exclude-trivial-rebase: 'false' + exclude-no-code-change: 'false' + - draft-published-event + - comment-added-contains-event: + comment-contains-value: 'recheck' - comment-added-contains-event: - comment-contains-value: 'check-experimental' + comment-contains-value: 'reverify' projects: - - project-compare-type: 'ANT' - project-pattern: '{project}' - branches: - - branch-compare-type: 'ANT' - branch-pattern: '**/{branch}' - file-paths: - - compare-type: 'ANT' - pattern: 'tests/**' + - project-compare-type: 'ANT' + project-pattern: '{project}' + branches: + - branch-compare-type: 'ANT' + branch-pattern: '**/{branch}' + file-paths: + - compare-type: ANT + pattern: 'tests/**' skip-vote: successful: true failed: true unstable: true notbuilt: true - silent-start: true diff --git a/jjb/domino/domino.yml b/jjb/domino/domino.yml index 532fce687..5fd9db3f1 100644 --- a/jjb/domino/domino.yml +++ b/jjb/domino/domino.yml @@ -24,7 +24,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' diff --git a/jjb/dovetail/dovetail-artifacts-upload.yml b/jjb/dovetail/dovetail-artifacts-upload.yml index dc2ae5aa2..3d9af5ed7 100644 --- a/jjb/dovetail/dovetail-artifacts-upload.yml +++ b/jjb/dovetail/dovetail-artifacts-upload.yml @@ -33,6 +33,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 1 @@ -42,7 +43,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' - dovetail-parameter: diff --git a/jjb/dovetail/dovetail-ci-jobs.yml b/jjb/dovetail/dovetail-ci-jobs.yml index 08eb5a5f1..0bd32a4ab 100644 --- a/jjb/dovetail/dovetail-ci-jobs.yml +++ b/jjb/dovetail/dovetail-ci-jobs.yml @@ -20,8 +20,8 @@ dovetail-branch: '{stream}' gs-pathname: '' docker-tag: 'latest' - colorado: &colorado - stream: colorado + danube: &danube + stream: danube branch: 'stable/{stream}' dovetail-branch: master gs-pathname: '/{stream}' @@ -54,12 +54,12 @@ slave-label: fuel-baremetal SUT: fuel auto-trigger-name: 'daily-trigger-disabled' - <<: *colorado + <<: *danube - virtual: slave-label: fuel-virtual SUT: fuel auto-trigger-name: 'daily-trigger-disabled' - <<: *colorado + <<: *danube #compass CI PODs - baremetal: slave-label: compass-baremetal @@ -75,33 +75,29 @@ slave-label: compass-baremetal SUT: compass auto-trigger-name: 'daily-trigger-disabled' - <<: *colorado + <<: *danube - virtual: slave-label: compass-virtual SUT: compass auto-trigger-name: 'daily-trigger-disabled' - <<: *colorado -#apex CI PODs - - apex-verify-master: - slave-label: '{pod}' - SUT: apex - auto-trigger-name: 'daily-trigger-disabled' - <<: *master - - apex-daily-master: + <<: *danube +#-------------------------------- +# Installers not using labels +# CI PODs +# This section should only contain the installers +# that have not been switched using labels for slaves +#-------------------------------- +#apex PODs + - lf-pod1: slave-label: '{pod}' SUT: apex auto-trigger-name: 'daily-trigger-disabled' <<: *master - - apex-verify-colorado: + - lf-pod1: slave-label: '{pod}' SUT: apex auto-trigger-name: 'daily-trigger-disabled' - <<: *colorado - - apex-daily-colorado: - slave-label: '{pod}' - SUT: apex - auto-trigger-name: 'daily-trigger-disabled' - <<: *colorado + <<: *danube #armband CI PODs - armband-baremetal: slave-label: armband-baremetal @@ -117,17 +113,17 @@ slave-label: armband-baremetal SUT: fuel auto-trigger-name: 'daily-trigger-disabled' - <<: *colorado + <<: *danube - armband-virtual: slave-label: armband-virtual SUT: fuel auto-trigger-name: 'daily-trigger-disabled' - <<: *colorado + <<: *danube #-------------------------------- # None-CI PODs #-------------------------------- - - huawei-pod5: - slave-label: '{pod}' + - baremetal-centos: + slave-label: 'intel-pod8' SUT: compass auto-trigger-name: 'daily-trigger-disabled' <<: *master @@ -161,6 +157,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-per-node: 1 @@ -179,8 +176,7 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: - branch: '{branch}' + branch: '{dovetail-branch}' - '{SUT}-defaults' - '{slave-label}-defaults' - string: diff --git a/jjb/dovetail/dovetail-project-jobs.yml b/jjb/dovetail/dovetail-project-jobs.yml index 904841396..9dc4808b4 100644 --- a/jjb/dovetail/dovetail-project-jobs.yml +++ b/jjb/dovetail/dovetail-project-jobs.yml @@ -28,7 +28,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' @@ -65,7 +64,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' diff --git a/jjb/dovetail/dovetail-weekly-jobs.yml b/jjb/dovetail/dovetail-weekly-jobs.yml new file mode 100644 index 000000000..8edce4246 --- /dev/null +++ b/jjb/dovetail/dovetail-weekly-jobs.yml @@ -0,0 +1,135 @@ +- project: + name: dovetail-weekly-jobs + project: dovetail +#-------------------------------- +# BRANCH ANCHORS +#-------------------------------- + master: &master + stream: master + branch: '{stream}' + dovetail-branch: '{stream}' + gs-pathname: '' + docker-tag: 'latest' + colorado: &colorado + stream: colorado + branch: 'stable/{stream}' + dovetail-branch: master + gs-pathname: '/{stream}' + docker-tag: 'latest' + +#-------------------------------- +# POD, INSTALLER, AND BRANCH MAPPING +#-------------------------------- +# Installers using labels +# CI PODs +# This section should only contain the installers +# that have been switched using labels for slaves +#-------------------------------- + pod: +# - baremetal: +# slave-label: apex-baremetal +# sut: apex +# <<: *colorado + - baremetal: + slave-label: compass-baremetal + sut: compass + <<: *colorado +# - baremetal: +# slave-label: fuel-baremetal +# sut: fuel +# <<: *master +# - baremetal: +# slave-label: joid-baremetal +# sut: joid +# <<: *colorado + + testsuite: + - 'debug' + - 'proposed_tests' + - 'compliance_set' + + loop: + - 'weekly': + job-timeout: 60 + + jobs: + - 'dovetail-{sut}-{pod}-{testsuite}-{loop}-{stream}' + +################################ +# job template +################################ +- job-template: + name: 'dovetail-{sut}-{pod}-{testsuite}-{loop}-{stream}' + + disabled: false + + concurrent: true + + properties: + - logrotate-default + - throttle: + enabled: true + max-per-node: 1 + option: 'project' + + wrappers: + - build-name: + name: '$BUILD_NUMBER Scenario: $DEPLOY_SCENARIO' + - timeout: + timeout: '{job-timeout}' + abort: true + + parameters: + - project-parameter: + project: '{project}' + branch: '{dovetail-branch}' + - '{sut}-defaults' + - '{slave-label}-defaults' + - string: + name: DEPLOY_SCENARIO + default: 'os-nosdn-nofeature-ha' + - string: + name: DOCKER_TAG + default: '{docker-tag}' + description: 'Tag to pull dovetail docker image' + - string: + name: CI_DEBUG + default: 'true' + description: "Show debug output information" + - string: + name: TESTSUITE + default: '{testsuite}' + description: "dovetail testsuite to run" + - string: + name: DOVETAIL_REPO_DIR + default: "/home/opnfv/dovetail" + description: "Directory where the dovetail repository is cloned" + + scm: + - git-scm + + builders: + - description-setter: + description: "POD: $NODE_NAME" + - 'dovetail-cleanup' + - 'dovetail-run' + + publishers: + - archive: + artifacts: 'results/**/*' + allow-empty: true + fingerprint: true + +######################## +# builder macros +######################## +- builder: + name: dovetail-run-weekly + builders: + - shell: + !include-raw: ./dovetail-run.sh +- builder: + name: dovetail-cleanup-weekly + builders: + - shell: + !include-raw: ./dovetail-cleanup.sh diff --git a/jjb/dpacc/dpacc.yml b/jjb/dpacc/dpacc.yml index 27e663507..bc61d7447 100644 --- a/jjb/dpacc/dpacc.yml +++ b/jjb/dpacc/dpacc.yml @@ -28,7 +28,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' diff --git a/jjb/escalator/escalator.yml b/jjb/escalator/escalator.yml index 4149ee93c..2265dafce 100644 --- a/jjb/escalator/escalator.yml +++ b/jjb/escalator/escalator.yml @@ -39,6 +39,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 4 @@ -80,7 +81,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-defaults' - 'escalator-defaults': @@ -96,7 +96,7 @@ - name: 'escalator-verify-basic-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -110,7 +110,7 @@ - name: 'escalator-verify-build-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -137,7 +137,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{slave-label}-defaults' - 'escalator-defaults': @@ -158,6 +157,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 4 @@ -193,7 +193,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-defaults' - 'escalator-defaults': @@ -209,7 +208,7 @@ - name: 'escalator-merge-basic-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -223,7 +222,7 @@ - name: 'escalator-merge-build-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -239,7 +238,7 @@ concurrent: true scm: - - git-scm-gerrit + - git-scm wrappers: - ssh-agent-wrapper @@ -250,7 +249,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{slave-label}-defaults' - 'escalator-defaults': diff --git a/jjb/fuel/fuel-basic-exp.sh b/jjb/fuel/fuel-basic-exp.sh deleted file mode 100755 index a70a0c765..000000000 --- a/jjb/fuel/fuel-basic-exp.sh +++ /dev/null @@ -1,18 +0,0 @@ -#!/bin/bash -set -o nounset - -echo "-----------------------------------------------------------------------" -echo $GERRIT_CHANGE_COMMIT_MESSAGE -echo "-----------------------------------------------------------------------" - -# proposal for specifying the scenario name in commit message -# currently only 1 scenario name is supported but depending on -# the need, it can be expanded, supporting multiple scenarios -# using comma separated list or something -SCENARIO_NAME_PATTERN="(?<=@scenario:).*?(?=@)" -SCENARIO_NAME=(echo $GERRIT_CHANGE_COMMIT_MESSAGE | grep -oP "$SCENARIO_NAME_PATTERN") -if [[ $? -ne 0 ]]; then - echo "The patch verification will be done only with build!" -else - echo "Will run full verification; build, deploy, and smoke test using scenario $SCENARIO_NAME" -fi diff --git a/jjb/fuel/fuel-build-exp.sh b/jjb/fuel/fuel-build-exp.sh deleted file mode 100755 index f7f613dc0..000000000 --- a/jjb/fuel/fuel-build-exp.sh +++ /dev/null @@ -1,10 +0,0 @@ -#!/bin/bash - -if [[ "$JOB_NAME" =~ (verify|merge|daily|weekly) ]]; then - JOB_TYPE=${BASH_REMATCH[0]} -else - echo "Unable to determine job type!" - exit 1 -fi - -echo "Not activated!" diff --git a/jjb/fuel/fuel-daily-jobs.yml b/jjb/fuel/fuel-daily-jobs.yml index 87488c886..19336d8ac 100644 --- a/jjb/fuel/fuel-daily-jobs.yml +++ b/jjb/fuel/fuel-daily-jobs.yml @@ -15,10 +15,10 @@ branch: '{stream}' disabled: false gs-pathname: '' - colorado: &colorado - stream: colorado + danube: &danube + stream: danube branch: 'stable/{stream}' - disabled: false + disabled: true gs-pathname: '/{stream}' #-------------------------------- # POD, INSTALLER, AND BRANCH MAPPING @@ -34,10 +34,10 @@ <<: *master - baremetal: slave-label: fuel-baremetal - <<: *colorado + <<: *danube - virtual: slave-label: fuel-virtual - <<: *colorado + <<: *danube #-------------------------------- # None-CI PODs #-------------------------------- @@ -52,10 +52,10 @@ <<: *master - zte-pod1: slave-label: zte-pod1 - <<: *colorado + <<: *danube - zte-pod3: slave-label: zte-pod3 - <<: *colorado + <<: *danube #-------------------------------- # scenarios #-------------------------------- @@ -81,6 +81,10 @@ auto-trigger-name: 'fuel-{scenario}-{pod}-daily-{stream}-trigger' - 'os-nosdn-kvm_ovs-ha': auto-trigger-name: 'daily-trigger-disabled' + - 'os-nosdn-kvm_ovs_dpdk-ha': + auto-trigger-name: 'fuel-{scenario}-{pod}-daily-{stream}-trigger' + - 'os-nosdn-kvm_ovs_dpdk_bar-ha': + auto-trigger-name: 'fuel-{scenario}-{pod}-daily-{stream}-trigger' # NOHA scenarios - 'os-nosdn-nofeature-noha': auto-trigger-name: 'fuel-{scenario}-{pod}-daily-{stream}-trigger' @@ -100,6 +104,10 @@ auto-trigger-name: 'fuel-{scenario}-{pod}-daily-{stream}-trigger' - 'os-nosdn-ovs-noha': auto-trigger-name: 'fuel-{scenario}-{pod}-daily-{stream}-trigger' + - 'os-nosdn-kvm_ovs_dpdk-noha': + auto-trigger-name: 'fuel-{scenario}-{pod}-daily-{stream}-trigger' + - 'os-nosdn-kvm_ovs_dpdk_bar-noha': + auto-trigger-name: 'fuel-{scenario}-{pod}-daily-{stream}-trigger' jobs: - 'fuel-{scenario}-{pod}-daily-{stream}' @@ -116,6 +124,7 @@ concurrent: false properties: + - logrotate-default - throttle: enabled: true max-total: 4 @@ -125,6 +134,7 @@ use-build-blocker: true blocking-jobs: - 'fuel-os-.*?-{pod}-daily-.*' + - 'fuel-os-.*?-{pod}-weekly-.*' block-level: 'NODE' wrappers: @@ -137,6 +147,7 @@ parameters: - project-parameter: project: '{project}' + branch: '{branch}' - '{installer}-defaults' - '{slave-label}-defaults': installer: '{installer}' @@ -148,7 +159,7 @@ builders: - description-setter: - description: "POD: $NODE_NAME" + description: "Built on $NODE_NAME" - trigger-builds: - project: 'fuel-deploy-{pod}-daily-{stream}' current-parameters: false @@ -191,6 +202,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 4 @@ -201,12 +213,13 @@ blocking-jobs: - 'fuel-deploy-{pod}-daily-.*' - 'fuel-deploy-generic-daily-.*' + - 'fuel-deploy-{pod}-weekly-.*' + - 'fuel-deploy-generic-weekly-.*' block-level: 'NODE' parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{installer}-defaults' - '{slave-label}-defaults': @@ -230,7 +243,7 @@ builders: - description-setter: - description: "POD: $NODE_NAME" + description: "Built on $NODE_NAME" - shell: !include-raw-escape: ./fuel-download-artifact.sh - shell: @@ -238,7 +251,7 @@ publishers: - email: - recipients: jonas.bjurel@ericsson.com stefan.k.berg@ericsson.com peter.barabas@ericsson.com fzhadaev@mirantis.com + recipients: peter.barabas@ericsson.com fzhadaev@mirantis.com ######################## # parameter macros @@ -272,11 +285,15 @@ - trigger: name: 'fuel-os-odl_l2-nofeature-ha-baremetal-daily-master-trigger' triggers: - - timed: '' # '5 23 * * *' + - timed: '5 23 * * *' - trigger: name: 'fuel-os-odl_l3-nofeature-ha-baremetal-daily-master-trigger' triggers: - - timed: '' # '5 2 * * *' + - timed: '5 2 * * *' +- trigger: + name: 'fuel-os-nosdn-ovs-ha-baremetal-daily-master-trigger' + triggers: + - timed: '5 5 * * *' - trigger: name: 'fuel-os-onos-sfc-ha-baremetal-daily-master-trigger' triggers: @@ -288,20 +305,23 @@ - trigger: name: 'fuel-os-odl_l2-sfc-ha-baremetal-daily-master-trigger' triggers: - - timed: '' # '5 11 * * *' + - timed: '5 11 * * *' - trigger: name: 'fuel-os-odl_l2-bgpvpn-ha-baremetal-daily-master-trigger' triggers: - - timed: '' # '5 14 * * *' + - timed: '5 14 * * *' - trigger: name: 'fuel-os-nosdn-kvm-ha-baremetal-daily-master-trigger' triggers: - - timed: '' # '5 17 * * *' + - timed: '5 17 * * *' - trigger: - name: 'fuel-os-nosdn-ovs-ha-baremetal-daily-master-trigger' + name: 'fuel-os-nosdn-kvm_ovs_dpdk-ha-baremetal-daily-master-trigger' triggers: - - timed: '5 20 * * *' - + - timed: '30 12 * * *' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-ha-baremetal-daily-master-trigger' + triggers: + - timed: '30 8 * * *' # NOHA Scenarios - trigger: name: 'fuel-os-nosdn-nofeature-noha-baremetal-daily-master-trigger' @@ -339,82 +359,105 @@ name: 'fuel-os-nosdn-ovs-noha-baremetal-daily-master-trigger' triggers: - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-noha-baremetal-daily-master-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-noha-baremetal-daily-master-trigger' + triggers: + - timed: '' #----------------------------------------------- -# Triggers for job running on fuel-baremetal against colorado branch +# Triggers for job running on fuel-baremetal against danube branch #----------------------------------------------- # HA Scenarios - trigger: - name: 'fuel-os-nosdn-nofeature-ha-baremetal-daily-colorado-trigger' + name: 'fuel-os-nosdn-nofeature-ha-baremetal-daily-danube-trigger' triggers: - timed: '0 20 * * *' - trigger: - name: 'fuel-os-odl_l2-nofeature-ha-baremetal-daily-colorado-trigger' + name: 'fuel-os-odl_l2-nofeature-ha-baremetal-daily-danube-trigger' triggers: - timed: '0 23 * * *' - trigger: - name: 'fuel-os-odl_l3-nofeature-ha-baremetal-daily-colorado-trigger' + name: 'fuel-os-odl_l3-nofeature-ha-baremetal-daily-danube-trigger' triggers: - timed: '0 2 * * *' - trigger: - name: 'fuel-os-onos-sfc-ha-baremetal-daily-colorado-trigger' + name: 'fuel-os-onos-sfc-ha-baremetal-daily-danube-trigger' triggers: - timed: '0 5 * * *' - trigger: - name: 'fuel-os-onos-nofeature-ha-baremetal-daily-colorado-trigger' + name: 'fuel-os-onos-nofeature-ha-baremetal-daily-danube-trigger' triggers: - timed: '0 8 * * *' - trigger: - name: 'fuel-os-odl_l2-sfc-ha-baremetal-daily-colorado-trigger' + name: 'fuel-os-odl_l2-sfc-ha-baremetal-daily-danube-trigger' triggers: - timed: '0 11 * * *' - trigger: - name: 'fuel-os-odl_l2-bgpvpn-ha-baremetal-daily-colorado-trigger' + name: 'fuel-os-odl_l2-bgpvpn-ha-baremetal-daily-danube-trigger' triggers: - timed: '0 14 * * *' - trigger: - name: 'fuel-os-nosdn-kvm-ha-baremetal-daily-colorado-trigger' + name: 'fuel-os-nosdn-kvm-ha-baremetal-daily-danube-trigger' triggers: - timed: '0 17 * * *' - trigger: - name: 'fuel-os-nosdn-ovs-ha-baremetal-daily-colorado-trigger' + name: 'fuel-os-nosdn-ovs-ha-baremetal-daily-danube-trigger' triggers: - timed: '0 20 * * *' - +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-ha-baremetal-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-ha-baremetal-daily-danube-trigger' + triggers: + - timed: '' # NOHA Scenarios - trigger: - name: 'fuel-os-nosdn-nofeature-noha-baremetal-daily-colorado-trigger' + name: 'fuel-os-nosdn-nofeature-noha-baremetal-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-nofeature-noha-baremetal-daily-colorado-trigger' + name: 'fuel-os-odl_l2-nofeature-noha-baremetal-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l3-nofeature-noha-baremetal-daily-colorado-trigger' + name: 'fuel-os-odl_l3-nofeature-noha-baremetal-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-sfc-noha-baremetal-daily-colorado-trigger' + name: 'fuel-os-onos-sfc-noha-baremetal-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-nofeature-noha-baremetal-daily-colorado-trigger' + name: 'fuel-os-onos-nofeature-noha-baremetal-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-sfc-noha-baremetal-daily-colorado-trigger' + name: 'fuel-os-odl_l2-sfc-noha-baremetal-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-bgpvpn-noha-baremetal-daily-colorado-trigger' + name: 'fuel-os-odl_l2-bgpvpn-noha-baremetal-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-nosdn-kvm-noha-baremetal-daily-colorado-trigger' + name: 'fuel-os-nosdn-kvm-noha-baremetal-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-nosdn-ovs-noha-baremetal-daily-colorado-trigger' + name: 'fuel-os-nosdn-ovs-noha-baremetal-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-noha-baremetal-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-noha-baremetal-daily-danube-trigger' triggers: - timed: '' #----------------------------------------------- @@ -456,6 +499,14 @@ name: 'fuel-os-nosdn-ovs-ha-virtual-daily-master-trigger' triggers: - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-ha-virtual-daily-master-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-ha-virtual-daily-master-trigger' + triggers: + - timed: '' # NOHA Scenarios - trigger: name: 'fuel-os-nosdn-nofeature-noha-virtual-daily-master-trigger' @@ -472,11 +523,11 @@ - trigger: name: 'fuel-os-onos-sfc-noha-virtual-daily-master-trigger' triggers: - - timed: '35 20 * * *' + - timed: '' # '35 20 * * *' - trigger: name: 'fuel-os-onos-nofeature-noha-virtual-daily-master-trigger' triggers: - - timed: '5 23 * * *' + - timed: '' # '5 23 * * *' - trigger: name: 'fuel-os-odl_l2-sfc-noha-virtual-daily-master-trigger' triggers: @@ -493,82 +544,106 @@ name: 'fuel-os-nosdn-ovs-noha-virtual-daily-master-trigger' triggers: - timed: '5 9 * * *' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-noha-virtual-daily-master-trigger' + triggers: + - timed: '30 16 * * *' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-noha-virtual-daily-master-trigger' + triggers: + - timed: '30 20 * * *' #----------------------------------------------- -# Triggers for job running on fuel-virtual against colorado branch +# Triggers for job running on fuel-virtual against danube branch #----------------------------------------------- - trigger: - name: 'fuel-os-nosdn-nofeature-ha-virtual-daily-colorado-trigger' + name: 'fuel-os-nosdn-nofeature-ha-virtual-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-nofeature-ha-virtual-daily-colorado-trigger' + name: 'fuel-os-odl_l2-nofeature-ha-virtual-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l3-nofeature-ha-virtual-daily-colorado-trigger' + name: 'fuel-os-odl_l3-nofeature-ha-virtual-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-sfc-ha-virtual-daily-colorado-trigger' + name: 'fuel-os-onos-sfc-ha-virtual-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-nofeature-ha-virtual-daily-colorado-trigger' + name: 'fuel-os-onos-nofeature-ha-virtual-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-bgpvpn-ha-virtual-daily-colorado-trigger' + name: 'fuel-os-odl_l2-bgpvpn-ha-virtual-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-sfc-ha-virtual-daily-colorado-trigger' + name: 'fuel-os-odl_l2-sfc-ha-virtual-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-nosdn-kvm-ha-virtual-daily-colorado-trigger' + name: 'fuel-os-nosdn-kvm-ha-virtual-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-nosdn-ovs-ha-virtual-daily-colorado-trigger' + name: 'fuel-os-nosdn-ovs-ha-virtual-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-ha-virtual-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-ha-virtual-daily-danube-trigger' triggers: - timed: '' # NOHA Scenarios - trigger: - name: 'fuel-os-nosdn-nofeature-noha-virtual-daily-colorado-trigger' + name: 'fuel-os-nosdn-nofeature-noha-virtual-daily-danube-trigger' triggers: - timed: '0 13 * * *' - trigger: - name: 'fuel-os-odl_l2-nofeature-noha-virtual-daily-colorado-trigger' + name: 'fuel-os-odl_l2-nofeature-noha-virtual-daily-danube-trigger' triggers: - timed: '30 15 * * *' - trigger: - name: 'fuel-os-odl_l3-nofeature-noha-virtual-daily-colorado-trigger' + name: 'fuel-os-odl_l3-nofeature-noha-virtual-daily-danube-trigger' triggers: - timed: '0 18 * * *' - trigger: - name: 'fuel-os-onos-sfc-noha-virtual-daily-colorado-trigger' + name: 'fuel-os-onos-sfc-noha-virtual-daily-danube-trigger' triggers: - timed: '30 20 * * *' - trigger: - name: 'fuel-os-onos-nofeature-noha-virtual-daily-colorado-trigger' + name: 'fuel-os-onos-nofeature-noha-virtual-daily-danube-trigger' triggers: - timed: '0 23 * * *' - trigger: - name: 'fuel-os-odl_l2-sfc-noha-virtual-daily-colorado-trigger' + name: 'fuel-os-odl_l2-sfc-noha-virtual-daily-danube-trigger' triggers: - timed: '30 1 * * *' - trigger: - name: 'fuel-os-odl_l2-bgpvpn-noha-virtual-daily-colorado-trigger' + name: 'fuel-os-odl_l2-bgpvpn-noha-virtual-daily-danube-trigger' triggers: - timed: '0 4 * * *' - trigger: - name: 'fuel-os-nosdn-kvm-noha-virtual-daily-colorado-trigger' + name: 'fuel-os-nosdn-kvm-noha-virtual-daily-danube-trigger' triggers: - timed: '30 6 * * *' - trigger: - name: 'fuel-os-nosdn-ovs-noha-virtual-daily-colorado-trigger' + name: 'fuel-os-nosdn-ovs-noha-virtual-daily-danube-trigger' triggers: - timed: '0 9 * * *' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-noha-virtual-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-noha-virtual-daily-danube-trigger' + triggers: + - timed: '' #----------------------------------------------- # ZTE POD1 Triggers running against master branch #----------------------------------------------- @@ -608,6 +683,14 @@ name: 'fuel-os-nosdn-ovs-ha-zte-pod1-daily-master-trigger' triggers: - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-ha-zte-pod1-daily-master-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-ha-zte-pod1-daily-master-trigger' + triggers: + - timed: '' # NOHA Scenarios - trigger: name: 'fuel-os-nosdn-nofeature-noha-zte-pod1-daily-master-trigger' @@ -645,6 +728,14 @@ name: 'fuel-os-nosdn-ovs-noha-zte-pod1-daily-master-trigger' triggers: - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-noha-zte-pod1-daily-master-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-noha-zte-pod1-daily-master-trigger' + triggers: + - timed: '' #----------------------------------------------- # ZTE POD2 Triggers running against master branch @@ -685,6 +776,14 @@ name: 'fuel-os-nosdn-ovs-ha-zte-pod2-daily-master-trigger' triggers: - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-ha-zte-pod2-daily-master-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-ha-zte-pod2-daily-master-trigger' + triggers: + - timed: '' # NOHA Scenarios - trigger: name: 'fuel-os-nosdn-nofeature-noha-zte-pod2-daily-master-trigger' @@ -722,6 +821,14 @@ name: 'fuel-os-nosdn-ovs-noha-zte-pod2-daily-master-trigger' triggers: - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-noha-zte-pod2-daily-master-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-noha-zte-pod2-daily-master-trigger' + triggers: + - timed: '' #----------------------------------------------- # ZTE POD3 Triggers running against master branch #----------------------------------------------- @@ -761,6 +868,14 @@ name: 'fuel-os-nosdn-ovs-ha-zte-pod3-daily-master-trigger' triggers: - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-ha-zte-pod3-daily-master-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-ha-zte-pod3-daily-master-trigger' + triggers: + - timed: '' # NOHA Scenarios - trigger: name: 'fuel-os-nosdn-nofeature-noha-zte-pod3-daily-master-trigger' @@ -798,232 +913,288 @@ name: 'fuel-os-nosdn-ovs-noha-zte-pod3-daily-master-trigger' triggers: - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-noha-zte-pod3-daily-master-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-noha-zte-pod3-daily-master-trigger' + triggers: + - timed: '' #----------------------------------------------- -# ZTE POD1 Triggers running against colorado branch +# ZTE POD1 Triggers running against danube branch #----------------------------------------------- - trigger: - name: 'fuel-os-nosdn-nofeature-ha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-nosdn-nofeature-ha-zte-pod1-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-nofeature-ha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-odl_l2-nofeature-ha-zte-pod1-daily-danube-trigger' triggers: - timed: '0 2 * * *' - trigger: - name: 'fuel-os-odl_l3-nofeature-ha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-odl_l3-nofeature-ha-zte-pod1-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-onos-sfc-ha-zte-pod1-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-sfc-ha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-onos-nofeature-ha-zte-pod1-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-nofeature-ha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-odl_l2-bgpvpn-ha-zte-pod1-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-bgpvpn-ha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-odl_l2-sfc-ha-zte-pod1-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-sfc-ha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-nosdn-kvm-ha-zte-pod1-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-nosdn-kvm-ha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-nosdn-ovs-ha-zte-pod1-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-nosdn-ovs-ha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-nosdn-kvm_ovs_dpdk-ha-zte-pod1-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-ha-zte-pod1-daily-danube-trigger' triggers: - timed: '' # NOHA Scenarios - trigger: - name: 'fuel-os-nosdn-nofeature-noha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-nosdn-nofeature-noha-zte-pod1-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-odl_l2-nofeature-noha-zte-pod1-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-odl_l3-nofeature-noha-zte-pod1-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-nofeature-noha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-onos-sfc-noha-zte-pod1-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l3-nofeature-noha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-onos-nofeature-noha-zte-pod1-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-sfc-noha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-odl_l2-sfc-noha-zte-pod1-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-nofeature-noha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-odl_l2-bgpvpn-noha-zte-pod1-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-sfc-noha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-nosdn-kvm-noha-zte-pod1-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-bgpvpn-noha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-nosdn-ovs-noha-zte-pod1-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-nosdn-kvm-noha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-nosdn-kvm_ovs_dpdk-noha-zte-pod1-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-nosdn-ovs-noha-zte-pod1-daily-colorado-trigger' + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-noha-zte-pod1-daily-danube-trigger' triggers: - timed: '' #----------------------------------------------- -# ZTE POD2 Triggers running against colorado branch +# ZTE POD2 Triggers running against danube branch #----------------------------------------------- - trigger: - name: 'fuel-os-nosdn-nofeature-ha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-nosdn-nofeature-ha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-nofeature-ha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-odl_l2-nofeature-ha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l3-nofeature-ha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-odl_l3-nofeature-ha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-sfc-ha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-onos-sfc-ha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-nofeature-ha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-onos-nofeature-ha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-bgpvpn-ha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-odl_l2-bgpvpn-ha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-sfc-ha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-odl_l2-sfc-ha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-nosdn-kvm-ha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-nosdn-kvm-ha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-nosdn-ovs-ha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-nosdn-ovs-ha-zte-pod2-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-ha-zte-pod2-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-ha-zte-pod2-daily-danube-trigger' triggers: - timed: '' # NOHA Scenarios - trigger: - name: 'fuel-os-nosdn-nofeature-noha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-nosdn-nofeature-noha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-nofeature-noha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-odl_l2-nofeature-noha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l3-nofeature-noha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-odl_l3-nofeature-noha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-sfc-noha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-onos-sfc-noha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-nofeature-noha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-onos-nofeature-noha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-sfc-noha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-odl_l2-sfc-noha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-bgpvpn-noha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-odl_l2-bgpvpn-noha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-nosdn-kvm-noha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-nosdn-kvm-noha-zte-pod2-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-nosdn-ovs-noha-zte-pod2-daily-colorado-trigger' + name: 'fuel-os-nosdn-ovs-noha-zte-pod2-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-noha-zte-pod2-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-noha-zte-pod2-daily-danube-trigger' triggers: - timed: '' #----------------------------------------------- -# ZTE POD3 Triggers running against colorado branch +# ZTE POD3 Triggers running against danube branch #----------------------------------------------- - trigger: - name: 'fuel-os-nosdn-nofeature-ha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-nosdn-nofeature-ha-zte-pod3-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-nofeature-ha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-odl_l2-nofeature-ha-zte-pod3-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l3-nofeature-ha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-odl_l3-nofeature-ha-zte-pod3-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-sfc-ha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-onos-sfc-ha-zte-pod3-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-nofeature-ha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-onos-nofeature-ha-zte-pod3-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-bgpvpn-ha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-odl_l2-bgpvpn-ha-zte-pod3-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-sfc-ha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-odl_l2-sfc-ha-zte-pod3-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-nosdn-kvm-ha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-nosdn-kvm-ha-zte-pod3-daily-danube-trigger' triggers: - timed: '0 18 * * *' - trigger: - name: 'fuel-os-nosdn-ovs-ha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-nosdn-ovs-ha-zte-pod3-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk-ha-zte-pod3-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-ha-zte-pod3-daily-danube-trigger' triggers: - timed: '' # NOHA Scenarios - trigger: - name: 'fuel-os-nosdn-nofeature-noha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-nosdn-nofeature-noha-zte-pod3-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-odl_l2-nofeature-noha-zte-pod3-daily-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'fuel-os-odl_l3-nofeature-noha-zte-pod3-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-nofeature-noha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-onos-sfc-noha-zte-pod3-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l3-nofeature-noha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-onos-nofeature-noha-zte-pod3-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-sfc-noha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-odl_l2-sfc-noha-zte-pod3-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-onos-nofeature-noha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-odl_l2-bgpvpn-noha-zte-pod3-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-sfc-noha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-nosdn-kvm-noha-zte-pod3-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-odl_l2-bgpvpn-noha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-nosdn-ovs-noha-zte-pod3-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-nosdn-kvm-noha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-nosdn-kvm_ovs_dpdk-noha-zte-pod3-daily-danube-trigger' triggers: - timed: '' - trigger: - name: 'fuel-os-nosdn-ovs-noha-zte-pod3-daily-colorado-trigger' + name: 'fuel-os-nosdn-kvm_ovs_dpdk_bar-noha-zte-pod3-daily-danube-trigger' triggers: - timed: '' diff --git a/jjb/fuel/fuel-deploy-exp.sh b/jjb/fuel/fuel-deploy-exp.sh deleted file mode 100755 index f7f613dc0..000000000 --- a/jjb/fuel/fuel-deploy-exp.sh +++ /dev/null @@ -1,10 +0,0 @@ -#!/bin/bash - -if [[ "$JOB_NAME" =~ (verify|merge|daily|weekly) ]]; then - JOB_TYPE=${BASH_REMATCH[0]} -else - echo "Unable to determine job type!" - exit 1 -fi - -echo "Not activated!" diff --git a/jjb/fuel/fuel-deploy.sh b/jjb/fuel/fuel-deploy.sh index 48b1dac2f..f5bbd1818 100755 --- a/jjb/fuel/fuel-deploy.sh +++ b/jjb/fuel/fuel-deploy.sh @@ -57,9 +57,9 @@ chmod a+x $TMPDIR # clone the securedlab repo cd $WORKSPACE -echo "Cloning securedlab repo ${GIT_BRANCH##origin/}" +echo "Cloning securedlab repo $BRANCH" git clone ssh://jenkins-ericsson@gerrit.opnfv.org:29418/securedlab --quiet \ - --branch ${GIT_BRANCH##origin/} + --branch $BRANCH # log file name FUEL_LOG_FILENAME="${JOB_NAME}_${BUILD_NUMBER}.log.tar.gz" @@ -95,7 +95,7 @@ echo "Deployment is done!" # upload logs for baremetal deployments # work with virtual deployments is still going on so we skip that for the timebeing -if [[ "$JOB_NAME" =~ "baremetal-daily" ]]; then +if [[ "$JOB_NAME" =~ (baremetal-daily|baremetal-weekly) ]]; then echo "Uploading deployment logs" gsutil cp $WORKSPACE/$FUEL_LOG_FILENAME gs://$GS_URL/logs/$FUEL_LOG_FILENAME > /dev/null 2>&1 echo "Logs are available as http://$GS_URL/logs/$FUEL_LOG_FILENAME" diff --git a/jjb/fuel/fuel-download-artifact.sh b/jjb/fuel/fuel-download-artifact.sh index 2a0f09a3f..8cc552e8d 100755 --- a/jjb/fuel/fuel-download-artifact.sh +++ b/jjb/fuel/fuel-download-artifact.sh @@ -36,7 +36,7 @@ echo "Using $OPNFV_ARTIFACT for deployment" # using ISOs for verify & merge jobs from local storage will be enabled later if [[ ! "$JOB_NAME" =~ (verify|merge) ]]; then # check if we already have the ISO to avoid redownload - ISOSTORE="/iso_mount/opnfv_ci/${GIT_BRANCH##*/}" + ISOSTORE="/iso_mount/opnfv_ci/${BRANCH##*/}" if [[ -f "$ISOSTORE/$OPNFV_ARTIFACT" ]]; then echo "ISO exists locally. Skipping the download and using the file from ISO store" ln -s $ISOSTORE/$OPNFV_ARTIFACT $WORKSPACE/opnfv.iso diff --git a/jjb/fuel/fuel-plugin-build.sh b/jjb/fuel/fuel-plugin-build.sh deleted file mode 100755 index f7f613dc0..000000000 --- a/jjb/fuel/fuel-plugin-build.sh +++ /dev/null @@ -1,10 +0,0 @@ -#!/bin/bash - -if [[ "$JOB_NAME" =~ (verify|merge|daily|weekly) ]]; then - JOB_TYPE=${BASH_REMATCH[0]} -else - echo "Unable to determine job type!" - exit 1 -fi - -echo "Not activated!" diff --git a/jjb/fuel/fuel-plugin-test.sh b/jjb/fuel/fuel-plugin-test.sh deleted file mode 100755 index f7f613dc0..000000000 --- a/jjb/fuel/fuel-plugin-test.sh +++ /dev/null @@ -1,10 +0,0 @@ -#!/bin/bash - -if [[ "$JOB_NAME" =~ (verify|merge|daily|weekly) ]]; then - JOB_TYPE=${BASH_REMATCH[0]} -else - echo "Unable to determine job type!" - exit 1 -fi - -echo "Not activated!" diff --git a/jjb/fuel/fuel-plugin-verify-jobs.yml b/jjb/fuel/fuel-plugin-verify-jobs.yml deleted file mode 100644 index bf847edfe..000000000 --- a/jjb/fuel/fuel-plugin-verify-jobs.yml +++ /dev/null @@ -1,236 +0,0 @@ -- project: - name: 'fuel-plugin-verify-jobs' - - project: 'fuel-plugin' - - installer: 'fuel' -##################################### -# branch definitions -##################################### - stream: - - master: - upstream-branch: '{stream}' - opnfv-branch: 'experimental' - gs-pathname: '' - disabled: false -##################################### -# patch verification phases -##################################### - phase: - - 'build': - slave-label: 'opnfv-build-ubuntu' - - 'test': - slave-label: 'opnfv-build-ubuntu' -##################################### -# jobs -##################################### - jobs: - - 'fuel-verify-plugin-{stream}' - - 'fuel-verify-plugin-{phase}-{stream}' -##################################### -# job templates -##################################### -- job-template: - name: 'fuel-verify-plugin-{stream}' - - project-type: multijob - - disabled: '{obj:disabled}' - - concurrent: true - - properties: - - throttle: - enabled: true - max-total: 4 - option: 'project' - - parameters: - - project-parameter: - project: '{project}' - - gerrit-parameter: - branch: '{upstream-branch}' - description: 'OpenStack branch to use' - - string: - name: OPNFV_BRANCH - default: '{opnfv-branch}' - description: 'OPNFV branch to use' - - 'opnfv-build-defaults' - - 'fuel-verify-plugin-defaults': - gs-pathname: '{gs-pathname}' - - scm: - - git: - url: 'https://git.openstack.org/$GERRIT_PROJECT' - refspec: '$GERRIT_REFSPEC' - branches: - - 'origin/$GERRIT_BRANCH' - skip-tag: true - choosing-strategy: 'gerrit' - timeout: 10 - wipe-workspace: true - - wrappers: - - ssh-agent-wrapper - - timeout: - timeout: 360 - fail: true - - triggers: - - gerrit: - server-name: 'review.openstack.org' - silent-start: false - skip-vote: - successful: true - failed: true - unstable: true - notbuilt: true - escape-quotes: true - trigger-on: - - patchset-created-event: - exclude-drafts: 'false' - exclude-trivial-rebase: 'false' - exclude-no-code-change: 'false' - - comment-added-contains-event: - comment-contains-value: 'recheck' - - comment-added-contains-event: - comment-contains-value: 'reverify' - projects: - - project-compare-type: 'PLAIN' - project-pattern: 'openstack/fuel-plugin-bgpvpn' - branches: - - branch-compare-type: 'ANT' - branch-pattern: '**/{upstream-branch}' - forbidden-file-paths: - - compare-type: ANT - pattern: 'README.md|.gitignore|.gitreview' - - project-compare-type: 'PLAIN' - project-pattern: 'openstack/fuel-plugin-onos' - branches: - - branch-compare-type: 'ANT' - branch-pattern: '**/{upstream-branch}' - forbidden-file-paths: - - compare-type: ANT - pattern: 'README.md|.gitignore|.gitreview' - readable-message: true - - builders: - - description-setter: - description: "Built on $NODE_NAME" - - multijob: - name: build - condition: SUCCESSFUL - projects: - - name: 'fuel-verify-plugin-build-{stream}' - current-parameters: false - predefined-parameters: | - GERRIT_PROJECT=$GERRIT_PROJECT - GERRIT_BRANCH=$GERRIT_BRANCH - GERRIT_REFSPEC=$GERRIT_REFSPEC - GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER - GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE - node-parameters: false - kill-phase-on: FAILURE - abort-all-job: true - - multijob: - name: test - condition: SUCCESSFUL - projects: - - name: 'fuel-verify-plugin-test-{stream}' - current-parameters: false - predefined-parameters: | - GERRIT_PROJECT=$GERRIT_PROJECT - GERRIT_BRANCH=$GERRIT_BRANCH - GERRIT_REFSPEC=$GERRIT_REFSPEC - GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER - GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE - node-parameters: false - kill-phase-on: FAILURE - abort-all-job: true - -- job-template: - name: 'fuel-verify-plugin-{phase}-{stream}' - - disabled: '{obj:disabled}' - - concurrent: true - - properties: - - throttle: - enabled: true - max-total: 6 - option: 'project' - - build-blocker: - use-build-blocker: true - blocking-jobs: - - 'fuel-verify-plugin-test-.*' - block-level: 'NODE' - - parameters: - - project-parameter: - project: '{project}' - - gerrit-parameter: - branch: '{upstream-branch}' - description: 'OpenStack branch to use' - - string: - name: OPNFV_BRANCH - default: '{opnfv-branch}' - description: 'OPNFV branch to use' - - '{slave-label}-defaults' - - '{installer}-defaults' - - 'fuel-verify-plugin-defaults': - gs-pathname: '{gs-pathname}' - - scm: - - git: - url: 'https://git.openstack.org/$GERRIT_PROJECT' - refspec: '$GERRIT_REFSPEC' - branches: - - 'origin/$GERRIT_BRANCH' - skip-tag: true - choosing-strategy: 'gerrit' - timeout: 10 - wipe-workspace: true - - wrappers: - - ssh-agent-wrapper - - timeout: - timeout: 360 - fail: true - - builders: - - description-setter: - description: "Built on $NODE_NAME" - - 'fuel-verify-plugin-{phase}-macro' -##################################### -# builder macros -##################################### -- builder: - name: 'fuel-verify-plugin-build-macro' - builders: - - shell: - !include-raw: ./fuel-plugin-build.sh - -- builder: - name: 'fuel-verify-plugin-test-macro' - builders: - - shell: - !include-raw: ./fuel-plugin-test.sh -##################################### -# parameter macros -##################################### -- parameter: - name: 'fuel-verify-plugin-defaults' - parameters: - - string: - name: BUILD_DIRECTORY - default: $WORKSPACE/build_output - description: "Directory where the build artifact will be located upon the completion of the build." - - string: - name: CACHE_DIRECTORY - default: $HOME/opnfv/cache/$INSTALLER_TYPE - description: "Directory where the cache to be used during the build is located." - - string: - name: GS_URL - default: artifacts.opnfv.org/$PROJECT{gs-pathname} - description: "URL to Google Storage." diff --git a/jjb/fuel/fuel-project-jobs.yml b/jjb/fuel/fuel-project-jobs.yml index 8fdf8deae..32ad8907e 100644 --- a/jjb/fuel/fuel-project-jobs.yml +++ b/jjb/fuel/fuel-project-jobs.yml @@ -13,10 +13,10 @@ branch: '{stream}' gs-pathname: '' disabled: false - - colorado: + - danube: branch: 'stable/{stream}' gs-pathname: '/{stream}' - disabled: false + disabled: true jobs: - 'fuel-build-daily-{stream}' @@ -35,6 +35,7 @@ concurrent: false properties: + - logrotate-default - throttle: enabled: true max-total: 1 @@ -44,7 +45,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' - '{installer}-defaults' @@ -78,7 +78,7 @@ publishers: - email: - recipients: jonas.bjurel@ericsson.com stefan.k.berg@ericsson.com fzhadaev@mirantis.com + recipients: fzhadaev@mirantis.com - job-template: name: 'fuel-merge-build-{stream}' @@ -90,7 +90,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' - '{installer}-defaults' @@ -146,6 +145,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 2 @@ -161,7 +161,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'fuel-virtual-defaults': installer: '{installer}' @@ -209,7 +208,7 @@ publishers: - email: - recipients: jonas.bjurel@ericsson.com stefan.k.berg@ericsson.com fzhadaev@mirantis.com + recipients: fzhadaev@mirantis.com - job-template: name: 'fuel-deploy-generic-daily-{stream}' @@ -219,6 +218,7 @@ disabled: '{obj:disabled}' properties: + - logrotate-default - throttle: enabled: true max-per-node: 1 @@ -233,7 +233,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{installer}-defaults' - string: diff --git a/jjb/fuel/fuel-smoke-test-exp.sh b/jjb/fuel/fuel-smoke-test-exp.sh deleted file mode 100755 index f7f613dc0..000000000 --- a/jjb/fuel/fuel-smoke-test-exp.sh +++ /dev/null @@ -1,10 +0,0 @@ -#!/bin/bash - -if [[ "$JOB_NAME" =~ (verify|merge|daily|weekly) ]]; then - JOB_TYPE=${BASH_REMATCH[0]} -else - echo "Unable to determine job type!" - exit 1 -fi - -echo "Not activated!" diff --git a/jjb/fuel/fuel-upload-artifact.sh b/jjb/fuel/fuel-upload-artifact.sh index ca4ba00b0..d1ac3509b 100755 --- a/jjb/fuel/fuel-upload-artifact.sh +++ b/jjb/fuel/fuel-upload-artifact.sh @@ -23,7 +23,7 @@ nfsstore () { # storing ISOs for verify & merge jobs will be done once we get the disk array if [[ ! "$JOB_NAME" =~ (verify|merge) ]]; then # store ISO locally on NFS first - ISOSTORE="/iso_mount/opnfv_ci/${GIT_BRANCH##*/}" + ISOSTORE="/iso_mount/opnfv_ci/${BRANCH##*/}" if [[ -d "$ISOSTORE" ]]; then # remove all but most recent 5 ISOs first to keep iso_mount clean & tidy cd $ISOSTORE diff --git a/jjb/fuel/fuel-verify-jobs-experimental.yml b/jjb/fuel/fuel-verify-jobs-experimental.yml deleted file mode 100644 index 3aa85b22d..000000000 --- a/jjb/fuel/fuel-verify-jobs-experimental.yml +++ /dev/null @@ -1,255 +0,0 @@ -- project: - # TODO: rename the project name - # TODO: get rid of appended -exp from the remainder of the file - name: 'fuel-verify-jobs-experimental' - - project: 'fuel' - - installer: 'fuel' -#------------------------------------ -# branch definitions -#------------------------------------ - # TODO: enable master once things settle - stream-exp: - - experimental: - branch: 'stable/{stream-exp}' - gs-pathname: '/{stream-exp}' - disabled: false -#------------------------------------ -# patch verification phases -#------------------------------------ - phase: - - 'basic': - # this phase does basic commit message check, unit test and so on - slave-label: 'opnfv-build' - - 'build': - # this phase builds artifacts if valid for given installer - slave-label: 'opnfv-build-ubuntu' - - 'deploy-virtual': - # this phase does virtual deployment using the artifacts produced in previous phase - slave-label: 'fuel-virtual' - - 'smoke-test': - # this phase runs functest smoke test - slave-label: 'fuel-virtual' -#------------------------------------ -# jobs -#------------------------------------ - jobs: - - 'fuel-verify-{stream-exp}' - - 'fuel-verify-{phase}-{stream-exp}' -#------------------------------------ -# job templates -#------------------------------------ -- job-template: - name: 'fuel-verify-{stream-exp}' - - project-type: multijob - - disabled: '{obj:disabled}' - - # TODO: this is valid for experimental only - # enable concurrency for master once things settle - concurrent: false - - properties: - - throttle: - enabled: true - max-total: 4 - option: 'project' - - scm: - - git-scm-gerrit - - wrappers: - - ssh-agent-wrapper - - timeout: - timeout: 360 - fail: true - - triggers: - - gerrit: - server-name: 'gerrit.opnfv.org' - trigger-on: - - patchset-created-event: - exclude-drafts: 'false' - exclude-trivial-rebase: 'false' - exclude-no-code-change: 'false' - - draft-published-event - - comment-added-contains-event: - comment-contains-value: 'recheck' - - comment-added-contains-event: - comment-contains-value: 'reverify' - projects: - - project-compare-type: 'ANT' - project-pattern: '{project}' - branches: - - branch-compare-type: 'ANT' - branch-pattern: '**/{branch}' - file-paths: - - compare-type: ANT - pattern: 'ci/**' - - compare-type: ANT - pattern: 'build/**' - - compare-type: ANT - pattern: 'deploy/**' - forbidden-file-paths: - - compare-type: ANT - pattern: 'docs/**' - readable-message: true - - parameters: - - project-parameter: - project: '{project}' - - gerrit-parameter: - branch: '{branch}' - - 'opnfv-build-defaults' - - 'fuel-verify-defaults-exp': - gs-pathname: '{gs-pathname}' - - builders: - - description-setter: - description: "Built on $NODE_NAME" - - multijob: - name: basic - condition: SUCCESSFUL - projects: - - name: 'fuel-verify-basic-{stream-exp}' - current-parameters: false - predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH - GERRIT_REFSPEC=$GERRIT_REFSPEC - GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER - GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE - node-parameters: false - kill-phase-on: FAILURE - abort-all-job: true - - multijob: - name: build - condition: SUCCESSFUL - projects: - - name: 'fuel-verify-build-{stream-exp}' - current-parameters: false - predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH - GERRIT_REFSPEC=$GERRIT_REFSPEC - GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER - GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE - node-parameters: false - kill-phase-on: FAILURE - abort-all-job: true - - multijob: - name: deploy-virtual - condition: SUCCESSFUL - projects: - - name: 'fuel-verify-deploy-virtual-{stream-exp}' - current-parameters: false - predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH - GERRIT_REFSPEC=$GERRIT_REFSPEC - GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER - GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE - node-parameters: false - kill-phase-on: FAILURE - abort-all-job: true - - multijob: - name: smoke-test - condition: SUCCESSFUL - projects: - - name: 'fuel-verify-smoke-test-{stream-exp}' - current-parameters: false - predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH - GERRIT_REFSPEC=$GERRIT_REFSPEC - GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER - GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE - node-parameters: false - kill-phase-on: FAILURE - abort-all-job: true - -- job-template: - name: 'fuel-verify-{phase}-{stream-exp}' - - disabled: '{obj:disabled}' - - concurrent: true - - properties: - - throttle: - enabled: true - max-total: 6 - option: 'project' - - build-blocker: - use-build-blocker: true - blocking-jobs: - - 'fuel-verify-deploy-.*' - - 'fuel-verify-test-.*' - block-level: 'NODE' - - scm: - - git-scm-gerrit - - wrappers: - - ssh-agent-wrapper - - timeout: - timeout: 360 - fail: true - parameters: - - project-parameter: - project: '{project}' - - gerrit-parameter: - branch: '{branch}' - - '{slave-label}-defaults' - - '{installer}-defaults' - - 'fuel-verify-defaults-exp': - gs-pathname: '{gs-pathname}' - - builders: - - description-setter: - description: "Built on $NODE_NAME" - - '{project}-verify-{phase}-macro-exp' -#------------------------------------ -# builder macros -#------------------------------------ -- builder: - name: 'fuel-verify-basic-macro-exp' - builders: - - shell: - !include-raw: ./fuel-basic-exp.sh - -- builder: - name: 'fuel-verify-build-macro-exp' - builders: - - shell: - !include-raw: ./fuel-build-exp.sh - - shell: - !include-raw: ./fuel-workspace-cleanup.sh - -- builder: - name: 'fuel-verify-deploy-virtual-macro-exp' - builders: - - shell: - !include-raw: ./fuel-deploy-exp.sh - -- builder: - name: 'fuel-verify-smoke-test-macro-exp' - builders: - - shell: - !include-raw: ./fuel-smoke-test-exp.sh -#------------------------------------ -# parameter macros -#------------------------------------ -- parameter: - name: 'fuel-verify-defaults-exp' - parameters: - - string: - name: BUILD_DIRECTORY - default: $WORKSPACE/build_output - description: "Directory where the build artifact will be located upon the completion of the build." - - string: - name: CACHE_DIRECTORY - default: $HOME/opnfv/cache/$INSTALLER_TYPE - description: "Directory where the cache to be used during the build is located." - - string: - name: GS_URL - default: artifacts.opnfv.org/$PROJECT{gs-pathname} - description: "URL to Google Storage." diff --git a/jjb/fuel/fuel-verify-jobs.yml b/jjb/fuel/fuel-verify-jobs.yml index 4a76d9da7..7f9eff04d 100644 --- a/jjb/fuel/fuel-verify-jobs.yml +++ b/jjb/fuel/fuel-verify-jobs.yml @@ -12,10 +12,10 @@ branch: '{stream}' gs-pathname: '' disabled: false - - colorado: + - danube: branch: 'stable/{stream}' gs-pathname: '/{stream}' - disabled: false + disabled: true ##################################### # patch verification phases ##################################### @@ -47,6 +47,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 4 @@ -95,7 +96,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' - 'fuel-verify-defaults': @@ -111,7 +111,7 @@ - name: 'fuel-verify-basic-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -125,7 +125,7 @@ - name: 'fuel-verify-build-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -139,7 +139,7 @@ - name: 'fuel-verify-deploy-virtual-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -153,7 +153,7 @@ - name: 'fuel-verify-smoke-test-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -169,6 +169,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 6 @@ -191,7 +192,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{slave-label}-defaults' - '{installer}-defaults' diff --git a/jjb/fuel/fuel-weekly-jobs.yml b/jjb/fuel/fuel-weekly-jobs.yml new file mode 100644 index 000000000..06d813458 --- /dev/null +++ b/jjb/fuel/fuel-weekly-jobs.yml @@ -0,0 +1,210 @@ +# jenkins job templates for Fuel +- project: + + name: fuel-weekly + + project: fuel + + installer: fuel + +#-------------------------------- +# BRANCH ANCHORS +#-------------------------------- + master: &master + stream: master + branch: '{stream}' + disabled: false + gs-pathname: '' + danube: &danube + stream: danube + branch: 'stable/{stream}' + disabled: true + gs-pathname: '/{stream}' +#-------------------------------- +# POD, INSTALLER, AND BRANCH MAPPING +#-------------------------------- +# CI PODs +#-------------------------------- + pod: + - baremetal: + slave-label: fuel-baremetal + <<: *master + - virtual: + slave-label: fuel-virtual + <<: *master + - baremetal: + slave-label: fuel-baremetal + <<: *danube + - virtual: + slave-label: fuel-virtual + <<: *danube +#-------------------------------- +# scenarios +#-------------------------------- + scenario: + # HA scenarios + - 'os-nosdn-nofeature-ha': + auto-trigger-name: 'weekly-trigger-disabled' + + jobs: + - 'fuel-{scenario}-{pod}-weekly-{stream}' + - 'fuel-deploy-{pod}-weekly-{stream}' + +######################## +# job templates +######################## +- job-template: + name: 'fuel-{scenario}-{pod}-weekly-{stream}' + + disabled: '{obj:disabled}' + + concurrent: false + + properties: + - logrotate-default + - throttle: + enabled: true + max-total: 4 + max-per-node: 1 + option: 'project' + - build-blocker: + use-build-blocker: true + blocking-jobs: + - 'fuel-os-.*?-{pod}-daily-.*' + - 'fuel-os-.*?-{pod}-weekly-.*' + block-level: 'NODE' + + wrappers: + - build-name: + name: '$BUILD_NUMBER - Scenario: $DEPLOY_SCENARIO' + + triggers: + - '{auto-trigger-name}' + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - '{installer}-defaults' + - '{slave-label}-defaults': + installer: '{installer}' + - string: + name: DEPLOY_SCENARIO + default: '{scenario}' + - fuel-weekly-parameter: + gs-pathname: '{gs-pathname}' + + builders: + - description-setter: + description: "Built on $NODE_NAME" + - trigger-builds: + - project: 'fuel-deploy-{pod}-weekly-{stream}' + current-parameters: false + predefined-parameters: + DEPLOY_SCENARIO={scenario} + same-node: true + block: true + - trigger-builds: + - project: 'functest-fuel-{pod}-weekly-{stream}' + current-parameters: false + predefined-parameters: + DEPLOY_SCENARIO={scenario} + same-node: true + block: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' + + publishers: + - email: + recipients: peter.barabas@ericsson.com fzhadaev@mirantis.com + +- job-template: + name: 'fuel-deploy-{pod}-weekly-{stream}' + + disabled: '{obj:disabled}' + + concurrent: true + + properties: + - logrotate-default + - throttle: + enabled: true + max-total: 4 + max-per-node: 1 + option: 'project' + - build-blocker: + use-build-blocker: true + blocking-jobs: + - 'fuel-deploy-{pod}-daily-.*' + - 'fuel-deploy-generic-daily-.*' + - 'fuel-deploy-{pod}-weekly-.*' + - 'fuel-deploy-generic-weekly-.*' + block-level: 'NODE' + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - '{installer}-defaults' + - '{slave-label}-defaults': + installer: '{installer}' + - string: + name: DEPLOY_SCENARIO + default: 'os-odl_l2-nofeature-ha' + - fuel-weekly-parameter: + gs-pathname: '{gs-pathname}' + - string: + name: DEPLOY_TIMEOUT + default: '150' + description: 'Deployment timeout in minutes' + + scm: + - git-scm + + wrappers: + - build-name: + name: '$BUILD_NUMBER - Scenario: $DEPLOY_SCENARIO' + + builders: + - description-setter: + description: "Built on $NODE_NAME" + - shell: + !include-raw-escape: ./fuel-download-artifact.sh + - shell: + !include-raw-escape: ./fuel-deploy.sh + + publishers: + - email: + recipients: peter.barabas@ericsson.com fzhadaev@mirantis.com + +######################## +# parameter macros +######################## +- parameter: + name: fuel-weekly-parameter + parameters: + - string: + name: BUILD_DIRECTORY + default: $WORKSPACE/build_output + description: "Directory where the build artifact will be located upon the completion of the build." + - string: + name: CACHE_DIRECTORY + default: $HOME/opnfv/cache/$INSTALLER_TYPE + description: "Directory where the cache to be used during the build is located." + - string: + name: GS_URL + default: artifacts.opnfv.org/$PROJECT{gs-pathname} + description: "URL to Google Storage." +######################## +# trigger macros +######################## +#----------------------------------------------- +# Triggers for job running on fuel-baremetal against master branch +#----------------------------------------------- +# HA Scenarios +- trigger: + name: 'fuel-os-nosdn-nofeature-ha-baremetal-weekly-master-trigger' + triggers: + - timed: '' diff --git a/jjb/functest/functest-cleanup.sh b/jjb/functest/functest-cleanup.sh index b03d4778d..fc277b9ed 100755 --- a/jjb/functest/functest-cleanup.sh +++ b/jjb/functest/functest-cleanup.sh @@ -3,14 +3,22 @@ [[ $CI_DEBUG == true ]] && redirect="/dev/stdout" || redirect="/dev/null" echo "Cleaning up docker containers/images..." +HOST_ARCH=$(uname -m) FUNCTEST_IMAGE=opnfv/functest -# Remove containers along with image opnfv/functest:<none> +if [ "$HOST_ARCH" = "aarch64" ]; then + FUNCTEST_IMAGE="${FUNCTEST_IMAGE}_${HOST_ARCH}" +fi + +# Remove containers along with image opnfv/functest*:<none> dangling_images=($(docker images -f "dangling=true" | grep $FUNCTEST_IMAGE | awk '{print $3}')) if [[ -n ${dangling_images} ]]; then echo " Removing $FUNCTEST_IMAGE:<none> images and their containers..." for image_id in "${dangling_images[@]}"; do echo " Removing image_id: $image_id and its containers" - docker ps -a | grep $image_id | awk '{print $1}'| xargs docker rm -f >${redirect} + containers=$(docker ps -a | grep $image_id | awk '{print $1}') + if [[ -n "$containers" ]];then + docker rm -f $containers >${redirect} + fi docker rmi $image_id >${redirect} done fi diff --git a/jjb/functest/functest-ci-jobs.yml b/jjb/functest/functest-daily-jobs.yml index 4920bffea..5984b3674 100644 --- a/jjb/functest/functest-ci-jobs.yml +++ b/jjb/functest/functest-daily-jobs.yml @@ -2,9 +2,9 @@ # job configuration for functest ################################### - project: - name: functest + name: functest-daily - project: '{name}' + project: functest #-------------------------------- # BRANCH ANCHORS @@ -113,6 +113,15 @@ slave-label: armband-virtual installer: fuel <<: *danube +# daisy CI PODs + - baremetal: + slave-label: daisy-baremetal + installer: daisy + <<: *master + - virtual: + slave-label: daisy-virtual + installer: daisy + <<: *master # netvirt 3rd party ci - virtual: slave-label: odl-netvirt-virtual @@ -133,8 +142,8 @@ slave-label: '{pod}' installer: joid <<: *master - - huawei-pod5: - slave-label: '{pod}' + - baremetal-centos: + slave-label: 'intel-pod8' installer: compass <<: *master - nokia-pod1: @@ -189,8 +198,6 @@ job-timeout: 60 - 'daily': job-timeout: 180 - - 'weekly': - job-timeout: 400 jobs: - 'functest-{installer}-{pod}-{testsuite}-{stream}' @@ -204,6 +211,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-per-node: 1 @@ -219,7 +227,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{installer}-defaults' - '{slave-label}-defaults' @@ -234,7 +241,7 @@ - string: name: CLEAN_DOCKER_IMAGES default: 'false' - description: 'Remove downloaded docker images (opnfv/functest:*)' + description: 'Remove downloaded docker images (opnfv/functest*:*)' - functest-parameter: gs-pathname: '{gs-pathname}' @@ -243,7 +250,7 @@ builders: - description-setter: - description: "POD: $NODE_NAME" + description: "Built on $NODE_NAME" - 'functest-{testsuite}-builder' ######################## @@ -257,13 +264,6 @@ default: 'daily' description: "Daily suite name to run" - parameter: - name: functest-weekly-parameter - parameters: - - string: - name: FUNCTEST_SUITE_NAME - default: 'weekly' - description: "Weekly suite name to run" -- parameter: name: functest-suite-parameter parameters: - choice: @@ -275,6 +275,7 @@ - 'tempest_smoke_serial' - 'rally_sanity' - 'odl' + - 'odl_netvirt' - 'onos' - 'promise' - 'doctor' @@ -333,15 +334,6 @@ - 'functest-exit' - builder: - name: functest-weekly-builder - builders: - - 'functest-cleanup' - - 'set-functest-env' - - 'functest-weekly' - - 'functest-store-results' - - 'functest-exit' - -- builder: name: functest-suite-builder builders: - 'functest-cleanup' @@ -354,11 +346,6 @@ - shell: !include-raw: ./functest-loop.sh -- builder: - name: functest-weekly - builders: - - shell: - !include-raw: ./functest-loop.sh - builder: name: functest-suite diff --git a/jjb/functest/functest-exit.sh b/jjb/functest/functest-exit.sh index 10edab005..925a3cfbb 100644 --- a/jjb/functest/functest-exit.sh +++ b/jjb/functest/functest-exit.sh @@ -1,7 +1,6 @@ #!/bin/bash -branch=${GIT_BRANCH##*/} -ret_val_file="${HOME}/opnfv/functest/results/${branch}/return_value" +ret_val_file="${HOME}/opnfv/functest/results/${BRANCH##*/}/return_value" if [ ! -f ${ret_val_file} ]; then echo "Return value not found!" exit -1 @@ -9,4 +8,4 @@ fi ret_val=`cat ${ret_val_file}` -exit ${ret_val}
\ No newline at end of file +exit ${ret_val} diff --git a/jjb/functest/functest-loop.sh b/jjb/functest/functest-loop.sh index 4528c00d1..893c428a2 100755 --- a/jjb/functest/functest-loop.sh +++ b/jjb/functest/functest-loop.sh @@ -3,9 +3,9 @@ set +e branch=${GIT_BRANCH##*/} [[ "$PUSH_RESULTS_TO_DB" == "true" ]] && flags+="-r" -if [[ ${branch} == *"brahmaputra"* ]]; then +if [[ "$BRANCH" =~ 'brahmaputra' ]]; then cmd="${FUNCTEST_REPO_DIR}/docker/run_tests.sh -s ${flags}" -elif [[ ${branch} == *"colorado"* ]]; then +elif [[ "$BRANCH" =~ 'colorado' ]]; then cmd="python ${FUNCTEST_REPO_DIR}/ci/run_tests.py -t all ${flags}" else cmd="python ${FUNCTEST_REPO_DIR}/functest/ci/run_tests.py -t all ${flags}" @@ -14,7 +14,7 @@ container_id=$(docker ps -a | grep opnfv/functest | awk '{print $1}' | head -1) docker exec $container_id $cmd ret_value=$? -ret_val_file="${HOME}/opnfv/functest/results/${branch}/return_value" +ret_val_file="${HOME}/opnfv/functest/results/${BRANCH##*/}/return_value" echo ${ret_value}>${ret_val_file} exit 0 diff --git a/jjb/functest/functest-project-jobs.yml b/jjb/functest/functest-project-jobs.yml index 6a0768c9c..42c19a777 100644 --- a/jjb/functest/functest-project-jobs.yml +++ b/jjb/functest/functest-project-jobs.yml @@ -28,7 +28,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' diff --git a/jjb/functest/functest-suite.sh b/jjb/functest/functest-suite.sh index 9dc8deca0..228cc3da4 100755 --- a/jjb/functest/functest-suite.sh +++ b/jjb/functest/functest-suite.sh @@ -1,18 +1,18 @@ #!/bin/bash -set -e -branch=${GIT_BRANCH##*/} -echo "Functest: run $FUNCTEST_SUITE_NAME on branch ${branch}" -if [[ ${branch} == *"brahmaputra"* ]]; then - cmd="${FUNCTEST_REPO_DIR}/docker/run_tests.sh --test $FUNCTEST_SUITE_NAME" -elif [[ ${branch} == *"colorado"* ]]; then - cmd="python ${FUNCTEST_REPO_DIR}/ci/run_tests.py -t $FUNCTEST_SUITE_NAME" -else - cmd="functest testcase run $FUNCTEST_SUITE_NAME" -fi container_id=$(docker ps -a | grep opnfv/functest | awk '{print $1}' | head -1) -docker exec $container_id $cmd +if [ -z $container_id ]; then + echo "Functest container not found" + exit 1 +fi + +global_ret_val=0 -ret_value=$? +tests=($(echo $FUNCTEST_SUITE_NAME | tr "," "\n")) +for test in ${tests[@]}; do + cmd="python /home/opnfv/repos/functest/functest/ci/run_tests.py -t $test" + docker exec $container_id $cmd + let global_ret_val+=$? +done -exit $ret_value +exit $global_ret_val diff --git a/jjb/functest/functest-weekly-jobs.yml b/jjb/functest/functest-weekly-jobs.yml new file mode 100644 index 000000000..f44f7b8aa --- /dev/null +++ b/jjb/functest/functest-weekly-jobs.yml @@ -0,0 +1,124 @@ +################################### +# job configuration for functest +################################### +- project: + name: functest-weekly + + project: functest + +#-------------------------------- +# BRANCH ANCHORS +#-------------------------------- + master: &master + stream: master + branch: '{stream}' + gs-pathname: '' + docker-tag: 'latest' + disabled: false + danube: &danube + stream: danube + branch: 'stable/{stream}' + gs-pathname: '/{stream}' + docker-tag: 'stable' + disabled: true +#-------------------------------- +# POD, INSTALLER, AND BRANCH MAPPING +#-------------------------------- +# Installers using labels +# CI PODs +# This section should only contain the installers +# that have been switched using labels for slaves +#-------------------------------- + pod: +# fuel CI PODs + - baremetal: + slave-label: fuel-baremetal + installer: fuel + <<: *master + - virtual: + slave-label: fuel-virtual + installer: fuel + <<: *master + - baremetal: + slave-label: fuel-baremetal + installer: fuel + <<: *danube + - virtual: + slave-label: fuel-virtual + installer: fuel + <<: *danube +#-------------------------------- + jobs: + - 'functest-{installer}-{pod}-weekly-{stream}' + +################################ +# job template +################################ +- job-template: + name: 'functest-{installer}-{pod}-weekly-{stream}' + + disabled: '{obj:disabled}' + + concurrent: true + + properties: + - logrotate-default + - throttle: + enabled: true + max-per-node: 1 + option: 'project' + + wrappers: + - build-name: + name: '$BUILD_NUMBER Suite: $FUNCTEST_SUITE_NAME Scenario: $DEPLOY_SCENARIO' + - timeout: + timeout: '400' + abort: true + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - '{installer}-defaults' + - '{slave-label}-defaults' + - string: + name: FUNCTEST_SUITE_NAME + default: 'weekly' + description: "Weekly suite name to run" + - string: + name: DEPLOY_SCENARIO + default: 'os-odl_l2-nofeature-ha' + - string: + name: DOCKER_TAG + default: '{docker-tag}' + description: 'Tag to pull docker image' + - string: + name: CLEAN_DOCKER_IMAGES + default: 'false' + description: 'Remove downloaded docker images (opnfv/functest*:*)' + - functest-parameter: + gs-pathname: '{gs-pathname}' + + scm: + - git-scm + + builders: + - description-setter: + description: "Built on $NODE_NAME" + - 'functest-weekly-builder' +######################## +# builder macros +######################## +- builder: + name: functest-weekly-builder + builders: + - shell: + !include-raw: ./functest-cleanup.sh + - shell: + !include-raw: ./set-functest-env.sh + - shell: + !include-raw: ./functest-loop.sh + - shell: + !include-raw: ../../utils/push-test-logs.sh + - shell: + !include-raw: ./functest-exit.sh diff --git a/jjb/functest/set-functest-env.sh b/jjb/functest/set-functest-env.sh index 583ce8041..05e3d5792 100755 --- a/jjb/functest/set-functest-env.sh +++ b/jjb/functest/set-functest-env.sh @@ -14,34 +14,37 @@ if [[ ${INSTALLER_TYPE} == 'joid' ]]; then fi if [[ ${RC_FILE_PATH} != '' ]] && [[ -f ${RC_FILE_PATH} ]] ; then + echo "Credentials file detected: ${RC_FILE_PATH}" # volume if credentials file path is given to Functest - rc_file_vol="-v $RC_FILE_PATH:/home/opnfv/functest/conf/openstack.creds" + rc_file_vol="-v ${RC_FILE_PATH}:/home/opnfv/functest/conf/openstack.creds" + RC_FLAG=1 fi if [[ ${INSTALLER_TYPE} == 'apex' ]]; then ssh_options="-o UserKnownHostsFile=/dev/null -o StrictHostKeyChecking=no" - if sudo virsh list | grep instack; then - instack_mac=$(sudo virsh domiflist instack | grep default | \ - grep -Eo "[0-9a-f]+:[0-9a-f]+:[0-9a-f]+:[0-9a-f]+:[0-9a-f]+:[0-9a-f]+") - elif sudo virsh list | grep undercloud; then - instack_mac=$(sudo virsh domiflist undercloud | grep default | \ + if sudo virsh list | grep undercloud; then + echo "Installer VM detected" + undercloud_mac=$(sudo virsh domiflist undercloud | grep default | \ grep -Eo "[0-9a-f]+:[0-9a-f]+:[0-9a-f]+:[0-9a-f]+:[0-9a-f]+:[0-9a-f]+") + INSTALLER_IP=$(/usr/sbin/arp -e | grep ${undercloud_mac} | awk {'print $1'}) + sshkey_vol="-v /root/.ssh/id_rsa:/root/.ssh/id_rsa" + sudo scp $ssh_options root@${INSTALLER_IP}:/home/stack/stackrc ${HOME}/stackrc + stackrc_vol="-v ${HOME}/stackrc:/home/opnfv/functest/conf/stackrc" + + if sudo iptables -C FORWARD -o virbr0 -j REJECT --reject-with icmp-port-unreachable 2> ${redirect}; then + sudo iptables -D FORWARD -o virbr0 -j REJECT --reject-with icmp-port-unreachable + fi + if sudo iptables -C FORWARD -i virbr0 -j REJECT --reject-with icmp-port-unreachable 2> ${redirect}; then + sudo iptables -D FORWARD -i virbr0 -j REJECT --reject-with icmp-port-unreachable + fi + elif [[ "$RC_FLAG" == 1 ]]; then + echo "No available installer VM, but credentials provided...continuing" else - echo "No available installer VM exists...exiting" + echo "No available installer VM exists and no credentials provided...exiting" exit 1 fi - INSTALLER_IP=$(/usr/sbin/arp -e | grep ${instack_mac} | awk {'print $1'}) - sshkey_vol="-v /root/.ssh/id_rsa:/root/.ssh/id_rsa" - sudo scp $ssh_options root@${INSTALLER_IP}:/home/stack/stackrc ${HOME}/stackrc - stackrc_vol="-v ${HOME}/stackrc:/home/opnfv/functest/conf/stackrc" - if sudo iptables -C FORWARD -o virbr0 -j REJECT --reject-with icmp-port-unreachable 2> ${redirect}; then - sudo iptables -D FORWARD -o virbr0 -j REJECT --reject-with icmp-port-unreachable - fi - if sudo iptables -C FORWARD -i virbr0 -j REJECT --reject-with icmp-port-unreachable 2> ${redirect}; then - sudo iptables -D FORWARD -i virbr0 -j REJECT --reject-with icmp-port-unreachable - fi fi @@ -56,8 +59,7 @@ DEPLOY_TYPE=baremetal echo "Functest: Start Docker and prepare environment" -branch=${GIT_BRANCH##*/} -dir_result="${HOME}/opnfv/functest/results/${branch}" +dir_result="${HOME}/opnfv/functest/results/${BRANCH##*/}" mkdir -p ${dir_result} sudo rm -rf ${dir_result}/* results_vol="-v ${dir_result}:/home/opnfv/functest/results" @@ -71,17 +73,22 @@ envs="-e INSTALLER_TYPE=${INSTALLER_TYPE} -e INSTALLER_IP=${INSTALLER_IP} \ volumes="${results_vol} ${sshkey_vol} ${stackrc_vol} ${rc_file_vol}" +HOST_ARCH=$(uname -m) +FUNCTEST_IMAGE="opnfv/functest" +if [ "$HOST_ARCH" = "aarch64" ]; then + FUNCTEST_IMAGE="${FUNCTEST_IMAGE}_${HOST_ARCH}" +fi -echo "Functest: Pulling image opnfv/functest:${DOCKER_TAG}" -docker pull opnfv/functest:$DOCKER_TAG >/dev/null +echo "Functest: Pulling image ${FUNCTEST_IMAGE}:${DOCKER_TAG}" +docker pull ${FUNCTEST_IMAGE}:$DOCKER_TAG >/dev/null cmd="sudo docker run --privileged=true -id ${envs} ${volumes} \ ${custom_params} ${TESTCASE_OPTIONS} \ - opnfv/functest:${DOCKER_TAG} /bin/bash" + ${FUNCTEST_IMAGE}:${DOCKER_TAG} /bin/bash" echo "Functest: Running docker run command: ${cmd}" ${cmd} >${redirect} sleep 5 -container_id=$(docker ps | grep "opnfv/functest:${DOCKER_TAG}" | awk '{print $1}' | head -1) +container_id=$(docker ps | grep "${FUNCTEST_IMAGE}:${DOCKER_TAG}" | awk '{print $1}' | head -1) echo "Container ID=${container_id}" if [ -z ${container_id} ]; then echo "Cannot find opnfv/functest container ID ${container_id}. Please check if it is existing." @@ -92,13 +99,13 @@ echo "Starting the container: docker start ${container_id}" docker start ${container_id} sleep 5 docker ps >${redirect} -if [ $(docker ps | grep "opnfv/functest:${DOCKER_TAG}" | wc -l) == 0 ]; then - echo "The container opnfv/functest with ID=${container_id} has not been properly started. Exiting..." +if [ $(docker ps | grep "${FUNCTEST_IMAGE}:${DOCKER_TAG}" | wc -l) == 0 ]; then + echo "The container ${FUNCTEST_IMAGE} with ID=${container_id} has not been properly started. Exiting..." exit 1 fi -if [[ ${branch} == *"brahmaputra"* ]]; then +if [[ "$BRANCH" =~ 'brahmaputra' ]]; then cmd="${FUNCTEST_REPO_DIR}/docker/prepare_env.sh" -elif [[ ${branch} == *"colorado"* ]]; then +elif [[ "$BRANCH" =~ 'colorado' ]]; then cmd="python ${FUNCTEST_REPO_DIR}/ci/prepare_env.py start" else cmd="python ${FUNCTEST_REPO_DIR}/functest/ci/prepare_env.py start" diff --git a/jjb/global/installer-params.yml b/jjb/global/installer-params.yml index 4a50a5906..fc9f34a48 100644 --- a/jjb/global/installer-params.yml +++ b/jjb/global/installer-params.yml @@ -10,10 +10,6 @@ default: apex description: 'Installer used for deploying OPNFV on this POD' - string: - name: DEPLOY_SCENARIO - default: 'none' - description: 'Scenario to deploy and test' - - string: name: EXTERNAL_NETWORK default: 'external' description: 'external network for test' @@ -66,6 +62,10 @@ default: joid description: 'Installer used for deploying OPNFV on this POD' - string: + name: MODEL + default: 'os' + description: 'Model to deploy (os|k8)' + - string: name: OS_RELEASE default: 'newton' description: 'OpenStack release (mitaka|newton)' @@ -89,6 +89,19 @@ name: CPU_ARCHITECTURE default: 'amd64' description: "CPU Architecture to use for Ubuntu distro " + +- parameter: + name: 'daisy-defaults' + parameters: + - string: + name: INSTALLER_IP + default: '10.20.0.2' + description: 'IP of the installer' + - string: + name: INSTALLER_TYPE + default: daisy + description: 'Installer used for deploying OPNFV on this POD' + - parameter: name: 'infra-defaults' parameters: @@ -109,13 +122,9 @@ description: 'IP of the installer' - string: name: INSTALLER_TYPE - default: netvirt + default: apex description: 'Installer used for deploying OPNFV on this POD' - string: - name: DEPLOY_SCENARIO - default: 'os-odl_l2-bgpvpn-noha' - description: 'Scenario to deploy and test' - - string: name: EXTERNAL_NETWORK default: 'external' description: 'external network for test' diff --git a/jjb/global/releng-defaults.yml b/jjb/global/releng-defaults.yml index 5003a8f48..283888603 100644 --- a/jjb/global/releng-defaults.yml +++ b/jjb/global/releng-defaults.yml @@ -3,15 +3,12 @@ - defaults: name: global - logrotate: - daysToKeep: 60 - numToKeep: 200 - artifactDaysToKeep: 30 - artifactNumToKeep: 100 - wrappers: - ssh-agent-wrapper project-type: freestyle node: master + + properties: + - logrotate-default diff --git a/jjb/global/releng-macros.yml b/jjb/global/releng-macros.yml index 10835f6a3..63613f88d 100644 --- a/jjb/global/releng-macros.yml +++ b/jjb/global/releng-macros.yml @@ -26,14 +26,23 @@ name: GS_BASE_PROXY default: build.opnfv.org/artifacts.opnfv.org/$PROJECT description: "URL to Google Storage proxy" - -- parameter: - name: gerrit-parameter - parameters: + - string: + name: BRANCH + default: '{branch}' + description: "JJB configured BRANCH parameter (e.g. master, stable/danube)" - string: name: GERRIT_BRANCH default: '{branch}' - description: "JJB configured GERRIT_BRANCH parameter" + description: "JJB configured GERRIT_BRANCH parameter (deprecated)" + +- property: + name: logrotate-default + properties: + - build-discarder: + days-to-keep: 60 + num-to-keep: 200 + artifact-days-to-keep: 60 + artifact-num-to-keep: 200 - scm: name: git-scm @@ -42,7 +51,7 @@ credentials-id: '$SSH_CREDENTIAL_ID' url: '$GIT_BASE' branches: - - 'origin/$GERRIT_BRANCH' + - 'origin/$BRANCH' timeout: 15 - scm: @@ -52,15 +61,33 @@ choosing-strategy: 'gerrit' refspec: '$GERRIT_REFSPEC' <<: *git-scm-defaults - +- scm: + name: git-scm-with-submodules + scm: + - git: + credentials-id: '$SSH_CREDENTIAL_ID' + url: '$GIT_BASE' + refspec: '' + branches: + - 'refs/heads/{branch}' + skip-tag: true + wipe-workspace: true + submodule: + recursive: true + timeout: 20 + shallow-clone: true - trigger: name: 'daily-trigger-disabled' triggers: - timed: '' -# NOTE: unused macro, but we may use this for some jobs. - trigger: - name: gerrit-trigger-patch-submitted + name: 'weekly-trigger-disabled' + triggers: + - timed: '' + +- trigger: + name: gerrit-trigger-patchset-created triggers: - gerrit: server-name: 'gerrit.opnfv.org' @@ -72,16 +99,25 @@ - draft-published-event - comment-added-contains-event: comment-contains-value: 'recheck' + - comment-added-contains-event: + comment-contains-value: 'reverify' projects: - project-compare-type: 'ANT' - project-pattern: '{name}' + project-pattern: '{project}' branches: - branch-compare-type: 'ANT' branch-pattern: '**/{branch}' + file-paths: + - compare-type: 'ANT' + pattern: '{files}' + skip-vote: + successful: false + failed: false + unstable: false + notbuilt: false -# NOTE: unused macro, but we may use this for some jobs. - trigger: - name: gerrit-trigger-patch-merged + name: gerrit-trigger-change-merged triggers: - gerrit: server-name: 'gerrit.opnfv.org' @@ -91,10 +127,36 @@ comment-contains-value: 'remerge' projects: - project-compare-type: 'ANT' - project-pattern: '{name}' + project-pattern: '{project}' branches: - branch-compare-type: 'ANT' branch-pattern: '**/{branch}' + file-paths: + - compare-type: 'ANT' + pattern: '{files}' + +- trigger: + name: 'experimental' + triggers: + - gerrit: + server-name: 'gerrit.opnfv.org' + trigger-on: + - comment-added-contains-event: + comment-contains-value: 'check-experimental' + projects: + - project-compare-type: 'ANT' + project-pattern: '{project}' + branches: + - branch-compare-type: 'ANT' + branch-pattern: '**/{branch}' + file-paths: + - compare-type: 'ANT' + pattern: 'tests/**' + skip-vote: + successful: true + failed: true + unstable: true + notbuilt: true - wrapper: name: ssh-agent-wrapper @@ -386,6 +448,12 @@ sed -r -i '4,$s/^/ /g' lint.log fi +- builder: + name: clean-workspace-log + builders: + - shell: | + find $WORKSPACE -type f -name '*.log' | xargs rm -f + - publisher: name: archive-artifacts publishers: @@ -394,3 +462,23 @@ allow-empty: true fingerprint: true latest-only: true + +- publisher: + name: publish-coverage + publishers: + - cobertura: + report-file: "coverage.xml" + only-stable: "true" + health-auto-update: "false" + stability-auto-update: "false" + zoom-coverage-chart: "true" + targets: + - files: + healthy: 10 + unhealthy: 20 + failing: 30 + - method: + healthy: 50 + unhealthy: 40 + failing: 30 + diff --git a/jjb/global/slave-params.yml b/jjb/global/slave-params.yml index 39a1b1b9c..4b3eaaabf 100644 --- a/jjb/global/slave-params.yml +++ b/jjb/global/slave-params.yml @@ -178,6 +178,23 @@ name: EXTERNAL_NETWORK default: ext-net description: "External network floating ips" +- parameter: + name: 'daisy-baremetal-defaults' + parameters: + - node: + name: SLAVE_NAME + description: 'Slave name on Jenkins' + allowed-slaves: + - zte-pod2 + default-slaves: + - zte-pod2 + - label: + name: SLAVE_LABEL + default: 'daisy-baremetal' + - string: + name: GIT_BASE + default: https://gerrit.opnfv.org/gerrit/$PROJECT + description: 'Git URL to use on this Jenkins Slave' ##################################################### # Parameters for CI virtual PODs ##################################################### @@ -239,15 +256,33 @@ name: GIT_BASE default: https://gerrit.opnfv.org/gerrit/$PROJECT description: 'Git URL to use on this Jenkins Slave' +- parameter: + name: 'daisy-virtual-defaults' + parameters: + - node: + name: SLAVE_NAME + description: 'Slave name on Jenkins' + allowed-slaves: + - zte-virtual1 + - zte-virtual2 + default-slaves: + - zte-virtual1 + - label: + name: SLAVE_LABEL + default: 'daisy-virtual' + - string: + name: GIT_BASE + default: https://gerrit.opnfv.org/gerrit/$PROJECT + description: 'Git URL to use on this Jenkins Slave' ##################################################### # Parameters for build slaves ##################################################### - parameter: - name: 'opnfv-build-arm-defaults' + name: 'opnfv-build-enea-defaults' parameters: - label: name: SLAVE_LABEL - default: 'opnfv-build-arm' + default: 'opnfv-build-enea' - string: name: GIT_BASE default: https://gerrit.opnfv.org/gerrit/$PROJECT @@ -314,6 +349,21 @@ name: GIT_BASE default: https://gerrit.opnfv.org/gerrit/$PROJECT description: 'Git URL to use on this Jenkins Slave' +- parameter: + name: 'opnfv-build-ubuntu-arm-defaults' + parameters: + - label: + name: SLAVE_LABEL + default: 'opnfv-build-ubuntu-arm' + description: 'Slave label on Jenkins' + - string: + name: GIT_BASE + default: https://gerrit.opnfv.org/gerrit/$PROJECT + description: 'Git URL to use on this Jenkins Slave' + - string: + name: BUILD_DIRECTORY + default: $WORKSPACE/build_output + description: "Directory where the build artifact will be located upon the completion of the build." ##################################################### # Parameters for none-CI PODs ##################################################### @@ -332,6 +382,20 @@ default: https://gerrit.opnfv.org/gerrit/$PROJECT description: 'Git URL to use on this Jenkins Slave' - parameter: + name: 'cengn-pod1-defaults' + parameters: + - node: + name: SLAVE_NAME + description: 'Slave name on Jenkins' + allowed-slaves: + - cengn-pod1 + default-slaves: + - cengn-pod1 + - string: + name: GIT_BASE + default: https://gerrit.opnfv.org/gerrit/$PROJECT + description: 'Git URL to use on this Jenkins Slave' +- parameter: name: 'intel-pod1-defaults' parameters: - node: @@ -364,15 +428,43 @@ default: /root/.ssh/id_rsa description: 'SSH key to use for Apex' - parameter: - name: 'intel-pod3-defaults' + name: 'intel-pod9-defaults' parameters: - node: name: SLAVE_NAME description: 'Slave name on Jenkins' allowed-slaves: - - intel-pod3 + - intel-pod9 default-slaves: - - intel-pod3 + - intel-pod9 + - string: + name: GIT_BASE + default: https://gerrit.opnfv.org/gerrit/$PROJECT + description: 'Git URL to use on this Jenkins Slave' +- parameter: + name: 'intel-pod10-defaults' + parameters: + - node: + name: SLAVE_NAME + description: 'Slave name on Jenkins' + allowed-slaves: + - intel-pod10 + default-slaves: + - intel-pod10 + - string: + name: GIT_BASE + default: https://gerrit.opnfv.org/gerrit/$PROJECT + description: 'Git URL to use on this Jenkins Slave' +- parameter: + name: 'intel-pod12-defaults' + parameters: + - node: + name: SLAVE_NAME + description: 'Slave name on Jenkins' + allowed-slaves: + - intel-pod12 + default-slaves: + - intel-pod12 - string: name: GIT_BASE default: https://gerrit.opnfv.org/gerrit/$PROJECT @@ -412,15 +504,28 @@ default: https://gerrit.opnfv.org/gerrit/$PROJECT description: 'Git URL to use on this Jenkins Slave' - parameter: - name: 'huawei-pod5-defaults' + name: 'intel-pod8-defaults' + parameters: + - node: + name: SLAVE_NAME + description: 'Slave name on Jenkins' + allowed-slaves: + - intel-pod8 + default-slaves: + - intel-pod8 + - string: + name: GIT_BASE + default: https://gerrit.opnfv.org/gerrit/$PROJECT +- parameter: + name: 'huawei-virtual7-defaults' parameters: - node: name: SLAVE_NAME description: 'Slave name on Jenkins' allowed-slaves: - - huawei-pod5 + - huawei-virtual7 default-slaves: - - huawei-pod5 + - huawei-virtual7 - string: name: GIT_BASE default: https://gerrit.opnfv.org/gerrit/$PROJECT @@ -656,15 +761,17 @@ default: https://gerrit.opnfv.org/gerrit/$PROJECT description: 'Git URL to use on this Jenkins Slave' - parameter: - name: 'ool-virtual1-defaults' + name: 'ool-defaults' parameters: - node: name: SLAVE_NAME description: 'Slave name on Jenkins' allowed-slaves: - ool-virtual1 + - ool-virtual2 + - ool-virtual3 default-slaves: - - ool-virtual1 + - '{default-slave}' - string: name: GIT_BASE default: https://gerrit.opnfv.org/gerrit/$PROJECT @@ -674,6 +781,21 @@ default: /root/.ssh/id_rsa description: 'SSH key to be used' - parameter: + name: 'ool-virtual1-defaults' + parameters: + - 'ool-defaults': + default-slave: 'ool-virtual1' +- parameter: + name: 'ool-virtual2-defaults' + parameters: + - 'ool-defaults': + default-slave: 'ool-virtual2' +- parameter: + name: 'ool-virtual3-defaults' + parameters: + - 'ool-defaults': + default-slave: 'ool-virtual3' +- parameter: name: 'multisite-virtual-defaults' parameters: - label: @@ -694,6 +816,26 @@ default: https://git.opendaylight.org/gerrit/p/$PROJECT.git description: 'Git URL to use on this Jenkins Slave' - parameter: + name: 'ericsson-virtual12-defaults' + parameters: + - label: + name: SLAVE_LABEL + default: 'ericsson-virtual12' + - string: + name: GIT_BASE + default: https://gerrit.opnfv.org/gerrit/$PROJECT + description: 'Git URL to use on this Jenkins Slave' +- parameter: + name: 'ericsson-virtual13-defaults' + parameters: + - label: + name: SLAVE_LABEL + default: 'ericsson-virtual13' + - string: + name: GIT_BASE + default: https://gerrit.opnfv.org/gerrit/$PROJECT + description: 'Git URL to use on this Jenkins Slave' +- parameter: name: 'odl-netvirt-virtual-defaults' parameters: - label: diff --git a/jjb/infra/bifrost-cleanup-job.yml b/jjb/infra/bifrost-cleanup-job.yml new file mode 100644 index 000000000..f1b38ca4b --- /dev/null +++ b/jjb/infra/bifrost-cleanup-job.yml @@ -0,0 +1,136 @@ +- project: + name: 'openstack-bifrost-cleanup' +#-------------------------------- +# branches +#-------------------------------- + stream: + - master: + branch: '{stream}' + +#-------------------------------- +# projects +#-------------------------------- + project: + - 'openstack': + project-repo: 'https://git.openstack.org/openstack/bifrost' + clone-location: '/opt/bifrost' + - 'opnfv': + project-repo: 'https://gerrit.opnfv.org/gerrit/releng' + clone-location: '/opt/releng' + +#-------------------------------- +# jobs +#-------------------------------- + jobs: + - '{project}-bifrost-cleanup-{stream}' + +- job-template: + name: '{project}-bifrost-cleanup-{stream}' + + concurrent: false + + node: bifrost-verify-virtual + + # Make sure no verify job is running on any of the slaves since that would + # produce build logs after we wipe the destination directory. + properties: + - build-blocker: + blocking-jobs: + - '{project}-bifrost-verify-*' + + parameters: + - string: + name: PROJECT + default: '{project}' + + builders: + - shell: | + #!/bin/bash + + set -eu + + # DO NOT change this unless you know what you are doing. + BIFROST_GS_URL="gs://artifacts.opnfv.org/cross-community-ci/openstack/bifrost/$GERRIT_NAME/$GERRIT_CHANGE_NUMBER/" + + # This should never happen... even 'recheck' uses the last jobs' + # gerrit information. Better exit with error so we can investigate + [[ ! -n $GERRIT_NAME ]] || [[ ! -n $GERRIT_CHANGE_NUMBER ]] && exit 1 + + echo "Removing build artifacts for $GERRIT_NAME/$GERRIT_CHANGE_NUMBER" + + if ! [[ "$BIFROST_GS_URL" =~ "/cross-community-ci/openstack/bifrost/" ]]; then + echo "Oops! BIFROST_GS_URL=$BIFROST_GS_URL does not seem like a valid" + echo "bifrost location on the Google storage server. Please double-check" + echo "that it's set properly or fix this line if necessary." + echo "gsutil will not be executed until this is fixed!" + exit 1 + fi + # No force (-f). We always verify upstream jobs so if there are no logs + # something else went wrong and we need to break immediately and investigate + gsutil -m rm -r $BIFROST_GS_URL + + triggers: + - '{project}-gerrit-trigger-cleanup': + branch: '{branch}' + + publishers: + - email: + recipients: fatih.degirmenci@ericsson.com yroblamo@redhat.com mchandras@suse.de jack.morgan@intel.com zhang.jun3g@zte.com.cn +#-------------------------------- +# trigger macros +#-------------------------------- +- trigger: + name: 'openstack-gerrit-trigger-cleanup' + triggers: + - gerrit: + server-name: 'review.openstack.org' + escape-quotes: true + trigger-on: + # We only run this when the change is merged or + # abandoned since we don't need the logs anymore + - change-merged-event: 'true' + - change-abandoned-event: 'true' + - change-restored-event: 'false' + - draft-published-event: 'false' + # This is an OPNFV maintenance job. We don't want to provide + # feedback on Gerrit + silent: true + silent-start: true + projects: + - project-compare-type: 'PLAIN' + project-pattern: 'openstack/bifrost' + branches: + - branch-compare-type: 'ANT' + branch-pattern: '**/{branch}' + forbidden-file-paths: + - compare-type: ANT + pattern: 'doc/**' + - compare-type: ANT + pattern: 'releasenotes/**' + readable-message: true +- trigger: + name: 'opnfv-gerrit-trigger-cleanup' + triggers: + - gerrit: + server-name: 'gerrit.opnfv.org' + trigger-on: + # We only run this when the change is merged or + # abandoned since we don't need the logs anymore + - change-merged-event: 'true' + - change-abandoned-event: 'true' + - change-restored-event: 'false' + - draft-published-event: 'false' + # This is an OPNFV maintenance job. We don't want to provide + # feedback on Gerrit + silent: true + silent-start: true + projects: + - project-compare-type: 'ANT' + project-pattern: 'releng' + branches: + - branch-compare-type: 'ANT' + branch-pattern: '**/{branch}' + file-paths: + - compare-type: ANT + pattern: 'prototypes/bifrost/**' + readable-message: true diff --git a/jjb/infra/bifrost-upload-logs.sh b/jjb/infra/bifrost-upload-logs.sh deleted file mode 100755 index e2b8126e4..000000000 --- a/jjb/infra/bifrost-upload-logs.sh +++ /dev/null @@ -1,29 +0,0 @@ -#!/bin/bash -# SPDX-license-identifier: Apache-2.0 -############################################################################## -# Copyright (c) 2016 SUSE. -# All rights reserved. This program and the accompanying materials -# are made available under the terms of the Apache License, Version 2.0 -# which accompanies this distribution, and is available at -# http://www.apache.org/licenses/LICENSE-2.0 -############################################################################## - -set -eu -set -o pipefail - -BIFROST_CONSOLE_LOG="${BUILD_URL}/consoleText" -BIFROST_GS_URL=${BIFROST_GS_STORAGE/http:/gs:} - -echo "Uploading build logs to ${BIFROST_LOG_URL}" - -echo "Uploading console output" -curl -L ${BIFROST_CONSOLE_LOG} | gsutil cp - ${BIFROST_GS_URL}/console.txt - -[[ ! -d ${WORKSPACE}/logs ]] && exit 0 - -pushd ${WORKSPACE}/logs/ &> /dev/null -for x in *.log; do - echo "Compressing and uploading $x" - tar -czf - $x | gsutil cp - ${BIFROST_GS_URL}/$x.tar.gz -done -popd ${WORKSPACE}/logs &> /dev/null diff --git a/jjb/infra/bifrost-verify-jobs.yml b/jjb/infra/bifrost-verify-jobs.yml index cbe21e256..d595d4bef 100644 --- a/jjb/infra/bifrost-verify-jobs.yml +++ b/jjb/infra/bifrost-verify-jobs.yml @@ -38,9 +38,6 @@ dib-os-element: 'opensuse-minimal' dib-os-packages: 'vim,less,bridge-utils,iputils,rsyslog,curl' extra-dib-elements: 'openssh-server' - vm-disk: '30' - vm-memory: '4096' - vm-cpu: '2' #-------------------------------- # type #-------------------------------- @@ -57,9 +54,10 @@ #-------------------------------- - defaults: name: vm_defaults - vm-disk: '100' - vm-memory: '8192' - vm-cpu: '4' + vm-disk: '30' + vm-disk-cache: 'unsafe' + vm-memory: '4096' + vm-cpu: '2' #-------------------------------- # job templates @@ -74,6 +72,7 @@ concurrent: false properties: + - logrotate-default - build-blocker: use-build-blocker: true blocking-jobs: @@ -109,6 +108,9 @@ name: VM_DISK default: '{vm-disk}' - string: + name: VM_DISK_CACHE + default: '{vm-disk-cache}' + - string: name: VM_MEMORY default: '{vm-memory}' - string: @@ -129,7 +131,7 @@ url: '$PROJECT_REPO' refspec: '$GERRIT_REFSPEC' branches: - - 'origin/$GERRIT_BRANCH' + - 'origin/$BRANCH' skip-tag: true choosing-strategy: 'gerrit' timeout: 10 @@ -142,11 +144,10 @@ builders: - bifrost-set-name - bifrost-build - - bifrost-artifacts-upload publishers: - email: - recipients: fatih.degirmenci@ericsson.com yroblamo@redhat.com mchandras@suse.de jack.morgan@intel.com zhang.jun3g@zte.com.cn + recipients: fatih.degirmenci@ericsson.com yroblamo@redhat.com mchandras@suse.de jack.morgan@intel.com julienjut@gmail.com #-------------------------------- # trigger macros #-------------------------------- @@ -163,7 +164,7 @@ exclude-no-code-change: 'false' - comment-added-contains-event: comment-contains-value: 'recheck' - custom-url: '* $JOB_NAME $BIFROST_LOG_URL' + custom-url: '* $JOB_NAME $BIFROST_LOG_URL/index.html' silent-start: true projects: - project-compare-type: 'PLAIN' @@ -192,7 +193,7 @@ comment-contains-value: 'recheck' - comment-added-contains-event: comment-contains-value: 'reverify' - custom-url: '* $JOB_NAME $BIFROST_LOG_URL' + custom-url: '* $JOB_NAME $BIFROST_LOG_URL/index.html' projects: - project-compare-type: 'ANT' project-pattern: 'releng' @@ -202,8 +203,6 @@ file-paths: - compare-type: ANT pattern: 'prototypes/bifrost/**' - - compare-type: ANT - pattern: 'jjb/infra/**' readable-message: true #--------------------------- @@ -220,9 +219,3 @@ builders: - shell: !include-raw: ./bifrost-verify.sh - -- builder: - name: bifrost-artifacts-upload - builders: - - shell: - !include-raw: ./bifrost-upload-logs.sh diff --git a/jjb/infra/bifrost-verify.sh b/jjb/infra/bifrost-verify.sh index 9fbb1d0d9..4115ffcc4 100755 --- a/jjb/infra/bifrost-verify.sh +++ b/jjb/infra/bifrost-verify.sh @@ -11,7 +11,63 @@ set -o errexit set -o nounset set -o pipefail -trap fix_ownership EXIT +trap cleanup_and_upload EXIT + +function upload_logs() { + BIFROST_CONSOLE_LOG="${BUILD_URL}/consoleText" + BIFROST_GS_URL=${BIFROST_LOG_URL/http:/gs:} + + # Make sure the old landing page is gone in case + # we break later on. We don't want to publish + # stale information. + # TODO: Maybe cleanup the entire $BIFROST_GS_URL directory + # before we upload the new data. + gsutil -q rm ${BIFROST_GS_URL}/index.html || true + + echo "Uploading collected bifrost build logs to ${BIFROST_LOG_URL}" + + if [[ -d ${WORKSPACE}/logs ]]; then + pushd ${WORKSPACE}/logs &> /dev/null + for x in *.log; do + echo "Compressing and uploading $x" + gsutil -q cp -Z ${x} ${BIFROST_GS_URL}/${x} + done + popd &> /dev/null + fi + + echo "Generating the ${BIFROST_LOG_URL}/index.html landing page" + cat > ${WORKSPACE}/index.html <<EOF +<html> +<h1>Build results for <a href=https://$GERRIT_NAME/#/c/$GERRIT_CHANGE_NUMBER/$GERRIT_PATCHSET_NUMBER>$GERRIT_NAME/$GERRIT_CHANGE_NUMBER/$GERRIT_PATCHSET_NUMBER</a></h1> +<h2>Job: <a href=${BUILD_URL}>$JOB_NAME</a></h2> +<ul> +<li><a href=${BIFROST_LOG_URL}/build_log.txt>build_log.txt</a></li> +EOF + + if [[ -d ${WORKSPACE}/logs ]]; then + pushd ${WORKSPACE}/logs &> /dev/null + for x in *.log; do + echo "<li><a href=${BIFROST_LOG_URL}/${x}>${x}</a></li>" >> ${WORKSPACE}/index.html + done + popd &> /dev/null + fi + + cat >> ${WORKSPACE}/index.html << EOF +</ul> +</html> +EOF + + # Finally, download and upload the entire build log so we can retain + # as much build information as possible + echo "Uploading the final console output" + curl -s -L ${BIFROST_CONSOLE_LOG} > ${WORKSPACE}/build_log.txt + gsutil -q cp -Z ${WORKSPACE}/build_log.txt ${BIFROST_GS_URL}/build_log.txt + rm ${WORKSPACE}/build_log.txt + + # Upload landing page + gsutil -q cp ${WORKSPACE}/index.html ${BIFROST_GS_URL}/index.html + rm ${WORKSPACE}/index.html +} function fix_ownership() { if [ -z "${JOB_URL+x}" ]; then @@ -25,6 +81,13 @@ function fix_ownership() { fi } +function cleanup_and_upload() { + original_exit=$? + fix_ownership + upload_logs + exit $original_exit +} + # check distro to see if we support it if [[ ! "$DISTRO" =~ (trusty|centos7|suse) ]]; then echo "Distro $DISTRO is not supported!" diff --git a/jjb/ipv6/ipv6.yml b/jjb/ipv6/ipv6.yml index da54c521e..a6745cd99 100644 --- a/jjb/ipv6/ipv6.yml +++ b/jjb/ipv6/ipv6.yml @@ -28,7 +28,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' diff --git a/jjb/joid/joid-daily-jobs.yml b/jjb/joid/joid-daily-jobs.yml index 91fcc8814..93cad0f0c 100644 --- a/jjb/joid/joid-daily-jobs.yml +++ b/jjb/joid/joid-daily-jobs.yml @@ -46,6 +46,9 @@ - orange-pod1: slave-label: orange-pod1 <<: *master + - cengn-pod1: + slave-label: cengn-pod1 + <<: *master #-------------------------------- # scenarios #-------------------------------- @@ -72,6 +75,10 @@ auto-trigger-name: 'daily-trigger-disabled' - 'os-ocl-nofeature-noha': auto-trigger-name: 'daily-trigger-disabled' + - 'k8-nosdn-nofeature-noha': + auto-trigger-name: 'joid-{scenario}-{pod}-{stream}-trigger' + - 'k8-nosdn-lb-noha': + auto-trigger-name: 'daily-trigger-disabled' jobs: - 'joid-{scenario}-{pod}-daily-{stream}' @@ -88,6 +95,7 @@ concurrent: false properties: + - logrotate-default - throttle: enabled: true max-total: 4 @@ -109,6 +117,7 @@ parameters: - project-parameter: project: '{project}' + branch: '{branch}' - '{installer}-defaults' - '{slave-label}-defaults': installer: '{installer}' @@ -148,6 +157,23 @@ build-step-failure-threshold: 'never' failure-threshold: 'never' unstable-threshold: 'FAILURE' + # 1.dovetail only master by now, not sync with A/B/C branches + # 2.here the stream means the SUT stream, dovetail stream is defined in its own job + # 3.only debug testsuite here(includes basic testcase, + # i.e. one tempest smoke ipv6, two vping from functest) + # 4.not used for release criteria or compliance, + # only to debug the dovetail tool bugs with joid + - trigger-builds: + - project: 'dovetail-joid-{pod}-debug-{stream}' + current-parameters: false + predefined-parameters: + DEPLOY_SCENARIO={scenario} + block: true + same-node: true + block-thresholds: + build-step-failure-threshold: 'never' + failure-threshold: 'never' + unstable-threshold: 'FAILURE' - job-template: name: 'joid-deploy-{pod}-daily-{stream}' @@ -157,6 +183,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 4 @@ -178,7 +205,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{installer}-defaults' - '{slave-label}-defaults': @@ -226,6 +252,10 @@ name: 'joid-os-nosdn-nofeature-ha-orange-pod1-master-trigger' triggers: - timed: '' +- trigger: + name: 'joid-os-nosdn-nofeature-ha-cengn-pod1-master-trigger' + triggers: + - timed: '' # os-nosdn-nofeature-ha trigger - branch: danube - trigger: name: 'joid-os-nosdn-nofeature-ha-baremetal-danube-trigger' @@ -239,6 +269,10 @@ name: 'joid-os-nosdn-nofeature-ha-orange-pod1-danube-trigger' triggers: - timed: '' +- trigger: + name: 'joid-os-nosdn-nofeature-ha-cengn-pod1-danube-trigger' + triggers: + - timed: '' # os-odl_l2-nofeature-ha trigger - branch: master - trigger: name: 'joid-os-odl_l2-nofeature-ha-baremetal-master-trigger' @@ -252,6 +286,10 @@ name: 'joid-os-odl_l2-nofeature-ha-orange-pod1-master-trigger' triggers: - timed: '' +- trigger: + name: 'joid-os-odl_l2-nofeature-ha-cengn-pod1-master-trigger' + triggers: + - timed: '' # os-odl_l2-nofeature-ha trigger - branch: danube - trigger: name: 'joid-os-odl_l2-nofeature-ha-baremetal-danube-trigger' @@ -265,6 +303,10 @@ name: 'joid-os-odl_l2-nofeature-ha-orange-pod1-danube-trigger' triggers: - timed: '' +- trigger: + name: 'joid-os-odl_l2-nofeature-ha-cengn-pod1-danube-trigger' + triggers: + - timed: '' # os-onos-nofeature-ha trigger - branch: master - trigger: name: 'joid-os-onos-nofeature-ha-baremetal-master-trigger' @@ -278,6 +320,10 @@ name: 'joid-os-onos-nofeature-ha-orange-pod1-master-trigger' triggers: - timed: '' +- trigger: + name: 'joid-os-onos-nofeature-ha-cengn-pod1-master-trigger' + triggers: + - timed: '' # os-onos-nofeature-ha trigger - branch: danube - trigger: name: 'joid-os-onos-nofeature-ha-baremetal-danube-trigger' @@ -291,6 +337,10 @@ name: 'joid-os-onos-nofeature-ha-orange-pod1-danube-trigger' triggers: - timed: '' +- trigger: + name: 'joid-os-onos-nofeature-ha-cengn-pod1-danube-trigger' + triggers: + - timed: '' # os-onos-sfc-ha trigger - branch: master - trigger: name: 'joid-os-onos-sfc-ha-baremetal-master-trigger' @@ -304,6 +354,10 @@ name: 'joid-os-onos-sfc-ha-orange-pod1-master-trigger' triggers: - timed: '' +- trigger: + name: 'joid-os-onos-sfc-ha-cengn-pod1-master-trigger' + triggers: + - timed: '' # os-onos-sfc-ha trigger - branch: danube - trigger: name: 'joid-os-onos-sfc-ha-baremetal-danube-trigger' @@ -317,6 +371,10 @@ name: 'joid-os-onos-sfc-ha-orange-pod1-danube-trigger' triggers: - timed: '' +- trigger: + name: 'joid-os-onos-sfc-ha-cengn-pod1-danube-trigger' + triggers: + - timed: '' # os-nosdn-lxd-noha trigger - branch: master - trigger: name: 'joid-os-nosdn-lxd-noha-baremetal-master-trigger' @@ -330,6 +388,10 @@ name: 'joid-os-nosdn-lxd-noha-orange-pod1-master-trigger' triggers: - timed: '' +- trigger: + name: 'joid-os-nosdn-lxd-noha-cengn-pod1-master-trigger' + triggers: + - timed: '' # os-nosdn-lxd-noha trigger - branch: danube - trigger: name: 'joid-os-nosdn-lxd-noha-baremetal-danube-trigger' @@ -343,6 +405,10 @@ name: 'joid-os-nosdn-lxd-noha-orange-pod1-danube-trigger' triggers: - timed: '' +- trigger: + name: 'joid-os-nosdn-lxd-noha-cengn-pod1-danube-trigger' + triggers: + - timed: '' # os-nosdn-lxd-ha trigger - branch: master - trigger: name: 'joid-os-nosdn-lxd-ha-baremetal-master-trigger' @@ -356,6 +422,10 @@ name: 'joid-os-nosdn-lxd-ha-orange-pod1-master-trigger' triggers: - timed: '' +- trigger: + name: 'joid-os-nosdn-lxd-ha-cengn-pod1-master-trigger' + triggers: + - timed: '' # os-nosdn-lxd-ha trigger - branch: danube - trigger: name: 'joid-os-nosdn-lxd-ha-baremetal-danube-trigger' @@ -369,6 +439,10 @@ name: 'joid-os-nosdn-lxd-ha-orange-pod1-danube-trigger' triggers: - timed: '' +- trigger: + name: 'joid-os-nosdn-lxd-ha-cengn-pod1-danube-trigger' + triggers: + - timed: '' # os-nosdn-nofeature-noha trigger - branch: master - trigger: name: 'joid-os-nosdn-nofeature-noha-baremetal-master-trigger' @@ -382,6 +456,10 @@ name: 'joid-os-nosdn-nofeature-noha-orange-pod1-master-trigger' triggers: - timed: '' +- trigger: + name: 'joid-os-nosdn-nofeature-noha-cengn-pod1-master-trigger' + triggers: + - timed: '' # os-nosdn-nofeature-noha trigger - branch: danube - trigger: name: 'joid-os-nosdn-nofeature-noha-baremetal-danube-trigger' @@ -395,3 +473,75 @@ name: 'joid-os-nosdn-nofeature-noha-orange-pod1-danube-trigger' triggers: - timed: '' +- trigger: + name: 'joid-os-nosdn-nofeature-noha-cengn-pod1-danube-trigger' + triggers: + - timed: '' +# k8-nosdn-nofeature-noha trigger - branch: master +- trigger: + name: 'joid-k8-nosdn-nofeature-noha-baremetal-master-trigger' + triggers: + - timed: '5 15 * * *' +- trigger: + name: 'joid-k8-nosdn-nofeature-noha-virtual-master-trigger' + triggers: + - timed: '' +- trigger: + name: 'joid-k8-nosdn-nofeature-noha-orange-pod1-master-trigger' + triggers: + - timed: '' +- trigger: + name: 'joid-k8-nosdn-nofeature-noha-cengn-pod1-master-trigger' + triggers: + - timed: '' +# k8-nosdn-nofeature-noha trigger - branch: danube +- trigger: + name: 'joid-k8-nosdn-nofeature-noha-baremetal-danube-trigger' + triggers: + - timed: '0 15 * * *' +- trigger: + name: 'joid-k8-nosdn-nofeature-noha-virtual-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'joid-k8-nosdn-nofeature-noha-orange-pod1-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'joid-k8-nosdn-nofeature-noha-cengn-pod1-danube-trigger' + triggers: + - timed: '' +# k8-nosdn-lb-noha trigger - branch: master +- trigger: + name: 'joid-k8-nosdn-lb-noha-baremetal-master-trigger' + triggers: + - timed: '5 20 * * *' +- trigger: + name: 'joid-k8-nosdn-lb-noha-virtual-master-trigger' + triggers: + - timed: '' +- trigger: + name: 'joid-k8-nosdn-lb-noha-orange-pod1-master-trigger' + triggers: + - timed: '' +- trigger: + name: 'joid-k8-nosdn-lb-noha-cengn-pod1-master-trigger' + triggers: + - timed: '' +# k8-nosdn-lb-noha trigger - branch: danube +- trigger: + name: 'joid-k8-nosdn-lb-noha-baremetal-danube-trigger' + triggers: + - timed: '0 20 * * *' +- trigger: + name: 'joid-k8-nosdn-lb-noha-virtual-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'joid-k8-nosdn-lb-noha-orange-pod1-danube-trigger' + triggers: + - timed: '' +- trigger: + name: 'joid-k8-nosdn-lb-noha-cengn-pod1-danube-trigger' + triggers: + - timed: '' diff --git a/jjb/joid/joid-deploy.sh b/jjb/joid/joid-deploy.sh index 05c2de1fc..e197dbd8c 100644 --- a/jjb/joid/joid-deploy.sh +++ b/jjb/joid/joid-deploy.sh @@ -45,17 +45,24 @@ export POD_NAME=${POD/-} ## cd $WORKSPACE/ci -if [ -e "$LAB_CONFIG/environments.yaml" ] && [ "$MAAS_REINSTALL" == "false" ]; then + +if [ -e "$LAB_CONFIG/deployconfig.yaml" ] && [ "$MAAS_REINSTALL" == "false" ]; then echo "------ Recover Juju environment to use MAAS ------" - cp $LAB_CONFIG/environments.yaml . - cp $LAB_CONFIG/deployment.yaml . - if [ -e $LAB_CONFIG/deployconfig.yaml ]; then + if [ ! -e deployconfig.yaml ]; then cp $LAB_CONFIG/deployconfig.yaml . + cp $LAB_CONFIG/deployment.yaml . + cp $LAB_CONFIG/labconfig.yaml . fi else - echo "------ Redeploy MAAS ------" - ./00-maasdeploy.sh $POD_NAME - exit_on_error $? "MAAS Deploy FAILED" + if ["$NODE_NAME" == "default" ]; then + echo "------ Redeploy MAAS ------" + ./03-maasdeploy.sh default + exit_on_error $? "MAAS Deploy FAILED" + else + echo "------ Redeploy MAAS ------" + ./03-maasdeploy.sh custom $LAB_CONFIG/labconfig.yaml + exit_on_error $? "MAAS Deploy FAILED" + fi fi ## @@ -64,8 +71,9 @@ fi # Based on scenario naming we can get joid options # naming convention: -# os-<controller>-<nfvfeature>-<mode>[-<extrastuff>] +# <model>-<controller>-<nfvfeature>-<mode>[-<extrastuff>] # With parameters: +# model=(os|k8) # controller=(nosdn|odl_l3|odl_l2|onos|ocl) # No odl_l3 today # nfvfeature=(kvm|ovs|dpdk|nofeature) @@ -77,6 +85,7 @@ fi IFS='-' read -r -a DEPLOY_OPTIONS <<< "${DEPLOY_SCENARIO}--" #last -- need to avoid nounset error +JOID_MODEL=${DEPLOY_OPTIONS[0]} SDN_CONTROLLER=${DEPLOY_OPTIONS[1]} NFV_FEATURES=${DEPLOY_OPTIONS[2]} HA_MODE=${DEPLOY_OPTIONS[3]} @@ -103,49 +112,47 @@ fi ## Configure Joid deployment ## -echo "------ Deploy with juju ------" -echo "Execute: ./deploy.sh -t $HA_MODE -o $OS_RELEASE -s $SDN_CONTROLLER -l $POD_NAME -d $UBUNTU_DISTRO -f $NFV_FEATURES" +if [ "$JOID_MODEL" == 'k8' ]; then + echo "------ Deploy with juju ------" + echo "Execute: ./deploy.sh -m $JOID_MODEL -s $SDN_CONTROLLER -l $POD_NAME -d $UBUNTU_DISTRO -f $NFV_FEATURES" -./deploy.sh -t $HA_MODE -o $OS_RELEASE -s $SDN_CONTROLLER -l $POD_NAME -d $UBUNTU_DISTRO -f $NFV_FEATURES -exit_on_error $? "Main deploy FAILED" + ./deploy.sh -m kubernetes -s $SDN_CONTROLLER -l $POD_NAME -d $UBUNTU_DISTRO -f $NFV_FEATURES + exit_on_error $? "Main deploy FAILED" +fi ## ## Set Admin RC ## -JOID_ADMIN_OPENRC=$LAB_CONFIG/admin-openrc -echo "------ Create OpenRC file [$JOID_ADMIN_OPENRC] ------" - -# get controller IP -case "$SDN_CONTROLLER" in - "odl") - SDN_CONTROLLER_IP=$(juju status odl-controller/0 |grep public-address|sed -- 's/.*\: //') - ;; - "onos") - SDN_CONTROLLER_IP=$(juju status onos-controller/0 |grep public-address|sed -- 's/.*\: //') - ;; - *) - SDN_CONTROLLER_IP='none' - ;; -esac -SDN_PASSWORD='admin' - -# export the openrc file by getting the one generated by joid and add SDN -# controller for Functest -cp ./cloud/admin-openrc $JOID_ADMIN_OPENRC -cat << EOF >> $JOID_ADMIN_OPENRC -export SDN_CONTROLLER=$SDN_CONTROLLER_IP -export SDN_PASSWORD=$SDN_PASSWORD -EOF - -## -## Backup local juju env -## +if [ "$JOID_MODEL" == 'os' ]; then + echo "------ Deploy with juju ------" + echo "Execute: ./deploy.sh -m $JOID_MODEL -t $HA_MODE -o $OS_RELEASE -s $SDN_CONTROLLER -l $POD_NAME -d $UBUNTU_DISTRO -f $NFV_FEATURES" + + ./deploy.sh -m openstack -t $HA_MODE -o $OS_RELEASE -s $SDN_CONTROLLER -l $POD_NAME -d $UBUNTU_DISTRO -f $NFV_FEATURES + exit_on_error $? "Main deploy FAILED" + + JOID_ADMIN_OPENRC=$LAB_CONFIG/admin-openrc + echo "------ Create OpenRC file [$JOID_ADMIN_OPENRC] ------" + + # get controller IP + case "$SDN_CONTROLLER" in + "odl") + SDN_CONTROLLER_IP=$(juju status odl-controller/0 |grep public-address|sed -- 's/.*\: //') + ;; + "onos") + SDN_CONTROLLER_IP=$(juju status onos-controller/0 |grep public-address|sed -- 's/.*\: //') + ;; + *) + SDN_CONTROLLER_IP='none' + ;; + esac + SDN_PASSWORD='admin' + + # export the openrc file by getting the one generated by joid and add SDN + # controller for Functest + # cp ./cloud/admin-openrc $JOID_ADMIN_OPENRC + echo export SDN_CONTROLLER=$SDN_CONTROLLER_IP >> $JOID_ADMIN_OPENRC + echo export SDN_PASSWORD=$SDN_PASSWORD >> $JOID_ADMIN_OPENRC -echo "------ Backup Juju environment ------" -cp environments.yaml $LAB_CONFIG/ -cp deployment.yaml $LAB_CONFIG/ -if [ -e deployconfig.yaml ]; then - cp deployconfig.yaml $LAB_CONFIG fi ## diff --git a/jjb/joid/joid-verify-jobs.yml b/jjb/joid/joid-verify-jobs.yml index 6e821a502..7b8ce7701 100644 --- a/jjb/joid/joid-verify-jobs.yml +++ b/jjb/joid/joid-verify-jobs.yml @@ -45,6 +45,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 4 @@ -93,7 +94,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'joid-virtual-defaults' @@ -107,7 +107,7 @@ - name: 'joid-verify-basic-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -120,7 +120,7 @@ - name: 'joid-verify-deploy-virtual-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -134,7 +134,7 @@ - name: 'joid-verify-smoke-test-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER GERRIT_CHANGE_COMMIT_MESSAGE=$GERRIT_CHANGE_COMMIT_MESSAGE @@ -150,6 +150,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 4 @@ -174,7 +175,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{installer}-defaults' - '{slave-label}-defaults' diff --git a/jjb/kvmfornfv/kvmfornfv-upload-artifact.sh b/jjb/kvmfornfv/kvmfornfv-upload-artifact.sh index 6f8fff3ff..56fb4f9c1 100755 --- a/jjb/kvmfornfv/kvmfornfv-upload-artifact.sh +++ b/jjb/kvmfornfv/kvmfornfv-upload-artifact.sh @@ -11,16 +11,17 @@ fi case "$JOB_TYPE" in verify) - OPNFV_ARTIFACT_VERSION="gerrit-$GERRIT_CHANGE_NUMBER" - GS_UPLOAD_LOCATION="gs://artifacts.opnfv.org/$PROJECT/review/$GERRIT_CHANGE_NUMBER" - echo "Removing outdated artifacts produced for the previous patch for the change $GERRIT_CHANGE_NUMBER" - gsutil ls $GS_UPLOAD_LOCATION > /dev/null 2>&1 && gsutil rm -r $GS_UPLOAD_LOCATION - echo "Uploading artifacts for the change $GERRIT_CHANGE_NUMBER. This could take some time..." - ;; + OPNFV_ARTIFACT_VERSION="gerrit-$GERRIT_CHANGE_NUMBER" + GS_UPLOAD_LOCATION="gs://artifacts.opnfv.org/$PROJECT/review/$GERRIT_CHANGE_NUMBER" + echo "Removing outdated artifacts produced for the previous patch for the change $GERRIT_CHANGE_NUMBER" + gsutil ls $GS_UPLOAD_LOCATION > /dev/null 2>&1 && gsutil rm -r $GS_UPLOAD_LOCATION + echo "Uploading artifacts for the change $GERRIT_CHANGE_NUMBER. This could take some time..." + ;; daily) echo "Uploading daily artifacts This could take some time..." OPNFV_ARTIFACT_VERSION=$(date -u +"%Y-%m-%d_%H-%M-%S") GS_UPLOAD_LOCATION="gs://$GS_URL/$OPNFV_ARTIFACT_VERSION" + GS_LOG_LOCATION="gs://$GS_URL/logs-$(date -u +"%Y-%m-%d")"/ ;; *) echo "Artifact upload is not enabled for $JOB_TYPE jobs" @@ -38,10 +39,23 @@ esac source $WORKSPACE/opnfv.properties # upload artifacts -gsutil cp -r $WORKSPACE/build_output/* $GS_UPLOAD_LOCATION > $WORKSPACE/gsutil.log 2>&1 -gsutil -m setmeta -r \ - -h "Cache-Control:private, max-age=0, no-transform" \ - $GS_UPLOAD_LOCATION > /dev/null 2>&1 +if [[ "$PHASE" == "build" ]]; then + gsutil cp -r $WORKSPACE/build_output/* $GS_UPLOAD_LOCATION > $WORKSPACE/gsutil.log 2>&1 + gsutil -m setmeta -r \ + -h "Cache-Control:private, max-age=0, no-transform" \ + $GS_UPLOAD_LOCATION > /dev/null 2>&1 +else + if [[ "$JOB_TYPE" == "daily" ]]; then + log_dir=$WORKSPACE/build_output/log + if [[ -d "$log_dir" ]]; then + #Uploading logs to artifacts + echo "Uploading artifacts for future debugging needs...." + gsutil cp -r $WORKSPACE/build_output/log-*.tar.gz $GS_LOG_LOCATION > $WORKSPACE/gsutil.log 2>&1 + else + echo "No test logs/artifacts available for uploading" + fi + fi +fi # upload metadata file for the artifacts built by daily job if [[ "$JOB_TYPE" == "daily" ]]; then diff --git a/jjb/kvmfornfv/kvmfornfv.yml b/jjb/kvmfornfv/kvmfornfv.yml index 60f8de8c4..a782ee0fa 100644 --- a/jjb/kvmfornfv/kvmfornfv.yml +++ b/jjb/kvmfornfv/kvmfornfv.yml @@ -19,7 +19,7 @@ - 'build': slave-label: 'opnfv-build-ubuntu' - 'test': - slave-label: 'intel-pod1' + slave-label: 'intel-pod10' ##################################### # patch verification phases ##################################### @@ -48,6 +48,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 3 @@ -56,7 +57,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' @@ -90,25 +90,25 @@ - name: 'kvmfornfv-verify-build-{stream}' current-parameters: false predefined-parameters: | - GERRIT_BRANCH=$GERRIT_BRANCH + BRANCH=$BRANCH + GERRIT_REFSPEC=$GERRIT_REFSPEC + GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER + node-parameters: false + kill-phase-on: FAILURE + abort-all-job: true + - multijob: + name: test + condition: SUCCESSFUL + projects: + - name: 'kvmfornfv-verify-test-{stream}' + current-parameters: false + predefined-parameters: | + BRANCH=$BRANCH GERRIT_REFSPEC=$GERRIT_REFSPEC GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER node-parameters: false kill-phase-on: FAILURE abort-all-job: true -# - multijob: -# name: test -# condition: SUCCESSFUL -# projects: -# - name: 'kvmfornfv-verify-test-{stream}' -# current-parameters: false -# predefined-parameters: | -# GERRIT_BRANCH=$GERRIT_BRANCH -# GERRIT_REFSPEC=$GERRIT_REFSPEC -# GERRIT_CHANGE_NUMBER=$GERRIT_CHANGE_NUMBER -# node-parameters: false -# kill-phase-on: FAILURE -# abort-all-job: true - job-template: name: 'kvmfornfv-verify-{phase}-{stream}' @@ -127,11 +127,14 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{slave-label}-defaults' - 'kvmfornfv-defaults': gs-pathname: '{gs-pathname}' + - string: + name: PHASE + default: '{phase}' + description: "Execution of kvmfornfv daily '{phase}' job ." builders: - description-setter: @@ -146,7 +149,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' - 'kvmfornfv-defaults': @@ -185,7 +187,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' - 'kvmfornfv-defaults': @@ -194,8 +195,8 @@ scm: - git-scm -# triggers: -# - timed: '@midnight' + triggers: + - timed: '@midnight' builders: - description-setter: @@ -259,7 +260,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{slave-label}-defaults' - 'kvmfornfv-defaults': @@ -268,6 +268,10 @@ name: TEST_NAME default: '{testname}' description: "Daily job to execute kvmfornfv '{testname}' testcase." + - string: + name: PHASE + default: '{phase}' + description: "Execution of kvmfornfv daily '{phase}' job ." builders: - description-setter: @@ -304,6 +308,8 @@ !include-raw: ./kvmfornfv-download-artifact.sh - shell: !include-raw: ./kvmfornfv-test.sh + - shell: + !include-raw: ./kvmfornfv-upload-artifact.sh - builder: name: 'kvmfornfv-packet_forward-daily-build-macro' builders: diff --git a/jjb/models/models.yml b/jjb/models/models.yml new file mode 100644 index 000000000..89d22bcbd --- /dev/null +++ b/jjb/models/models.yml @@ -0,0 +1,67 @@ +################################################### +# All the jobs except verify have been removed! +# They will only be enabled on request by projects! +################################################### +- project: + name: models + + project: '{name}' + + jobs: + - 'models-verify-{stream}' + + stream: + - master: + branch: '{stream}' + gs-pathname: '' + disabled: false + - danube: + branch: 'stable/{stream}' + gs-pathname: '/{stream}' + disabled: false + +- job-template: + name: 'models-verify-{stream}' + + disabled: '{obj:disabled}' + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - 'opnfv-build-ubuntu-defaults' + + scm: + - git-scm-gerrit + + triggers: + - gerrit: + server-name: 'gerrit.opnfv.org' + trigger-on: + - patchset-created-event: + exclude-drafts: 'false' + exclude-trivial-rebase: 'false' + exclude-no-code-change: 'false' + - draft-published-event + - comment-added-contains-event: + comment-contains-value: 'recheck' + - comment-added-contains-event: + comment-contains-value: 'reverify' + projects: + - project-compare-type: 'ANT' + project-pattern: '{project}' + branches: + - branch-compare-type: 'ANT' + branch-pattern: '**/{branch}' + forbidden-file-paths: + - compare-type: ANT + pattern: 'docs/**|.gitignore' + + builders: + - shell: | + #!/bin/bash + set -o errexit + set -o nounset + set -o pipefail + + # shellcheck -f tty tests/*.sh diff --git a/jjb/moon/moon.yml b/jjb/moon/moon.yml index 15c3ddec8..a318bc54d 100644 --- a/jjb/moon/moon.yml +++ b/jjb/moon/moon.yml @@ -17,7 +17,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' diff --git a/jjb/multisite/fuel-deploy-for-multisite.sh b/jjb/multisite/fuel-deploy-for-multisite.sh new file mode 100755 index 000000000..06617610c --- /dev/null +++ b/jjb/multisite/fuel-deploy-for-multisite.sh @@ -0,0 +1,124 @@ +#!/bin/bash +# SPDX-license-identifier: Apache-2.0 +############################################################################## +# Copyright (c) 2016 Ericsson AB and others. +# All rights reserved. This program and the accompanying materials +# are made available under the terms of the Apache License, Version 2.0 +# which accompanies this distribution, and is available at +# http://www.apache.org/licenses/LICENSE-2.0 +############################################################################## +set -o nounset +set -o pipefail + +# do not continue with the deployment if FRESH_INSTALL is not requested +if [[ "$FRESH_INSTALL" == "true" ]]; then + echo "Fresh install requested. Proceeding with the installation." +else + echo "Fresh install is not requested. Skipping the installation." + exit 0 +fi + +export TERM="vt220" + +# get the latest successful job console log and extract the properties filename +FUEL_DEPLOY_BUILD_URL="https://build.opnfv.org/ci/job/fuel-deploy-virtual-daily-master/lastSuccessfulBuild/consoleText" +FUEL_PROPERTIES_FILE=$(curl -s -L ${FUEL_DEPLOY_BUILD_URL} | grep 'ISO:' | awk '{print $2}' | sed 's/iso/properties/g') +if [[ -z "FUEL_PROPERTIES_FILE" ]]; then + echo "Unable to extract the url to Fuel ISO properties from ${FUEL_DEPLOY_URL}" + exit 1 +fi + +# use known/working version of fuel +FUEL_PROPERTIES_FILE="opnfv-2017-03-06_16-00-15.properties" +curl -L -s -o $WORKSPACE/latest.properties http://artifacts.opnfv.org/fuel/$FUEL_PROPERTIES_FILE + +# source the file so we get OPNFV vars +source latest.properties + +# echo the info about artifact that is used during the deployment +echo "Using ${OPNFV_ARTIFACT_URL/*\/} for deployment" + +# download the iso +echo "Downloading the ISO using the link http://$OPNFV_ARTIFACT_URL" +curl -L -s -o $WORKSPACE/opnfv.iso http://$OPNFV_ARTIFACT_URL > gsutil.iso.log 2>&1 + + +# set deployment parameters +DEPLOY_SCENARIO="os-nosdn-nofeature-noha" +export TMPDIR=$HOME/tmpdir +BRIDGE=${BRIDGE:-pxebr} +LAB_NAME=${NODE_NAME/-*} +POD_NAME=${NODE_NAME/*-} + +if [[ "$NODE_NAME" =~ "virtual" ]]; then + POD_NAME="virtual_kvm" +fi + +# we currently support ericsson, intel, lf and zte labs +if [[ ! "$LAB_NAME" =~ (ericsson|intel|lf|zte) ]]; then + echo "Unsupported/unidentified lab $LAB_NAME. Cannot continue!" + exit 1 +else + echo "Using configuration for $LAB_NAME" +fi + +# create TMPDIR if it doesn't exist +export TMPDIR=$HOME/tmpdir +mkdir -p $TMPDIR + +# change permissions down to TMPDIR +chmod a+x $HOME +chmod a+x $TMPDIR + +# clone fuel repo and checkout the sha1 that corresponds to the ISO +echo "Cloning fuel repo" +git clone https://gerrit.opnfv.org/gerrit/p/fuel.git fuel +cd $WORKSPACE/fuel +echo "Checking out $OPNFV_GIT_SHA1" +git checkout $OPNFV_GIT_SHA1 --quiet + +# clone the securedlab repo +cd $WORKSPACE +echo "Cloning securedlab repo ${GIT_BRANCH##origin/}" +git clone ssh://jenkins-ericsson@gerrit.opnfv.org:29418/securedlab --quiet \ + --branch ${GIT_BRANCH##origin/} + +# log file name +FUEL_LOG_FILENAME="${JOB_NAME}_${BUILD_NUMBER}.log.tar.gz" + +# construct the command +DEPLOY_COMMAND="sudo $WORKSPACE/fuel/ci/deploy.sh -b file://$WORKSPACE/securedlab \ + -l $LAB_NAME -p $POD_NAME -s $DEPLOY_SCENARIO -i file://$WORKSPACE/opnfv.iso \ + -H -B $BRIDGE -S $TMPDIR -L $WORKSPACE/$FUEL_LOG_FILENAME" + +# log info to console +echo "Deployment parameters" +echo "--------------------------------------------------------" +echo "Scenario: $DEPLOY_SCENARIO" +echo "Lab: $LAB_NAME" +echo "POD: $POD_NAME" +echo "ISO: ${OPNFV_ARTIFACT_URL/*\/}" +echo +echo "Starting the deployment using $INSTALLER_TYPE. This could take some time..." +echo "--------------------------------------------------------" +echo + +# start the deployment +echo "Issuing command" +echo "$DEPLOY_COMMAND" +echo + +$DEPLOY_COMMAND +exit_code=$? + +echo +echo "--------------------------------------------------------" +echo "Deployment is done!" + +if [[ $exit_code -ne 0 ]]; then + echo "Deployment failed!" + exit $exit_code +else + echo "Deployment is successful!" + exit 0 +fi diff --git a/jjb/multisite/multisite-daily-jobs.yml b/jjb/multisite/multisite-daily-jobs.yml index cfb40a1fa..23c95f627 100644 --- a/jjb/multisite/multisite-daily-jobs.yml +++ b/jjb/multisite/multisite-daily-jobs.yml @@ -8,19 +8,23 @@ - 'multisite-{phase}-{stream}' phase: - - 'fuel-deploy-regionone-virtual' - - 'fuel-deploy-regiontwo-virtual' - - 'register-endpoints' - - 'update-auth' - - 'kingbird-deploy-virtual' - - 'kingbird-functest' + - 'fuel-deploy-regionone-virtual': + slave-label: ericsson-virtual12 + - 'fuel-deploy-regiontwo-virtual': + slave-label: ericsson-virtual13 + - 'register-endpoints': + slave-label: ericsson-virtual12 + - 'update-auth': + slave-label: ericsson-virtual13 + - 'kingbird-deploy-virtual': + slave-label: ericsson-virtual12 stream: - master: branch: '{stream}' gs-pathname: '' disabled: false - timed: '#@midnight' + timed: '@midnight' - job-template: name: 'multisite-kingbird-virtual-daily-{stream}' @@ -34,13 +38,16 @@ parameters: - project-parameter: project: '{project}' + branch: '{branch}' + - choice: + name: FRESH_INSTALL + choices: + - 'true' + - 'false' - string: name: KINGBIRD_LOG_FILE default: $WORKSPACE/kingbird.log - - 'multisite-virtual-defaults' - - string: - name: DEPLOY_SCENARIO - default: 'os-nosdn-multisite-noha' + - 'opnfv-build-defaults' triggers: - timed: '{timed}' @@ -56,26 +63,28 @@ current-parameters: false predefined-parameters: | FUEL_VERSION=latest - DEPLOY_SCENARIO=$DEPLOY_SCENARIO + DEPLOY_SCENARIO=os-nosdn-nofeature-noha OS_REGION=RegionOne - REGIONONE_IP=10.2.117.79 - REGIONTWO_IP=10.2.117.181 + REGIONONE_IP=100.64.209.10 + REGIONTWO_IP=100.64.209.11 + FRESH_INSTALL=$FRESH_INSTALL node-parameters: false node-label-name: SLAVE_LABEL - node-label: intel-virtual2 + node-label: ericsson-virtual12 kill-phase-on: FAILURE abort-all-job: true - name: 'multisite-fuel-deploy-regiontwo-virtual-{stream}' current-parameters: false predefined-parameters: | FUEL_VERSION=latest - DEPLOY_SCENARIO=$DEPLOY_SCENARIO + DEPLOY_SCENARIO=os-nosdn-nofeature-noha OS_REGION=RegionTwo - REGIONONE_IP=10.2.117.79 - REGIONTWO_IP=10.2.117.181 + REGIONONE_IP=100.64.209.10 + REGIONTWO_IP=100.64.209.11 + FRESH_INSTALL=$FRESH_INSTALL node-parameters: false node-label-name: SLAVE_LABEL - node-label: intel-virtual6 + node-label: ericsson-virtual13 kill-phase-on: FAILURE abort-all-job: true - multijob: @@ -86,22 +95,24 @@ current-parameters: false predefined-parameters: | OS_REGION=RegionOne - REGIONONE_IP=10.2.117.79 - REGIONTWO_IP=10.2.117.181 + REGIONONE_IP=100.64.209.10 + REGIONTWO_IP=100.64.209.11 + FRESH_INSTALL=$FRESH_INSTALL node-parameters: false node-label-name: SLAVE_LABEL - node-label: intel-virtual2 + node-label: ericsson-virtual12 kill-phase-on: FAILURE abort-all-job: true - name: 'multisite-update-auth-{stream}' current-parameters: false predefined-parameters: | OS_REGION=RegionTwo - REGIONONE_IP=10.2.117.79 - REGIONTWO_IP=10.2.117.181 + REGIONONE_IP=100.64.209.10 + REGIONTWO_IP=100.64.209.11 + FRESH_INSTALL=$FRESH_INSTALL node-parameters: false node-label-name: SLAVE_LABEL - node-label: intel-virtual6 + node-label: ericsson-virtual13 kill-phase-on: FAILURE abort-all-job: true - multijob: @@ -112,26 +123,30 @@ current-parameters: false predefined-parameters: | OS_REGION=RegionOne - REGIONONE_IP=10.2.117.79 - REGIONTWO_IP=10.2.117.181 + REGIONONE_IP=100.64.209.10 + REGIONTWO_IP=100.64.209.11 + FRESH_INSTALL=$FRESH_INSTALL node-parameters: false node-label-name: SLAVE_LABEL - node-label: intel-virtual2 + node-label: ericsson-virtual12 kill-phase-on: FAILURE abort-all-job: true - multijob: name: kingbird-functest condition: SUCCESSFUL projects: - - name: 'multisite-kingbird-functest-{stream}' + - name: 'functest-fuel-virtual-suite-{stream}' current-parameters: false predefined-parameters: | + DEPLOY_SCENARIO=os-nosdn-multisite-noha + FUNCTEST_SUITE_NAME=multisite OS_REGION=RegionOne - REGIONONE_IP=10.2.117.79 - REGIONTWO_IP=10.2.117.181 + REGIONONE_IP=100.64.209.10 + REGIONTWO_IP=100.64.209.11 + FRESH_INSTALL=$FRESH_INSTALL node-parameters: false node-label-name: SLAVE_LABEL - node-label: intel-virtual2 + node-label: ericsson-virtual12 kill-phase-on: NEVER abort-all-job: false @@ -140,6 +155,28 @@ concurrent: false + disabled: '{obj:disabled}' + + concurrent: false + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - string: + name: KINGBIRD_LOG_FILE + default: $WORKSPACE/kingbird.log + - 'fuel-defaults' + - '{slave-label}-defaults' + - choice: + name: FRESH_INSTALL + choices: + - 'true' + - 'false' + + scm: + - git-scm + builders: - description-setter: description: "Built on $NODE_NAME" @@ -155,39 +192,57 @@ - builder: name: 'multisite-fuel-deploy-regionone-virtual-builder' builders: + - shell: + !include-raw-escape: ./fuel-deploy-for-multisite.sh - shell: | #!/bin/bash echo "This is where we deploy fuel, extract passwords and save into file" + + cd $WORKSPACE/tools/keystone/ + ./run.sh -t controller -r fetchpass.sh -o servicepass.ini + - builder: name: 'multisite-fuel-deploy-regiontwo-virtual-builder' builders: + - shell: + !include-raw-escape: ./fuel-deploy-for-multisite.sh - shell: | #!/bin/bash echo "This is where we deploy fuel, extract publicUrl, privateUrl, and adminUrl and save into file" + + cd $WORKSPACE/tools/keystone/ + ./run.sh -t controller -r endpoint.sh -o endpoints.ini - builder: name: 'multisite-register-endpoints-builder' builders: - copyartifact: project: 'multisite-fuel-deploy-regiontwo-virtual-{stream}' which-build: multijob-build - filter: "RegionTwo-Endpoints.txt" + filter: "endpoints.ini" - shell: | #!/bin/bash - echo "This is where we register RegionTwo in RegionOne keystone" + echo "This is where we register RegionTwo in RegionOne keystone using endpoints.ini" + + cd $WORKSPACE/tools/keystone/ + ./run.sh -t controller -r region.sh -d $WORKSPACE/endpoints.ini - builder: name: 'multisite-update-auth-builder' builders: - copyartifact: project: 'multisite-fuel-deploy-regionone-virtual-{stream}' which-build: multijob-build - filter: "RegionOne-Passwords.txt" + filter: "servicepass.ini" - shell: | #!/bin/bash - echo "This is where we read passwords from RegionOne-passwords.txt and replace passwords in RegionTwo" + echo "This is where we read passwords from servicepass.ini and replace passwords in RegionTwo" + + cd $WORKSPACE/tools/keystone/ + ./run.sh -t controller -r writepass.sh -d $WORKSPACE/servicepass.ini + ./run.sh -t compute -r writepass.sh -d $WORKSPACE/servicepass.ini - builder: name: 'multisite-kingbird-deploy-virtual-builder' builders: @@ -195,13 +250,8 @@ #!/bin/bash echo "This is where we install kingbird" -- builder: - name: 'multisite-kingbird-functest-builder' - builders: - - shell: | - #!/bin/bash - - echo "This is where we run kingbird-functest" + cd $WORKSPACE/tools/kingbird + ./deploy.sh ######################## # publisher macros ######################## @@ -209,7 +259,7 @@ name: 'multisite-fuel-deploy-regionone-virtual-publisher' publishers: - archive: - artifacts: '/root/servicepass.ini' + artifacts: 'servicepass.ini' allow-empty: false only-if-success: true fingerprint: true @@ -217,7 +267,7 @@ name: 'multisite-fuel-deploy-regiontwo-virtual-publisher' publishers: - archive: - artifacts: '/root/endpoints.ini' + artifacts: 'endpoints.ini' allow-empty: false only-if-success: true fingerprint: true diff --git a/jjb/multisite/multisite-verify-jobs.yml b/jjb/multisite/multisite-verify-jobs.yml new file mode 100644 index 000000000..5ecfafb55 --- /dev/null +++ b/jjb/multisite/multisite-verify-jobs.yml @@ -0,0 +1,68 @@ +################################################### +# All the jobs except verify have been removed! +# They will only be enabled on request by projects! +################################################### +- project: + name: multisite + + project: '{name}' + + jobs: + - 'multisite-verify-{stream}' + + stream: + - master: + branch: '{stream}' + gs-pathname: '' + disabled: false + timed: '@midnight' + - danube: + branch: 'stable/{stream}' + gs-pathname: '/{stream}' + disabled: true + timed: '' + +- job-template: + name: 'multisite-verify-{stream}' + + disabled: '{obj:disabled}' + + concurrent: true + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - 'opnfv-build-ubuntu-defaults' + + scm: + - git-scm-gerrit + + triggers: + - gerrit: + server-name: 'gerrit.opnfv.org' + trigger-on: + - patchset-created-event: + exclude-drafts: 'false' + exclude-trivial-rebase: 'false' + exclude-no-code-change: 'false' + - draft-published-event + - comment-added-contains-event: + comment-contains-value: 'recheck' + - comment-added-contains-event: + comment-contains-value: 'reverify' + projects: + - project-compare-type: 'ANT' + project-pattern: '{project}' + branches: + - branch-compare-type: 'ANT' + branch-pattern: '**/{branch}' + forbidden-file-paths: + - compare-type: ANT + pattern: 'docs/**|.gitignore' + + builders: + - shell: | + #!/bin/bash + + echo "Hello World" diff --git a/jjb/multisite/multisite.yml b/jjb/multisite/multisite.yml deleted file mode 100644 index 6b6406983..000000000 --- a/jjb/multisite/multisite.yml +++ /dev/null @@ -1,149 +0,0 @@ -################################################### -# All the jobs except verify have been removed! -# They will only be enabled on request by projects! -################################################### -- project: - name: multisite - - project: '{name}' - - jobs: - - 'multisite-verify-{stream}' - - 'multisite-kingbird-daily-{stream}' - - 'multisite-kingbird-deploy-{stream}' - - stream: - - master: - branch: '{stream}' - gs-pathname: '' - disabled: false - timed: '@midnight' - - danube: - branch: 'stable/{stream}' - gs-pathname: '/{stream}' - disabled: false - timed: '' - -- job-template: - name: 'multisite-verify-{stream}' - - disabled: '{obj:disabled}' - - concurrent: true - - parameters: - - project-parameter: - project: '{project}' - - gerrit-parameter: - branch: '{branch}' - - 'opnfv-build-ubuntu-defaults' - - scm: - - git-scm-gerrit - - triggers: - - gerrit: - server-name: 'gerrit.opnfv.org' - trigger-on: - - patchset-created-event: - exclude-drafts: 'false' - exclude-trivial-rebase: 'false' - exclude-no-code-change: 'false' - - draft-published-event - - comment-added-contains-event: - comment-contains-value: 'recheck' - - comment-added-contains-event: - comment-contains-value: 'reverify' - projects: - - project-compare-type: 'ANT' - project-pattern: '{project}' - branches: - - branch-compare-type: 'ANT' - branch-pattern: '**/{branch}' - forbidden-file-paths: - - compare-type: ANT - pattern: 'docs/**|.gitignore' - - builders: - - shell: | - #!/bin/bash - - echo "Hello World" - -- job-template: - name: 'multisite-kingbird-daily-{stream}' - - project-type: freestyle - - disabled: '{obj:disabled}' - - concurrent: false - - parameters: - - project-parameter: - project: '{project}' - - gerrit-parameter: - branch: '{branch}' - - string: - name: KINGBIRD_LOG_FILE - default: $WORKSPACE/kingbird.log - - 'intel-virtual6-defaults' - - string: - name: DEPLOY_SCENARIO - default: 'os-nosdn-multisite-ha' - - scm: - - git-scm - - triggers: - - timed: '{timed}' - - builders: - - trigger-builds: - - project: 'multisite-kingbird-deploy-{stream}' - current-parameters: true - same-node: true - block: true - - trigger-builds: - - project: 'functest-fuel-virtual-suite-{stream}' - current-parameters: true - predefined-parameters: - FUNCTEST_SUITE_NAME=multisite - same-node: true - block: true - block-thresholds: - build-step-failure-threshold: 'never' - failure-threshold: 'never' - unstable-threshold: 'FAILURE' - -- job-template: - name: 'multisite-kingbird-deploy-{stream}' - - concurrent: false - - scm: - - git-scm-gerrit - - builders: - - 'multisite-kingbird-deploy' - - 'multisite-kingbird-log-upload' - -######################## -# builder macros -######################## -- builder: - name: 'multisite-kingbird-deploy' - builders: - - shell: | - #!/bin/bash - - $WORKSPACE/tools/kingbird/deploy.sh -- builder: - name: 'multisite-kingbird-log-upload' - builders: - - shell: | - #!/bin/bash - - echo "Here is where we upload kingbird logs to artifact repo" - echo "We just check the existence of log file" - ls -al $KINGBIRD_LOG_FILE diff --git a/jjb/netready/netready.yml b/jjb/netready/netready.yml index 3d043f9e3..382434ae6 100644 --- a/jjb/netready/netready.yml +++ b/jjb/netready/netready.yml @@ -21,7 +21,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' scm: - git-scm-gerrit @@ -65,7 +64,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' - 'netready-parameter': diff --git a/jjb/octopus/octopus.yml b/jjb/octopus/octopus.yml index b820ecb0e..cb66112fe 100644 --- a/jjb/octopus/octopus.yml +++ b/jjb/octopus/octopus.yml @@ -27,7 +27,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' diff --git a/jjb/onosfw/onosfw.yml b/jjb/onosfw/onosfw.yml index d3a845403..13c96718c 100644 --- a/jjb/onosfw/onosfw.yml +++ b/jjb/onosfw/onosfw.yml @@ -31,7 +31,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' @@ -72,7 +71,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' @@ -96,7 +94,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' - string: diff --git a/jjb/openretriever/openretriever-project.yml b/jjb/openretriever/openretriever-project.yml new file mode 100644 index 000000000..3d53f9b2e --- /dev/null +++ b/jjb/openretriever/openretriever-project.yml @@ -0,0 +1,62 @@ +################################################### +# All the jobs except verify have been removed! +# They will only be enabled on request by projects! +################################################### +- project: + name: openretriever + + project: '{name}' + + jobs: + - 'openretriever-verify-{stream}' + + stream: + - master: + branch: '{stream}' + gs-pathname: '' + disabled: false + - danube: + branch: 'stable/{stream}' + gs-pathname: '/{stream}' + disabled: false + +- job-template: + name: 'openretriever-verify-{stream}' + + disabled: '{obj:disabled}' + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - 'opnfv-build-ubuntu-defaults' + + scm: + - git-scm-gerrit + + triggers: + - gerrit: + server-name: 'gerrit.opnfv.org' + trigger-on: + - patchset-created-event: + exclude-drafts: 'false' + exclude-trivial-rebase: 'false' + exclude-no-code-change: 'false' + - draft-published-event + - comment-added-contains-event: + comment-contains-value: 'recheck' + - comment-added-contains-event: + comment-contains-value: 'reverify' + projects: + - project-compare-type: 'ANT' + project-pattern: '{project}' + branches: + - branch-compare-type: 'ANT' + branch-pattern: '**/{branch}' + forbidden-file-paths: + - compare-type: ANT + pattern: 'docs/**|.gitignore' + + builders: + - shell: | + echo "Nothing to verify!" diff --git a/jjb/opera/opera-daily-jobs.yml b/jjb/opera/opera-daily-jobs.yml index 556d59fcb..5d2cc03f3 100644 --- a/jjb/opera/opera-daily-jobs.yml +++ b/jjb/opera/opera-daily-jobs.yml @@ -38,6 +38,7 @@ concurrent: false properties: + - logrotate-default - throttle: enabled: true max-total: 1 @@ -51,7 +52,7 @@ - ssh-agent-wrapper - timeout: - timeout: 120 + timeout: 240 fail: true triggers: @@ -60,9 +61,8 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - - 'huawei-pod7-defaults' + - 'huawei-virtual7-defaults' builders: - description-setter: @@ -80,8 +80,11 @@ name: deploy condition: SUCCESSFUL projects: - - name: 'opera-daily-deploy-{stream}' - current-parameters: true + - name: 'compass-deploy-virtual-daily-{stream}' + current-parameters: false + predefined-parameters: | + DEPLOY_SCENARIO=os-nosdn-openo-ha + COMPASS_OS_VERSION=xenial node-parameters: true kill-phase-on: FAILURE abort-all-job: true @@ -90,7 +93,7 @@ # condition: SUCCESSFUL # projects: # - name: 'functest-compass-baremetal-suite-{stream}' -# current-parameters: true +# current-parameters: false # predefined-parameters: # FUNCTEST_SUITE_NAME=opera # node-parameters: true @@ -105,6 +108,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-per-node: 1 diff --git a/jjb/opera/opera-project-jobs.yml b/jjb/opera/opera-project-jobs.yml index 19f066b5f..38efbc159 100644 --- a/jjb/opera/opera-project-jobs.yml +++ b/jjb/opera/opera-project-jobs.yml @@ -21,6 +21,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 1 @@ -30,9 +31,8 @@ parameters: - project-parameter: project: '{project}' - - 'opnfv-build-ubuntu-defaults' - - gerrit-parameter: branch: '{branch}' + - 'opnfv-build-ubuntu-defaults' scm: - git-scm diff --git a/jjb/opera/opera-verify-jobs.yml b/jjb/opera/opera-verify-jobs.yml index 0e9dba01d..b7b5cb3c9 100644 --- a/jjb/opera/opera-verify-jobs.yml +++ b/jjb/opera/opera-verify-jobs.yml @@ -38,6 +38,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-total: 1 @@ -83,7 +84,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'huawei-pod7-defaults' @@ -117,6 +117,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-per-node: 1 diff --git a/jjb/opnfvdocs/docs-post-rtd.sh b/jjb/opnfvdocs/docs-post-rtd.sh new file mode 100644 index 000000000..e3dc9b5f0 --- /dev/null +++ b/jjb/opnfvdocs/docs-post-rtd.sh @@ -0,0 +1,7 @@ +#!/bin/bash +if [ $GERRIT_BRANCH == "master" ]; then + RTD_BUILD_VERSION=latest +else + RTD_BUILD_VERSION=${{GERRIT_BRANCH/\//-}} +fi +curl -X POST --data "version_slug=$RTD_BUILD_VERSION" https://readthedocs.org/build/opnfvdocsdemo diff --git a/jjb/opnfvdocs/docs-rtd.yaml b/jjb/opnfvdocs/docs-rtd.yaml new file mode 100644 index 000000000..c78e7f0f6 --- /dev/null +++ b/jjb/opnfvdocs/docs-rtd.yaml @@ -0,0 +1,88 @@ +- project: + name: docs-rtd + jobs: + - 'docs-merge-rtd-{stream}' + - 'docs-verify-rtd-{stream}' + + stream: + - master: + branch: 'master' + + project: 'opnfvdocs' + rtdproject: 'opnfv' + # TODO: Archive Artifacts + +- job-template: + name: 'docs-merge-rtd-{stream}' + + project-type: freestyle + + parameters: + - label: + name: SLAVE_LABEL + default: 'lf-build1' + description: 'Slave label on Jenkins' + - project-parameter: + project: '{project}' + branch: '{branch}' + - string: + name: GIT_BASE + default: https://gerrit.opnfv.org/gerrit/releng + description: 'Git URL to use on this Jenkins Slave' + scm: + - git-scm + + triggers: + - gerrit-trigger-change-merged: + project: '**' + branch: '{branch}' + files: 'docs/**/*.*' + + builders: + - shell: !include-raw: docs-post-rtd.sh + +- job-template: + name: 'docs-verify-rtd-{stream}' + + project-type: freestyle + + parameters: + - label: + name: SLAVE_LABEL + default: 'lf-build2' + description: 'Slave label on Jenkins' + - project-parameter: + project: '{project}' + branch: '{branch}' + - string: + name: GIT_BASE + default: https://gerrit.opnfv.org/gerrit/opnfvdocs + description: 'Git URL to use on this Jenkins Slave' + scm: + - git-scm-with-submodules: + branch: '{branch}' + + triggers: + - gerrit-trigger-patchset-created: + server: 'gerrit.opnfv.org' + project: '**' + branch: '{branch}' + files: 'docs/**/*.rst' + - timed: 'H H * * *' + + builders: + - shell: | + if [ "$GERRIT_PROJECT" != "opnfvdocs" ]; then + cd docs/submodules/$GERRIT_PROJECT + git fetch origin $GERRIT_REFSPEC && git checkout FETCH_HEAD + else + git fetch origin $GERRIT_REFSPEC && git checkout FETCH_HEAD + fi + - shell: | + sudo pip install virtualenv + virtualenv $WORKSPACE/venv + . $WORKSPACE/venv/bin/activate + pip install --upgrade pip + pip freeze + pip install tox + tox -edocs diff --git a/jjb/opnfvdocs/opnfvdocs.yml b/jjb/opnfvdocs/opnfvdocs.yml index 0d4c46199..661f060ee 100644 --- a/jjb/opnfvdocs/opnfvdocs.yml +++ b/jjb/opnfvdocs/opnfvdocs.yml @@ -34,7 +34,6 @@ parameters: - project-parameter: project: $GERRIT_PROJECT - - gerrit-parameter: branch: '{branch}' - string: name: GIT_CLONE_BASE @@ -63,6 +62,11 @@ branches: - branch-compare-type: 'ANT' branch-pattern: '**/{branch}' + skip-vote: + successful: true + failed: true + unstable: true + notbuilt: true builders: - check-bash-syntax @@ -75,7 +79,6 @@ parameters: - project-parameter: project: $GERRIT_PROJECT - - gerrit-parameter: branch: '{branch}' - string: name: GIT_CLONE_BASE @@ -87,7 +90,7 @@ description: "Directory where the build artifact will be located upon the completion of the build." scm: - - git-scm-gerrit + - git-scm triggers: - gerrit: @@ -114,6 +117,7 @@ parameters: - project-parameter: project: '{project}' + branch: '{branch}' - string: name: GS_URL default: '$GS_BASE{gs-pathname}' @@ -122,10 +126,6 @@ name: GIT_CLONE_BASE default: ssh://gerrit.opnfv.org:29418 description: "Used for overriding the GIT URL coming from parameters macro." - - string: - name: GERRIT_BRANCH - default: '{branch}' - description: 'Specify the branch in this way in order to be able to use build-opnfv-composite-docs builder.' scm: - git-scm @@ -136,4 +136,3 @@ builders: - build-html-and-pdf-docs-output # - upload-generated-docs-to-opnfv-artifacts - diff --git a/jjb/opnfvdocs/project.cfg b/jjb/opnfvdocs/project.cfg index 186e0ea74..1ea05c1d4 100644 --- a/jjb/opnfvdocs/project.cfg +++ b/jjb/opnfvdocs/project.cfg @@ -24,6 +24,7 @@ movie multisite octopus onosfw +openretriever ovno ovsnfv parser diff --git a/jjb/ovsnfv/ovsnfv.yml b/jjb/ovsnfv/ovsnfv.yml index 9b2adf3a8..937a367fb 100644 --- a/jjb/ovsnfv/ovsnfv.yml +++ b/jjb/ovsnfv/ovsnfv.yml @@ -26,7 +26,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-centos-defaults' - string: @@ -73,7 +72,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-centos-defaults' - string: @@ -119,7 +117,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-centos-defaults' - string: diff --git a/jjb/parser/parser.yml b/jjb/parser/parser.yml index de5587ed8..7f3d6cebe 100644 --- a/jjb/parser/parser.yml +++ b/jjb/parser/parser.yml @@ -28,7 +28,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' @@ -56,7 +55,11 @@ branch-pattern: '**/{branch}' forbidden-file-paths: - compare-type: ANT - pattern: 'docs/**|.gitignore' + pattern: 'docs/**' + - compare-type: ANT + pattern: 'governance/**' + - compare-type: ANT + pattern: '*.txt|.gitignore|.gitreview|INFO|LICENSE' builders: - shell: | diff --git a/jjb/pharos/pharos.yml b/jjb/pharos/pharos.yml index dbf1b92a4..6dae9f33c 100644 --- a/jjb/pharos/pharos.yml +++ b/jjb/pharos/pharos.yml @@ -28,7 +28,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' diff --git a/jjb/prediction/prediction.yml b/jjb/prediction/prediction.yml index fba5741ac..b380d8c86 100644 --- a/jjb/prediction/prediction.yml +++ b/jjb/prediction/prediction.yml @@ -28,7 +28,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' diff --git a/jjb/promise/promise.yml b/jjb/promise/promise.yml index a0af6f41e..a5aa302c7 100644 --- a/jjb/promise/promise.yml +++ b/jjb/promise/promise.yml @@ -28,7 +28,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' diff --git a/jjb/qtip/qtip-cleanup.sh b/jjb/qtip/helpers/cleanup-deploy.sh index 95babb318..95babb318 100644 --- a/jjb/qtip/qtip-cleanup.sh +++ b/jjb/qtip/helpers/cleanup-deploy.sh diff --git a/jjb/qtip/qtip-daily-ci.sh b/jjb/qtip/helpers/validate-deploy.sh index 4fdc04345..16455371f 100644 --- a/jjb/qtip/qtip-daily-ci.sh +++ b/jjb/qtip/helpers/validate-deploy.sh @@ -27,12 +27,7 @@ if [ $(docker ps | grep 'opnfv/qtip' | wc -l) == 0 ]; then else echo "The container ID is: ${container_id}" QTIP_REPO=/home/opnfv/repos/qtip - - echo "Run Qtip test" - docker exec -t ${container_id} $QTIP_REPO/docker/run_qtip.sh - - echo "Pushing available results to DB" - docker exec -t ${container_id} $QTIP_REPO/docker/push_db.sh +# TODO(yujunz): execute benchmark plan for compute-qpi fi echo "Qtip done!" diff --git a/jjb/qtip/helpers/validate-setup.sh b/jjb/qtip/helpers/validate-setup.sh new file mode 100644 index 000000000..8d84e120c --- /dev/null +++ b/jjb/qtip/helpers/validate-setup.sh @@ -0,0 +1,24 @@ +#!/usr/bin/env bash +############################################################################## +# Copyright (c) 2017 ZTE and others. +# All rights reserved. This program and the accompanying materials +# are made available under the terms of the Apache License, Version 2.0 +# which accompanies this distribution, and is available at +# http://www.apache.org/licenses/LICENSE-2.0 +############################################################################## + +set -e + +# setup virtualenv +sudo pip install -u virtualenv virtualenvwrapper +export WORKON_HOME=$HOME/.virtualenvs +source /usr/local/bin/virtualenvwrapper.sh +mkvirtualenv qtip +workon qtip + +# setup qtip +sudo pip install $HOME/repos/qtip + +# testing +qtip --version +qtip --help diff --git a/jjb/qtip/qtip-ci-jobs.yml b/jjb/qtip/qtip-ci-jobs.yml deleted file mode 100644 index 69cb32b41..000000000 --- a/jjb/qtip/qtip-ci-jobs.yml +++ /dev/null @@ -1,101 +0,0 @@ -#################################### -# job configuration for qtip -#################################### -- project: - name: qtip - - project: 'qtip' - -#-------------------------------- -# BRANCH ANCHORS -#-------------------------------- - master: &master - stream: master - branch: '{stream}' - gs-pathname: '' - docker-tag: 'latest' -#-------------------------------- -# POD, INSTALLER, AND BRANCH MAPPING -#-------------------------------- -# master -#-------------------------------- - pod: - - zte-pod2: - installer: fuel - auto-trigger-name: 'qtip-daily-zte-pod2-trigger' - <<: *master - - zte-pod3: - installer: fuel - auto-trigger-name: 'qtip-daily-zte-pod3-trigger' - <<: *master - -#-------------------------------- - jobs: - - 'qtip-{installer}-{pod}-daily-{stream}' - -################################ -# job templates -################################ -- job-template: - name: 'qtip-{installer}-{pod}-daily-{stream}' - - disabled: true - - parameters: - - project-parameter: - project: '{project}' - - gerrit-parameter: - branch: '{branch}' - - '{installer}-defaults' - - '{pod}-defaults' - - string: - name: DEPLOY_SCENARIO - default: 'os-nosdn-nofeature-ha' - - string: - name: DOCKER_TAG - default: '{docker-tag}' - description: 'Tag to pull docker image' - - scm: - - git-scm - - triggers: - - '{auto-trigger-name}' - - builders: - - description-setter: - description: "POD: $NODE_NAME" - - 'qtip-cleanup' - - 'qtip-daily-ci' - - publishers: - - email: - recipients: wu.zhihui1@zte.com.cn, zhang.yujunz@zte.com.cn - -########################### -#biuilder macros -########################### -- builder: - name: qtip-daily-ci - builders: - - shell: - !include-raw: ./qtip-daily-ci.sh - -- builder: - name: qtip-cleanup - builders: - - shell: - !include-raw: ./qtip-cleanup.sh - -################# -#trigger macros -################# -- trigger: - name: 'qtip-daily-zte-pod2-trigger' - triggers: - - timed: '0 7 * * *' - -- trigger: - name: 'qtip-daily-zte-pod3-trigger' - triggers: - - timed: '0 1 * * *' diff --git a/jjb/qtip/qtip-validate-jobs.yml b/jjb/qtip/qtip-validate-jobs.yml new file mode 100644 index 000000000..10ee72a8b --- /dev/null +++ b/jjb/qtip/qtip-validate-jobs.yml @@ -0,0 +1,142 @@ +####################### +# validate after MERGE +####################### +- project: + name: qtip + project: qtip + +#-------------------------------- +# BRANCH ANCHORS +#-------------------------------- + master: &master + stream: master + branch: '{stream}' + gs-pathname: '' + docker-tag: latest + +#-------------------------------- +# JOB VARIABLES +#-------------------------------- + pod: + - zte-pod2: + installer: fuel + <<: *master + - zte-pod3: + installer: fuel + <<: *master + task: + - daily: + auto-builder-name: qtip-validate-deploy + auto-trigger-name: 'qtip-daily-{pod}-trigger' + - validate: + auto-builder-name: qtip-validate-setup + auto-trigger-name: qtip-validate-trigger + - experimental: + auto-builder-name: qtip-validate-setup + auto-trigger-name: experimental + +#-------------------------------- +# JOB LIST +#-------------------------------- + jobs: + - 'qtip-{task}-{installer}-{pod}-{stream}' + +################################ +# job templates +################################ +- job-template: + name: 'qtip-{task}-{installer}-{pod}-{stream}' + disabled: false + parameters: + - qtip-common-parameters: + project: '{project}' + <<: *master + - '{installer}-defaults' + - '{pod}-defaults' + scm: + - git-scm + triggers: + - '{auto-trigger-name}' + builders: + - qtip-common-builders + - '{auto-builder-name}' + publishers: + - qtip-common-publishers + +################ +# MARCOS +################ + +#--------- +# builder +#--------- + +- builder: + name: qtip-common-builders + builders: + - description-setter: + description: "POD: $NODE_NAME" + +- builder: + name: qtip-validate-deploy + builders: + - shell: + !include-raw: ./helpers/validate-deploy.sh + - shell: + !include-raw: ./helpers/cleanup-deploy.sh + +- builder: + name: qtip-validate-setup + builders: + - shell: + !include-raw: ./helpers/validate-setup.sh + +#----------- +# parameter +#----------- + +- parameter: + name: qtip-common-parameters + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - string: + name: DEPLOY_SCENARIO + default: 'os-nosdn-nofeature-ha' + - string: + name: DOCKER_TAG + default: '{docker-tag}' + description: 'Tag to pull docker image' + +#----------- +# publisher +#----------- + +- publisher: + name: qtip-common-publishers + publishers: + - email: + recipients: wu.zhihui1@zte.com.cn, zhang.yujunz@zte.com.cn + +#--------- +# trigger +#--------- + +- trigger: + name: qtip-daily-zte-pod2-trigger + triggers: + - timed: '0 7 * * *' + +- trigger: + name: qtip-daily-zte-pod3-trigger + triggers: + - timed: '0 1 * * *' + +- trigger: + name: qtip-validate-trigger + triggers: + - gerrit-trigger-change-merged: + project: '{project}' + branch: '{branch}' + files: '**' diff --git a/jjb/qtip/qtip-project-jobs.yml b/jjb/qtip/qtip-verify-jobs.yml index a9c8251fc..5f0292b92 100644 --- a/jjb/qtip/qtip-project-jobs.yml +++ b/jjb/qtip/qtip-verify-jobs.yml @@ -1,11 +1,12 @@ -- project: - name: qtip-project-jobs - - project: 'qtip' +###################### +# verify before MERGE +###################### +- project: + name: qtip-verify-jobs + project: qtip jobs: - 'qtip-verify-{stream}' - stream: - master: branch: '{stream}' @@ -23,7 +24,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' @@ -55,6 +55,8 @@ builders: - qtip-unit-tests-and-docs-build + publishers: + - publish-coverage ################################ ## job builders diff --git a/jjb/releng/artifact-cleanup.yml b/jjb/releng/artifact-cleanup.yml index e10d5defb..2d0205660 100644 --- a/jjb/releng/artifact-cleanup.yml +++ b/jjb/releng/artifact-cleanup.yml @@ -27,7 +27,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' scm: diff --git a/jjb/releng/opnfv-docker-arm.yml b/jjb/releng/opnfv-docker-arm.yml new file mode 100644 index 000000000..09c9f335e --- /dev/null +++ b/jjb/releng/opnfv-docker-arm.yml @@ -0,0 +1,77 @@ +############################################## +# job configuration for docker build and push +############################################## + +- project: + + name: opnfv-docker-arm + + master: &master + stream: master + branch: '{stream}' + disabled: false + danube: &danube + stream: danube + branch: 'stable/{stream}' + disabled: true + functest-arm-receivers: &functest-arm-receivers + receivers: > + cristina.pauna@enea.com + alexandru.avadanii@enea.com + other-receivers: &other-receivers + receivers: '' + + project: + # projects with jobs for master + - 'functest': + <<: *master + <<: *functest-arm-receivers + # projects with jobs for stable + + jobs: + - '{project}-docker-build-arm-push-{stream}' + +######################## +# job templates +######################## +- job-template: + name: '{project}-docker-build-arm-push-{stream}' + + disabled: '{obj:disabled}' + + parameters: ¶meters + - project-parameter: + project: '{project}' + branch: '{branch}' + - 'opnfv-build-ubuntu-arm-defaults' + - string: + name: PUSH_IMAGE + default: "true" + description: "To enable/disable pushing the image to Dockerhub." + - string: + name: DOCKER_REPO_NAME + default: "opnfv/{project}_aarch64" + description: "Dockerhub repo to be pushed to." + - string: + name: RELEASE_VERSION + default: "" + description: "Release version, e.g. 1.0, 2.0, 3.0" + - string: + name: DOCKERFILE + default: "Dockerfile.aarch64" + description: "Dockerfile to use for creating the image." + + scm: + - git-scm + + builders: &builders + - shell: + !include-raw-escape: ./opnfv-docker.sh + + triggers: + - pollscm: + cron: "*/30 * * * *" + + publishers: + - email: + recipients: '{receivers}' diff --git a/jjb/releng/opnfv-docker.sh b/jjb/releng/opnfv-docker.sh index e26727abf..ded743d7e 100644 --- a/jjb/releng/opnfv-docker.sh +++ b/jjb/releng/opnfv-docker.sh @@ -12,6 +12,7 @@ set -o nounset set -o pipefail + echo "Starting opnfv-docker for $DOCKER_REPO_NAME ..." echo "--------------------------------------------------------" echo @@ -42,32 +43,29 @@ fi if [[ -n "$(docker images | grep $DOCKER_REPO_NAME)" ]]; then echo "Docker images to remove:" docker images | head -1 && docker images | grep $DOCKER_REPO_NAME - image_tags=($(docker images | grep $DOCKER_REPO_NAME | awk '{print $2}')) - for tag in "${image_tags[@]}"; do - if [[ -n "$(docker images|grep $DOCKER_REPO_NAME|grep $tag)" ]]; then - echo "Removing docker image $DOCKER_REPO_NAME:$tag..." - docker rmi -f $DOCKER_REPO_NAME:$tag + image_ids=($(docker images | grep $DOCKER_REPO_NAME | awk '{print $3}')) + for id in "${image_ids[@]}"; do + if [[ -n "$(docker images|grep $DOCKER_REPO_NAME|grep $id)" ]]; then + echo "Removing docker image $DOCKER_REPO_NAME:$id..." + docker rmi -f $id fi done fi - -# cd to directory where Dockerfile is located cd $WORKSPACE/docker -if [ ! -f ./Dockerfile ]; then +if [ ! -f ${DOCKERFILE} ]; then echo "ERROR: Dockerfile not found." exit 1 fi # Get tag version -branch="${GIT_BRANCH##origin/}" -echo "Current branch: $branch" +echo "Current branch: $BRANCH" -if [[ "$branch" == "master" ]]; then +if [[ "$BRANCH" == "master" ]]; then DOCKER_TAG="latest" else if [[ "$RELEASE_VERSION" != "" ]]; then - release=$(echo $branch|sed 's/.*\///') + release=${BRANCH##*/} DOCKER_TAG=${release}.${RELEASE_VERSION} # e.g. colorado.1.0, colorado.2.0, colorado.3.0 else @@ -79,7 +77,12 @@ fi echo "Building docker image: $DOCKER_REPO_NAME:$DOCKER_TAG" echo "--------------------------------------------------------" echo -cmd="docker build --no-cache -t $DOCKER_REPO_NAME:$DOCKER_TAG --build-arg BRANCH=$branch ." +if [[ $DOCKER_REPO_NAME == *"dovetail"* ]]; then + cmd="docker build --no-cache -t $DOCKER_REPO_NAME:$DOCKER_TAG -f $DOCKERFILE ." +else + cmd="docker build --no-cache -t $DOCKER_REPO_NAME:$DOCKER_TAG --build-arg BRANCH=$BRANCH + -f $DOCKERFILE ." +fi echo ${cmd} ${cmd} diff --git a/jjb/releng/opnfv-docker.yml b/jjb/releng/opnfv-docker.yml index 02dfb7560..90a91f802 100644 --- a/jjb/releng/opnfv-docker.yml +++ b/jjb/releng/opnfv-docker.yml @@ -14,32 +14,51 @@ stream: danube branch: 'stable/{stream}' disabled: true + functest-receivers: &functest-receivers + receivers: > + jose.lausuch@ericsson.com morgan.richomme@orange.com + cedric.ollivier@orange.com feng.xiaowei@zte.com.cn + yaohelan@huawei.com helanyao@gmail.com + juha.kosonen@nokia.com + other-receivers: &other-receivers + receivers: '' project: # projects with jobs for master - 'bottlenecks': <<: *master + <<: *other-receivers - 'cperf': <<: *master + <<: *other-receivers - 'dovetail': <<: *master + <<: *other-receivers - 'functest': <<: *master + <<: *functest-receivers - 'qtip': <<: *master + <<: *other-receivers - 'storperf': <<: *master + <<: *other-receivers - 'yardstick': <<: *master + <<: *other-receivers # projects with jobs for stable - 'bottlenecks': <<: *danube + <<: *other-receivers - 'functest': <<: *danube + <<: *functest-receivers - 'storperf': <<: *danube + <<: *other-receivers - 'yardstick': <<: *danube + <<: *other-receivers jobs: - '{project}-docker-build-push-{stream}' @@ -53,6 +72,8 @@ # projects with jobs for master - 'daisy': <<: *master + - 'escalator': + <<: *master jobs: - '{project}-docker-build-push-monitor-{stream}' @@ -68,7 +89,6 @@ parameters: ¶meters - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' - string: @@ -83,6 +103,10 @@ name: RELEASE_VERSION default: "" description: "Release version, e.g. 1.0, 2.0, 3.0" + - string: + name: DOCKERFILE + default: "Dockerfile" + description: "Dockerfile to use for creating the image." scm: - git-scm @@ -95,6 +119,10 @@ - pollscm: cron: "*/30 * * * *" + publishers: + - email: + recipients: '{receivers}' + - job-template: name: '{project}-docker-build-push-monitor-{stream}' disabled: '{obj:disabled}' diff --git a/jjb/releng/opnfv-docs.yml b/jjb/releng/opnfv-docs.yml index f6092eee0..f4b25017e 100644 --- a/jjb/releng/opnfv-docs.yml +++ b/jjb/releng/opnfv-docs.yml @@ -35,7 +35,6 @@ parameters: - project-parameter: project: $GERRIT_PROJECT - - gerrit-parameter: branch: '{branch}' scm: @@ -77,7 +76,6 @@ parameters: - project-parameter: project: $GERRIT_PROJECT - - gerrit-parameter: branch: '{branch}' - string: name: GS_URL @@ -89,7 +87,7 @@ description: "JJB configured GERRIT_REFSPEC parameter" scm: - - git-scm-gerrit + - git-scm triggers: - gerrit: diff --git a/jjb/releng/opnfv-lint.yml b/jjb/releng/opnfv-lint.yml index 590790f89..166aea8f9 100644 --- a/jjb/releng/opnfv-lint.yml +++ b/jjb/releng/opnfv-lint.yml @@ -33,7 +33,6 @@ parameters: - project-parameter: project: $GERRIT_PROJECT - - gerrit-parameter: branch: '{branch}' scm: @@ -54,7 +53,7 @@ comment-contains-value: 'reverify' projects: - project-compare-type: 'REG_EXP' - project-pattern: 'functest|sdnvpn|qtip|daisy|sfc|escalator' + project-pattern: 'functest|sdnvpn|qtip|daisy|sfc|escalator|releng' branches: - branch-compare-type: 'ANT' branch-pattern: '**/{branch}' @@ -76,7 +75,6 @@ parameters: - project-parameter: project: $GERRIT_PROJECT - - gerrit-parameter: branch: '{branch}' - node: name: SLAVE_NAME @@ -104,7 +102,7 @@ comment-contains-value: 'reverify' projects: - project-compare-type: 'REG_EXP' - project-pattern: 'compass4nfv' + project-pattern: '' branches: - branch-compare-type: 'ANT' branch-pattern: '**/{branch}' diff --git a/jjb/releng/releng-ci-jobs.yml b/jjb/releng/releng-ci-jobs.yml index 626daffbd..ecc87303f 100644 --- a/jjb/releng/releng-ci-jobs.yml +++ b/jjb/releng/releng-ci-jobs.yml @@ -13,7 +13,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: 'master' scm: - git-scm-gerrit @@ -64,7 +63,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: 'master' scm: @@ -104,7 +102,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: 'master' scm: diff --git a/jjb/releng/testapi-automate.yml b/jjb/releng/testapi-automate.yml index 2a2f7b6d4..dd76538a3 100644 --- a/jjb/releng/testapi-automate.yml +++ b/jjb/releng/testapi-automate.yml @@ -4,23 +4,133 @@ - master: branch: '{stream}' gs-pathname: '' + + phase: + - 'docker-update' + - 'docker-deploy': + slave-label: 'testresults' + - 'generate-doc' + jobs: - 'testapi-automate-{stream}' + - 'testapi-automate-{phase}-{stream}' + - 'testapi-verify-{stream}' + project: 'releng' +- job: + name: 'testapi-mongodb-backup' + + parameters: + - label: + name: SLAVE_LABEL + default: 'testresults' + description: 'Slave label on Jenkins' + - project-parameter: + project: 'releng' + branch: 'master' + - string: + name: GIT_BASE + default: https://gerrit.opnfv.org/gerrit/releng + description: 'Git URL to use on this Jenkins Slave' + + scm: + - git-scm + + triggers: + - timed: '@weekly' + + builders: + - mongodb-backup + +- job-template: + name: 'testapi-verify-{stream}' + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - 'opnfv-build-ubuntu-defaults' + + scm: + - git-scm-gerrit + + triggers: + - gerrit: + server-name: 'gerrit.opnfv.org' + trigger-on: + - patchset-created-event: + exclude-drafts: 'false' + exclude-trivial-rebase: 'false' + exclude-no-code-change: 'false' + - draft-published-event + - comment-added-contains-event: + comment-contains-value: 'recheck' + - comment-added-contains-event: + comment-contains-value: 'reverify' + projects: + - project-compare-type: 'ANT' + project-pattern: '{project}' + branches: + - branch-compare-type: 'ANT' + branch-pattern: '**/{branch}' + file-paths: + - compare-type: 'ANT' + pattern: 'utils/test/testapi/**' + + builders: + - run-unit-tests + + publishers: + - junit: + results: nosetests.xml + - cobertura: + report-file: "coverage.xml" + only-stable: "true" + health-auto-update: "false" + stability-auto-update: "false" + zoom-coverage-chart: "true" + targets: + - files: + healthy: 10 + unhealthy: 20 + failing: 30 + - method: + healthy: 50 + unhealthy: 40 + failing: 30 + - job-template: name: 'testapi-automate-{stream}' + project-type: multijob + + properties: + - throttle: + enabled: true + max-total: 1 + max-per-node: 1 + option: 'project' + parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' + - string: + name: DOCKER_TAG + default: "latest" + description: "Tag name for testapi docker image" - 'opnfv-build-defaults' scm: - git-scm + wrappers: + - ssh-agent-wrapper + - timeout: + timeout: 360 + fail: true + triggers: - gerrit: server-name: 'gerrit.opnfv.org' @@ -36,38 +146,128 @@ branch-pattern: '**/{branch}' file-paths: - compare-type: 'ANT' - pattern: 'utils/**' + pattern: 'utils/test/testapi/**' + + builders: + - description-setter: + description: "Built on $NODE_NAME" + - multijob: + name: docker-update + condition: SUCCESSFUL + projects: + - name: 'testapi-automate-docker-update-{stream}' + current-parameters: true + kill-phase-on: FAILURE + abort-all-job: true + - multijob: + name: docker-deploy + condition: SUCCESSFUL + projects: + - name: 'testapi-automate-docker-deploy-{stream}' + current-parameters: false + predefined-parameters: | + GIT_BASE=$GIT_BASE + node-label-name: SLAVE_LABEL + node-label: testresults + kill-phase-on: FAILURE + abort-all-job: true + - multijob: + name: generate-doc + condition: SUCCESSFUL + projects: + - name: 'testapi-automate-generate-doc-{stream}' + current-parameters: true + kill-phase-on: FAILURE + abort-all-job: true + + publishers: + - 'email-publisher' + +- job-template: + name: 'testapi-automate-{phase}-{stream}' + + properties: + - throttle: + enabled: true + max-per-node: 1 + option: 'project' + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - string: + name: DOCKER_TAG + default: "latest" + description: "Tag name for testapi docker image" + + wrappers: + - ssh-agent-wrapper + - timeout: + timeout: 120 + fail: true + + scm: + - git-scm builders: - - start-testapi-server - - testapi-doc-build - - upload-doc-artifact - - clean-testapi-server + - description-setter: + description: "Built on $NODE_NAME" + - 'testapi-automate-{phase}-macro' ################################ # job builders ################################ +- builder: + name: mongodb-backup + builders: + - shell: | + bash ./jjb/releng/testapi-backup-mongodb.sh - builder: - name: testapi-doc-build + name: 'run-unit-tests' builders: - shell: | - python ./utils/test/testapi/htmlize/htmlize.py -o ${WORKSPACE}/ + bash ./utils/test/testapi/run_test.sh - builder: - name: start-testapi-server + name: 'testapi-automate-docker-update-macro' builders: - shell: | - bash ./utils/test/testapi/htmlize/prepare.sh + bash ./jjb/releng/testapi-docker-update.sh - builder: - name: clean-testapi-server + name: 'testapi-automate-generate-doc-macro' + builders: + - 'testapi-doc-build' + - 'upload-doc-artifact' + +- builder: + name: 'testapi-doc-build' builders: - shell: | - bash ./utils/test/testapi/htmlize/finish.sh + bash ./utils/test/testapi/htmlize/doc-build.sh - builder: - name: upload-doc-artifact + name: 'upload-doc-artifact' builders: - shell: | bash ./utils/test/testapi/htmlize/push-doc-artifact.sh + +- builder: + name: 'testapi-automate-docker-deploy-macro' + builders: + - shell: | + bash ./jjb/releng/testapi-docker-deploy.sh + +################################ +# job publishers +################################ + +- publisher: + name: 'email-publisher' + publishers: + - email: + recipients: rohitsakala@gmail.com feng.xiaowei@zte.com.cn + notify-every-unstable-build: false + send-to-individuals: true diff --git a/jjb/releng/testapi-backup-mongodb.sh b/jjb/releng/testapi-backup-mongodb.sh new file mode 100644 index 000000000..795e479d9 --- /dev/null +++ b/jjb/releng/testapi-backup-mongodb.sh @@ -0,0 +1,31 @@ +#!/bin/bash + +set -e + +# Run MongoDB backup +python $WORKSPACE/utils/test/testapi/update/templates/backup_mongodb.py -o $WORKSPACE/ + +# Compressing the dump +now=$(date +"%m_%d_%Y_%H_%M_%S") +echo $now + +file_name="testapi_mongodb_"$now".tar.gz" +echo $file_name + +tar cvfz "$file_name" test_results_collection* + +rm -rf test_results_collection* + +artifact_dir="testapibackup" +workspace="$WORKSPACE" + +set +e +/usr/local/bin/gsutil &>/dev/null +if [ $? != 0 ]; then + echo "Not possible to push results to artifact: gsutil not installed" + exit 1 +else + echo "Uploading mongodump to artifact $artifact_dir" + /usr/local/bin/gsutil cp -r "$workspace"/"$file_name" gs://artifacts.opnfv.org/"$artifact_dir"/ + echo "MongoDump can be found at http://artifacts.opnfv.org/$artifact_dir.html" +fi diff --git a/jjb/releng/testapi-docker-deploy.sh b/jjb/releng/testapi-docker-deploy.sh new file mode 100644 index 000000000..b4e60b09a --- /dev/null +++ b/jjb/releng/testapi-docker-deploy.sh @@ -0,0 +1,81 @@ +#!/bin/bash + +function check() { + + # Verify hosted + sleep 5 + cmd=`curl -s --head --request GET http://testresults.opnfv.org/test/swagger/spec | grep '200 OK' > /dev/null` + rc=$? + echo $rc + + if [[ $rc == 0 ]] + then + return 0 + else + return 1 + fi + +} + +echo "Getting contianer Id of the currently running one" +contId=$(sudo docker ps | grep "opnfv/testapi:latest" | awk '{print $1}') + +echo "Pulling the latest image" +sudo docker pull opnfv/testapi:latest + +echo "Deleting old containers of opnfv/testapi:old" +sudo docker ps -a | grep "opnfv/testapi" | grep "old" | awk '{print $1}' | xargs -r sudo docker rm -f + +echo "Deleting old images of opnfv/testapi:latest" +sudo docker images | grep "opnfv/testapi" | grep "old" | awk '{print $3}' | xargs -r sudo docker rmi -f + + +if [[ -z "$contId" ]] +then + echo "No running testapi container" + + echo "Removing stopped testapi containers in the previous iterations" + sudo docker ps -f status=exited | grep "opnfv_testapi" | awk '{print $1}' | xargs -r sudo docker rm -f +else + echo $contId + + echo "Get the image id of the currently running conatiner" + currImgId=$(sudo docker ps | grep "$contId" | awk '{print $2}') + echo $currImgId + + if [[ -z "$currImgId" ]] + then + echo "No image id found for the container id" + exit 1 + fi + + echo "Changing current image tag to old" + sudo docker tag "$currImgId" opnfv/testapi:old + + echo "Removing stopped testapi containers in the previous iteration" + sudo docker ps -f status=exited | grep "opnfv_testapi" | awk '{print $1}' | xargs -r sudo docker rm -f + + echo "Renaming the running container name to opnfv_testapi as to identify it." + sudo docker rename $contId opnfv_testapi + + echo "Stop the currently running container" + sudo docker stop $contId +fi + +echo "Running a container with the new image" +sudo docker run -dti -p "8082:8000" -e "mongodb_url=mongodb://172.17.0.1:27017" -e "swagger_url=http://testresults.opnfv.org/test" opnfv/testapi:latest + +if check; then + echo "TestResults Hosted." +else + echo "TestResults Hosting Failed" + if [[ $(sudo docker images | grep "opnfv/testapi" | grep "old" | awk '{print $3}') ]]; then + echo "Running old Image" + sudo docker run -dti -p "8082:8000" -e "mongodb_url=mongodb://172.17.0.1:27017" -e "swagger_url=http://testresults.opnfv.org/test" opnfv/testapi:old + exit 1 + fi +fi + +# Echo Images and Containers +sudo docker images +sudo docker ps -a diff --git a/jjb/releng/testapi-docker-update.sh b/jjb/releng/testapi-docker-update.sh new file mode 100644 index 000000000..84f5c3217 --- /dev/null +++ b/jjb/releng/testapi-docker-update.sh @@ -0,0 +1,18 @@ +#!/bin/bash + +set -o errexit +set -o nounset + +cd $WORKSPACE/utils/test/testapi/docker/ + +# Remove previous containers +docker ps -a | grep "opnfv/testapi" | awk '{ print $1 }' | xargs -r docker rm -f + +# Remove previous images +docker images | grep "opnfv/testapi" | awk '{ print $3 }' | xargs -r docker rmi -f + +# Start build +docker build --no-cache -t opnfv/testapi:$DOCKER_TAG . + +# Push Image +docker push opnfv/testapi:$DOCKER_TAG diff --git a/jjb/securityaudit/opnfv-security-audit.yml b/jjb/securityaudit/opnfv-security-audit.yml index 680be20d2..732df8925 100644 --- a/jjb/securityaudit/opnfv-security-audit.yml +++ b/jjb/securityaudit/opnfv-security-audit.yml @@ -27,7 +27,6 @@ parameters: - project-parameter: project: $GERRIT_PROJECT - - gerrit-parameter: branch: '{branch}' scm: diff --git a/jjb/snaps/snaps.yml b/jjb/snaps/snaps.yml new file mode 100644 index 000000000..32680f54e --- /dev/null +++ b/jjb/snaps/snaps.yml @@ -0,0 +1,62 @@ +################################################### +# All the jobs except verify have been removed! +# They will only be enabled on request by projects! +################################################### +- project: + name: snaps + + project: '{name}' + + jobs: + - 'snaps-verify-{stream}' + + stream: + - master: + branch: '{stream}' + gs-pathname: '' + disabled: false + - danube: + branch: 'stable/{stream}' + gs-pathname: '/{stream}' + disabled: true + +- job-template: + name: 'snaps-verify-{stream}' + + disabled: '{obj:disabled}' + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - 'opnfv-build-ubuntu-defaults' + + scm: + - git-scm-gerrit + + triggers: + - gerrit: + server-name: 'gerrit.opnfv.org' + trigger-on: + - patchset-created-event: + exclude-drafts: 'false' + exclude-trivial-rebase: 'false' + exclude-no-code-change: 'false' + - draft-published-event + - comment-added-contains-event: + comment-contains-value: 'recheck' + - comment-added-contains-event: + comment-contains-value: 'reverify' + projects: + - project-compare-type: 'ANT' + project-pattern: '{project}' + branches: + - branch-compare-type: 'ANT' + branch-pattern: '**/{branch}' + forbidden-file-paths: + - compare-type: ANT + pattern: 'docs/**|.gitignore' + + builders: + - shell: | + echo "Nothing to verify!" diff --git a/jjb/storperf/storperf.yml b/jjb/storperf/storperf.yml index 95d464c9b..a04a9f4b4 100644 --- a/jjb/storperf/storperf.yml +++ b/jjb/storperf/storperf.yml @@ -28,7 +28,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - string: name: GIT_BASE @@ -89,8 +88,7 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: - branch: 'master' + branch: '{branch}' - string: name: GIT_BASE default: https://gerrit.opnfv.org/gerrit/$PROJECT @@ -144,15 +142,13 @@ # Required Variables: # stream: branch with - in place of / (eg. stable) # branch: branch (eg. stable) - node: opnfv-build-ubuntu - - disabled: true + disabled: '{obj:disabled}' parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' + - 'intel-pod9-defaults' scm: - git-scm diff --git a/jjb/ves/ves.yml b/jjb/ves/ves.yml new file mode 100644 index 000000000..3d3ba2ca8 --- /dev/null +++ b/jjb/ves/ves.yml @@ -0,0 +1,68 @@ +################################################### +# All the jobs except verify have been removed! +# They will only be enabled on request by projects! +################################################### +- project: + name: ves + + project: '{name}' + + jobs: + - 'ves-verify-{stream}' + + stream: + - master: + branch: '{stream}' + gs-pathname: '' + disabled: false + - danube: + branch: 'stable/{stream}' + gs-pathname: '/{stream}' + disabled: false + +- job-template: + name: 'ves-verify-{stream}' + + disabled: '{obj:disabled}' + + parameters: + - project-parameter: + project: '{project}' + branch: '{branch}' + - 'opnfv-build-ubuntu-defaults' + + scm: + - git-scm-gerrit + + triggers: + - gerrit: + server-name: 'gerrit.opnfv.org' + trigger-on: + - patchset-created-event: + exclude-drafts: 'false' + exclude-trivial-rebase: 'false' + exclude-no-code-change: 'false' + - draft-published-event + - comment-added-contains-event: + comment-contains-value: 'recheck' + - comment-added-contains-event: + comment-contains-value: 'reverify' + projects: + - project-compare-type: 'ANT' + project-pattern: '{project}' + branches: + - branch-compare-type: 'ANT' + branch-pattern: '**/{branch}' + forbidden-file-paths: + - compare-type: ANT + pattern: 'docs/**|.gitignore' + + builders: + - shell: | + #!/bin/bash + set -o errexit + set -o nounset + set -o pipefail + + # shellcheck -f tty tests/*.sh + # shellcheck -f tty utils/*.sh diff --git a/jjb/vnf_forwarding_graph/vnf_forwarding_graph.yml b/jjb/vnf_forwarding_graph/vnf_forwarding_graph.yml index c129f4937..450599eaf 100644 --- a/jjb/vnf_forwarding_graph/vnf_forwarding_graph.yml +++ b/jjb/vnf_forwarding_graph/vnf_forwarding_graph.yml @@ -24,7 +24,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' scm: - git-scm-gerrit diff --git a/jjb/vswitchperf/vswitchperf.yml b/jjb/vswitchperf/vswitchperf.yml index 4cfe5d98f..ef0e90a76 100644 --- a/jjb/vswitchperf/vswitchperf.yml +++ b/jjb/vswitchperf/vswitchperf.yml @@ -19,7 +19,7 @@ branch: 'stable/{stream}' gs-pathname: '/{stream}' disabled: true - slave-label: 'intel-pod3' + slave-label: 'intel-pod12' - job-template: @@ -30,9 +30,8 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - - 'intel-pod3-defaults' + - 'intel-pod12-defaults' scm: - git-scm @@ -62,6 +61,7 @@ concurrent: true properties: + - logrotate-default - build-blocker: use-build-blocker: true blocking-jobs: @@ -72,7 +72,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{slave-label}-defaults' @@ -123,6 +122,7 @@ concurrent: true properties: + - logrotate-default - build-blocker: use-build-blocker: true blocking-jobs: @@ -133,7 +133,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{slave-label}-defaults' diff --git a/jjb/yardstick/yardstick-ci-jobs.yml b/jjb/yardstick/yardstick-ci-jobs.yml index ed2dccab8..1f2f3122c 100644 --- a/jjb/yardstick/yardstick-ci-jobs.yml +++ b/jjb/yardstick/yardstick-ci-jobs.yml @@ -197,8 +197,8 @@ installer: compass auto-trigger-name: 'yardstick-daily-huawei-pod4-trigger' <<: *master - - huawei-pod5: - slave-label: '{pod}' + - baremetal-centos: + slave-label: 'intel-pod8' installer: compass auto-trigger-name: 'daily-trigger-disabled' <<: *master @@ -220,6 +220,7 @@ concurrent: true properties: + - logrotate-default - throttle: enabled: true max-per-node: 1 @@ -238,7 +239,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - '{installer}-defaults' - '{slave-label}-defaults' @@ -272,7 +272,7 @@ publishers: - email: - recipients: jean.gaoliang@huawei.com matthew.lijun@huawei.com + recipients: jean.gaoliang@huawei.com limingjiang@huawei.com ######################## # builder macros @@ -381,15 +381,6 @@ name: YARDSTICK_DB_BACKEND default: '-i 104.197.68.199:8086' description: 'Arguments to use in order to choose the backend DB' - -- parameter: - name: 'yardstick-params-huawei-pod5' - parameters: - - string: - name: YARDSTICK_DB_BACKEND - default: '-i 104.197.68.199:8086' - description: 'Arguments to use in order to choose the backend DB' - - parameter: name: 'yardstick-params-zte-pod1' parameters: diff --git a/jjb/yardstick/yardstick-daily.sh b/jjb/yardstick/yardstick-daily.sh index da9042bbc..f769e9cdd 100755 --- a/jjb/yardstick/yardstick-daily.sh +++ b/jjb/yardstick/yardstick-daily.sh @@ -31,14 +31,14 @@ fi opts="--privileged=true --rm" envs="-e INSTALLER_TYPE=${INSTALLER_TYPE} -e INSTALLER_IP=${INSTALLER_IP} \ -e NODE_NAME=${NODE_NAME} -e EXTERNAL_NETWORK=${EXTERNAL_NETWORK} \ - -e YARDSTICK_BRANCH=${GIT_BRANCH##origin/} -e DEPLOY_SCENARIO=${DEPLOY_SCENARIO}" + -e YARDSTICK_BRANCH=${BRANCH} -e DEPLOY_SCENARIO=${DEPLOY_SCENARIO}" # Pull the image with correct tag echo "Yardstick: Pulling image opnfv/yardstick:${DOCKER_TAG}" docker pull opnfv/yardstick:$DOCKER_TAG >$redirect # map log directory -branch=${GIT_BRANCH##*/} +branch=${BRANCH##*/} dir_result="${HOME}/opnfv/yardstick/results/${branch}" mkdir -p ${dir_result} sudo rm -rf ${dir_result}/* diff --git a/jjb/yardstick/yardstick-project-jobs.yml b/jjb/yardstick/yardstick-project-jobs.yml index a54750ef7..bbfa152a2 100644 --- a/jjb/yardstick/yardstick-project-jobs.yml +++ b/jjb/yardstick/yardstick-project-jobs.yml @@ -33,7 +33,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' @@ -70,7 +69,6 @@ parameters: - project-parameter: project: '{project}' - - gerrit-parameter: branch: '{branch}' - 'opnfv-build-ubuntu-defaults' - string: @@ -110,18 +108,8 @@ set -o errexit set -o pipefail + sudo apt-get install -y build-essential python-dev python3-dev + echo "Running unit tests..." cd $WORKSPACE - virtualenv $WORKSPACE/yardstick_venv - source $WORKSPACE/yardstick_venv/bin/activate - - # install python packages - easy_install -U setuptools - easy_install -U pip - pip install -r requirements.txt || pip install -r tests/ci/requirements.txt - pip install -e . - - # unit tests - ./run_tests.sh - - deactivate + tox diff --git a/modules/opnfv/installer_adapters/__init__.py b/modules/opnfv/deployment/__init__.py index e69de29bb..e69de29bb 100644 --- a/modules/opnfv/installer_adapters/__init__.py +++ b/modules/opnfv/deployment/__init__.py diff --git a/modules/opnfv/installer_adapters/apex/__init__.py b/modules/opnfv/deployment/apex/__init__.py index e69de29bb..e69de29bb 100644 --- a/modules/opnfv/installer_adapters/apex/__init__.py +++ b/modules/opnfv/deployment/apex/__init__.py diff --git a/modules/opnfv/deployment/apex/adapter.py b/modules/opnfv/deployment/apex/adapter.py new file mode 100644 index 000000000..225e17438 --- /dev/null +++ b/modules/opnfv/deployment/apex/adapter.py @@ -0,0 +1,100 @@ +############################################################################## +# Copyright (c) 2017 Ericsson AB and others. +# Author: Jose Lausuch (jose.lausuch@ericsson.com) +# All rights reserved. This program and the accompanying materials +# are made available under the terms of the Apache License, Version 2.0 +# which accompanies this distribution, and is available at +# http://www.apache.org/licenses/LICENSE-2.0 +############################################################################## + +import re + +from opnfv.deployment import manager +from opnfv.utils import opnfv_logger as logger +from opnfv.utils import ssh_utils + +logger = logger.Logger(__name__).getLogger() + + +class ApexAdapter(manager.DeploymentHandler): + + def __init__(self, installer_ip, installer_user, pkey_file): + super(ApexAdapter, self).__init__(installer='apex', + installer_ip=installer_ip, + installer_user=installer_user, + installer_pwd=None, + pkey_file=pkey_file) + + def get_nodes(self): + nodes = [] + cmd = "source /home/stack/stackrc;openstack server list" + output = self.installer_node.run_cmd(cmd) + lines = output.rsplit('\n') + if len(lines) < 4: + logger.info("No nodes found in the deployment.") + return None + + for line in lines: + roles = [] + if any(x in line for x in ['-----', 'Networks']): + continue + if 'controller' in line: + roles.append(manager.Role.CONTROLLER) + if 'compute' in line: + roles.append(manager.Role.COMPUTE) + if 'opendaylight' in line.lower(): + roles.append(manager.Role.ODL) + + fields = line.split('|') + id = re.sub('[!| ]', '', fields[1]).encode() + name = re.sub('[!| ]', '', fields[2]).encode() + status_node = re.sub('[!| ]', '', fields[3]).encode().lower() + ip = re.sub('[!| ctlplane=]', '', fields[4]).encode() + + ssh_client = None + if 'active' in status_node: + status = manager.NodeStatus.STATUS_OK + ssh_client = ssh_utils.get_ssh_client(hostname=ip, + username='heat-admin', + pkey_file=self.pkey_file) + elif 'error' in status_node: + status = manager.NodeStatus.STATUS_ERROR + elif 'off' in status_node: + status = manager.NodeStatus.STATUS_OFFLINE + else: + status = manager.NodeStatus.STATUS_INACTIVE + + node = manager.Node(id, ip, name, status, roles, ssh_client) + nodes.append(node) + + return nodes + + def get_openstack_version(self): + cmd = 'source overcloudrc;sudo nova-manage version' + result = self.installer_node.run_cmd(cmd) + return result + + def get_sdn_version(self): + cmd_descr = ("sudo yum info opendaylight 2>/dev/null|" + "grep Description|sed 's/^.*\: //'") + cmd_ver = ("sudo yum info opendaylight 2>/dev/null|" + "grep Version|sed 's/^.*\: //'") + description = None + for node in self.nodes: + if node.is_controller(): + description = node.run_cmd(cmd_descr) + version = node.run_cmd(cmd_ver) + break + + if description is None: + return None + else: + return description + ':' + version + + def get_deployment_status(self): + cmd = 'source stackrc;openstack stack list|grep CREATE_COMPLETE' + result = self.installer_node.run_cmd(cmd) + if result is None or len(result) == 0: + return 'failed' + else: + return 'active' diff --git a/modules/opnfv/deployment/example.py b/modules/opnfv/deployment/example.py new file mode 100644 index 000000000..3999a11c6 --- /dev/null +++ b/modules/opnfv/deployment/example.py @@ -0,0 +1,36 @@ +# This is an example of usage of this Tool +# Author: Jose Lausuch (jose.lausuch@ericsson.com) + +from opnfv.deployment import factory + +print("########## APEX ##########") +handler = factory.Factory.get_handler('apex', + '192.168.122.135', + 'stack', + pkey_file='/root/.ssh/id_rsa') + + +installer_node = handler.get_installer_node() +print("Hello, I am node '%s'" % installer_node.run_cmd('hostname')) +installer_node.get_file('/home/stack/overcloudrc', './overcloudrc') + +nodes = handler.get_nodes() +for node in nodes: + print("Hello, I am node '%s' and my ip is %s." % + (node.run_cmd('hostname'), node.ip)) + +print(handler.get_deployment_info()) + + +print("########## FUEL ##########") +handler = factory.Factory.get_handler('fuel', + '10.20.0.2', + 'root', + installer_pwd='r00tme') + +print(handler.get_deployment_info()) + +print("List of nodes in cluster 4:") +nodes = handler.get_nodes({'cluster': '4'}) +for node in nodes: + print(node) diff --git a/modules/opnfv/deployment/factory.py b/modules/opnfv/deployment/factory.py new file mode 100644 index 000000000..1ccee4e80 --- /dev/null +++ b/modules/opnfv/deployment/factory.py @@ -0,0 +1,45 @@ +############################################################################## +# Copyright (c) 2017 Ericsson AB and others. +# Author: Jose Lausuch (jose.lausuch@ericsson.com) +# All rights reserved. This program and the accompanying materials +# are made available under the terms of the Apache License, Version 2.0 +# which accompanies this distribution, and is available at +# http://www.apache.org/licenses/LICENSE-2.0 +############################################################################## + + +from opnfv.deployment.apex import adapter as apex_adapter +from opnfv.deployment.fuel import adapter as fuel_adapter +from opnfv.utils import opnfv_logger as logger + +logger = logger.Logger(__name__).getLogger() + + +class Factory(object): + + INSTALLERS = ["fuel", "apex", "compass", "joid", "daisy"] + + def __init__(self): + pass + + @staticmethod + def get_handler(installer, + installer_ip, + installer_user, + installer_pwd=None, + pkey_file=None): + + if installer not in Factory.INSTALLERS: + raise Exception("This is not an OPNFV installer.") + + if installer.lower() == "apex": + return apex_adapter.ApexAdapter(installer_ip=installer_ip, + installer_user=installer_user, + pkey_file=pkey_file) + elif installer.lower() == "fuel": + return fuel_adapter.FuelAdapter(installer_ip=installer_ip, + installer_user=installer_user, + installer_pwd=installer_pwd) + else: + raise Exception("Installer adapter is not implemented for " + "the given installer.") diff --git a/modules/opnfv/installer_adapters/compass/__init__.py b/modules/opnfv/deployment/fuel/__init__.py index e69de29bb..e69de29bb 100644 --- a/modules/opnfv/installer_adapters/compass/__init__.py +++ b/modules/opnfv/deployment/fuel/__init__.py diff --git a/modules/opnfv/deployment/fuel/adapter.py b/modules/opnfv/deployment/fuel/adapter.py new file mode 100644 index 000000000..a217767ba --- /dev/null +++ b/modules/opnfv/deployment/fuel/adapter.py @@ -0,0 +1,199 @@ +############################################################################## +# Copyright (c) 2017 Ericsson AB and others. +# Author: Jose Lausuch (jose.lausuch@ericsson.com) +# George Paraskevopoulos (geopar@intracom-telecom.com) +# All rights reserved. This program and the accompanying materials +# are made available under the terms of the Apache License, Version 2.0 +# which accompanies this distribution, and is available at +# http://www.apache.org/licenses/LICENSE-2.0 +############################################################################## + + +from opnfv.deployment import manager +from opnfv.utils import opnfv_logger as logger +from opnfv.utils import ssh_utils + +logger = logger.Logger(__name__).getLogger() + + +class FuelAdapter(manager.DeploymentHandler): + + def __init__(self, installer_ip, installer_user, installer_pwd): + super(FuelAdapter, self).__init__(installer='fuel', + installer_ip=installer_ip, + installer_user=installer_user, + installer_pwd=installer_pwd, + pkey_file=None) + + def _get_clusters(self): + environments = [] + output = self.runcmd_fuel_env() + lines = output.rsplit('\n') + if len(lines) < 2: + logger.info("No environments found in the deployment.") + return None + else: + fields = lines[0].rsplit(' | ') + + index_id = -1 + index_status = -1 + index_name = -1 + index_release_id = -1 + + for i in range(len(fields)): + if "id" in fields[i]: + index_id = i + elif "status" in fields[i]: + index_status = i + elif "name" in fields[i]: + index_name = i + elif "release_id" in fields[i]: + index_release_id = i + + # order env info + for i in range(2, len(lines)): + fields = lines[i].rsplit(' | ') + dict = {"id": fields[index_id].strip(), + "status": fields[index_status].strip(), + "name": fields[index_name].strip(), + "release_id": fields[index_release_id].strip()} + environments.append(dict) + + return environments + + def get_nodes(self, options=None): + + if options and options['cluster'] and len(self.nodes) > 0: + n = [] + for node in self.nodes: + if str(node.info['cluster']) == str(options['cluster']): + n.append(node) + return n + + try: + # if we have retrieved previously all the nodes, don't do it again + # This fails the first time when the constructor calls this method + # therefore the try/except + if len(self.nodes) > 0: + return self.nodes + except: + pass + + nodes = [] + cmd = 'fuel node' + output = self.installer_node.run_cmd(cmd) + lines = output.rsplit('\n') + if len(lines) < 2: + logger.info("No nodes found in the deployment.") + return nodes + + # get fields indexes + fields = lines[0].rsplit(' | ') + + index_id = -1 + index_status = -1 + index_name = -1 + index_cluster = -1 + index_ip = -1 + index_mac = -1 + index_roles = -1 + index_online = -1 + + for i in range(len(fields)): + if "group_id" in fields[i]: + break + elif "id" in fields[i]: + index_id = i + elif "status" in fields[i]: + index_status = i + elif "name" in fields[i]: + index_name = i + elif "cluster" in fields[i]: + index_cluster = i + elif "ip" in fields[i]: + index_ip = i + elif "mac" in fields[i]: + index_mac = i + elif "roles " in fields[i] and "pending_roles" not in fields[i]: + index_roles = i + elif "online" in fields[i]: + index_online = i + + # order nodes info + for i in range(2, len(lines)): + fields = lines[i].rsplit(' | ') + id = fields[index_id].strip().encode() + ip = fields[index_ip].strip().encode() + status_node = fields[index_status].strip().encode().lower() + name = fields[index_name].strip().encode() + roles_all = fields[index_roles].strip().encode().lower() + + roles = [x for x in [manager.Role.CONTROLLER, + manager.Role.COMPUTE, + manager.Role.ODL] if x in roles_all] + + dict = {"cluster": fields[index_cluster].strip().encode(), + "mac": fields[index_mac].strip().encode(), + "status_node": status_node, + "online": fields[index_online].strip().encode()} + + ssh_client = None + if status_node == 'ready': + status = manager.NodeStatus.STATUS_OK + proxy = {'ip': self.installer_ip, + 'username': self.installer_user, + 'password': self.installer_pwd} + ssh_client = ssh_utils.get_ssh_client(hostname=ip, + username='root', + proxy=proxy) + elif 'error' in status_node: + status = manager.NodeStatus.STATUS_ERROR + elif 'off' in status_node: + status = manager.NodeStatus.STATUS_OFFLINE + elif 'discover' in status_node: + status = manager.NodeStatus.STATUS_UNUSED + else: + status = manager.NodeStatus.STATUS_INACTIVE + + node = manager.Node( + id, ip, name, status, roles, ssh_client, dict) + if options and options['cluster']: + if fields[index_cluster].strip() == options['cluster']: + nodes.append(node) + else: + nodes.append(node) + + self.get_nodes_called = True + return nodes + + def get_openstack_version(self): + cmd = 'source openrc;nova-manage version 2>/dev/null' + version = None + for node in self.nodes: + if node.is_controller() and node.is_active(): + version = node.run_cmd(cmd) + break + return version + + def get_sdn_version(self): + cmd = "apt-cache policy opendaylight|grep Installed" + version = None + for node in self.nodes: + if manager.Role.ODL in node.roles and node.is_active(): + odl_version = node.run_cmd(cmd) + if odl_version: + version = 'OpenDaylight ' + odl_version.split(' ')[-1] + break + return version + + def get_deployment_status(self): + cmd = "fuel env|tail -1|awk '{print $3}'" + result = self.installer_node.run_cmd(cmd) + if result is None or len(result) == 0: + return 'unknown' + elif 'operational' in result: + return 'active' + elif 'deploy' in result: + return 'deploying' + else: + return 'active' diff --git a/modules/opnfv/deployment/manager.py b/modules/opnfv/deployment/manager.py new file mode 100644 index 000000000..df735f157 --- /dev/null +++ b/modules/opnfv/deployment/manager.py @@ -0,0 +1,386 @@ +############################################################################## +# Copyright (c) 2017 Ericsson AB and others. +# Author: Jose Lausuch (jose.lausuch@ericsson.com) +# All rights reserved. This program and the accompanying materials +# are made available under the terms of the Apache License, Version 2.0 +# which accompanies this distribution, and is available at +# http://www.apache.org/licenses/LICENSE-2.0 +############################################################################## + +from abc import abstractmethod +import os + + +from opnfv.utils import opnfv_logger as logger +from opnfv.utils import ssh_utils + +logger = logger.Logger(__name__).getLogger() + + +class Deployment(object): + + def __init__(self, + installer, + installer_ip, + scenario, + pod, + status, + openstack_version, + sdn_controller, + nodes=None): + + self.deployment_info = { + 'installer': installer, + 'installer_ip': installer_ip, + 'scenario': scenario, + 'pod': pod, + 'status': status, + 'openstack_version': openstack_version, + 'sdn_controller': sdn_controller, + 'nodes': nodes + } + + def _get_openstack_release(self): + ''' + Translates an openstack version into the release name + ''' + os_versions = { + '12': 'Liberty', + '13': 'Mitaka', + '14': 'Newton', + '15': 'Ocata', + '16': 'Pike', + '17': 'Queens' + } + try: + version = self.deployment_info['openstack_version'].split('.')[0] + name = os_versions[version] + return name + except Exception: + return 'Unknown release' + + def get_dict(self): + ''' + Returns a dictionary will all the attributes + ''' + return self.deployment_info + + def __str__(self): + ''' + Override of the str method + ''' + s = ''' + INSTALLER: {installer} + SCENARIO: {scenario} + INSTALLER IP: {installer_ip} + POD: {pod} + STATUS: {status} + OPENSTACK: {openstack_version} ({openstack_release}) + SDN: {sdn_controller} + NODES: + '''.format(installer=self.deployment_info['installer'], + scenario=self.deployment_info['scenario'], + installer_ip=self.deployment_info['installer_ip'], + pod=self.deployment_info['pod'], + status=self.deployment_info['status'], + openstack_version=self.deployment_info[ + 'openstack_version'], + openstack_release=self._get_openstack_release(), + sdn_controller=self.deployment_info['sdn_controller']) + + for node in self.deployment_info['nodes']: + s += '{node_object}\n'.format(node_object=node) + + return s + + +class Role(): + INSTALLER = 'installer' + CONTROLLER = 'controller' + COMPUTE = 'compute' + ODL = 'opendaylight' + ONOS = 'onos' + + +class NodeStatus(): + STATUS_OK = 'active' + STATUS_INACTIVE = 'inactive' + STATUS_OFFLINE = 'offline' + STATUS_ERROR = 'error' + STATUS_UNUSED = 'unused' + + +class Node(object): + + def __init__(self, + id, + ip, + name, + status, + roles=None, + ssh_client=None, + info=None): + self.id = id + self.ip = ip + self.name = name + self.status = status + self.ssh_client = ssh_client + self.roles = roles + self.info = info + + self.cpu_info = 'unknown' + self.memory = 'unknown' + self.ovs = 'unknown' + + if ssh_client and Role.INSTALLER not in self.roles: + sys_info = self.get_system_info() + self.cpu_info = sys_info['cpu_info'] + self.memory = sys_info['memory'] + self.ovs = self.get_ovs_info() + + def get_file(self, src, dest): + ''' + SCP file from a node + ''' + if self.status is not NodeStatus.STATUS_OK: + logger.info("The node %s is not active" % self.ip) + return 1 + logger.info("Fetching %s from %s" % (src, self.ip)) + get_file_result = ssh_utils.get_file(self.ssh_client, src, dest) + if get_file_result is None: + logger.error("SFTP failed to retrieve the file.") + else: + logger.info("Successfully copied %s:%s to %s" % + (self.ip, src, dest)) + return get_file_result + + def put_file(self, src, dest): + ''' + SCP file to a node + ''' + if self.status is not NodeStatus.STATUS_OK: + logger.info("The node %s is not active" % self.ip) + return 1 + logger.info("Copying %s to %s" % (src, self.ip)) + put_file_result = ssh_utils.put_file(self.ssh_client, src, dest) + if put_file_result is None: + logger.error("SFTP failed to retrieve the file.") + else: + logger.info("Successfully copied %s to %s:%s" % + (src, dest, self.ip)) + return put_file_result + + def run_cmd(self, cmd): + ''' + Run command remotely on a node + ''' + if self.status is not NodeStatus.STATUS_OK: + logger.error( + "Error running command %s. The node %s is not active" + % (cmd, self.ip)) + return None + _, stdout, stderr = (self.ssh_client.exec_command(cmd)) + error = stderr.readlines() + if len(error) > 0: + logger.error("error %s" % ''.join(error)) + return None + output = ''.join(stdout.readlines()).rstrip() + return output + + def get_dict(self): + ''' + Returns a dictionary with all the attributes + ''' + return { + 'id': self.id, + 'ip': self.ip, + 'name': self.name, + 'status': self.status, + 'roles': self.roles, + 'cpu_info': self.cpu_info, + 'memory': self.memory, + 'ovs': self.ovs, + 'info': self.info + } + + def is_active(self): + ''' + Returns if the node is active + ''' + if self.status == NodeStatus.STATUS_OK: + return True + return False + + def is_controller(self): + ''' + Returns if the node is a controller + ''' + return Role.CONTROLLER in self.roles + + def is_compute(self): + ''' + Returns if the node is a compute + ''' + return Role.COMPUTE in self.roles + + def is_odl(self): + ''' + Returns if the node is an opendaylight + ''' + return Role.ODL in self.roles + + def get_ovs_info(self): + ''' + Returns the ovs version installed + ''' + if self.is_active(): + cmd = "ovs-vsctl --version|head -1| sed 's/^.*) //'" + return self.run_cmd(cmd) + return None + + def get_system_info(self): + ''' + Returns the ovs version installed + ''' + cmd = 'grep MemTotal /proc/meminfo' + memory = self.run_cmd(cmd).partition('MemTotal:')[-1].strip().encode() + + cpu_info = {} + cmd = 'lscpu' + result = self.run_cmd(cmd) + for line in result.splitlines(): + if line.startswith('CPU(s)'): + cpu_info['num_cpus'] = line.split(' ')[-1].encode() + elif line.startswith('Thread(s) per core'): + cpu_info['threads/core'] = line.split(' ')[-1].encode() + elif line.startswith('Core(s) per socket'): + cpu_info['cores/socket'] = line.split(' ')[-1].encode() + elif line.startswith('Model name'): + cpu_info['model'] = line.partition( + 'Model name:')[-1].strip().encode() + elif line.startswith('Architecture'): + cpu_info['arch'] = line.split(' ')[-1].encode() + + return {'memory': memory, 'cpu_info': cpu_info} + + def __str__(self): + return ''' + name: {name} + id: {id} + ip: {ip} + status: {status} + roles: {roles} + cpu: {cpu_info} + memory: {memory} + ovs: {ovs} + info: {info}'''.format(name=self.name, + id=self.id, + ip=self.ip, + status=self.status, + roles=self.roles, + cpu_info=self.cpu_info, + memory=self.memory, + ovs=self.ovs, + info=self.info) + + +class DeploymentHandler(object): + + EX_OK = os.EX_OK + EX_ERROR = os.EX_SOFTWARE + FUNCTION_NOT_IMPLEMENTED = "Function not implemented by adapter!" + + def __init__(self, + installer, + installer_ip, + installer_user, + installer_pwd=None, + pkey_file=None): + + self.installer = installer.lower() + self.installer_ip = installer_ip + self.installer_user = installer_user + self.installer_pwd = installer_pwd + self.pkey_file = pkey_file + + if pkey_file is not None and not os.path.isfile(pkey_file): + raise Exception( + 'The private key file %s does not exist!' % pkey_file) + + self.installer_connection = ssh_utils.get_ssh_client( + hostname=self.installer_ip, + username=self.installer_user, + password=self.installer_pwd, + pkey_file=self.pkey_file) + + if self.installer_connection: + self.installer_node = Node(id='', + ip=installer_ip, + name=installer, + status=NodeStatus.STATUS_OK, + ssh_client=self.installer_connection, + roles=Role.INSTALLER) + else: + raise Exception( + 'Cannot establish connection to the installer node!') + + self.nodes = self.get_nodes() + + @abstractmethod + def get_openstack_version(self): + ''' + Returns a string of the openstack version (nova-compute) + ''' + raise Exception(DeploymentHandler.FUNCTION_NOT_IMPLEMENTED) + + @abstractmethod + def get_sdn_version(self): + ''' + Returns a string of the sdn controller and its version, if exists + ''' + raise Exception(DeploymentHandler.FUNCTION_NOT_IMPLEMENTED) + + @abstractmethod + def get_deployment_status(self): + ''' + Returns a string of the status of the deployment + ''' + raise Exception(DeploymentHandler.FUNCTION_NOT_IMPLEMENTED) + + @abstractmethod + def get_nodes(self, options=None): + ''' + Generates a list of all the nodes in the deployment + ''' + raise Exception(DeploymentHandler.FUNCTION_NOT_IMPLEMENTED) + + def get_installer_node(self): + ''' + Returns the installer node object + ''' + return self.installer_node + + def get_arch(self): + ''' + Returns the architecture of the first compute node found + ''' + arch = None + for node in self.nodes: + if node.is_compute(): + arch = node.cpu_info.get('arch', None) + if arch: + break + return arch + + def get_deployment_info(self): + ''' + Returns an object of type Deployment + ''' + return Deployment(installer=self.installer, + installer_ip=self.installer_ip, + scenario=os.getenv('DEPLOY_SCENARIO', 'Unknown'), + status=self.get_deployment_status(), + pod=os.getenv('NODE_NAME', 'Unknown'), + openstack_version=self.get_openstack_version(), + sdn_controller=self.get_sdn_version(), + nodes=self.get_nodes()) diff --git a/modules/opnfv/installer_adapters/InstallerHandler.py b/modules/opnfv/installer_adapters/InstallerHandler.py deleted file mode 100644 index dc5bdb9d6..000000000 --- a/modules/opnfv/installer_adapters/InstallerHandler.py +++ /dev/null @@ -1,81 +0,0 @@ -############################################################################## -# Copyright (c) 2015 Ericsson AB and others. -# Author: Jose Lausuch (jose.lausuch@ericsson.com) -# All rights reserved. This program and the accompanying materials -# are made available under the terms of the Apache License, Version 2.0 -# which accompanies this distribution, and is available at -# http://www.apache.org/licenses/LICENSE-2.0 -############################################################################## - -from opnfv.installer_adapters.fuel.FuelAdapter import FuelAdapter -from opnfv.installer_adapters.apex.ApexAdapter import ApexAdapter -from opnfv.installer_adapters.compass.CompassAdapter import CompassAdapter -from opnfv.installer_adapters.joid.JoidAdapter import JoidAdapter -from opnfv.installer_adapters.daisy.DaisyAdapter import DaisyAdapter - - -INSTALLERS = ["fuel", "apex", "compass", "joid", "daisy"] - - -class InstallerHandler: - - def __init__(self, - installer, - installer_ip, - installer_user, - installer_pwd=None): - self.installer = installer.lower() - self.installer_ip = installer_ip - self.installer_user = installer_user - self.installer_pwd = installer_pwd - - if self.installer == INSTALLERS[0]: - self.InstallerAdapter = FuelAdapter(self.installer_ip, - self.installer_user, - self.installer_pwd) - elif self.installer == INSTALLERS[1]: - self.InstallerAdapter = ApexAdapter(self.installer_ip) - elif self.installer == INSTALLERS[2]: - self.InstallerAdapter = CompassAdapter(self.installer_ip) - elif self.installer == INSTALLERS[3]: - self.InstallerAdapter = JoidAdapter(self.installer_ip) - elif self.installer == INSTALLERS[4]: - self.InstallerAdapter = DaisyAdapter(self.installer_ip) - else: - print("Installer %s is not valid. " - "Please use one of the followings: %s" - % (self.installer, INSTALLERS)) - exit(1) - - def get_deployment_info(self): - return self.InstallerAdapter.get_deployment_info() - - def get_nodes(self, options=None): - return self.InstallerAdapter.get_nodes(options=options) - - def get_controller_ips(self, options=None): - return self.InstallerAdapter.get_controller_ips(options=options) - - def get_compute_ips(self, options=None): - return self.InstallerAdapter.get_compute_ips(options=options) - - def get_file_from_installer(self, - remote_path, - local_path, - options=None): - return self.InstallerAdapter.get_file_from_installer(remote_path, - local_path, - options=options) - - def get_file_from_controller(self, - remote_path, - local_path, - ip=None, - options=None): - return self.InstallerAdapter.get_file_from_controller(remote_path, - local_path, - ip=ip, - options=options) - - def get_all(self): - pass diff --git a/modules/opnfv/installer_adapters/apex/ApexAdapter.py b/modules/opnfv/installer_adapters/apex/ApexAdapter.py deleted file mode 100644 index 17a27b10a..000000000 --- a/modules/opnfv/installer_adapters/apex/ApexAdapter.py +++ /dev/null @@ -1,32 +0,0 @@ -############################################################################## -# Copyright (c) 2016 Ericsson AB and others. -# Author: Jose Lausuch (jose.lausuch@ericsson.com) -# All rights reserved. This program and the accompanying materials -# are made available under the terms of the Apache License, Version 2.0 -# which accompanies this distribution, and is available at -# http://www.apache.org/licenses/LICENSE-2.0 -############################################################################## - - -class ApexAdapter: - - def __init__(self, installer_ip): - self.installer_ip = installer_ip - - def get_deployment_info(self): - pass - - def get_nodes(self): - pass - - def get_controller_ips(self): - pass - - def get_compute_ips(self): - pass - - def get_file_from_installer(self, origin, target, options=None): - pass - - def get_file_from_controller(self, origin, target, ip=None, options=None): - pass diff --git a/modules/opnfv/installer_adapters/compass/CompassAdapter.py b/modules/opnfv/installer_adapters/compass/CompassAdapter.py deleted file mode 100644 index 47cbc646d..000000000 --- a/modules/opnfv/installer_adapters/compass/CompassAdapter.py +++ /dev/null @@ -1,32 +0,0 @@ -############################################################################## -# Copyright (c) 2016 Ericsson AB and others. -# Author: Jose Lausuch (jose.lausuch@ericsson.com) -# All rights reserved. This program and the accompanying materials -# are made available under the terms of the Apache License, Version 2.0 -# which accompanies this distribution, and is available at -# http://www.apache.org/licenses/LICENSE-2.0 -############################################################################## - - -class CompassAdapter: - - def __init__(self, installer_ip): - self.installer_ip = installer_ip - - def get_deployment_info(self): - pass - - def get_nodes(self): - pass - - def get_controller_ips(self): - pass - - def get_compute_ips(self): - pass - - def get_file_from_installer(self, origin, target, options=None): - pass - - def get_file_from_controller(self, origin, target, ip=None, options=None): - pass diff --git a/modules/opnfv/installer_adapters/daisy/DaisyAdapter.py b/modules/opnfv/installer_adapters/daisy/DaisyAdapter.py deleted file mode 100644 index 9b06f4c3c..000000000 --- a/modules/opnfv/installer_adapters/daisy/DaisyAdapter.py +++ /dev/null @@ -1,32 +0,0 @@ -############################################################################## -# Copyright (c) 2016 Ericsson AB and others. -# Author: Jose Lausuch (jose.lausuch@ericsson.com) -# All rights reserved. This program and the accompanying materials -# are made available under the terms of the Apache License, Version 2.0 -# which accompanies this distribution, and is available at -# http://www.apache.org/licenses/LICENSE-2.0 -############################################################################## - - -class DaisyAdapter: - - def __init__(self, installer_ip): - self.installer_ip = installer_ip - - def get_deployment_info(self): - pass - - def get_nodes(self): - pass - - def get_controller_ips(self): - pass - - def get_compute_ips(self): - pass - - def get_file_from_installer(self, origin, target, options=None): - pass - - def get_file_from_controller(self, origin, target, ip=None, options=None): - pass diff --git a/modules/opnfv/installer_adapters/fuel/FuelAdapter.py b/modules/opnfv/installer_adapters/fuel/FuelAdapter.py deleted file mode 100644 index 8ed8f8937..000000000 --- a/modules/opnfv/installer_adapters/fuel/FuelAdapter.py +++ /dev/null @@ -1,236 +0,0 @@ -############################################################################## -# Copyright (c) 2016 Ericsson AB and others. -# Author: Jose Lausuch (jose.lausuch@ericsson.com) -# George Paraskevopoulos (geopar@intracom-telecom.com) -# All rights reserved. This program and the accompanying materials -# are made available under the terms of the Apache License, Version 2.0 -# which accompanies this distribution, and is available at -# http://www.apache.org/licenses/LICENSE-2.0 -############################################################################## - -import opnfv.utils.SSHUtils as ssh_utils -import opnfv.utils.OPNFVLogger as logger - - -class FuelAdapter: - - def __init__(self, installer_ip, user="root", password="r00tme"): - self.installer_ip = installer_ip - self.installer_user = user - self.installer_password = password - self.installer_connection = ssh_utils.get_ssh_client( - installer_ip, - self.installer_user, - password=self.installer_password) - self.logger = logger.Logger("FuelHandler").getLogger() - - def runcmd_fuel_installer(self, cmd): - _, stdout, stderr = (self - .installer_connection - .exec_command(cmd)) - error = stderr.readlines() - if len(error) > 0: - self.logger.error("error %s" % ''.join(error)) - return error - output = ''.join(stdout.readlines()) - return output - - def runcmd_fuel_nodes(self): - return self.runcmd_fuel_installer('fuel nodes') - - def runcmd_fuel_env(self): - return self.runcmd_fuel_installer('fuel env') - - def get_clusters(self): - environments = [] - output = self.runcmd_fuel_env() - lines = output.rsplit('\n') - if len(lines) < 2: - self.logger.infp("No environments found in the deployment.") - return None - else: - fields = lines[0].rsplit(' | ') - - index_id = -1 - index_status = -1 - index_name = -1 - index_release_id = -1 - - for i in range(0, len(fields) - 1): - if "id" in fields[i]: - index_id = i - elif "status" in fields[i]: - index_status = i - elif "name" in fields[i]: - index_name = i - elif "release_id" in fields[i]: - index_release_id = i - - # order env info - for i in range(2, len(lines) - 1): - fields = lines[i].rsplit(' | ') - dict = {"id": fields[index_id].strip(), - "status": fields[index_status].strip(), - "name": fields[index_name].strip(), - "release_id": fields[index_release_id].strip()} - environments.append(dict) - - return environments - - def get_nodes(self, options=None): - nodes = [] - output = self.runcmd_fuel_nodes() - lines = output.rsplit('\n') - if len(lines) < 2: - self.logger.info("No nodes found in the deployment.") - return None - else: - # get fields indexes - fields = lines[0].rsplit(' | ') - - index_id = -1 - index_status = -1 - index_name = -1 - index_cluster = -1 - index_ip = -1 - index_mac = -1 - index_roles = -1 - index_online = -1 - - for i in range(0, len(fields) - 1): - if "id" in fields[i]: - index_id = i - elif "status" in fields[i]: - index_status = i - elif "name" in fields[i]: - index_name = i - elif "cluster" in fields[i]: - index_cluster = i - elif "ip" in fields[i]: - index_ip = i - elif "mac" in fields[i]: - index_mac = i - elif "roles " in fields[i]: - index_roles = i - elif "online" in fields[i]: - index_online = i - - # order nodes info - for i in range(2, len(lines) - 1): - fields = lines[i].rsplit(' | ') - dict = {"id": fields[index_id].strip(), - "status": fields[index_status].strip(), - "name": fields[index_name].strip(), - "cluster": fields[index_cluster].strip(), - "ip": fields[index_ip].strip(), - "mac": fields[index_mac].strip(), - "roles": fields[index_roles].strip(), - "online": fields[index_online].strip()} - if options and options['cluster']: - if fields[index_cluster].strip() == options['cluster']: - nodes.append(dict) - else: - nodes.append(dict) - - return nodes - - def get_controller_ips(self, options): - nodes = self.get_nodes(options=options) - controllers = [] - for node in nodes: - if "controller" in node["roles"]: - controllers.append(node['ip']) - return controllers - - def get_compute_ips(self, options=None): - nodes = self.get_nodes(options=options) - computes = [] - for node in nodes: - if "compute" in node["roles"]: - computes.append(node['ip']) - return computes - - def get_deployment_info(self): - str = "Deployment details:\n" - str += "\tInstaller: Fuel\n" - str += "\tScenario: Unknown\n" - sdn = "None" - clusters = self.get_clusters() - str += "\tN.Clusters: %s\n" % len(clusters) - for cluster in clusters: - cluster_dic = {'cluster': cluster['id']} - str += "\tCluster info:\n" - str += "\t ID: %s\n" % cluster['id'] - str += "\t NAME: %s\n" % cluster['name'] - str += "\t STATUS: %s\n" % cluster['status'] - nodes = self.get_nodes(options=cluster_dic) - num_nodes = len(nodes) - for node in nodes: - if "opendaylight" in node['roles']: - sdn = "OpenDaylight" - elif "onos" in node['roles']: - sdn = "ONOS" - num_controllers = len( - self.get_controller_ips(options=cluster_dic)) - num_computes = len(self.get_compute_ips(options=cluster_dic)) - ha = False - if num_controllers > 1: - ha = True - - str += "\t HA: %s\n" % ha - str += "\t NUM.NODES: %s\n" % num_nodes - str += "\t CONTROLLERS: %s\n" % num_controllers - str += "\t COMPUTES: %s\n" % num_computes - str += "\t SDN CONTR.: %s\n\n" % sdn - str += self.runcmd_fuel_nodes() - return str - - def get_file_from_installer(self, remote_path, local_path, options=None): - self.logger.debug("Fetching %s from %s" % - (remote_path, self.installer_ip)) - get_file_result = ssh_utils.get_file(self.installer_connection, - remote_path, - local_path) - if get_file_result is None: - self.logger.error("SFTP failed to retrieve the file.") - return 1 - self.logger.info("%s successfully copied from Fuel to %s" % - (remote_path, local_path)) - - def get_file_from_controller(self, - remote_path, - local_path, - ip=None, - user='root', - options=None): - if ip is None: - controllers = self.get_controller_ips(options=options) - if len(controllers) == 0: - self.logger.info("No controllers found in the deployment.") - return 1 - else: - target_ip = controllers[0] - else: - target_ip = ip - - installer_proxy = { - 'ip': self.installer_ip, - 'username': self.installer_user, - 'password': self.installer_password - } - controller_conn = ssh_utils.get_ssh_client( - target_ip, - user, - proxy=installer_proxy) - - self.logger.debug("Fetching %s from %s" % - (remote_path, target_ip)) - - get_file_result = ssh_utils.get_file(controller_conn, - remote_path, - local_path) - if get_file_result is None: - self.logger.error("SFTP failed to retrieve the file.") - return 1 - self.logger.info("%s successfully copied from %s to %s" % - (remote_path, target_ip, local_path)) diff --git a/modules/opnfv/installer_adapters/fuel/example.py b/modules/opnfv/installer_adapters/fuel/example.py deleted file mode 100644 index 7fea4dfd7..000000000 --- a/modules/opnfv/installer_adapters/fuel/example.py +++ /dev/null @@ -1,22 +0,0 @@ -# This is an example of usage of this Tool -# Author: Jose Lausuch (jose.lausuch@ericsson.com) - -import opnfv.installer_adapters.InstallerHandler as ins_handler - -fuel_handler = ins_handler.InstallerHandler(installer='fuel', - installer_ip='10.20.0.2', - installer_user='root', - installer_pwd='r00tme') -print("Nodes in cluster 1:\n%s\n" % - fuel_handler.get_nodes(options={'cluster': '1'})) -print("Nodes in cluster 2:\n%s\n" % - fuel_handler.get_nodes(options={'cluster': '2'})) -print("Nodes:\n%s\n" % fuel_handler.get_nodes()) -print("Controller nodes:\n%s\n" % fuel_handler.get_controller_ips()) -print("Compute nodes:\n%s\n" % fuel_handler.get_compute_ips()) -print("\n%s\n" % fuel_handler.get_deployment_info()) -fuel_handler.get_file_from_installer('/root/deploy/dea.yaml', './dea.yaml') -fuel_handler.get_file_from_controller( - '/etc/neutron/neutron.conf', './neutron.conf') -fuel_handler.get_file_from_controller( - '/root/openrc', './openrc') diff --git a/modules/opnfv/installer_adapters/joid/JoidAdapter.py b/modules/opnfv/installer_adapters/joid/JoidAdapter.py deleted file mode 100644 index be8c2ebac..000000000 --- a/modules/opnfv/installer_adapters/joid/JoidAdapter.py +++ /dev/null @@ -1,32 +0,0 @@ -############################################################################## -# Copyright (c) 2016 Ericsson AB and others. -# Author: Jose Lausuch (jose.lausuch@ericsson.com) -# All rights reserved. This program and the accompanying materials -# are made available under the terms of the Apache License, Version 2.0 -# which accompanies this distribution, and is available at -# http://www.apache.org/licenses/LICENSE-2.0 -############################################################################## - - -class JoidAdapter: - - def __init__(self, installer_ip): - self.installer_ip = installer_ip - - def get_deployment_info(self): - pass - - def get_nodes(self): - pass - - def get_controller_ips(self): - pass - - def get_compute_ips(self): - pass - - def get_file_from_installer(self, origin, target, options=None): - pass - - def get_file_from_controller(self, origin, target, ip=None, options=None): - pass diff --git a/modules/opnfv/installer_adapters/joid/__init__.py b/modules/opnfv/installer_adapters/joid/__init__.py deleted file mode 100644 index e69de29bb..000000000 --- a/modules/opnfv/installer_adapters/joid/__init__.py +++ /dev/null diff --git a/modules/opnfv/utils/Credentials.py b/modules/opnfv/utils/Credentials.py index 6441b841c..141ecbd93 100644 --- a/modules/opnfv/utils/Credentials.py +++ b/modules/opnfv/utils/Credentials.py @@ -77,7 +77,7 @@ class Credentials(object): creds_file = '/root/openrc' try: self.handler.get_file_from_controller(creds_file, target_path) - except Exception, e: + except Exception as e: self.logger.error( "Cannot get %s from controller. %e" % (creds_file, e)) pass diff --git a/modules/opnfv/utils/constants.py b/modules/opnfv/utils/constants.py index ed83488d4..56008c37f 100644 --- a/modules/opnfv/utils/constants.py +++ b/modules/opnfv/utils/constants.py @@ -14,6 +14,7 @@ EXIT_OK = 0 EXIT_RUN_ERROR = -1 EXIT_PUSH_TO_TEST_DB_ERROR = -2 + class Constants(object): INSTALLERS = ['apex', 'fuel', 'compass', 'joid', "daisy"] VERSIONS = ['arno', 'brahmaputra', 'colorado', 'danube'] diff --git a/modules/opnfv/utils/OPNFVLogger.py b/modules/opnfv/utils/opnfv_logger.py index 6fa4ef2e2..6fa4ef2e2 100644 --- a/modules/opnfv/utils/OPNFVLogger.py +++ b/modules/opnfv/utils/opnfv_logger.py diff --git a/modules/opnfv/utils/ovs_logger.py b/modules/opnfv/utils/ovs_logger.py index 3159609f1..7777a9a16 100644 --- a/modules/opnfv/utils/ovs_logger.py +++ b/modules/opnfv/utils/ovs_logger.py @@ -7,7 +7,7 @@ # http://www.apache.org/licenses/LICENSE-2.0 ############################################################################## -import opnfv.utils.OPNFVLogger as OPNFVLogger +import opnfv.utils.opnfv_logger as OPNFVLogger import os import time import shutil @@ -16,6 +16,7 @@ logger = OPNFVLogger.Logger('ovs_logger').getLogger() class OVSLogger(object): + def __init__(self, basedir, ft_resdir): self.ovs_dir = basedir self.ft_resdir = ft_resdir @@ -32,7 +33,7 @@ class OVSLogger(object): hosts = stdout.readline().strip().split(' ') found_host = [h for h in hosts if h.startswith(host_prefix)][0] return found_host - except Exception, e: + except Exception as e: logger.error(e) def __dump_to_file(self, operation, host, text, timestamp=None): @@ -55,7 +56,7 @@ class OVSLogger(object): .format(cmd, host)) output = ''.join(stdout.readlines()) return output - except Exception, e: + except Exception as e: logger.error('[__remote_command(ssh_client, {0})]: {1}' .format(cmd, e)) return None @@ -78,7 +79,7 @@ class OVSLogger(object): host = self.__ssh_host(ssh_conn) self.__dump_to_file(operation, host, output, timestamp=timestamp) return output - except Exception, e: + except Exception as e: logger.error('[ofctl_dump_flows(ssh_client, {0}, {1})]: {2}' .format(br, choose_table, e)) return None @@ -91,7 +92,7 @@ class OVSLogger(object): host = self.__ssh_host(ssh_conn) self.__dump_to_file(operation, host, output, timestamp=timestamp) return output - except Exception, e: + except Exception as e: logger.error('[vsctl_show(ssh_client)]: {0}'.format(e)) return None @@ -100,19 +101,13 @@ class OVSLogger(object): if timestamp is None: timestamp = time.strftime("%Y%m%d-%H%M%S") - for controller_client in controller_clients: - self.ofctl_dump_flows(controller_client, - timestamp=timestamp) - self.vsctl_show(controller_client, - timestamp=timestamp) - - for compute_client in compute_clients: - self.ofctl_dump_flows(compute_client, - timestamp=timestamp) - self.vsctl_show(compute_client, - timestamp=timestamp) + clients = controller_clients + compute_clients + for client in clients: + self.ofctl_dump_flows(client, timestamp=timestamp) + self.vsctl_show(client, timestamp=timestamp) if related_error is not None: dumpdir = os.path.join(self.ovs_dir, timestamp) + self.__mkdir_p(dumpdir) with open(os.path.join(dumpdir, 'error'), 'w') as f: f.write(related_error) diff --git a/modules/opnfv/utils/SSHUtils.py b/modules/opnfv/utils/ssh_utils.py index 16e34c3e5..d17f5ae81 100644 --- a/modules/opnfv/utils/SSHUtils.py +++ b/modules/opnfv/utils/ssh_utils.py @@ -9,14 +9,19 @@ ############################################################################## -import paramiko -import opnfv.utils.OPNFVLogger as OPNFVLogger import os +import paramiko -logger = OPNFVLogger.Logger('SSHUtils').getLogger() +from opnfv.utils import opnfv_logger as logger +logger = logger.Logger("SSH utils").getLogger() -def get_ssh_client(hostname, username, password=None, proxy=None): + +def get_ssh_client(hostname, + username, + password=None, + proxy=None, + pkey_file=None): client = None try: if proxy is None: @@ -26,16 +31,23 @@ def get_ssh_client(hostname, username, password=None, proxy=None): client.configure_jump_host(proxy['ip'], proxy['username'], proxy['password']) - if client is None: raise Exception('Could not connect to client') client.set_missing_host_key_policy(paramiko.AutoAddPolicy()) - client.connect(hostname, - username=username, - password=password) + if pkey_file is not None: + key = paramiko.RSAKey.from_private_key_file(pkey_file) + client.load_system_host_keys() + client.connect(hostname, + username=username, + pkey=key) + else: + client.connect(hostname, + username=username, + password=password) + return client - except Exception, e: + except Exception as e: logger.error(e) return None @@ -45,7 +57,7 @@ def get_file(ssh_conn, src, dest): sftp = ssh_conn.open_sftp() sftp.get(src, dest) return True - except Exception, e: + except Exception as e: logger.error("Error [get_file(ssh_conn, '%s', '%s']: %s" % (src, dest, e)) return None @@ -56,7 +68,7 @@ def put_file(ssh_conn, src, dest): sftp = ssh_conn.open_sftp() sftp.put(src, dest) return True - except Exception, e: + except Exception as e: logger.error("Error [put_file(ssh_conn, '%s', '%s']: %s" % (src, dest, e)) return None @@ -66,8 +78,8 @@ class ProxyHopClient(paramiko.SSHClient): ''' Connect to a remote server using a proxy hop ''' + def __init__(self, *args, **kwargs): - self.logger = OPNFVLogger.Logger("ProxyHopClient").getLogger() self.proxy_ssh = None self.proxy_transport = None self.proxy_channel = None @@ -116,5 +128,5 @@ class ProxyHopClient(paramiko.SSHClient): pkey=proxy_key, sock=self.proxy_channel) os.remove(self.local_ssh_key) - except Exception, e: - self.logger.error(e) + except Exception as e: + logger.error(e) diff --git a/prototypes/bifrost/playbooks/test-bifrost-infracloud.yaml b/prototypes/bifrost/playbooks/test-bifrost-infracloud.yaml index 541a1f7d4..07d5e245b 100644 --- a/prototypes/bifrost/playbooks/test-bifrost-infracloud.yaml +++ b/prototypes/bifrost/playbooks/test-bifrost-infracloud.yaml @@ -54,7 +54,7 @@ dib_os_element: "{{ lookup('env','DIB_OS_ELEMENT') }}" dib_os_release: "{{ lookup('env', 'DIB_OS_RELEASE') }}" extra_dib_elements: "{{ lookup('env', 'EXTRA_DIB_ELEMENTS') | default('') }}" - dib_elements: "vm serial-console simple-init devuser infra-cloud-bridge puppet growroot {{ extra_dib_elements }}" + dib_elements: "vm enable-serial-console simple-init devuser infra-cloud-bridge puppet growroot {{ extra_dib_elements }}" dib_packages: "{{ lookup('env', 'DIB_OS_PACKAGES') }}" when: create_image_via_dib | bool == true and transform_boot_image | bool == false environment: diff --git a/prototypes/bifrost/scripts/destroy-env.sh b/prototypes/bifrost/scripts/destroy-env.sh index cdc55df1b..b73092b0f 100755 --- a/prototypes/bifrost/scripts/destroy-env.sh +++ b/prototypes/bifrost/scripts/destroy-env.sh @@ -14,24 +14,23 @@ if [[ $(whoami) != "root" ]]; then exit 1 fi -virsh destroy jumphost.opnfvlocal || true -virsh destroy controller00.opnfvlocal || true -virsh destroy compute00.opnfvlocal || true -virsh undefine jumphost.opnfvlocal || true -virsh undefine controller00.opnfvlocal || true -virsh undefine compute00.opnfvlocal || true - -service ironic-conductor stop - -echo "removing from database" -mysql -u root ironic --execute "truncate table ports;" -mysql -u root ironic --execute "delete from node_tags;" -mysql -u root ironic --execute "delete from nodes;" -mysql -u root ironic --execute "delete from conductors;" +# Delete all VMs on the slave since proposed patchsets +# may leave undesired VM leftovers +for vm in $(virsh list --all --name); do + virsh destroy $vm || true + virsh undefine $vm || true +done + +service ironic-conductor stop || true + +echo "removing ironic database" +if $(which mysql &> /dev/null); then + mysql -u root ironic --execute "drop database ironic;" +fi echo "removing leases" [[ -e /var/lib/misc/dnsmasq/dnsmasq.leases ]] && > /var/lib/misc/dnsmasq/dnsmasq.leases echo "removing logs" -rm -rf /var/log/libvirt/baremetal_logs/*.log +rm -rf /var/log/libvirt/baremetal_logs/* # clean up dib images only if requested explicitly CLEAN_DIB_IMAGES=${CLEAN_DIB_IMAGES:-false} @@ -48,6 +47,6 @@ rm -rf /var/lib/libvirt/images/*.qcow2 echo "restarting services" service dnsmasq restart || true service libvirtd restart -service ironic-api restart -service ironic-conductor start -service ironic-inspector restart +service ironic-api restart || true +service ironic-conductor start || true +service ironic-inspector restart || true diff --git a/prototypes/bifrost/scripts/test-bifrost-deployment.sh b/prototypes/bifrost/scripts/test-bifrost-deployment.sh index 90f014c74..b7165ffd1 100755 --- a/prototypes/bifrost/scripts/test-bifrost-deployment.sh +++ b/prototypes/bifrost/scripts/test-bifrost-deployment.sh @@ -18,6 +18,7 @@ ENABLE_VENV="false" USE_DHCP="false" USE_VENV="false" BUILD_IMAGE=true +BAREMETAL_DATA_FILE=${BAREMETAL_DATA_FILE:-'/tmp/baremetal.json'} PROVISION_WAIT_TIMEOUT=${PROVISION_WAIT_TIMEOUT:-3600} # Set defaults for ansible command-line options to drive the different @@ -36,6 +37,7 @@ export TEST_VM_NODE_NAMES="jumphost.opnfvlocal controller00.opnfvlocal compute00 export VM_DOMAIN_TYPE="kvm" export VM_CPU=${VM_CPU:-4} export VM_DISK=${VM_DISK:-100} +export VM_DISK_CACHE=${VM_DISK_CACHE:-unsafe} TEST_PLAYBOOK="test-bifrost-infracloud.yaml" USE_INSPECTOR=true USE_CIRROS=false @@ -49,10 +51,10 @@ INVENTORY_DHCP_STATIC_IP=false WRITE_INTERFACES_FILE=true # Set BIFROST_INVENTORY_SOURCE -export BIFROST_INVENTORY_SOURCE=/tmp/baremetal.csv +export BIFROST_INVENTORY_SOURCE=/tmp/baremetal.json # DIB custom elements path -export ELEMENTS_PATH=/usr/share/diskimage-builder/elements:/opt/puppet-infracloud/files/elements +export ELEMENTS_PATH=/opt/puppet-infracloud/files/elements # settings for console access export DIB_DEV_USER_PWDLESS_SUDO=yes @@ -78,6 +80,11 @@ source ${ANSIBLE_INSTALL_ROOT}/ansible/hacking/env-setup ANSIBLE=$(which ansible-playbook) set -x -o nounset +logs_on_exit() { + $SCRIPT_HOME/collect-test-info.sh +} +trap logs_on_exit EXIT + # Change working directory cd $BIFROST_HOME/playbooks @@ -101,7 +108,8 @@ ${ANSIBLE} -vvvv \ -e test_vm_num_nodes=${TEST_VM_NUM_NODES} \ -e test_vm_memory_size=${VM_MEMORY_SIZE} \ -e enable_venv=${ENABLE_VENV} \ - -e test_vm_domain_type=${VM_DOMAIN_TYPE} + -e test_vm_domain_type=${VM_DOMAIN_TYPE} \ + -e baremetal_json_file=${BAREMETAL_DATA_FILE} # Execute the installation and VM startup test. ${ANSIBLE} -vvvv \ @@ -128,6 +136,4 @@ if [ $EXITCODE != 0 ]; then echo "****************************" fi -$SCRIPT_HOME/collect-test-info.sh - exit $EXITCODE diff --git a/prototypes/openstack-ansible/README.md b/prototypes/openstack-ansible/README.md new file mode 100644 index 000000000..34c1d0d03 --- /dev/null +++ b/prototypes/openstack-ansible/README.md @@ -0,0 +1,48 @@ +=============================== +How to deploy OpenStack-Ansible +=============================== +The script and playbooks defined on this repo will deploy an OpenStack +cloud based on OpenStack-Ansible. +It needs to be combined with Bifrost. You need use Bifrost to provide six VMs. +To learn about how to use Bifrost, you can read the document on +[/opt/releng/prototypes/bifrost/README.md]. + +Minimal requirements: +1. You will need to have a least 150G free space for the partition on where + "/var/lib/libvirt/images/" lives. +2. each vm needs to have at least 8 vCPU, 12 GB RAM, 60 GB HDD. + +After provisioning the six VMs please follow that steps: + +1.Run the script to deploy OpenStack + cd /opt/releng/prototypes/openstack-ansible/scripts/ + sudo ./osa_deploy.sh +It will take a lot of time. When the deploy is successful, you will see the +message "OpenStack deployed successfully". + +2.To verify the OpenStack operation + 2.1 ssh into the controller:: + ssh 192.168.122.3 + 2.2 Enter into the lxc container:: + lxcname=$(lxc-ls | grep utility) + lxc-attach -n $lxcname + 2.3 Verify the OpenStack API:: + source /root/openrc + openstack user list + +This will show the following output:: ++----------------------------------+--------------------+ +| ID | Name | ++----------------------------------+--------------------+ +| 056f8fe41336435991fd80872731cada | aodh | +| 308f6436e68f40b49d3b8e7ce5c5be1e | glance | +| 351b71b43a66412d83f9b3cd75485875 | nova | +| 511129e053394aea825cce13b9f28504 | ceilometer | +| 5596f71319d44c8991fdc65f3927b62e | gnocchi | +| 586f49e3398a4c47a2f6fe50135d4941 | stack_domain_admin | +| 601b329e6b1d427f9a1e05ed28753497 | heat | +| 67fe383b94964a4781345fbcc30ae434 | cinder | +| 729bb08351264d729506dad84ed3ccf0 | admin | +| 9f2beb2b270940048fe6844f0b16281e | neutron | +| fa68f86dd1de4ddbbb7415b4d9a54121 | keystone | ++----------------------------------+--------------------+ diff --git a/prototypes/openstack-ansible/file/cinder.yml b/prototypes/openstack-ansible/file/cinder.yml new file mode 100644 index 000000000..e40b39256 --- /dev/null +++ b/prototypes/openstack-ansible/file/cinder.yml @@ -0,0 +1,13 @@ +--- +# This file contains an example to show how to set +# the cinder-volume service to run in a container. +# +# Important note: +# When using LVM or any iSCSI-based cinder backends, such as NetApp with +# iSCSI protocol, the cinder-volume service *must* run on metal. +# Reference: https://bugs.launchpad.net/ubuntu/+source/lxc/+bug/1226855 + +container_skel: + cinder_volumes_container: + properties: + is_metal: false diff --git a/prototypes/openstack-ansible/file/exports b/prototypes/openstack-ansible/file/exports new file mode 100644 index 000000000..315f79d2f --- /dev/null +++ b/prototypes/openstack-ansible/file/exports @@ -0,0 +1,12 @@ +# /etc/exports: the access control list for filesystems which may be exported +# to NFS clients. See exports(5). +# +# Example for NFSv2 and NFSv3: +# /srv/homes hostname1(rw,sync,no_subtree_check) hostname2(ro,sync,no_subtree_check) +# +# Example for NFSv4: +# /srv/nfs4 gss/krb5i(rw,sync,fsid=0,crossmnt,no_subtree_check) +# /srv/nfs4/homes gss/krb5i(rw,sync,no_subtree_check) +# +/images *(rw,sync,no_subtree_check,no_root_squash) + diff --git a/prototypes/openstack-ansible/file/modules b/prototypes/openstack-ansible/file/modules new file mode 100644 index 000000000..60a517f18 --- /dev/null +++ b/prototypes/openstack-ansible/file/modules @@ -0,0 +1,8 @@ +# /etc/modules: kernel modules to load at boot time. +# +# This file contains the names of kernel modules that should be loaded +# at boot time, one per line. Lines beginning with "#" are ignored. +# Parameters can be specified after the module name. + +bonding +8021q diff --git a/prototypes/openstack-ansible/file/openstack_user_config.yml b/prototypes/openstack-ansible/file/openstack_user_config.yml new file mode 100644 index 000000000..2811e62ce --- /dev/null +++ b/prototypes/openstack-ansible/file/openstack_user_config.yml @@ -0,0 +1,278 @@ +--- +cidr_networks: + container: 172.29.236.0/22 + tunnel: 172.29.240.0/22 + storage: 172.29.244.0/22 + +used_ips: + - "172.29.236.1,172.29.236.50" + - "172.29.240.1,172.29.240.50" + - "172.29.244.1,172.29.244.50" + - "172.29.248.1,172.29.248.50" + +global_overrides: + internal_lb_vip_address: 172.29.236.222 + external_lb_vip_address: 192.168.122.220 + tunnel_bridge: "br-vxlan" + management_bridge: "br-mgmt" + provider_networks: + - network: + container_bridge: "br-mgmt" + container_type: "veth" + container_interface: "eth1" + ip_from_q: "container" + type: "raw" + group_binds: + - all_containers + - hosts + is_container_address: true + is_ssh_address: true + - network: + container_bridge: "br-vxlan" + container_type: "veth" + container_interface: "eth10" + ip_from_q: "tunnel" + type: "vxlan" + range: "1:1000" + net_name: "vxlan" + group_binds: + - neutron_linuxbridge_agent + - network: + container_bridge: "br-vlan" + container_type: "veth" + container_interface: "eth12" + host_bind_override: "eth12" + type: "flat" + net_name: "flat" + group_binds: + - neutron_linuxbridge_agent + - network: + container_bridge: "br-vlan" + container_type: "veth" + container_interface: "eth11" + type: "vlan" + range: "1:1" + net_name: "vlan" + group_binds: + - neutron_linuxbridge_agent + - network: + container_bridge: "br-storage" + container_type: "veth" + container_interface: "eth2" + ip_from_q: "storage" + type: "raw" + group_binds: + - glance_api + - cinder_api + - cinder_volume + - nova_compute + +### +### Infrastructure +### + +# galera, memcache, rabbitmq, utility +shared-infra_hosts: + controller00: + ip: 172.29.236.11 + controller01: + ip: 172.29.236.12 + controller02: + ip: 172.29.236.13 + +# repository (apt cache, python packages, etc) +repo-infra_hosts: + controller00: + ip: 172.29.236.11 + controller01: + ip: 172.29.236.12 + controller02: + ip: 172.29.236.13 + +# load balancer +# Ideally the load balancer should not use the Infrastructure hosts. +# Dedicated hardware is best for improved performance and security. +haproxy_hosts: + controller00: + ip: 172.29.236.11 + controller01: + ip: 172.29.236.12 + controller02: + ip: 172.29.236.13 + +# rsyslog server +#log_hosts: + # log1: + # ip: 172.29.236.14 + +### +### OpenStack +### + +# keystone +identity_hosts: + controller00: + ip: 172.29.236.11 + controller01: + ip: 172.29.236.12 + controller02: + ip: 172.29.236.13 + +# cinder api services +storage-infra_hosts: + controller00: + ip: 172.29.236.11 + controller01: + ip: 172.29.236.12 + controller02: + ip: 172.29.236.13 + +# glance +# The settings here are repeated for each infra host. +# They could instead be applied as global settings in +# user_variables, but are left here to illustrate that +# each container could have different storage targets. +image_hosts: + controller00: + ip: 172.29.236.11 + container_vars: + limit_container_types: glance + glance_nfs_client: + - server: "172.29.244.15" + remote_path: "/images" + local_path: "/var/lib/glance/images" + type: "nfs" + options: "_netdev,auto" + controller01: + ip: 172.29.236.12 + container_vars: + limit_container_types: glance + glance_nfs_client: + - server: "172.29.244.15" + remote_path: "/images" + local_path: "/var/lib/glance/images" + type: "nfs" + options: "_netdev,auto" + controller02: + ip: 172.29.236.13 + container_vars: + limit_container_types: glance + glance_nfs_client: + - server: "172.29.244.15" + remote_path: "/images" + local_path: "/var/lib/glance/images" + type: "nfs" + options: "_netdev,auto" + +# nova api, conductor, etc services +compute-infra_hosts: + controller00: + ip: 172.29.236.11 + controller01: + ip: 172.29.236.12 + controller02: + ip: 172.29.236.13 + +# heat +orchestration_hosts: + controller00: + ip: 172.29.236.11 + controller01: + ip: 172.29.236.12 + controller02: + ip: 172.29.236.13 + +# horizon +dashboard_hosts: + controller00: + ip: 172.29.236.11 + controller01: + ip: 172.29.236.12 + controller02: + ip: 172.29.236.13 + +# neutron server, agents (L3, etc) +network_hosts: + controller00: + ip: 172.29.236.11 + controller01: + ip: 172.29.236.12 + controller02: + ip: 172.29.236.13 + +# ceilometer (telemetry API) +metering-infra_hosts: + controller00: + ip: 172.29.236.11 + controller01: + ip: 172.29.236.12 + controller02: + ip: 172.29.236.13 + +# aodh (telemetry alarm service) +metering-alarm_hosts: + controller00: + ip: 172.29.236.11 + controller01: + ip: 172.29.236.12 + controller02: + ip: 172.29.236.13 + +# gnocchi (telemetry metrics storage) +metrics_hosts: + controller00: + ip: 172.29.236.11 + controller01: + ip: 172.29.236.12 + controller02: + ip: 172.29.236.13 + +# nova hypervisors +compute_hosts: + compute00: + ip: 172.29.236.14 + compute01: + ip: 172.29.236.15 + +# ceilometer compute agent (telemetry) +metering-compute_hosts: + compute00: + ip: 172.29.236.14 + compute01: + ip: 172.29.236.15 +# cinder volume hosts (NFS-backed) +# The settings here are repeated for each infra host. +# They could instead be applied as global settings in +# user_variables, but are left here to illustrate that +# each container could have different storage targets. +storage_hosts: + controller00: + ip: 172.29.236.11 + container_vars: + cinder_backends: + limit_container_types: cinder_volume + lvm: + volume_group: cinder-volumes + volume_driver: cinder.volume.drivers.lvm.LVMVolumeDriver + volume_backend_name: LVM_iSCSI + iscsi_ip_address: "172.29.244.11" + controller01: + ip: 172.29.236.12 + container_vars: + cinder_backends: + limit_container_types: cinder_volume + lvm: + volume_group: cinder-volumes + volume_driver: cinder.volume.drivers.lvm.LVMVolumeDriver + volume_backend_name: LVM_iSCSI + iscsi_ip_address: "172.29.244.12" + controller02: + ip: 172.29.236.13 + container_vars: + cinder_backends: + limit_container_types: cinder_volume + lvm: + volume_group: cinder-volumes + volume_driver: cinder.volume.drivers.lvm.LVMVolumeDriver + volume_backend_name: LVM_iSCSI + iscsi_ip_address: "172.29.244.13" diff --git a/prototypes/openstack-ansible/file/user_variables.yml b/prototypes/openstack-ansible/file/user_variables.yml new file mode 100644 index 000000000..3e14bc57e --- /dev/null +++ b/prototypes/openstack-ansible/file/user_variables.yml @@ -0,0 +1,27 @@ +--- +# Copyright 2014, Rackspace US, Inc. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + +### +### This file contains commonly used overrides for convenience. Please inspect +### the defaults for each role to find additional override options. +### + +## Debug and Verbose options. +debug: false + +haproxy_keepalived_external_vip_cidr: "192.168.122.220/32" +haproxy_keepalived_internal_vip_cidr: "172.29.236.222/32" +haproxy_keepalived_external_interface: br-vlan +haproxy_keepalived_internal_interface: br-mgmt diff --git a/prototypes/openstack-ansible/playbooks/inventory b/prototypes/openstack-ansible/playbooks/inventory new file mode 100644 index 000000000..f53da5305 --- /dev/null +++ b/prototypes/openstack-ansible/playbooks/inventory @@ -0,0 +1,11 @@ +[jumphost] +jumphost ansible_ssh_host=192.168.122.2 + +[controller] +controller00 ansible_ssh_host=192.168.122.3 +controller01 ansible_ssh_host=192.168.122.4 +controller02 ansible_ssh_host=192.168.122.5 + +[compute] +compute00 ansible_ssh_host=192.168.122.6 +compute01 ansible_ssh_host=192.168.122.7 diff --git a/prototypes/openstack-ansible/playbooks/jumphost_configuration.yml b/prototypes/openstack-ansible/playbooks/jumphost_configuration.yml new file mode 100644 index 000000000..c51d83073 --- /dev/null +++ b/prototypes/openstack-ansible/playbooks/jumphost_configuration.yml @@ -0,0 +1,53 @@ +--- +- hosts: jumphost + remote_user: root + vars_files: + - ../var/ubuntu.yml + tasks: + - name: generate SSH keys + shell: ssh-keygen -b 2048 -t rsa -f /root/.ssh/id_rsa -q -N "" + args: + creates: /root/.ssh/id_rsa + - name: fetch public key + fetch: src="/root/.ssh/id_rsa.pub" dest="/" + - name: remove the directory + shell: "rm -rf {{OSA_PATH}} {{OSA_ETC_PATH}}" + - name: git openstack ansible + shell: "git clone {{OSA_URL}} {{OSA_PATH}} -b {{OSA_BRANCH}}" + - name: copy /opt/openstack-ansible/etc/openstack_deploy to /etc/openstack_deploy + shell: "/bin/cp -rf {{OSA_PATH}}/etc/openstack_deploy {{OSA_ETC_PATH}}" + - name: bootstrap + command: "/bin/bash ./scripts/bootstrap-ansible.sh" + args: + chdir: "{{OSA_PATH}}" + - name: generate password token + command: "python pw-token-gen.py --file /etc/openstack_deploy/user_secrets.yml" + args: + chdir: /opt/openstack-ansible/scripts/ + - name: copy openstack_user_config.yml to /etc/openstack_deploy + copy: + src: ../file/openstack_user_config.yml + dest: "{{OSA_ETC_PATH}}/openstack_user_config.yml" + - name: copy cinder.yml to /etc/openstack_deploy/env.d + copy: + src: ../file/cinder.yml + dest: "{{OSA_ETC_PATH}}/env.d/cinder.yml" + - name: copy user_variables.yml to /etc/openstack_deploy/ + copy: + src: ../file/user_variables.yml + dest: "{{OSA_ETC_PATH}}/user_variables.yml" + - name: configure network + template: + src: ../template/bifrost/controller.interface.j2 + dest: /etc/network/interfaces + notify: + - restart network service + handlers: + - name: restart network service + shell: "/sbin/ifconfig ens3 0 &&/sbin/ifdown -a && /sbin/ifup -a" + +- hosts: localhost + remote_user: root + tasks: + - name: Generate authorized_keys + shell: "/bin/cat /jumphost/root/.ssh/id_rsa.pub >> ../file/authorized_keys" diff --git a/prototypes/openstack-ansible/playbooks/targethost_configuration.yml b/prototypes/openstack-ansible/playbooks/targethost_configuration.yml new file mode 100644 index 000000000..ffe788f0e --- /dev/null +++ b/prototypes/openstack-ansible/playbooks/targethost_configuration.yml @@ -0,0 +1,61 @@ +--- +- hosts: all + remote_user: root + vars_files: + - ../var/ubuntu.yml + tasks: + - name: add public key to host + copy: + src: ../file/authorized_keys + dest: /root/.ssh/authorized_keys + - name: configure modules + copy: + src: ../file/modules + dest: /etc/modules + +- hosts: controller + remote_user: root + vars_files: + - ../var/ubuntu.yml + tasks: + - name: configure network + template: + src: ../template/bifrost/controller.interface.j2 + dest: /etc/network/interfaces + notify: + - restart network service + handlers: + - name: restart network service + shell: "/sbin/ifconfig ens3 0 &&/sbin/ifdown -a && /sbin/ifup -a" + +- hosts: compute + remote_user: root + vars_files: + - ../var/ubuntu.yml + tasks: + - name: configure network + template: + src: ../template/bifrost/compute.interface.j2 + dest: /etc/network/interfaces + notify: + - restart network service + handlers: + - name: restart network service + shell: "/sbin/ifconfig ens3 0 &&/sbin/ifdown -a && /sbin/ifup -a" + +- hosts: compute01 + remote_user: root + tasks: + - name: make nfs dir + file: "dest=/images mode=777 state=directory" + - name: configure sdrvice + shell: "echo 'nfs 2049/tcp' >> /etc/services && echo 'nfs 2049/udp' >> /etc/services" + - name: configure NFS + copy: + src: ../file/exports + dest: /etc/exports + notify: + - restart nfs service + handlers: + - name: restart nfs service + service: name=nfs-kernel-server state=restarted diff --git a/prototypes/openstack-ansible/scripts/osa_deploy.sh b/prototypes/openstack-ansible/scripts/osa_deploy.sh new file mode 100755 index 000000000..95f593194 --- /dev/null +++ b/prototypes/openstack-ansible/scripts/osa_deploy.sh @@ -0,0 +1,82 @@ +#!/bin/bash + +export OSA_PATH=/opt/openstack-ansible +export LOG_PATH=$OSA_PATH/log +export PLAYBOOK_PATH=$OSA_PATH/playbooks +export OSA_BRANCH=${OSA_BRANCH:-"master"} + +JUMPHOST_IP="192.168.122.2" + +sudo /bin/rm -rf $LOG_PATH +sudo /bin/mkdir -p $LOG_PATH +sudo /bin/cp /root/.ssh/id_rsa.pub ../file/authorized_keys +sudo echo -e '\n'>>../file/authorized_keys + +cd ../playbooks/ +# this will prepare the jump host +# git clone the Openstack-Ansible, bootstrap and configure network +sudo ansible-playbook -i inventory jumphost_configuration.yml -vvv + +# this will prepare the target host +# such as configure network and NFS +sudo ansible-playbook -i inventory targethost_configuration.yml + +# using OpenStack-Ansible deploy the OpenStack + +echo "set UP Host !" +sudo /bin/sh -c "ssh root@$JUMPHOST_IP openstack-ansible \ + $PLAYBOOK_PATH/setup-hosts.yml" | \ + tee $LOG_PATH/setup-host.log + +#check the result of openstack-ansible setup-hosts.yml +#if failed, exit with exit code 1 +grep "failed=1" $LOG_PATH/setup-host.log>/dev/null \ + || grep "unreachable=1" $LOG_PATH/setup-host.log>/dev/null +if [ $? -eq 0 ]; then + echo "failed setup host!" + exit 1 +else + echo "setup host successfully!" +fi + +echo "Set UP Infrastructure !" +sudo /bin/sh -c "ssh root@$JUMPHOST_IP openstack-ansible \ + $PLAYBOOK_PATH/setup-infrastructure.yml" | \ + tee $LOG_PATH/setup-infrastructure.log + +grep "failed=1" $LOG_PATH/setup-infrastructure.log>/dev/null \ + || grep "unreachable=1" $LOG_PATH/setup-infrastructure.log>/dev/null +if [ $? -eq 0 ]; then + echo "failed setup infrastructure!" + exit 1 +else + echo "setup infrastructure successfully!" +fi + +sudo /bin/sh -c "ssh root@$JUMPHOST_IP ansible -i $PLAYBOOK_PATH/inventory/ \ + galera_container -m shell \ + -a "mysql -h localhost -e 'show status like \"%wsrep_cluster_%\";'"" \ + | tee $LOG_PATH/galera.log + +grep "FAILED" $LOG_PATH/galera.log>/dev/null +if [ $? -eq 0 ]; then + echo "failed verify the database cluster!" + exit 1 +else + echo "verify the database cluster successfully!" +fi + +echo "Set UP OpenStack !" +sudo /bin/sh -c "ssh root@$JUMPHOST_IP openstack-ansible \ + $PLAYBOOK_PATH/setup-openstack.yml" | \ + tee $LOG_PATH/setup-openstack.log + +grep "failed=1" $LOG_PATH/setup-openstack.log>/dev/null \ + || grep "unreachable=1" $LOG_PATH/setup-openstack.log>/dev/null +if [ $? -eq 0 ]; then + echo "failed setup openstack!" + exit 1 +else + echo "OpenStack successfully deployed!" + exit 0 +fi diff --git a/prototypes/openstack-ansible/template/bifrost/compute.interface.j2 b/prototypes/openstack-ansible/template/bifrost/compute.interface.j2 new file mode 100644 index 000000000..1719f6a08 --- /dev/null +++ b/prototypes/openstack-ansible/template/bifrost/compute.interface.j2 @@ -0,0 +1,86 @@ +# This file describes the network interfaces available on your system +# and how to activate them. For more information, see interfaces(5). + +# The loopback network interface +auto lo +iface lo inet loopback + + +# Physical interface +auto ens3 +iface ens3 inet manual + +# Container/Host management VLAN interface +auto ens3.10 +iface ens3.10 inet manual + vlan-raw-device ens3 + +# OpenStack Networking VXLAN (tunnel/overlay) VLAN interface +auto ens3.30 +iface ens3.30 inet manual + vlan-raw-device ens3 + +# Storage network VLAN interface (optional) +auto ens3.20 +iface ens3.20 inet manual + vlan-raw-device ens3 + +# Container/Host management bridge +auto br-mgmt +iface br-mgmt inet static + bridge_stp off + bridge_waitport 0 + bridge_fd 0 + bridge_ports ens3.10 + address {{host_info[inventory_hostname].MGMT_IP}} + netmask 255.255.252.0 + +# compute1 VXLAN (tunnel/overlay) bridge config +auto br-vxlan +iface br-vxlan inet static + bridge_stp off + bridge_waitport 0 + bridge_fd 0 + bridge_ports ens3.30 + address {{host_info[inventory_hostname].VXLAN_IP}} + netmask 255.255.252.0 + +# OpenStack Networking VLAN bridge +auto br-vlan +iface br-vlan inet static + bridge_stp off + bridge_waitport 0 + bridge_fd 0 + bridge_ports ens3 + address {{host_info[inventory_hostname].VLAN_IP}} + netmask 255.255.255.0 + gateway 192.168.122.1 + offload-sg off + # Create veth pair, don't bomb if already exists + pre-up ip link add br-vlan-veth type veth peer name eth12 || true + # Set both ends UP + pre-up ip link set br-vlan-veth up + pre-up ip link set eth12 up + # Delete veth pair on DOWN + post-down ip link del br-vlan-veth || true + bridge_ports br-vlan-veth + +# Add an additional address to br-vlan +iface br-vlan inet static + # Flat network default gateway + # -- This needs to exist somewhere for network reachability + # -- from the router namespace for floating IP paths. + # -- Putting this here is primarily for tempest to work. + address {{host_info[inventory_hostname].VLAN_IP_SECOND}} + netmask 255.255.252.0 + dns-nameserver 8.8.8.8 8.8.4.4 + +# compute1 Storage bridge +auto br-storage +iface br-storage inet static + bridge_stp off + bridge_waitport 0 + bridge_fd 0 + bridge_ports ens3.20 + address {{host_info[inventory_hostname].STORAGE_IP}} + netmask 255.255.252.0 diff --git a/prototypes/openstack-ansible/template/bifrost/controller.interface.j2 b/prototypes/openstack-ansible/template/bifrost/controller.interface.j2 new file mode 100644 index 000000000..74aeea99d --- /dev/null +++ b/prototypes/openstack-ansible/template/bifrost/controller.interface.j2 @@ -0,0 +1,71 @@ +# This file describes the network interfaces available on your system +# and how to activate them. For more information, see interfaces(5). + +# The loopback network interface +auto lo +iface lo inet loopback + +# Physical interface +auto ens3 +iface ens3 inet manual + +# Container/Host management VLAN interface +auto ens3.10 +iface ens3.10 inet manual + vlan-raw-device ens3 + +# OpenStack Networking VXLAN (tunnel/overlay) VLAN interface +auto ens3.30 +iface ens3.30 inet manual + vlan-raw-device ens3 + +# Storage network VLAN interface (optional) +auto ens3.20 +iface ens3.20 inet manual + vlan-raw-device ens3 + +# Container/Host management bridge +auto br-mgmt +iface br-mgmt inet static + bridge_stp off + bridge_waitport 0 + bridge_fd 0 + bridge_ports ens3.10 + address {{host_info[inventory_hostname].MGMT_IP}} + netmask 255.255.252.0 + +# OpenStack Networking VXLAN (tunnel/overlay) bridge +# +# Only the COMPUTE and NETWORK nodes must have an IP address +# on this bridge. When used by infrastructure nodes, the +# IP addresses are assigned to containers which use this +# bridge. +# +auto br-vxlan +iface br-vxlan inet manual + bridge_stp off + bridge_waitport 0 + bridge_fd 0 + bridge_ports ens3.30 + +# OpenStack Networking VLAN bridge +auto br-vlan +iface br-vlan inet static + bridge_stp off + bridge_waitport 0 + bridge_fd 0 + bridge_ports ens3 + address {{host_info[inventory_hostname].VLAN_IP}} + netmask 255.255.255.0 + gateway 192.168.122.1 + dns-nameserver 8.8.8.8 8.8.4.4 + +# compute1 Storage bridge +auto br-storage +iface br-storage inet static + bridge_stp off + bridge_waitport 0 + bridge_fd 0 + bridge_ports ens3.20 + address {{host_info[inventory_hostname].STORAGE_IP}} + netmask 255.255.252.0 diff --git a/prototypes/openstack-ansible/var/ubuntu.yml b/prototypes/openstack-ansible/var/ubuntu.yml new file mode 100644 index 000000000..71f54ecb5 --- /dev/null +++ b/prototypes/openstack-ansible/var/ubuntu.yml @@ -0,0 +1,6 @@ +--- +OSA_URL: https://git.openstack.org/openstack/openstack-ansible +OSA_PATH: /opt/openstack-ansible +OSA_ETC_PATH: /etc/openstack_deploy +JUMPHOST_IP: 192.168.122.2 +host_info: {'jumphost':{'MGMT_IP': '172.29.236.10','VLAN_IP': '192.168.122.2', 'STORAGE_IP': '172.29.244.10'},'controller00':{'MGMT_IP': '172.29.236.11','VLAN_IP': '192.168.122.3', 'STORAGE_IP': '172.29.244.11'},'controller01':{'MGMT_IP': '172.29.236.12','VLAN_IP': '192.168.122.4', 'STORAGE_IP': '172.29.244.12'},'controller02':{'MGMT_IP': '172.29.236.13','VLAN_IP': '192.168.122.5', 'STORAGE_IP': '172.29.240.13'},'compute00':{'MGMT_IP': '172.29.236.14','VLAN_IP': '192.168.122.6','VLAN_IP_SECOND': '173.29.241.1','VXLAN_IP': '172.29.240.14', 'STORAGE_IP': '172.29.244.14'},'compute01':{'MGMT_IP': '172.29.236.15','VLAN_IP': '192.168.122.7','VLAN_IP_SECOND': '173.29.241.2','VXLAN_IP': '172.29.240.15', 'STORAGE_IP': '172.29.244.15'}} diff --git a/utils/fetch_os_creds.sh b/utils/fetch_os_creds.sh index 3667dbe6c..c99afaca8 100755 --- a/utils/fetch_os_creds.sh +++ b/utils/fetch_os_creds.sh @@ -38,6 +38,16 @@ verify_connectivity() { error "Can not talk to $ip." } + +swap_to_public() { + if [ "$1" != "" ]; then + info "Exchanging keystone public IP in rc file to $public_ip" + sed -i "/OS_AUTH_URL/c\export OS_AUTH_URL=\'$public_ip'" $dest_path + sed -i 's/internalURL/publicURL/g' $dest_path + fi +} + + : ${DEPLOY_TYPE:=''} #Get options @@ -111,6 +121,14 @@ if [ "$installer_type" == "fuel" ]; then # but sometimes the output of endpoint-list is like this: http://172.30.9.70:8004/v1/%(tenant_id)s # Fuel virtual need a fix + #convert to v3 URL + auth_url=$(cat $dest_path|grep AUTH_URL) + if [[ -z `echo $auth_url |grep v3` ]]; then + auth_url=$(echo $auth_url |sed "s|'$|v3&|") + fi + sed -i '/AUTH_URL/d' $dest_path + echo $auth_url >> $dest_path + elif [ "$installer_type" == "apex" ]; then verify_connectivity $installer_ip @@ -126,7 +144,7 @@ elif [ "$installer_type" == "compass" ]; then verify_connectivity $installer_ip controller_ip=$(sshpass -p'root' ssh 2>/dev/null $ssh_options root@${installer_ip} \ 'mysql -ucompass -pcompass -Dcompass -e"select * from cluster;"' \ - | awk -F"," '{for(i=1;i<NF;i++)if($i~/\"host[1-5]\"/) {print $(i+1);break;}}' \ + | awk -F"," '{for(i=1;i<NF;i++)if($i~/\"127.0.0.1\"/) {print $(i+2);break;}}' \ | grep -oP "\d+.\d+.\d+.\d+") if [ -z $controller_ip ]; then @@ -151,6 +169,7 @@ elif [ "$installer_type" == "compass" ]; then | grep identity | awk '{print $14}') fi info "public_ip: $public_ip" + swap_to_public $public_ip elif [ "$installer_type" == "joid" ]; then @@ -182,6 +201,17 @@ elif [ "$installer_type" == "foreman" ]; then 'source keystonerc_admin;keystone endpoint-list'" \ | grep $admin_ip | sed 's/ /\n/g' | grep ^http | head -1) &> /dev/null +elif [ "$installer_type" == "daisy" ]; then + verify_connectivity $installer_ip + cluster=$(sshpass -p r00tme ssh 2>/dev/null $ssh_options root@${installer_ip} \ + "source ~/daisyrc_admin; daisy cluster-list"|grep active|head -1|awk -F "|" '{print $3}') &> /dev/null + if [ -z $cluster ]; then + echo "No active cluster detected in daisy" + exit 1 + fi + + sshpass -p r00tme scp 2>/dev/null $ssh_options root@${installer_ip}:/etc/kolla/admin-openrc.sh $dest_path &> /dev/null + else error "Installer $installer is not supported by this script" fi diff --git a/utils/jenkins-jnlp-connect.sh b/utils/jenkins-jnlp-connect.sh index be9fe184d..8fce2e021 100755 --- a/utils/jenkins-jnlp-connect.sh +++ b/utils/jenkins-jnlp-connect.sh @@ -92,13 +92,16 @@ main () { exit 1 fi + chown=$(type -p chown) + mkdir=$(type -p mkdir) + makemonit () { echo "Writing the following as monit config:" cat << EOF | tee $monitconfdir/jenkins check directory jenkins_piddir path /var/run/$jenkinsuser -if does not exist then exec "/usr/bin/mkdir -p /var/run/$jenkinsuser" -if failed uid $jenkinsuser then exec "/usr/bin/chown $jenkinsuser /var/run/$jenkinsuser" -if failed gid $jenkinsuser then exec "/usr/bin/chown :$jenkinsuser /var/run/$jenkinsuser" +if does not exist then exec "$mkdir -p /var/run/$jenkinsuser" +if failed uid $jenkinsuser then exec "$chown $jenkinsuser /var/run/$jenkinsuser" +if failed gid $jenkinsuser then exec "$chown :$jenkinsuser /var/run/$jenkinsuser" check process jenkins with pidfile /var/run/$jenkinsuser/jenkins_jnlp_pid start program = "/usr/bin/sudo -u $jenkinsuser /bin/bash -c 'cd $jenkinshome; export started_monit=true; $0 $@' with timeout 60 seconds" @@ -111,9 +114,9 @@ EOF #test for diff if [[ "$(diff $monitconfdir/jenkins <(echo "\ check directory jenkins_piddir path /var/run/$jenkinsuser -if does not exist then exec \"/usr/bin/mkdir -p /var/run/$jenkinsuser\" -if failed uid $jenkinsuser then exec \"/usr/bin/chown $jenkinsuser /var/run/$jenkinsuser\" -if failed gid $jenkinsuser then exec \"/usr/bin/chown :$jenkinsuser /var/run/$jenkinsuser\" +if does not exist then exec \"$mkdir -p /var/run/$jenkinsuser\" +if failed uid $jenkinsuser then exec \"$chown $jenkinsuser /var/run/$jenkinsuser\" +if failed gid $jenkinsuser then exec \"$chown :$jenkinsuser /var/run/$jenkinsuser\" check process jenkins with pidfile /var/run/$jenkinsuser/jenkins_jnlp_pid start program = \"/usr/bin/sudo -u $jenkinsuser /bin/bash -c 'cd $jenkinshome; export started_monit=true; $0 $@' with timeout 60 seconds\" diff --git a/utils/lab-reconfiguration/reconfigUcsNet.py b/utils/lab-reconfiguration/reconfigUcsNet.py index 4c08f3dc9..0dd902f6d 100755 --- a/utils/lab-reconfiguration/reconfigUcsNet.py +++ b/utils/lab-reconfiguration/reconfigUcsNet.py @@ -22,8 +22,10 @@ # -p PASSWORD, --password=PASSWORD # [Mandatory] Account Password for UCSM Login # -f FILE, --file=FILE -# [Optional] Yaml file with network config you want to set for POD -# If not present only current network config will be printed +# [Optional] Yaml file with network config you +# want to set for POD +# If not present only current network config +# will be printed # import getpass @@ -32,12 +34,14 @@ import platform import yaml import time import sys -from UcsSdk import * -from collections import defaultdict +from UcsSdk import LsmaintAck, LsPower, LsServer, OrgOrg +from UcsSdk import UcsHandle, VnicEther, VnicEtherIf, YesOrNo + POD_PREFIX = "POD-2" INSTALLER = "POD-21" + def getpassword(prompt): if platform.system() == "Linux": return getpass.unix_getpass(prompt=prompt) @@ -51,7 +55,8 @@ def get_servers(handle=None): """ Return list of servers """ - orgObj = handle.GetManagedObject(None, OrgOrg.ClassId(), {OrgOrg.DN : "org-root"})[0] + orgObj = handle.GetManagedObject( + None, OrgOrg.ClassId(), {OrgOrg.DN: "org-root"})[0] servers = handle.GetManagedObject(orgObj, LsServer.ClassId()) for server in servers: if server.Type == 'instance' and POD_PREFIX in server.Dn: @@ -63,10 +68,10 @@ def set_boot_policy(handle=None, server=None, policy=None): Modify Boot policy of server """ obj = handle.GetManagedObject(None, LsServer.ClassId(), { - LsServer.DN: server.Dn}) + LsServer.DN: server.Dn}) handle.SetManagedObject(obj, LsServer.ClassId(), { - LsServer.BOOT_POLICY_NAME: policy} ) - print " Configured boot policy: {}".format(policy) + LsServer.BOOT_POLICY_NAME: policy}) + print(" Configured boot policy: {}".format(policy)) def ack_pending(handle=None, server=None): @@ -74,30 +79,32 @@ def ack_pending(handle=None, server=None): Acknowledge pending state of server """ handle.AddManagedObject(server, LsmaintAck.ClassId(), { - LsmaintAck.DN: server.Dn + "/ack", - LsmaintAck.DESCR:"", - LsmaintAck.ADMIN_STATE:"trigger-immediate", - LsmaintAck.SCHEDULER:"", - LsmaintAck.POLICY_OWNER:"local"}, True) - print " Pending-reboot -> Acknowledged." + LsmaintAck.DN: server.Dn + "/ack", + LsmaintAck.DESCR: "", + LsmaintAck.ADMIN_STATE: "trigger-immediate", + LsmaintAck.SCHEDULER: "", + LsmaintAck.POLICY_OWNER: "local"}, True) + print(" Pending-reboot -> Acknowledged.") def boot_server(handle=None, server=None): """ Boot server (when is in power-off state) """ - obj = handle.GetManagedObject(None, LsServer.ClassId(), {LsServer.DN: server.Dn}) + obj = handle.GetManagedObject( + None, LsServer.ClassId(), {LsServer.DN: server.Dn}) handle.AddManagedObject(obj, LsPower.ClassId(), { - LsPower.DN: server.Dn + "/power", - LsPower.STATE:"admin-up"}, True) - print " Booting." + LsPower.DN: server.Dn + "/power", + LsPower.STATE: "admin-up"}, True) + print(" Booting.") def get_vnics(handle=None, server=None): """ Return list of vnics for given server """ - vnics = handle.ConfigResolveChildren(VnicEther.ClassId(), server.Dn, None, YesOrNo.TRUE) + vnics = handle.ConfigResolveChildren( + VnicEther.ClassId(), server.Dn, None, YesOrNo.TRUE) return vnics.OutConfigs.GetChild() @@ -105,28 +112,36 @@ def get_network_config(handle=None): """ Print current network config """ - print "\nCURRENT NETWORK CONFIG:" - print " d - default, t - tagged" + print("\nCURRENT NETWORK CONFIG:") + print(" d - default, t - tagged") for server in get_servers(handle): - print ' {}'.format(server.Name) - print ' Boot policy: {}'.format(server.OperBootPolicyName) + print(' {}'.format(server.Name)) + print(' Boot policy: {}'.format(server.OperBootPolicyName)) for vnic in get_vnics(handle, server): - print ' {}'.format(vnic.Name) - print ' {}'.format(vnic.Addr) - vnicIfs = handle.ConfigResolveChildren(VnicEtherIf.ClassId(), vnic.Dn, None, YesOrNo.TRUE) + print(' {}'.format(vnic.Name)) + print(' {}'.format(vnic.Addr)) + vnicIfs = handle.ConfigResolveChildren( + VnicEtherIf.ClassId(), vnic.Dn, None, YesOrNo.TRUE) for vnicIf in vnicIfs.OutConfigs.GetChild(): if vnicIf.DefaultNet == 'yes': - print ' Vlan: {}d'.format(vnicIf.Vnet) + print(' Vlan: {}d'.format(vnicIf.Vnet)) else: - print ' Vlan: {}t'.format(vnicIf.Vnet) + print(' Vlan: {}t'.format(vnicIf.Vnet)) -def add_interface(handle=None, lsServerDn=None, vnicEther=None, templName=None, order=None, macAddr=None): +def add_interface(handle=None, + lsServerDn=None, + vnicEther=None, + templName=None, + order=None, + macAddr=None): """ Add interface to server specified by server.DN name """ - print " Adding interface: {}, template: {}, server.Dn: {}".format(vnicEther, templName, lsServerDn) - obj = handle.GetManagedObject(None, LsServer.ClassId(), {LsServer.DN:lsServerDn}) + print(" Adding interface: {}, template: {}, server.Dn: {}".format( + vnicEther, templName, lsServerDn)) + obj = handle.GetManagedObject( + None, LsServer.ClassId(), {LsServer.DN: lsServerDn}) vnicEtherDn = lsServerDn + "/ether-" + vnicEther params = { VnicEther.STATS_POLICY_NAME: "default", @@ -146,8 +161,9 @@ def remove_interface(handle=None, vnicEtherDn=None): """ Remove interface specified by Distinguished Name (vnicEtherDn) """ - print " Removing interface: {}".format(vnicEtherDn) - obj = handle.GetManagedObject(None, VnicEther.ClassId(), {VnicEther.DN:vnicEtherDn}) + print(" Removing interface: {}".format(vnicEtherDn)) + obj = handle.GetManagedObject( + None, VnicEther.ClassId(), {VnicEther.DN: vnicEtherDn}) handle.RemoveManagedObject(obj) @@ -165,32 +181,37 @@ def set_network(handle=None, yamlFile=None): Configure VLANs on POD according specified network """ # add interfaces and bind them with vNIC templates - print "\nRECONFIGURING VNICs..." + print("\nRECONFIGURING VNICs...") pod_data = read_yaml_file(yamlFile) network = pod_data['network'] for index, server in enumerate(get_servers(handle)): # Assign template to interface for iface, data in network.iteritems(): - add_interface(handle, server.Dn, iface, data['template'], data['order'], data['mac-list'][index]) + add_interface(handle, server.Dn, iface, data['template'], data[ + 'order'], data['mac-list'][index]) - # Remove other interfaces which have not assigned required vnic template + # Remove other interfaces which have not assigned required vnic + # template vnics = get_vnics(handle, server) for vnic in vnics: - if not any(data['template'] in vnic.OperNwTemplName for iface, data in network.iteritems()): + if not any(data['template'] in vnic.OperNwTemplName for + iface, data in network.iteritems()): remove_interface(handle, vnic.Dn) - print " {} removed, template: {}".format(vnic.Name, vnic.OperNwTemplName) + print(" {} removed, template: {}".format( + vnic.Name, vnic.OperNwTemplName)) # Set boot policy template - if not INSTALLER in server.Dn: + if INSTALLER not in server.Dn: set_boot_policy(handle, server, pod_data['boot-policy']) if __name__ == "__main__": - print "\n*** SKIPING RECONFIGURATION.***\n" + print("\n*** SKIPING RECONFIGURATION.***\n") sys.exit(0) # Latest urllib2 validate certs by default - # The process wide "revert to the old behaviour" hook is to monkeypatch the ssl module + # The process wide "revert to the old behaviour" hook is to monkeypatch + # the ssl module # https://bugs.python.org/issue22417 import ssl if hasattr(ssl, '_create_unverified_context'): @@ -198,14 +219,15 @@ if __name__ == "__main__": try: handle = UcsHandle() parser = optparse.OptionParser() - parser.add_option('-i', '--ip',dest="ip", - help="[Mandatory] UCSM IP Address") - parser.add_option('-u', '--username',dest="userName", - help="[Mandatory] Account Username for UCSM Login") - parser.add_option('-p', '--password',dest="password", - help="[Mandatory] Account Password for UCSM Login") - parser.add_option('-f', '--file',dest="yamlFile", - help="[Optional] Yaml file contains network config you want to set on UCS POD1") + parser.add_option('-i', '--ip', dest="ip", + help="[Mandatory] UCSM IP Address") + parser.add_option('-u', '--username', dest="userName", + help="[Mandatory] Account Username for UCSM Login") + parser.add_option('-p', '--password', dest="password", + help="[Mandatory] Account Password for UCSM Login") + parser.add_option('-f', '--file', dest="yamlFile", + help=("[Optional] Yaml file contains network " + "config you want to set on UCS POD1")) (options, args) = parser.parse_args() if not options.ip: @@ -215,26 +237,27 @@ if __name__ == "__main__": parser.print_help() parser.error("Provide UCSM UserName") if not options.password: - options.password=getpassword("UCSM Password:") + options.password = getpassword("UCSM Password:") handle.Login(options.ip, options.userName, options.password) # Change vnic template if specified in cli option - if (options.yamlFile != None): + if (options.yamlFile is not None): set_network(handle, options.yamlFile) time.sleep(5) - print "\nWait until Overall Status of all nodes is OK..." - timeout = time.time() + 60*10 #10 minutes timeout + print("\nWait until Overall Status of all nodes is OK...") + timeout = time.time() + 60 * 10 # 10 minutes timeout while True: list_of_states = [] for server in get_servers(handle): if server.OperState == "power-off": - boot_server(handle,server) + boot_server(handle, server) if server.OperState == "pending-reboot": - ack_pending(handle,server) + ack_pending(handle, server) list_of_states.append(server.OperState) - print " {}, {} seconds remains.".format(list_of_states, round(timeout-time.time())) + print(" {}, {} seconds remains.".format( + list_of_states, round(timeout - time.time()))) if all(state == "ok" for state in list_of_states): break if time.time() > timeout: @@ -246,11 +269,12 @@ if __name__ == "__main__": handle.Logout() - except Exception, err: + except Exception as err: handle.Logout() - print "Exception:", str(err) - import traceback, sys - print '-'*60 + print("Exception:", str(err)) + import traceback + import sys + print('-' * 60) traceback.print_exc(file=sys.stdout) - print '-'*60 + print('-' * 60) sys.exit(1) diff --git a/utils/opnfv-artifacts.py b/utils/opnfv-artifacts.py index 876efedba..2f2cc41ba 100644 --- a/utils/opnfv-artifacts.py +++ b/utils/opnfv-artifacts.py @@ -28,56 +28,55 @@ from apiclient.errors import HttpError import argparse import json -import os import sys api = { - 'projects': {}, - 'docs': {}, - 'releases': {}, + 'projects': {}, + 'docs': {}, + 'releases': {}, } releases = [ - 'arno.2015.1.0', - 'arno.2015.2.0', - 'brahmaputra.1.0', + 'arno.2015.1.0', + 'arno.2015.2.0', + 'brahmaputra.1.0', ] # List of file extensions to filter out ignore_extensions = [ - '.buildinfo', - '.woff', - '.ttf', - '.svg', - '.eot', - '.pickle', - '.doctree', - '.js', - '.png', - '.css', - '.gif', - '.jpeg', - '.jpg', - '.bmp', + '.buildinfo', + '.woff', + '.ttf', + '.svg', + '.eot', + '.pickle', + '.doctree', + '.js', + '.png', + '.css', + '.gif', + '.jpeg', + '.jpg', + '.bmp', ] parser = argparse.ArgumentParser( - description='OPNFV Artifacts JSON Generator') + description='OPNFV Artifacts JSON Generator') parser.add_argument( - '-k', - dest='key', - default='', - help='API Key for Google Cloud Storage') + '-k', + dest='key', + default='', + help='API Key for Google Cloud Storage') parser.add_argument( - '-p', - default=None, - dest='pretty', - action='store_const', - const=2, - help='pretty print the output') + '-p', + default=None, + dest='pretty', + action='store_const', + const=2, + help='pretty print the output') # Parse and assign arguments args = parser.parse_args() @@ -130,7 +129,6 @@ def has_logs(gerrit_review): return False - def has_ignorable_extension(filename): for extension in ignore_extensions: if filename.lower().endswith(extension): @@ -148,11 +146,11 @@ def get_results(key): files = storage.objects().list(bucket='artifacts.opnfv.org', fields='nextPageToken,' 'items(' - 'name,' - 'mediaLink,' - 'updated,' - 'contentType,' - 'size' + 'name,' + 'mediaLink,' + 'updated,' + 'contentType,' + 'size' ')') while (files is not None): sites = files.execute() @@ -173,7 +171,8 @@ def get_results(key): project = site_split[0] name = '/'.join(site_split[1:]) - proxy = "http://build.opnfv.org/artifacts.opnfv.org/%s" % site['name'] + proxy = "http://build.opnfv.org/artifacts.opnfv.org/%s" % site[ + 'name'] if name.endswith('.html'): href = "http://artifacts.opnfv.org/%s" % site['name'] href_type = 'view' @@ -183,7 +182,7 @@ def get_results(key): gerrit = has_gerrit_review(site_split) logs = False # has_logs(gerrit) - documentation = has_documentation(site_split) + # documentation = has_documentation(site_split) release = has_release(site_split) category = 'project' diff --git a/utils/push-test-logs.sh b/utils/push-test-logs.sh index 913748f03..9099657c8 100644 --- a/utils/push-test-logs.sh +++ b/utils/push-test-logs.sh @@ -15,19 +15,21 @@ export PATH=$PATH:/usr/local/bin/ git_sha1="$(git rev-parse HEAD)" res_build_date=${1:-$(date -u +"%Y-%m-%d_%H-%M-%S")} project=$PROJECT -branch=${GIT_BRANCH##*/} +branch=${BRANCH##*/} testbed=$NODE_NAME dir_result="${HOME}/opnfv/$project/results/${branch}" # src: https://wiki.opnfv.org/display/INF/Hardware+Infrastructure -# + intel-pod3 (vsperf) +# + intel-pod12 (vsperf) node_list=(\ -'lf-pod1' 'lf-pod2' 'intel-pod2' 'intel-pod3' \ +'lf-pod1' 'lf-pod2' 'intel-pod2' 'intel-pod12' \ 'intel-pod5' 'intel-pod6' 'intel-pod7' 'intel-pod8' \ -'ericsson-pod2' 'ericsson-pod3' 'ericsson-pod4' \ +'ericsson-pod1' 'ericsson-pod2' \ 'ericsson-virtual1' 'ericsson-virtual2' 'ericsson-virtual3' \ -'ericsson-virtual4' 'ericsson-virtual5' \ +'ericsson-virtual4' 'ericsson-virtual5' 'ericsson-virtual12' \ 'arm-pod1' 'arm-pod3' \ -'huawei-pod1' 'huawei-pod2' 'huawei-virtual1' 'huawei-virtual2' 'huawei-virtual3' 'huawei-virtual4') +'huawei-pod1' 'huawei-pod2' 'huawei-pod3' 'huawei-pod4' 'huawei-pod5' \ +'huawei-pod6' 'huawei-pod7' 'huawei-pod12' \ +'huawei-virtual1' 'huawei-virtual2' 'huawei-virtual3' 'huawei-virtual4') if [[ ! " ${node_list[@]} " =~ " ${testbed} " ]]; then diff --git a/utils/test/dashboard/dashboard/common/elastic_access.py b/utils/test/dashboard/dashboard/common/elastic_access.py index aaf776f7a..eb29ce879 100644 --- a/utils/test/dashboard/dashboard/common/elastic_access.py +++ b/utils/test/dashboard/dashboard/common/elastic_access.py @@ -30,7 +30,7 @@ def publish_docs(url, creds=None, body=None): def _get_docs_nr(url, creds=None, body=None): res_data = _get('{}/_search?size=0'.format(url), creds=creds, body=body) - print type(res_data), res_data + print(type(res_data), res_data) return res_data['hits']['total'] diff --git a/utils/test/dashboard/dashboard/conf/testcases.py b/utils/test/dashboard/dashboard/conf/testcases.py index ff801b4c9..98ce20984 100644 --- a/utils/test/dashboard/dashboard/conf/testcases.py +++ b/utils/test/dashboard/dashboard/conf/testcases.py @@ -21,4 +21,4 @@ def get_format(project, case): if __name__ == '__main__': fmt = get_format('functest', 'vping_ssh') - print fmt + print(fmt) diff --git a/utils/test/dashboard/dashboard/elastic2kibana/utility.py b/utils/test/dashboard/dashboard/elastic2kibana/utility.py index 55578bd8c..40d9202a6 100644 --- a/utils/test/dashboard/dashboard/elastic2kibana/utility.py +++ b/utils/test/dashboard/dashboard/elastic2kibana/utility.py @@ -2,7 +2,8 @@ import json from jinja2 import Environment, PackageLoader -env = Environment(loader=PackageLoader('dashboard', 'elastic2kibana/templates')) +env = Environment(loader=PackageLoader('dashboard', + 'elastic2kibana/templates')) env.filters['jsonify'] = json.dumps diff --git a/utils/test/dashboard/dashboard/functest/format.py b/utils/test/dashboard/dashboard/functest/format.py index ef485bae0..75d361ff8 100644 --- a/utils/test/dashboard/dashboard/functest/format.py +++ b/utils/test/dashboard/dashboard/functest/format.py @@ -6,7 +6,8 @@ def _convert_value(value): def _convert_duration(duration): - if (isinstance(duration, str) or isinstance(duration, unicode)) and ':' in duration: + if ((isinstance(duration, str) or + isinstance(duration, unicode)) and ':' in duration): hours, minutes, seconds = duration.split(":") hours = _convert_value(hours) minutes = _convert_value(minutes) @@ -42,11 +43,11 @@ def format_normal(testcase): testcase_tests = float(testcase_details['tests']) testcase_failures = float(testcase_details['failures']) if testcase_tests != 0: - testcase_details['success_percentage'] = 100 * (testcase_tests - testcase_failures) / testcase_tests + testcase_details['success_percentage'] = 100 * \ + (testcase_tests - testcase_failures) / testcase_tests else: testcase_details['success_percentage'] = 0 - return found @@ -115,28 +116,33 @@ def format_onos(testcase): """ testcase_details = testcase['details'] - if 'FUNCvirNet' not in testcase_details or 'FUNCvirNetL3' not in testcase_details: + if ('FUNCvirNet' not in testcase_details or + 'FUNCvirNetL3' not in testcase_details): return False funcvirnet_details = testcase_details['FUNCvirNet']['status'] - funcvirnet_stats = _get_statistics(funcvirnet_details, ('Case result',), ('PASS', 'FAIL')) + funcvirnet_stats = _get_statistics( + funcvirnet_details, ('Case result',), ('PASS', 'FAIL')) funcvirnet_passed = funcvirnet_stats['PASS'] funcvirnet_failed = funcvirnet_stats['FAIL'] funcvirnet_all = funcvirnet_passed + funcvirnet_failed funcvirnetl3_details = testcase_details['FUNCvirNetL3']['status'] - funcvirnetl3_stats = _get_statistics(funcvirnetl3_details, ('Case result',), ('PASS', 'FAIL')) + funcvirnetl3_stats = _get_statistics( + funcvirnetl3_details, ('Case result',), ('PASS', 'FAIL')) funcvirnetl3_passed = funcvirnetl3_stats['PASS'] funcvirnetl3_failed = funcvirnetl3_stats['FAIL'] funcvirnetl3_all = funcvirnetl3_passed + funcvirnetl3_failed testcase_details['FUNCvirNet'] = { - 'duration': _convert_duration(testcase_details['FUNCvirNet']['duration']), + 'duration': + _convert_duration(testcase_details['FUNCvirNet']['duration']), 'tests': funcvirnet_all, 'failures': funcvirnet_failed } testcase_details['FUNCvirNetL3'] = { - 'duration': _convert_duration(testcase_details['FUNCvirNetL3']['duration']), + 'duration': + _convert_duration(testcase_details['FUNCvirNetL3']['duration']), 'tests': funcvirnetl3_all, 'failures': funcvirnetl3_failed } diff --git a/utils/test/dashboard/dashboard/mongo2elastic/main.py b/utils/test/dashboard/dashboard/mongo2elastic/main.py index 688f55f7d..e33252df2 100644 --- a/utils/test/dashboard/dashboard/mongo2elastic/main.py +++ b/utils/test/dashboard/dashboard/mongo2elastic/main.py @@ -27,7 +27,8 @@ parser.add_argument('-ld', '--latest-days', metavar='N', help='get entries old at most N days from mongodb and' ' parse those that are not already in elasticsearch.' - ' If not present, will get everything from mongodb, which is the default') + ' If not present, will get everything from mongodb,' + ' which is the default') args = parser.parse_args() CONF = APIConfig().parse(args.config_file) @@ -37,6 +38,7 @@ tmp_docs_file = './mongo-{}.json'.format(uuid.uuid4()) class DocumentVerification(object): + def __init__(self, doc): super(DocumentVerification, self).__init__() self.doc = doc @@ -55,8 +57,8 @@ class DocumentVerification(object): for key, value in self.doc.items(): if key in mandatory_fields: if value is None: - logger.info("Skip testcase '%s' because field '%s' missing" % - (self.doc_id, key)) + logger.info("Skip testcase '%s' because field " + "'%s' missing" % (self.doc_id, key)) self.skip = True else: mandatory_fields.remove(key) @@ -131,10 +133,12 @@ class DocumentPublisher(object): self._publish() def _publish(self): - status, data = elastic_access.publish_docs(self.elastic_url, self.creds, self.doc) + status, data = elastic_access.publish_docs( + self.elastic_url, self.creds, self.doc) if status > 300: logger.error('Publish record[{}] failed, due to [{}]' - .format(self.doc, json.loads(data)['error']['reason'])) + .format(self.doc, + json.loads(data)['error']['reason'])) def _fix_date(self, date_string): if isinstance(date_string, dict): @@ -163,7 +167,8 @@ class DocumentsPublisher(object): def export(self): if self.days > 0: - past_time = datetime.datetime.today() - datetime.timedelta(days=self.days) + past_time = datetime.datetime.today( + ) - datetime.timedelta(days=self.days) query = '''{{ "project_name": "{}", "case_name": "{}", @@ -182,7 +187,7 @@ class DocumentsPublisher(object): try: subprocess.check_call(cmd) return self - except Exception, err: + except Exception as err: logger.error("export mongodb failed: %s" % err) self._remove() exit(-1) @@ -217,7 +222,8 @@ class DocumentsPublisher(object): }}'''.format(self.project, self.case, self.days) else: raise Exception('Update days must be non-negative') - self.existed_docs = elastic_access.get_docs(self.elastic_url, self.creds, body) + self.existed_docs = elastic_access.get_docs( + self.elastic_url, self.creds, body) return self def publish(self): diff --git a/utils/test/dashboard/kibana_cleanup.py b/utils/test/dashboard/kibana_cleanup.py index ee0190049..7e3662c29 100644 --- a/utils/test/dashboard/kibana_cleanup.py +++ b/utils/test/dashboard/kibana_cleanup.py @@ -9,7 +9,8 @@ from dashboard.common import elastic_access logger = logging.getLogger('clear_kibana') logger.setLevel(logging.DEBUG) file_handler = logging.FileHandler('/var/log/{}.log'.format('clear_kibana')) -file_handler.setFormatter(logging.Formatter('%(asctime)s %(levelname)s: %(message)s')) +file_handler.setFormatter(logging.Formatter('%(asctime)s %(levelname)s: ' + '%(message)s')) logger.addHandler(file_handler) @@ -21,12 +22,17 @@ def delete_all(url, es_creds): if __name__ == '__main__': - parser = argparse.ArgumentParser(description='Delete saved kibana searches, visualizations and dashboards') - parser.add_argument('-e', '--elasticsearch-url', default='http://localhost:9200', - help='the url of elasticsearch, defaults to http://localhost:9200') + parser = argparse.ArgumentParser( + description=('Delete saved kibana searches, ' + 'visualizations and dashboards')) + parser.add_argument('-e', '--elasticsearch-url', + default='http://localhost:9200', + help=('the url of elasticsearch, ' + 'defaults to http://localhost:9200')) parser.add_argument('-u', '--elasticsearch-username', default=None, - help='The username with password for elasticsearch in format username:password') + help=('The username with password for elasticsearch ' + 'in format username:password')) args = parser.parse_args() base_elastic_url = args.elasticsearch_url @@ -38,4 +44,3 @@ if __name__ == '__main__': for url in urls: delete_all(url, es_creds) - diff --git a/utils/test/declaration/addtestcase.php b/utils/test/declaration/addtestcase.php deleted file mode 100644 index 0e5bed689..000000000 --- a/utils/test/declaration/addtestcase.php +++ /dev/null @@ -1,40 +0,0 @@ -<?php -function sendPostData($url, $post){ - $ch = curl_init($url); - $headers= array('Accept: application/json','Content-Type: application/json'); - curl_setopt($ch, CURLOPT_CUSTOMREQUEST, "POST"); - curl_setopt($ch, CURLOPT_RETURNTRANSFER, true); - curl_setopt($ch, CURLOPT_HTTPHEADER, $headers); - curl_setopt($ch, CURLOPT_POSTFIELDS,$post); - curl_setopt($ch, CURLOPT_FOLLOWLOCATION, 1); - $result = curl_exec($ch); - curl_close($ch); - return $result; -} - -if(isset($_REQUEST['url'])){ - $url=$_REQUEST['url']; -} -if(isset($_REQUEST['name'])){ - $name=$_REQUEST['name']; -} -if(isset($_REQUEST['desc'])){ - $desc=$_REQUEST['desc']; -} -if(isset($_REQUEST['project'])){ - - $url_send=$_REQUEST['project']; - $url_send="http://testresults.opnfv.org:80/test/api/v1/projects/".$url_send."/cases"; - $str_data=array('url'=>$url,'name'=>$name,'description'=>$desc); - $str_data=json_encode($str_data); - $res=sendPostData($url_send, $str_data); - echo '<div class="alert alert-success"> <strong>Success!</strong> Added New test Case </div>'; - -}else{ - - echo '<div class="alert alert-danger"> <strong>Error!</strong> Failed to Add New test Case </div>'; - -} - -?> - diff --git a/utils/test/declaration/index.php b/utils/test/declaration/index.php deleted file mode 100644 index b2c5d0370..000000000 --- a/utils/test/declaration/index.php +++ /dev/null @@ -1,221 +0,0 @@ -<!DOCTYPE html> -<html lang="en"> -<head> - <title>OPNFV DashBoard</title> - <meta charset="utf-8"> - <meta name="viewport" content="width=device-width, initial-scale=1"> - <link rel="stylesheet" href="http://maxcdn.bootstrapcdn.com/bootstrap/3.3.6/css/bootstrap.min.css"> - <script src="https://ajax.googleapis.com/ajax/libs/jquery/1.12.2/jquery.min.js"></script> - <script src="http://maxcdn.bootstrapcdn.com/bootstrap/3.3.6/js/bootstrap.min.js"></script> -<script> -$(function() { - - $('form#new_testcase').on('submit', function(){ - var selected = $('select#sel_pro2').find("option:selected").val(); - var uri = $('input#uri').val(); - var name = $('input#name').val(); - var desc = $('textarea#desc').val(); - var new_url="http://testresults.opnfv.org:80/test/api/v1/projects/"+selected+"/cases"; - $.post("addtestcase.php", {"project":selected,"url":uri,"name":name,"description":desc}, function(result){ - $("div#result").html(result); - }); - }); - -}); - -$(function() { - - $('select#sel1').on('change', function(){ - var selected = $(this).find("option:selected").val(); - var new_url="http://testresults.opnfv.org:80/test/api/v1/projects/"+selected+"/cases"; - //$.post('testcases.php', {project: selected}); - console.log(selected); - $.post("testcases.php", {project: selected}, function(result){ - $("div#4a").html(result); - }); - - }); - -}); -</script> -<style> -body { - padding : 10px ; -} - -#exTab1 .tab-content { - color : black; - padding : 5px 15px; -} - -#exTab2 h3 { - color : white; - background-color: #428bca; - padding : 5px 15px; -} - -/* remove border radius for the tab */ - -#exTab1 .nav-pills > li > a { - border-radius: 0; -} - -/* change border radius for the tab , apply corners on top*/ - -#exTab3 .nav-pills > li > a { - border-radius: 4px 4px 0 0 ; -} - -#exTab3 .tab-content { - color : white; - background-color: #428bca; - padding : 5px 15px; -} - -</style> -</head> -<body> - -<div class="container"> - <h1>OPNFV DASHBOARD: </h1></div> -<div id="exTab1" class="container"> - <ul class="nav nav-pills"> - <li class="active"> - <a href="#1a" data-toggle="tab">PODS</a> - </li> - <li><a href="#2a" data-toggle="tab">PROJECTS</a> - </li> - <li><a href="#3a" data-toggle="tab">TESTCASES</a> - </li> - <li><a href="#5a" data-toggle="tab">ADD TESTCASE</a> - </li> - <li><a href="http://testresults.opnfv.org/kibana_dashboards/" >RESULTS</a> - </li> - </ul> - <div class="tab-content clearfix"> - <div class="tab-pane active" id="1a"> - <table class="table table-striped"> - <thead> - <tr> - <th>#</th> - <th>Pod Name</th> - <th>Creation Date</th> - <th>Role</th> - <th>Mode</th> - </tr> - </thead> - <?php - $url = "http://testresults.opnfv.org:80/test/api/v1/pods"; - $response = file_get_contents($url); - $data = json_decode($response); - $pods = $data->pods; - $i=1; - foreach ( $pods as $pod ){ - - $column_str=""; - $column_str="<tr><td>".$i."</td>"; - $column_str=$column_str."<td>".$pod->name."</td>"; - $column_str= $column_str."<td>".$pod->creation_date."</td>"; - $column_str= $column_str."<td>".$pod->role."</td>"; - $column_str= $column_str."<td>".$pod->mode."</td>"; - $column_str= $column_str."</tr>"; - echo $column_str; - $i=$i+1; - } - ?> - </table> - </div> - <div class="tab-pane" id="2a"> - <table class="table table-striped"> - <thead> - <tr> - <th>#</th> - <th>Project</th> - <th>Creation Date</th> - </tr> - </thead> - <?php - $url = "http://testresults.opnfv.org:80/test/api/v1/projects"; - $response = file_get_contents($url); - $data = json_decode($response); - $projects=$data->projects; - $i=0; - foreach ( $projects as $project ){ - - $column_str=""; - $column_str="<tr><td>".$i."</td>"; - $column_str=$column_str."<td>".$project->name."</td>"; - $column_str= $column_str."<td>".$project->creation_date."</td>"; - $column_str= $column_str."</tr>"; - echo $column_str; - $i=$i+1; - } -?> - </table> - </div> - <div class="tab-pane" id="3a"> -<div class="form-group"> - <label for="sel1">Select list:</label> - <select class="form-control" id="sel1"> -<?php - $url = "http://testresults.opnfv.org:80/test/api/v1/projects"; - $response = file_get_contents($url); - $data = json_decode($response); - $projects=$data->projects; - $i=0; - $firstvalue=$projects[0]->name; - foreach ( $projects as $project ){ - $column_str=""; - $column_str="<option>".$project->name."</option>"; - echo $column_str; - } - -?> -</select> -</div> - <div class="tab-pane" id="4a"> - <?php - require "testcases.php"; - ?> - </div> - </div> - <div class="tab-pane" id="5a"> - <form role="form" id="new_testcase"> -<div class="form-group"> - <label for="sel1">Select list:</label> - <select class="form-control" id="sel_pro2"> -<?php - $url = "http://testresults.opnfv.org:80/test/api/v1/projects"; - $response = file_get_contents($url); - $data = json_decode($response); - $projects=$data->projects; - $i=0; - $firstvalue=$projects[0]->name; - foreach ( $projects as $project ){ - $column_str=""; - $column_str="<option>".$project->name."</option>"; - echo $column_str; - } -?> -</select> -</div> -<div class="form-group"> <!-- Name field --> - <label class="control-label " for="name">TestCase URI</label> - <input class="form-control" id="uri" name="uri" type="text"/> - </div> -<div class="form-group"> <!-- Name field --> - <label class="control-label " for="name">TestCase Name</label> - <input class="form-control" id="name" name="name" type="text"/> - </div> -<div class="form-group"> <!-- Name field --> - <label class="control-label " for="name">Description</label> - <textarea class="form-control" rows="5" id="desc"></textarea> - </div> - <button type="submit" class="btn btn-default">Submit</button> -</form> - </div> -<div class="container" id="result"></div> - </div> -</div> -</body> -</html> diff --git a/utils/test/declaration/testcases.php b/utils/test/declaration/testcases.php deleted file mode 100644 index 20645807e..000000000 --- a/utils/test/declaration/testcases.php +++ /dev/null @@ -1,36 +0,0 @@ -<?php - if(isset($_REQUEST['project'])){ - $selected=$_REQUEST['project']; - } - else{ - $url = "http://testresults.opnfv.org:80/test/api/v1/projects"; - $response = file_get_contents($url); - $data = json_decode($response); - $projects=$data->projects; - $selected=$projects[0]->name; - } - $new_url="http://testresults.opnfv.org:80/test/api/v1/projects/".$selected."/cases"; - $response = file_get_contents($new_url); - $data = json_decode($response); - $testcases=$data->testcases; - $i=0; - $column_str=""; - $column_str=$column_str."<table class=\"table table-striped\"><tr>"; - $column_str=$column_str."<th>#</th><th>Test Case Name</th>"; - $column_str=$column_str."<th>Creation Date</th>"; - $column_str=$column_str."<th>Description</th></tr>"; - foreach ( $testcases as $testcase ){ - $i=$i+1; - $column_str=$column_str."<tr>"; - $column_str=$column_str."<td>".$i."</td>"; - $column_str=$column_str."<td>".$testcase->name."</td>"; - $column_str=$column_str."<td>".$testcase->creation_date."</td>"; - $column_str=$column_str."<td>".$testcase->description."</td>"; - $column_str=$column_str."</tr>"; - - } - $column_str=$column_str."</table>"; - echo $column_str; - -?> - diff --git a/utils/test/reporting/api/handlers/landing.py b/utils/test/reporting/api/handlers/landing.py index 137c05007..ae1fd2037 100644 --- a/utils/test/reporting/api/handlers/landing.py +++ b/utils/test/reporting/api/handlers/landing.py @@ -6,15 +6,172 @@ # which accompanies this distribution, and is available at # http://www.apache.org/licenses/LICENSE-2.0 ############################################################################## +import requests + from tornado.web import RequestHandler from tornado.escape import json_encode +from tornado.escape import json_decode -class FiltersHandler(RequestHandler): - def get(self): - return self.write(json_encode({'status': 'SUCCESS'})) +class BaseHandler(RequestHandler): + def _set_header(self): + self.set_header('Access-Control-Allow-Origin', '*') + self.set_header('Access-Control-Allow-Headers', + 'Content-Type, Content-Length, Authorization, \ + Accept, X-Requested-With , PRIVATE-TOKEN') + self.set_header('Access-Control-Allow-Methods', + 'PUT, POST, GET, DELETE, OPTIONS') -class ScenariosHandler(RequestHandler): +class FiltersHandler(BaseHandler): def get(self): - return self.write(json_encode({'status': 'SUCCESS'})) + self._set_header() + + filters = { + 'filters': { + 'status': ['success', 'warning', 'danger'], + 'projects': ['functest', 'yardstick'], + 'installers': ['apex', 'compass', 'fuel', 'joid'], + 'version': ['colorado', 'master'], + 'loops': ['daily', 'weekly', 'monthly'], + 'time': ['10 days', '30 days'] + } + } + return self.write(json_encode(filters)) + + +class ScenariosHandler(BaseHandler): + def post(self): + self._set_header() + + body = json_decode(self.request.body) + args = self._get_args(body) + + scenarios = self._get_result_data(self._get_scenarios(), args) + + return self.write(json_encode(dict(scenarios=scenarios))) + + def _get_result_data(self, data, args): + data = self._filter_status(data, args) + return {s: self._get_scenario_result(s, data[s], args) for s in data} + + def _filter_status(self, data, args): + return {k: v for k, v in data.items() if v['status'] in args['status']} + + def _get_scenario_result(self, scenario, data, args): + result = { + 'status': data.get('status'), + 'installers': self._get_installers_result(data['installers'], args) + } + return result + + def _get_installers_result(self, data, args): + func = self._get_installer_result + return {k: func(k, data.get(k, {}), args) for k in args['installers']} + + def _get_installer_result(self, installer, data, args): + projects = data.get(args['version'], []) + return [self._get_project_data(projects, p) for p in args['projects']] + + def _get_project_data(self, projects, project): + atom = { + 'project': project, + 'score': None, + 'status': None + } + for p in projects: + if p['project'] == project: + return p + return atom + + def _get_scenarios(self): + url = 'http://testresults.opnfv.org/test/api/v1/scenarios' + resp = requests.get(url).json() + data = self._change_to_utf8(resp).get('scenarios', {}) + return {a.get('name'): self._get_scenario(a.get('installers', []) + ) for a in data} + + def _get_scenario(self, data): + installers = {a.get('installer'): self._get_installer(a.get('versions', + []) + ) for a in data} + scenario = { + 'status': self._get_status(), + 'installers': installers + } + return scenario + + def _get_status(self): + return 'success' + + def _get_installer(self, data): + return {a.get('version'): self._get_version(a) for a in data} + + def _get_version(self, data): + try: + scores = data.get('score', {}).get('projects')[0] + trusts = data.get('trust_indicator', {}).get('projects')[0] + except (TypeError, IndexError): + return [] + else: + scores = {key: [dict(date=a.get('date')[:10], + score=a.get('score') + ) for a in scores[key]] for key in scores} + trusts = {key: [dict(date=a.get('date')[:10], + status=a.get('status') + ) for a in trusts[key]] for key in trusts} + atom = self._get_atom(scores, trusts) + return [dict(project=k, + score=sorted(atom[k], reverse=True)[0].get('score'), + status=sorted(atom[k], reverse=True)[0].get('status') + ) for k in atom if atom[k]] + + def _get_atom(self, scores, trusts): + s = {k: {a['date']: a['score'] for a in scores[k]} for k in scores} + t = {k: {a['date']: a['status'] for a in trusts[k]} for k in trusts} + return {k: [dict(score=s[k][a], status=t[k][a], data=a + ) for a in s[k] if a in t[k]] for k in s} + + def _change_to_utf8(self, obj): + if isinstance(obj, dict): + return {str(k): self._change_to_utf8(v) for k, v in obj.items()} + elif isinstance(obj, list): + return [self._change_to_utf8(ele) for ele in obj] + else: + try: + new = eval(obj) + if isinstance(new, int): + return obj + return self._change_to_utf8(new) + except (NameError, TypeError, SyntaxError): + return str(obj) + + def _get_args(self, body): + status = self._get_status_args(body) + projects = self._get_projects_args(body) + installers = self._get_installers_args(body) + + args = { + 'status': status, + 'projects': projects, + 'installers': installers, + 'version': body.get('version', 'master').lower(), + 'loops': body.get('loops', 'daily').lower(), + 'time': body.get('times', '10 days')[:2].lower() + } + return args + + def _get_status_args(self, body): + status_all = ['success', 'warning', 'danger'] + status = [a.lower() for a in body.get('status', ['all'])] + return status_all if 'all' in status else status + + def _get_projects_args(self, body): + project_all = ['functest', 'yardstick'] + projects = [a.lower() for a in body.get('projects', ['all'])] + return project_all if 'all' in projects else projects + + def _get_installers_args(self, body): + installer_all = ['apex', 'compass', 'fuel', 'joid'] + installers = [a.lower() for a in body.get('installers', ['all'])] + return installer_all if 'all' in installers else installers diff --git a/utils/test/reporting/api/install.sh b/utils/test/reporting/api/install.sh new file mode 100755 index 000000000..55d6b77ec --- /dev/null +++ b/utils/test/reporting/api/install.sh @@ -0,0 +1,3 @@ +apt-get install -y python-pip +pip install tornado +pip install requests diff --git a/utils/test/reporting/docker/reporting.sh b/utils/test/reporting/docker/reporting.sh index 1bef1b811..1de13ae32 100755 --- a/utils/test/reporting/docker/reporting.sh +++ b/utils/test/reporting/docker/reporting.sh @@ -4,7 +4,7 @@ export PYTHONPATH="${PYTHONPATH}:." export CONFIG_REPORTING_YAML=./reporting.yaml declare -a versions=(colorado master) -declare -a projects=(functest yardstick) +declare -a projects=(functest storperf yardstick) project=$1 reporting_type=$2 @@ -30,6 +30,7 @@ cp -Rf js display # $1 | $2 # functest | status, vims, tempest # yardstick | +# storperf | if [ -z "$1" ]; then echo "********************************" @@ -52,6 +53,13 @@ if [ -z "$1" ]; then echo "********************************" python ./yardstick/reporting-status.py echo "Yardstick reporting status...OK" + + echo "********************************" + echo " Storperf reporting " + echo "********************************" + python ./storperf/reporting-status.py + echo "Storperf reporting status...OK" + else if [ -z "$2" ]; then reporting_type="status" @@ -71,10 +79,4 @@ echo "daemon off;" >> /etc/nginx/nginx.conf # supervisor config cp /home/opnfv/utils/test/reporting/docker/supervisor.conf /etc/supervisor/conf.d/ -# build pages -cd pages ln -s /usr/bin/nodejs /usr/bin/node -npm install -npm install -g grunt bower -bower install --allow-root -grunt build diff --git a/utils/test/reporting/docker/supervisor.conf b/utils/test/reporting/docker/supervisor.conf index 0c2207793..1e0eed9c8 100644 --- a/utils/test/reporting/docker/supervisor.conf +++ b/utils/test/reporting/docker/supervisor.conf @@ -14,3 +14,9 @@ autorestart = true user = root command = service nginx restart autorestart = true + +[program:reporting_angular] +user = root +directory = /home/opnfv/utils/test/reporting/pages +command = bash angular.sh +autorestart = true diff --git a/utils/test/reporting/functest/reporting-status.py b/utils/test/reporting/functest/reporting-status.py index 66bdd57c1..95f9e66e8 100755 --- a/utils/test/reporting/functest/reporting-status.py +++ b/utils/test/reporting/functest/reporting-status.py @@ -28,9 +28,9 @@ testValid = [] otherTestCases = [] reportingDate = datetime.datetime.now().strftime("%Y-%m-%d %H:%M") -# init just tempest to get the list of scenarios -# as all the scenarios run Tempest -tempest = tc.TestCase("tempest_smoke_serial", "functest", -1) +# init just connection_check to get the list of scenarios +# as all the scenarios run connection_check +healthcheck = tc.TestCase("connection_check", "functest", -1) # Retrieve the Functest configuration to detect which tests are relevant # according to the installer, scenario @@ -40,6 +40,9 @@ versions = rp_utils.get_config('general.versions') installers = rp_utils.get_config('general.installers') blacklist = rp_utils.get_config('functest.blacklist') log_level = rp_utils.get_config('general.log.log_level') +exclude_noha = rp_utils.get_config('functest.exclude_noha') +exclude_virtual = rp_utils.get_config('functest.exclude_virtual') + response = requests.get(cf) functest_yaml_config = yaml.safe_load(response.text) @@ -48,20 +51,23 @@ logger.info("*******************************************") logger.info("* *") logger.info("* Generating reporting scenario status *") logger.info("* Data retention: %s days *" % period) -logger.info("* Log level: %s *" % log_level) +logger.info("* Log level: %s *" % log_level) +logger.info("* *") +logger.info("* Virtual PODs exluded: %s *" % exclude_virtual) +logger.info("* NOHA scenarios excluded: %s *" % exclude_noha) logger.info("* *") logger.info("*******************************************") # Retrieve test cases of Tier 1 (smoke) config_tiers = functest_yaml_config.get("tiers") -# we consider Tier 1 (smoke),2 (features) +# we consider Tier 0 (Healthcheck), Tier 1 (smoke),2 (features) # to validate scenarios -# Tier > 4 are not used to validate scenarios but we display the results anyway +# Tier > 2 are not used to validate scenarios but we display the results anyway # tricky thing for the API as some tests are Functest tests # other tests are declared directly in the feature projects for tier in config_tiers: - if tier['order'] > 0 and tier['order'] < 2: + if tier['order'] >= 0 and tier['order'] < 2: for case in tier['testcases']: if case['name'] not in blacklist: testValid.append(tc.TestCase(case['name'], @@ -86,11 +92,12 @@ for version in versions: # For all the installers for installer in installers: # get scenarios - scenario_results = rp_utils.getScenarios(tempest, installer, version) + scenario_results = rp_utils.getScenarios(healthcheck, + installer, + version) scenario_stats = rp_utils.getScenarioStats(scenario_results) items = {} scenario_result_criteria = {} - scenario_file_name = ("./display/" + version + "/functest/scenario_history.txt") # initiate scenario file if it does not exist diff --git a/utils/test/reporting/functest/reporting-tempest.py b/utils/test/reporting/functest/reporting-tempest.py index 5d6bcc062..6e6585a32 100755 --- a/utils/test/reporting/functest/reporting-tempest.py +++ b/utils/test/reporting/functest/reporting-tempest.py @@ -44,7 +44,7 @@ for version in rp_utils.get_config('general.versions'): response = urlopen(request) k = response.read() results = json.loads(k) - except URLError, e: + except URLError as e: logger.error("Error code: %s" % e) test_results = results['results'] @@ -73,9 +73,9 @@ for version in rp_utils.get_config('general.versions'): nb_tests_run = result['details']['tests'] nb_tests_failed = result['details']['failures'] if nb_tests_run != 0: - success_rate = 100*((int(nb_tests_run) - - int(nb_tests_failed)) / - int(nb_tests_run)) + success_rate = 100 * ((int(nb_tests_run) - + int(nb_tests_failed)) / + int(nb_tests_run)) else: success_rate = 0 diff --git a/utils/test/reporting/functest/reporting-vims.py b/utils/test/reporting/functest/reporting-vims.py index 2077d2a4a..b236b8963 100755 --- a/utils/test/reporting/functest/reporting-vims.py +++ b/utils/test/reporting/functest/reporting-vims.py @@ -51,7 +51,7 @@ for version in versions: response = urlopen(request) k = response.read() results = json.loads(k) - except URLError, e: + except URLError as e: logger.error("Error code: %s" % e) test_results = results['results'] @@ -91,7 +91,7 @@ for version in versions: result['pr_step_ok'] = 0 if nb_step != 0: - result['pr_step_ok'] = (float(nb_step_ok)/nb_step)*100 + result['pr_step_ok'] = (float(nb_step_ok) / nb_step) * 100 try: logger.debug("Scenario %s, Installer %s" % (s_result[1]['scenario'], installer)) diff --git a/utils/test/reporting/functest/testCase.py b/utils/test/reporting/functest/testCase.py index 8d90fc861..f77136e11 100644 --- a/utils/test/reporting/functest/testCase.py +++ b/utils/test/reporting/functest/testCase.py @@ -27,6 +27,7 @@ class TestCase(object): 'ocl': 'OCL', 'tempest_smoke_serial': 'Tempest (smoke)', 'tempest_full_parallel': 'Tempest (full)', + 'tempest_defcore': 'Tempest (Defcore)', 'rally_sanity': 'Rally (smoke)', 'bgpvpn': 'bgpvpn', 'rally_full': 'Rally (full)', @@ -36,14 +37,17 @@ class TestCase(object): 'moon': 'Moon', 'copper': 'Copper', 'security_scan': 'Security', - 'multisite':'Multisite', - 'domino':'Domino', - 'odl-sfc':'SFC', - 'onos_sfc':'SFC', - 'parser':'Parser', - 'connection_check':'Health (connection)', - 'api_check':'Health (api)', - 'snaps_smoke':'SNAPS' } + 'multisite': 'Multisite', + 'domino': 'Domino', + 'odl-sfc': 'SFC', + 'onos_sfc': 'SFC', + 'parser': 'Parser', + 'connection_check': 'Health (connection)', + 'api_check': 'Health (api)', + 'snaps_smoke': 'SNAPS', + 'snaps_health_check': 'Health (dhcp)', + 'netready': 'Netready', + 'barometer': 'Barometer'} try: self.displayName = display_name_matrix[self.name] except: @@ -122,6 +126,7 @@ class TestCase(object): 'ocl': 'ocl', 'tempest_smoke_serial': 'tempest_smoke_serial', 'tempest_full_parallel': 'tempest_full_parallel', + 'tempest_defcore': 'tempest_defcore', 'rally_sanity': 'rally_sanity', 'bgpvpn': 'bgpvpn', 'rally_full': 'rally_full', @@ -131,15 +136,17 @@ class TestCase(object): 'moon': 'moon_authentication', 'copper': 'copper-notification', 'security_scan': 'security', - 'multisite':'multisite', - 'domino':'domino-multinode', - 'odl-sfc':'functest-odl-sfc', - 'onos_sfc':'onos_sfc', - 'parser':'parser-basics', - 'connection_check':'connection_check', - 'api_check':'api_check', - 'snaps_smoke':'snaps_smoke' - } + 'multisite': 'multisite', + 'domino': 'domino-multinode', + 'odl-sfc': 'functest-odl-sfc', + 'onos_sfc': 'onos_sfc', + 'parser': 'parser-basics', + 'connection_check': 'connection_check', + 'api_check': 'api_check', + 'snaps_smoke': 'snaps_smoke', + 'snaps_health_check': 'snaps_health_check', + 'netready': 'gluon_vping', + 'barometer': 'barometercollectd'} try: return test_match_matrix[self.name] except: @@ -147,4 +154,3 @@ class TestCase(object): def getDisplayName(self): return self.displayName - diff --git a/utils/test/reporting/html/danube.html b/utils/test/reporting/html/danube.html index 58d6bc0fe..d21875b53 100644 --- a/utils/test/reporting/html/danube.html +++ b/utils/test/reporting/html/danube.html @@ -76,6 +76,17 @@ </div>
</a>
</article>
+ <article class="style4">
+ <span class="image">
+ <img src="img/storperf.jpg" alt="" />
+ </span>
+ <a href="master/storperf/status-apex.html">
+ <h2>Storperf</h2>
+ <div class="content">
+ <p>Storage testing</p>
+ </div>
+ </a>
+ </article>
</section>
</div>
</div>
diff --git a/utils/test/reporting/img/storperf.jpg b/utils/test/reporting/img/storperf.jpg Binary files differnew file mode 100644 index 000000000..37492e69e --- /dev/null +++ b/utils/test/reporting/img/storperf.jpg diff --git a/utils/test/reporting/pages/angular.sh b/utils/test/reporting/pages/angular.sh new file mode 100755 index 000000000..a7f167516 --- /dev/null +++ b/utils/test/reporting/pages/angular.sh @@ -0,0 +1,10 @@ +: ${SERVER_URL:='http://testresults.opnfv.org/reporting/api'} + +echo "var BASE_URL = 'http://${SERVER_URL}/landing-page'" > app/scripts/app.config.js + +apt-get install -y nodejs +apt-get install -y npm +npm install +npm install -g grunt bower +bower install --allow-root +grunt build diff --git a/utils/test/reporting/pages/app/images/green.png b/utils/test/reporting/pages/app/images/green.png Binary files differnew file mode 100644 index 000000000..57fc59927 --- /dev/null +++ b/utils/test/reporting/pages/app/images/green.png diff --git a/utils/test/reporting/pages/app/images/green@2x.png b/utils/test/reporting/pages/app/images/green@2x.png Binary files differnew file mode 100644 index 000000000..3bda5beb6 --- /dev/null +++ b/utils/test/reporting/pages/app/images/green@2x.png diff --git a/utils/test/reporting/pages/app/index.html b/utils/test/reporting/pages/app/index.html index 7673a4cc2..1159c2176 100644 --- a/utils/test/reporting/pages/app/index.html +++ b/utils/test/reporting/pages/app/index.html @@ -1,6 +1,7 @@ <!doctype html> <html ng-app="opnfvApp"> - <head> + +<head> <meta charset="utf-8"> <title>OPNFV-DASHBOARD EXAMPLE</title> <meta name="description" content=""> @@ -13,17 +14,22 @@ <link rel="stylesheet" href="bower_components/chosen/chosen.css" /> <link rel="stylesheet" href="bower_components/selectize/dist/css/selectize.css" /> <link rel="stylesheet" href="bower_components/components-font-awesome/css/font-awesome.css" /> + <link rel="stylesheet" href="bower_components/angular-tooltips/dist/angular-tooltips.min.css" /> + <link rel="stylesheet" href="bower_components/animate.css/animate.css" /> + <link rel="stylesheet" href="bower_components/ng-dialog/css/ngDialog.css" /> + <link rel="stylesheet" href="bower_components/ng-dialog/css/ngDialog-theme-default.css" /> + <link rel="stylesheet" href="bower_components/inspiniacss/style.css" /> <!-- endbower --> <!-- endbuild --> <!-- build:css(.tmp) styles/style.css --> - <!--<link rel="stylesheet" href="styles/main.css">--> - <link rel="stylesheet" href="styles/animate.css"> - <link rel="stylesheet" href="styles/style.css"> + <link rel="stylesheet" href="styles/custome.css"> + <!-- endbuild --> - </head> - <body class="{{$state.current.data.specialClass}}" id="page-top"> +</head> + +<body class="{{$state.current.data.specialClass}}" id="page-top"> <!--[if lte IE 8]> <p class="browsehappy">You are using an <strong>outdated</strong> browser. Please <a href="http://browsehappy.com/">upgrade your browser</a> to improve your experience.</p> <![endif]--> @@ -31,7 +37,7 @@ <!-- Add your site or application content here --> <div ui-view></div> <!-- Google Analytics: change UA-XXXXX-X to be your site's ID --> - <!--<script> + <!--<script> !function(A,n,g,u,l,a,r){A.GoogleAnalyticsObject=l,A[l]=A[l]||function(){ (A[l].q=A[l].q||[]).push(arguments)},A[l].l=+new Date,a=n.createElement(g), r=n.getElementsByTagName(g)[0],a.src=u,r.parentNode.insertBefore(a,r) @@ -59,17 +65,27 @@ <script src="bower_components/microplugin/src/microplugin.js"></script> <script src="bower_components/selectize/dist/js/selectize.js"></script> <script src="bower_components/angular-selectize2/dist/angular-selectize.js"></script> + <script src="bower_components/angular-tooltips/dist/angular-tooltips.min.js"></script> + <script src="bower_components/jQuery-rwdImageMaps/jquery.rwdImageMaps.min.js"></script> + <script src="bower_components/ng-dialog/js/ngDialog.js"></script> <!-- endbower --> <!-- endbuild --> - <!-- build:js({.tmp,app}) scripts/scripts.js --> - <script src="scripts/app.js"></script> - <!--<script src="scripts/controllers/main.js"></script>--> - <script src="scripts/config.router.js"></script> - <script src="scripts/controllers/table.controller.js"></script> - <script src="scripts/config.js"></script> - <script src="scripts/directives/mydirective.js"></script> - <script src="scripts/factory/table.factory.js"></script> - <!-- endbuild --> + <!-- build:js({.tmp,app}) scripts/scripts.js --> + <script src="scripts/app.js"></script> + <!--<script src="scripts/controllers/main.js"></script>--> + <script src="scripts/config.router.js"></script> + <script src="scripts/controllers/table.controller.js"></script> + <script src="scripts/config.js"></script> + <script src="scripts/factory/table.factory.js"></script> + <script src="scripts/controllers/case.controller.js"></script> + <script src="scripts/controllers/auth.controller.js"></script> + <script src="scripts/controllers/admin.controller.js"></script> + <script src="scripts/controllers/main.controller.js"></script> + <script src="scripts/app.config.js"></script> + <script src="scripts/controllers/testvisual.controller.js"></script> + + <!-- endbuild --> </body> -</html> + +</html>
\ No newline at end of file diff --git a/modules/opnfv/installer_adapters/daisy/__init__.py b/utils/test/reporting/pages/app/scripts/app.config.js index e69de29bb..e69de29bb 100644 --- a/modules/opnfv/installer_adapters/daisy/__init__.py +++ b/utils/test/reporting/pages/app/scripts/app.config.js diff --git a/utils/test/reporting/pages/app/scripts/app.js b/utils/test/reporting/pages/app/scripts/app.js index 6e99ce3d7..d06019c55 100644 --- a/utils/test/reporting/pages/app/scripts/app.js +++ b/utils/test/reporting/pages/app/scripts/app.js @@ -9,12 +9,13 @@ * Main module of the application. */ angular - .module('opnfvApp', [ - 'ngAnimate', - 'ui.router', - 'oc.lazyLoad', - 'ui.bootstrap', - 'ngResource', - 'selectize' + .module('opnfvApp', [ + 'ngAnimate', + 'ui.router', + 'oc.lazyLoad', + 'ui.bootstrap', + 'ngResource', + 'selectize', + '720kb.tooltips' - ]); + ]);
\ No newline at end of file diff --git a/utils/test/reporting/pages/app/scripts/config.js b/utils/test/reporting/pages/app/scripts/config.js index 838460a38..1010169d3 100644 --- a/utils/test/reporting/pages/app/scripts/config.js +++ b/utils/test/reporting/pages/app/scripts/config.js @@ -7,8 +7,13 @@ * Main config file of the application. */ angular - .module('opnfvApp').config(function () { + .module('opnfvApp').config(['$httpProvider', '$qProvider', function($httpProvider, $qProvider) { - } + $httpProvider.defaults.useXDomain = true; + delete $httpProvider.defaults.headers.common['X-Requested-With']; - ) + $qProvider.errorOnUnhandledRejections(false); + + } + + ]);
\ No newline at end of file diff --git a/utils/test/reporting/pages/app/scripts/config.router.js b/utils/test/reporting/pages/app/scripts/config.router.js index 641ea6a74..d38ad7507 100644 --- a/utils/test/reporting/pages/app/scripts/config.router.js +++ b/utils/test/reporting/pages/app/scripts/config.router.js @@ -23,7 +23,7 @@ angular.module('opnfvApp') $stateProvider .state('landingpage', { url: "/landingpage", - //controller: 'MainCtrl', + controller: 'MainController', templateUrl: "views/main.html", data: { pageTitle: '首页', specialClass: 'landing-page' }, resolve: { diff --git a/utils/test/reporting/pages/app/scripts/controllers/main.controller.js b/utils/test/reporting/pages/app/scripts/controllers/main.controller.js new file mode 100644 index 000000000..2054dc2dd --- /dev/null +++ b/utils/test/reporting/pages/app/scripts/controllers/main.controller.js @@ -0,0 +1,32 @@ +'use strict'; + +/** + * @ngdoc function + * @name opnfvdashBoardAngularApp.controller:MainPageController + * @description + * # TableController + * Controller of the opnfvdashBoardAngularApp + */ +angular.module('opnfvApp') + .controller('MainController', ['$scope', '$state', '$stateParams', function($scope, $state, $stateParams) { + + init(); + + function init() { + $scope.goTest = goTest; + $scope.goLogin = goLogin; + + } + + function goTest() { + $state.go("select.selectTestCase"); + } + + function goLogin() { + $state.go("login"); + } + + + + + }]);
\ No newline at end of file diff --git a/utils/test/reporting/pages/app/scripts/controllers/table.controller.js b/utils/test/reporting/pages/app/scripts/controllers/table.controller.js index 8ca1e474c..0f3a17a03 100644 --- a/utils/test/reporting/pages/app/scripts/controllers/table.controller.js +++ b/utils/test/reporting/pages/app/scripts/controllers/table.controller.js @@ -8,255 +8,131 @@ * Controller of the opnfvdashBoardAngularApp */ angular.module('opnfvApp') - .controller('TableController', ['$scope', '$state', '$stateParams', 'TableFactory', function ($scope, $state, $stateParams, TableFactory) { + .controller('TableController', ['$scope', '$state', '$stateParams', '$http', 'TableFactory', function($scope, $state, $stateParams, $http, TableFactory) { $scope.filterlist = []; $scope.selection = []; - $scope.statusList = ["Success", "Warning", "Danger"]; - $scope.projectList = ["Deployment", "Functest", "Yardstick"]; - $scope.installerList = ["apex", "compass", "fuel", "joid"]; - $scope.versionlist = ["Colorado", "Master"]; - $scope.loopci = ["Daily", "Weekly", "Monthly"]; - $scope.time = ["10 days", "1 Month"]; + $scope.statusList = []; + $scope.projectList = []; + $scope.installerList = []; + $scope.versionlist = []; + $scope.loopci = []; + $scope.time = []; $scope.tableDataAll = {}; $scope.tableInfoAll = {}; + $scope.scenario = {}; + $scope.VersionConfig = { + create: true, + valueField: 'title', + labelField: 'title', + delimiter: '|', + maxItems: 1, + placeholder: 'Version', + onChange: function(value) { + checkElementArrayValue($scope.selection, $scope.VersionOption); + $scope.selection.push(value); + // console.log($scope.selection); + getScenarioData(); + } + } - $scope.scenario = - { - "scenarios": { - "os-nosdn-kvm-noha": { - "status": "Success", - "installers": { - "apex": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS", - - - }, - { - "project": "Functest", - "score": "null", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "score": "13/14", - "status": "SUCCESS" - } - ], - "compass": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Functest", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "score": "13/14", - "status": "SUCCESS" - } - ], - "fuel": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Functest", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "score": "13/14", - "status": "SUCCESS" - } - ], - "joid": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Functest", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "score": "13/14", - "status": "SUCCESS" - } - ] - } - }, - "os-nosdn-ovs-ha": { - "status": "Danger", - "installers": { - "apex": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS", - - - }, - { - "project": "Functest", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "score": "13/14", - "status": "SUCCESS" - } - ], - "compass": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Functest", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "score": "13/14", - "status": "SUCCESS" - } - ], - "fuel": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Functest", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "score": "13/14", - "status": "SUCCESS" - } - ], - "joid": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Functest", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "score": "13/14", - "status": "SUCCESS" - } - ] - } - }, - "os-nosdn-ovs-noha": { - "status": "Warning", - "installers": { - "apex": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS", - - - }, - { - "project": "Functest", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "score": "13/14", - "status": "SUCCESS" - } - ], - "compass": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Functest", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "score": "13/14", - "status": "SUCCESS" - } - ], - "fuel": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Functest", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "score": "13/14", - "status": "SUCCESS" - } - ], - "joid": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Functest", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "score": "13/14", - "status": "SUCCESS" - } - ] - } - } + $scope.LoopConfig = { + create: true, + valueField: 'title', + labelField: 'title', + delimiter: '|', + maxItems: 1, + placeholder: 'Loop', + onChange: function(value) { + checkElementArrayValue($scope.selection, $scope.LoopOption); + $scope.selection.push(value); + // console.log($scope.selection); + getScenarioData(); + + } + } + + $scope.TimeConfig = { + create: true, + valueField: 'title', + labelField: 'title', + delimiter: '|', + maxItems: 1, + placeholder: 'Time', + onChange: function(value) { + checkElementArrayValue($scope.selection, $scope.TimeOption); + $scope.selection.push(value); + // console.log($scope.selection) + getScenarioData(); + + + } + } + + + init(); + + function init() { + $scope.toggleSelection = toggleSelection; + getScenarioData(); + // radioSetting(); + getFilters(); + } + + function getFilters() { + TableFactory.getFilter().get({ + + + }).$promise.then(function(response) { + if (response != null) { + $scope.statusList = response.filters.status; + $scope.projectList = response.filters.projects; + $scope.installerList = response.filters.installers; + $scope.versionlist = response.filters.version; + $scope.loopci = response.filters.loops; + $scope.time = response.filters.time; + + $scope.statusListString = $scope.statusList.toString(); + $scope.projectListString = $scope.projectList.toString(); + $scope.installerListString = $scope.installerList.toString(); + $scope.VersionSelected = $scope.versionlist[1]; + $scope.LoopCiSelected = $scope.loopci[0]; + $scope.TimeSelected = $scope.time[0]; + radioSetting($scope.versionlist, $scope.loopci, $scope.time); + + } else { + alert("网络错误"); } + }) + } + + function getScenarioData() { + + var utl = BASE_URL + '/scenarios'; + var data = { + 'status': ['success', 'danger', 'warning'], + 'projects': ['functest', 'yardstick'], + 'installers': ['apex', 'compass', 'fuel', 'joid'], + 'version': $scope.VersionSelected, + 'loops': $scope.LoopCiSelected, + 'time': $scope.TimeSelected }; + var config = { + headers: { + 'Content-Type': 'application/x-www-form-urlencoded;charset=utf-8;' + } + } + $http.post(utl, data, config).then(function(response) { + if (response.status == 200) { + $scope.scenario = response.data; + constructJson(); + } + }) + } - // var headData = Object.keys($scope.scenario.scenarios.os_nosdn_kvm_noha.installers); - // $scope.headData = headData; - //construct json + //construct json function constructJson() { var colspan; @@ -267,19 +143,22 @@ angular.module('opnfvApp') for (var item in $scope.scenario.scenarios) { - - - - var headData = Object.keys($scope.scenario.scenarios[item].installers); + var headData = Object.keys($scope.scenario.scenarios[item].installers).sort(); var scenarioStatus = $scope.scenario.scenarios[item].status; - + var scenarioStatusDisplay; + if (scenarioStatus == "success") { + scenarioStatusDisplay = "navy"; + } else if (scenarioStatus == "danger") { + scenarioStatusDisplay = "danger"; + } else if (scenarioStatus == "warning") { + scenarioStatusDisplay = "warning"; + } InstallerData = headData; var projectData = []; var datadisplay = []; var projects = []; - for (var j = 0; j < headData.length; j++) { projectData.push($scope.scenario.scenarios[item].installers[headData[j]]); @@ -289,9 +168,30 @@ angular.module('opnfvApp') for (var k = 0; k < projectData[j].length; k++) { projects.push(projectData[j][k].project); var temArray = []; - temArray.push(projectData[j][k].score); - temArray.push(projectData[j][k].project); - temArray.push(headData[j]); + if (projectData[j][k].score == null) { + temArray.push("null"); + temArray.push(projectData[j][k].project); + temArray.push(headData[j]); + } else { + temArray.push(projectData[j][k].score); + temArray.push(projectData[j][k].project); + temArray.push(headData[j]); + } + + + if (projectData[j][k].status == "platinium") { + temArray.push("primary"); + temArray.push("P"); + } else if (projectData[j][k].status == "gold") { + temArray.push("danger"); + temArray.push("G"); + } else if (projectData[j][k].status == "silver") { + temArray.push("warning"); + temArray.push("S"); + } else if (projectData[j][k].status == null) { + temArray.push("null"); + } + datadisplay.push(temArray); } @@ -301,13 +201,21 @@ angular.module('opnfvApp') colspan = projects.length / headData.length; var tabledata = { - scenarioName: item, Installer: InstallerData, projectData: projectData, projects: projects, - datadisplay: datadisplay, colspan: colspan, status: scenarioStatus + scenarioName: item, + Installer: InstallerData, + projectData: projectData, + projects: projects, + datadisplay: datadisplay, + colspan: colspan, + status: scenarioStatus, + statusDisplay: scenarioStatusDisplay }; JSON.stringify(tabledata); $scope.tableDataAll.scenario.push(tabledata); + // console.log(tabledata); + } @@ -315,15 +223,13 @@ angular.module('opnfvApp') var tempHeadData = []; - - for (var i = 0; i < InstallerData.length; i++) { for (var j = 0; j < colspan; j++) { tempHeadData.push(InstallerData[i]); } } - console.log(tempHeadData); + //console.log(tempHeadData); var projectsInfoAll = []; @@ -334,13 +240,14 @@ angular.module('opnfvApp') projectsInfoAll.push(tempA); } - console.log(projectsInfoAll); + //console.log(projectsInfoAll); $scope.tableDataAll["colspan"] = colspan; $scope.tableDataAll["Installer"] = InstallerData; $scope.tableDataAll["Projects"] = projectsInfoAll; - console.log($scope.tableDataAll); + // console.log($scope.tableDataAll); + $scope.colspan = $scope.tableDataAll.colspan; } @@ -353,58 +260,11 @@ angular.module('opnfvApp') return size; } - init(); - function init() { - $scope.toggleSelection = toggleSelection; - - constructJson(); - - } - - // $scope.test=false; + $scope.colspan = $scope.tableDataAll.colspan; + // console.log($scope.colspan); - var statusListString = $scope.statusList.toString(); - var projectListString = $scope.projectList.toString(); - var installerListString = $scope.installerList.toString(); - - $scope.colspan=$scope.tableDataAll.colspan; - //filter function - function filterData() { - - - $scope.selectInstallers = []; - $scope.selectProjects = []; - $scope.selectStatus = []; - for (var i = 0; i < $scope.selection.length; i++) { - if (statusListString.indexOf($scope.selection[i]) > -1) { - $scope.selectStatus.push($scope.selection[i]); - } - if (projectListString.indexOf($scope.selection[i]) > -1) { - $scope.selectProjects.push($scope.selection[i]); - } - if (installerListString.indexOf($scope.selection[i]) > -1) { - $scope.selectInstallers.push($scope.selection[i]); - } - } - - $scope.colspan=$scope.selectProjects.length; - //when some selection is empty, we set it full - if($scope.selectInstallers.length==0){ - $scope.selectInstallers=$scope.installerList; - - } - if($scope.selectProjects.length==0){ - $scope.selectProjects=$scope.projectList; - $scope.colspan=$scope.tableDataAll.colspan; - } - if($scope.selectStatus.length==0){ - $scope.selectStatus=$scope.statusList - } - } - - - //find all same element index + //find all same element index function getSameElementIndex(array, element) { var indices = []; var idx = array.indexOf(element); @@ -424,64 +284,31 @@ angular.module('opnfvApp') } - - $scope.VersionOption = [ - { title: 'Colorado' }, - { title: 'Master' } - ]; - $scope.VersionConfig = { - create: true, - valueField: 'title', - labelField: 'title', - delimiter: '|', - maxItems: 1, - placeholder: 'Version', - onChange: function (value) { - checkElementArrayValue($scope.selection, $scope.VersionOption); - $scope.selection.push(value); - // console.log($scope.selection); - + function radioSetting(array1, array2, array3) { + var tempVersion = []; + var tempLoop = []; + var tempTime = []; + for (var i = 0; i < array1.length; i++) { + var temp = { + title: array1[i] + }; + tempVersion.push(temp); } - - } - - $scope.LoopOption = [ - { title: 'Daily' }, - { title: 'Weekly' }, - { title: 'Monthly' } - ]; - $scope.LoopConfig = { - create: true, - valueField: 'title', - labelField: 'title', - delimiter: '|', - maxItems: 1, - placeholder: 'Loop', - onChange: function (value) { - checkElementArrayValue($scope.selection, $scope.LoopOption); - $scope.selection.push(value); - // console.log($scope.selection); - + for (var i = 0; i < array2.length; i++) { + var temp = { + title: array2[i] + }; + tempLoop.push(temp); } - } - - $scope.TimeOption = [ - { title: '10 days' }, - { title: '1 month' } - ]; - $scope.TimeConfig = { - create: true, - valueField: 'title', - labelField: 'title', - delimiter: '|', - maxItems: 1, - placeholder: 'Time', - onChange: function (value) { - checkElementArrayValue($scope.selection, $scope.TimeOption); - $scope.selection.push(value); - // console.log($scope.selection) - + for (var i = 0; i < array3.length; i++) { + var temp = { + title: array3[i] + }; + tempTime.push(temp); } + $scope.VersionOption = tempVersion; + $scope.LoopOption = tempLoop; + $scope.TimeOption = tempTime; } //remove element in the array @@ -508,13 +335,51 @@ angular.module('opnfvApp') if (idx > -1) { $scope.selection.splice(idx, 1); - } - else { + filterData($scope.selection) + } else { $scope.selection.push(status); + filterData($scope.selection) } - console.log($scope.selection); - filterData(); + // console.log($scope.selection); } - }]); + //filter function + function filterData(selection) { + + $scope.selectInstallers = []; + $scope.selectProjects = []; + $scope.selectStatus = []; + for (var i = 0; i < selection.length; i++) { + if ($scope.statusListString.indexOf(selection[i]) > -1) { + $scope.selectStatus.push(selection[i]); + } + if ($scope.projectListString.indexOf(selection[i]) > -1) { + $scope.selectProjects.push(selection[i]); + } + if ($scope.installerListString.indexOf(selection[i]) > -1) { + $scope.selectInstallers.push(selection[i]); + } + } + + $scope.colspan = $scope.selectProjects.length; + //when some selection is empty, we set it full + if ($scope.selectInstallers.length == 0) { + $scope.selectInstallers = $scope.installerList; + + } + if ($scope.selectProjects.length == 0) { + $scope.selectProjects = $scope.projectList; + $scope.colspan = $scope.tableDataAll.colspan; + } + if ($scope.selectStatus.length == 0) { + $scope.selectStatus = $scope.statusList + } + + // console.log($scope.selectStatus); + // console.log($scope.selectProjects); + + } + + + }]);
\ No newline at end of file diff --git a/utils/test/reporting/pages/app/scripts/data.json b/utils/test/reporting/pages/app/scripts/data.json deleted file mode 100644 index a15fdf37e..000000000 --- a/utils/test/reporting/pages/app/scripts/data.json +++ /dev/null @@ -1,76 +0,0 @@ - -{"scenarios": { - "os-nosdn-kvm-noha": { - "status": "Success", - "installers": { - "apex": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Functest", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "socre": "13/14", - "status": "SUCCESS" - } - ], - "compass": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Functest", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "socre": "13/14", - "status": "SUCCESS" - } - ], - "fuel": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Functest", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "socre": "13/14", - "status": "SUCCESS" - } - ], - "joid": [ - { - "project": "Deployment", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Functest", - "score": "13/14", - "status": "SUCCESS" - }, - { - "project": "Yardstick", - "socre": "13/14", - "status": "SUCCESS" - } - ] - } - } -}} diff --git a/utils/test/reporting/pages/app/scripts/factory/table.factory.js b/utils/test/reporting/pages/app/scripts/factory/table.factory.js index 22443221e..a2e2aeff0 100644 --- a/utils/test/reporting/pages/app/scripts/factory/table.factory.js +++ b/utils/test/reporting/pages/app/scripts/factory/table.factory.js @@ -4,17 +4,23 @@ * get data factory */ angular.module('opnfvApp') - .factory('TableFactory', function ($resource, $rootScope) { - // var baseUrl = base_Url; + .factory('TableFactory', function($resource, $rootScope) { return { - getFilter: function () { - return $resource(baseUrl + '/', {}, { - 'post': { - method: 'POST', + getFilter: function() { + return $resource(BASE_URL + '/filters', {}, { + 'get': { + method: 'GET', } }); + }, + getScenario: function() { + return $resource(BASE_URL + '/scenarios', {}, { + 'post': { + method: 'POST', + } + }) } }; - }); + });
\ No newline at end of file diff --git a/utils/test/reporting/pages/app/styles/custome.css b/utils/test/reporting/pages/app/styles/custome.css index dadc68a03..b498cf04d 100644 --- a/utils/test/reporting/pages/app/styles/custome.css +++ b/utils/test/reporting/pages/app/styles/custome.css @@ -1,8 +1,8 @@ .container-tablesize { - margin: auto 5%; + margin: auto 5%; } -.btn-outline { +.btn-outline { border-color: white; } @@ -29,6 +29,68 @@ } .myhr { - border:0.5px dashed #e7eaec; - border-top:1px;margin-bottom: 3px; -}
\ No newline at end of file + border: 0.5px dashed #e7eaec; + border-top: 1px; + margin-bottom: 3px; +} + +td.null { + background-color: #e7eaec; + color: #e7eaec; +} + +input[type="radio"][disabled], +input[type="checkbox"][disabled], +input[type="radio"].disabled, +input[type="checkbox"].disabled, +fieldset[disabled] input[type="radio"], +fieldset[disabled] input[type="checkbox"] { + cursor: not-allowed; + display: none; +} + +body, +html { + margin: 0; + padding: 0; + min-height: 100%; +} + + +/*img[usemap] { + border: none; + height: auto; + max-width: 100%; + width: auto; +}*/ + +.popup { + position: absolute; + display: none; + /*background-color: #dd8;*/ + border-radius: 5px 5px 5px 5px; + background-color: #f3f3f4; + opacity: 0.9; +} + + +/* +body { + height: 1200px; +} + +html { + min-height: 100%; +}*/ + + +/*html, +body { + height: 100%; +} + +#page-wrapper { + position: inherit; + margin: 0 0 0 220px; + min-height: 773px; +}*/
\ No newline at end of file diff --git a/utils/test/reporting/pages/app/styles/fonts/glyphicons-halflings-regular.svg b/utils/test/reporting/pages/app/styles/fonts/glyphicons-halflings-regular.svg index 187805af6..94fb5490a 100644 --- a/utils/test/reporting/pages/app/styles/fonts/glyphicons-halflings-regular.svg +++ b/utils/test/reporting/pages/app/styles/fonts/glyphicons-halflings-regular.svg @@ -285,4 +285,4 @@ <glyph unicode="🔑" d="M250 1200h600q21 0 35.5 -14.5t14.5 -35.5v-400q0 -21 -14.5 -35.5t-35.5 -14.5h-150v-500l-255 -178q-19 -9 -32 -1t-13 29v650h-150q-21 0 -35.5 14.5t-14.5 35.5v400q0 21 14.5 35.5t35.5 14.5zM400 1100v-100h300v100h-300z" /> <glyph unicode="🚪" d="M250 1200h750q39 0 69.5 -40.5t30.5 -84.5v-933l-700 -117v950l600 125h-700v-1000h-100v1025q0 23 15.5 49t34.5 26zM500 525v-100l100 20v100z" /> </font> -</defs></svg> +</defs></svg>
\ No newline at end of file diff --git a/utils/test/reporting/pages/app/views/commons/table.html b/utils/test/reporting/pages/app/views/commons/table.html index ed9300edd..f504bd76b 100644 --- a/utils/test/reporting/pages/app/views/commons/table.html +++ b/utils/test/reporting/pages/app/views/commons/table.html @@ -29,81 +29,85 @@ <div class=" col-md-12" data-toggle="buttons" aria-pressed="false"> <label> Status </label> - <label class="btn btn-outline btn-success btn-sm" style="height:25px; margin-right: 5px;" ng-repeat="status in statusList" - value={{status}} ng-checked="selection.indexOf(status)>-1" ng-click="toggleSelection(status)"> + <label class="btn btn-outline btn-success btn-sm" style="height:25px; margin-right: 5px;" ng-repeat="status in statusList" value={{status}} ng-checked="selection.indexOf(status)>-1" ng-click="toggleSelection(status)"> <input type="checkbox" disabled="disabled" > {{status}} + </label> </div> - <hr class="myhr"> + <hr class="myhr"> <div class=" col-md-12" data-toggle="buttons"> - <label> Projects </label> - <label class="btn btn-outline btn-success btn-sm " style="height:25px;margin-right: 5px;" ng-repeat="project in projectList" - value={{project}} ng-checked="selection.indexOf(project)>-1" ng-click="toggleSelection(project)"> + <label> Projects </label> + <label class="btn btn-outline btn-success btn-sm " style="height:25px;margin-right: 5px;" ng-repeat="project in projectList" value={{project}} ng-checked="selection.indexOf(project)>-1" ng-click="toggleSelection(project)"> <input type="checkbox" disabled="disabled"> {{project}} </label> </div> - <hr class="myhr"> + <hr class="myhr"> <div class=" col-md-12" data-toggle="buttons"> <label> Installers </label> - <label class="btn btn-outline btn-success btn-sm" style="height:25px;margin-right: 5px;" ng-repeat="installer in installerList" - value={{installer}} ng-checked="selection.indexOf(installer)" ng-click="toggleSelection(installer)"> + <label class="btn btn-outline btn-success btn-sm" style="height:25px;margin-right: 5px;" ng-repeat="installer in installerList" value={{installer}} ng-checked="selection.indexOf(installer)>-1" ng-click="toggleSelection(installer)"> <input type="checkbox" disabled="disabled"> {{installer}} </label> - </div> + </div> - <hr style="border:0.5px dashed #e7eaec;border-top:1px;margin-bottom:10px;"> + <hr style="border:0.5px dashed #e7eaec;border-top:1px;margin-bottom:10px;"> - <div class=" col-md-1" style="margin-top:5px;margin-right: 5px;"> - <selectize options="VersionOption" ng-model="VersionSelected" config="VersionConfig"></selectize> + <div class=" col-md-1" style="margin-top:5px;margin-right: 5px;"> + <selectize options="VersionOption" ng-model="VersionSelected" config="VersionConfig"></selectize> - </div> + </div> - <div class=" col-md-1" style="margin-top:5px;margin-left: 5px;margin-right: 5px;"> - <selectize options="LoopOption" ng-model="LoopCiSelected" config="LoopConfig"></selectize> + <div class=" col-md-1" style="margin-top:5px;margin-right: 5px;"> + <selectize options="LoopOption" ng-model="LoopCiSelected" config="LoopConfig"></selectize> - </div> + </div> - <div class=" col-md-1" style="margin-top:5px;margin-left: 5px;margin-right: 5px;"> - <selectize options="TimeOption" ng-model="TimeSelected" config="TimeConfig"></selectize> + <div class=" col-md-1" style="margin-top:5px;margin-right: 5px;"> + <selectize options="TimeOption" ng-model="TimeSelected" config="TimeConfig"></selectize> + </div> </div> + <div class="table-responsive"> + + <table class="table table-bordered" id="table" ng-model="tableDataAll"> + <thead class="thead"> + <tr> + <th>Scenario </th> + <th colspan={{colspan}} ng-show="selectInstallers.indexOf(key)!=-1" value={{key}} ng-repeat="key in tableDataAll.Installer"><a href="notfound.html">{{key}}</a> </th> + </tr> + <tr> -</div> + <td></td> + <td ng-show="selectProjects.indexOf(project[0])!=-1 && selectInstallers.indexOf(project[1])!=-1" ng-repeat="project in tableDataAll.Projects track by $index" data={{project[1]}} value={{project[0]}}>{{project[0]}}</td> -<table class="table table-bordered" id="table" ng-model="tableDataAll"> - <thead class="thead"> - <tr > - <th>Scenario </th> - <th colspan={{colspan}} ng-show="selectInstallers.indexOf(key)!=-1" value={{key}} ng-repeat="key in tableDataAll.Installer"><a href="notfound.html">{{key}}</a> </th> - </tr> + </tr> + </thead> + <tbody class="tbody"> + <tr ng-repeat="scenario in tableDataAll.scenario" ng-show="selectStatus.indexOf(scenario.status)!=-1"> - <tr> + <td nowrap="nowrap" data={{scenario.status}}><span class="fa fa-circle text-{{scenario.statusDisplay}}"></span> <a href="notfound.html">{{scenario.scenarioName}}</a> </td> - <td align="justify"></td> - <td align="justify" ng-show="selectProjects.indexOf(project[0])!=-1 && selectInstallers.indexOf(project[1])!=-1" ng-repeat="project in tableDataAll.Projects track by $index" data={{project[1]}} value={{project[0]}}>{{project[0]}}</td> - </tr> - </thead> - <tbody class="tbody"> - <tr ng-repeat="scenario in tableDataAll.scenario" ng-show="selectStatus.indexOf(scenario.status)!=-1" > + <!--<td style="background-color:#e7eaec" align="justify" ng-if="data[0]=='Not Support'" ng-repeat="data in scenario.datadisplay track by $index" data={{data[1]}} value={{data[2]}}></td>--> - <td align="justify" data={{scenario.status}}><span class="fa fa-circle text-warning"><a href="notfound.html">{{scenario.scenarioName}}</a></span> </td> - <td align="justify" ng-show="selectInstallers.indexOf(data[2])!=-1 && selectProjects.indexOf(data[1])!=-1" ng-repeat="data in scenario.datadisplay track by $index" data={{data[1]}} value={{data[2]}} ><span class="label label-danger">D<a href="notfound.html"></a></span> {{data[0]}}</td> - </tr> - </tbody> -</table> + <td nowrap="nowrap" ng-show="selectInstallers.indexOf(data[2])!=-1 && selectProjects.indexOf(data[1])!=-1" ng-repeat="data in scenario.datadisplay track by $index" data={{data[1]}} value={{data[2]}} class={{data[0]}}> + <span class="label label-{{data[3]}}">{{data[4]}}</a></span> {{data[0]}}</td> - <div class="pull-right"> - <span class="label label-danger">D</span>danger<span style="padding-left:20px"></span> - <span class="label label-primary">S</span><span>success</span><span style="padding-left:20px"></span> - <span class="label label-warning">W</span><span>warning</span> + </tr> + </tbody> + </table> + </div> + + <div class="pull-right" style="margin-top: 5px"> + <span class="label label-danger">G</span>gold<span style="padding-left:20px"></span> + <span class="label label-primary">P</span><span>platinium</span><span style="padding-left:20px"></span> + <span class="label label-warning">S</span><span>silver</span> </div> + </div> </div> </div> -</div> -</section> +</section>
\ No newline at end of file diff --git a/utils/test/reporting/pages/app/views/main.html b/utils/test/reporting/pages/app/views/main.html index 1e3fe9e5a..cca893713 100644 --- a/utils/test/reporting/pages/app/views/main.html +++ b/utils/test/reporting/pages/app/views/main.html @@ -1,186 +1,171 @@ - <div class="navbar-wrapper"> - <nav class="navbar navbar-default navbar-fixed-top" role="navigation"> - <div class="container"> - <div class="navbar-header page-scroll"> - <button type="button" class="navbar-toggle collapsed" data-toggle="collapse" data-target="#navbar" aria-expanded="false" - aria-controls="navbar"> + <nav class="navbar navbar-default navbar-fixed-top" role="navigation"> + <div class="container"> + <div class="navbar-header page-scroll"> + <button type="button" class="navbar-toggle collapsed" data-toggle="collapse" data-target="#navbar" aria-expanded="false" aria-controls="navbar"> <span class="sr-only">Toggle navigation</span> <span class="icon-bar"></span> <span class="icon-bar"></span> <span class="icon-bar"></span> </button> - <a class="navbar-brand" href="index.html">OPNFV-DASHBOARD</a> - </div> - <div id="navbar" class="navbar-collapse collapse"> - <ul class="nav navbar-nav navbar-right"> - <li><a href="#page-top">Home</a></li> - <li><a href="#DashBoard">DashBoard</a></li> - <!--<li><a href="#team">Team</a></li> + <a class="navbar-brand" href="index.html">OPNFV-DASHBOARD</a> + </div> + <div class="navbar-collapse collapse"> + <ul class="nav navbar-nav navbar-right"> + <li><a href="#page-top">Home</a></li> + <li><a href="#DashBoard">DashBoard</a></li> + <li><a ui-sref="select.selectTestCase">TestCase</a></li> + <li><a ui-sref="login">Login</a></li> + <!--<li><a href="#team">Team</a></li> <li><a href="#testimonials">Testimonials</a></li> <li><a href="#pricing">Pricing</a></li> <li><a href="#contact">Contact</a></li>--> - </ul> - </div> - </div> - </nav> + </ul> + </div> + </div> + </nav> </div> <div id="inSlider" class="carousel carousel-fade" data-ride="carousel"> - <ol class="carousel-indicators"> - <!--<li data-target="#inSlider" data-slide-to="0" class="active"></li> + <ol class="carousel-indicators"> + <!--<li data-target="#inSlider" data-slide-to="0" class="active"></li> <li data-target="#inSlider" data-slide-to="1"></li>--> - </ol> - <div class="carousel-inner" role="listbox"> - <div class="item active"> - <div class="container"> - <div class="carousel-caption"> - <h1>OPNFV<br/> facilitates the development and evolution<br/> of NFV components across<br/> various open source ecosystems<br/> - </h1> - <!--<p>Lorem Ipsum is simply dummy text of the printing.</p> + </ol> + <div class="carousel-inner" role="listbox"> + <div class="item active"> + <div class="container"> + <div class="carousel-caption"> + <h1>OPNFV<br/> facilitates the development and evolution<br/> of NFV components across<br/> various open source ecosystems<br/> + </h1> + <!--<p>Lorem Ipsum is simply dummy text of the printing.</p> <p>--> - <a class="btn btn-lg btn-primary" href="#" role="button">READ MORE</a> - <!--<a class="caption-link" href="#" role="button">Inspinia Theme</a>--> - <!--</p>--> + <a class="btn btn-lg btn-primary" href="#" role="button">READ MORE</a> + <!--<a class="caption-link" href="#" role="button">Inspinia Theme</a>--> + <!--</p>--> + </div> + + </div> + <!-- Set background for slide in css --> + <div class="header-back one" style="background: url('images/header_one.jpg') 50% 0 no-repeat;"></div> + </div> - <!--<div class="carousel-image wow zoomIn"> - <img src="img/landing/laptop.png" alt="laptop"/> - </div>--> - </div> - <!-- Set background for slide in css --> - <div class="header-back one" style="background: url('images/header_one.jpg') 50% 0 no-repeat;"></div> </div> - <!--<div class="item"> - <div class="container"> - <div class="carousel-caption blank"> - <h1>We create meaningful <br/> interfaces that inspire.</h1> - <p>Cras justo odio, dapibus ac facilisis in, egestas eget quam.</p> - <p><a class="btn btn-lg btn-primary" href="#" role="button">Learn more</a></p> - </div> - </div>--> - <!-- Set background for slide in css --> - <!--<div class="header-back two"></div> - </div>--> - </div> - <!--<a class="left carousel-control" href="#inSlider" role="button" data-slide="prev"> - <span class="glyphicon glyphicon-chevron-left" aria-hidden="true"></span> - <span class="sr-only">Previous</span> - </a> - <a class="right carousel-control" href="#inSlider" role="button" data-slide="next"> - <span class="glyphicon glyphicon-chevron-right" aria-hidden="true"></span> - <span class="sr-only">Next</span> - </a>--> + </div> - <section id="DashBoard" class="container services"> - <div class="row"> +<section id="DashBoard" class="container services"> + <div class="row"> - <h1> - OPNFV’s goals are to: - </h1> - <div class="col-sm-3"> + <h1> + OPNFV’s goals are to: + </h1> + <div class="col-sm-3"> - <p>Develop an integrated and tested open source platform that can be used to build NFV functionality--accelerating - the introduction of new products and services</p> - <p><a class="navy-link" href="#" role="button">Details »</a></p> - </div> - <div class="col-sm-3"> + <p>Develop an integrated and tested open source platform that can be used to build NFV functionality--accelerating the introduction of new products and services</p> + <p><a class="navy-link" href="#" role="button">Details »</a></p> + </div> + <div class="col-sm-3"> - <p>Include participation of leading end users to validate that OPNFV meets the needs of user community</p> - <p><a class="navy-link" href="#" role="button">Details »</a></p> - </div> - <div class="col-sm-3"> + <p>Include participation of leading end users to validate that OPNFV meets the needs of user community</p> + <p><a class="navy-link" href="#" role="button">Details »</a></p> + </div> + <div class="col-sm-3"> - <p>Contribute to and participate in relevant open source projects that will be leveraged in the OPNFV platform; - ensuring consistency, performance and interoperability among open source components</p> - <p><a class="navy-link" href="#" role="button">Details »</a></p> - </div> - <div class="col-sm-3"> + <p>Contribute to and participate in relevant open source projects that will be leveraged in the OPNFV platform; ensuring consistency, performance and interoperability among open source components</p> + <p><a class="navy-link" href="#" role="button">Details »</a></p> + </div> + <div class="col-sm-3"> - <p>Establish an ecosystem for NFV solutions based on open standards and software to meet the needs of end users</p> - <p><a class="navy-link" href="#" role="button">Details »</a></p> - </div> - <div class="col-sm-3"> + <p>Establish an ecosystem for NFV solutions based on open standards and software to meet the needs of end users</p> + <p><a class="navy-link" href="#" role="button">Details »</a></p> + </div> + <div class="col-sm-3"> - <p>Promote OPNFV as the preferred platform and community for open source NFV</p> - <p><a class="navy-link" href="#" role="button">Details »</a></p> - </div> + <p>Promote OPNFV as the preferred platform and community for open source NFV</p> + <p><a class="navy-link" href="#" role="button">Details »</a></p> </div> - </section> + </div> +</section> <div ui-view></div> <section id="contact" class="gray-section contact" style="background-image: url(images/word_map.png)"> - <div class="container"> - <div class="row m-b-lg"> - <div class="col-lg-12 text-center"> - <div class="navy-line"></div> - <h1>Contact Us</h1> - </div> - </div> - <div class="row m-b-lg"> - <div class="col-lg-3 col-lg-offset-3"> - <address> + <div class="container"> + <div class="row m-b-lg"> + <div class="col-lg-12 text-center"> + <div class="navy-line"></div> + <h1>Contact Us</h1> + </div> + </div> + <div class="row m-b-lg"> + <div class="col-lg-3 col-lg-offset-3"> + <address> <strong><span class="navy">Press, Analyst, or Speaking Inquiries</span></strong><br/> pr@opnfv.org <br/> </address> - <address> + <address> <strong><span class="navy">OPNFV Events</span></strong><br/> events@opnfv.org <br/> </address> - <address> + <address> <strong><span class="navy">IT Support</span></strong><br/>opnfv-helpdesk@rt.linuxfoundation.org <br/> </address> - </div> + </div> - <div class="col-lg-4"> - <address> + <div class="col-lg-4"> + <address> <strong><span class="navy">To submit and track bugs related to OPNFV</span></strong><br/>Please visit https://jira.opnfv.org <br/> </address> - <address> + <address> <strong><span class="navy">Newsletter</span></strong><br/>Sign up for the OPNFV newsletter <br/> </address> - <address> + <address> <strong><span class="navy">Membership</span></strong><br/>Please visit the Join as a Member page <br/> </address> - </div> - </div> - <div class="row"> - <div class="col-lg-12 text-center"> - <img src="images/logo.png" /> + </div> + </div> + <div class="row"> + <div class="col-lg-12 text-center"> + <img src="images/logo.png" /> - </div> - </div> - <div class="row"> - <div class="col-lg-8 col-lg-offset-2 text-center m-t-lg m-b-lg"> - <p><strong>© 2016 Open Platform for NFV Project, Inc</strong><br/> A Linux Foundation Collaborative Project. All - Rights Reserved. Open Platform for NFV and OPNFV are trademarks of the Open Platform for NFV Project, Inc. Linux - Foundation is a registered trademark of The Linux Foundation. Linux is a registered trademark of Linus Torvalds. - Please see our terms of use, trademark policy, and privacy policy. - </p> - </div> + </div> + </div> + <div class="row"> + <div class="col-lg-8 col-lg-offset-2 text-center m-t-lg m-b-lg"> + <p><strong>© 2016 Open Platform for NFV Project, Inc</strong><br/> A Linux Foundation Collaborative Project. All Rights Reserved. Open Platform for NFV and OPNFV are trademarks of the Open Platform for NFV Project, Inc. Linux Foundation + is a registered trademark of The Linux Foundation. Linux is a registered trademark of Linus Torvalds. Please see our terms of use, trademark policy, and privacy policy. + </p> + </div> + </div> </div> - </div> </section> <script> + $(document).ready(function() { - $(document).ready(function () { + // $('body').scrollspy({ + // target: '.navbar-fixed-top', + // offset: 80 + // }); - $('body').scrollspy({ - target: '.navbar-fixed-top', - offset: 80 + //Page scrolling feature + $('a.page-scroll').bind('click', function(event) { + var link = $(this); + $('html, body').stop().animate({ + scrollTop: $(link.attr('href')).offset().top - 50 + }, 500); + event.preventDefault(); + $("#navbar").collapse('hide'); }); - // Page scrolling feature $('a.page-scroll').bind('click', function(event) { var link = $(this); $('html, body').stop().animate({ @@ -190,63 +175,56 @@ $("#navbar").collapse('hide'); }); - - console.log( $("selectVersion").val()); - }); - // $(".select2_demo_1").select2(); - // $(".select2_demo_2").select2(); - // $(".select2_demo_3").select2({ - // placeholder: "Version", - // allowClear: true - // }); - // $(".select2_demo_4").select2({ - // placeholder: "Period", - // allowClear: true - // }); - - var config = { - '.chosen-select' : {}, - '.chosen-select-deselect' : {allow_single_deselect:true}, - '.chosen-select-no-single' : {disable_search_threshold:10}, - '.chosen-select-no-results': {no_results_text:'Oops, nothing found!'}, - '.chosen-select-width' : {width:"95%"} - } - for (var selector in config) { - $(selector).chosen(config[selector]); - } + '.chosen-select': {}, + '.chosen-select-deselect': { + allow_single_deselect: true + }, + '.chosen-select-no-single': { + disable_search_threshold: 10 + }, + '.chosen-select-no-results': { + no_results_text: 'Oops, nothing found!' + }, + '.chosen-select-width': { + width: "95%" + } + } + for (var selector in config) { + $(selector).chosen(config[selector]); + } var cbpAnimatedHeader = (function() { var docElem = document.documentElement, - header = document.querySelector( '.navbar-default' ), - didScroll = false, - changeHeaderOn = 200; + header = document.querySelector('.navbar-default'), + didScroll = false, + changeHeaderOn = 200; + function init() { - window.addEventListener( 'scroll', function( event ) { - if( !didScroll ) { + window.addEventListener('scroll', function(event) { + if (!didScroll) { didScroll = true; - setTimeout( scrollPage, 250 ); + setTimeout(scrollPage, 250); } - }, false ); + }, false); } + function scrollPage() { var sy = scrollY(); - if ( sy >= changeHeaderOn ) { + if (sy >= changeHeaderOn) { $(header).addClass('navbar-scroll') - } - else { + } else { $(header).removeClass('navbar-scroll') } didScroll = false; } + function scrollY() { return window.pageYOffset || docElem.scrollTop; } init(); })(); - - -</script> +</script>
\ No newline at end of file diff --git a/utils/test/reporting/pages/bower.json b/utils/test/reporting/pages/bower.json index dd0996d18..bfc4df3d9 100644 --- a/utils/test/reporting/pages/bower.json +++ b/utils/test/reporting/pages/bower.json @@ -1,32 +1,47 @@ { - "name": "opnfv", - "version": "0.0.0", - "dependencies": { - "angular": "^1.4.0", - "bootstrap": "^3.2.0", - "angular-animate": "^1.4.0", - "jquery-slimscroll": "slimscroll#^1.3.8", - "metisMenu": "~2.0.2", - "chosen": "^1.6.2", - "oclazyload": "^1.0.9", - "angular-bootstrap": "~1.1.2", - "angular-ui-router": "~0.2.15", - "angular-resource": "^1.6.0", - "angular-selectize2": "^3.0.1", - "components-font-awesome": "^4.7.0" - }, - "devDependencies": { - "angular-mocks": "^1.4.0" - }, - "appPath": "app", - "moduleName": "opnfvApp", - "overrides": { - "bootstrap": { - "main": [ - "less/bootstrap.less", - "dist/css/bootstrap.css", - "dist/js/bootstrap.js" - ] + "name": "opnfv", + "version": "0.0.0", + "dependencies": { + "angular": "^1.4.0", + "bootstrap": "^3.2.0", + "angular-animate": "^1.4.0", + "jquery-slimscroll": "slimscroll#^1.3.8", + "metisMenu": "~2.0.2", + "chosen": "^1.6.2", + "oclazyload": "^1.0.9", + "angular-bootstrap": "~1.1.2", + "angular-ui-router": "~0.2.15", + "angular-resource": "^1.6.0", + "angular-selectize2": "^3.0.1", + "components-font-awesome": "^4.7.0", + "angular-tooltips": "^1.1.8", + "jQuery-rwdImageMaps": "*", + "animate.css": "^3.5.2", + "ng-dialog": "^1.0.0", + "inspiniacss": "^0.0.1" + }, + "devDependencies": { + "angular-mocks": "^1.4.0" + }, + "appPath": "app", + "moduleName": "opnfvApp", + "overrides": { + "bootstrap": { + "main": [ + "less/bootstrap.less", + "dist/css/bootstrap.css", + "dist/js/bootstrap.js" + ] + }, + "jQuery-rwdImageMaps": { + "main": [ + "jquery.rwdImageMaps.min.js" + ] + }, + "inspiniacss": { + "main": [ + "style.css" + ] + } } - } -} +}
\ No newline at end of file diff --git a/utils/test/reporting/pages/test/karma.conf.js b/utils/test/reporting/pages/test/karma.conf.js index 2b0f41cd3..5c2e79b9f 100644 --- a/utils/test/reporting/pages/test/karma.conf.js +++ b/utils/test/reporting/pages/test/karma.conf.js @@ -36,6 +36,7 @@ module.exports = function(config) { 'bower_components/microplugin/src/microplugin.js', 'bower_components/selectize/dist/js/selectize.js', 'bower_components/angular-selectize2/dist/angular-selectize.js', + 'bower_components/angular-tooltips/dist/angular-tooltips.min.js', 'bower_components/angular-mocks/angular-mocks.js', // endbower 'app/scripts/**/*.js', diff --git a/utils/test/reporting/reporting.yaml b/utils/test/reporting/reporting.yaml index fa9862615..81e976a28 100644 --- a/utils/test/reporting/reporting.yaml +++ b/utils/test/reporting/reporting.yaml @@ -2,13 +2,13 @@ general: installers: - apex - compass + - daisy - fuel - joid - - daisy versions: - master - - colorado + log: log_file: reporting.log log_level: ERROR @@ -30,21 +30,38 @@ general: testapi: url: testresults.opnfv.org/test/api/v1/results - + functest: blacklist: - ovno - security_scan + - rally_sanity + - healthcheck + - odl_netvirt + - aaa + - cloudify_ims + - orchestra_ims + - juju_epc + - orchestra + - promise max_scenario_criteria: 50 test_conf: https://git.opnfv.org/cgit/functest/plain/functest/ci/testcases.yaml log_level: ERROR - jenkins_url: https://build.opnfv.org/ci/view/functest/job - - + jenkins_url: https://build.opnfv.org/ci/view/functest/job/ + exclude_noha: False + exclude_virtual: False + yardstick: test_conf: https://git.opnfv.org/cgit/yardstick/plain/tests/ci/report_config.yaml log_level: ERROR +storperf: + test_list: + - snia_steady_state + log_level: ERROR + qtip: bottleneck: + +vsperf: diff --git a/utils/test/reporting/storperf/reporting-status.py b/utils/test/reporting/storperf/reporting-status.py new file mode 100644 index 000000000..888e339f8 --- /dev/null +++ b/utils/test/reporting/storperf/reporting-status.py @@ -0,0 +1,145 @@ +#!/usr/bin/python +# +# This program and the accompanying materials +# are made available under the terms of the Apache License, Version 2.0 +# which accompanies this distribution, and is available at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +import datetime +import jinja2 +import os + +# manage conf +import utils.reporting_utils as rp_utils + +import utils.scenarioResult as sr + +installers = rp_utils.get_config('general.installers') +versions = rp_utils.get_config('general.versions') +PERIOD = rp_utils.get_config('general.period') + +# Logger +logger = rp_utils.getLogger("Storperf-Status") +reportingDate = datetime.datetime.now().strftime("%Y-%m-%d %H:%M") + +logger.info("*******************************************") +logger.info("* Generating reporting scenario status *") +logger.info("* Data retention = %s days *" % PERIOD) +logger.info("* *") +logger.info("*******************************************") + +# retrieve the list of storperf tests +storperf_tests = rp_utils.get_config('storperf.test_list') +logger.info("Storperf tests: %s" % storperf_tests) + +# For all the versions +for version in versions: + # For all the installers + for installer in installers: + # get scenarios results data + # for the moment we consider only 1 case snia_steady_state + scenario_results = rp_utils.getScenarios("snia_steady_state", + installer, + version) + # logger.info("scenario_results: %s" % scenario_results) + + scenario_stats = rp_utils.getScenarioStats(scenario_results) + logger.info("scenario_stats: %s" % scenario_stats) + items = {} + scenario_result_criteria = {} + + # From each scenarios get results list + for s, s_result in scenario_results.items(): + logger.info("---------------------------------") + logger.info("installer %s, version %s, scenario %s", installer, + version, s) + ten_criteria = len(s_result) + + ten_score = 0 + for v in s_result: + if "PASS" in v['criteria']: + ten_score += 1 + + logger.info("ten_score: %s / %s" % (ten_score, ten_criteria)) + + four_score = 0 + try: + LASTEST_TESTS = rp_utils.get_config( + 'general.nb_iteration_tests_success_criteria') + s_result.sort(key=lambda x: x['start_date']) + four_result = s_result[-LASTEST_TESTS:] + logger.debug("four_result: {}".format(four_result)) + logger.debug("LASTEST_TESTS: {}".format(LASTEST_TESTS)) + # logger.debug("four_result: {}".format(four_result)) + four_criteria = len(four_result) + for v in four_result: + if "PASS" in v['criteria']: + four_score += 1 + logger.info("4 Score: %s / %s " % (four_score, + four_criteria)) + except: + logger.error("Impossible to retrieve the four_score") + + try: + s_status = (four_score * 100) / four_criteria + except: + s_status = 0 + logger.info("Score percent = %s" % str(s_status)) + s_four_score = str(four_score) + '/' + str(four_criteria) + s_ten_score = str(ten_score) + '/' + str(ten_criteria) + s_score_percent = str(s_status) + + logger.debug(" s_status: {}".format(s_status)) + if s_status == 100: + logger.info(">>>>> scenario OK, save the information") + else: + logger.info(">>>> scenario not OK, last 4 iterations = %s, \ + last 10 days = %s" % (s_four_score, s_ten_score)) + + s_url = "" + if len(s_result) > 0: + build_tag = s_result[len(s_result)-1]['build_tag'] + logger.debug("Build tag: %s" % build_tag) + s_url = s_url = rp_utils.getJenkinsUrl(build_tag) + logger.info("last jenkins url: %s" % s_url) + + # Save daily results in a file + path_validation_file = ("./display/" + version + + "/storperf/scenario_history.txt") + + if not os.path.exists(path_validation_file): + with open(path_validation_file, 'w') as f: + info = 'date,scenario,installer,details,score\n' + f.write(info) + + with open(path_validation_file, "a") as f: + info = (reportingDate + "," + s + "," + installer + + "," + s_ten_score + "," + + str(s_score_percent) + "\n") + f.write(info) + + scenario_result_criteria[s] = sr.ScenarioResult(s_status, + s_four_score, + s_ten_score, + s_score_percent, + s_url) + + logger.info("--------------------------") + + templateLoader = jinja2.FileSystemLoader(".") + templateEnv = jinja2.Environment(loader=templateLoader, + autoescape=True) + + TEMPLATE_FILE = "./storperf/template/index-status-tmpl.html" + template = templateEnv.get_template(TEMPLATE_FILE) + + outputText = template.render(scenario_results=scenario_result_criteria, + installer=installer, + period=PERIOD, + version=version, + date=reportingDate) + + with open("./display/" + version + + "/storperf/status-" + installer + ".html", "wb") as fh: + fh.write(outputText) diff --git a/utils/test/reporting/storperf/template/index-status-tmpl.html b/utils/test/reporting/storperf/template/index-status-tmpl.html new file mode 100644 index 000000000..e0fcc6828 --- /dev/null +++ b/utils/test/reporting/storperf/template/index-status-tmpl.html @@ -0,0 +1,111 @@ + <html> + <head> + <meta charset="utf-8"> + <!-- Bootstrap core CSS --> + <link href="https://maxcdn.bootstrapcdn.com/bootstrap/3.3.4/css/bootstrap.min.css" rel="stylesheet"> + <link href="../../css/default.css" rel="stylesheet"> + <script type="text/javascript" src="http://ajax.googleapis.com/ajax/libs/jquery/1/jquery.min.js"></script> + <script type="text/javascript" src="https://maxcdn.bootstrapcdn.com/bootstrap/3.3.4/js/bootstrap.min.js"></script> + <script type="text/javascript" src="http://d3js.org/d3.v2.min.js"></script> + <script type="text/javascript" src="../../js/gauge.js"></script> + <script type="text/javascript" src="../../js/trend.js"></script> + <script> + function onDocumentReady() { + // Gauge management + {% for scenario in scenario_results.keys() -%} + var gaugeScenario{{loop.index}} = gauge('#gaugeScenario{{loop.index}}'); + {%- endfor %} + // assign success rate to the gauge + function updateReadings() { + {% for scenario in scenario_results.keys() -%} + gaugeScenario{{loop.index}}.update({{scenario_results[scenario].getScorePercent()}}); + {%- endfor %} + } + updateReadings(); + } + + // trend line management + d3.csv("./scenario_history.txt", function(data) { + // *************************************** + // Create the trend line + {% for scenario in scenario_results.keys() -%} + // for scenario {{scenario}} + // Filter results + var trend{{loop.index}} = data.filter(function(row) { + return row["scenario"]=="{{scenario}}" && row["installer"]=="{{installer}}"; + }) + // Parse the date + trend{{loop.index}}.forEach(function(d) { + d.date = parseDate(d.date); + d.score = +d.score + }); + // Draw the trend line + var mytrend = trend("#trend_svg{{loop.index}}",trend{{loop.index}}) + // **************************************** + {%- endfor %} + }); + if ( !window.isLoaded ) { + window.addEventListener("load", function() { + onDocumentReady(); + }, false); + } else { + onDocumentReady(); + } + </script> + <script type="text/javascript"> + $(document).ready(function (){ + $(".btn-more").click(function() { + $(this).hide(); + $(this).parent().find(".panel-default").show(); + }); + }) + </script> + </head> + <body> + <div class="container"> + <div class="masthead"> + <h3 class="text-muted">Storperf status page ({{version}}, {{date}})</h3> + <nav> + <ul class="nav nav-justified"> + <li class="active"><a href="http://testresults.opnfv.org/reporting/index.html">Home</a></li> + <li><a href="status-apex.html">Apex</a></li> + <li><a href="status-compass.html">Compass</a></li> + <li><a href="status-daisy.html">Daisy</a></li> + <li><a href="status-fuel.html">Fuel</a></li> + <li><a href="status-joid.html">Joid</a></li> + </ul> + </nav> + </div> +<div class="row"> + <div class="col-md-1"></div> + <div class="col-md-10"> + <div class="page-header"> + <h2>{{installer}}</h2> + </div> + + <div class="scenario-overview"> + <div class="panel-heading"><h4><b>List of last scenarios ({{version}}) run over the last {{period}} days </b></h4></div> + <table class="table"> + <tr> + <th width="40%">Scenario</th> + <th width="20%">Status</th> + <th width="20%">Trend</th> + <th width="10%">Last 4 Iterations</th> + <th width="10%">Last 10 Days</th> + </tr> + {% for scenario,result in scenario_results.iteritems() -%} + <tr class="tr-ok"> + <td><a href="{{scenario_results[scenario].getLastUrl()}}">{{scenario}}</a></td> + <td><div id="gaugeScenario{{loop.index}}"></div></td> + <td><div id="trend_svg{{loop.index}}"></div></td> + <td>{{scenario_results[scenario].getFourDaysScore()}}</td> + <td>{{scenario_results[scenario].getTenDaysScore()}}</td> + </tr> + {%- endfor %} + </table> + </div> + + + </div> + <div class="col-md-1"></div> +</div> diff --git a/utils/test/reporting/utils/reporting_utils.py b/utils/test/reporting/utils/reporting_utils.py index 0af60c78a..47d67f362 100644 --- a/utils/test/reporting/utils/reporting_utils.py +++ b/utils/test/reporting/utils/reporting_utils.py @@ -93,15 +93,23 @@ def getApiResults(case, installer, scenario, version): response = urlopen(request) k = response.read() results = json.loads(k) - except URLError, e: - print 'No kittez. Got an error code:', e + except URLError as e: + print('No kittez. Got an error code:', e) return results def getScenarios(case, installer, version): - case = case.getName() + try: + case = case.getName() + except: + # if case is not an object test case, try the string + if type(case) == str: + case = case + else: + raise ValueError("Case cannot be evaluated") + period = get_config('general.period') url_base = get_config('testapi.url') @@ -115,8 +123,8 @@ def getScenarios(case, installer, version): k = response.read() results = json.loads(k) test_results = results['results'] - except URLError, e: - print 'Got an error code:', e + except URLError as e: + print('Got an error code:', e) if test_results is not None: test_results.reverse() @@ -127,7 +135,15 @@ def getScenarios(case, installer, version): # Retrieve all the scenarios per installer if not r['scenario'] in scenario_results.keys(): scenario_results[r['scenario']] = [] - scenario_results[r['scenario']].append(r) + # Do we consider results from virtual pods ... + # Do we consider results for non HA scenarios... + exclude_virtual_pod = get_config('functest.exclude_virtual') + exclude_noha = get_config('functest.exclude_noha') + if ((exclude_virtual_pod and "virtual" in r['pod_name']) or + (exclude_noha and "noha" in r['scenario'])): + print("exclude virtual pod results...") + else: + scenario_results[r['scenario']].append(r) return scenario_results @@ -156,8 +172,8 @@ def getScenarioStatus(installer, version): response.close() results = json.loads(k) test_results = results['results'] - except URLError, e: - print 'Got an error code:', e + except URLError as e: + print('Got an error code:', e) scenario_results = {} result_dict = {} @@ -190,7 +206,7 @@ def getNbtestOk(results): if "PASS" in v: nb_test_ok += 1 except: - print "Cannot retrieve test status" + print("Cannot retrieve test status") return nb_test_ok @@ -254,16 +270,18 @@ def getResult(testCase, installer, scenario, version): def getJenkinsUrl(build_tag): # e.g. jenkins-functest-apex-apex-daily-colorado-daily-colorado-246 # id = 246 + # jenkins-functest-compass-huawei-pod5-daily-master-136 + # id = 136 # note it is linked to jenkins format # if this format changes...function to be adapted.... url_base = get_config('functest.jenkins_url') try: build_id = [int(s) for s in build_tag.split("-") if s.isdigit()] - jenkins_path = filter(lambda c: not c.isdigit(), build_tag) - url_id = jenkins_path[8:-1] + "/" + str(build_id[0]) + url_id = (build_tag[8:-(len(str(build_id[0])) + 1)] + + "/" + str(build_id[0])) jenkins_url = url_base + url_id + "/console" except: - print 'Impossible to get jenkins url:' + print('Impossible to get jenkins url:') return jenkins_url @@ -273,7 +291,7 @@ def getScenarioPercent(scenario_score, scenario_criteria): try: score = float(scenario_score) / float(scenario_criteria) * 100 except: - print 'Impossible to calculate the percentage score' + print('Impossible to calculate the percentage score') return score @@ -321,8 +339,8 @@ def get_percent(four_list, ten_list): def _test(): status = getScenarioStatus("compass", "master") - print "status:++++++++++++++++++++++++" - print json.dumps(status, indent=4) + print("status:++++++++++++++++++++++++") + print(json.dumps(status, indent=4)) # ---------------------------------------------------------- diff --git a/utils/test/reporting/yardstick/scenarioResult.py b/utils/test/reporting/utils/scenarioResult.py index 1f7eb2b24..6029d7f42 100644 --- a/utils/test/reporting/yardstick/scenarioResult.py +++ b/utils/test/reporting/utils/scenarioResult.py @@ -10,11 +10,12 @@ class ScenarioResult(object): def __init__(self, status, four_days_score='', ten_days_score='', - score_percent=0.0): + score_percent=0.0, last_url=''): self.status = status self.four_days_score = four_days_score self.ten_days_score = ten_days_score self.score_percent = score_percent + self.last_url = last_url def getStatus(self): return self.status @@ -27,3 +28,6 @@ class ScenarioResult(object): def getScorePercent(self): return self.score_percent + + def getLastUrl(self): + return self.last_url diff --git a/utils/test/reporting/yardstick/reporting-status.py b/utils/test/reporting/yardstick/reporting-status.py index a0f0b0184..12f42ca31 100644 --- a/utils/test/reporting/yardstick/reporting-status.py +++ b/utils/test/reporting/yardstick/reporting-status.py @@ -10,7 +10,7 @@ import datetime import jinja2 import os -import scenarioResult as sr +import utils.scenarioResult as sr from scenarios import config as cf # manage conf diff --git a/utils/test/testapi/.coveragerc b/utils/test/testapi/.coveragerc new file mode 100644 index 000000000..23fb97fba --- /dev/null +++ b/utils/test/testapi/.coveragerc @@ -0,0 +1,27 @@ +# .coveragerc to control coverage.py + +[run] +branch = True +source = + opnfv_testapi + +[report] +# Regexes for lines to exclude from consideration +exclude_lines = + # Have to re-enable the standard pragma + pragma: no cover + + # Don't complain about missing debug-only code: + def __repr__ + if self\.debug + + # Don't complain if tests don't hit defensive assertion code: + raise AssertionError + raise NotImplementedError + + # Don't complain if non-runnable code isn't run: + if 0: + if __name__ == .__main__.: + +ignore_errors = True + diff --git a/utils/test/testapi/docker/Dockerfile b/utils/test/testapi/docker/Dockerfile index 86513e05b..e031e194c 100644 --- a/utils/test/testapi/docker/Dockerfile +++ b/utils/test/testapi/docker/Dockerfile @@ -8,13 +8,12 @@ # $ docker build -t opnfv/testapi:tag . # # Execution: -# $ docker run -dti -p 8000:8000 \ -# -e "swagger_url=http://10.63.243.17:8000" \ +# $ docker run -dti -p 8001:8000 \ +# -e "swagger_url=http://10.63.243.17:8001" \ # -e "mongodb_url=mongodb://10.63.243.17:27017/" \ -# -e "api_port=8000" # opnfv/testapi:tag # -# NOTE: providing swagger_url, api_port, mongodb_url is optional. +# NOTE: providing swagger_url, mongodb_url is optional. # If not provided, it will use the default one # configured in config.ini # diff --git a/utils/test/testapi/docker/prepare-env.sh b/utils/test/testapi/docker/prepare-env.sh index 99433cc8c..9f07efbd1 100755 --- a/utils/test/testapi/docker/prepare-env.sh +++ b/utils/test/testapi/docker/prepare-env.sh @@ -9,8 +9,3 @@ fi if [ "$swagger_url" != "" ]; then sudo crudini --set --existing $FILE swagger base_url $swagger_url fi - -if [ "$api_port" != "" ];then - sudo crudini --set --existing $FILE api port $api_port -fi - diff --git a/utils/test/testapi/etc/config.ini b/utils/test/testapi/etc/config.ini index 0edb73a3f..77cc6c6ee 100644 --- a/utils/test/testapi/etc/config.ini +++ b/utils/test/testapi/etc/config.ini @@ -11,6 +11,7 @@ dbname = test_results_collection port = 8000 # With debug_on set to true, error traces will be shown in HTTP responses debug = True +authenticate = False [swagger] base_url = http://localhost:8000 diff --git a/utils/test/testapi/htmlize/doc-build.sh b/utils/test/testapi/htmlize/doc-build.sh new file mode 100644 index 000000000..33560ceea --- /dev/null +++ b/utils/test/testapi/htmlize/doc-build.sh @@ -0,0 +1,21 @@ +#!/bin/bash + +set -o errexit + +# Create virtual environment +virtualenv $WORKSPACE/testapi_venv +source $WORKSPACE/testapi_venv/bin/activate + +# Swgger Codegen Tool +url="http://repo1.maven.org/maven2/io/swagger/swagger-codegen-cli/2.2.1/swagger-codegen-cli-2.2.1.jar" + +# Check for jar file locally and in the repo +if [ ! -f swagger-codegen-cli.jar ]; +then + wget http://repo1.maven.org/maven2/io/swagger/swagger-codegen-cli/2.2.1/swagger-codegen-cli-2.2.1.jar -O swagger-codegen-cli.jar +fi + +# Install Pre-requistics +pip install requests + +python ./utils/test/testapi/htmlize/htmlize.py -o ${WORKSPACE}/ diff --git a/utils/test/testapi/htmlize/finish.sh b/utils/test/testapi/htmlize/finish.sh deleted file mode 100644 index d24ae056c..000000000 --- a/utils/test/testapi/htmlize/finish.sh +++ /dev/null @@ -1,17 +0,0 @@ -#!/bin/bash - -# All rights reserved. This program and the accompanying materials -# are made available under the terms of the Apache License, Version 2.0 -# which accompanies this distribution, and is available at -# http://www.apache.org/licenses/LICENSE-2.0 - -# Stop opnfv-testapi server -proc_number=`ps -ef | grep opnfv-testapi | grep -v grep | wc -l` - -if [ $proc_number -gt 0 ]; then - procs=`ps -ef | grep opnfv-testapi | grep -v grep` - echo "Kill opnfv-testapi server $procs" - ps -ef | grep opnfv-testapi | grep -v grep | awk '{print $2}' | xargs kill -kill &>/dev/null -fi - -deactivate diff --git a/utils/test/testapi/htmlize/htmlize.py b/utils/test/testapi/htmlize/htmlize.py index 68d02febd..b8c4fb43f 100644 --- a/utils/test/testapi/htmlize/htmlize.py +++ b/utils/test/testapi/htmlize/htmlize.py @@ -28,7 +28,10 @@ def main(args): # Generating html page cmd = 'java -jar swagger-codegen-cli.jar generate \ -i specs.json -l html2 -o %s' % (args.output_directory) - os.system(cmd) + if os.system(cmd) == 0: + exit(0) + else: + exit(1) if __name__ == '__main__': parser = argparse.ArgumentParser(description='Create \ @@ -36,12 +39,14 @@ if __name__ == '__main__': parser.add_argument('-ru', '--resource-listing-url', type=str, required=False, - default='http://localhost:8000/swagger/spec.json', + default=('http://testresults.opnfv.org' + '/test/swagger/spec.json'), help='Resource Listing Spec File') parser.add_argument('-au', '--api-declaration-url', type=str, required=False, - default='http://localhost:8000/swagger/spec', + default=('http://testresults.opnfv.org' + '/test/swagger/spec'), help='API Declaration Spec File') parser.add_argument('-o', '--output-directory', required=True, diff --git a/utils/test/testapi/htmlize/prepare.sh b/utils/test/testapi/htmlize/prepare.sh deleted file mode 100644 index 67158f211..000000000 --- a/utils/test/testapi/htmlize/prepare.sh +++ /dev/null @@ -1,28 +0,0 @@ -#!/bin/bash - -# All rights reserved. This program and the accompanying materials -# are made available under the terms of the Apache License, Version 2.0 -# which accompanies this distribution, and is available at -# http://www.apache.org/licenses/LICENSE-2.0 - -#Creating virtual environment -virtualenv testapi_venv -source testapi_venv/bin/activate - -# Install Pre-requisites -pip install requests - -# Swgger Codegen Tool -url="http://repo1.maven.org/maven2/io/swagger/swagger-codegen-cli/2.2.1/swagger-codegen-cli-2.2.1.jar" - -#Check for jar file locally and in the repo -if [ ! -f swagger-codegen-cli.jar ]; -then - wget http://repo1.maven.org/maven2/io/swagger/swagger-codegen-cli/2.2.1/swagger-codegen-cli-2.2.1.jar -O swagger-codegen-cli.jar -fi - -# Start OPNFV Test API Server -cd utils/test/testapi/ -pip install -r requirements.txt -./install.sh -opnfv-testapi -c ../../../testapi_venv/etc/opnfv_testapi/config.ini & diff --git a/utils/test/testapi/htmlize/push-doc-artifact.sh b/utils/test/testapi/htmlize/push-doc-artifact.sh index 383565df1..4cf1988b0 100644 --- a/utils/test/testapi/htmlize/push-doc-artifact.sh +++ b/utils/test/testapi/htmlize/push-doc-artifact.sh @@ -7,19 +7,21 @@ export PATH=$PATH:/usr/local/bin/ project=$PROJECT workspace=$WORKSPACE -artifact_dir="functest/docs" +artifact_dir="$project/docs" set +e gsutil&>/dev/null if [ $? != 0 ]; then echo "Not possible to push results to artifact: gsutil not installed" + exit 1 else gsutil ls gs://artifacts.opnfv.org/"$project"/ &>/dev/null if [ $? != 0 ]; then echo "Not possible to push results to artifact: gsutil not installed." + exit 1 else echo "Uploading document to artifact $artifact_dir" gsutil cp "$workspace"/index.html gs://artifacts.opnfv.org/"$artifact_dir"/testapi.html >/dev/null 2>&1 - echo "Document can be found at http://artifacts.opnfv.org/functest/docs/testapi.html" + echo "Document can be found at http://artifacts.opnfv.org/releng/docs/testapi.html" fi fi diff --git a/utils/test/testapi/opnfv_testapi/cmd/server.py b/utils/test/testapi/opnfv_testapi/cmd/server.py index c3d734607..fa2b72250 100644 --- a/utils/test/testapi/opnfv_testapi/cmd/server.py +++ b/utils/test/testapi/opnfv_testapi/cmd/server.py @@ -30,37 +30,43 @@ TODOs : """ import argparse +import sys -import tornado.ioloop import motor +import tornado.ioloop -from opnfv_testapi.common.config import APIConfig -from opnfv_testapi.tornado_swagger import swagger +from opnfv_testapi.common import config from opnfv_testapi.router import url_mappings +from opnfv_testapi.tornado_swagger import swagger + +CONF = None + -# optionally get config file from command line -parser = argparse.ArgumentParser() -parser.add_argument("-c", "--config-file", dest='config_file', - help="Config file location") -args = parser.parse_args() -CONF = APIConfig().parse(args.config_file) +def parse_config(argv=[]): + global CONF + parser = argparse.ArgumentParser() + parser.add_argument("-c", "--config-file", dest='config_file', + help="Config file location") + args = parser.parse_args(argv) + CONF = config.APIConfig().parse(args.config_file) -# connecting to MongoDB server, and choosing database -client = motor.MotorClient(CONF.mongo_url) -db = client[CONF.mongo_dbname] -swagger.docs(base_url=CONF.swagger_base_url) +def get_db(): + return motor.MotorClient(CONF.mongo_url)[CONF.mongo_dbname] def make_app(): + swagger.docs(base_url=CONF.swagger_base_url) return swagger.Application( url_mappings.mappings, - db=db, + db=get_db(), debug=CONF.api_debug_on, + auth=CONF.api_authenticate_on ) def main(): + parse_config(sys.argv[1:]) application = make_app() application.listen(CONF.api_port) tornado.ioloop.IOLoop.current().start() diff --git a/utils/test/testapi/opnfv_testapi/common/config.py b/utils/test/testapi/opnfv_testapi/common/config.py index ecab88ae3..105d4fabf 100644 --- a/utils/test/testapi/opnfv_testapi/common/config.py +++ b/utils/test/testapi/opnfv_testapi/common/config.py @@ -7,9 +7,8 @@ # http://www.apache.org/licenses/LICENSE-2.0 # feng.xiaowei@zte.com.cn remove prepare_put_request 5-30-2016 ############################################################################## - - -from ConfigParser import SafeConfigParser, NoOptionError +import ConfigParser +import os class ParseError(Exception): @@ -24,7 +23,7 @@ class ParseError(Exception): return 'error parsing config file : %s' % self.msg -class APIConfig: +class APIConfig(object): """ The purpose of this class is to load values correctly from the config file. Each key is declared as an attribute in __init__() and linked in parse() @@ -36,20 +35,21 @@ class APIConfig: self.mongo_dbname = None self.api_port = None self.api_debug_on = None + self.api_authenticate_on = None self._parser = None self.swagger_base_url = None def _get_parameter(self, section, param): try: return self._parser.get(section, param) - except NoOptionError: - raise ParseError("[%s.%s] parameter not found" % (section, param)) + except ConfigParser.NoOptionError: + raise ParseError("No parameter: [%s.%s]" % (section, param)) def _get_int_parameter(self, section, param): try: return int(self._get_parameter(section, param)) except ValueError: - raise ParseError("[%s.%s] not an int" % (section, param)) + raise ParseError("Not int: [%s.%s]" % (section, param)) def _get_bool_parameter(self, section, param): result = self._get_parameter(section, param) @@ -59,7 +59,7 @@ class APIConfig: return False raise ParseError( - "[%s.%s : %s] not a boolean" % (section, param, result)) + "Not boolean: [%s.%s : %s]" % (section, param, result)) @staticmethod def parse(config_location=None): @@ -68,28 +68,21 @@ class APIConfig: if config_location is None: config_location = obj._default_config_location - obj._parser = SafeConfigParser() - obj._parser.read(config_location) - if not obj._parser: + if not os.path.exists(config_location): raise ParseError("%s not found" % config_location) + obj._parser = ConfigParser.SafeConfigParser() + obj._parser.read(config_location) + # Linking attributes to keys from file with their sections obj.mongo_url = obj._get_parameter("mongo", "url") obj.mongo_dbname = obj._get_parameter("mongo", "dbname") obj.api_port = obj._get_int_parameter("api", "port") obj.api_debug_on = obj._get_bool_parameter("api", "debug") + obj.api_authenticate_on = obj._get_bool_parameter("api", + "authenticate") + obj.swagger_base_url = obj._get_parameter("swagger", "base_url") return obj - - def __str__(self): - return "mongo_url = %s \n" \ - "mongo_dbname = %s \n" \ - "api_port = %s \n" \ - "api_debug_on = %s \n" \ - "swagger_base_url = %s \n" % (self.mongo_url, - self.mongo_dbname, - self.api_port, - self.api_debug_on, - self.swagger_base_url) diff --git a/utils/test/testapi/opnfv_testapi/common/constants.py b/utils/test/testapi/opnfv_testapi/common/constants.py index 4d39a142d..71bd95216 100644 --- a/utils/test/testapi/opnfv_testapi/common/constants.py +++ b/utils/test/testapi/opnfv_testapi/common/constants.py @@ -10,6 +10,7 @@ DEFAULT_REPRESENTATION = "application/json" HTTP_BAD_REQUEST = 400 +HTTP_UNAUTHORIZED = 401 HTTP_FORBIDDEN = 403 HTTP_NOT_FOUND = 404 HTTP_OK = 200 diff --git a/utils/test/testapi/opnfv_testapi/resources/handlers.py b/utils/test/testapi/opnfv_testapi/resources/handlers.py index 9fc5d6be1..8255b526a 100644 --- a/utils/test/testapi/opnfv_testapi/resources/handlers.py +++ b/utils/test/testapi/opnfv_testapi/resources/handlers.py @@ -20,19 +20,19 @@ # feng.xiaowei@zte.com.cn remove DashboardHandler 5-30-2016 ############################################################################## -import json from datetime import datetime +import functools +import json from tornado import gen -from tornado.web import RequestHandler, asynchronous, HTTPError +from tornado import web -from models import CreateResponse -from opnfv_testapi.common.constants import DEFAULT_REPRESENTATION, \ - HTTP_BAD_REQUEST, HTTP_NOT_FOUND, HTTP_FORBIDDEN +import models +from opnfv_testapi.common import constants from opnfv_testapi.tornado_swagger import swagger -class GenericApiHandler(RequestHandler): +class GenericApiHandler(web.RequestHandler): def __init__(self, application, request, **kwargs): super(GenericApiHandler, self).__init__(application, request, **kwargs) self.db = self.settings["db"] @@ -44,49 +44,71 @@ class GenericApiHandler(RequestHandler): self.db_testcases = 'testcases' self.db_results = 'results' self.db_scenarios = 'scenarios' + self.auth = self.settings["auth"] def prepare(self): if self.request.method != "GET" and self.request.method != "DELETE": if self.request.headers.get("Content-Type") is not None: if self.request.headers["Content-Type"].startswith( - DEFAULT_REPRESENTATION): + constants.DEFAULT_REPRESENTATION): try: self.json_args = json.loads(self.request.body) except (ValueError, KeyError, TypeError) as error: - raise HTTPError(HTTP_BAD_REQUEST, - "Bad Json format [{}]". - format(error)) + raise web.HTTPError(constants.HTTP_BAD_REQUEST, + "Bad Json format [{}]". + format(error)) def finish_request(self, json_object=None): if json_object: self.write(json.dumps(json_object)) - self.set_header("Content-Type", DEFAULT_REPRESENTATION) + self.set_header("Content-Type", constants.DEFAULT_REPRESENTATION) self.finish() def _create_response(self, resource): href = self.request.full_url() + '/' + str(resource) - return CreateResponse(href=href).format() + return models.CreateResponse(href=href).format() def format_data(self, data): cls_data = self.table_cls.from_dict(data) return cls_data.format_http() - @asynchronous + def authenticate(method): + @web.asynchronous + @gen.coroutine + @functools.wraps(method) + def wrapper(self, *args, **kwargs): + if self.auth: + try: + token = self.request.headers['X-Auth-Token'] + except KeyError: + raise web.HTTPError(constants.HTTP_UNAUTHORIZED, + "No Authentication Header.") + query = {'access_token': token} + check = yield self._eval_db_find_one(query, 'tokens') + if not check: + raise web.HTTPError(constants.HTTP_FORBIDDEN, + "Invalid Token.") + ret = yield gen.coroutine(method)(self, *args, **kwargs) + raise gen.Return(ret) + return wrapper + + @web.asynchronous @gen.coroutine + @authenticate def _create(self, miss_checks, db_checks, **kwargs): """ :param miss_checks: [miss1, miss2] :param db_checks: [(table, exist, query, error)] """ if self.json_args is None: - raise HTTPError(HTTP_BAD_REQUEST, "no body") + raise web.HTTPError(constants.HTTP_BAD_REQUEST, "no body") data = self.table_cls.from_dict(self.json_args) for miss in miss_checks: miss_data = data.__getattribute__(miss) if miss_data is None or miss_data == '': - raise HTTPError(HTTP_BAD_REQUEST, - '{} missing'.format(miss)) + raise web.HTTPError(constants.HTTP_BAD_REQUEST, + '{} missing'.format(miss)) for k, v in kwargs.iteritems(): data.__setattr__(k, v) @@ -95,7 +117,7 @@ class GenericApiHandler(RequestHandler): check = yield self._eval_db_find_one(query(data), table) if (exist and not check) or (not exist and check): code, message = error(data) - raise HTTPError(code, message) + raise web.HTTPError(code, message) if self.table != 'results': data.creation_date = datetime.now() @@ -107,7 +129,7 @@ class GenericApiHandler(RequestHandler): resource = _id self.finish_request(self._create_response(resource)) - @asynchronous + @web.asynchronous @gen.coroutine def _list(self, query=None, res_op=None, *args, **kwargs): if query is None: @@ -126,40 +148,42 @@ class GenericApiHandler(RequestHandler): res = res_op(data, *args) self.finish_request(res) - @asynchronous + @web.asynchronous @gen.coroutine def _get_one(self, query): data = yield self._eval_db_find_one(query) if data is None: - raise HTTPError(HTTP_NOT_FOUND, - "[{}] not exist in table [{}]" - .format(query, self.table)) + raise web.HTTPError(constants.HTTP_NOT_FOUND, + "[{}] not exist in table [{}]" + .format(query, self.table)) self.finish_request(self.format_data(data)) - @asynchronous + @web.asynchronous @gen.coroutine + @authenticate def _delete(self, query): data = yield self._eval_db_find_one(query) if data is None: - raise HTTPError(HTTP_NOT_FOUND, - "[{}] not exit in table [{}]" - .format(query, self.table)) + raise web.HTTPError(constants.HTTP_NOT_FOUND, + "[{}] not exit in table [{}]" + .format(query, self.table)) yield self._eval_db(self.table, 'remove', query) self.finish_request() - @asynchronous + @web.asynchronous @gen.coroutine + @authenticate def _update(self, query, db_keys): if self.json_args is None: - raise HTTPError(HTTP_BAD_REQUEST, "No payload") + raise web.HTTPError(constants.HTTP_BAD_REQUEST, "No payload") # check old data exist from_data = yield self._eval_db_find_one(query) if from_data is None: - raise HTTPError(HTTP_NOT_FOUND, - "{} could not be found in table [{}]" - .format(query, self.table)) + raise web.HTTPError(constants.HTTP_NOT_FOUND, + "{} could not be found in table [{}]" + .format(query, self.table)) data = self.table_cls.from_dict(from_data) # check new data exist @@ -167,13 +191,12 @@ class GenericApiHandler(RequestHandler): if not equal: to_data = yield self._eval_db_find_one(new_query) if to_data is not None: - raise HTTPError(HTTP_FORBIDDEN, - "{} already exists in table [{}]" - .format(new_query, self.table)) + raise web.HTTPError(constants.HTTP_FORBIDDEN, + "{} already exists in table [{}]" + .format(new_query, self.table)) # we merge the whole document """ - edit_request = data.format() - edit_request.update(self._update_requests(data)) + edit_request = self._update_requests(data) """ Updating the DB """ yield self._eval_db(self.table, 'update', query, edit_request, @@ -187,8 +210,11 @@ class GenericApiHandler(RequestHandler): request = self._update_request(request, k, v, data.__getattribute__(k)) if not request: - raise HTTPError(HTTP_FORBIDDEN, "Nothing to update") - return request + raise web.HTTPError(constants.HTTP_FORBIDDEN, "Nothing to update") + + edit_request = data.format() + edit_request.update(request) + return edit_request @staticmethod def _update_request(edit_request, key, new_value, old_value): @@ -228,7 +254,7 @@ class GenericApiHandler(RequestHandler): class VersionHandler(GenericApiHandler): - @swagger.operation(nickname='List all versions') + @swagger.operation(nickname='listAllVersions') def get(self): """ @description: list all supported versions diff --git a/utils/test/testapi/opnfv_testapi/resources/models.py b/utils/test/testapi/opnfv_testapi/resources/models.py index f518c97a0..0ea482fd2 100644 --- a/utils/test/testapi/opnfv_testapi/resources/models.py +++ b/utils/test/testapi/opnfv_testapi/resources/models.py @@ -1,98 +1,116 @@ -##############################################################################
-# Copyright (c) 2015 Orange
-# guyrodrigue.koffi@orange.com / koffirodrigue@gmail.com
-# All rights reserved. This program and the accompanying materials
-# are made available under the terms of the Apache License, Version 2.0
-# which accompanies this distribution, and is available at
-# http://www.apache.org/licenses/LICENSE-2.0
-# feng.xiaowei@zte.com.cn mv Pod to pod_models.py 5-18-2016
-# feng.xiaowei@zte.com.cn add MetaCreateResponse/MetaGetResponse 5-18-2016
-# feng.xiaowei@zte.com.cn mv TestProject to project_models.py 5-19-2016
-# feng.xiaowei@zte.com.cn delete meta class 5-19-2016
-# feng.xiaowei@zte.com.cn add CreateResponse 5-19-2016
-# feng.xiaowei@zte.com.cn mv TestCase to testcase_models.py 5-20-2016
-# feng.xiaowei@zte.com.cn mv TestResut to result_models.py 5-23-2016
-# feng.xiaowei@zte.com.cn add ModelBase 12-20-2016
-##############################################################################
-import copy
-
-from opnfv_testapi.tornado_swagger import swagger
-
-
-class ModelBase(object):
-
- def _format(self, excludes):
- new_obj = copy.deepcopy(self)
- dicts = new_obj.__dict__
- for k in dicts.keys():
- if k in excludes:
- del dicts[k]
- elif dicts[k]:
- if hasattr(dicts[k], 'format'):
- dicts[k] = dicts[k].format()
- elif isinstance(dicts[k], list):
- hs = list()
- [hs.append(h.format() if hasattr(h, 'format') else str(h))
- for h in dicts[k]]
- dicts[k] = hs
- elif not isinstance(dicts[k], (str, int, float, dict)):
- dicts[k] = str(dicts[k])
- return dicts
-
- def format(self):
- return self._format(['_id'])
-
- def format_http(self):
- return self._format([])
-
- @staticmethod
- def attr_parser():
- return {}
-
- @classmethod
- def from_dict(cls, a_dict):
- if a_dict is None:
- return None
-
- attr_parser = cls.attr_parser()
- t = cls()
- for k, v in a_dict.iteritems():
- value = v
- if isinstance(v, dict) and k in attr_parser:
- value = attr_parser[k].from_dict(v)
- elif isinstance(v, list) and k in attr_parser:
- value = []
- for item in v:
- value.append(attr_parser[k].from_dict(item))
-
- t.__setattr__(k, value)
-
- return t
-
-
-@swagger.model()
-class CreateResponse(ModelBase):
- def __init__(self, href=''):
- self.href = href
-
-
-@swagger.model()
-class Versions(ModelBase):
- """
- @property versions:
- @ptype versions: C{list} of L{Version}
- """
-
- def __init__(self):
- self.versions = list()
-
- @staticmethod
- def attr_parser():
- return {'versions': Version}
-
-
-@swagger.model()
-class Version(ModelBase):
- def __init__(self, version=None, description=None):
- self.version = version
- self.description = description
+############################################################################## +# Copyright (c) 2015 Orange +# guyrodrigue.koffi@orange.com / koffirodrigue@gmail.com +# All rights reserved. This program and the accompanying materials +# are made available under the terms of the Apache License, Version 2.0 +# which accompanies this distribution, and is available at +# http://www.apache.org/licenses/LICENSE-2.0 +# feng.xiaowei@zte.com.cn mv Pod to pod_models.py 5-18-2016 +# feng.xiaowei@zte.com.cn add MetaCreateResponse/MetaGetResponse 5-18-2016 +# feng.xiaowei@zte.com.cn mv TestProject to project_models.py 5-19-2016 +# feng.xiaowei@zte.com.cn delete meta class 5-19-2016 +# feng.xiaowei@zte.com.cn add CreateResponse 5-19-2016 +# feng.xiaowei@zte.com.cn mv TestCase to testcase_models.py 5-20-2016 +# feng.xiaowei@zte.com.cn mv TestResut to result_models.py 5-23-2016 +# feng.xiaowei@zte.com.cn add ModelBase 12-20-2016 +############################################################################## +import copy +import ast + + +from opnfv_testapi.tornado_swagger import swagger + + +class ModelBase(object): + + def format(self): + return self._format(['_id']) + + def format_http(self): + return self._format([]) + + @classmethod + def from_dict(cls, a_dict): + if a_dict is None: + return None + + attr_parser = cls.attr_parser() + t = cls() + for k, v in a_dict.iteritems(): + value = v + if isinstance(v, dict) and k in attr_parser: + value = attr_parser[k].from_dict(v) + elif isinstance(v, list) and k in attr_parser: + value = [] + for item in v: + value.append(attr_parser[k].from_dict(item)) + + t.__setattr__(k, value) + + return t + + @staticmethod + def attr_parser(): + return {} + + def _format(self, excludes): + new_obj = copy.deepcopy(self) + dicts = new_obj.__dict__ + for k in dicts.keys(): + if k in excludes: + del dicts[k] + elif dicts[k]: + dicts[k] = self._obj_format(dicts[k]) + return dicts + + def _obj_format(self, obj): + if self._has_format(obj): + obj = obj.format() + elif isinstance(obj, unicode): + try: + obj = self._obj_format(ast.literal_eval(obj)) + except: + try: + obj = str(obj) + except: + obj = obj + elif isinstance(obj, list): + hs = list() + for h in obj: + hs.append(self._obj_format(h)) + obj = hs + elif not isinstance(obj, (str, int, float, dict)): + obj = str(obj) + return obj + + @staticmethod + def _has_format(obj): + return not isinstance(obj, (str, unicode)) and hasattr(obj, 'format') + + +@swagger.model() +class CreateResponse(ModelBase): + def __init__(self, href=''): + self.href = href + + +@swagger.model() +class Versions(ModelBase): + """ + @property versions: + @ptype versions: C{list} of L{Version} + """ + + def __init__(self): + self.versions = list() + + @staticmethod + def attr_parser(): + return {'versions': Version} + + +@swagger.model() +class Version(ModelBase): + def __init__(self, version=None, description=None): + self.version = version + self.description = description diff --git a/utils/test/testapi/opnfv_testapi/resources/pod_handlers.py b/utils/test/testapi/opnfv_testapi/resources/pod_handlers.py index 631d4a91d..65c27f60a 100644 --- a/utils/test/testapi/opnfv_testapi/resources/pod_handlers.py +++ b/utils/test/testapi/opnfv_testapi/resources/pod_handlers.py @@ -6,21 +6,21 @@ # which accompanies this distribution, and is available at # http://www.apache.org/licenses/LICENSE-2.0 ############################################################################## +import handlers +from opnfv_testapi.common import constants from opnfv_testapi.tornado_swagger import swagger -from handlers import GenericApiHandler -from pod_models import Pod -from opnfv_testapi.common.constants import HTTP_FORBIDDEN +import pod_models -class GenericPodHandler(GenericApiHandler): +class GenericPodHandler(handlers.GenericApiHandler): def __init__(self, application, request, **kwargs): super(GenericPodHandler, self).__init__(application, request, **kwargs) self.table = 'pods' - self.table_cls = Pod + self.table_cls = pod_models.Pod class PodCLHandler(GenericPodHandler): - @swagger.operation(nickname='List all Pods') + @swagger.operation(nickname='listAllPods') def get(self): """ @description: list all pods @@ -29,7 +29,7 @@ class PodCLHandler(GenericPodHandler): """ self._list() - @swagger.operation(nickname='Create a Pod') + @swagger.operation(nickname='createPod') def post(self): """ @description: create a pod @@ -46,7 +46,7 @@ class PodCLHandler(GenericPodHandler): def error(data): message = '{} already exists as a pod'.format(data.name) - return HTTP_FORBIDDEN, message + return constants.HTTP_FORBIDDEN, message miss_checks = ['name'] db_checks = [(self.table, False, query, error)] @@ -54,7 +54,7 @@ class PodCLHandler(GenericPodHandler): class PodGURHandler(GenericPodHandler): - @swagger.operation(nickname='Get a Pod by pod_name') + @swagger.operation(nickname='getPodByName') def get(self, pod_name): """ @description: get a single pod by pod_name diff --git a/utils/test/testapi/opnfv_testapi/resources/project_handlers.py b/utils/test/testapi/opnfv_testapi/resources/project_handlers.py index 9cf698623..f3521961d 100644 --- a/utils/test/testapi/opnfv_testapi/resources/project_handlers.py +++ b/utils/test/testapi/opnfv_testapi/resources/project_handlers.py @@ -6,23 +6,23 @@ # which accompanies this distribution, and is available at # http://www.apache.org/licenses/LICENSE-2.0 ############################################################################## +import handlers +from opnfv_testapi.common import constants from opnfv_testapi.tornado_swagger import swagger -from handlers import GenericApiHandler -from opnfv_testapi.common.constants import HTTP_FORBIDDEN -from project_models import Project +import project_models -class GenericProjectHandler(GenericApiHandler): +class GenericProjectHandler(handlers.GenericApiHandler): def __init__(self, application, request, **kwargs): super(GenericProjectHandler, self).__init__(application, request, **kwargs) self.table = 'projects' - self.table_cls = Project + self.table_cls = project_models.Project class ProjectCLHandler(GenericProjectHandler): - @swagger.operation(nickname="List all Projects") + @swagger.operation(nickname="listAllProjects") def get(self): """ @description: list all projects @@ -31,7 +31,7 @@ class ProjectCLHandler(GenericProjectHandler): """ self._list() - @swagger.operation(nickname="Create a Project") + @swagger.operation(nickname="createProject") def post(self): """ @description: create a project @@ -48,7 +48,7 @@ class ProjectCLHandler(GenericProjectHandler): def error(data): message = '{} already exists as a project'.format(data.name) - return HTTP_FORBIDDEN, message + return constants.HTTP_FORBIDDEN, message miss_checks = ['name'] db_checks = [(self.table, False, query, error)] @@ -56,7 +56,7 @@ class ProjectCLHandler(GenericProjectHandler): class ProjectGURHandler(GenericProjectHandler): - @swagger.operation(nickname='Get a Project by project_name') + @swagger.operation(nickname='getProjectByName') def get(self, project_name): """ @description: get a single project by project_name @@ -66,7 +66,7 @@ class ProjectGURHandler(GenericProjectHandler): """ self._get_one({'name': project_name}) - @swagger.operation(nickname="Update a Project by project_name") + @swagger.operation(nickname="updateProjectByName") def put(self, project_name): """ @description: update a single project by project_name @@ -82,7 +82,7 @@ class ProjectGURHandler(GenericProjectHandler): db_keys = ['name'] self._update(query, db_keys) - @swagger.operation(nickname='Delete a Project by project_name') + @swagger.operation(nickname='deleteProjectByName') def delete(self, project_name): """ @description: delete a project by project_name diff --git a/utils/test/testapi/opnfv_testapi/resources/result_handlers.py b/utils/test/testapi/opnfv_testapi/resources/result_handlers.py index fe13c09b7..d41ba4820 100644 --- a/utils/test/testapi/opnfv_testapi/resources/result_handlers.py +++ b/utils/test/testapi/opnfv_testapi/resources/result_handlers.py @@ -6,30 +6,32 @@ # which accompanies this distribution, and is available at # http://www.apache.org/licenses/LICENSE-2.0 ############################################################################## -from datetime import datetime, timedelta +from datetime import datetime +from datetime import timedelta -from bson.objectid import ObjectId -from tornado.web import HTTPError +from bson import objectid +from tornado import web -from opnfv_testapi.common.constants import HTTP_BAD_REQUEST, HTTP_NOT_FOUND -from opnfv_testapi.resources.handlers import GenericApiHandler -from opnfv_testapi.resources.result_models import TestResult +from opnfv_testapi.common import constants +from opnfv_testapi.resources import handlers +from opnfv_testapi.resources import result_models from opnfv_testapi.tornado_swagger import swagger -class GenericResultHandler(GenericApiHandler): +class GenericResultHandler(handlers.GenericApiHandler): def __init__(self, application, request, **kwargs): super(GenericResultHandler, self).__init__(application, request, **kwargs) self.table = self.db_results - self.table_cls = TestResult + self.table_cls = result_models.TestResult def get_int(self, key, value): try: value = int(value) except: - raise HTTPError(HTTP_BAD_REQUEST, '{} must be int'.format(key)) + raise web.HTTPError(constants.HTTP_BAD_REQUEST, + '{} must be int'.format(key)) return value def set_query(self): @@ -52,7 +54,7 @@ class GenericResultHandler(GenericApiHandler): class ResultsCLHandler(GenericResultHandler): - @swagger.operation(nickname="List all Test Results") + @swagger.operation(nickname="queryTestResults") def get(self): """ @description: Retrieve result(s) for a test project @@ -127,7 +129,7 @@ class ResultsCLHandler(GenericResultHandler): self._list(self.set_query(), sort=[('start_date', -1)], last=last) - @swagger.operation(nickname="Create a Test Result") + @swagger.operation(nickname="createTestResult") def post(self): """ @description: create a test result @@ -144,14 +146,14 @@ class ResultsCLHandler(GenericResultHandler): def pod_error(data): message = 'Could not find pod [{}]'.format(data.pod_name) - return HTTP_NOT_FOUND, message + return constants.HTTP_NOT_FOUND, message def project_query(data): return {'name': data.project_name} def project_error(data): message = 'Could not find project [{}]'.format(data.project_name) - return HTTP_NOT_FOUND, message + return constants.HTTP_NOT_FOUND, message def testcase_query(data): return {'project_name': data.project_name, 'name': data.case_name} @@ -159,7 +161,7 @@ class ResultsCLHandler(GenericResultHandler): def testcase_error(data): message = 'Could not find testcase [{}] in project [{}]'\ .format(data.case_name, data.project_name) - return HTTP_NOT_FOUND, message + return constants.HTTP_NOT_FOUND, message miss_checks = ['pod_name', 'project_name', 'case_name'] db_checks = [('pods', True, pod_query, pod_error), @@ -169,7 +171,7 @@ class ResultsCLHandler(GenericResultHandler): class ResultsGURHandler(GenericResultHandler): - @swagger.operation(nickname='Get a Test Result by result_id') + @swagger.operation(nickname='getTestResultById') def get(self, result_id): """ @description: get a single result by result_id @@ -178,10 +180,10 @@ class ResultsGURHandler(GenericResultHandler): @raise 404: test result not exist """ query = dict() - query["_id"] = ObjectId(result_id) + query["_id"] = objectid.ObjectId(result_id) self._get_one(query) - @swagger.operation(nickname="Update a Test Result by result_id") + @swagger.operation(nickname="updateTestResultById") def put(self, result_id): """ @description: update a single result by _id @@ -193,6 +195,6 @@ class ResultsGURHandler(GenericResultHandler): @raise 404: result not exist @raise 403: nothing to update """ - query = {'_id': ObjectId(result_id)} + query = {'_id': objectid.ObjectId(result_id)} db_keys = [] self._update(query, db_keys) diff --git a/utils/test/testapi/opnfv_testapi/resources/scenario_handlers.py b/utils/test/testapi/opnfv_testapi/resources/scenario_handlers.py index 7bf3d5d53..083bf59fc 100644 --- a/utils/test/testapi/opnfv_testapi/resources/scenario_handlers.py +++ b/utils/test/testapi/opnfv_testapi/resources/scenario_handlers.py @@ -1,31 +1,69 @@ -from opnfv_testapi.common.constants import HTTP_FORBIDDEN -from opnfv_testapi.resources.handlers import GenericApiHandler -from opnfv_testapi.resources.scenario_models import Scenario +from opnfv_testapi.common import constants +from opnfv_testapi.resources import handlers +import opnfv_testapi.resources.scenario_models as models from opnfv_testapi.tornado_swagger import swagger -class GenericScenarioHandler(GenericApiHandler): +class GenericScenarioHandler(handlers.GenericApiHandler): def __init__(self, application, request, **kwargs): super(GenericScenarioHandler, self).__init__(application, request, **kwargs) self.table = self.db_scenarios - self.table_cls = Scenario + self.table_cls = models.Scenario class ScenariosCLHandler(GenericScenarioHandler): - @swagger.operation(nickname="List scenarios by queries") + @swagger.operation(nickname="queryScenarios") def get(self): """ @description: Retrieve scenario(s). @notes: Retrieve scenario(s) - @return 200: all scenarios consist with query, + Available filters for this request are : + - name : scenario name + + GET /scenarios?name=scenario_1 + @param name: scenario name + @type name: L{string} + @in name: query + @required name: False + @param installer: installer type + @type installer: L{string} + @in installer: query + @required installer: False + @param version: version + @type version: L{string} + @in version: query + @required version: False + @param project: project name + @type project: L{string} + @in project: query + @required project: False + @return 200: all scenarios satisfy queries, empty list if no scenario is found @rtype: L{Scenarios} """ - self._list() - @swagger.operation(nickname="Create a new scenario") + def _set_query(): + query = dict() + elem_query = dict() + for k in self.request.query_arguments.keys(): + v = self.get_query_argument(k) + if k == 'installer': + elem_query["installer"] = v + elif k == 'version': + elem_query["versions.version"] = v + elif k == 'project': + elem_query["versions.projects.project"] = v + else: + query[k] = v + if elem_query: + query['installers'] = {'$elemMatch': elem_query} + return query + + self._list(_set_query()) + + @swagger.operation(nickname="createScenario") def post(self): """ @description: create a new scenario by name @@ -42,7 +80,7 @@ class ScenariosCLHandler(GenericScenarioHandler): def error(data): message = '{} already exists as a scenario'.format(data.name) - return HTTP_FORBIDDEN, message + return constants.HTTP_FORBIDDEN, message miss_checks = ['name'] db_checks = [(self.table, False, query, error)] @@ -50,7 +88,7 @@ class ScenariosCLHandler(GenericScenarioHandler): class ScenarioGURHandler(GenericScenarioHandler): - @swagger.operation(nickname='Get the scenario by name') + @swagger.operation(nickname='getScenarioByName') def get(self, name): """ @description: get a single scenario by name @@ -58,18 +96,188 @@ class ScenarioGURHandler(GenericScenarioHandler): @return 200: scenario exist @raise 404: scenario not exist """ + self._get_one({'name': name}) pass - @swagger.operation(nickname="Update the scenario by name") + @swagger.operation(nickname="updateScenarioByName") def put(self, name): """ @description: update a single scenario by name @param body: fields to be updated - @type body: L{string} + @type body: L{ScenarioUpdateRequest} @in body: body @rtype: L{Scenario} @return 200: update success @raise 404: scenario not exist @raise 403: nothing to update """ - pass + query = {'name': name} + db_keys = ['name'] + self._update(query, db_keys) + + @swagger.operation(nickname="deleteScenarioByName") + def delete(self, name): + """ + @description: delete a scenario by name + @return 200: delete success + @raise 404: scenario not exist: + """ + + query = {'name': name} + self._delete(query) + + def _update_query(self, keys, data): + query = dict() + equal = True + if self._is_rename(): + new = self._term.get('name') + if data.name != new: + equal = False + query['name'] = new + + return equal, query + + def _update_requests(self, data): + updates = { + ('name', 'update'): self._update_requests_rename, + ('installer', 'add'): self._update_requests_add_installer, + ('installer', 'delete'): self._update_requests_delete_installer, + ('version', 'add'): self._update_requests_add_version, + ('version', 'delete'): self._update_requests_delete_version, + ('owner', 'update'): self._update_requests_change_owner, + ('project', 'add'): self._update_requests_add_project, + ('project', 'delete'): self._update_requests_delete_project, + ('customs', 'add'): self._update_requests_add_customs, + ('customs', 'delete'): self._update_requests_delete_customs, + ('score', 'add'): self._update_requests_add_score, + ('trust_indicator', 'add'): self._update_requests_add_ti, + } + + updates[(self._field, self._op)](data) + + return data.format() + + def _iter_installers(xstep): + def magic(self, data): + [xstep(self, installer) + for installer in self._filter_installers(data.installers)] + return magic + + def _iter_versions(xstep): + def magic(self, installer): + [xstep(self, version) + for version in (self._filter_versions(installer.versions))] + return magic + + def _iter_projects(xstep): + def magic(self, version): + [xstep(self, project) + for project in (self._filter_projects(version.projects))] + return magic + + def _update_requests_rename(self, data): + data.name = self._term.get('name') + + def _update_requests_add_installer(self, data): + data.installers.append(models.ScenarioInstaller.from_dict(self._term)) + + def _update_requests_delete_installer(self, data): + data.installers = self._remove_installers(data.installers) + + @_iter_installers + def _update_requests_add_version(self, installer): + installer.versions.append(models.ScenarioVersion.from_dict(self._term)) + + @_iter_installers + def _update_requests_delete_version(self, installer): + installer.versions = self._remove_versions(installer.versions) + + @_iter_installers + @_iter_versions + def _update_requests_change_owner(self, version): + version.owner = self._term.get('owner') + + @_iter_installers + @_iter_versions + def _update_requests_add_project(self, version): + version.projects.append(models.ScenarioProject.from_dict(self._term)) + + @_iter_installers + @_iter_versions + def _update_requests_delete_project(self, version): + version.projects = self._remove_projects(version.projects) + + @_iter_installers + @_iter_versions + @_iter_projects + def _update_requests_add_customs(self, project): + project.customs = list(set(project.customs + self._term)) + + @_iter_installers + @_iter_versions + @_iter_projects + def _update_requests_delete_customs(self, project): + project.customs = filter( + lambda f: f not in self._term, + project.customs) + + @_iter_installers + @_iter_versions + @_iter_projects + def _update_requests_add_score(self, project): + project.scores.append( + models.ScenarioScore.from_dict(self._term)) + + @_iter_installers + @_iter_versions + @_iter_projects + def _update_requests_add_ti(self, project): + project.trust_indicators.append( + models.ScenarioTI.from_dict(self._term)) + + def _is_rename(self): + return self._field == 'name' and self._op == 'update' + + def _remove_installers(self, installers): + return self._remove('installer', installers) + + def _filter_installers(self, installers): + return self._filter('installer', installers) + + def _remove_versions(self, versions): + return self._remove('version', versions) + + def _filter_versions(self, versions): + return self._filter('version', versions) + + def _remove_projects(self, projects): + return self._remove('project', projects) + + def _filter_projects(self, projects): + return self._filter('project', projects) + + def _remove(self, field, fields): + return filter( + lambda f: getattr(f, field) != self._locate.get(field), + fields) + + def _filter(self, field, fields): + return filter( + lambda f: getattr(f, field) == self._locate.get(field), + fields) + + @property + def _field(self): + return self.json_args.get('field') + + @property + def _op(self): + return self.json_args.get('op') + + @property + def _locate(self): + return self.json_args.get('locate') + + @property + def _term(self): + return self.json_args.get('term') diff --git a/utils/test/testapi/opnfv_testapi/resources/scenario_models.py b/utils/test/testapi/opnfv_testapi/resources/scenario_models.py index b4bb3634b..b84accf4d 100644 --- a/utils/test/testapi/opnfv_testapi/resources/scenario_models.py +++ b/utils/test/testapi/opnfv_testapi/resources/scenario_models.py @@ -2,6 +2,14 @@ import models from opnfv_testapi.tornado_swagger import swagger +def list_default(value): + return value if value else list() + + +def dict_default(value): + return value if value else dict() + + @swagger.model() class ScenarioTI(models.ModelBase): def __init__(self, date=None, status='silver'): @@ -11,7 +19,7 @@ class ScenarioTI(models.ModelBase): @swagger.model() class ScenarioScore(models.ModelBase): - def __init__(self, date=None, score=''): + def __init__(self, date=None, score='0'): self.date = date self.score = score @@ -27,14 +35,37 @@ class ScenarioProject(models.ModelBase): @ptype trust_indicators: C{list} of L{ScenarioTI} """ def __init__(self, - name='', + project='', customs=None, scores=None, trust_indicators=None): - self.name = name - self.customs = customs - self.scores = scores - self.trust_indicator = trust_indicators + self.project = project + self.customs = list_default(customs) + self.scores = list_default(scores) + self.trust_indicators = list_default(trust_indicators) + + @staticmethod + def attr_parser(): + return {'scores': ScenarioScore, + 'trust_indicators': ScenarioTI} + + def __eq__(self, other): + return [self.project == other.project and + self._customs_eq(other) and + self._scores_eq(other) and + self._ti_eq(other)] + + def __ne__(self, other): + return not self.__eq__(other) + + def _customs_eq(self, other): + return set(self.customs) == set(other.customs) + + def _scores_eq(self, other): + return set(self.scores) == set(other.scores) + + def _ti_eq(self, other): + return set(self.trust_indicators) == set(other.trust_indicators) @swagger.model() @@ -43,9 +74,28 @@ class ScenarioVersion(models.ModelBase): @property projects: @ptype projects: C{list} of L{ScenarioProject} """ - def __init__(self, version, projects=None): + def __init__(self, version=None, projects=None): self.version = version - self.projects = projects + self.projects = list_default(projects) + + @staticmethod + def attr_parser(): + return {'projects': ScenarioProject} + + def __eq__(self, other): + return [self.version == other.version and self._projects_eq(other)] + + def __ne__(self, other): + return not self.__eq__(other) + + def _projects_eq(self, other): + for s_project in self.projects: + for o_project in other.projects: + if s_project.project == o_project.project: + if s_project != o_project: + return False + + return True @swagger.model() @@ -54,10 +104,28 @@ class ScenarioInstaller(models.ModelBase): @property versions: @ptype versions: C{list} of L{ScenarioVersion} """ - def __init__(self, installer=None, owner=None, versions=None): + def __init__(self, installer=None, versions=None): self.installer = installer - self.owner = owner - self.versions = versions if versions else list() + self.versions = list_default(versions) + + @staticmethod + def attr_parser(): + return {'versions': ScenarioVersion} + + def __eq__(self, other): + return [self.installer == other.installer and self._versions_eq(other)] + + def __ne__(self, other): + return not self.__eq__(other) + + def _versions_eq(self, other): + for s_version in self.versions: + for o_version in other.versions: + if s_version.version == o_version.version: + if s_version != o_version: + return False + + return True @swagger.model() @@ -68,7 +136,26 @@ class ScenarioCreateRequest(models.ModelBase): """ def __init__(self, name='', installers=None): self.name = name - self.installers = installers if installers else list() + self.installers = list_default(installers) + + @staticmethod + def attr_parser(): + return {'installers': ScenarioInstaller} + + +@swagger.model() +class ScenarioUpdateRequest(models.ModelBase): + """ + @property field: update field + @property op: add/delete/update + @property locate: information used to locate the field + @property term: new value + """ + def __init__(self, field=None, op=None, locate=None, term=None): + self.field = field + self.op = op + self.locate = dict_default(locate) + self.term = dict_default(term) @swagger.model() @@ -81,7 +168,26 @@ class Scenario(models.ModelBase): self.name = name self._id = _id self.creation_date = create_date - self.installers = installers if installers else list() + self.installers = list_default(installers) + + @staticmethod + def attr_parser(): + return {'installers': ScenarioInstaller} + + def __ne__(self, other): + return not self.__eq__(other) + + def __eq__(self, other): + return [self.name == other.name and self._installers_eq(other)] + + def _installers_eq(self, other): + for s_install in self.installers: + for o_install in other.installers: + if s_install.installer == o_install.installer: + if s_install != o_install: + return False + + return True @swagger.model() diff --git a/utils/test/testapi/opnfv_testapi/resources/testcase_handlers.py b/utils/test/testapi/opnfv_testapi/resources/testcase_handlers.py index 3692b164f..3debd6918 100644 --- a/utils/test/testapi/opnfv_testapi/resources/testcase_handlers.py +++ b/utils/test/testapi/opnfv_testapi/resources/testcase_handlers.py @@ -6,23 +6,23 @@ # which accompanies this distribution, and is available at # http://www.apache.org/licenses/LICENSE-2.0 ############################################################################## -from opnfv_testapi.common.constants import HTTP_FORBIDDEN -from opnfv_testapi.resources.handlers import GenericApiHandler -from opnfv_testapi.resources.testcase_models import Testcase +from opnfv_testapi.common import constants +from opnfv_testapi.resources import handlers +from opnfv_testapi.resources import testcase_models from opnfv_testapi.tornado_swagger import swagger -class GenericTestcaseHandler(GenericApiHandler): +class GenericTestcaseHandler(handlers.GenericApiHandler): def __init__(self, application, request, **kwargs): super(GenericTestcaseHandler, self).__init__(application, request, **kwargs) self.table = self.db_testcases - self.table_cls = Testcase + self.table_cls = testcase_models.Testcase class TestcaseCLHandler(GenericTestcaseHandler): - @swagger.operation(nickname="List all TestCases by project_name") + @swagger.operation(nickname="listAllTestCases") def get(self, project_name): """ @description: list all testcases of a project by project_name @@ -34,7 +34,7 @@ class TestcaseCLHandler(GenericTestcaseHandler): query['project_name'] = project_name self._list(query) - @swagger.operation(nickname="Create a TestCase by project_name") + @swagger.operation(nickname="createTestCase") def post(self, project_name): """ @description: create a testcase of a project by project_name @@ -58,12 +58,12 @@ class TestcaseCLHandler(GenericTestcaseHandler): def p_error(data): message = 'Could not find project [{}]'.format(data.project_name) - return HTTP_FORBIDDEN, message + return constants.HTTP_FORBIDDEN, message def tc_error(data): message = '{} already exists as a testcase in project {}'\ .format(data.name, data.project_name) - return HTTP_FORBIDDEN, message + return constants.HTTP_FORBIDDEN, message miss_checks = ['name'] db_checks = [(self.db_projects, True, p_query, p_error), @@ -72,7 +72,7 @@ class TestcaseCLHandler(GenericTestcaseHandler): class TestcaseGURHandler(GenericTestcaseHandler): - @swagger.operation(nickname='Get a TestCase by project and case name') + @swagger.operation(nickname='getTestCaseByName') def get(self, project_name, case_name): """ @description: get a single testcase @@ -86,7 +86,7 @@ class TestcaseGURHandler(GenericTestcaseHandler): query["name"] = case_name self._get_one(query) - @swagger.operation(nickname="Update a TestCase by project and case name") + @swagger.operation(nickname="updateTestCaseByName") def put(self, project_name, case_name): """ @description: update a single testcase @@ -104,7 +104,7 @@ class TestcaseGURHandler(GenericTestcaseHandler): db_keys = ['name', 'project_name'] self._update(query, db_keys) - @swagger.operation(nickname='Delete a TestCase by project and case name') + @swagger.operation(nickname='deleteTestCaseByName') def delete(self, project_name, case_name): """ @description: delete a testcase by project_name and case_name diff --git a/utils/test/testapi/opnfv_testapi/router/url_mappings.py b/utils/test/testapi/opnfv_testapi/router/url_mappings.py index 0ae3c31c3..39cf006af 100644 --- a/utils/test/testapi/opnfv_testapi/router/url_mappings.py +++ b/utils/test/testapi/opnfv_testapi/router/url_mappings.py @@ -6,37 +6,34 @@ # which accompanies this distribution, and is available at # http://www.apache.org/licenses/LICENSE-2.0 ############################################################################## -from opnfv_testapi.resources.handlers import VersionHandler -from opnfv_testapi.resources.testcase_handlers import TestcaseCLHandler, \ - TestcaseGURHandler -from opnfv_testapi.resources.pod_handlers import PodCLHandler, PodGURHandler -from opnfv_testapi.resources.project_handlers import ProjectCLHandler, \ - ProjectGURHandler -from opnfv_testapi.resources.result_handlers import ResultsCLHandler, \ - ResultsGURHandler -from opnfv_testapi.resources.scenario_handlers import ScenariosCLHandler -from opnfv_testapi.resources.scenario_handlers import ScenarioGURHandler +from opnfv_testapi.resources import handlers +from opnfv_testapi.resources import pod_handlers +from opnfv_testapi.resources import project_handlers +from opnfv_testapi.resources import result_handlers +from opnfv_testapi.resources import scenario_handlers +from opnfv_testapi.resources import testcase_handlers mappings = [ # GET /versions => GET API version - (r"/versions", VersionHandler), + (r"/versions", handlers.VersionHandler), # few examples: # GET /api/v1/pods => Get all pods # GET /api/v1/pods/1 => Get details on POD 1 - (r"/api/v1/pods", PodCLHandler), - (r"/api/v1/pods/([^/]+)", PodGURHandler), + (r"/api/v1/pods", pod_handlers.PodCLHandler), + (r"/api/v1/pods/([^/]+)", pod_handlers.PodGURHandler), # few examples: # GET /projects # GET /projects/yardstick - (r"/api/v1/projects", ProjectCLHandler), - (r"/api/v1/projects/([^/]+)", ProjectGURHandler), + (r"/api/v1/projects", project_handlers.ProjectCLHandler), + (r"/api/v1/projects/([^/]+)", project_handlers.ProjectGURHandler), # few examples # GET /projects/qtip/cases => Get cases for qtip - (r"/api/v1/projects/([^/]+)/cases", TestcaseCLHandler), - (r"/api/v1/projects/([^/]+)/cases/([^/]+)", TestcaseGURHandler), + (r"/api/v1/projects/([^/]+)/cases", testcase_handlers.TestcaseCLHandler), + (r"/api/v1/projects/([^/]+)/cases/([^/]+)", + testcase_handlers.TestcaseGURHandler), # new path to avoid a long depth # GET /results?project=functest&case=keystone.catalog&pod=1 @@ -44,10 +41,10 @@ mappings = [ # POST /results => # Push results with mandatory request payload parameters # (project, case, and pod) - (r"/api/v1/results", ResultsCLHandler), - (r"/api/v1/results/([^/]+)", ResultsGURHandler), + (r"/api/v1/results", result_handlers.ResultsCLHandler), + (r"/api/v1/results/([^/]+)", result_handlers.ResultsGURHandler), # scenarios - (r"/api/v1/scenarios", ScenariosCLHandler), - (r"/api/v1/scenarios/([^/]+)", ScenarioGURHandler), + (r"/api/v1/scenarios", scenario_handlers.ScenariosCLHandler), + (r"/api/v1/scenarios/([^/]+)", scenario_handlers.ScenarioGURHandler), ] diff --git a/modules/opnfv/installer_adapters/fuel/__init__.py b/utils/test/testapi/opnfv_testapi/tests/unit/common/__init__.py index e69de29bb..e69de29bb 100644 --- a/modules/opnfv/installer_adapters/fuel/__init__.py +++ b/utils/test/testapi/opnfv_testapi/tests/unit/common/__init__.py diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/common/noparam.ini b/utils/test/testapi/opnfv_testapi/tests/unit/common/noparam.ini new file mode 100644 index 000000000..fda2a09e9 --- /dev/null +++ b/utils/test/testapi/opnfv_testapi/tests/unit/common/noparam.ini @@ -0,0 +1,16 @@ +# to add a new parameter in the config file, +# the CONF object in config.ini must be updated +[mongo] +# URL of the mongo DB +# Mongo auth url => mongodb://user1:pwd1@host1/?authSource=db1 +url = mongodb://127.0.0.1:27017/ + +[api] +# Listening port +port = 8000 +# With debug_on set to true, error traces will be shown in HTTP responses +debug = True +authenticate = False + +[swagger] +base_url = http://localhost:8000 diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/common/normal.ini b/utils/test/testapi/opnfv_testapi/tests/unit/common/normal.ini new file mode 100644 index 000000000..77cc6c6ee --- /dev/null +++ b/utils/test/testapi/opnfv_testapi/tests/unit/common/normal.ini @@ -0,0 +1,17 @@ +# to add a new parameter in the config file, +# the CONF object in config.ini must be updated +[mongo] +# URL of the mongo DB +# Mongo auth url => mongodb://user1:pwd1@host1/?authSource=db1 +url = mongodb://127.0.0.1:27017/ +dbname = test_results_collection + +[api] +# Listening port +port = 8000 +# With debug_on set to true, error traces will be shown in HTTP responses +debug = True +authenticate = False + +[swagger] +base_url = http://localhost:8000 diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/common/nosection.ini b/utils/test/testapi/opnfv_testapi/tests/unit/common/nosection.ini new file mode 100644 index 000000000..9988fc0a4 --- /dev/null +++ b/utils/test/testapi/opnfv_testapi/tests/unit/common/nosection.ini @@ -0,0 +1,11 @@ +# to add a new parameter in the config file, +# the CONF object in config.ini must be updated +[api] +# Listening port +port = 8000 +# With debug_on set to true, error traces will be shown in HTTP responses +debug = True +authenticate = False + +[swagger] +base_url = http://localhost:8000 diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/common/notboolean.ini b/utils/test/testapi/opnfv_testapi/tests/unit/common/notboolean.ini new file mode 100644 index 000000000..b3f327670 --- /dev/null +++ b/utils/test/testapi/opnfv_testapi/tests/unit/common/notboolean.ini @@ -0,0 +1,17 @@ +# to add a new parameter in the config file, +# the CONF object in config.ini must be updated +[mongo] +# URL of the mongo DB +# Mongo auth url => mongodb://user1:pwd1@host1/?authSource=db1 +url = mongodb://127.0.0.1:27017/ +dbname = test_results_collection + +[api] +# Listening port +port = 8000 +# With debug_on set to true, error traces will be shown in HTTP responses +debug = True +authenticate = notboolean + +[swagger] +base_url = http://localhost:8000 diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/common/notint.ini b/utils/test/testapi/opnfv_testapi/tests/unit/common/notint.ini new file mode 100644 index 000000000..d1b752a34 --- /dev/null +++ b/utils/test/testapi/opnfv_testapi/tests/unit/common/notint.ini @@ -0,0 +1,17 @@ +# to add a new parameter in the config file, +# the CONF object in config.ini must be updated +[mongo] +# URL of the mongo DB +# Mongo auth url => mongodb://user1:pwd1@host1/?authSource=db1 +url = mongodb://127.0.0.1:27017/ +dbname = test_results_collection + +[api] +# Listening port +port = notint +# With debug_on set to true, error traces will be shown in HTTP responses +debug = True +authenticate = False + +[swagger] +base_url = http://localhost:8000 diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/common/test_config.py b/utils/test/testapi/opnfv_testapi/tests/unit/common/test_config.py new file mode 100644 index 000000000..aaff6bb91 --- /dev/null +++ b/utils/test/testapi/opnfv_testapi/tests/unit/common/test_config.py @@ -0,0 +1,36 @@ +import ConfigParser +import os + +import pytest + +from opnfv_testapi.common import config + + +@pytest.fixture() +def config_dir(): + return os.path.dirname(__file__) + + +@pytest.mark.parametrize('exception, config_file, excepted', [ + (config.ParseError, None, '/etc/opnfv_testapi/config.ini not found'), + (ConfigParser.NoSectionError, 'nosection.ini', 'No section:'), + (config.ParseError, 'noparam.ini', 'No parameter:'), + (config.ParseError, 'notint.ini', 'Not int:'), + (config.ParseError, 'notboolean.ini', 'Not boolean:')]) +def pytest_config_exceptions(config_dir, exception, config_file, excepted): + file = '{}/{}'.format(config_dir, config_file) if config_file else None + with pytest.raises(exception) as error: + config.APIConfig().parse(file) + assert excepted in str(error.value) + + +def test_config_success(): + config_dir = os.path.join(os.path.dirname(__file__), + '../../../../etc/config.ini') + conf = config.APIConfig().parse(config_dir) + assert conf.mongo_url == 'mongodb://127.0.0.1:27017/' + assert conf.mongo_dbname == 'test_results_collection' + assert conf.api_port == 8000 + assert conf.api_debug_on is True + assert conf.api_authenticate_on is False + assert conf.swagger_base_url == 'http://localhost:8000' diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/fake_pymongo.py b/utils/test/testapi/opnfv_testapi/tests/unit/fake_pymongo.py index d86d8eadf..ef74a0857 100644 --- a/utils/test/testapi/opnfv_testapi/tests/unit/fake_pymongo.py +++ b/utils/test/testapi/opnfv_testapi/tests/unit/fake_pymongo.py @@ -55,7 +55,8 @@ class MemCursor(object): class MemDb(object): - def __init__(self): + def __init__(self, name): + self.name = name self.contents = [] pass @@ -109,8 +110,59 @@ class MemDb(object): return True return False - @staticmethod - def _in(content, *args): + def _in(self, content, *args): + if self.name == 'scenarios': + return self._in_scenarios(content, *args) + else: + return self._in_others(content, *args) + + def _in_scenarios_installer(self, installer, content): + hit = False + for s_installer in content['installers']: + if installer == s_installer['installer']: + hit = True + + return hit + + def _in_scenarios_version(self, version, content): + hit = False + for s_installer in content['installers']: + for s_version in s_installer['versions']: + if version == s_version['version']: + hit = True + return hit + + def _in_scenarios_project(self, project, content): + hit = False + for s_installer in content['installers']: + for s_version in s_installer['versions']: + for s_project in s_version['projects']: + if project == s_project['project']: + hit = True + + return hit + + def _in_scenarios(self, content, *args): + for arg in args: + for k, v in arg.iteritems(): + if k == 'installers': + for inner in v.values(): + for i_k, i_v in inner.iteritems(): + if i_k == 'installer': + return self._in_scenarios_installer(i_v, + content) + elif i_k == 'versions.version': + return self._in_scenarios_version(i_v, + content) + elif i_k == 'versions.projects.project': + return self._in_scenarios_project(i_v, + content) + elif content.get(k, None) != v: + return False + + return True + + def _in_others(self, content, *args): for arg in args: for k, v in arg.iteritems(): if k == 'start_date': @@ -185,8 +237,9 @@ def __getattr__(name): return globals()[name] -pods = MemDb() -projects = MemDb() -testcases = MemDb() -results = MemDb() -scenarios = MemDb() +pods = MemDb('pods') +projects = MemDb('projects') +testcases = MemDb('testcases') +results = MemDb('results') +scenarios = MemDb('scenarios') +tokens = MemDb('tokens') diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/scenario-create.json b/utils/test/testapi/opnfv_testapi/tests/unit/scenario-c1.json index eba8b6c0a..187802215 100644 --- a/utils/test/testapi/opnfv_testapi/tests/unit/scenario-create.json +++ b/utils/test/testapi/opnfv_testapi/tests/unit/scenario-c1.json @@ -35,4 +35,4 @@ ] } ] -}
\ No newline at end of file +} diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/scenario-c2.json b/utils/test/testapi/opnfv_testapi/tests/unit/scenario-c2.json new file mode 100644 index 000000000..b6a3b83ab --- /dev/null +++ b/utils/test/testapi/opnfv_testapi/tests/unit/scenario-c2.json @@ -0,0 +1,73 @@ +{ + "name": "odl_2-nofeature-ha", + "installers": + [ + { + "installer": "fuel", + "versions": + [ + { + "owner": "Lucky", + "version": "colorado", + "projects": + [ + { + "project": "functest", + "customs": [ "healthcheck", "vping_ssh"], + "scores": [], + "trust_indicators": [ + { + "date": "2017-01-18 22:46:44", + "status": "silver" + } + + ] + }, + { + "project": "yardstick", + "customs": ["suite-a"], + "scores": [ + { + "date": "2017-01-08 22:46:44", + "score": "0" + } + ], + "trust_indicators": [ + { + "date": "2017-01-18 22:46:44", + "status": "gold" + } + ] + } + ] + }, + { + "owner": "Luke", + "version": "colorado", + "projects": + [ + { + "project": "functest", + "customs": [ "healthcheck", "vping_ssh"], + "scores": + [ + { + "date": "2017-01-09 22:46:44", + "score": "11/14" + } + + ], + "trust_indicators": [] + }, + { + "project": "yardstick", + "customs": [], + "scores": [], + "trust_indicators": [] + } + ] + } + ] + } + ] +} diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/test_base.py b/utils/test/testapi/opnfv_testapi/tests/unit/test_base.py index 9343ab2fb..b955f4a5a 100644 --- a/utils/test/testapi/opnfv_testapi/tests/unit/test_base.py +++ b/utils/test/testapi/opnfv_testapi/tests/unit/test_base.py @@ -7,21 +7,23 @@ # http://www.apache.org/licenses/LICENSE-2.0 ############################################################################## import json +from os import path -from tornado.web import Application -from tornado.testing import AsyncHTTPTestCase +import mock +from tornado import testing -from opnfv_testapi.router import url_mappings -from opnfv_testapi.resources.models import CreateResponse import fake_pymongo +from opnfv_testapi.cmd import server +from opnfv_testapi.resources import models -class TestBase(AsyncHTTPTestCase): +class TestBase(testing.AsyncHTTPTestCase): headers = {'Content-Type': 'application/json; charset=UTF-8'} def setUp(self): + self._patch_server() self.basePath = '' - self.create_res = CreateResponse + self.create_res = models.CreateResponse self.get_res = None self.list_res = None self.update_res = None @@ -30,12 +32,24 @@ class TestBase(AsyncHTTPTestCase): self.addCleanup(self._clear) super(TestBase, self).setUp() + def tearDown(self): + self.db_patcher.stop() + + def _patch_server(self): + server.parse_config([ + '--config-file', + path.join(path.dirname(__file__), 'common/normal.ini') + ]) + self.db_patcher = mock.patch('opnfv_testapi.cmd.server.get_db', + self._fake_pymongo) + self.db_patcher.start() + + @staticmethod + def _fake_pymongo(): + return fake_pymongo + def get_app(self): - return Application( - url_mappings.mappings, - db=fake_pymongo, - debug=True, - ) + return server.make_app() def create_d(self, *args): return self.create(self.req_d, *args) @@ -47,11 +61,11 @@ class TestBase(AsyncHTTPTestCase): return self.create_help(self.basePath, req, *args) def create_help(self, uri, req, *args): - if req and not isinstance(req, str): - req = json.dumps(req.format()) + if req and not isinstance(req, str) and hasattr(req, 'format'): + req = req.format() res = self.fetch(self._update_uri(uri, *args), method='POST', - body=req if req else json.dumps(None), + body=json.dumps(req), headers=self.headers) return self._get_return(res, self.create_res) @@ -97,7 +111,7 @@ class TestBase(AsyncHTTPTestCase): return uri.count('%s') def _get_query_uri(self, query): - return self.basePath + '?' + query + return self.basePath + '?' + query if query else self.basePath def _get_uri(self, *args): return self._update_uri(self.basePath, *args) diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/test_fake_pymongo.py b/utils/test/testapi/opnfv_testapi/tests/unit/test_fake_pymongo.py index 5f50ba867..7c43fca62 100644 --- a/utils/test/testapi/opnfv_testapi/tests/unit/test_fake_pymongo.py +++ b/utils/test/testapi/opnfv_testapi/tests/unit/test_fake_pymongo.py @@ -9,13 +9,13 @@ import unittest from tornado import gen -from tornado.testing import AsyncHTTPTestCase, gen_test -from tornado.web import Application +from tornado import testing +from tornado import web import fake_pymongo -class MyTest(AsyncHTTPTestCase): +class MyTest(testing.AsyncHTTPTestCase): def setUp(self): super(MyTest, self).setUp() self.db = fake_pymongo @@ -23,7 +23,7 @@ class MyTest(AsyncHTTPTestCase): self.io_loop.run_sync(self.fixture_setup) def get_app(self): - return Application() + return web.Application() @gen.coroutine def fixture_setup(self): @@ -32,13 +32,13 @@ class MyTest(AsyncHTTPTestCase): yield self.db.pods.insert({'_id': '1', 'name': 'test1'}) yield self.db.pods.insert({'name': 'test2'}) - @gen_test + @testing.gen_test def test_find_one(self): user = yield self.db.pods.find_one({'name': 'test1'}) self.assertEqual(user, self.test1) self.db.pods.remove() - @gen_test + @testing.gen_test def test_find(self): cursor = self.db.pods.find() names = [] @@ -47,7 +47,7 @@ class MyTest(AsyncHTTPTestCase): names.append(ob.get('name')) self.assertItemsEqual(names, ['test1', 'test2']) - @gen_test + @testing.gen_test def test_update(self): yield self.db.pods.update({'_id': '1'}, {'name': 'new_test1'}) user = yield self.db.pods.find_one({'_id': '1'}) @@ -71,7 +71,7 @@ class MyTest(AsyncHTTPTestCase): None, check_keys=False) - @gen_test + @testing.gen_test def test_remove(self): yield self.db.pods.remove({'_id': '1'}) user = yield self.db.pods.find_one({'_id': '1'}) @@ -104,7 +104,7 @@ class MyTest(AsyncHTTPTestCase): def _insert_assert(self, docs, error=None, **kwargs): self._db_assert('insert', error, docs, **kwargs) - @gen_test + @testing.gen_test def _db_assert(self, method, error, *args, **kwargs): name_error = None try: diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/test_pod.py b/utils/test/testapi/opnfv_testapi/tests/unit/test_pod.py index a1184d554..922bd46e2 100644 --- a/utils/test/testapi/opnfv_testapi/tests/unit/test_pod.py +++ b/utils/test/testapi/opnfv_testapi/tests/unit/test_pod.py @@ -8,20 +8,19 @@ ############################################################################## import unittest -from test_base import TestBase -from opnfv_testapi.resources.pod_models import PodCreateRequest, Pod, Pods -from opnfv_testapi.common.constants import HTTP_OK, HTTP_BAD_REQUEST, \ - HTTP_FORBIDDEN, HTTP_NOT_FOUND +from opnfv_testapi.common import constants +from opnfv_testapi.resources import pod_models +import test_base as base -class TestPodBase(TestBase): +class TestPodBase(base.TestBase): def setUp(self): super(TestPodBase, self).setUp() - self.req_d = PodCreateRequest('zte-1', 'virtual', - 'zte pod 1', 'ci-pod') - self.req_e = PodCreateRequest('zte-2', 'metal', 'zte pod 2') - self.get_res = Pod - self.list_res = Pods + self.req_d = pod_models.PodCreateRequest('zte-1', 'virtual', + 'zte pod 1', 'ci-pod') + self.req_e = pod_models.PodCreateRequest('zte-2', 'metal', 'zte pod 2') + self.get_res = pod_models.Pod + self.list_res = pod_models.Pods self.basePath = '/api/v1/pods' def assert_get_body(self, pod, req=None): @@ -38,36 +37,36 @@ class TestPodBase(TestBase): class TestPodCreate(TestPodBase): def test_withoutBody(self): (code, body) = self.create() - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) def test_emptyName(self): - req_empty = PodCreateRequest('') + req_empty = pod_models.PodCreateRequest('') (code, body) = self.create(req_empty) - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) self.assertIn('name missing', body) def test_noneName(self): - req_none = PodCreateRequest(None) + req_none = pod_models.PodCreateRequest(None) (code, body) = self.create(req_none) - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) self.assertIn('name missing', body) def test_success(self): code, body = self.create_d() - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) self.assert_create_body(body) def test_alreadyExist(self): self.create_d() code, body = self.create_d() - self.assertEqual(code, HTTP_FORBIDDEN) + self.assertEqual(code, constants.HTTP_FORBIDDEN) self.assertIn('already exists', body) class TestPodGet(TestPodBase): def test_notExist(self): code, body = self.get('notExist') - self.assertEqual(code, HTTP_NOT_FOUND) + self.assertEqual(code, constants.HTTP_NOT_FOUND) def test_getOne(self): self.create_d() diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/test_project.py b/utils/test/testapi/opnfv_testapi/tests/unit/test_project.py index 327ddf7b2..afd4a6601 100644 --- a/utils/test/testapi/opnfv_testapi/tests/unit/test_project.py +++ b/utils/test/testapi/opnfv_testapi/tests/unit/test_project.py @@ -8,21 +8,21 @@ ############################################################################## import unittest -from test_base import TestBase -from opnfv_testapi.resources.project_models import ProjectCreateRequest, \ - Project, Projects, ProjectUpdateRequest -from opnfv_testapi.common.constants import HTTP_OK, HTTP_BAD_REQUEST, \ - HTTP_FORBIDDEN, HTTP_NOT_FOUND +from opnfv_testapi.common import constants +from opnfv_testapi.resources import project_models +import test_base as base -class TestProjectBase(TestBase): +class TestProjectBase(base.TestBase): def setUp(self): super(TestProjectBase, self).setUp() - self.req_d = ProjectCreateRequest('vping', 'vping-ssh test') - self.req_e = ProjectCreateRequest('doctor', 'doctor test') - self.get_res = Project - self.list_res = Projects - self.update_res = Project + self.req_d = project_models.ProjectCreateRequest('vping', + 'vping-ssh test') + self.req_e = project_models.ProjectCreateRequest('doctor', + 'doctor test') + self.get_res = project_models.Project + self.list_res = project_models.Projects + self.update_res = project_models.Project self.basePath = '/api/v1/projects' def assert_body(self, project, req=None): @@ -37,41 +37,41 @@ class TestProjectBase(TestBase): class TestProjectCreate(TestProjectBase): def test_withoutBody(self): (code, body) = self.create() - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) def test_emptyName(self): - req_empty = ProjectCreateRequest('') + req_empty = project_models.ProjectCreateRequest('') (code, body) = self.create(req_empty) - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) self.assertIn('name missing', body) def test_noneName(self): - req_none = ProjectCreateRequest(None) + req_none = project_models.ProjectCreateRequest(None) (code, body) = self.create(req_none) - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) self.assertIn('name missing', body) def test_success(self): (code, body) = self.create_d() - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) self.assert_create_body(body) def test_alreadyExist(self): self.create_d() (code, body) = self.create_d() - self.assertEqual(code, HTTP_FORBIDDEN) + self.assertEqual(code, constants.HTTP_FORBIDDEN) self.assertIn('already exists', body) class TestProjectGet(TestProjectBase): def test_notExist(self): code, body = self.get('notExist') - self.assertEqual(code, HTTP_NOT_FOUND) + self.assertEqual(code, constants.HTTP_NOT_FOUND) def test_getOne(self): self.create_d() code, body = self.get(self.req_d.name) - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) self.assert_body(body) def test_list(self): @@ -88,23 +88,23 @@ class TestProjectGet(TestProjectBase): class TestProjectUpdate(TestProjectBase): def test_withoutBody(self): code, _ = self.update(None, 'noBody') - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) def test_notFound(self): code, _ = self.update(self.req_e, 'notFound') - self.assertEqual(code, HTTP_NOT_FOUND) + self.assertEqual(code, constants.HTTP_NOT_FOUND) def test_newNameExist(self): self.create_d() self.create_e() code, body = self.update(self.req_e, self.req_d.name) - self.assertEqual(code, HTTP_FORBIDDEN) + self.assertEqual(code, constants.HTTP_FORBIDDEN) self.assertIn("already exists", body) def test_noUpdate(self): self.create_d() code, body = self.update(self.req_d, self.req_d.name) - self.assertEqual(code, HTTP_FORBIDDEN) + self.assertEqual(code, constants.HTTP_FORBIDDEN) self.assertIn("Nothing to update", body) def test_success(self): @@ -112,9 +112,9 @@ class TestProjectUpdate(TestProjectBase): code, body = self.get(self.req_d.name) _id = body._id - req = ProjectUpdateRequest('newName', 'new description') + req = project_models.ProjectUpdateRequest('newName', 'new description') code, body = self.update(req, self.req_d.name) - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) self.assertEqual(_id, body._id) self.assert_body(body, req) @@ -126,16 +126,16 @@ class TestProjectUpdate(TestProjectBase): class TestProjectDelete(TestProjectBase): def test_notFound(self): code, body = self.delete('notFound') - self.assertEqual(code, HTTP_NOT_FOUND) + self.assertEqual(code, constants.HTTP_NOT_FOUND) def test_success(self): self.create_d() code, body = self.delete(self.req_d.name) - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) self.assertEqual(body, '') code, body = self.get(self.req_d.name) - self.assertEqual(code, HTTP_NOT_FOUND) + self.assertEqual(code, constants.HTTP_NOT_FOUND) if __name__ == '__main__': unittest.main() diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/test_result.py b/utils/test/testapi/opnfv_testapi/tests/unit/test_result.py index 10575a9f5..2c7268eb6 100644 --- a/utils/test/testapi/opnfv_testapi/tests/unit/test_result.py +++ b/utils/test/testapi/opnfv_testapi/tests/unit/test_result.py @@ -7,17 +7,15 @@ # http://www.apache.org/licenses/LICENSE-2.0 ############################################################################## import copy -import unittest from datetime import datetime, timedelta +import unittest -from opnfv_testapi.common.constants import HTTP_OK, HTTP_BAD_REQUEST, \ - HTTP_NOT_FOUND -from opnfv_testapi.resources.pod_models import PodCreateRequest -from opnfv_testapi.resources.project_models import ProjectCreateRequest -from opnfv_testapi.resources.result_models import ResultCreateRequest, \ - TestResult, TestResults, ResultUpdateRequest, TI, TIHistory -from opnfv_testapi.resources.testcase_models import TestcaseCreateRequest -from test_base import TestBase +from opnfv_testapi.common import constants +from opnfv_testapi.resources import pod_models +from opnfv_testapi.resources import project_models +from opnfv_testapi.resources import result_models +from opnfv_testapi.resources import testcase_models +import test_base as base class Details(object): @@ -49,7 +47,7 @@ class Details(object): return t -class TestResultBase(TestBase): +class TestResultBase(base.TestBase): def setUp(self): self.pod = 'zte-pod1' self.project = 'functest' @@ -59,34 +57,41 @@ class TestResultBase(TestBase): self.build_tag = 'v3.0' self.scenario = 'odl-l2' self.criteria = 'passed' - self.trust_indicator = TI(0.7) + self.trust_indicator = result_models.TI(0.7) self.start_date = "2016-05-23 07:16:09.477097" self.stop_date = "2016-05-23 07:16:19.477097" self.update_date = "2016-05-24 07:16:19.477097" self.update_step = -0.05 super(TestResultBase, self).setUp() self.details = Details(timestart='0', duration='9s', status='OK') - self.req_d = ResultCreateRequest(pod_name=self.pod, - project_name=self.project, - case_name=self.case, - installer=self.installer, - version=self.version, - start_date=self.start_date, - stop_date=self.stop_date, - details=self.details.format(), - build_tag=self.build_tag, - scenario=self.scenario, - criteria=self.criteria, - trust_indicator=self.trust_indicator) - self.get_res = TestResult - self.list_res = TestResults - self.update_res = TestResult + self.req_d = result_models.ResultCreateRequest( + pod_name=self.pod, + project_name=self.project, + case_name=self.case, + installer=self.installer, + version=self.version, + start_date=self.start_date, + stop_date=self.stop_date, + details=self.details.format(), + build_tag=self.build_tag, + scenario=self.scenario, + criteria=self.criteria, + trust_indicator=self.trust_indicator) + self.get_res = result_models.TestResult + self.list_res = result_models.TestResults + self.update_res = result_models.TestResult self.basePath = '/api/v1/results' - self.req_pod = PodCreateRequest(self.pod, 'metal', 'zte pod 1') - self.req_project = ProjectCreateRequest(self.project, 'vping test') - self.req_testcase = TestcaseCreateRequest(self.case, - '/cases/vping', - 'vping-ssh test') + self.req_pod = pod_models.PodCreateRequest( + self.pod, + 'metal', + 'zte pod 1') + self.req_project = project_models.ProjectCreateRequest( + self.project, + 'vping test') + self.req_testcase = testcase_models.TestcaseCreateRequest( + self.case, + '/cases/vping', + 'vping-ssh test') self.create_help('/api/v1/pods', self.req_pod) self.create_help('/api/v1/projects', self.req_project) self.create_help('/api/v1/projects/%s/cases', @@ -94,7 +99,7 @@ class TestResultBase(TestBase): self.project) def assert_res(self, code, result, req=None): - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) if req is None: req = self.req_d self.assertEqual(result.pod_name, req.pod_name) @@ -129,78 +134,78 @@ class TestResultBase(TestBase): class TestResultCreate(TestResultBase): def test_nobody(self): (code, body) = self.create(None) - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) self.assertIn('no body', body) def test_podNotProvided(self): req = self.req_d req.pod_name = None (code, body) = self.create(req) - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) self.assertIn('pod_name missing', body) def test_projectNotProvided(self): req = self.req_d req.project_name = None (code, body) = self.create(req) - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) self.assertIn('project_name missing', body) def test_testcaseNotProvided(self): req = self.req_d req.case_name = None (code, body) = self.create(req) - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) self.assertIn('case_name missing', body) def test_noPod(self): req = self.req_d req.pod_name = 'notExistPod' (code, body) = self.create(req) - self.assertEqual(code, HTTP_NOT_FOUND) + self.assertEqual(code, constants.HTTP_NOT_FOUND) self.assertIn('Could not find pod', body) def test_noProject(self): req = self.req_d req.project_name = 'notExistProject' (code, body) = self.create(req) - self.assertEqual(code, HTTP_NOT_FOUND) + self.assertEqual(code, constants.HTTP_NOT_FOUND) self.assertIn('Could not find project', body) def test_noTestcase(self): req = self.req_d req.case_name = 'notExistTestcase' (code, body) = self.create(req) - self.assertEqual(code, HTTP_NOT_FOUND) + self.assertEqual(code, constants.HTTP_NOT_FOUND) self.assertIn('Could not find testcase', body) def test_success(self): (code, body) = self.create_d() - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) self.assert_href(body) def test_key_with_doc(self): req = copy.deepcopy(self.req_d) req.details = {'1.name': 'dot_name'} (code, body) = self.create(req) - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) self.assert_href(body) def test_no_ti(self): - req = ResultCreateRequest(pod_name=self.pod, - project_name=self.project, - case_name=self.case, - installer=self.installer, - version=self.version, - start_date=self.start_date, - stop_date=self.stop_date, - details=self.details.format(), - build_tag=self.build_tag, - scenario=self.scenario, - criteria=self.criteria) + req = result_models.ResultCreateRequest(pod_name=self.pod, + project_name=self.project, + case_name=self.case, + installer=self.installer, + version=self.version, + start_date=self.start_date, + stop_date=self.stop_date, + details=self.details.format(), + build_tag=self.build_tag, + scenario=self.scenario, + criteria=self.criteria) (code, res) = self.create(req) _id = res.href.split('/')[-1] - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) code, body = self.get(_id) self.assert_res(code, body, req) @@ -240,7 +245,7 @@ class TestResultGet(TestResultBase): def test_queryPeriodNotInt(self): code, body = self.query(self._set_query('period=a')) - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) self.assertIn('period must be int', body) def test_queryPeriodFail(self): @@ -253,7 +258,7 @@ class TestResultGet(TestResultBase): def test_queryLastNotInt(self): code, body = self.query(self._set_query('last=a')) - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) self.assertIn('last must be int', body) def test_queryLast(self): @@ -292,7 +297,7 @@ class TestResultGet(TestResultBase): req = self._create_changed_date(**kwargs) code, body = self.query(query) if not found: - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) self.assertEqual(0, len(body.results)) else: self.assertEqual(1, len(body.results)) @@ -326,10 +331,11 @@ class TestResultUpdate(TestResultBase): new_ti = copy.deepcopy(self.trust_indicator) new_ti.current += self.update_step - new_ti.histories.append(TIHistory(self.update_date, self.update_step)) + new_ti.histories.append( + result_models.TIHistory(self.update_date, self.update_step)) new_data = copy.deepcopy(self.req_d) new_data.trust_indicator = new_ti - update = ResultUpdateRequest(trust_indicator=new_ti) + update = result_models.ResultUpdateRequest(trust_indicator=new_ti) code, body = self.update(update, _id) self.assertEqual(_id, body._id) self.assert_res(code, body, new_data) diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/test_scenario.py b/utils/test/testapi/opnfv_testapi/tests/unit/test_scenario.py index 8e827813c..7a6e94a93 100644 --- a/utils/test/testapi/opnfv_testapi/tests/unit/test_scenario.py +++ b/utils/test/testapi/opnfv_testapi/tests/unit/test_scenario.py @@ -1,18 +1,21 @@ +from copy import deepcopy +from datetime import datetime import json import os -from opnfv_testapi.common.constants import HTTP_BAD_REQUEST -from opnfv_testapi.common.constants import HTTP_FORBIDDEN -from opnfv_testapi.common.constants import HTTP_OK -from opnfv_testapi.resources.scenario_models import ScenarioCreateRequest -from test_testcase import TestBase +from opnfv_testapi.common import constants +import opnfv_testapi.resources.scenario_models as models +import test_base as base -class TestScenarioBase(TestBase): +class TestScenarioBase(base.TestBase): def setUp(self): super(TestScenarioBase, self).setUp() + self.get_res = models.Scenario + self.list_res = models.Scenarios self.basePath = '/api/v1/scenarios' - self.load_request('scenario-create.json') + self.req_d = self._load_request('scenario-c1.json') + self.req_2 = self._load_request('scenario-c2.json') def tearDown(self): pass @@ -20,36 +23,294 @@ class TestScenarioBase(TestBase): def assert_body(self, project, req=None): pass - def load_request(self, f_req): - with open(os.path.join(os.path.dirname(__file__), f_req), 'r') as f: - self.req_d = json.dumps(json.load(f)) + @staticmethod + def _load_request(f_req): + abs_file = os.path.join(os.path.dirname(__file__), f_req) + with open(abs_file, 'r') as f: + loader = json.load(f) f.close() + return loader + + def create_return_name(self, req): + _, res = self.create(req) + return res.href.split('/')[-1] + + def assert_res(self, code, scenario, req=None): + self.assertEqual(code, constants.HTTP_OK) + if req is None: + req = self.req_d + self.assertIsNotNone(scenario._id) + self.assertIsNotNone(scenario.creation_date) + + scenario == models.Scenario.from_dict(req) + + @staticmethod + def _set_query(*args): + uri = '' + for arg in args: + uri += arg + '&' + return uri[0: -1] + + def _get_and_assert(self, name, req=None): + code, body = self.get(name) + self.assert_res(code, body, req) class TestScenarioCreate(TestScenarioBase): def test_withoutBody(self): (code, body) = self.create() - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) def test_emptyName(self): - req_empty = ScenarioCreateRequest('') + req_empty = models.ScenarioCreateRequest('') (code, body) = self.create(req_empty) - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) self.assertIn('name missing', body) def test_noneName(self): - req_none = ScenarioCreateRequest(None) + req_none = models.ScenarioCreateRequest(None) (code, body) = self.create(req_none) - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) self.assertIn('name missing', body) def test_success(self): (code, body) = self.create_d() - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) self.assert_create_body(body) def test_alreadyExist(self): self.create_d() (code, body) = self.create_d() - self.assertEqual(code, HTTP_FORBIDDEN) + self.assertEqual(code, constants.HTTP_FORBIDDEN) self.assertIn('already exists', body) + + +class TestScenarioGet(TestScenarioBase): + def setUp(self): + super(TestScenarioGet, self).setUp() + self.scenario_1 = self.create_return_name(self.req_d) + self.scenario_2 = self.create_return_name(self.req_2) + + def test_getByName(self): + self._get_and_assert(self.scenario_1, self.req_d) + + def test_getAll(self): + self._query_and_assert(query=None, reqs=[self.req_d, self.req_2]) + + def test_queryName(self): + query = self._set_query('name=nosdn-nofeature-ha') + self._query_and_assert(query, reqs=[self.req_d]) + + def test_queryInstaller(self): + query = self._set_query('installer=apex') + self._query_and_assert(query, reqs=[self.req_d]) + + def test_queryVersion(self): + query = self._set_query('version=master') + self._query_and_assert(query, reqs=[self.req_d]) + + def test_queryProject(self): + query = self._set_query('project=functest') + self._query_and_assert(query, reqs=[self.req_d, self.req_2]) + + def test_queryCombination(self): + query = self._set_query('name=nosdn-nofeature-ha', + 'installer=apex', + 'version=master', + 'project=functest') + + self._query_and_assert(query, reqs=[self.req_d]) + + def _query_and_assert(self, query, found=True, reqs=None): + code, body = self.query(query) + if not found: + self.assertEqual(code, constants.HTTP_OK) + self.assertEqual(0, len(body.scenarios)) + else: + self.assertEqual(len(reqs), len(body.scenarios)) + for req in reqs: + for scenario in body.scenarios: + if req['name'] == scenario.name: + self.assert_res(code, scenario, req) + + +class TestScenarioUpdate(TestScenarioBase): + def setUp(self): + super(TestScenarioUpdate, self).setUp() + self.scenario = self.create_return_name(self.req_d) + + def _execute(set_update): + def magic(self): + update, scenario = set_update(self, deepcopy(self.req_d)) + self._update_and_assert(update, scenario) + return magic + + def test_renameScenario(self): + new_name = 'nosdn-nofeature-noha' + new_scenario = deepcopy(self.req_d) + new_scenario['name'] = new_name + update_req = models.ScenarioUpdateRequest(field='name', + op='update', + locate={}, + term={'name': new_name}) + self._update_and_assert(update_req, new_scenario, new_name) + + @_execute + def test_addInstaller(self, scenario): + add = models.ScenarioInstaller(installer='daisy', versions=list()) + scenario['installers'].append(add.format()) + update = models.ScenarioUpdateRequest(field='installer', + op='add', + locate={}, + term=add.format()) + return update, scenario + + @_execute + def test_deleteInstaller(self, scenario): + scenario['installers'] = filter(lambda f: f['installer'] != 'apex', + scenario['installers']) + + update = models.ScenarioUpdateRequest(field='installer', + op='delete', + locate={'installer': 'apex'}) + return update, scenario + + @_execute + def test_addVersion(self, scenario): + add = models.ScenarioVersion(version='danube', projects=list()) + scenario['installers'][0]['versions'].append(add.format()) + update = models.ScenarioUpdateRequest(field='version', + op='add', + locate={'installer': 'apex'}, + term=add.format()) + return update, scenario + + @_execute + def test_deleteVersion(self, scenario): + scenario['installers'][0]['versions'] = filter( + lambda f: f['version'] != 'master', + scenario['installers'][0]['versions']) + + update = models.ScenarioUpdateRequest(field='version', + op='delete', + locate={'installer': 'apex', + 'version': 'master'}) + return update, scenario + + @_execute + def test_changeOwner(self, scenario): + scenario['installers'][0]['versions'][0]['owner'] = 'lucy' + + update = models.ScenarioUpdateRequest(field='owner', + op='update', + locate={'installer': 'apex', + 'version': 'master'}, + term={'owner': 'lucy'}) + return update, scenario + + @_execute + def test_addProject(self, scenario): + add = models.ScenarioProject(project='qtip').format() + scenario['installers'][0]['versions'][0]['projects'].append(add) + update = models.ScenarioUpdateRequest(field='project', + op='add', + locate={'installer': 'apex', + 'version': 'master'}, + term=add) + return update, scenario + + @_execute + def test_deleteProject(self, scenario): + scenario['installers'][0]['versions'][0]['projects'] = filter( + lambda f: f['project'] != 'functest', + scenario['installers'][0]['versions'][0]['projects']) + + update = models.ScenarioUpdateRequest(field='project', + op='delete', + locate={ + 'installer': 'apex', + 'version': 'master', + 'project': 'functest'}) + return update, scenario + + @_execute + def test_addCustoms(self, scenario): + add = ['odl', 'parser', 'vping_ssh'] + projects = scenario['installers'][0]['versions'][0]['projects'] + functest = filter(lambda f: f['project'] == 'functest', projects)[0] + functest['customs'] = ['healthcheck', 'odl', 'parser', 'vping_ssh'] + update = models.ScenarioUpdateRequest(field='customs', + op='add', + locate={ + 'installer': 'apex', + 'version': 'master', + 'project': 'functest'}, + term=add) + return update, scenario + + @_execute + def test_deleteCustoms(self, scenario): + projects = scenario['installers'][0]['versions'][0]['projects'] + functest = filter(lambda f: f['project'] == 'functest', projects)[0] + functest['customs'] = ['healthcheck'] + update = models.ScenarioUpdateRequest(field='customs', + op='delete', + locate={ + 'installer': 'apex', + 'version': 'master', + 'project': 'functest'}, + term=['vping_ssh']) + return update, scenario + + @_execute + def test_addScore(self, scenario): + add = models.ScenarioScore(date=str(datetime.now()), score='11/12') + projects = scenario['installers'][0]['versions'][0]['projects'] + functest = filter(lambda f: f['project'] == 'functest', projects)[0] + functest['scores'].append(add.format()) + update = models.ScenarioUpdateRequest(field='score', + op='add', + locate={ + 'installer': 'apex', + 'version': 'master', + 'project': 'functest'}, + term=add.format()) + return update, scenario + + @_execute + def test_addTi(self, scenario): + add = models.ScenarioTI(date=str(datetime.now()), status='gold') + projects = scenario['installers'][0]['versions'][0]['projects'] + functest = filter(lambda f: f['project'] == 'functest', projects)[0] + functest['trust_indicators'].append(add.format()) + update = models.ScenarioUpdateRequest(field='trust_indicator', + op='add', + locate={ + 'installer': 'apex', + 'version': 'master', + 'project': 'functest'}, + term=add.format()) + return update, scenario + + def _update_and_assert(self, update_req, new_scenario, name=None): + code, _ = self.update(update_req, self.scenario) + self.assertEqual(code, constants.HTTP_OK) + self._get_and_assert(self._none_default(name, self.scenario), + new_scenario) + + @staticmethod + def _none_default(check, default): + return check if check else default + + +class TestScenarioDelete(TestScenarioBase): + def test_notFound(self): + code, body = self.delete('notFound') + self.assertEqual(code, constants.HTTP_NOT_FOUND) + + def test_success(self): + scenario = self.create_return_name(self.req_d) + code, _ = self.delete(scenario) + self.assertEqual(code, constants.HTTP_OK) + code, _ = self.get(scenario) + self.assertEqual(code, constants.HTTP_NOT_FOUND) diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/test_testcase.py b/utils/test/testapi/opnfv_testapi/tests/unit/test_testcase.py index cb767844a..c0494db5d 100644 --- a/utils/test/testapi/opnfv_testapi/tests/unit/test_testcase.py +++ b/utils/test/testapi/opnfv_testapi/tests/unit/test_testcase.py @@ -6,35 +6,33 @@ # which accompanies this distribution, and is available at # http://www.apache.org/licenses/LICENSE-2.0 ############################################################################## -import unittest import copy +import unittest -from test_base import TestBase -from opnfv_testapi.resources.testcase_models import TestcaseCreateRequest, \ - Testcase, Testcases, TestcaseUpdateRequest -from opnfv_testapi.resources.project_models import ProjectCreateRequest -from opnfv_testapi.common.constants import HTTP_OK, HTTP_BAD_REQUEST, \ - HTTP_FORBIDDEN, HTTP_NOT_FOUND +from opnfv_testapi.common import constants +from opnfv_testapi.resources import project_models +from opnfv_testapi.resources import testcase_models +import test_base as base -class TestCaseBase(TestBase): +class TestCaseBase(base.TestBase): def setUp(self): super(TestCaseBase, self).setUp() - self.req_d = TestcaseCreateRequest('vping_1', - '/cases/vping_1', - 'vping-ssh test') - self.req_e = TestcaseCreateRequest('doctor_1', - '/cases/doctor_1', - 'create doctor') - self.update_d = TestcaseUpdateRequest('vping_1', - 'vping-ssh test', - 'functest') - self.update_e = TestcaseUpdateRequest('doctor_1', - 'create doctor', - 'functest') - self.get_res = Testcase - self.list_res = Testcases - self.update_res = Testcase + self.req_d = testcase_models.TestcaseCreateRequest('vping_1', + '/cases/vping_1', + 'vping-ssh test') + self.req_e = testcase_models.TestcaseCreateRequest('doctor_1', + '/cases/doctor_1', + 'create doctor') + self.update_d = testcase_models.TestcaseUpdateRequest('vping_1', + 'vping-ssh test', + 'functest') + self.update_e = testcase_models.TestcaseUpdateRequest('doctor_1', + 'create doctor', + 'functest') + self.get_res = testcase_models.Testcase + self.list_res = testcase_models.Testcases + self.update_res = testcase_models.Testcase self.basePath = '/api/v1/projects/%s/cases' self.create_project() @@ -57,7 +55,8 @@ class TestCaseBase(TestBase): self.assertIsNotNone(new.creation_date) def create_project(self): - req_p = ProjectCreateRequest('functest', 'vping-ssh test') + req_p = project_models.ProjectCreateRequest('functest', + 'vping-ssh test') self.create_help('/api/v1/projects', req_p) self.project = req_p.name @@ -80,46 +79,46 @@ class TestCaseBase(TestBase): class TestCaseCreate(TestCaseBase): def test_noBody(self): (code, body) = self.create(None, 'vping') - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) def test_noProject(self): code, body = self.create(self.req_d, 'noProject') - self.assertEqual(code, HTTP_FORBIDDEN) + self.assertEqual(code, constants.HTTP_FORBIDDEN) self.assertIn('Could not find project', body) def test_emptyName(self): - req_empty = TestcaseCreateRequest('') + req_empty = testcase_models.TestcaseCreateRequest('') (code, body) = self.create(req_empty, self.project) - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) self.assertIn('name missing', body) def test_noneName(self): - req_none = TestcaseCreateRequest(None) + req_none = testcase_models.TestcaseCreateRequest(None) (code, body) = self.create(req_none, self.project) - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) self.assertIn('name missing', body) def test_success(self): code, body = self.create_d() - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) self.assert_create_body(body, None, self.project) def test_alreadyExist(self): self.create_d() code, body = self.create_d() - self.assertEqual(code, HTTP_FORBIDDEN) + self.assertEqual(code, constants.HTTP_FORBIDDEN) self.assertIn('already exists', body) class TestCaseGet(TestCaseBase): def test_notExist(self): code, body = self.get('notExist') - self.assertEqual(code, HTTP_NOT_FOUND) + self.assertEqual(code, constants.HTTP_NOT_FOUND) def test_getOne(self): self.create_d() code, body = self.get(self.req_d.name) - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) self.assert_body(body) def test_list(self): @@ -136,23 +135,23 @@ class TestCaseGet(TestCaseBase): class TestCaseUpdate(TestCaseBase): def test_noBody(self): code, _ = self.update(case='noBody') - self.assertEqual(code, HTTP_BAD_REQUEST) + self.assertEqual(code, constants.HTTP_BAD_REQUEST) def test_notFound(self): code, _ = self.update(self.update_e, 'notFound') - self.assertEqual(code, HTTP_NOT_FOUND) + self.assertEqual(code, constants.HTTP_NOT_FOUND) def test_newNameExist(self): self.create_d() self.create_e() code, body = self.update(self.update_e, self.req_d.name) - self.assertEqual(code, HTTP_FORBIDDEN) + self.assertEqual(code, constants.HTTP_FORBIDDEN) self.assertIn("already exists", body) def test_noUpdate(self): self.create_d() code, body = self.update(self.update_d, self.req_d.name) - self.assertEqual(code, HTTP_FORBIDDEN) + self.assertEqual(code, constants.HTTP_FORBIDDEN) self.assertIn("Nothing to update", body) def test_success(self): @@ -161,7 +160,7 @@ class TestCaseUpdate(TestCaseBase): _id = body._id code, body = self.update(self.update_e, self.req_d.name) - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) self.assertEqual(_id, body._id) self.assert_update_body(self.req_d, body, self.update_e) @@ -174,22 +173,22 @@ class TestCaseUpdate(TestCaseBase): update = copy.deepcopy(self.update_d) update.description = {'2. change': 'dollar change'} code, body = self.update(update, self.req_d.name) - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) class TestCaseDelete(TestCaseBase): def test_notFound(self): code, body = self.delete('notFound') - self.assertEqual(code, HTTP_NOT_FOUND) + self.assertEqual(code, constants.HTTP_NOT_FOUND) def test_success(self): self.create_d() code, body = self.delete(self.req_d.name) - self.assertEqual(code, HTTP_OK) + self.assertEqual(code, constants.HTTP_OK) self.assertEqual(body, '') code, body = self.get(self.req_d.name) - self.assertEqual(code, HTTP_NOT_FOUND) + self.assertEqual(code, constants.HTTP_NOT_FOUND) if __name__ == '__main__': diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/test_token.py b/utils/test/testapi/opnfv_testapi/tests/unit/test_token.py new file mode 100644 index 000000000..19b9e3e07 --- /dev/null +++ b/utils/test/testapi/opnfv_testapi/tests/unit/test_token.py @@ -0,0 +1,118 @@ +# All rights reserved. This program and the accompanying materials +# are made available under the terms of the Apache License, Version 2.0 +# which accompanies this distribution, and is available at +# http://www.apache.org/licenses/LICENSE-2.0 + +import unittest + +from tornado import web + +import fake_pymongo +from opnfv_testapi.common import constants +from opnfv_testapi.resources import project_models +from opnfv_testapi.router import url_mappings +import test_base as base + + +class TestToken(base.TestBase): + def get_app(self): + return web.Application( + url_mappings.mappings, + db=fake_pymongo, + debug=True, + auth=True + ) + + +class TestTokenCreateProject(TestToken): + def setUp(self): + super(TestTokenCreateProject, self).setUp() + self.req_d = project_models.ProjectCreateRequest('vping') + fake_pymongo.tokens.insert({"access_token": "12345"}) + self.basePath = '/api/v1/projects' + + def test_projectCreateTokenInvalid(self): + self.headers['X-Auth-Token'] = '1234' + code, body = self.create_d() + self.assertEqual(code, constants.HTTP_FORBIDDEN) + self.assertIn('Invalid Token.', body) + + def test_projectCreateTokenUnauthorized(self): + self.headers.pop('X-Auth-Token') + code, body = self.create_d() + self.assertEqual(code, constants.HTTP_UNAUTHORIZED) + self.assertIn('No Authentication Header.', body) + + def test_projectCreateTokenSuccess(self): + self.headers['X-Auth-Token'] = '12345' + code, body = self.create_d() + self.assertEqual(code, constants.HTTP_OK) + + +class TestTokenDeleteProject(TestToken): + def setUp(self): + super(TestTokenDeleteProject, self).setUp() + self.req_d = project_models.ProjectCreateRequest('vping') + fake_pymongo.tokens.insert({"access_token": "12345"}) + self.basePath = '/api/v1/projects' + + def test_projectDeleteTokenIvalid(self): + self.headers['X-Auth-Token'] = '12345' + self.create_d() + self.headers['X-Auth-Token'] = '1234' + code, body = self.delete(self.req_d.name) + self.assertEqual(code, constants.HTTP_FORBIDDEN) + self.assertIn('Invalid Token.', body) + + def test_projectDeleteTokenUnauthorized(self): + self.headers['X-Auth-Token'] = '12345' + self.create_d() + self.headers.pop('X-Auth-Token') + code, body = self.delete(self.req_d.name) + self.assertEqual(code, constants.HTTP_UNAUTHORIZED) + self.assertIn('No Authentication Header.', body) + + def test_projectDeleteTokenSuccess(self): + self.headers['X-Auth-Token'] = '12345' + self.create_d() + code, body = self.delete(self.req_d.name) + self.assertEqual(code, constants.HTTP_OK) + + +class TestTokenUpdateProject(TestToken): + def setUp(self): + super(TestTokenUpdateProject, self).setUp() + self.req_d = project_models.ProjectCreateRequest('vping') + fake_pymongo.tokens.insert({"access_token": "12345"}) + self.basePath = '/api/v1/projects' + + def test_projectUpdateTokenIvalid(self): + self.headers['X-Auth-Token'] = '12345' + self.create_d() + code, body = self.get(self.req_d.name) + self.headers['X-Auth-Token'] = '1234' + req = project_models.ProjectUpdateRequest('newName', 'new description') + code, body = self.update(req, self.req_d.name) + self.assertEqual(code, constants.HTTP_FORBIDDEN) + self.assertIn('Invalid Token.', body) + + def test_projectUpdateTokenUnauthorized(self): + self.headers['X-Auth-Token'] = '12345' + self.create_d() + code, body = self.get(self.req_d.name) + self.headers.pop('X-Auth-Token') + req = project_models.ProjectUpdateRequest('newName', 'new description') + code, body = self.update(req, self.req_d.name) + self.assertEqual(code, constants.HTTP_UNAUTHORIZED) + self.assertIn('No Authentication Header.', body) + + def test_projectUpdateTokenSuccess(self): + self.headers['X-Auth-Token'] = '12345' + self.create_d() + code, body = self.get(self.req_d.name) + req = project_models.ProjectUpdateRequest('newName', 'new description') + code, body = self.update(req, self.req_d.name) + self.assertEqual(code, constants.HTTP_OK) + +if __name__ == '__main__': + unittest.main() diff --git a/utils/test/testapi/opnfv_testapi/tests/unit/test_version.py b/utils/test/testapi/opnfv_testapi/tests/unit/test_version.py index b6fbf45dc..c8f3f5062 100644 --- a/utils/test/testapi/opnfv_testapi/tests/unit/test_version.py +++ b/utils/test/testapi/opnfv_testapi/tests/unit/test_version.py @@ -8,14 +8,14 @@ ############################################################################## import unittest -from test_base import TestBase -from opnfv_testapi.resources.models import Versions +from opnfv_testapi.resources import models +import test_base as base -class TestVersionBase(TestBase): +class TestVersionBase(base.TestBase): def setUp(self): super(TestVersionBase, self).setUp() - self.list_res = Versions + self.list_res = models.Versions self.basePath = '/versions' diff --git a/utils/test/testapi/run_test.sh b/utils/test/testapi/run_test.sh index 9b25f8ffc..4efc7af3b 100755 --- a/utils/test/testapi/run_test.sh +++ b/utils/test/testapi/run_test.sh @@ -1,10 +1,38 @@ -#! /bin/bash +#!/bin/bash -# Before run this script, make sure that testtools and discover -# had been installed in your env -# or else using pip to install them as follows: -# pip install testtools, discover +set -o errexit + +# Get script directory +SCRIPTDIR=`dirname $0` + +echo "Running unit tests..." + +# Creating virtual environment +virtualenv $SCRIPTDIR/testapi_venv +source $SCRIPTDIR/testapi_venv/bin/activate + +# Install requirements +pip install -r $SCRIPTDIR/requirements.txt +pip install coverage +pip install nose>=1.3.1 +pip install pytest +pip install mock find . -type f -name "*.pyc" -delete -testrargs="discover ./opnfv_testapi/tests/unit" -python -m testtools.run $testrargs + +nosetests --with-xunit \ + --with-coverage \ + --cover-erase \ + --cover-package=$SCRIPTDIR/opnfv_testapi/cmd \ + --cover-package=$SCRIPTDIR/opnfv_testapi/common \ + --cover-package=$SCRIPTDIR/opnfv_testapi/resources \ + --cover-package=$SCRIPTDIR/opnfv_testapi/router \ + --cover-xml \ + --cover-html \ + $SCRIPTDIR/opnfv_testapi/tests + +exit_code=$? + +deactivate + +exit $exit_code diff --git a/utils/test/testapi/test-requirements.txt b/utils/test/testapi/test-requirements.txt index ddbdefcfd..4633ad637 100644 --- a/utils/test/testapi/test-requirements.txt +++ b/utils/test/testapi/test-requirements.txt @@ -2,6 +2,10 @@ # of appearance. Changing the order has an impact on the overall integration # process, which may cause wedges in the gate later. -testtools>=1.4.0 -discover -futures
\ No newline at end of file +tox +mock +pytest +pytest-cov +coverage +pykwalify +pip_check_reqs diff --git a/utils/test/testapi/tox.ini b/utils/test/testapi/tox.ini new file mode 100644 index 000000000..81c9dfab1 --- /dev/null +++ b/utils/test/testapi/tox.ini @@ -0,0 +1,41 @@ +# Tox (http://tox.testrun.org/) is a tool for running tests +# in multiple virtualenvs. This configuration file will run the +# test suite on all supported python versions. To use it, "pip install tox" +# and then run "tox" from this directory. + +[tox] +envlist = py27,pep8 +skipsdist = True +sitepackages = True + +[testenv] +usedevelop = True +install_command = pip install -U {opts} {packages} +deps = + -rrequirements.txt + -rtest-requirements.txt +commands= + py.test \ + --basetemp={envtmpdir} \ + --cov \ + {posargs} +setenv= + HOME = {envtmpdir} + PYTHONPATH = {toxinidir} + +[testenv:pep8] +deps = flake8 +commands = flake8 {toxinidir} + +[flake8] +# H803 skipped on purpose per list discussion. +# E123, E125 skipped as they are invalid PEP-8. + +show-source = True +ignore = E123,E125,H803,E501 +builtins = _ +exclude = build,dist,doc,legacy,.eggs,.git,.tox,.venv,testapi_venv,venv + +[pytest] +testpaths = opnfv_testapi/tests +python_functions = test_* diff --git a/utils/test/testapi/update/templates/utils.py b/utils/test/testapi/update/templates/utils.py index a18ff0389..4254fee34 100644 --- a/utils/test/testapi/update/templates/utils.py +++ b/utils/test/testapi/update/templates/utils.py @@ -44,5 +44,5 @@ def main(method, parser): args = parser.parse_args() try: method(args) - except AssertionError, msg: + except AssertionError as msg: print(msg) diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/README.md b/utils/test/vnfcatalogue/VNF_Catalogue/README.md new file mode 100644 index 000000000..32ad65416 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/README.md @@ -0,0 +1,12 @@ +#VNF_Catalogue Nodejs + Jade + MySql server + + +## Quickstart + +First install the dependencies + + ```npm install``` + +Then Start the Server + + ```npm start``` diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/app.js b/utils/test/vnfcatalogue/VNF_Catalogue/app.js new file mode 100644 index 000000000..0f842b62d --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/app.js @@ -0,0 +1,79 @@ +/******************************************************************************* + * Copyright (c) 2017 Kumar Rishabh and others. + * + * All rights reserved. This program and the accompanying materials + * are made available under the terms of the Apache License, Version 2.0 + * which accompanies this distribution, and is available at + * http://www.apache.org/licenses/LICENSE-2.0 + *******************************************************************************/ + +var express = require('express'); +var path = require('path'); +var favicon = require('serve-favicon'); +var logger = require('morgan'); +var cookieParser = require('cookie-parser'); +var bodyParser = require('body-parser'); + +var routes = require('./routes/index'); +var search_projects = require('./routes/search_projects'); + +var app = express(); + +// view engine setup +app.set('views', path.join(__dirname, 'views')); +app.set('view engine', 'jade'); + +// Database +var db = require('mysql2'); + +// uncomment after placing your favicon in /public +//app.use(favicon(__dirname + '/public/favicon.ico')); +app.use(logger('dev')); +app.use(bodyParser.json()); +app.use(bodyParser.urlencoded({ extended: false })); +app.use(cookieParser()); +app.use(express.static(path.join(__dirname, 'public'))); + +// Make our db accessible to our router +app.use(function(req,res,next){ + req.db = db; + next(); +}); + +app.use('/', routes); +app.use('/search_projects', search_projects); + + +// Some Error handling for now #TODO Remove + +/// catch 404 and forwarding to error handler +app.use(function(req, res, next) { + var err = new Error('Not Found'); + err.status = 404; + next(err); +}); + + +// development error handler +// will print stacktrace +if (app.get('env') === 'development') { + app.use(function(err, req, res, next) { + res.status(err.status || 500); + res.render('error', { + message: err.message, + error: err + }); + }); +} + +// production error handler +// no stacktraces leaked to user +app.use(function(err, req, res, next) { + res.status(err.status || 500); + res.render('error', { + message: err.message, + error: {} + }); +}); + +module.exports = app; diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/bin/www b/utils/test/vnfcatalogue/VNF_Catalogue/bin/www new file mode 100644 index 000000000..3cfbf7796 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/bin/www @@ -0,0 +1,9 @@ +#!/usr/bin/env node +var debug = require('debug')('my-application'); +var app = require('../app'); + +app.set('port', process.env.PORT || 3000); + +var server = app.listen(app.get('port'), function() { + debug('Express server listening on port ' + server.address().port); +}); diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/package.json b/utils/test/vnfcatalogue/VNF_Catalogue/package.json new file mode 100644 index 000000000..7c6a86730 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/package.json @@ -0,0 +1,18 @@ +{ + "name": "VNF_Catalogue", + "version": "0.0.1", + "private": true, + "scripts": { + "start": "node ./bin/www" + }, + "dependencies": { + "body-parser": "~1.15.1", + "cookie-parser": "~1.4.3", + "debug": "~2.2.0", + "express": "~4.13.4", + "jade": "~1.11.0", + "morgan": "~1.7.0", + "serve-favicon": "~2.3.0", + "mysql2": "*" + } +}
\ No newline at end of file diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/.DS_Store b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/.DS_Store Binary files differnew file mode 100644 index 000000000..2828ef680 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/.DS_Store diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/LICENSE b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/LICENSE new file mode 100644 index 000000000..44bd03eab --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014-2017 Materialize + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/README.md b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/README.md new file mode 100644 index 000000000..497b01ae0 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/README.md @@ -0,0 +1,49 @@ +![alt tag](https://raw.github.com/dogfalo/materialize/master/images/materialize.gif) +=========== + +[![Travis CI](https://travis-ci.org/Dogfalo/materialize.svg?branch=master)](https://travis-ci.org/Dogfalo/materialize)[![devDependency Status](https://david-dm.org/Dogfalo/materialize/dev-status.svg)](https://david-dm.org/Dogfalo/materialize#info=devDependencies)[![Gitter](https://badges.gitter.im/Join Chat.svg)](https://gitter.im/Dogfalo/materialize?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge) + +[Materialize](http://materializecss.com/), a CSS Framework based on material design + +### Current Version : v0.97.8 + +## Sass Requirements: +- Ruby Sass 3.3+, LibSass 0.6+ + +## Supported Browsers: +Chrome 35+, Firefox 31+, Safari 7+, IE 10+ + +## Changelog +- v0.97.8 (October 30th, 2016) + - **Refactored Modal plugin** + - Tabs now supported in navbar + - Chips data can now be reinitiailized + - Minor side nav fixes + - FAB to toolbar component added + - Fixed dropdown options bug +- v0.97.7 (July 23rd, 2016) + - Basic horizontal cards + - Carousel bug fixes and new features + - Updated sidenav styles and new component + - Meteor package now supports Sass + - Autocomplete form component + - Chips jQuery plugin +- v0.97.6 (April 1st, 2016) + - **Removed deprecated material icons from project** + - **Changed /font directory to /fonts** + - Datepicker and ScrollSpy now compatible with jQuery 2.2.x + - Responsive tables now work with empty cells + - Added focus states to checkboxes, switches, and radio buttons + - Sidenav and Modals no longer cause flicker with scrollbar + - Materialbox overflow and z-index issues fixed + - Added new option for Card actions within a Card reveal +- v0.97.5 (December 21st, 2015) + - Fixed Meteor package crash + + + +## Contributing +[Please read CONTRIBUTING.md for more information](CONTRIBUTING.md) + +## Testing +We use Jasmine as our testing framework and we're trying to write a robust test suite for our components. If you want to help, [here's a starting guide on how to write tests in Jasmine](https://docs.google.com/document/d/1dVM6qGt_b_y9RRhr9X7oZfFydaJIEqB9CT7yekv-4XE/edit?usp=sharing) diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/css/materialize.css b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/css/materialize.css new file mode 100644 index 000000000..27de210a1 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/css/materialize.css @@ -0,0 +1,8582 @@ +/*! + * Materialize v0.98.0 (http://materializecss.com) + * Copyright 2014-2015 Materialize + * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) + */ +.materialize-red { + background-color: #e51c23 !important; +} + +.materialize-red-text { + color: #e51c23 !important; +} + +.materialize-red.lighten-5 { + background-color: #fdeaeb !important; +} + +.materialize-red-text.text-lighten-5 { + color: #fdeaeb !important; +} + +.materialize-red.lighten-4 { + background-color: #f8c1c3 !important; +} + +.materialize-red-text.text-lighten-4 { + color: #f8c1c3 !important; +} + +.materialize-red.lighten-3 { + background-color: #f3989b !important; +} + +.materialize-red-text.text-lighten-3 { + color: #f3989b !important; +} + +.materialize-red.lighten-2 { + background-color: #ee6e73 !important; +} + +.materialize-red-text.text-lighten-2 { + color: #ee6e73 !important; +} + +.materialize-red.lighten-1 { + background-color: #ea454b !important; +} + +.materialize-red-text.text-lighten-1 { + color: #ea454b !important; +} + +.materialize-red.darken-1 { + background-color: #d0181e !important; +} + +.materialize-red-text.text-darken-1 { + color: #d0181e !important; +} + +.materialize-red.darken-2 { + background-color: #b9151b !important; +} + +.materialize-red-text.text-darken-2 { + color: #b9151b !important; +} + +.materialize-red.darken-3 { + background-color: #a21318 !important; +} + +.materialize-red-text.text-darken-3 { + color: #a21318 !important; +} + +.materialize-red.darken-4 { + background-color: #8b1014 !important; +} + +.materialize-red-text.text-darken-4 { + color: #8b1014 !important; +} + +.red { + background-color: #F44336 !important; +} + +.red-text { + color: #F44336 !important; +} + +.red.lighten-5 { + background-color: #FFEBEE !important; +} + +.red-text.text-lighten-5 { + color: #FFEBEE !important; +} + +.red.lighten-4 { + background-color: #FFCDD2 !important; +} + +.red-text.text-lighten-4 { + color: #FFCDD2 !important; +} + +.red.lighten-3 { + background-color: #EF9A9A !important; +} + +.red-text.text-lighten-3 { + color: #EF9A9A !important; +} + +.red.lighten-2 { + background-color: #E57373 !important; +} + +.red-text.text-lighten-2 { + color: #E57373 !important; +} + +.red.lighten-1 { + background-color: #EF5350 !important; +} + +.red-text.text-lighten-1 { + color: #EF5350 !important; +} + +.red.darken-1 { + background-color: #E53935 !important; +} + +.red-text.text-darken-1 { + color: #E53935 !important; +} + +.red.darken-2 { + background-color: #D32F2F !important; +} + +.red-text.text-darken-2 { + color: #D32F2F !important; +} + +.red.darken-3 { + background-color: #C62828 !important; +} + +.red-text.text-darken-3 { + color: #C62828 !important; +} + +.red.darken-4 { + background-color: #B71C1C !important; +} + +.red-text.text-darken-4 { + color: #B71C1C !important; +} + +.red.accent-1 { + background-color: #FF8A80 !important; +} + +.red-text.text-accent-1 { + color: #FF8A80 !important; +} + +.red.accent-2 { + background-color: #FF5252 !important; +} + +.red-text.text-accent-2 { + color: #FF5252 !important; +} + +.red.accent-3 { + background-color: #FF1744 !important; +} + +.red-text.text-accent-3 { + color: #FF1744 !important; +} + +.red.accent-4 { + background-color: #D50000 !important; +} + +.red-text.text-accent-4 { + color: #D50000 !important; +} + +.pink { + background-color: #e91e63 !important; +} + +.pink-text { + color: #e91e63 !important; +} + +.pink.lighten-5 { + background-color: #fce4ec !important; +} + +.pink-text.text-lighten-5 { + color: #fce4ec !important; +} + +.pink.lighten-4 { + background-color: #f8bbd0 !important; +} + +.pink-text.text-lighten-4 { + color: #f8bbd0 !important; +} + +.pink.lighten-3 { + background-color: #f48fb1 !important; +} + +.pink-text.text-lighten-3 { + color: #f48fb1 !important; +} + +.pink.lighten-2 { + background-color: #f06292 !important; +} + +.pink-text.text-lighten-2 { + color: #f06292 !important; +} + +.pink.lighten-1 { + background-color: #ec407a !important; +} + +.pink-text.text-lighten-1 { + color: #ec407a !important; +} + +.pink.darken-1 { + background-color: #d81b60 !important; +} + +.pink-text.text-darken-1 { + color: #d81b60 !important; +} + +.pink.darken-2 { + background-color: #c2185b !important; +} + +.pink-text.text-darken-2 { + color: #c2185b !important; +} + +.pink.darken-3 { + background-color: #ad1457 !important; +} + +.pink-text.text-darken-3 { + color: #ad1457 !important; +} + +.pink.darken-4 { + background-color: #880e4f !important; +} + +.pink-text.text-darken-4 { + color: #880e4f !important; +} + +.pink.accent-1 { + background-color: #ff80ab !important; +} + +.pink-text.text-accent-1 { + color: #ff80ab !important; +} + +.pink.accent-2 { + background-color: #ff4081 !important; +} + +.pink-text.text-accent-2 { + color: #ff4081 !important; +} + +.pink.accent-3 { + background-color: #f50057 !important; +} + +.pink-text.text-accent-3 { + color: #f50057 !important; +} + +.pink.accent-4 { + background-color: #c51162 !important; +} + +.pink-text.text-accent-4 { + color: #c51162 !important; +} + +.purple { + background-color: #9c27b0 !important; +} + +.purple-text { + color: #9c27b0 !important; +} + +.purple.lighten-5 { + background-color: #f3e5f5 !important; +} + +.purple-text.text-lighten-5 { + color: #f3e5f5 !important; +} + +.purple.lighten-4 { + background-color: #e1bee7 !important; +} + +.purple-text.text-lighten-4 { + color: #e1bee7 !important; +} + +.purple.lighten-3 { + background-color: #ce93d8 !important; +} + +.purple-text.text-lighten-3 { + color: #ce93d8 !important; +} + +.purple.lighten-2 { + background-color: #ba68c8 !important; +} + +.purple-text.text-lighten-2 { + color: #ba68c8 !important; +} + +.purple.lighten-1 { + background-color: #ab47bc !important; +} + +.purple-text.text-lighten-1 { + color: #ab47bc !important; +} + +.purple.darken-1 { + background-color: #8e24aa !important; +} + +.purple-text.text-darken-1 { + color: #8e24aa !important; +} + +.purple.darken-2 { + background-color: #7b1fa2 !important; +} + +.purple-text.text-darken-2 { + color: #7b1fa2 !important; +} + +.purple.darken-3 { + background-color: #6a1b9a !important; +} + +.purple-text.text-darken-3 { + color: #6a1b9a !important; +} + +.purple.darken-4 { + background-color: #4a148c !important; +} + +.purple-text.text-darken-4 { + color: #4a148c !important; +} + +.purple.accent-1 { + background-color: #ea80fc !important; +} + +.purple-text.text-accent-1 { + color: #ea80fc !important; +} + +.purple.accent-2 { + background-color: #e040fb !important; +} + +.purple-text.text-accent-2 { + color: #e040fb !important; +} + +.purple.accent-3 { + background-color: #d500f9 !important; +} + +.purple-text.text-accent-3 { + color: #d500f9 !important; +} + +.purple.accent-4 { + background-color: #aa00ff !important; +} + +.purple-text.text-accent-4 { + color: #aa00ff !important; +} + +.deep-purple { + background-color: #673ab7 !important; +} + +.deep-purple-text { + color: #673ab7 !important; +} + +.deep-purple.lighten-5 { + background-color: #ede7f6 !important; +} + +.deep-purple-text.text-lighten-5 { + color: #ede7f6 !important; +} + +.deep-purple.lighten-4 { + background-color: #d1c4e9 !important; +} + +.deep-purple-text.text-lighten-4 { + color: #d1c4e9 !important; +} + +.deep-purple.lighten-3 { + background-color: #b39ddb !important; +} + +.deep-purple-text.text-lighten-3 { + color: #b39ddb !important; +} + +.deep-purple.lighten-2 { + background-color: #9575cd !important; +} + +.deep-purple-text.text-lighten-2 { + color: #9575cd !important; +} + +.deep-purple.lighten-1 { + background-color: #7e57c2 !important; +} + +.deep-purple-text.text-lighten-1 { + color: #7e57c2 !important; +} + +.deep-purple.darken-1 { + background-color: #5e35b1 !important; +} + +.deep-purple-text.text-darken-1 { + color: #5e35b1 !important; +} + +.deep-purple.darken-2 { + background-color: #512da8 !important; +} + +.deep-purple-text.text-darken-2 { + color: #512da8 !important; +} + +.deep-purple.darken-3 { + background-color: #4527a0 !important; +} + +.deep-purple-text.text-darken-3 { + color: #4527a0 !important; +} + +.deep-purple.darken-4 { + background-color: #311b92 !important; +} + +.deep-purple-text.text-darken-4 { + color: #311b92 !important; +} + +.deep-purple.accent-1 { + background-color: #b388ff !important; +} + +.deep-purple-text.text-accent-1 { + color: #b388ff !important; +} + +.deep-purple.accent-2 { + background-color: #7c4dff !important; +} + +.deep-purple-text.text-accent-2 { + color: #7c4dff !important; +} + +.deep-purple.accent-3 { + background-color: #651fff !important; +} + +.deep-purple-text.text-accent-3 { + color: #651fff !important; +} + +.deep-purple.accent-4 { + background-color: #6200ea !important; +} + +.deep-purple-text.text-accent-4 { + color: #6200ea !important; +} + +.indigo { + background-color: #3f51b5 !important; +} + +.indigo-text { + color: #3f51b5 !important; +} + +.indigo.lighten-5 { + background-color: #e8eaf6 !important; +} + +.indigo-text.text-lighten-5 { + color: #e8eaf6 !important; +} + +.indigo.lighten-4 { + background-color: #c5cae9 !important; +} + +.indigo-text.text-lighten-4 { + color: #c5cae9 !important; +} + +.indigo.lighten-3 { + background-color: #9fa8da !important; +} + +.indigo-text.text-lighten-3 { + color: #9fa8da !important; +} + +.indigo.lighten-2 { + background-color: #7986cb !important; +} + +.indigo-text.text-lighten-2 { + color: #7986cb !important; +} + +.indigo.lighten-1 { + background-color: #5c6bc0 !important; +} + +.indigo-text.text-lighten-1 { + color: #5c6bc0 !important; +} + +.indigo.darken-1 { + background-color: #3949ab !important; +} + +.indigo-text.text-darken-1 { + color: #3949ab !important; +} + +.indigo.darken-2 { + background-color: #303f9f !important; +} + +.indigo-text.text-darken-2 { + color: #303f9f !important; +} + +.indigo.darken-3 { + background-color: #283593 !important; +} + +.indigo-text.text-darken-3 { + color: #283593 !important; +} + +.indigo.darken-4 { + background-color: #1a237e !important; +} + +.indigo-text.text-darken-4 { + color: #1a237e !important; +} + +.indigo.accent-1 { + background-color: #8c9eff !important; +} + +.indigo-text.text-accent-1 { + color: #8c9eff !important; +} + +.indigo.accent-2 { + background-color: #536dfe !important; +} + +.indigo-text.text-accent-2 { + color: #536dfe !important; +} + +.indigo.accent-3 { + background-color: #3d5afe !important; +} + +.indigo-text.text-accent-3 { + color: #3d5afe !important; +} + +.indigo.accent-4 { + background-color: #304ffe !important; +} + +.indigo-text.text-accent-4 { + color: #304ffe !important; +} + +.blue { + background-color: #2196F3 !important; +} + +.blue-text { + color: #2196F3 !important; +} + +.blue.lighten-5 { + background-color: #E3F2FD !important; +} + +.blue-text.text-lighten-5 { + color: #E3F2FD !important; +} + +.blue.lighten-4 { + background-color: #BBDEFB !important; +} + +.blue-text.text-lighten-4 { + color: #BBDEFB !important; +} + +.blue.lighten-3 { + background-color: #90CAF9 !important; +} + +.blue-text.text-lighten-3 { + color: #90CAF9 !important; +} + +.blue.lighten-2 { + background-color: #64B5F6 !important; +} + +.blue-text.text-lighten-2 { + color: #64B5F6 !important; +} + +.blue.lighten-1 { + background-color: #42A5F5 !important; +} + +.blue-text.text-lighten-1 { + color: #42A5F5 !important; +} + +.blue.darken-1 { + background-color: #1E88E5 !important; +} + +.blue-text.text-darken-1 { + color: #1E88E5 !important; +} + +.blue.darken-2 { + background-color: #1976D2 !important; +} + +.blue-text.text-darken-2 { + color: #1976D2 !important; +} + +.blue.darken-3 { + background-color: #1565C0 !important; +} + +.blue-text.text-darken-3 { + color: #1565C0 !important; +} + +.blue.darken-4 { + background-color: #0D47A1 !important; +} + +.blue-text.text-darken-4 { + color: #0D47A1 !important; +} + +.blue.accent-1 { + background-color: #82B1FF !important; +} + +.blue-text.text-accent-1 { + color: #82B1FF !important; +} + +.blue.accent-2 { + background-color: #448AFF !important; +} + +.blue-text.text-accent-2 { + color: #448AFF !important; +} + +.blue.accent-3 { + background-color: #2979FF !important; +} + +.blue-text.text-accent-3 { + color: #2979FF !important; +} + +.blue.accent-4 { + background-color: #2962FF !important; +} + +.blue-text.text-accent-4 { + color: #2962FF !important; +} + +.light-blue { + background-color: #03a9f4 !important; +} + +.light-blue-text { + color: #03a9f4 !important; +} + +.light-blue.lighten-5 { + background-color: #e1f5fe !important; +} + +.light-blue-text.text-lighten-5 { + color: #e1f5fe !important; +} + +.light-blue.lighten-4 { + background-color: #b3e5fc !important; +} + +.light-blue-text.text-lighten-4 { + color: #b3e5fc !important; +} + +.light-blue.lighten-3 { + background-color: #81d4fa !important; +} + +.light-blue-text.text-lighten-3 { + color: #81d4fa !important; +} + +.light-blue.lighten-2 { + background-color: #4fc3f7 !important; +} + +.light-blue-text.text-lighten-2 { + color: #4fc3f7 !important; +} + +.light-blue.lighten-1 { + background-color: #29b6f6 !important; +} + +.light-blue-text.text-lighten-1 { + color: #29b6f6 !important; +} + +.light-blue.darken-1 { + background-color: #039be5 !important; +} + +.light-blue-text.text-darken-1 { + color: #039be5 !important; +} + +.light-blue.darken-2 { + background-color: #0288d1 !important; +} + +.light-blue-text.text-darken-2 { + color: #0288d1 !important; +} + +.light-blue.darken-3 { + background-color: #0277bd !important; +} + +.light-blue-text.text-darken-3 { + color: #0277bd !important; +} + +.light-blue.darken-4 { + background-color: #01579b !important; +} + +.light-blue-text.text-darken-4 { + color: #01579b !important; +} + +.light-blue.accent-1 { + background-color: #80d8ff !important; +} + +.light-blue-text.text-accent-1 { + color: #80d8ff !important; +} + +.light-blue.accent-2 { + background-color: #40c4ff !important; +} + +.light-blue-text.text-accent-2 { + color: #40c4ff !important; +} + +.light-blue.accent-3 { + background-color: #00b0ff !important; +} + +.light-blue-text.text-accent-3 { + color: #00b0ff !important; +} + +.light-blue.accent-4 { + background-color: #0091ea !important; +} + +.light-blue-text.text-accent-4 { + color: #0091ea !important; +} + +.cyan { + background-color: #00bcd4 !important; +} + +.cyan-text { + color: #00bcd4 !important; +} + +.cyan.lighten-5 { + background-color: #e0f7fa !important; +} + +.cyan-text.text-lighten-5 { + color: #e0f7fa !important; +} + +.cyan.lighten-4 { + background-color: #b2ebf2 !important; +} + +.cyan-text.text-lighten-4 { + color: #b2ebf2 !important; +} + +.cyan.lighten-3 { + background-color: #80deea !important; +} + +.cyan-text.text-lighten-3 { + color: #80deea !important; +} + +.cyan.lighten-2 { + background-color: #4dd0e1 !important; +} + +.cyan-text.text-lighten-2 { + color: #4dd0e1 !important; +} + +.cyan.lighten-1 { + background-color: #26c6da !important; +} + +.cyan-text.text-lighten-1 { + color: #26c6da !important; +} + +.cyan.darken-1 { + background-color: #00acc1 !important; +} + +.cyan-text.text-darken-1 { + color: #00acc1 !important; +} + +.cyan.darken-2 { + background-color: #0097a7 !important; +} + +.cyan-text.text-darken-2 { + color: #0097a7 !important; +} + +.cyan.darken-3 { + background-color: #00838f !important; +} + +.cyan-text.text-darken-3 { + color: #00838f !important; +} + +.cyan.darken-4 { + background-color: #006064 !important; +} + +.cyan-text.text-darken-4 { + color: #006064 !important; +} + +.cyan.accent-1 { + background-color: #84ffff !important; +} + +.cyan-text.text-accent-1 { + color: #84ffff !important; +} + +.cyan.accent-2 { + background-color: #18ffff !important; +} + +.cyan-text.text-accent-2 { + color: #18ffff !important; +} + +.cyan.accent-3 { + background-color: #00e5ff !important; +} + +.cyan-text.text-accent-3 { + color: #00e5ff !important; +} + +.cyan.accent-4 { + background-color: #00b8d4 !important; +} + +.cyan-text.text-accent-4 { + color: #00b8d4 !important; +} + +.teal { + background-color: #009688 !important; +} + +.teal-text { + color: #009688 !important; +} + +.teal.lighten-5 { + background-color: #e0f2f1 !important; +} + +.teal-text.text-lighten-5 { + color: #e0f2f1 !important; +} + +.teal.lighten-4 { + background-color: #b2dfdb !important; +} + +.teal-text.text-lighten-4 { + color: #b2dfdb !important; +} + +.teal.lighten-3 { + background-color: #80cbc4 !important; +} + +.teal-text.text-lighten-3 { + color: #80cbc4 !important; +} + +.teal.lighten-2 { + background-color: #4db6ac !important; +} + +.teal-text.text-lighten-2 { + color: #4db6ac !important; +} + +.teal.lighten-1 { + background-color: #26a69a !important; +} + +.teal-text.text-lighten-1 { + color: #26a69a !important; +} + +.teal.darken-1 { + background-color: #00897b !important; +} + +.teal-text.text-darken-1 { + color: #00897b !important; +} + +.teal.darken-2 { + background-color: #00796b !important; +} + +.teal-text.text-darken-2 { + color: #00796b !important; +} + +.teal.darken-3 { + background-color: #00695c !important; +} + +.teal-text.text-darken-3 { + color: #00695c !important; +} + +.teal.darken-4 { + background-color: #004d40 !important; +} + +.teal-text.text-darken-4 { + color: #004d40 !important; +} + +.teal.accent-1 { + background-color: #a7ffeb !important; +} + +.teal-text.text-accent-1 { + color: #a7ffeb !important; +} + +.teal.accent-2 { + background-color: #64ffda !important; +} + +.teal-text.text-accent-2 { + color: #64ffda !important; +} + +.teal.accent-3 { + background-color: #1de9b6 !important; +} + +.teal-text.text-accent-3 { + color: #1de9b6 !important; +} + +.teal.accent-4 { + background-color: #00bfa5 !important; +} + +.teal-text.text-accent-4 { + color: #00bfa5 !important; +} + +.green { + background-color: #4CAF50 !important; +} + +.green-text { + color: #4CAF50 !important; +} + +.green.lighten-5 { + background-color: #E8F5E9 !important; +} + +.green-text.text-lighten-5 { + color: #E8F5E9 !important; +} + +.green.lighten-4 { + background-color: #C8E6C9 !important; +} + +.green-text.text-lighten-4 { + color: #C8E6C9 !important; +} + +.green.lighten-3 { + background-color: #A5D6A7 !important; +} + +.green-text.text-lighten-3 { + color: #A5D6A7 !important; +} + +.green.lighten-2 { + background-color: #81C784 !important; +} + +.green-text.text-lighten-2 { + color: #81C784 !important; +} + +.green.lighten-1 { + background-color: #66BB6A !important; +} + +.green-text.text-lighten-1 { + color: #66BB6A !important; +} + +.green.darken-1 { + background-color: #43A047 !important; +} + +.green-text.text-darken-1 { + color: #43A047 !important; +} + +.green.darken-2 { + background-color: #388E3C !important; +} + +.green-text.text-darken-2 { + color: #388E3C !important; +} + +.green.darken-3 { + background-color: #2E7D32 !important; +} + +.green-text.text-darken-3 { + color: #2E7D32 !important; +} + +.green.darken-4 { + background-color: #1B5E20 !important; +} + +.green-text.text-darken-4 { + color: #1B5E20 !important; +} + +.green.accent-1 { + background-color: #B9F6CA !important; +} + +.green-text.text-accent-1 { + color: #B9F6CA !important; +} + +.green.accent-2 { + background-color: #69F0AE !important; +} + +.green-text.text-accent-2 { + color: #69F0AE !important; +} + +.green.accent-3 { + background-color: #00E676 !important; +} + +.green-text.text-accent-3 { + color: #00E676 !important; +} + +.green.accent-4 { + background-color: #00C853 !important; +} + +.green-text.text-accent-4 { + color: #00C853 !important; +} + +.light-green { + background-color: #8bc34a !important; +} + +.light-green-text { + color: #8bc34a !important; +} + +.light-green.lighten-5 { + background-color: #f1f8e9 !important; +} + +.light-green-text.text-lighten-5 { + color: #f1f8e9 !important; +} + +.light-green.lighten-4 { + background-color: #dcedc8 !important; +} + +.light-green-text.text-lighten-4 { + color: #dcedc8 !important; +} + +.light-green.lighten-3 { + background-color: #c5e1a5 !important; +} + +.light-green-text.text-lighten-3 { + color: #c5e1a5 !important; +} + +.light-green.lighten-2 { + background-color: #aed581 !important; +} + +.light-green-text.text-lighten-2 { + color: #aed581 !important; +} + +.light-green.lighten-1 { + background-color: #9ccc65 !important; +} + +.light-green-text.text-lighten-1 { + color: #9ccc65 !important; +} + +.light-green.darken-1 { + background-color: #7cb342 !important; +} + +.light-green-text.text-darken-1 { + color: #7cb342 !important; +} + +.light-green.darken-2 { + background-color: #689f38 !important; +} + +.light-green-text.text-darken-2 { + color: #689f38 !important; +} + +.light-green.darken-3 { + background-color: #558b2f !important; +} + +.light-green-text.text-darken-3 { + color: #558b2f !important; +} + +.light-green.darken-4 { + background-color: #33691e !important; +} + +.light-green-text.text-darken-4 { + color: #33691e !important; +} + +.light-green.accent-1 { + background-color: #ccff90 !important; +} + +.light-green-text.text-accent-1 { + color: #ccff90 !important; +} + +.light-green.accent-2 { + background-color: #b2ff59 !important; +} + +.light-green-text.text-accent-2 { + color: #b2ff59 !important; +} + +.light-green.accent-3 { + background-color: #76ff03 !important; +} + +.light-green-text.text-accent-3 { + color: #76ff03 !important; +} + +.light-green.accent-4 { + background-color: #64dd17 !important; +} + +.light-green-text.text-accent-4 { + color: #64dd17 !important; +} + +.lime { + background-color: #cddc39 !important; +} + +.lime-text { + color: #cddc39 !important; +} + +.lime.lighten-5 { + background-color: #f9fbe7 !important; +} + +.lime-text.text-lighten-5 { + color: #f9fbe7 !important; +} + +.lime.lighten-4 { + background-color: #f0f4c3 !important; +} + +.lime-text.text-lighten-4 { + color: #f0f4c3 !important; +} + +.lime.lighten-3 { + background-color: #e6ee9c !important; +} + +.lime-text.text-lighten-3 { + color: #e6ee9c !important; +} + +.lime.lighten-2 { + background-color: #dce775 !important; +} + +.lime-text.text-lighten-2 { + color: #dce775 !important; +} + +.lime.lighten-1 { + background-color: #d4e157 !important; +} + +.lime-text.text-lighten-1 { + color: #d4e157 !important; +} + +.lime.darken-1 { + background-color: #c0ca33 !important; +} + +.lime-text.text-darken-1 { + color: #c0ca33 !important; +} + +.lime.darken-2 { + background-color: #afb42b !important; +} + +.lime-text.text-darken-2 { + color: #afb42b !important; +} + +.lime.darken-3 { + background-color: #9e9d24 !important; +} + +.lime-text.text-darken-3 { + color: #9e9d24 !important; +} + +.lime.darken-4 { + background-color: #827717 !important; +} + +.lime-text.text-darken-4 { + color: #827717 !important; +} + +.lime.accent-1 { + background-color: #f4ff81 !important; +} + +.lime-text.text-accent-1 { + color: #f4ff81 !important; +} + +.lime.accent-2 { + background-color: #eeff41 !important; +} + +.lime-text.text-accent-2 { + color: #eeff41 !important; +} + +.lime.accent-3 { + background-color: #c6ff00 !important; +} + +.lime-text.text-accent-3 { + color: #c6ff00 !important; +} + +.lime.accent-4 { + background-color: #aeea00 !important; +} + +.lime-text.text-accent-4 { + color: #aeea00 !important; +} + +.yellow { + background-color: #ffeb3b !important; +} + +.yellow-text { + color: #ffeb3b !important; +} + +.yellow.lighten-5 { + background-color: #fffde7 !important; +} + +.yellow-text.text-lighten-5 { + color: #fffde7 !important; +} + +.yellow.lighten-4 { + background-color: #fff9c4 !important; +} + +.yellow-text.text-lighten-4 { + color: #fff9c4 !important; +} + +.yellow.lighten-3 { + background-color: #fff59d !important; +} + +.yellow-text.text-lighten-3 { + color: #fff59d !important; +} + +.yellow.lighten-2 { + background-color: #fff176 !important; +} + +.yellow-text.text-lighten-2 { + color: #fff176 !important; +} + +.yellow.lighten-1 { + background-color: #ffee58 !important; +} + +.yellow-text.text-lighten-1 { + color: #ffee58 !important; +} + +.yellow.darken-1 { + background-color: #fdd835 !important; +} + +.yellow-text.text-darken-1 { + color: #fdd835 !important; +} + +.yellow.darken-2 { + background-color: #fbc02d !important; +} + +.yellow-text.text-darken-2 { + color: #fbc02d !important; +} + +.yellow.darken-3 { + background-color: #f9a825 !important; +} + +.yellow-text.text-darken-3 { + color: #f9a825 !important; +} + +.yellow.darken-4 { + background-color: #f57f17 !important; +} + +.yellow-text.text-darken-4 { + color: #f57f17 !important; +} + +.yellow.accent-1 { + background-color: #ffff8d !important; +} + +.yellow-text.text-accent-1 { + color: #ffff8d !important; +} + +.yellow.accent-2 { + background-color: #ffff00 !important; +} + +.yellow-text.text-accent-2 { + color: #ffff00 !important; +} + +.yellow.accent-3 { + background-color: #ffea00 !important; +} + +.yellow-text.text-accent-3 { + color: #ffea00 !important; +} + +.yellow.accent-4 { + background-color: #ffd600 !important; +} + +.yellow-text.text-accent-4 { + color: #ffd600 !important; +} + +.amber { + background-color: #ffc107 !important; +} + +.amber-text { + color: #ffc107 !important; +} + +.amber.lighten-5 { + background-color: #fff8e1 !important; +} + +.amber-text.text-lighten-5 { + color: #fff8e1 !important; +} + +.amber.lighten-4 { + background-color: #ffecb3 !important; +} + +.amber-text.text-lighten-4 { + color: #ffecb3 !important; +} + +.amber.lighten-3 { + background-color: #ffe082 !important; +} + +.amber-text.text-lighten-3 { + color: #ffe082 !important; +} + +.amber.lighten-2 { + background-color: #ffd54f !important; +} + +.amber-text.text-lighten-2 { + color: #ffd54f !important; +} + +.amber.lighten-1 { + background-color: #ffca28 !important; +} + +.amber-text.text-lighten-1 { + color: #ffca28 !important; +} + +.amber.darken-1 { + background-color: #ffb300 !important; +} + +.amber-text.text-darken-1 { + color: #ffb300 !important; +} + +.amber.darken-2 { + background-color: #ffa000 !important; +} + +.amber-text.text-darken-2 { + color: #ffa000 !important; +} + +.amber.darken-3 { + background-color: #ff8f00 !important; +} + +.amber-text.text-darken-3 { + color: #ff8f00 !important; +} + +.amber.darken-4 { + background-color: #ff6f00 !important; +} + +.amber-text.text-darken-4 { + color: #ff6f00 !important; +} + +.amber.accent-1 { + background-color: #ffe57f !important; +} + +.amber-text.text-accent-1 { + color: #ffe57f !important; +} + +.amber.accent-2 { + background-color: #ffd740 !important; +} + +.amber-text.text-accent-2 { + color: #ffd740 !important; +} + +.amber.accent-3 { + background-color: #ffc400 !important; +} + +.amber-text.text-accent-3 { + color: #ffc400 !important; +} + +.amber.accent-4 { + background-color: #ffab00 !important; +} + +.amber-text.text-accent-4 { + color: #ffab00 !important; +} + +.orange { + background-color: #ff9800 !important; +} + +.orange-text { + color: #ff9800 !important; +} + +.orange.lighten-5 { + background-color: #fff3e0 !important; +} + +.orange-text.text-lighten-5 { + color: #fff3e0 !important; +} + +.orange.lighten-4 { + background-color: #ffe0b2 !important; +} + +.orange-text.text-lighten-4 { + color: #ffe0b2 !important; +} + +.orange.lighten-3 { + background-color: #ffcc80 !important; +} + +.orange-text.text-lighten-3 { + color: #ffcc80 !important; +} + +.orange.lighten-2 { + background-color: #ffb74d !important; +} + +.orange-text.text-lighten-2 { + color: #ffb74d !important; +} + +.orange.lighten-1 { + background-color: #ffa726 !important; +} + +.orange-text.text-lighten-1 { + color: #ffa726 !important; +} + +.orange.darken-1 { + background-color: #fb8c00 !important; +} + +.orange-text.text-darken-1 { + color: #fb8c00 !important; +} + +.orange.darken-2 { + background-color: #f57c00 !important; +} + +.orange-text.text-darken-2 { + color: #f57c00 !important; +} + +.orange.darken-3 { + background-color: #ef6c00 !important; +} + +.orange-text.text-darken-3 { + color: #ef6c00 !important; +} + +.orange.darken-4 { + background-color: #e65100 !important; +} + +.orange-text.text-darken-4 { + color: #e65100 !important; +} + +.orange.accent-1 { + background-color: #ffd180 !important; +} + +.orange-text.text-accent-1 { + color: #ffd180 !important; +} + +.orange.accent-2 { + background-color: #ffab40 !important; +} + +.orange-text.text-accent-2 { + color: #ffab40 !important; +} + +.orange.accent-3 { + background-color: #ff9100 !important; +} + +.orange-text.text-accent-3 { + color: #ff9100 !important; +} + +.orange.accent-4 { + background-color: #ff6d00 !important; +} + +.orange-text.text-accent-4 { + color: #ff6d00 !important; +} + +.deep-orange { + background-color: #ff5722 !important; +} + +.deep-orange-text { + color: #ff5722 !important; +} + +.deep-orange.lighten-5 { + background-color: #fbe9e7 !important; +} + +.deep-orange-text.text-lighten-5 { + color: #fbe9e7 !important; +} + +.deep-orange.lighten-4 { + background-color: #ffccbc !important; +} + +.deep-orange-text.text-lighten-4 { + color: #ffccbc !important; +} + +.deep-orange.lighten-3 { + background-color: #ffab91 !important; +} + +.deep-orange-text.text-lighten-3 { + color: #ffab91 !important; +} + +.deep-orange.lighten-2 { + background-color: #ff8a65 !important; +} + +.deep-orange-text.text-lighten-2 { + color: #ff8a65 !important; +} + +.deep-orange.lighten-1 { + background-color: #ff7043 !important; +} + +.deep-orange-text.text-lighten-1 { + color: #ff7043 !important; +} + +.deep-orange.darken-1 { + background-color: #f4511e !important; +} + +.deep-orange-text.text-darken-1 { + color: #f4511e !important; +} + +.deep-orange.darken-2 { + background-color: #e64a19 !important; +} + +.deep-orange-text.text-darken-2 { + color: #e64a19 !important; +} + +.deep-orange.darken-3 { + background-color: #d84315 !important; +} + +.deep-orange-text.text-darken-3 { + color: #d84315 !important; +} + +.deep-orange.darken-4 { + background-color: #bf360c !important; +} + +.deep-orange-text.text-darken-4 { + color: #bf360c !important; +} + +.deep-orange.accent-1 { + background-color: #ff9e80 !important; +} + +.deep-orange-text.text-accent-1 { + color: #ff9e80 !important; +} + +.deep-orange.accent-2 { + background-color: #ff6e40 !important; +} + +.deep-orange-text.text-accent-2 { + color: #ff6e40 !important; +} + +.deep-orange.accent-3 { + background-color: #ff3d00 !important; +} + +.deep-orange-text.text-accent-3 { + color: #ff3d00 !important; +} + +.deep-orange.accent-4 { + background-color: #dd2c00 !important; +} + +.deep-orange-text.text-accent-4 { + color: #dd2c00 !important; +} + +.brown { + background-color: #795548 !important; +} + +.brown-text { + color: #795548 !important; +} + +.brown.lighten-5 { + background-color: #efebe9 !important; +} + +.brown-text.text-lighten-5 { + color: #efebe9 !important; +} + +.brown.lighten-4 { + background-color: #d7ccc8 !important; +} + +.brown-text.text-lighten-4 { + color: #d7ccc8 !important; +} + +.brown.lighten-3 { + background-color: #bcaaa4 !important; +} + +.brown-text.text-lighten-3 { + color: #bcaaa4 !important; +} + +.brown.lighten-2 { + background-color: #a1887f !important; +} + +.brown-text.text-lighten-2 { + color: #a1887f !important; +} + +.brown.lighten-1 { + background-color: #8d6e63 !important; +} + +.brown-text.text-lighten-1 { + color: #8d6e63 !important; +} + +.brown.darken-1 { + background-color: #6d4c41 !important; +} + +.brown-text.text-darken-1 { + color: #6d4c41 !important; +} + +.brown.darken-2 { + background-color: #5d4037 !important; +} + +.brown-text.text-darken-2 { + color: #5d4037 !important; +} + +.brown.darken-3 { + background-color: #4e342e !important; +} + +.brown-text.text-darken-3 { + color: #4e342e !important; +} + +.brown.darken-4 { + background-color: #3e2723 !important; +} + +.brown-text.text-darken-4 { + color: #3e2723 !important; +} + +.blue-grey { + background-color: #607d8b !important; +} + +.blue-grey-text { + color: #607d8b !important; +} + +.blue-grey.lighten-5 { + background-color: #eceff1 !important; +} + +.blue-grey-text.text-lighten-5 { + color: #eceff1 !important; +} + +.blue-grey.lighten-4 { + background-color: #cfd8dc !important; +} + +.blue-grey-text.text-lighten-4 { + color: #cfd8dc !important; +} + +.blue-grey.lighten-3 { + background-color: #b0bec5 !important; +} + +.blue-grey-text.text-lighten-3 { + color: #b0bec5 !important; +} + +.blue-grey.lighten-2 { + background-color: #90a4ae !important; +} + +.blue-grey-text.text-lighten-2 { + color: #90a4ae !important; +} + +.blue-grey.lighten-1 { + background-color: #78909c !important; +} + +.blue-grey-text.text-lighten-1 { + color: #78909c !important; +} + +.blue-grey.darken-1 { + background-color: #546e7a !important; +} + +.blue-grey-text.text-darken-1 { + color: #546e7a !important; +} + +.blue-grey.darken-2 { + background-color: #455a64 !important; +} + +.blue-grey-text.text-darken-2 { + color: #455a64 !important; +} + +.blue-grey.darken-3 { + background-color: #37474f !important; +} + +.blue-grey-text.text-darken-3 { + color: #37474f !important; +} + +.blue-grey.darken-4 { + background-color: #263238 !important; +} + +.blue-grey-text.text-darken-4 { + color: #263238 !important; +} + +.grey { + background-color: #9e9e9e !important; +} + +.grey-text { + color: #9e9e9e !important; +} + +.grey.lighten-5 { + background-color: #fafafa !important; +} + +.grey-text.text-lighten-5 { + color: #fafafa !important; +} + +.grey.lighten-4 { + background-color: #f5f5f5 !important; +} + +.grey-text.text-lighten-4 { + color: #f5f5f5 !important; +} + +.grey.lighten-3 { + background-color: #eeeeee !important; +} + +.grey-text.text-lighten-3 { + color: #eeeeee !important; +} + +.grey.lighten-2 { + background-color: #e0e0e0 !important; +} + +.grey-text.text-lighten-2 { + color: #e0e0e0 !important; +} + +.grey.lighten-1 { + background-color: #bdbdbd !important; +} + +.grey-text.text-lighten-1 { + color: #bdbdbd !important; +} + +.grey.darken-1 { + background-color: #757575 !important; +} + +.grey-text.text-darken-1 { + color: #757575 !important; +} + +.grey.darken-2 { + background-color: #616161 !important; +} + +.grey-text.text-darken-2 { + color: #616161 !important; +} + +.grey.darken-3 { + background-color: #424242 !important; +} + +.grey-text.text-darken-3 { + color: #424242 !important; +} + +.grey.darken-4 { + background-color: #212121 !important; +} + +.grey-text.text-darken-4 { + color: #212121 !important; +} + +.black { + background-color: #000000 !important; +} + +.black-text { + color: #000000 !important; +} + +.white { + background-color: #FFFFFF !important; +} + +.white-text { + color: #FFFFFF !important; +} + +.transparent { + background-color: transparent !important; +} + +.transparent-text { + color: transparent !important; +} + +/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */ +/** + * 1. Set default font family to sans-serif. + * 2. Prevent iOS and IE text size adjust after device orientation change, + * without disabling user zoom. + */ +html { + font-family: sans-serif; + /* 1 */ + -ms-text-size-adjust: 100%; + /* 2 */ + -webkit-text-size-adjust: 100%; + /* 2 */ +} + +/** + * Remove default margin. + */ +body { + margin: 0; +} + +/* HTML5 display definitions + ========================================================================== */ +/** + * Correct `block` display not defined for any HTML5 element in IE 8/9. + * Correct `block` display not defined for `details` or `summary` in IE 10/11 + * and Firefox. + * Correct `block` display not defined for `main` in IE 11. + */ +article, +aside, +details, +figcaption, +figure, +footer, +header, +hgroup, +main, +menu, +nav, +section, +summary { + display: block; +} + +/** + * 1. Correct `inline-block` display not defined in IE 8/9. + * 2. Normalize vertical alignment of `progress` in Chrome, Firefox, and Opera. + */ +audio, +canvas, +progress, +video { + display: inline-block; + /* 1 */ + vertical-align: baseline; + /* 2 */ +} + +/** + * Prevent modern browsers from displaying `audio` without controls. + * Remove excess height in iOS 5 devices. + */ +audio:not([controls]) { + display: none; + height: 0; +} + +/** + * Address `[hidden]` styling not present in IE 8/9/10. + * Hide the `template` element in IE 8/9/10/11, Safari, and Firefox < 22. + */ +[hidden], +template { + display: none; +} + +/* Links + ========================================================================== */ +/** + * Remove the gray background color from active links in IE 10. + */ +a { + background-color: transparent; +} + +/** + * Improve readability of focused elements when they are also in an + * active/hover state. + */ +a:active, +a:hover { + outline: 0; +} + +/* Text-level semantics + ========================================================================== */ +/** + * Address styling not present in IE 8/9/10/11, Safari, and Chrome. + */ +abbr[title] { + border-bottom: 1px dotted; +} + +/** + * Address style set to `bolder` in Firefox 4+, Safari, and Chrome. + */ +b, +strong { + font-weight: bold; +} + +/** + * Address styling not present in Safari and Chrome. + */ +dfn { + font-style: italic; +} + +/** + * Address variable `h1` font-size and margin within `section` and `article` + * contexts in Firefox 4+, Safari, and Chrome. + */ +h1 { + font-size: 2em; + margin: 0.67em 0; +} + +/** + * Address styling not present in IE 8/9. + */ +mark { + background: #ff0; + color: #000; +} + +/** + * Address inconsistent and variable font size in all browsers. + */ +small { + font-size: 80%; +} + +/** + * Prevent `sub` and `sup` affecting `line-height` in all browsers. + */ +sub, +sup { + font-size: 75%; + line-height: 0; + position: relative; + vertical-align: baseline; +} + +sup { + top: -0.5em; +} + +sub { + bottom: -0.25em; +} + +/* Embedded content + ========================================================================== */ +/** + * Remove border when inside `a` element in IE 8/9/10. + */ +img { + border: 0; +} + +/** + * Correct overflow not hidden in IE 9/10/11. + */ +svg:not(:root) { + overflow: hidden; +} + +/* Grouping content + ========================================================================== */ +/** + * Address margin not present in IE 8/9 and Safari. + */ +figure { + margin: 1em 40px; +} + +/** + * Address differences between Firefox and other browsers. + */ +hr { + box-sizing: content-box; + height: 0; +} + +/** + * Contain overflow in all browsers. + */ +pre { + overflow: auto; +} + +/** + * Address odd `em`-unit font size rendering in all browsers. + */ +code, +kbd, +pre, +samp { + font-family: monospace, monospace; + font-size: 1em; +} + +/* Forms + ========================================================================== */ +/** + * Known limitation: by default, Chrome and Safari on OS X allow very limited + * styling of `select`, unless a `border` property is set. + */ +/** + * 1. Correct color not being inherited. + * Known issue: affects color of disabled elements. + * 2. Correct font properties not being inherited. + * 3. Address margins set differently in Firefox 4+, Safari, and Chrome. + */ +button, +input, +optgroup, +select, +textarea { + color: inherit; + /* 1 */ + font: inherit; + /* 2 */ + margin: 0; + /* 3 */ +} + +/** + * Address `overflow` set to `hidden` in IE 8/9/10/11. + */ +button { + overflow: visible; +} + +/** + * Address inconsistent `text-transform` inheritance for `button` and `select`. + * All other form control elements do not inherit `text-transform` values. + * Correct `button` style inheritance in Firefox, IE 8/9/10/11, and Opera. + * Correct `select` style inheritance in Firefox. + */ +button, +select { + text-transform: none; +} + +/** + * 1. Avoid the WebKit bug in Android 4.0.* where (2) destroys native `audio` + * and `video` controls. + * 2. Correct inability to style clickable `input` types in iOS. + * 3. Improve usability and consistency of cursor style between image-type + * `input` and others. + */ +button, +html input[type="button"], +input[type="reset"], +input[type="submit"] { + -webkit-appearance: button; + /* 2 */ + cursor: pointer; + /* 3 */ +} + +/** + * Re-set default cursor for disabled elements. + */ +button[disabled], +html input[disabled] { + cursor: default; +} + +/** + * Remove inner padding and border in Firefox 4+. + */ +button::-moz-focus-inner, +input::-moz-focus-inner { + border: 0; + padding: 0; +} + +/** + * Address Firefox 4+ setting `line-height` on `input` using `!important` in + * the UA stylesheet. + */ +input { + line-height: normal; +} + +/** + * It's recommended that you don't attempt to style these elements. + * Firefox's implementation doesn't respect box-sizing, padding, or width. + * + * 1. Address box sizing set to `content-box` in IE 8/9/10. + * 2. Remove excess padding in IE 8/9/10. + */ +input[type="checkbox"], +input[type="radio"] { + box-sizing: border-box; + /* 1 */ + padding: 0; + /* 2 */ +} + +/** + * Fix the cursor style for Chrome's increment/decrement buttons. For certain + * `font-size` values of the `input`, it causes the cursor style of the + * decrement button to change from `default` to `text`. + */ +input[type="number"]::-webkit-inner-spin-button, +input[type="number"]::-webkit-outer-spin-button { + height: auto; +} + +/** + * 1. Address `appearance` set to `searchfield` in Safari and Chrome. + * 2. Address `box-sizing` set to `border-box` in Safari and Chrome. + */ +input[type="search"] { + -webkit-appearance: textfield; + /* 1 */ + box-sizing: content-box; + /* 2 */ +} + +/** + * Remove inner padding and search cancel button in Safari and Chrome on OS X. + * Safari (but not Chrome) clips the cancel button when the search input has + * padding (and `textfield` appearance). + */ +input[type="search"]::-webkit-search-cancel-button, +input[type="search"]::-webkit-search-decoration { + -webkit-appearance: none; +} + +/** + * Define consistent border, margin, and padding. + */ +fieldset { + border: 1px solid #c0c0c0; + margin: 0 2px; + padding: 0.35em 0.625em 0.75em; +} + +/** + * 1. Correct `color` not being inherited in IE 8/9/10/11. + * 2. Remove padding so people aren't caught out if they zero out fieldsets. + */ +legend { + border: 0; + /* 1 */ + padding: 0; + /* 2 */ +} + +/** + * Remove default vertical scrollbar in IE 8/9/10/11. + */ +textarea { + overflow: auto; +} + +/** + * Don't inherit the `font-weight` (applied by a rule above). + * NOTE: the default cannot safely be changed in Chrome and Safari on OS X. + */ +optgroup { + font-weight: bold; +} + +/* Tables + ========================================================================== */ +/** + * Remove most spacing between table cells. + */ +table { + border-collapse: collapse; + border-spacing: 0; +} + +td, +th { + padding: 0; +} + +html { + box-sizing: border-box; +} + +*, *:before, *:after { + box-sizing: inherit; +} + +ul:not(.browser-default) { + padding-left: 0; + list-style-type: none; +} + +ul:not(.browser-default) li { + list-style-type: none; +} + +a { + color: #039be5; + text-decoration: none; + -webkit-tap-highlight-color: transparent; +} + +.valign-wrapper { + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + -webkit-align-items: center; + -ms-flex-align: center; + align-items: center; +} + +.valign-wrapper .valign { + display: block; +} + +.clearfix { + clear: both; +} + +.z-depth-0 { + box-shadow: none !important; +} + +.z-depth-1, nav, .card-panel, .card, .toast, .btn, .btn-large, .btn-floating, .dropdown-content, .collapsible, .side-nav { + box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2); +} + +.z-depth-1-half, .btn:hover, .btn-large:hover, .btn-floating:hover { + box-shadow: 0 3px 3px 0 rgba(0, 0, 0, 0.14), 0 1px 7px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -1px rgba(0, 0, 0, 0.2); +} + +.z-depth-2 { + box-shadow: 0 4px 5px 0 rgba(0, 0, 0, 0.14), 0 1px 10px 0 rgba(0, 0, 0, 0.12), 0 2px 4px -1px rgba(0, 0, 0, 0.3); +} + +.z-depth-3 { + box-shadow: 0 6px 10px 0 rgba(0, 0, 0, 0.14), 0 1px 18px 0 rgba(0, 0, 0, 0.12), 0 3px 5px -1px rgba(0, 0, 0, 0.3); +} + +.z-depth-4, .modal { + box-shadow: 0 8px 10px 1px rgba(0, 0, 0, 0.14), 0 3px 14px 2px rgba(0, 0, 0, 0.12), 0 5px 5px -3px rgba(0, 0, 0, 0.3); +} + +.z-depth-5 { + box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14), 0 6px 30px 5px rgba(0, 0, 0, 0.12), 0 8px 10px -5px rgba(0, 0, 0, 0.3); +} + +.hoverable { + transition: box-shadow .25s; + box-shadow: 0; +} + +.hoverable:hover { + transition: box-shadow .25s; + box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19); +} + +.divider { + height: 1px; + overflow: hidden; + background-color: #e0e0e0; +} + +blockquote { + margin: 20px 0; + padding-left: 1.5rem; + border-left: 5px solid #ee6e73; +} + +i { + line-height: inherit; +} + +i.left { + float: left; + margin-right: 15px; +} + +i.right { + float: right; + margin-left: 15px; +} + +i.tiny { + font-size: 1rem; +} + +i.small { + font-size: 2rem; +} + +i.medium { + font-size: 4rem; +} + +i.large { + font-size: 6rem; +} + +img.responsive-img, +video.responsive-video { + max-width: 100%; + height: auto; +} + +.pagination li { + display: inline-block; + border-radius: 2px; + text-align: center; + vertical-align: top; + height: 30px; +} + +.pagination li a { + color: #444; + display: inline-block; + font-size: 1.2rem; + padding: 0 10px; + line-height: 30px; +} + +.pagination li.active a { + color: #fff; +} + +.pagination li.active { + background-color: #ee6e73; +} + +.pagination li.disabled a { + cursor: default; + color: #999; +} + +.pagination li i { + font-size: 2rem; +} + +.pagination li.pages ul li { + display: inline-block; + float: none; +} + +@media only screen and (max-width: 992px) { + .pagination { + width: 100%; + } + .pagination li.prev, + .pagination li.next { + width: 10%; + } + .pagination li.pages { + width: 80%; + overflow: hidden; + white-space: nowrap; + } +} + +.breadcrumb { + font-size: 18px; + color: rgba(255, 255, 255, 0.7); +} + +.breadcrumb i, +.breadcrumb [class^="mdi-"], .breadcrumb [class*="mdi-"], +.breadcrumb i.material-icons { + display: inline-block; + float: left; + font-size: 24px; +} + +.breadcrumb:before { + content: '\E5CC'; + color: rgba(255, 255, 255, 0.7); + vertical-align: top; + display: inline-block; + font-family: 'Material Icons'; + font-weight: normal; + font-style: normal; + font-size: 25px; + margin: 0 10px 0 8px; + -webkit-font-smoothing: antialiased; +} + +.breadcrumb:first-child:before { + display: none; +} + +.breadcrumb:last-child { + color: #fff; +} + +.parallax-container { + position: relative; + overflow: hidden; + height: 500px; +} + +.parallax { + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; + z-index: -1; +} + +.parallax img { + display: none; + position: absolute; + left: 50%; + bottom: 0; + min-width: 100%; + min-height: 100%; + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + -webkit-transform: translateX(-50%); + transform: translateX(-50%); +} + +.pin-top, .pin-bottom { + position: relative; +} + +.pinned { + position: fixed !important; +} + +/********************* + Transition Classes +**********************/ +ul.staggered-list li { + opacity: 0; +} + +.fade-in { + opacity: 0; + -webkit-transform-origin: 0 50%; + transform-origin: 0 50%; +} + +/********************* + Media Query Classes +**********************/ +@media only screen and (max-width: 600px) { + .hide-on-small-only, .hide-on-small-and-down { + display: none !important; + } +} + +@media only screen and (max-width: 992px) { + .hide-on-med-and-down { + display: none !important; + } +} + +@media only screen and (min-width: 601px) { + .hide-on-med-and-up { + display: none !important; + } +} + +@media only screen and (min-width: 600px) and (max-width: 992px) { + .hide-on-med-only { + display: none !important; + } +} + +@media only screen and (min-width: 993px) { + .hide-on-large-only { + display: none !important; + } +} + +@media only screen and (min-width: 993px) { + .show-on-large { + display: block !important; + } +} + +@media only screen and (min-width: 600px) and (max-width: 992px) { + .show-on-medium { + display: block !important; + } +} + +@media only screen and (max-width: 600px) { + .show-on-small { + display: block !important; + } +} + +@media only screen and (min-width: 601px) { + .show-on-medium-and-up { + display: block !important; + } +} + +@media only screen and (max-width: 992px) { + .show-on-medium-and-down { + display: block !important; + } +} + +@media only screen and (max-width: 600px) { + .center-on-small-only { + text-align: center; + } +} + +footer.page-footer { + padding-top: 20px; + background-color: #ee6e73; +} + +footer.page-footer .footer-copyright { + overflow: hidden; + min-height: 50px; + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + -webkit-align-items: center; + -ms-flex-align: center; + align-items: center; + padding: 10px 0px; + color: rgba(255, 255, 255, 0.8); + background-color: rgba(51, 51, 51, 0.08); +} + +table, th, td { + border: none; +} + +table { + width: 100%; + display: table; +} + +table.bordered > thead > tr, +table.bordered > tbody > tr { + border-bottom: 1px solid #d0d0d0; +} + +table.striped > tbody > tr:nth-child(odd) { + background-color: #f2f2f2; +} + +table.striped > tbody > tr > td { + border-radius: 0; +} + +table.highlight > tbody > tr { + transition: background-color .25s ease; +} + +table.highlight > tbody > tr:hover { + background-color: #f2f2f2; +} + +table.centered thead tr th, table.centered tbody tr td { + text-align: center; +} + +thead { + border-bottom: 1px solid #d0d0d0; +} + +td, th { + padding: 15px 5px; + display: table-cell; + text-align: left; + vertical-align: middle; + border-radius: 2px; +} + +@media only screen and (max-width: 992px) { + table.responsive-table { + width: 100%; + border-collapse: collapse; + border-spacing: 0; + display: block; + position: relative; + /* sort out borders */ + } + table.responsive-table td:empty:before { + content: '\00a0'; + } + table.responsive-table th, + table.responsive-table td { + margin: 0; + vertical-align: top; + } + table.responsive-table th { + text-align: left; + } + table.responsive-table thead { + display: block; + float: left; + } + table.responsive-table thead tr { + display: block; + padding: 0 10px 0 0; + } + table.responsive-table thead tr th::before { + content: "\00a0"; + } + table.responsive-table tbody { + display: block; + width: auto; + position: relative; + overflow-x: auto; + white-space: nowrap; + } + table.responsive-table tbody tr { + display: inline-block; + vertical-align: top; + } + table.responsive-table th { + display: block; + text-align: right; + } + table.responsive-table td { + display: block; + min-height: 1.25em; + text-align: left; + } + table.responsive-table tr { + padding: 0 10px; + } + table.responsive-table thead { + border: 0; + border-right: 1px solid #d0d0d0; + } + table.responsive-table.bordered th { + border-bottom: 0; + border-left: 0; + } + table.responsive-table.bordered td { + border-left: 0; + border-right: 0; + border-bottom: 0; + } + table.responsive-table.bordered tr { + border: 0; + } + table.responsive-table.bordered tbody tr { + border-right: 1px solid #d0d0d0; + } +} + +.collection { + margin: 0.5rem 0 1rem 0; + border: 1px solid #e0e0e0; + border-radius: 2px; + overflow: hidden; + position: relative; +} + +.collection .collection-item { + background-color: #fff; + line-height: 1.5rem; + padding: 10px 20px; + margin: 0; + border-bottom: 1px solid #e0e0e0; +} + +.collection .collection-item.avatar { + min-height: 84px; + padding-left: 72px; + position: relative; +} + +.collection .collection-item.avatar .circle { + position: absolute; + width: 42px; + height: 42px; + overflow: hidden; + left: 15px; + display: inline-block; + vertical-align: middle; +} + +.collection .collection-item.avatar i.circle { + font-size: 18px; + line-height: 42px; + color: #fff; + background-color: #999; + text-align: center; +} + +.collection .collection-item.avatar .title { + font-size: 16px; +} + +.collection .collection-item.avatar p { + margin: 0; +} + +.collection .collection-item.avatar .secondary-content { + position: absolute; + top: 16px; + right: 16px; +} + +.collection .collection-item:last-child { + border-bottom: none; +} + +.collection .collection-item.active { + background-color: #26a69a; + color: #eafaf9; +} + +.collection .collection-item.active .secondary-content { + color: #fff; +} + +.collection a.collection-item { + display: block; + transition: .25s; + color: #26a69a; +} + +.collection a.collection-item:not(.active):hover { + background-color: #ddd; +} + +.collection.with-header .collection-header { + background-color: #fff; + border-bottom: 1px solid #e0e0e0; + padding: 10px 20px; +} + +.collection.with-header .collection-item { + padding-left: 30px; +} + +.collection.with-header .collection-item.avatar { + padding-left: 72px; +} + +.secondary-content { + float: right; + color: #26a69a; +} + +.collapsible .collection { + margin: 0; + border: none; +} + +.video-container { + position: relative; + padding-bottom: 56.25%; + height: 0; + overflow: hidden; +} + +.video-container iframe, .video-container object, .video-container embed { + position: absolute; + top: 0; + left: 0; + width: 100%; + height: 100%; +} + +.progress { + position: relative; + height: 4px; + display: block; + width: 100%; + background-color: #acece6; + border-radius: 2px; + margin: 0.5rem 0 1rem 0; + overflow: hidden; +} + +.progress .determinate { + position: absolute; + top: 0; + left: 0; + bottom: 0; + background-color: #26a69a; + transition: width .3s linear; +} + +.progress .indeterminate { + background-color: #26a69a; +} + +.progress .indeterminate:before { + content: ''; + position: absolute; + background-color: inherit; + top: 0; + left: 0; + bottom: 0; + will-change: left, right; + -webkit-animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; + animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; +} + +.progress .indeterminate:after { + content: ''; + position: absolute; + background-color: inherit; + top: 0; + left: 0; + bottom: 0; + will-change: left, right; + -webkit-animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + -webkit-animation-delay: 1.15s; + animation-delay: 1.15s; +} + +@-webkit-keyframes indeterminate { + 0% { + left: -35%; + right: 100%; + } + 60% { + left: 100%; + right: -90%; + } + 100% { + left: 100%; + right: -90%; + } +} + +@keyframes indeterminate { + 0% { + left: -35%; + right: 100%; + } + 60% { + left: 100%; + right: -90%; + } + 100% { + left: 100%; + right: -90%; + } +} + +@-webkit-keyframes indeterminate-short { + 0% { + left: -200%; + right: 100%; + } + 60% { + left: 107%; + right: -8%; + } + 100% { + left: 107%; + right: -8%; + } +} + +@keyframes indeterminate-short { + 0% { + left: -200%; + right: 100%; + } + 60% { + left: 107%; + right: -8%; + } + 100% { + left: 107%; + right: -8%; + } +} + +/******************* + Utility Classes +*******************/ +.hide { + display: none !important; +} + +.left-align { + text-align: left; +} + +.right-align { + text-align: right; +} + +.center, .center-align { + text-align: center; +} + +.left { + float: left !important; +} + +.right { + float: right !important; +} + +.no-select, input[type=range], +input[type=range] + .thumb { + -webkit-touch-callout: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.circle { + border-radius: 50%; +} + +.center-block { + display: block; + margin-left: auto; + margin-right: auto; +} + +.truncate { + display: block; + white-space: nowrap; + overflow: hidden; + text-overflow: ellipsis; +} + +.no-padding { + padding: 0 !important; +} + +span.badge { + min-width: 3rem; + padding: 0 6px; + margin-left: 14px; + text-align: center; + font-size: 1rem; + line-height: 22px; + height: 22px; + color: #757575; + float: right; + box-sizing: border-box; +} + +span.badge.new { + font-weight: 300; + font-size: 0.8rem; + color: #fff; + background-color: #26a69a; + border-radius: 2px; +} + +span.badge.new:after { + content: " new"; +} + +span.badge[data-badge-caption]::after { + content: " " attr(data-badge-caption); +} + +nav ul a span.badge { + display: inline-block; + float: none; + margin-left: 4px; + line-height: 22px; + height: 22px; +} + +.collection-item span.badge { + margin-top: calc(0.75rem - 11px); +} + +.collapsible span.badge { + margin-top: calc(1.5rem - 11px); +} + +.side-nav span.badge { + margin-top: calc(24px - 11px); +} + +/* This is needed for some mobile phones to display the Google Icon font properly */ +.material-icons { + text-rendering: optimizeLegibility; + -webkit-font-feature-settings: 'liga'; + -moz-font-feature-settings: 'liga'; + font-feature-settings: 'liga'; +} + +.container { + margin: 0 auto; + max-width: 1280px; + width: 90%; +} + +@media only screen and (min-width: 601px) { + .container { + width: 85%; + } +} + +@media only screen and (min-width: 993px) { + .container { + width: 70%; + } +} + +.container .row { + margin-left: -0.75rem; + margin-right: -0.75rem; +} + +.section { + padding-top: 1rem; + padding-bottom: 1rem; +} + +.section.no-pad { + padding: 0; +} + +.section.no-pad-bot { + padding-bottom: 0; +} + +.section.no-pad-top { + padding-top: 0; +} + +.row { + margin-left: auto; + margin-right: auto; + margin-bottom: 20px; +} + +.row:after { + content: ""; + display: table; + clear: both; +} + +.row .col { + float: left; + box-sizing: border-box; + padding: 0 0.75rem; + min-height: 1px; +} + +.row .col[class*="push-"], .row .col[class*="pull-"] { + position: relative; +} + +.row .col.s1 { + width: 8.3333333333%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s2 { + width: 16.6666666667%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s3 { + width: 25%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s4 { + width: 33.3333333333%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s5 { + width: 41.6666666667%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s6 { + width: 50%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s7 { + width: 58.3333333333%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s8 { + width: 66.6666666667%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s9 { + width: 75%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s10 { + width: 83.3333333333%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s11 { + width: 91.6666666667%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s12 { + width: 100%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.offset-s1 { + margin-left: 8.3333333333%; +} + +.row .col.pull-s1 { + right: 8.3333333333%; +} + +.row .col.push-s1 { + left: 8.3333333333%; +} + +.row .col.offset-s2 { + margin-left: 16.6666666667%; +} + +.row .col.pull-s2 { + right: 16.6666666667%; +} + +.row .col.push-s2 { + left: 16.6666666667%; +} + +.row .col.offset-s3 { + margin-left: 25%; +} + +.row .col.pull-s3 { + right: 25%; +} + +.row .col.push-s3 { + left: 25%; +} + +.row .col.offset-s4 { + margin-left: 33.3333333333%; +} + +.row .col.pull-s4 { + right: 33.3333333333%; +} + +.row .col.push-s4 { + left: 33.3333333333%; +} + +.row .col.offset-s5 { + margin-left: 41.6666666667%; +} + +.row .col.pull-s5 { + right: 41.6666666667%; +} + +.row .col.push-s5 { + left: 41.6666666667%; +} + +.row .col.offset-s6 { + margin-left: 50%; +} + +.row .col.pull-s6 { + right: 50%; +} + +.row .col.push-s6 { + left: 50%; +} + +.row .col.offset-s7 { + margin-left: 58.3333333333%; +} + +.row .col.pull-s7 { + right: 58.3333333333%; +} + +.row .col.push-s7 { + left: 58.3333333333%; +} + +.row .col.offset-s8 { + margin-left: 66.6666666667%; +} + +.row .col.pull-s8 { + right: 66.6666666667%; +} + +.row .col.push-s8 { + left: 66.6666666667%; +} + +.row .col.offset-s9 { + margin-left: 75%; +} + +.row .col.pull-s9 { + right: 75%; +} + +.row .col.push-s9 { + left: 75%; +} + +.row .col.offset-s10 { + margin-left: 83.3333333333%; +} + +.row .col.pull-s10 { + right: 83.3333333333%; +} + +.row .col.push-s10 { + left: 83.3333333333%; +} + +.row .col.offset-s11 { + margin-left: 91.6666666667%; +} + +.row .col.pull-s11 { + right: 91.6666666667%; +} + +.row .col.push-s11 { + left: 91.6666666667%; +} + +.row .col.offset-s12 { + margin-left: 100%; +} + +.row .col.pull-s12 { + right: 100%; +} + +.row .col.push-s12 { + left: 100%; +} + +@media only screen and (min-width: 601px) { + .row .col.m1 { + width: 8.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m2 { + width: 16.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m3 { + width: 25%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m4 { + width: 33.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m5 { + width: 41.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m6 { + width: 50%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m7 { + width: 58.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m8 { + width: 66.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m9 { + width: 75%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m10 { + width: 83.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m11 { + width: 91.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m12 { + width: 100%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.offset-m1 { + margin-left: 8.3333333333%; + } + .row .col.pull-m1 { + right: 8.3333333333%; + } + .row .col.push-m1 { + left: 8.3333333333%; + } + .row .col.offset-m2 { + margin-left: 16.6666666667%; + } + .row .col.pull-m2 { + right: 16.6666666667%; + } + .row .col.push-m2 { + left: 16.6666666667%; + } + .row .col.offset-m3 { + margin-left: 25%; + } + .row .col.pull-m3 { + right: 25%; + } + .row .col.push-m3 { + left: 25%; + } + .row .col.offset-m4 { + margin-left: 33.3333333333%; + } + .row .col.pull-m4 { + right: 33.3333333333%; + } + .row .col.push-m4 { + left: 33.3333333333%; + } + .row .col.offset-m5 { + margin-left: 41.6666666667%; + } + .row .col.pull-m5 { + right: 41.6666666667%; + } + .row .col.push-m5 { + left: 41.6666666667%; + } + .row .col.offset-m6 { + margin-left: 50%; + } + .row .col.pull-m6 { + right: 50%; + } + .row .col.push-m6 { + left: 50%; + } + .row .col.offset-m7 { + margin-left: 58.3333333333%; + } + .row .col.pull-m7 { + right: 58.3333333333%; + } + .row .col.push-m7 { + left: 58.3333333333%; + } + .row .col.offset-m8 { + margin-left: 66.6666666667%; + } + .row .col.pull-m8 { + right: 66.6666666667%; + } + .row .col.push-m8 { + left: 66.6666666667%; + } + .row .col.offset-m9 { + margin-left: 75%; + } + .row .col.pull-m9 { + right: 75%; + } + .row .col.push-m9 { + left: 75%; + } + .row .col.offset-m10 { + margin-left: 83.3333333333%; + } + .row .col.pull-m10 { + right: 83.3333333333%; + } + .row .col.push-m10 { + left: 83.3333333333%; + } + .row .col.offset-m11 { + margin-left: 91.6666666667%; + } + .row .col.pull-m11 { + right: 91.6666666667%; + } + .row .col.push-m11 { + left: 91.6666666667%; + } + .row .col.offset-m12 { + margin-left: 100%; + } + .row .col.pull-m12 { + right: 100%; + } + .row .col.push-m12 { + left: 100%; + } +} + +@media only screen and (min-width: 993px) { + .row .col.l1 { + width: 8.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l2 { + width: 16.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l3 { + width: 25%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l4 { + width: 33.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l5 { + width: 41.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l6 { + width: 50%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l7 { + width: 58.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l8 { + width: 66.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l9 { + width: 75%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l10 { + width: 83.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l11 { + width: 91.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l12 { + width: 100%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.offset-l1 { + margin-left: 8.3333333333%; + } + .row .col.pull-l1 { + right: 8.3333333333%; + } + .row .col.push-l1 { + left: 8.3333333333%; + } + .row .col.offset-l2 { + margin-left: 16.6666666667%; + } + .row .col.pull-l2 { + right: 16.6666666667%; + } + .row .col.push-l2 { + left: 16.6666666667%; + } + .row .col.offset-l3 { + margin-left: 25%; + } + .row .col.pull-l3 { + right: 25%; + } + .row .col.push-l3 { + left: 25%; + } + .row .col.offset-l4 { + margin-left: 33.3333333333%; + } + .row .col.pull-l4 { + right: 33.3333333333%; + } + .row .col.push-l4 { + left: 33.3333333333%; + } + .row .col.offset-l5 { + margin-left: 41.6666666667%; + } + .row .col.pull-l5 { + right: 41.6666666667%; + } + .row .col.push-l5 { + left: 41.6666666667%; + } + .row .col.offset-l6 { + margin-left: 50%; + } + .row .col.pull-l6 { + right: 50%; + } + .row .col.push-l6 { + left: 50%; + } + .row .col.offset-l7 { + margin-left: 58.3333333333%; + } + .row .col.pull-l7 { + right: 58.3333333333%; + } + .row .col.push-l7 { + left: 58.3333333333%; + } + .row .col.offset-l8 { + margin-left: 66.6666666667%; + } + .row .col.pull-l8 { + right: 66.6666666667%; + } + .row .col.push-l8 { + left: 66.6666666667%; + } + .row .col.offset-l9 { + margin-left: 75%; + } + .row .col.pull-l9 { + right: 75%; + } + .row .col.push-l9 { + left: 75%; + } + .row .col.offset-l10 { + margin-left: 83.3333333333%; + } + .row .col.pull-l10 { + right: 83.3333333333%; + } + .row .col.push-l10 { + left: 83.3333333333%; + } + .row .col.offset-l11 { + margin-left: 91.6666666667%; + } + .row .col.pull-l11 { + right: 91.6666666667%; + } + .row .col.push-l11 { + left: 91.6666666667%; + } + .row .col.offset-l12 { + margin-left: 100%; + } + .row .col.pull-l12 { + right: 100%; + } + .row .col.push-l12 { + left: 100%; + } +} + +nav { + color: #fff; + background-color: #ee6e73; + width: 100%; + height: 56px; + line-height: 56px; +} + +nav.nav-extended { + height: auto; +} + +nav.nav-extended .nav-wrapper { + min-height: 56px; + height: auto; +} + +nav.nav-extended .nav-content { + position: relative; + line-height: normal; +} + +nav a { + color: #fff; +} + +nav i, +nav [class^="mdi-"], nav [class*="mdi-"], +nav i.material-icons { + display: block; + font-size: 24px; + height: 56px; + line-height: 56px; +} + +nav .nav-wrapper { + position: relative; + height: 100%; +} + +@media only screen and (min-width: 993px) { + nav a.button-collapse { + display: none; + } +} + +nav .button-collapse { + float: left; + position: relative; + z-index: 1; + height: 56px; + margin: 0 18px; +} + +nav .button-collapse i { + height: 56px; + line-height: 56px; +} + +nav .brand-logo { + position: absolute; + color: #fff; + display: inline-block; + font-size: 2.1rem; + padding: 0; + white-space: nowrap; +} + +nav .brand-logo.center { + left: 50%; + -webkit-transform: translateX(-50%); + transform: translateX(-50%); +} + +@media only screen and (max-width: 992px) { + nav .brand-logo { + left: 50%; + -webkit-transform: translateX(-50%); + transform: translateX(-50%); + } + nav .brand-logo.left, nav .brand-logo.right { + padding: 0; + -webkit-transform: none; + transform: none; + } + nav .brand-logo.left { + left: 0.5rem; + } + nav .brand-logo.right { + right: 0.5rem; + left: auto; + } +} + +nav .brand-logo.right { + right: 0.5rem; + padding: 0; +} + +nav .brand-logo i, +nav .brand-logo [class^="mdi-"], nav .brand-logo [class*="mdi-"], +nav .brand-logo i.material-icons { + float: left; + margin-right: 15px; +} + +nav .nav-title { + display: inline-block; + font-size: 32px; + padding: 28px 0; +} + +nav ul { + margin: 0; +} + +nav ul li { + transition: background-color .3s; + float: left; + padding: 0; +} + +nav ul li.active { + background-color: rgba(0, 0, 0, 0.1); +} + +nav ul a { + transition: background-color .3s; + font-size: 1rem; + color: #fff; + display: block; + padding: 0 15px; + cursor: pointer; +} + +nav ul a.btn, nav ul a.btn-large, nav ul a.btn-large, nav ul a.btn-flat, nav ul a.btn-floating { + margin-top: -2px; + margin-left: 15px; + margin-right: 15px; +} + +nav ul a.btn > .material-icons, nav ul a.btn-large > .material-icons, nav ul a.btn-large > .material-icons, nav ul a.btn-flat > .material-icons, nav ul a.btn-floating > .material-icons { + height: inherit; + line-height: inherit; +} + +nav ul a:hover { + background-color: rgba(0, 0, 0, 0.1); +} + +nav ul.left { + float: left; +} + +nav form { + height: 100%; +} + +nav .input-field { + margin: 0; + height: 100%; +} + +nav .input-field input { + height: 100%; + font-size: 1.2rem; + border: none; + padding-left: 2rem; +} + +nav .input-field input:focus, nav .input-field input[type=text]:valid, nav .input-field input[type=password]:valid, nav .input-field input[type=email]:valid, nav .input-field input[type=url]:valid, nav .input-field input[type=date]:valid { + border: none; + box-shadow: none; +} + +nav .input-field label { + top: 0; + left: 0; +} + +nav .input-field label i { + color: rgba(255, 255, 255, 0.7); + transition: color .3s; +} + +nav .input-field label.active i { + color: #fff; +} + +.navbar-fixed { + position: relative; + height: 56px; + z-index: 997; +} + +.navbar-fixed nav { + position: fixed; +} + +@media only screen and (min-width: 601px) { + nav.nav-extended .nav-wrapper { + min-height: 64px; + } + nav, nav .nav-wrapper i, nav a.button-collapse, nav a.button-collapse i { + height: 64px; + line-height: 64px; + } + .navbar-fixed { + height: 64px; + } +} + +@font-face { + font-family: "Roboto"; + src: local(Roboto Thin), url("../fonts/roboto/Roboto-Thin.eot"); + src: url("../fonts/roboto/Roboto-Thin.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Thin.woff2") format("woff2"), url("../fonts/roboto/Roboto-Thin.woff") format("woff"), url("../fonts/roboto/Roboto-Thin.ttf") format("truetype"); + font-weight: 200; +} + +@font-face { + font-family: "Roboto"; + src: local(Roboto Light), url("../fonts/roboto/Roboto-Light.eot"); + src: url("../fonts/roboto/Roboto-Light.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Light.woff2") format("woff2"), url("../fonts/roboto/Roboto-Light.woff") format("woff"), url("../fonts/roboto/Roboto-Light.ttf") format("truetype"); + font-weight: 300; +} + +@font-face { + font-family: "Roboto"; + src: local(Roboto Regular), url("../fonts/roboto/Roboto-Regular.eot"); + src: url("../fonts/roboto/Roboto-Regular.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Regular.woff2") format("woff2"), url("../fonts/roboto/Roboto-Regular.woff") format("woff"), url("../fonts/roboto/Roboto-Regular.ttf") format("truetype"); + font-weight: 400; +} + +@font-face { + font-family: "Roboto"; + src: url("../fonts/roboto/Roboto-Medium.eot"); + src: url("../fonts/roboto/Roboto-Medium.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Medium.woff2") format("woff2"), url("../fonts/roboto/Roboto-Medium.woff") format("woff"), url("../fonts/roboto/Roboto-Medium.ttf") format("truetype"); + font-weight: 500; +} + +@font-face { + font-family: "Roboto"; + src: url("../fonts/roboto/Roboto-Bold.eot"); + src: url("../fonts/roboto/Roboto-Bold.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Bold.woff2") format("woff2"), url("../fonts/roboto/Roboto-Bold.woff") format("woff"), url("../fonts/roboto/Roboto-Bold.ttf") format("truetype"); + font-weight: 700; +} + +a { + text-decoration: none; +} + +html { + line-height: 1.5; + font-family: "Roboto", sans-serif; + font-weight: normal; + color: rgba(0, 0, 0, 0.87); +} + +@media only screen and (min-width: 0) { + html { + font-size: 14px; + } +} + +@media only screen and (min-width: 992px) { + html { + font-size: 14.5px; + } +} + +@media only screen and (min-width: 1200px) { + html { + font-size: 15px; + } +} + +h1, h2, h3, h4, h5, h6 { + font-weight: 400; + line-height: 1.1; +} + +h1 a, h2 a, h3 a, h4 a, h5 a, h6 a { + font-weight: inherit; +} + +h1 { + font-size: 4.2rem; + line-height: 110%; + margin: 2.1rem 0 1.68rem 0; +} + +h2 { + font-size: 3.56rem; + line-height: 110%; + margin: 1.78rem 0 1.424rem 0; +} + +h3 { + font-size: 2.92rem; + line-height: 110%; + margin: 1.46rem 0 1.168rem 0; +} + +h4 { + font-size: 2.28rem; + line-height: 110%; + margin: 1.14rem 0 0.912rem 0; +} + +h5 { + font-size: 1.64rem; + line-height: 110%; + margin: 0.82rem 0 0.656rem 0; +} + +h6 { + font-size: 1rem; + line-height: 110%; + margin: 0.5rem 0 0.4rem 0; +} + +em { + font-style: italic; +} + +strong { + font-weight: 500; +} + +small { + font-size: 75%; +} + +.light, footer.page-footer .footer-copyright { + font-weight: 300; +} + +.thin { + font-weight: 200; +} + +.flow-text { + font-weight: 300; +} + +@media only screen and (min-width: 360px) { + .flow-text { + font-size: 1.2rem; + } +} + +@media only screen and (min-width: 390px) { + .flow-text { + font-size: 1.224rem; + } +} + +@media only screen and (min-width: 420px) { + .flow-text { + font-size: 1.248rem; + } +} + +@media only screen and (min-width: 450px) { + .flow-text { + font-size: 1.272rem; + } +} + +@media only screen and (min-width: 480px) { + .flow-text { + font-size: 1.296rem; + } +} + +@media only screen and (min-width: 510px) { + .flow-text { + font-size: 1.32rem; + } +} + +@media only screen and (min-width: 540px) { + .flow-text { + font-size: 1.344rem; + } +} + +@media only screen and (min-width: 570px) { + .flow-text { + font-size: 1.368rem; + } +} + +@media only screen and (min-width: 600px) { + .flow-text { + font-size: 1.392rem; + } +} + +@media only screen and (min-width: 630px) { + .flow-text { + font-size: 1.416rem; + } +} + +@media only screen and (min-width: 660px) { + .flow-text { + font-size: 1.44rem; + } +} + +@media only screen and (min-width: 690px) { + .flow-text { + font-size: 1.464rem; + } +} + +@media only screen and (min-width: 720px) { + .flow-text { + font-size: 1.488rem; + } +} + +@media only screen and (min-width: 750px) { + .flow-text { + font-size: 1.512rem; + } +} + +@media only screen and (min-width: 780px) { + .flow-text { + font-size: 1.536rem; + } +} + +@media only screen and (min-width: 810px) { + .flow-text { + font-size: 1.56rem; + } +} + +@media only screen and (min-width: 840px) { + .flow-text { + font-size: 1.584rem; + } +} + +@media only screen and (min-width: 870px) { + .flow-text { + font-size: 1.608rem; + } +} + +@media only screen and (min-width: 900px) { + .flow-text { + font-size: 1.632rem; + } +} + +@media only screen and (min-width: 930px) { + .flow-text { + font-size: 1.656rem; + } +} + +@media only screen and (min-width: 960px) { + .flow-text { + font-size: 1.68rem; + } +} + +@media only screen and (max-width: 360px) { + .flow-text { + font-size: 1.2rem; + } +} + +.scale-transition { + transition: -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important; + transition: transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important; + transition: transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63), -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important; +} + +.scale-transition.scale-out { + -webkit-transform: scale(0); + transform: scale(0); + transition: -webkit-transform .2s !important; + transition: transform .2s !important; + transition: transform .2s, -webkit-transform .2s !important; +} + +.scale-transition.scale-in { + -webkit-transform: scale(1); + transform: scale(1); +} + +.card-panel { + transition: box-shadow .25s; + padding: 24px; + margin: 0.5rem 0 1rem 0; + border-radius: 2px; + background-color: #fff; +} + +.card { + position: relative; + margin: 0.5rem 0 1rem 0; + background-color: #fff; + transition: box-shadow .25s; + border-radius: 2px; +} + +.card .card-title { + font-size: 24px; + font-weight: 300; +} + +.card .card-title.activator { + cursor: pointer; +} + +.card.small, .card.medium, .card.large { + position: relative; +} + +.card.small .card-image, .card.medium .card-image, .card.large .card-image { + max-height: 60%; + overflow: hidden; +} + +.card.small .card-image + .card-content, .card.medium .card-image + .card-content, .card.large .card-image + .card-content { + max-height: 40%; +} + +.card.small .card-content, .card.medium .card-content, .card.large .card-content { + max-height: 100%; + overflow: hidden; +} + +.card.small .card-action, .card.medium .card-action, .card.large .card-action { + position: absolute; + bottom: 0; + left: 0; + right: 0; +} + +.card.small { + height: 300px; +} + +.card.medium { + height: 400px; +} + +.card.large { + height: 500px; +} + +.card.horizontal { + display: -webkit-flex; + display: -ms-flexbox; + display: flex; +} + +.card.horizontal.small .card-image, .card.horizontal.medium .card-image, .card.horizontal.large .card-image { + height: 100%; + max-height: none; + overflow: visible; +} + +.card.horizontal.small .card-image img, .card.horizontal.medium .card-image img, .card.horizontal.large .card-image img { + height: 100%; +} + +.card.horizontal .card-image { + max-width: 50%; +} + +.card.horizontal .card-image img { + border-radius: 2px 0 0 2px; + max-width: 100%; + width: auto; +} + +.card.horizontal .card-stacked { + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + -webkit-flex-direction: column; + -ms-flex-direction: column; + flex-direction: column; + -webkit-flex: 1; + -ms-flex: 1; + flex: 1; + position: relative; +} + +.card.horizontal .card-stacked .card-content { + -webkit-flex-grow: 1; + -ms-flex-positive: 1; + flex-grow: 1; +} + +.card.sticky-action .card-action { + z-index: 2; +} + +.card.sticky-action .card-reveal { + z-index: 1; + padding-bottom: 64px; +} + +.card .card-image { + position: relative; +} + +.card .card-image img { + display: block; + border-radius: 2px 2px 0 0; + position: relative; + left: 0; + right: 0; + top: 0; + bottom: 0; + width: 100%; +} + +.card .card-image .card-title { + color: #fff; + position: absolute; + bottom: 0; + left: 0; + max-width: 100%; + padding: 24px; +} + +.card .card-content { + padding: 24px; + border-radius: 0 0 2px 2px; +} + +.card .card-content p { + margin: 0; + color: inherit; +} + +.card .card-content .card-title { + display: block; + line-height: 32px; + margin-bottom: 8px; +} + +.card .card-content .card-title i { + line-height: 32px; +} + +.card .card-action { + position: relative; + background-color: inherit; + border-top: 1px solid rgba(160, 160, 160, 0.2); + padding: 16px 24px; +} + +.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating) { + color: #ffab40; + margin-right: 24px; + transition: color .3s ease; + text-transform: uppercase; +} + +.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating):hover { + color: #ffd8a6; +} + +.card .card-reveal { + padding: 24px; + position: absolute; + background-color: #fff; + width: 100%; + overflow-y: auto; + left: 0; + top: 100%; + height: 100%; + z-index: 3; + display: none; +} + +.card .card-reveal .card-title { + cursor: pointer; + display: block; +} + +#toast-container { + display: block; + position: fixed; + z-index: 10000; +} + +@media only screen and (max-width: 600px) { + #toast-container { + min-width: 100%; + bottom: 0%; + } +} + +@media only screen and (min-width: 601px) and (max-width: 992px) { + #toast-container { + left: 5%; + bottom: 7%; + max-width: 90%; + } +} + +@media only screen and (min-width: 993px) { + #toast-container { + top: 10%; + right: 7%; + max-width: 86%; + } +} + +.toast { + border-radius: 2px; + top: 35px; + width: auto; + clear: both; + margin-top: 10px; + position: relative; + max-width: 100%; + height: auto; + min-height: 48px; + line-height: 1.5em; + word-break: break-all; + background-color: #323232; + padding: 10px 25px; + font-size: 1.1rem; + font-weight: 300; + color: #fff; + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + -webkit-align-items: center; + -ms-flex-align: center; + align-items: center; + -webkit-justify-content: space-between; + -ms-flex-pack: justify; + justify-content: space-between; +} + +.toast .btn, .toast .btn-large, .toast .btn-flat { + margin: 0; + margin-left: 3rem; +} + +.toast.rounded { + border-radius: 24px; +} + +@media only screen and (max-width: 600px) { + .toast { + width: 100%; + border-radius: 0; + } +} + +@media only screen and (min-width: 601px) and (max-width: 992px) { + .toast { + float: left; + } +} + +@media only screen and (min-width: 993px) { + .toast { + float: right; + } +} + +.tabs { + position: relative; + overflow-x: auto; + overflow-y: hidden; + height: 48px; + width: 100%; + background-color: #fff; + margin: 0 auto; + white-space: nowrap; +} + +.tabs.tabs-transparent { + background-color: transparent; +} + +.tabs.tabs-transparent .tab a, +.tabs.tabs-transparent .tab.disabled a, +.tabs.tabs-transparent .tab.disabled a:hover { + color: rgba(255, 255, 255, 0.7); +} + +.tabs.tabs-transparent .tab a:hover, +.tabs.tabs-transparent .tab a.active { + color: #fff; +} + +.tabs.tabs-transparent .indicator { + background-color: #fff; +} + +.tabs.tabs-fixed-width { + display: -webkit-flex; + display: -ms-flexbox; + display: flex; +} + +.tabs.tabs-fixed-width .tab { + -webkit-flex-grow: 1; + -ms-flex-positive: 1; + flex-grow: 1; +} + +.tabs .tab { + display: inline-block; + text-align: center; + line-height: 48px; + height: 48px; + padding: 0; + margin: 0; + text-transform: uppercase; +} + +.tabs .tab a { + color: rgba(238, 110, 115, 0.7); + display: block; + width: 100%; + height: 100%; + padding: 0 24px; + font-size: 14px; + text-overflow: ellipsis; + overflow: hidden; + transition: color .28s ease; +} + +.tabs .tab a:hover, .tabs .tab a.active { + background-color: transparent; + color: #ee6e73; +} + +.tabs .tab.disabled a, +.tabs .tab.disabled a:hover { + color: rgba(238, 110, 115, 0.7); + cursor: default; +} + +.tabs .indicator { + position: absolute; + bottom: 0; + height: 2px; + background-color: #f6b2b5; + will-change: left, right; +} + +@media only screen and (max-width: 992px) { + .tabs { + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + } + .tabs .tab { + -webkit-flex-grow: 1; + -ms-flex-positive: 1; + flex-grow: 1; + } + .tabs .tab a { + padding: 0 12px; + } +} + +.material-tooltip { + padding: 10px 8px; + font-size: 1rem; + z-index: 2000; + background-color: transparent; + border-radius: 2px; + color: #fff; + min-height: 36px; + line-height: 120%; + opacity: 0; + position: absolute; + text-align: center; + max-width: calc(100% - 4px); + overflow: hidden; + left: 0; + top: 0; + pointer-events: none; + visibility: hidden; +} + +.backdrop { + position: absolute; + opacity: 0; + height: 7px; + width: 14px; + border-radius: 0 0 50% 50%; + background-color: #323232; + z-index: -1; + -webkit-transform-origin: 50% 0%; + transform-origin: 50% 0%; + visibility: hidden; +} + +.btn, .btn-large, +.btn-flat { + border: none; + border-radius: 2px; + display: inline-block; + height: 36px; + line-height: 36px; + padding: 0 2rem; + text-transform: uppercase; + vertical-align: middle; + -webkit-tap-highlight-color: transparent; +} + +.btn.disabled, .disabled.btn-large, +.btn-floating.disabled, +.btn-large.disabled, +.btn-flat.disabled, +.btn:disabled, +.btn-large:disabled, +.btn-floating:disabled, +.btn-large:disabled, +.btn-flat:disabled, +.btn[disabled], +[disabled].btn-large, +.btn-floating[disabled], +.btn-large[disabled], +.btn-flat[disabled] { + pointer-events: none; + background-color: #DFDFDF !important; + box-shadow: none; + color: #9F9F9F !important; + cursor: default; +} + +.btn.disabled:hover, .disabled.btn-large:hover, +.btn-floating.disabled:hover, +.btn-large.disabled:hover, +.btn-flat.disabled:hover, +.btn:disabled:hover, +.btn-large:disabled:hover, +.btn-floating:disabled:hover, +.btn-large:disabled:hover, +.btn-flat:disabled:hover, +.btn[disabled]:hover, +[disabled].btn-large:hover, +.btn-floating[disabled]:hover, +.btn-large[disabled]:hover, +.btn-flat[disabled]:hover { + background-color: #DFDFDF !important; + color: #9F9F9F !important; +} + +.btn, .btn-large, +.btn-floating, +.btn-large, +.btn-flat { + outline: 0; +} + +.btn i, .btn-large i, +.btn-floating i, +.btn-large i, +.btn-flat i { + font-size: 1.3rem; + line-height: inherit; +} + +.btn:focus, .btn-large:focus, +.btn-floating:focus { + background-color: #1d7d74; +} + +.btn, .btn-large { + text-decoration: none; + color: #fff; + background-color: #26a69a; + text-align: center; + letter-spacing: .5px; + transition: .2s ease-out; + cursor: pointer; +} + +.btn:hover, .btn-large:hover { + background-color: #2bbbad; +} + +.btn-floating { + display: inline-block; + color: #fff; + position: relative; + overflow: hidden; + z-index: 1; + width: 40px; + height: 40px; + line-height: 40px; + padding: 0; + background-color: #26a69a; + border-radius: 50%; + transition: .3s; + cursor: pointer; + vertical-align: middle; +} + +.btn-floating:hover { + background-color: #26a69a; +} + +.btn-floating:before { + border-radius: 0; +} + +.btn-floating.btn-large { + width: 56px; + height: 56px; +} + +.btn-floating.btn-large i { + line-height: 56px; +} + +.btn-floating.halfway-fab { + position: absolute; + right: 24px; + bottom: 0; + -webkit-transform: translateY(50%); + transform: translateY(50%); +} + +.btn-floating.halfway-fab.left { + right: auto; + left: 24px; +} + +.btn-floating i { + width: inherit; + display: inline-block; + text-align: center; + color: #fff; + font-size: 1.6rem; + line-height: 40px; +} + +button.btn-floating { + border: none; +} + +.fixed-action-btn { + position: fixed; + right: 23px; + bottom: 23px; + padding-top: 15px; + margin-bottom: 0; + z-index: 998; +} + +.fixed-action-btn.active ul { + visibility: visible; +} + +.fixed-action-btn.horizontal { + padding: 0 0 0 15px; +} + +.fixed-action-btn.horizontal ul { + text-align: right; + right: 64px; + top: 50%; + -webkit-transform: translateY(-50%); + transform: translateY(-50%); + height: 100%; + left: auto; + width: 500px; + /*width 100% only goes to width of button container */ +} + +.fixed-action-btn.horizontal ul li { + display: inline-block; + margin: 15px 15px 0 0; +} + +.fixed-action-btn.toolbar { + padding: 0; + height: 56px; +} + +.fixed-action-btn.toolbar.active > a i { + opacity: 0; +} + +.fixed-action-btn.toolbar ul { + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + top: 0; + bottom: 0; +} + +.fixed-action-btn.toolbar ul li { + -webkit-flex: 1; + -ms-flex: 1; + flex: 1; + display: inline-block; + margin: 0; + height: 100%; + transition: none; +} + +.fixed-action-btn.toolbar ul li a { + display: block; + overflow: hidden; + position: relative; + width: 100%; + height: 100%; + background-color: transparent; + box-shadow: none; + color: #fff; + line-height: 56px; + z-index: 1; +} + +.fixed-action-btn.toolbar ul li a i { + line-height: inherit; +} + +.fixed-action-btn ul { + left: 0; + right: 0; + text-align: center; + position: absolute; + bottom: 64px; + margin: 0; + visibility: hidden; +} + +.fixed-action-btn ul li { + margin-bottom: 15px; +} + +.fixed-action-btn ul a.btn-floating { + opacity: 0; +} + +.fixed-action-btn .fab-backdrop { + position: absolute; + top: 0; + left: 0; + z-index: -1; + width: 40px; + height: 40px; + background-color: #26a69a; + border-radius: 50%; + -webkit-transform: scale(0); + transform: scale(0); +} + +.btn-flat { + box-shadow: none; + background-color: transparent; + color: #343434; + cursor: pointer; + transition: background-color .2s; +} + +.btn-flat:focus, .btn-flat:active { + background-color: transparent; +} + +.btn-flat:focus, .btn-flat:hover { + background-color: rgba(0, 0, 0, 0.1); + box-shadow: none; +} + +.btn-flat:active { + background-color: rgba(0, 0, 0, 0.2); +} + +.btn-flat.disabled { + background-color: transparent !important; + color: #b3b3b3 !important; + cursor: default; +} + +.btn-large { + height: 54px; + line-height: 54px; +} + +.btn-large i { + font-size: 1.6rem; +} + +.btn-block { + display: block; +} + +.dropdown-content { + background-color: #fff; + margin: 0; + display: none; + min-width: 100px; + max-height: 650px; + overflow-y: auto; + opacity: 0; + position: absolute; + z-index: 999; + will-change: width, height; +} + +.dropdown-content li { + clear: both; + color: rgba(0, 0, 0, 0.87); + cursor: pointer; + min-height: 50px; + line-height: 1.5rem; + width: 100%; + text-align: left; + text-transform: none; +} + +.dropdown-content li:hover, .dropdown-content li.active, .dropdown-content li.selected { + background-color: #eee; +} + +.dropdown-content li.active.selected { + background-color: #e1e1e1; +} + +.dropdown-content li.divider { + min-height: 0; + height: 1px; +} + +.dropdown-content li > a, .dropdown-content li > span { + font-size: 16px; + color: #26a69a; + display: block; + line-height: 22px; + padding: 14px 16px; +} + +.dropdown-content li > span > label { + top: 1px; + left: 0; + height: 18px; +} + +.dropdown-content li > a > i { + height: inherit; + line-height: inherit; +} + +.input-field.col .dropdown-content [type="checkbox"] + label { + top: 1px; + left: 0; + height: 18px; +} + +/*! + * Waves v0.6.0 + * http://fian.my.id/Waves + * + * Copyright 2014 Alfiana E. Sibuea and other contributors + * Released under the MIT license + * https://github.com/fians/Waves/blob/master/LICENSE + */ +.waves-effect { + position: relative; + cursor: pointer; + display: inline-block; + overflow: hidden; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + -webkit-tap-highlight-color: transparent; + vertical-align: middle; + z-index: 1; + transition: .3s ease-out; +} + +.waves-effect .waves-ripple { + position: absolute; + border-radius: 50%; + width: 20px; + height: 20px; + margin-top: -10px; + margin-left: -10px; + opacity: 0; + background: rgba(0, 0, 0, 0.2); + transition: all 0.7s ease-out; + transition-property: opacity, -webkit-transform; + transition-property: transform, opacity; + transition-property: transform, opacity, -webkit-transform; + -webkit-transform: scale(0); + transform: scale(0); + pointer-events: none; +} + +.waves-effect.waves-light .waves-ripple { + background-color: rgba(255, 255, 255, 0.45); +} + +.waves-effect.waves-red .waves-ripple { + background-color: rgba(244, 67, 54, 0.7); +} + +.waves-effect.waves-yellow .waves-ripple { + background-color: rgba(255, 235, 59, 0.7); +} + +.waves-effect.waves-orange .waves-ripple { + background-color: rgba(255, 152, 0, 0.7); +} + +.waves-effect.waves-purple .waves-ripple { + background-color: rgba(156, 39, 176, 0.7); +} + +.waves-effect.waves-green .waves-ripple { + background-color: rgba(76, 175, 80, 0.7); +} + +.waves-effect.waves-teal .waves-ripple { + background-color: rgba(0, 150, 136, 0.7); +} + +.waves-effect input[type="button"], .waves-effect input[type="reset"], .waves-effect input[type="submit"] { + border: 0; + font-style: normal; + font-size: inherit; + text-transform: inherit; + background: none; +} + +.waves-effect img { + position: relative; + z-index: -1; +} + +.waves-notransition { + transition: none !important; +} + +.waves-circle { + -webkit-transform: translateZ(0); + transform: translateZ(0); + -webkit-mask-image: -webkit-radial-gradient(circle, white 100%, black 100%); +} + +.waves-input-wrapper { + border-radius: 0.2em; + vertical-align: bottom; +} + +.waves-input-wrapper .waves-button-input { + position: relative; + top: 0; + left: 0; + z-index: 1; +} + +.waves-circle { + text-align: center; + width: 2.5em; + height: 2.5em; + line-height: 2.5em; + border-radius: 50%; + -webkit-mask-image: none; +} + +.waves-block { + display: block; +} + +/* Firefox Bug: link not triggered */ +.waves-effect .waves-ripple { + z-index: -1; +} + +.modal { + display: none; + position: fixed; + left: 0; + right: 0; + background-color: #fafafa; + padding: 0; + max-height: 70%; + width: 55%; + margin: auto; + overflow-y: auto; + border-radius: 2px; + will-change: top, opacity; +} + +@media only screen and (max-width: 992px) { + .modal { + width: 80%; + } +} + +.modal h1, .modal h2, .modal h3, .modal h4 { + margin-top: 0; +} + +.modal .modal-content { + padding: 24px; +} + +.modal .modal-close { + cursor: pointer; +} + +.modal .modal-footer { + border-radius: 0 0 2px 2px; + background-color: #fafafa; + padding: 4px 6px; + height: 56px; + width: 100%; +} + +.modal .modal-footer .btn, .modal .modal-footer .btn-large, .modal .modal-footer .btn-flat { + float: right; + margin: 6px 0; +} + +.modal-overlay { + position: fixed; + z-index: 999; + top: -100px; + left: 0; + bottom: 0; + right: 0; + height: 125%; + width: 100%; + background: #000; + display: none; + will-change: opacity; +} + +.modal.modal-fixed-footer { + padding: 0; + height: 70%; +} + +.modal.modal-fixed-footer .modal-content { + position: absolute; + height: calc(100% - 56px); + max-height: 100%; + width: 100%; + overflow-y: auto; +} + +.modal.modal-fixed-footer .modal-footer { + border-top: 1px solid rgba(0, 0, 0, 0.1); + position: absolute; + bottom: 0; +} + +.modal.bottom-sheet { + top: auto; + bottom: -100%; + margin: 0; + width: 100%; + max-height: 45%; + border-radius: 0; + will-change: bottom, opacity; +} + +.collapsible { + border-top: 1px solid #ddd; + border-right: 1px solid #ddd; + border-left: 1px solid #ddd; + margin: 0.5rem 0 1rem 0; +} + +.collapsible-header { + display: block; + cursor: pointer; + min-height: 3rem; + line-height: 3rem; + padding: 0 1rem; + background-color: #fff; + border-bottom: 1px solid #ddd; +} + +.collapsible-header i { + width: 2rem; + font-size: 1.6rem; + line-height: 3rem; + display: block; + float: left; + text-align: center; + margin-right: 1rem; +} + +.collapsible-body { + display: none; + border-bottom: 1px solid #ddd; + box-sizing: border-box; + padding: 2rem; +} + +.side-nav .collapsible, +.side-nav.fixed .collapsible { + border: none; + box-shadow: none; +} + +.side-nav .collapsible li, +.side-nav.fixed .collapsible li { + padding: 0; +} + +.side-nav .collapsible-header, +.side-nav.fixed .collapsible-header { + background-color: transparent; + border: none; + line-height: inherit; + height: inherit; + padding: 0 16px; +} + +.side-nav .collapsible-header:hover, +.side-nav.fixed .collapsible-header:hover { + background-color: rgba(0, 0, 0, 0.05); +} + +.side-nav .collapsible-header i, +.side-nav.fixed .collapsible-header i { + line-height: inherit; +} + +.side-nav .collapsible-body, +.side-nav.fixed .collapsible-body { + border: 0; + background-color: #fff; +} + +.side-nav .collapsible-body li a, +.side-nav.fixed .collapsible-body li a { + padding: 0 23.5px 0 31px; +} + +.collapsible.popout { + border: none; + box-shadow: none; +} + +.collapsible.popout > li { + box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12); + margin: 0 24px; + transition: margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94); +} + +.collapsible.popout > li.active { + box-shadow: 0 5px 11px 0 rgba(0, 0, 0, 0.18), 0 4px 15px 0 rgba(0, 0, 0, 0.15); + margin: 16px 0; +} + +.chip { + display: inline-block; + height: 32px; + font-size: 13px; + font-weight: 500; + color: rgba(0, 0, 0, 0.6); + line-height: 32px; + padding: 0 12px; + border-radius: 16px; + background-color: #e4e4e4; + margin-bottom: 5px; + margin-right: 5px; +} + +.chip img { + float: left; + margin: 0 8px 0 -12px; + height: 32px; + width: 32px; + border-radius: 50%; +} + +.chip .close { + cursor: pointer; + float: right; + font-size: 16px; + line-height: 32px; + padding-left: 8px; +} + +.chips { + border: none; + border-bottom: 1px solid #9e9e9e; + box-shadow: none; + margin: 0 0 20px 0; + min-height: 45px; + outline: none; + transition: all .3s; +} + +.chips.focus { + border-bottom: 1px solid #26a69a; + box-shadow: 0 1px 0 0 #26a69a; +} + +.chips:hover { + cursor: text; +} + +.chips .chip.selected { + background-color: #26a69a; + color: #fff; +} + +.chips .input { + background: none; + border: 0; + color: rgba(0, 0, 0, 0.6); + display: inline-block; + font-size: 1rem; + height: 3rem; + line-height: 32px; + outline: 0; + margin: 0; + padding: 0 !important; + width: 120px !important; +} + +.chips .input:focus { + border: 0 !important; + box-shadow: none !important; +} + +.prefix ~ .chips { + margin-left: 3rem; + width: 92%; + width: calc(100% - 3rem); +} + +.chips:empty ~ label { + font-size: 0.8rem; + -webkit-transform: translateY(-140%); + transform: translateY(-140%); +} + +.materialboxed { + display: block; + cursor: -webkit-zoom-in; + cursor: zoom-in; + position: relative; + transition: opacity .4s; + -webkit-backface-visibility: hidden; +} + +.materialboxed:hover:not(.active) { + opacity: .8; +} + +.materialboxed.active { + cursor: -webkit-zoom-out; + cursor: zoom-out; +} + +#materialbox-overlay { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + background-color: #292929; + z-index: 1000; + will-change: opacity; +} + +.materialbox-caption { + position: fixed; + display: none; + color: #fff; + line-height: 50px; + bottom: 0; + left: 0; + width: 100%; + text-align: center; + padding: 0% 15%; + height: 50px; + z-index: 1000; + -webkit-font-smoothing: antialiased; +} + +select:focus { + outline: 1px solid #c9f3ef; +} + +button:focus { + outline: none; + background-color: #2ab7a9; +} + +label { + font-size: 0.8rem; + color: #9e9e9e; +} + +/* Text Inputs + Textarea + ========================================================================== */ +/* Style Placeholders */ +::-webkit-input-placeholder { + color: #d1d1d1; +} + +:-moz-placeholder { + /* Firefox 18- */ + color: #d1d1d1; +} + +::-moz-placeholder { + /* Firefox 19+ */ + color: #d1d1d1; +} + +:-ms-input-placeholder { + color: #d1d1d1; +} + +/* Text inputs */ +input:not([type]), +input[type=text], +input[type=password], +input[type=email], +input[type=url], +input[type=time], +input[type=date], +input[type=datetime], +input[type=datetime-local], +input[type=tel], +input[type=number], +input[type=search], +textarea.materialize-textarea { + background-color: transparent; + border: none; + border-bottom: 1px solid #9e9e9e; + border-radius: 0; + outline: none; + height: 3rem; + width: 100%; + font-size: 1rem; + margin: 0 0 20px 0; + padding: 0; + box-shadow: none; + box-sizing: content-box; + transition: all 0.3s; +} + +input:not([type]):disabled, input:not([type])[readonly="readonly"], +input[type=text]:disabled, +input[type=text][readonly="readonly"], +input[type=password]:disabled, +input[type=password][readonly="readonly"], +input[type=email]:disabled, +input[type=email][readonly="readonly"], +input[type=url]:disabled, +input[type=url][readonly="readonly"], +input[type=time]:disabled, +input[type=time][readonly="readonly"], +input[type=date]:disabled, +input[type=date][readonly="readonly"], +input[type=datetime]:disabled, +input[type=datetime][readonly="readonly"], +input[type=datetime-local]:disabled, +input[type=datetime-local][readonly="readonly"], +input[type=tel]:disabled, +input[type=tel][readonly="readonly"], +input[type=number]:disabled, +input[type=number][readonly="readonly"], +input[type=search]:disabled, +input[type=search][readonly="readonly"], +textarea.materialize-textarea:disabled, +textarea.materialize-textarea[readonly="readonly"] { + color: rgba(0, 0, 0, 0.26); + border-bottom: 1px dotted rgba(0, 0, 0, 0.26); +} + +input:not([type]):disabled + label, +input:not([type])[readonly="readonly"] + label, +input[type=text]:disabled + label, +input[type=text][readonly="readonly"] + label, +input[type=password]:disabled + label, +input[type=password][readonly="readonly"] + label, +input[type=email]:disabled + label, +input[type=email][readonly="readonly"] + label, +input[type=url]:disabled + label, +input[type=url][readonly="readonly"] + label, +input[type=time]:disabled + label, +input[type=time][readonly="readonly"] + label, +input[type=date]:disabled + label, +input[type=date][readonly="readonly"] + label, +input[type=datetime]:disabled + label, +input[type=datetime][readonly="readonly"] + label, +input[type=datetime-local]:disabled + label, +input[type=datetime-local][readonly="readonly"] + label, +input[type=tel]:disabled + label, +input[type=tel][readonly="readonly"] + label, +input[type=number]:disabled + label, +input[type=number][readonly="readonly"] + label, +input[type=search]:disabled + label, +input[type=search][readonly="readonly"] + label, +textarea.materialize-textarea:disabled + label, +textarea.materialize-textarea[readonly="readonly"] + label { + color: rgba(0, 0, 0, 0.26); +} + +input:not([type]):focus:not([readonly]), +input[type=text]:focus:not([readonly]), +input[type=password]:focus:not([readonly]), +input[type=email]:focus:not([readonly]), +input[type=url]:focus:not([readonly]), +input[type=time]:focus:not([readonly]), +input[type=date]:focus:not([readonly]), +input[type=datetime]:focus:not([readonly]), +input[type=datetime-local]:focus:not([readonly]), +input[type=tel]:focus:not([readonly]), +input[type=number]:focus:not([readonly]), +input[type=search]:focus:not([readonly]), +textarea.materialize-textarea:focus:not([readonly]) { + border-bottom: 1px solid #26a69a; + box-shadow: 0 1px 0 0 #26a69a; +} + +input:not([type]):focus:not([readonly]) + label, +input[type=text]:focus:not([readonly]) + label, +input[type=password]:focus:not([readonly]) + label, +input[type=email]:focus:not([readonly]) + label, +input[type=url]:focus:not([readonly]) + label, +input[type=time]:focus:not([readonly]) + label, +input[type=date]:focus:not([readonly]) + label, +input[type=datetime]:focus:not([readonly]) + label, +input[type=datetime-local]:focus:not([readonly]) + label, +input[type=tel]:focus:not([readonly]) + label, +input[type=number]:focus:not([readonly]) + label, +input[type=search]:focus:not([readonly]) + label, +textarea.materialize-textarea:focus:not([readonly]) + label { + color: #26a69a; +} + +input:not([type]).valid, input:not([type]):focus.valid, +input[type=text].valid, +input[type=text]:focus.valid, +input[type=password].valid, +input[type=password]:focus.valid, +input[type=email].valid, +input[type=email]:focus.valid, +input[type=url].valid, +input[type=url]:focus.valid, +input[type=time].valid, +input[type=time]:focus.valid, +input[type=date].valid, +input[type=date]:focus.valid, +input[type=datetime].valid, +input[type=datetime]:focus.valid, +input[type=datetime-local].valid, +input[type=datetime-local]:focus.valid, +input[type=tel].valid, +input[type=tel]:focus.valid, +input[type=number].valid, +input[type=number]:focus.valid, +input[type=search].valid, +input[type=search]:focus.valid, +textarea.materialize-textarea.valid, +textarea.materialize-textarea:focus.valid { + border-bottom: 1px solid #4CAF50; + box-shadow: 0 1px 0 0 #4CAF50; +} + +input:not([type]).valid + label:after, +input:not([type]):focus.valid + label:after, +input[type=text].valid + label:after, +input[type=text]:focus.valid + label:after, +input[type=password].valid + label:after, +input[type=password]:focus.valid + label:after, +input[type=email].valid + label:after, +input[type=email]:focus.valid + label:after, +input[type=url].valid + label:after, +input[type=url]:focus.valid + label:after, +input[type=time].valid + label:after, +input[type=time]:focus.valid + label:after, +input[type=date].valid + label:after, +input[type=date]:focus.valid + label:after, +input[type=datetime].valid + label:after, +input[type=datetime]:focus.valid + label:after, +input[type=datetime-local].valid + label:after, +input[type=datetime-local]:focus.valid + label:after, +input[type=tel].valid + label:after, +input[type=tel]:focus.valid + label:after, +input[type=number].valid + label:after, +input[type=number]:focus.valid + label:after, +input[type=search].valid + label:after, +input[type=search]:focus.valid + label:after, +textarea.materialize-textarea.valid + label:after, +textarea.materialize-textarea:focus.valid + label:after { + content: attr(data-success); + color: #4CAF50; + opacity: 1; +} + +input:not([type]).invalid, input:not([type]):focus.invalid, +input[type=text].invalid, +input[type=text]:focus.invalid, +input[type=password].invalid, +input[type=password]:focus.invalid, +input[type=email].invalid, +input[type=email]:focus.invalid, +input[type=url].invalid, +input[type=url]:focus.invalid, +input[type=time].invalid, +input[type=time]:focus.invalid, +input[type=date].invalid, +input[type=date]:focus.invalid, +input[type=datetime].invalid, +input[type=datetime]:focus.invalid, +input[type=datetime-local].invalid, +input[type=datetime-local]:focus.invalid, +input[type=tel].invalid, +input[type=tel]:focus.invalid, +input[type=number].invalid, +input[type=number]:focus.invalid, +input[type=search].invalid, +input[type=search]:focus.invalid, +textarea.materialize-textarea.invalid, +textarea.materialize-textarea:focus.invalid { + border-bottom: 1px solid #F44336; + box-shadow: 0 1px 0 0 #F44336; +} + +input:not([type]).invalid + label:after, +input:not([type]):focus.invalid + label:after, +input[type=text].invalid + label:after, +input[type=text]:focus.invalid + label:after, +input[type=password].invalid + label:after, +input[type=password]:focus.invalid + label:after, +input[type=email].invalid + label:after, +input[type=email]:focus.invalid + label:after, +input[type=url].invalid + label:after, +input[type=url]:focus.invalid + label:after, +input[type=time].invalid + label:after, +input[type=time]:focus.invalid + label:after, +input[type=date].invalid + label:after, +input[type=date]:focus.invalid + label:after, +input[type=datetime].invalid + label:after, +input[type=datetime]:focus.invalid + label:after, +input[type=datetime-local].invalid + label:after, +input[type=datetime-local]:focus.invalid + label:after, +input[type=tel].invalid + label:after, +input[type=tel]:focus.invalid + label:after, +input[type=number].invalid + label:after, +input[type=number]:focus.invalid + label:after, +input[type=search].invalid + label:after, +input[type=search]:focus.invalid + label:after, +textarea.materialize-textarea.invalid + label:after, +textarea.materialize-textarea:focus.invalid + label:after { + content: attr(data-error); + color: #F44336; + opacity: 1; +} + +input:not([type]).validate + label, +input[type=text].validate + label, +input[type=password].validate + label, +input[type=email].validate + label, +input[type=url].validate + label, +input[type=time].validate + label, +input[type=date].validate + label, +input[type=datetime].validate + label, +input[type=datetime-local].validate + label, +input[type=tel].validate + label, +input[type=number].validate + label, +input[type=search].validate + label, +textarea.materialize-textarea.validate + label { + width: 100%; + pointer-events: none; +} + +input:not([type]) + label:after, +input[type=text] + label:after, +input[type=password] + label:after, +input[type=email] + label:after, +input[type=url] + label:after, +input[type=time] + label:after, +input[type=date] + label:after, +input[type=datetime] + label:after, +input[type=datetime-local] + label:after, +input[type=tel] + label:after, +input[type=number] + label:after, +input[type=search] + label:after, +textarea.materialize-textarea + label:after { + display: block; + content: ""; + position: absolute; + top: 60px; + opacity: 0; + transition: .2s opacity ease-out, .2s color ease-out; +} + +.input-field { + position: relative; + margin-top: 1rem; +} + +.input-field.inline { + display: inline-block; + vertical-align: middle; + margin-left: 5px; +} + +.input-field.inline input, +.input-field.inline .select-dropdown { + margin-bottom: 1rem; +} + +.input-field.col label { + left: 0.75rem; +} + +.input-field.col .prefix ~ label, +.input-field.col .prefix ~ .validate ~ label { + width: calc(100% - 3rem - 1.5rem); +} + +.input-field label { + color: #9e9e9e; + position: absolute; + top: 0.8rem; + left: 0; + font-size: 1rem; + cursor: text; + transition: .2s ease-out; +} + +.input-field label:not(.label-icon).active { + font-size: 0.8rem; + -webkit-transform: translateY(-140%); + transform: translateY(-140%); +} + +.input-field .prefix { + position: absolute; + width: 3rem; + font-size: 2rem; + transition: color .2s; +} + +.input-field .prefix.active { + color: #26a69a; +} + +.input-field .prefix ~ input, +.input-field .prefix ~ textarea, +.input-field .prefix ~ label, +.input-field .prefix ~ .validate ~ label, +.input-field .prefix ~ .autocomplete-content { + margin-left: 3rem; + width: 92%; + width: calc(100% - 3rem); +} + +.input-field .prefix ~ label { + margin-left: 3rem; +} + +@media only screen and (max-width: 992px) { + .input-field .prefix ~ input { + width: 86%; + width: calc(100% - 3rem); + } +} + +@media only screen and (max-width: 600px) { + .input-field .prefix ~ input { + width: 80%; + width: calc(100% - 3rem); + } +} + +/* Search Field */ +.input-field input[type=search] { + display: block; + line-height: inherit; + padding-left: 4rem; + width: calc(100% - 4rem); +} + +.input-field input[type=search]:focus { + background-color: #fff; + border: 0; + box-shadow: none; + color: #444; +} + +.input-field input[type=search]:focus + label i, +.input-field input[type=search]:focus ~ .mdi-navigation-close, +.input-field input[type=search]:focus ~ .material-icons { + color: #444; +} + +.input-field input[type=search] + label { + left: 1rem; +} + +.input-field input[type=search] ~ .mdi-navigation-close, +.input-field input[type=search] ~ .material-icons { + position: absolute; + top: 0; + right: 1rem; + color: transparent; + cursor: pointer; + font-size: 2rem; + transition: .3s color; +} + +/* Textarea */ +textarea { + width: 100%; + height: 3rem; + background-color: transparent; +} + +textarea.materialize-textarea { + overflow-y: hidden; + /* prevents scroll bar flash */ + padding: .8rem 0 1.6rem 0; + /* prevents text jump on Enter keypress */ + resize: none; + min-height: 3rem; +} + +.hiddendiv { + display: none; + white-space: pre-wrap; + word-wrap: break-word; + overflow-wrap: break-word; + /* future version of deprecated 'word-wrap' */ + padding-top: 1.2rem; + /* prevents text jump on Enter keypress */ +} + +/* Autocomplete */ +.autocomplete-content { + margin-top: -15px; + display: block; + opacity: 1; + position: static; +} + +.autocomplete-content li .highlight { + color: #444; +} + +.autocomplete-content li img { + height: 40px; + width: 40px; + margin: 5px 15px; +} + +/* Radio Buttons + ========================================================================== */ +[type="radio"]:not(:checked), +[type="radio"]:checked { + position: absolute; + left: -9999px; + opacity: 0; +} + +[type="radio"]:not(:checked) + label, +[type="radio"]:checked + label { + position: relative; + padding-left: 35px; + cursor: pointer; + display: inline-block; + height: 25px; + line-height: 25px; + font-size: 1rem; + transition: .28s ease; + /* webkit (konqueror) browsers */ + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +[type="radio"] + label:before, +[type="radio"] + label:after { + content: ''; + position: absolute; + left: 0; + top: 0; + margin: 4px; + width: 16px; + height: 16px; + z-index: 0; + transition: .28s ease; +} + +/* Unchecked styles */ +[type="radio"]:not(:checked) + label:before, +[type="radio"]:not(:checked) + label:after, +[type="radio"]:checked + label:before, +[type="radio"]:checked + label:after, +[type="radio"].with-gap:checked + label:before, +[type="radio"].with-gap:checked + label:after { + border-radius: 50%; +} + +[type="radio"]:not(:checked) + label:before, +[type="radio"]:not(:checked) + label:after { + border: 2px solid #5a5a5a; +} + +[type="radio"]:not(:checked) + label:after { + -webkit-transform: scale(0); + transform: scale(0); +} + +/* Checked styles */ +[type="radio"]:checked + label:before { + border: 2px solid transparent; +} + +[type="radio"]:checked + label:after, +[type="radio"].with-gap:checked + label:before, +[type="radio"].with-gap:checked + label:after { + border: 2px solid #26a69a; +} + +[type="radio"]:checked + label:after, +[type="radio"].with-gap:checked + label:after { + background-color: #26a69a; +} + +[type="radio"]:checked + label:after { + -webkit-transform: scale(1.02); + transform: scale(1.02); +} + +/* Radio With gap */ +[type="radio"].with-gap:checked + label:after { + -webkit-transform: scale(0.5); + transform: scale(0.5); +} + +/* Focused styles */ +[type="radio"].tabbed:focus + label:before { + box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1); +} + +/* Disabled Radio With gap */ +[type="radio"].with-gap:disabled:checked + label:before { + border: 2px solid rgba(0, 0, 0, 0.26); +} + +[type="radio"].with-gap:disabled:checked + label:after { + border: none; + background-color: rgba(0, 0, 0, 0.26); +} + +/* Disabled style */ +[type="radio"]:disabled:not(:checked) + label:before, +[type="radio"]:disabled:checked + label:before { + background-color: transparent; + border-color: rgba(0, 0, 0, 0.26); +} + +[type="radio"]:disabled + label { + color: rgba(0, 0, 0, 0.26); +} + +[type="radio"]:disabled:not(:checked) + label:before { + border-color: rgba(0, 0, 0, 0.26); +} + +[type="radio"]:disabled:checked + label:after { + background-color: rgba(0, 0, 0, 0.26); + border-color: #BDBDBD; +} + +/* Checkboxes + ========================================================================== */ +/* CUSTOM CSS CHECKBOXES */ +form p { + margin-bottom: 10px; + text-align: left; +} + +form p:last-child { + margin-bottom: 0; +} + +/* Remove default checkbox */ +[type="checkbox"]:not(:checked), +[type="checkbox"]:checked { + position: absolute; + left: -9999px; + opacity: 0; +} + +[type="checkbox"] { + /* checkbox aspect */ +} + +[type="checkbox"] + label { + position: relative; + padding-left: 35px; + cursor: pointer; + display: inline-block; + height: 25px; + line-height: 25px; + font-size: 1rem; + -webkit-user-select: none; + /* webkit (safari, chrome) browsers */ + -moz-user-select: none; + /* mozilla browsers */ + -khtml-user-select: none; + /* webkit (konqueror) browsers */ + -ms-user-select: none; + /* IE10+ */ +} + +[type="checkbox"] + label:before, +[type="checkbox"]:not(.filled-in) + label:after { + content: ''; + position: absolute; + top: 0; + left: 0; + width: 18px; + height: 18px; + z-index: 0; + border: 2px solid #5a5a5a; + border-radius: 1px; + margin-top: 2px; + transition: .2s; +} + +[type="checkbox"]:not(.filled-in) + label:after { + border: 0; + -webkit-transform: scale(0); + transform: scale(0); +} + +[type="checkbox"]:not(:checked):disabled + label:before { + border: none; + background-color: rgba(0, 0, 0, 0.26); +} + +[type="checkbox"].tabbed:focus + label:after { + -webkit-transform: scale(1); + transform: scale(1); + border: 0; + border-radius: 50%; + box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1); + background-color: rgba(0, 0, 0, 0.1); +} + +[type="checkbox"]:checked + label:before { + top: -4px; + left: -5px; + width: 12px; + height: 22px; + border-top: 2px solid transparent; + border-left: 2px solid transparent; + border-right: 2px solid #26a69a; + border-bottom: 2px solid #26a69a; + -webkit-transform: rotate(40deg); + transform: rotate(40deg); + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-transform-origin: 100% 100%; + transform-origin: 100% 100%; +} + +[type="checkbox"]:checked:disabled + label:before { + border-right: 2px solid rgba(0, 0, 0, 0.26); + border-bottom: 2px solid rgba(0, 0, 0, 0.26); +} + +/* Indeterminate checkbox */ +[type="checkbox"]:indeterminate + label:before { + top: -11px; + left: -12px; + width: 10px; + height: 22px; + border-top: none; + border-left: none; + border-right: 2px solid #26a69a; + border-bottom: none; + -webkit-transform: rotate(90deg); + transform: rotate(90deg); + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-transform-origin: 100% 100%; + transform-origin: 100% 100%; +} + +[type="checkbox"]:indeterminate:disabled + label:before { + border-right: 2px solid rgba(0, 0, 0, 0.26); + background-color: transparent; +} + +[type="checkbox"].filled-in + label:after { + border-radius: 2px; +} + +[type="checkbox"].filled-in + label:before, +[type="checkbox"].filled-in + label:after { + content: ''; + left: 0; + position: absolute; + /* .1s delay is for check animation */ + transition: border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s; + z-index: 1; +} + +[type="checkbox"].filled-in:not(:checked) + label:before { + width: 0; + height: 0; + border: 3px solid transparent; + left: 6px; + top: 10px; + -webkit-transform: rotateZ(37deg); + transform: rotateZ(37deg); + -webkit-transform-origin: 20% 40%; + transform-origin: 100% 100%; +} + +[type="checkbox"].filled-in:not(:checked) + label:after { + height: 20px; + width: 20px; + background-color: transparent; + border: 2px solid #5a5a5a; + top: 0px; + z-index: 0; +} + +[type="checkbox"].filled-in:checked + label:before { + top: 0; + left: 1px; + width: 8px; + height: 13px; + border-top: 2px solid transparent; + border-left: 2px solid transparent; + border-right: 2px solid #fff; + border-bottom: 2px solid #fff; + -webkit-transform: rotateZ(37deg); + transform: rotateZ(37deg); + -webkit-transform-origin: 100% 100%; + transform-origin: 100% 100%; +} + +[type="checkbox"].filled-in:checked + label:after { + top: 0; + width: 20px; + height: 20px; + border: 2px solid #26a69a; + background-color: #26a69a; + z-index: 0; +} + +[type="checkbox"].filled-in.tabbed:focus + label:after { + border-radius: 2px; + border-color: #5a5a5a; + background-color: rgba(0, 0, 0, 0.1); +} + +[type="checkbox"].filled-in.tabbed:checked:focus + label:after { + border-radius: 2px; + background-color: #26a69a; + border-color: #26a69a; +} + +[type="checkbox"].filled-in:disabled:not(:checked) + label:before { + background-color: transparent; + border: 2px solid transparent; +} + +[type="checkbox"].filled-in:disabled:not(:checked) + label:after { + border-color: transparent; + background-color: #BDBDBD; +} + +[type="checkbox"].filled-in:disabled:checked + label:before { + background-color: transparent; +} + +[type="checkbox"].filled-in:disabled:checked + label:after { + background-color: #BDBDBD; + border-color: #BDBDBD; +} + +/* Switch + ========================================================================== */ +.switch, +.switch * { + -webkit-user-select: none; + -moz-user-select: none; + -khtml-user-select: none; + -ms-user-select: none; +} + +.switch label { + cursor: pointer; +} + +.switch label input[type=checkbox] { + opacity: 0; + width: 0; + height: 0; +} + +.switch label input[type=checkbox]:checked + .lever { + background-color: #84c7c1; +} + +.switch label input[type=checkbox]:checked + .lever:after { + background-color: #26a69a; + left: 24px; +} + +.switch label .lever { + content: ""; + display: inline-block; + position: relative; + width: 40px; + height: 15px; + background-color: #818181; + border-radius: 15px; + margin-right: 10px; + transition: background 0.3s ease; + vertical-align: middle; + margin: 0 16px; +} + +.switch label .lever:after { + content: ""; + position: absolute; + display: inline-block; + width: 21px; + height: 21px; + background-color: #F1F1F1; + border-radius: 21px; + box-shadow: 0 1px 3px 1px rgba(0, 0, 0, 0.4); + left: -5px; + top: -3px; + transition: left 0.3s ease, background .3s ease, box-shadow 0.1s ease; +} + +input[type=checkbox]:checked:not(:disabled) ~ .lever:active::after, +input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::after { + box-shadow: 0 1px 3px 1px rgba(0, 0, 0, 0.4), 0 0 0 15px rgba(38, 166, 154, 0.1); +} + +input[type=checkbox]:not(:disabled) ~ .lever:active:after, +input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::after { + box-shadow: 0 1px 3px 1px rgba(0, 0, 0, 0.4), 0 0 0 15px rgba(0, 0, 0, 0.08); +} + +.switch input[type=checkbox][disabled] + .lever { + cursor: default; +} + +.switch label input[type=checkbox][disabled] + .lever:after, +.switch label input[type=checkbox][disabled]:checked + .lever:after { + background-color: #BDBDBD; +} + +/* Select Field + ========================================================================== */ +select { + display: none; +} + +select.browser-default { + display: block; +} + +select { + background-color: rgba(255, 255, 255, 0.9); + width: 100%; + padding: 5px; + border: 1px solid #f2f2f2; + border-radius: 2px; + height: 3rem; +} + +.select-label { + position: absolute; +} + +.select-wrapper { + position: relative; +} + +.select-wrapper input.select-dropdown { + position: relative; + cursor: pointer; + background-color: transparent; + border: none; + border-bottom: 1px solid #9e9e9e; + outline: none; + height: 3rem; + line-height: 3rem; + width: 100%; + font-size: 1rem; + margin: 0 0 20px 0; + padding: 0; + display: block; +} + +.select-wrapper span.caret { + color: initial; + position: absolute; + right: 0; + top: 0; + bottom: 0; + height: 10px; + margin: auto 0; + font-size: 10px; + line-height: 10px; +} + +.select-wrapper span.caret.disabled { + color: rgba(0, 0, 0, 0.26); +} + +.select-wrapper + label { + position: absolute; + top: -14px; + font-size: 0.8rem; +} + +select:disabled { + color: rgba(0, 0, 0, 0.3); +} + +.select-wrapper input.select-dropdown:disabled { + color: rgba(0, 0, 0, 0.3); + cursor: default; + -webkit-user-select: none; + /* webkit (safari, chrome) browsers */ + -moz-user-select: none; + /* mozilla browsers */ + -ms-user-select: none; + /* IE10+ */ + border-bottom: 1px solid rgba(0, 0, 0, 0.3); +} + +.select-wrapper i { + color: rgba(0, 0, 0, 0.3); +} + +.select-dropdown li.disabled, +.select-dropdown li.disabled > span, +.select-dropdown li.optgroup { + color: rgba(0, 0, 0, 0.3); + background-color: transparent; +} + +.prefix ~ .select-wrapper { + margin-left: 3rem; + width: 92%; + width: calc(100% - 3rem); +} + +.prefix ~ label { + margin-left: 3rem; +} + +.select-dropdown li img { + height: 40px; + width: 40px; + margin: 5px 15px; + float: right; +} + +.select-dropdown li.optgroup { + border-top: 1px solid #eee; +} + +.select-dropdown li.optgroup.selected > span { + color: rgba(0, 0, 0, 0.7); +} + +.select-dropdown li.optgroup > span { + color: rgba(0, 0, 0, 0.4); +} + +.select-dropdown li.optgroup ~ li.optgroup-option { + padding-left: 1rem; +} + +/* File Input + ========================================================================== */ +.file-field { + position: relative; +} + +.file-field .file-path-wrapper { + overflow: hidden; + padding-left: 10px; +} + +.file-field input.file-path { + width: 100%; +} + +.file-field .btn, .file-field .btn-large { + float: left; + height: 3rem; + line-height: 3rem; +} + +.file-field span { + cursor: pointer; +} + +.file-field input[type=file] { + position: absolute; + top: 0; + right: 0; + left: 0; + bottom: 0; + width: 100%; + margin: 0; + padding: 0; + font-size: 20px; + cursor: pointer; + opacity: 0; + filter: alpha(opacity=0); +} + +/* Range + ========================================================================== */ +.range-field { + position: relative; +} + +input[type=range], +input[type=range] + .thumb { + cursor: pointer; +} + +input[type=range] { + position: relative; + background-color: transparent; + border: none; + outline: none; + width: 100%; + margin: 15px 0; + padding: 0; +} + +input[type=range]:focus { + outline: none; +} + +input[type=range] + .thumb { + position: absolute; + border: none; + height: 0; + width: 0; + border-radius: 50%; + background-color: #26a69a; + top: 10px; + margin-left: -6px; + -webkit-transform-origin: 50% 50%; + transform-origin: 50% 50%; + -webkit-transform: rotate(-45deg); + transform: rotate(-45deg); +} + +input[type=range] + .thumb .value { + display: block; + width: 30px; + text-align: center; + color: #26a69a; + font-size: 0; + -webkit-transform: rotate(45deg); + transform: rotate(45deg); +} + +input[type=range] + .thumb.active { + border-radius: 50% 50% 50% 0; +} + +input[type=range] + .thumb.active .value { + color: #fff; + margin-left: -1px; + margin-top: 8px; + font-size: 10px; +} + +input[type=range] { + -webkit-appearance: none; +} + +input[type=range]::-webkit-slider-runnable-track { + height: 3px; + background: #c2c0c2; + border: none; +} + +input[type=range]::-webkit-slider-thumb { + -webkit-appearance: none; + border: none; + height: 14px; + width: 14px; + border-radius: 50%; + background-color: #26a69a; + -webkit-transform-origin: 50% 50%; + transform-origin: 50% 50%; + margin: -5px 0 0 0; + transition: .3s; +} + +input[type=range]:focus::-webkit-slider-runnable-track { + background: #ccc; +} + +input[type=range] { + /* fix for FF unable to apply focus style bug */ + border: 1px solid white; + /*required for proper track sizing in FF*/ +} + +input[type=range]::-moz-range-track { + height: 3px; + background: #ddd; + border: none; +} + +input[type=range]::-moz-range-thumb { + border: none; + height: 14px; + width: 14px; + border-radius: 50%; + background: #26a69a; + margin-top: -5px; +} + +input[type=range]:-moz-focusring { + outline: 1px solid #fff; + outline-offset: -1px; +} + +input[type=range]:focus::-moz-range-track { + background: #ccc; +} + +input[type=range]::-ms-track { + height: 3px; + background: transparent; + border-color: transparent; + border-width: 6px 0; + /*remove default tick marks*/ + color: transparent; +} + +input[type=range]::-ms-fill-lower { + background: #777; +} + +input[type=range]::-ms-fill-upper { + background: #ddd; +} + +input[type=range]::-ms-thumb { + border: none; + height: 14px; + width: 14px; + border-radius: 50%; + background: #26a69a; +} + +input[type=range]:focus::-ms-fill-lower { + background: #888; +} + +input[type=range]:focus::-ms-fill-upper { + background: #ccc; +} + +/*************** + Nav List +***************/ +.table-of-contents.fixed { + position: fixed; +} + +.table-of-contents li { + padding: 2px 0; +} + +.table-of-contents a { + display: inline-block; + font-weight: 300; + color: #757575; + padding-left: 20px; + height: 1.5rem; + line-height: 1.5rem; + letter-spacing: .4; + display: inline-block; +} + +.table-of-contents a:hover { + color: #a8a8a8; + padding-left: 19px; + border-left: 1px solid #ee6e73; +} + +.table-of-contents a.active { + font-weight: 500; + padding-left: 18px; + border-left: 2px solid #ee6e73; +} + +.side-nav { + position: fixed; + width: 300px; + left: 0; + top: 0; + margin: 0; + -webkit-transform: translateX(-100%); + transform: translateX(-100%); + height: 100%; + height: calc(100% + 60px); + height: -moz-calc(100%); + padding-bottom: 60px; + background-color: #fff; + z-index: 999; + overflow-y: auto; + will-change: transform; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-transform: translateX(-105%); + transform: translateX(-105%); +} + +.side-nav.right-aligned { + right: 0; + -webkit-transform: translateX(105%); + transform: translateX(105%); + left: auto; + -webkit-transform: translateX(100%); + transform: translateX(100%); +} + +.side-nav .collapsible { + margin: 0; +} + +.side-nav li { + float: none; + line-height: 48px; +} + +.side-nav li.active { + background-color: rgba(0, 0, 0, 0.05); +} + +.side-nav a { + color: rgba(0, 0, 0, 0.87); + display: block; + font-size: 14px; + font-weight: 500; + height: 48px; + line-height: 48px; + padding: 0 32px; +} + +.side-nav a:hover { + background-color: rgba(0, 0, 0, 0.05); +} + +.side-nav a.btn, .side-nav a.btn-large, .side-nav a.btn-large, .side-nav a.btn-flat, .side-nav a.btn-floating { + margin: 10px 15px; +} + +.side-nav a.btn, .side-nav a.btn-large, .side-nav a.btn-large, .side-nav a.btn-floating { + color: #fff; +} + +.side-nav a.btn-flat { + color: #343434; +} + +.side-nav a.btn:hover, .side-nav a.btn-large:hover, .side-nav a.btn-large:hover { + background-color: #2bbbad; +} + +.side-nav a.btn-floating:hover { + background-color: #26a69a; +} + +.side-nav li > a > i, +.side-nav li > a > [class^="mdi-"], .side-nav li > a > [class*="mdi-"], +.side-nav li > a > i.material-icons { + float: left; + height: 48px; + line-height: 48px; + margin: 0 32px 0 0; + width: 24px; + color: rgba(0, 0, 0, 0.54); +} + +.side-nav .divider { + margin: 8px 0 0 0; +} + +.side-nav .subheader { + cursor: initial; + pointer-events: none; + color: rgba(0, 0, 0, 0.54); + font-size: 14px; + font-weight: 500; + line-height: 48px; +} + +.side-nav .subheader:hover { + background-color: transparent; +} + +.side-nav .userView { + position: relative; + padding: 32px 32px 0; + margin-bottom: 8px; +} + +.side-nav .userView > a { + height: auto; + padding: 0; +} + +.side-nav .userView > a:hover { + background-color: transparent; +} + +.side-nav .userView .background { + overflow: hidden; + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: -1; +} + +.side-nav .userView .circle, .side-nav .userView .name, .side-nav .userView .email { + display: block; +} + +.side-nav .userView .circle { + height: 64px; + width: 64px; +} + +.side-nav .userView .name, +.side-nav .userView .email { + font-size: 14px; + line-height: 24px; +} + +.side-nav .userView .name { + margin-top: 16px; + font-weight: 500; +} + +.side-nav .userView .email { + padding-bottom: 16px; + font-weight: 400; +} + +.drag-target { + height: 100%; + width: 10px; + position: fixed; + top: 0; + z-index: 998; +} + +.side-nav.fixed { + left: 0; + -webkit-transform: translateX(0); + transform: translateX(0); + position: fixed; +} + +.side-nav.fixed.right-aligned { + right: 0; + left: auto; +} + +@media only screen and (max-width: 992px) { + .side-nav.fixed { + -webkit-transform: translateX(-105%); + transform: translateX(-105%); + } + .side-nav.fixed.right-aligned { + -webkit-transform: translateX(105%); + transform: translateX(105%); + } + .side-nav a { + padding: 0 16px; + } + .side-nav .userView { + padding: 16px 16px 0; + } +} + +.side-nav .collapsible-body > ul:not(.collapsible) > li.active, +.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active { + background-color: #ee6e73; +} + +.side-nav .collapsible-body > ul:not(.collapsible) > li.active a, +.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active a { + color: #fff; +} + +#sidenav-overlay { + position: fixed; + top: 0; + left: 0; + right: 0; + height: 120vh; + background-color: rgba(0, 0, 0, 0.5); + z-index: 997; + will-change: opacity; +} + +/* + @license + Copyright (c) 2014 The Polymer Project Authors. All rights reserved. + This code may only be used under the BSD style license found at http://polymer.github.io/LICENSE.txt + The complete set of authors may be found at http://polymer.github.io/AUTHORS.txt + The complete set of contributors may be found at http://polymer.github.io/CONTRIBUTORS.txt + Code distributed by Google as part of the polymer project is also + subject to an additional IP rights grant found at http://polymer.github.io/PATENTS.txt + */ +/**************************/ +/* STYLES FOR THE SPINNER */ +/**************************/ +/* + * Constants: + * STROKEWIDTH = 3px + * ARCSIZE = 270 degrees (amount of circle the arc takes up) + * ARCTIME = 1333ms (time it takes to expand and contract arc) + * ARCSTARTROT = 216 degrees (how much the start location of the arc + * should rotate each time, 216 gives us a + * 5 pointed star shape (it's 360/5 * 3). + * For a 7 pointed star, we might do + * 360/7 * 3 = 154.286) + * CONTAINERWIDTH = 28px + * SHRINK_TIME = 400ms + */ +.preloader-wrapper { + display: inline-block; + position: relative; + width: 48px; + height: 48px; +} + +.preloader-wrapper.small { + width: 36px; + height: 36px; +} + +.preloader-wrapper.big { + width: 64px; + height: 64px; +} + +.preloader-wrapper.active { + /* duration: 360 * ARCTIME / (ARCSTARTROT + (360-ARCSIZE)) */ + -webkit-animation: container-rotate 1568ms linear infinite; + animation: container-rotate 1568ms linear infinite; +} + +@-webkit-keyframes container-rotate { + to { + -webkit-transform: rotate(360deg); + } +} + +@keyframes container-rotate { + to { + -webkit-transform: rotate(360deg); + transform: rotate(360deg); + } +} + +.spinner-layer { + position: absolute; + width: 100%; + height: 100%; + opacity: 0; + border-color: #26a69a; +} + +.spinner-blue, +.spinner-blue-only { + border-color: #4285f4; +} + +.spinner-red, +.spinner-red-only { + border-color: #db4437; +} + +.spinner-yellow, +.spinner-yellow-only { + border-color: #f4b400; +} + +.spinner-green, +.spinner-green-only { + border-color: #0f9d58; +} + +/** + * IMPORTANT NOTE ABOUT CSS ANIMATION PROPERTIES (keanulee): + * + * iOS Safari (tested on iOS 8.1) does not handle animation-delay very well - it doesn't + * guarantee that the animation will start _exactly_ after that value. So we avoid using + * animation-delay and instead set custom keyframes for each color (as redundant as it + * seems). + * + * We write out each animation in full (instead of separating animation-name, + * animation-duration, etc.) because under the polyfill, Safari does not recognize those + * specific properties properly, treats them as -webkit-animation, and overrides the + * other animation rules. See https://github.com/Polymer/platform/issues/53. + */ +.active .spinner-layer.spinner-blue { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +.active .spinner-layer.spinner-red { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +.active .spinner-layer.spinner-yellow { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +.active .spinner-layer.spinner-green { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +.active .spinner-layer, +.active .spinner-layer.spinner-blue-only, +.active .spinner-layer.spinner-red-only, +.active .spinner-layer.spinner-yellow-only, +.active .spinner-layer.spinner-green-only { + /* durations: 4 * ARCTIME */ + opacity: 1; + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +@-webkit-keyframes fill-unfill-rotate { + 12.5% { + -webkit-transform: rotate(135deg); + } + /* 0.5 * ARCSIZE */ + 25% { + -webkit-transform: rotate(270deg); + } + /* 1 * ARCSIZE */ + 37.5% { + -webkit-transform: rotate(405deg); + } + /* 1.5 * ARCSIZE */ + 50% { + -webkit-transform: rotate(540deg); + } + /* 2 * ARCSIZE */ + 62.5% { + -webkit-transform: rotate(675deg); + } + /* 2.5 * ARCSIZE */ + 75% { + -webkit-transform: rotate(810deg); + } + /* 3 * ARCSIZE */ + 87.5% { + -webkit-transform: rotate(945deg); + } + /* 3.5 * ARCSIZE */ + to { + -webkit-transform: rotate(1080deg); + } + /* 4 * ARCSIZE */ +} + +@keyframes fill-unfill-rotate { + 12.5% { + -webkit-transform: rotate(135deg); + transform: rotate(135deg); + } + /* 0.5 * ARCSIZE */ + 25% { + -webkit-transform: rotate(270deg); + transform: rotate(270deg); + } + /* 1 * ARCSIZE */ + 37.5% { + -webkit-transform: rotate(405deg); + transform: rotate(405deg); + } + /* 1.5 * ARCSIZE */ + 50% { + -webkit-transform: rotate(540deg); + transform: rotate(540deg); + } + /* 2 * ARCSIZE */ + 62.5% { + -webkit-transform: rotate(675deg); + transform: rotate(675deg); + } + /* 2.5 * ARCSIZE */ + 75% { + -webkit-transform: rotate(810deg); + transform: rotate(810deg); + } + /* 3 * ARCSIZE */ + 87.5% { + -webkit-transform: rotate(945deg); + transform: rotate(945deg); + } + /* 3.5 * ARCSIZE */ + to { + -webkit-transform: rotate(1080deg); + transform: rotate(1080deg); + } + /* 4 * ARCSIZE */ +} + +@-webkit-keyframes blue-fade-in-out { + from { + opacity: 1; + } + 25% { + opacity: 1; + } + 26% { + opacity: 0; + } + 89% { + opacity: 0; + } + 90% { + opacity: 1; + } + 100% { + opacity: 1; + } +} + +@keyframes blue-fade-in-out { + from { + opacity: 1; + } + 25% { + opacity: 1; + } + 26% { + opacity: 0; + } + 89% { + opacity: 0; + } + 90% { + opacity: 1; + } + 100% { + opacity: 1; + } +} + +@-webkit-keyframes red-fade-in-out { + from { + opacity: 0; + } + 15% { + opacity: 0; + } + 25% { + opacity: 1; + } + 50% { + opacity: 1; + } + 51% { + opacity: 0; + } +} + +@keyframes red-fade-in-out { + from { + opacity: 0; + } + 15% { + opacity: 0; + } + 25% { + opacity: 1; + } + 50% { + opacity: 1; + } + 51% { + opacity: 0; + } +} + +@-webkit-keyframes yellow-fade-in-out { + from { + opacity: 0; + } + 40% { + opacity: 0; + } + 50% { + opacity: 1; + } + 75% { + opacity: 1; + } + 76% { + opacity: 0; + } +} + +@keyframes yellow-fade-in-out { + from { + opacity: 0; + } + 40% { + opacity: 0; + } + 50% { + opacity: 1; + } + 75% { + opacity: 1; + } + 76% { + opacity: 0; + } +} + +@-webkit-keyframes green-fade-in-out { + from { + opacity: 0; + } + 65% { + opacity: 0; + } + 75% { + opacity: 1; + } + 90% { + opacity: 1; + } + 100% { + opacity: 0; + } +} + +@keyframes green-fade-in-out { + from { + opacity: 0; + } + 65% { + opacity: 0; + } + 75% { + opacity: 1; + } + 90% { + opacity: 1; + } + 100% { + opacity: 0; + } +} + +/** + * Patch the gap that appear between the two adjacent div.circle-clipper while the + * spinner is rotating (appears on Chrome 38, Safari 7.1, and IE 11). + */ +.gap-patch { + position: absolute; + top: 0; + left: 45%; + width: 10%; + height: 100%; + overflow: hidden; + border-color: inherit; +} + +.gap-patch .circle { + width: 1000%; + left: -450%; +} + +.circle-clipper { + display: inline-block; + position: relative; + width: 50%; + height: 100%; + overflow: hidden; + border-color: inherit; +} + +.circle-clipper .circle { + width: 200%; + height: 100%; + border-width: 3px; + /* STROKEWIDTH */ + border-style: solid; + border-color: inherit; + border-bottom-color: transparent !important; + border-radius: 50%; + -webkit-animation: none; + animation: none; + position: absolute; + top: 0; + right: 0; + bottom: 0; +} + +.circle-clipper.left .circle { + left: 0; + border-right-color: transparent !important; + -webkit-transform: rotate(129deg); + transform: rotate(129deg); +} + +.circle-clipper.right .circle { + left: -100%; + border-left-color: transparent !important; + -webkit-transform: rotate(-129deg); + transform: rotate(-129deg); +} + +.active .circle-clipper.left .circle { + /* duration: ARCTIME */ + -webkit-animation: left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +.active .circle-clipper.right .circle { + /* duration: ARCTIME */ + -webkit-animation: right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +@-webkit-keyframes left-spin { + from { + -webkit-transform: rotate(130deg); + } + 50% { + -webkit-transform: rotate(-5deg); + } + to { + -webkit-transform: rotate(130deg); + } +} + +@keyframes left-spin { + from { + -webkit-transform: rotate(130deg); + transform: rotate(130deg); + } + 50% { + -webkit-transform: rotate(-5deg); + transform: rotate(-5deg); + } + to { + -webkit-transform: rotate(130deg); + transform: rotate(130deg); + } +} + +@-webkit-keyframes right-spin { + from { + -webkit-transform: rotate(-130deg); + } + 50% { + -webkit-transform: rotate(5deg); + } + to { + -webkit-transform: rotate(-130deg); + } +} + +@keyframes right-spin { + from { + -webkit-transform: rotate(-130deg); + transform: rotate(-130deg); + } + 50% { + -webkit-transform: rotate(5deg); + transform: rotate(5deg); + } + to { + -webkit-transform: rotate(-130deg); + transform: rotate(-130deg); + } +} + +#spinnerContainer.cooldown { + /* duration: SHRINK_TIME */ + -webkit-animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1); + animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1); +} + +@-webkit-keyframes fade-out { + from { + opacity: 1; + } + to { + opacity: 0; + } +} + +@keyframes fade-out { + from { + opacity: 1; + } + to { + opacity: 0; + } +} + +.slider { + position: relative; + height: 400px; + width: 100%; +} + +.slider.fullscreen { + height: 100%; + width: 100%; + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; +} + +.slider.fullscreen ul.slides { + height: 100%; +} + +.slider.fullscreen ul.indicators { + z-index: 2; + bottom: 30px; +} + +.slider .slides { + background-color: #9e9e9e; + margin: 0; + height: 400px; +} + +.slider .slides li { + opacity: 0; + position: absolute; + top: 0; + left: 0; + z-index: 1; + width: 100%; + height: inherit; + overflow: hidden; +} + +.slider .slides li img { + height: 100%; + width: 100%; + background-size: cover; + background-position: center; +} + +.slider .slides li .caption { + color: #fff; + position: absolute; + top: 15%; + left: 15%; + width: 70%; + opacity: 0; +} + +.slider .slides li .caption p { + color: #e0e0e0; +} + +.slider .slides li.active { + z-index: 2; +} + +.slider .indicators { + position: absolute; + text-align: center; + left: 0; + right: 0; + bottom: 0; + margin: 0; +} + +.slider .indicators .indicator-item { + display: inline-block; + position: relative; + cursor: pointer; + height: 16px; + width: 16px; + margin: 0 12px; + background-color: #e0e0e0; + transition: background-color .3s; + border-radius: 50%; +} + +.slider .indicators .indicator-item.active { + background-color: #4CAF50; +} + +.carousel { + overflow: hidden; + position: relative; + width: 100%; + height: 400px; + -webkit-perspective: 500px; + perspective: 500px; + -webkit-transform-style: preserve-3d; + transform-style: preserve-3d; + -webkit-transform-origin: 0% 50%; + transform-origin: 0% 50%; +} + +.carousel.carousel-slider { + top: 0; + left: 0; + height: 0; +} + +.carousel.carousel-slider .carousel-fixed-item { + position: absolute; + left: 0; + right: 0; + bottom: 20px; + z-index: 1; +} + +.carousel.carousel-slider .carousel-fixed-item.with-indicators { + bottom: 68px; +} + +.carousel.carousel-slider .carousel-item { + width: 100%; + height: 100%; + min-height: 400px; + position: absolute; + top: 0; + left: 0; +} + +.carousel.carousel-slider .carousel-item h2 { + font-size: 24px; + font-weight: 500; + line-height: 32px; +} + +.carousel.carousel-slider .carousel-item p { + font-size: 15px; +} + +.carousel .carousel-item { + display: none; + width: 200px; + height: 200px; + position: absolute; + top: 0; + left: 0; +} + +.carousel .carousel-item img { + width: 100%; +} + +.carousel .indicators { + position: absolute; + text-align: center; + left: 0; + right: 0; + bottom: 0; + margin: 0; +} + +.carousel .indicators .indicator-item { + display: inline-block; + position: relative; + cursor: pointer; + height: 8px; + width: 8px; + margin: 24px 4px; + background-color: rgba(255, 255, 255, 0.5); + transition: background-color .3s; + border-radius: 50%; +} + +.carousel .indicators .indicator-item.active { + background-color: #fff; +} + +/* ========================================================================== + $BASE-PICKER + ========================================================================== */ +/** + * Note: the root picker element should *NOT* be styled more than what's here. + */ +.picker { + font-size: 16px; + text-align: left; + line-height: 1.2; + color: #000000; + position: absolute; + z-index: 10000; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +/** + * The picker input element. + */ +.picker__input { + cursor: default; +} + +/** + * When the picker is opened, the input element is "activated". + */ +.picker__input.picker__input--active { + border-color: #0089ec; +} + +/** + * The holder is the only "scrollable" top-level container element. + */ +.picker__holder { + width: 100%; + overflow-y: auto; + -webkit-overflow-scrolling: touch; +} + +/*! + * Default mobile-first, responsive styling for pickadate.js + * Demo: http://amsul.github.io/pickadate.js + */ +/** + * Note: the root picker element should *NOT* be styled more than what's here. + */ +/** + * Make the holder and frame fullscreen. + */ +.picker__holder, +.picker__frame { + bottom: 0; + left: 0; + right: 0; + top: 100%; +} + +/** + * The holder should overlay the entire screen. + */ +.picker__holder { + position: fixed; + transition: background 0.15s ease-out, top 0s 0.15s; + -webkit-backface-visibility: hidden; +} + +/** + * The frame that bounds the box contents of the picker. + */ +.picker__frame { + position: absolute; + margin: 0 auto; + min-width: 256px; + width: 300px; + max-height: 350px; + -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; + filter: alpha(opacity=0); + -moz-opacity: 0; + opacity: 0; + transition: all 0.15s ease-out; +} + +@media (min-height: 28.875em) { + .picker__frame { + overflow: visible; + top: auto; + bottom: -100%; + max-height: 80%; + } +} + +@media (min-height: 40.125em) { + .picker__frame { + margin-bottom: 7.5%; + } +} + +/** + * The wrapper sets the stage to vertically align the box contents. + */ +.picker__wrap { + display: table; + width: 100%; + height: 100%; +} + +@media (min-height: 28.875em) { + .picker__wrap { + display: block; + } +} + +/** + * The box contains all the picker contents. + */ +.picker__box { + background: #ffffff; + display: table-cell; + vertical-align: middle; +} + +@media (min-height: 28.875em) { + .picker__box { + display: block; + border: 1px solid #777777; + border-top-color: #898989; + border-bottom-width: 0; + border-radius: 5px 5px 0 0; + box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24); + } +} + +/** + * When the picker opens... + */ +.picker--opened .picker__holder { + top: 0; + background: transparent; + -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorstr=#1E000000,endColorstr=#1E000000)"; + zoom: 1; + background: rgba(0, 0, 0, 0.32); + transition: background 0.15s ease-out; +} + +.picker--opened .picker__frame { + top: 0; + -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=100)"; + filter: alpha(opacity=100); + -moz-opacity: 1; + opacity: 1; +} + +@media (min-height: 35.875em) { + .picker--opened .picker__frame { + top: 10%; + bottom: auto; + } +} + +/** + * For `large` screens, transform into an inline picker. + */ +/* ========================================================================== + CUSTOM MATERIALIZE STYLES + ========================================================================== */ +.picker__input.picker__input--active { + border-color: #E3F2FD; +} + +.picker__frame { + margin: 0 auto; + max-width: 325px; +} + +@media (min-height: 38.875em) { + .picker--opened .picker__frame { + top: 10%; + bottom: auto; + } +} + +/* ========================================================================== + $BASE-DATE-PICKER + ========================================================================== */ +/** + * The picker box. + */ +.picker__box { + padding: 0 1em; +} + +/** + * The header containing the month and year stuff. + */ +.picker__header { + text-align: center; + position: relative; + margin-top: .75em; +} + +/** + * The month and year labels. + */ +.picker__month, +.picker__year { + display: inline-block; + margin-left: .25em; + margin-right: .25em; +} + +/** + * The month and year selectors. + */ +.picker__select--month, +.picker__select--year { + height: 2em; + padding: 0; + margin-left: .25em; + margin-right: .25em; +} + +.picker__select--month.browser-default { + display: inline; + background-color: #FFFFFF; + width: 40%; +} + +.picker__select--year.browser-default { + display: inline; + background-color: #FFFFFF; + width: 26%; +} + +.picker__select--month:focus, +.picker__select--year:focus { + border-color: rgba(0, 0, 0, 0.05); +} + +/** + * The month navigation buttons. + */ +.picker__nav--prev, +.picker__nav--next { + position: absolute; + padding: .5em 1.25em; + width: 1em; + height: 1em; + box-sizing: content-box; + top: -0.25em; +} + +.picker__nav--prev { + left: -1em; + padding-right: 1.25em; +} + +.picker__nav--next { + right: -1em; + padding-left: 1.25em; +} + +.picker__nav--disabled, +.picker__nav--disabled:hover, +.picker__nav--disabled:before, +.picker__nav--disabled:before:hover { + cursor: default; + background: none; + border-right-color: #f5f5f5; + border-left-color: #f5f5f5; +} + +/** + * The calendar table of dates + */ +.picker__table { + text-align: center; + border-collapse: collapse; + border-spacing: 0; + table-layout: fixed; + font-size: 1rem; + width: 100%; + margin-top: .75em; + margin-bottom: .5em; +} + +.picker__table th, .picker__table td { + text-align: center; +} + +.picker__table td { + margin: 0; + padding: 0; +} + +/** + * The weekday labels + */ +.picker__weekday { + width: 14.285714286%; + font-size: .75em; + padding-bottom: .25em; + color: #999999; + font-weight: 500; + /* Increase the spacing a tad */ +} + +@media (min-height: 33.875em) { + .picker__weekday { + padding-bottom: .5em; + } +} + +/** + * The days on the calendar + */ +.picker__day--today { + position: relative; + color: #595959; + letter-spacing: -.3; + padding: .75rem 0; + font-weight: 400; + border: 1px solid transparent; +} + +.picker__day--disabled:before { + border-top-color: #aaaaaa; +} + +.picker__day--infocus:hover { + cursor: pointer; + color: #000; + font-weight: 500; +} + +.picker__day--outfocus { + display: none; + padding: .75rem 0; + color: #fff; +} + +.picker__day--outfocus:hover { + cursor: pointer; + color: #dddddd; + font-weight: 500; +} + +.picker__day--highlighted:hover, +.picker--focused .picker__day--highlighted { + cursor: pointer; +} + +.picker__day--selected, +.picker__day--selected:hover, +.picker--focused .picker__day--selected { + border-radius: 50%; + -webkit-transform: scale(0.75); + transform: scale(0.75); + background: #0089ec; + color: #ffffff; +} + +.picker__day--disabled, +.picker__day--disabled:hover, +.picker--focused .picker__day--disabled { + background: #f5f5f5; + border-color: #f5f5f5; + color: #dddddd; + cursor: default; +} + +.picker__day--highlighted.picker__day--disabled, +.picker__day--highlighted.picker__day--disabled:hover { + background: #bbbbbb; +} + +/** + * The footer containing the "today", "clear", and "close" buttons. + */ +.picker__footer { + text-align: center; + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + -webkit-align-items: center; + -ms-flex-align: center; + align-items: center; + -webkit-justify-content: space-between; + -ms-flex-pack: justify; + justify-content: space-between; +} + +.picker__button--today, +.picker__button--clear, +.picker__button--close { + border: 1px solid #ffffff; + background: #ffffff; + font-size: .8em; + padding: .66em 0; + font-weight: bold; + width: 33%; + display: inline-block; + vertical-align: bottom; +} + +.picker__button--today:hover, +.picker__button--clear:hover, +.picker__button--close:hover { + cursor: pointer; + color: #000000; + background: #b1dcfb; + border-bottom-color: #b1dcfb; +} + +.picker__button--today:focus, +.picker__button--clear:focus, +.picker__button--close:focus { + background: #b1dcfb; + border-color: rgba(0, 0, 0, 0.05); + outline: none; +} + +.picker__button--today:before, +.picker__button--clear:before, +.picker__button--close:before { + position: relative; + display: inline-block; + height: 0; +} + +.picker__button--today:before, +.picker__button--clear:before { + content: " "; + margin-right: .45em; +} + +.picker__button--today:before { + top: -0.05em; + width: 0; + border-top: 0.66em solid #0059bc; + border-left: .66em solid transparent; +} + +.picker__button--clear:before { + top: -0.25em; + width: .66em; + border-top: 3px solid #ee2200; +} + +.picker__button--close:before { + content: "\D7"; + top: -0.1em; + vertical-align: top; + font-size: 1.1em; + margin-right: .35em; + color: #777777; +} + +.picker__button--today[disabled], +.picker__button--today[disabled]:hover { + background: #f5f5f5; + border-color: #f5f5f5; + color: #dddddd; + cursor: default; +} + +.picker__button--today[disabled]:before { + border-top-color: #aaaaaa; +} + +/* ========================================================================== + CUSTOM MATERIALIZE STYLES + ========================================================================== */ +.picker__box { + border-radius: 2px; + overflow: hidden; +} + +.picker__date-display { + text-align: center; + background-color: #26a69a; + color: #fff; + padding-bottom: 15px; + font-weight: 300; +} + +.picker__nav--prev:hover, +.picker__nav--next:hover { + cursor: pointer; + color: #000000; + background: #a1ded8; +} + +.picker__weekday-display { + background-color: #1f897f; + padding: 10px; + font-weight: 200; + letter-spacing: .5; + font-size: 1rem; + margin-bottom: 15px; +} + +.picker__month-display { + text-transform: uppercase; + font-size: 2rem; +} + +.picker__day-display { + font-size: 4.5rem; + font-weight: 400; +} + +.picker__year-display { + font-size: 1.8rem; + color: rgba(255, 255, 255, 0.4); +} + +.picker__box { + padding: 0; +} + +.picker__calendar-container { + padding: 0 1rem; +} + +.picker__calendar-container thead { + border: none; +} + +.picker__table { + margin-top: 0; + margin-bottom: .5em; +} + +.picker__day--infocus { + color: #595959; + letter-spacing: -.3; + padding: .75rem 0; + font-weight: 400; + border: 1px solid transparent; +} + +.picker__day.picker__day--today { + color: #26a69a; +} + +.picker__day.picker__day--today.picker__day--selected { + color: #fff; +} + +.picker__weekday { + font-size: .9rem; +} + +.picker__day--selected, +.picker__day--selected:hover, +.picker--focused .picker__day--selected { + border-radius: 50%; + -webkit-transform: scale(0.9); + transform: scale(0.9); + background-color: #26a69a; + color: #ffffff; +} + +.picker__day--selected.picker__day--outfocus, +.picker__day--selected:hover.picker__day--outfocus, +.picker--focused .picker__day--selected.picker__day--outfocus { + background-color: #a1ded8; +} + +.picker__footer { + text-align: right; + padding: 5px 10px; +} + +.picker__close, .picker__today { + font-size: 1.1rem; + padding: 0 1rem; + color: #26a69a; +} + +.picker__nav--prev:before, +.picker__nav--next:before { + content: " "; + border-top: .5em solid transparent; + border-bottom: .5em solid transparent; + border-right: 0.75em solid #676767; + width: 0; + height: 0; + display: block; + margin: 0 auto; +} + +.picker__nav--next:before { + border-right: 0; + border-left: 0.75em solid #676767; +} + +button.picker__today:focus, button.picker__clear:focus, button.picker__close:focus { + background-color: #a1ded8; +} + +/* ========================================================================== + $BASE-TIME-PICKER + ========================================================================== */ +/** + * The list of times. + */ +.picker__list { + list-style: none; + padding: 0.75em 0 4.2em; + margin: 0; +} + +/** + * The times on the clock. + */ +.picker__list-item { + border-bottom: 1px solid #dddddd; + border-top: 1px solid #dddddd; + margin-bottom: -1px; + position: relative; + background: #ffffff; + padding: .75em 1.25em; +} + +@media (min-height: 46.75em) { + .picker__list-item { + padding: .5em 1em; + } +} + +/* Hovered time */ +.picker__list-item:hover { + cursor: pointer; + color: #000000; + background: #b1dcfb; + border-color: #0089ec; + z-index: 10; +} + +/* Highlighted and hovered/focused time */ +.picker__list-item--highlighted { + border-color: #0089ec; + z-index: 10; +} + +.picker__list-item--highlighted:hover, +.picker--focused .picker__list-item--highlighted { + cursor: pointer; + color: #000000; + background: #b1dcfb; +} + +/* Selected and hovered/focused time */ +.picker__list-item--selected, +.picker__list-item--selected:hover, +.picker--focused .picker__list-item--selected { + background: #0089ec; + color: #ffffff; + z-index: 10; +} + +/* Disabled time */ +.picker__list-item--disabled, +.picker__list-item--disabled:hover, +.picker--focused .picker__list-item--disabled { + background: #f5f5f5; + border-color: #f5f5f5; + color: #dddddd; + cursor: default; + border-color: #dddddd; + z-index: auto; +} + +/** + * The clear button + */ +.picker--time .picker__button--clear { + display: block; + width: 80%; + margin: 1em auto 0; + padding: 1em 1.25em; + background: none; + border: 0; + font-weight: 500; + font-size: .67em; + text-align: center; + text-transform: uppercase; + color: #666; +} + +.picker--time .picker__button--clear:hover, +.picker--time .picker__button--clear:focus { + color: #000000; + background: #b1dcfb; + background: #ee2200; + border-color: #ee2200; + cursor: pointer; + color: #ffffff; + outline: none; +} + +.picker--time .picker__button--clear:before { + top: -0.25em; + color: #666; + font-size: 1.25em; + font-weight: bold; +} + +.picker--time .picker__button--clear:hover:before, +.picker--time .picker__button--clear:focus:before { + color: #ffffff; +} + +/* ========================================================================== + $DEFAULT-TIME-PICKER + ========================================================================== */ +/** + * The frame the bounds the time picker. + */ +.picker--time .picker__frame { + min-width: 256px; + max-width: 320px; +} + +/** + * The picker box. + */ +.picker--time .picker__box { + font-size: 1em; + background: #f2f2f2; + padding: 0; +} + +@media (min-height: 40.125em) { + .picker--time .picker__box { + margin-bottom: 5em; + } +} diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/css/materialize.min.css b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/css/materialize.min.css new file mode 100644 index 000000000..910474550 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/css/materialize.min.css @@ -0,0 +1,16 @@ +/*! + * Materialize v0.98.0 (http://materializecss.com) + * Copyright 2014-2015 Materialize + * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) + */ +.materialize-red{background-color:#e51c23 !important}.materialize-red-text{color:#e51c23 !important}.materialize-red.lighten-5{background-color:#fdeaeb !important}.materialize-red-text.text-lighten-5{color:#fdeaeb !important}.materialize-red.lighten-4{background-color:#f8c1c3 !important}.materialize-red-text.text-lighten-4{color:#f8c1c3 !important}.materialize-red.lighten-3{background-color:#f3989b !important}.materialize-red-text.text-lighten-3{color:#f3989b !important}.materialize-red.lighten-2{background-color:#ee6e73 !important}.materialize-red-text.text-lighten-2{color:#ee6e73 !important}.materialize-red.lighten-1{background-color:#ea454b !important}.materialize-red-text.text-lighten-1{color:#ea454b !important}.materialize-red.darken-1{background-color:#d0181e !important}.materialize-red-text.text-darken-1{color:#d0181e !important}.materialize-red.darken-2{background-color:#b9151b !important}.materialize-red-text.text-darken-2{color:#b9151b !important}.materialize-red.darken-3{background-color:#a21318 !important}.materialize-red-text.text-darken-3{color:#a21318 !important}.materialize-red.darken-4{background-color:#8b1014 !important}.materialize-red-text.text-darken-4{color:#8b1014 !important}.red{background-color:#F44336 !important}.red-text{color:#F44336 !important}.red.lighten-5{background-color:#FFEBEE !important}.red-text.text-lighten-5{color:#FFEBEE !important}.red.lighten-4{background-color:#FFCDD2 !important}.red-text.text-lighten-4{color:#FFCDD2 !important}.red.lighten-3{background-color:#EF9A9A !important}.red-text.text-lighten-3{color:#EF9A9A !important}.red.lighten-2{background-color:#E57373 !important}.red-text.text-lighten-2{color:#E57373 !important}.red.lighten-1{background-color:#EF5350 !important}.red-text.text-lighten-1{color:#EF5350 !important}.red.darken-1{background-color:#E53935 !important}.red-text.text-darken-1{color:#E53935 !important}.red.darken-2{background-color:#D32F2F !important}.red-text.text-darken-2{color:#D32F2F !important}.red.darken-3{background-color:#C62828 !important}.red-text.text-darken-3{color:#C62828 !important}.red.darken-4{background-color:#B71C1C !important}.red-text.text-darken-4{color:#B71C1C !important}.red.accent-1{background-color:#FF8A80 !important}.red-text.text-accent-1{color:#FF8A80 !important}.red.accent-2{background-color:#FF5252 !important}.red-text.text-accent-2{color:#FF5252 !important}.red.accent-3{background-color:#FF1744 !important}.red-text.text-accent-3{color:#FF1744 !important}.red.accent-4{background-color:#D50000 !important}.red-text.text-accent-4{color:#D50000 !important}.pink{background-color:#e91e63 !important}.pink-text{color:#e91e63 !important}.pink.lighten-5{background-color:#fce4ec !important}.pink-text.text-lighten-5{color:#fce4ec !important}.pink.lighten-4{background-color:#f8bbd0 !important}.pink-text.text-lighten-4{color:#f8bbd0 !important}.pink.lighten-3{background-color:#f48fb1 !important}.pink-text.text-lighten-3{color:#f48fb1 !important}.pink.lighten-2{background-color:#f06292 !important}.pink-text.text-lighten-2{color:#f06292 !important}.pink.lighten-1{background-color:#ec407a !important}.pink-text.text-lighten-1{color:#ec407a !important}.pink.darken-1{background-color:#d81b60 !important}.pink-text.text-darken-1{color:#d81b60 !important}.pink.darken-2{background-color:#c2185b !important}.pink-text.text-darken-2{color:#c2185b !important}.pink.darken-3{background-color:#ad1457 !important}.pink-text.text-darken-3{color:#ad1457 !important}.pink.darken-4{background-color:#880e4f !important}.pink-text.text-darken-4{color:#880e4f !important}.pink.accent-1{background-color:#ff80ab !important}.pink-text.text-accent-1{color:#ff80ab !important}.pink.accent-2{background-color:#ff4081 !important}.pink-text.text-accent-2{color:#ff4081 !important}.pink.accent-3{background-color:#f50057 !important}.pink-text.text-accent-3{color:#f50057 !important}.pink.accent-4{background-color:#c51162 !important}.pink-text.text-accent-4{color:#c51162 !important}.purple{background-color:#9c27b0 !important}.purple-text{color:#9c27b0 !important}.purple.lighten-5{background-color:#f3e5f5 !important}.purple-text.text-lighten-5{color:#f3e5f5 !important}.purple.lighten-4{background-color:#e1bee7 !important}.purple-text.text-lighten-4{color:#e1bee7 !important}.purple.lighten-3{background-color:#ce93d8 !important}.purple-text.text-lighten-3{color:#ce93d8 !important}.purple.lighten-2{background-color:#ba68c8 !important}.purple-text.text-lighten-2{color:#ba68c8 !important}.purple.lighten-1{background-color:#ab47bc !important}.purple-text.text-lighten-1{color:#ab47bc !important}.purple.darken-1{background-color:#8e24aa !important}.purple-text.text-darken-1{color:#8e24aa !important}.purple.darken-2{background-color:#7b1fa2 !important}.purple-text.text-darken-2{color:#7b1fa2 !important}.purple.darken-3{background-color:#6a1b9a !important}.purple-text.text-darken-3{color:#6a1b9a !important}.purple.darken-4{background-color:#4a148c !important}.purple-text.text-darken-4{color:#4a148c !important}.purple.accent-1{background-color:#ea80fc !important}.purple-text.text-accent-1{color:#ea80fc !important}.purple.accent-2{background-color:#e040fb !important}.purple-text.text-accent-2{color:#e040fb !important}.purple.accent-3{background-color:#d500f9 !important}.purple-text.text-accent-3{color:#d500f9 !important}.purple.accent-4{background-color:#a0f !important}.purple-text.text-accent-4{color:#a0f !important}.deep-purple{background-color:#673ab7 !important}.deep-purple-text{color:#673ab7 !important}.deep-purple.lighten-5{background-color:#ede7f6 !important}.deep-purple-text.text-lighten-5{color:#ede7f6 !important}.deep-purple.lighten-4{background-color:#d1c4e9 !important}.deep-purple-text.text-lighten-4{color:#d1c4e9 !important}.deep-purple.lighten-3{background-color:#b39ddb !important}.deep-purple-text.text-lighten-3{color:#b39ddb !important}.deep-purple.lighten-2{background-color:#9575cd !important}.deep-purple-text.text-lighten-2{color:#9575cd !important}.deep-purple.lighten-1{background-color:#7e57c2 !important}.deep-purple-text.text-lighten-1{color:#7e57c2 !important}.deep-purple.darken-1{background-color:#5e35b1 !important}.deep-purple-text.text-darken-1{color:#5e35b1 !important}.deep-purple.darken-2{background-color:#512da8 !important}.deep-purple-text.text-darken-2{color:#512da8 !important}.deep-purple.darken-3{background-color:#4527a0 !important}.deep-purple-text.text-darken-3{color:#4527a0 !important}.deep-purple.darken-4{background-color:#311b92 !important}.deep-purple-text.text-darken-4{color:#311b92 !important}.deep-purple.accent-1{background-color:#b388ff !important}.deep-purple-text.text-accent-1{color:#b388ff !important}.deep-purple.accent-2{background-color:#7c4dff !important}.deep-purple-text.text-accent-2{color:#7c4dff !important}.deep-purple.accent-3{background-color:#651fff !important}.deep-purple-text.text-accent-3{color:#651fff !important}.deep-purple.accent-4{background-color:#6200ea !important}.deep-purple-text.text-accent-4{color:#6200ea !important}.indigo{background-color:#3f51b5 !important}.indigo-text{color:#3f51b5 !important}.indigo.lighten-5{background-color:#e8eaf6 !important}.indigo-text.text-lighten-5{color:#e8eaf6 !important}.indigo.lighten-4{background-color:#c5cae9 !important}.indigo-text.text-lighten-4{color:#c5cae9 !important}.indigo.lighten-3{background-color:#9fa8da !important}.indigo-text.text-lighten-3{color:#9fa8da !important}.indigo.lighten-2{background-color:#7986cb !important}.indigo-text.text-lighten-2{color:#7986cb !important}.indigo.lighten-1{background-color:#5c6bc0 !important}.indigo-text.text-lighten-1{color:#5c6bc0 !important}.indigo.darken-1{background-color:#3949ab !important}.indigo-text.text-darken-1{color:#3949ab !important}.indigo.darken-2{background-color:#303f9f !important}.indigo-text.text-darken-2{color:#303f9f !important}.indigo.darken-3{background-color:#283593 !important}.indigo-text.text-darken-3{color:#283593 !important}.indigo.darken-4{background-color:#1a237e !important}.indigo-text.text-darken-4{color:#1a237e !important}.indigo.accent-1{background-color:#8c9eff !important}.indigo-text.text-accent-1{color:#8c9eff !important}.indigo.accent-2{background-color:#536dfe !important}.indigo-text.text-accent-2{color:#536dfe !important}.indigo.accent-3{background-color:#3d5afe !important}.indigo-text.text-accent-3{color:#3d5afe !important}.indigo.accent-4{background-color:#304ffe !important}.indigo-text.text-accent-4{color:#304ffe !important}.blue{background-color:#2196F3 !important}.blue-text{color:#2196F3 !important}.blue.lighten-5{background-color:#E3F2FD !important}.blue-text.text-lighten-5{color:#E3F2FD !important}.blue.lighten-4{background-color:#BBDEFB !important}.blue-text.text-lighten-4{color:#BBDEFB !important}.blue.lighten-3{background-color:#90CAF9 !important}.blue-text.text-lighten-3{color:#90CAF9 !important}.blue.lighten-2{background-color:#64B5F6 !important}.blue-text.text-lighten-2{color:#64B5F6 !important}.blue.lighten-1{background-color:#42A5F5 !important}.blue-text.text-lighten-1{color:#42A5F5 !important}.blue.darken-1{background-color:#1E88E5 !important}.blue-text.text-darken-1{color:#1E88E5 !important}.blue.darken-2{background-color:#1976D2 !important}.blue-text.text-darken-2{color:#1976D2 !important}.blue.darken-3{background-color:#1565C0 !important}.blue-text.text-darken-3{color:#1565C0 !important}.blue.darken-4{background-color:#0D47A1 !important}.blue-text.text-darken-4{color:#0D47A1 !important}.blue.accent-1{background-color:#82B1FF !important}.blue-text.text-accent-1{color:#82B1FF !important}.blue.accent-2{background-color:#448AFF !important}.blue-text.text-accent-2{color:#448AFF !important}.blue.accent-3{background-color:#2979FF !important}.blue-text.text-accent-3{color:#2979FF !important}.blue.accent-4{background-color:#2962FF !important}.blue-text.text-accent-4{color:#2962FF !important}.light-blue{background-color:#03a9f4 !important}.light-blue-text{color:#03a9f4 !important}.light-blue.lighten-5{background-color:#e1f5fe !important}.light-blue-text.text-lighten-5{color:#e1f5fe !important}.light-blue.lighten-4{background-color:#b3e5fc !important}.light-blue-text.text-lighten-4{color:#b3e5fc !important}.light-blue.lighten-3{background-color:#81d4fa !important}.light-blue-text.text-lighten-3{color:#81d4fa !important}.light-blue.lighten-2{background-color:#4fc3f7 !important}.light-blue-text.text-lighten-2{color:#4fc3f7 !important}.light-blue.lighten-1{background-color:#29b6f6 !important}.light-blue-text.text-lighten-1{color:#29b6f6 !important}.light-blue.darken-1{background-color:#039be5 !important}.light-blue-text.text-darken-1{color:#039be5 !important}.light-blue.darken-2{background-color:#0288d1 !important}.light-blue-text.text-darken-2{color:#0288d1 !important}.light-blue.darken-3{background-color:#0277bd !important}.light-blue-text.text-darken-3{color:#0277bd !important}.light-blue.darken-4{background-color:#01579b !important}.light-blue-text.text-darken-4{color:#01579b !important}.light-blue.accent-1{background-color:#80d8ff !important}.light-blue-text.text-accent-1{color:#80d8ff !important}.light-blue.accent-2{background-color:#40c4ff !important}.light-blue-text.text-accent-2{color:#40c4ff !important}.light-blue.accent-3{background-color:#00b0ff !important}.light-blue-text.text-accent-3{color:#00b0ff !important}.light-blue.accent-4{background-color:#0091ea !important}.light-blue-text.text-accent-4{color:#0091ea !important}.cyan{background-color:#00bcd4 !important}.cyan-text{color:#00bcd4 !important}.cyan.lighten-5{background-color:#e0f7fa !important}.cyan-text.text-lighten-5{color:#e0f7fa !important}.cyan.lighten-4{background-color:#b2ebf2 !important}.cyan-text.text-lighten-4{color:#b2ebf2 !important}.cyan.lighten-3{background-color:#80deea !important}.cyan-text.text-lighten-3{color:#80deea !important}.cyan.lighten-2{background-color:#4dd0e1 !important}.cyan-text.text-lighten-2{color:#4dd0e1 !important}.cyan.lighten-1{background-color:#26c6da !important}.cyan-text.text-lighten-1{color:#26c6da !important}.cyan.darken-1{background-color:#00acc1 !important}.cyan-text.text-darken-1{color:#00acc1 !important}.cyan.darken-2{background-color:#0097a7 !important}.cyan-text.text-darken-2{color:#0097a7 !important}.cyan.darken-3{background-color:#00838f !important}.cyan-text.text-darken-3{color:#00838f !important}.cyan.darken-4{background-color:#006064 !important}.cyan-text.text-darken-4{color:#006064 !important}.cyan.accent-1{background-color:#84ffff !important}.cyan-text.text-accent-1{color:#84ffff !important}.cyan.accent-2{background-color:#18ffff !important}.cyan-text.text-accent-2{color:#18ffff !important}.cyan.accent-3{background-color:#00e5ff !important}.cyan-text.text-accent-3{color:#00e5ff !important}.cyan.accent-4{background-color:#00b8d4 !important}.cyan-text.text-accent-4{color:#00b8d4 !important}.teal{background-color:#009688 !important}.teal-text{color:#009688 !important}.teal.lighten-5{background-color:#e0f2f1 !important}.teal-text.text-lighten-5{color:#e0f2f1 !important}.teal.lighten-4{background-color:#b2dfdb !important}.teal-text.text-lighten-4{color:#b2dfdb !important}.teal.lighten-3{background-color:#80cbc4 !important}.teal-text.text-lighten-3{color:#80cbc4 !important}.teal.lighten-2{background-color:#4db6ac !important}.teal-text.text-lighten-2{color:#4db6ac !important}.teal.lighten-1{background-color:#26a69a !important}.teal-text.text-lighten-1{color:#26a69a !important}.teal.darken-1{background-color:#00897b !important}.teal-text.text-darken-1{color:#00897b !important}.teal.darken-2{background-color:#00796b !important}.teal-text.text-darken-2{color:#00796b !important}.teal.darken-3{background-color:#00695c !important}.teal-text.text-darken-3{color:#00695c !important}.teal.darken-4{background-color:#004d40 !important}.teal-text.text-darken-4{color:#004d40 !important}.teal.accent-1{background-color:#a7ffeb !important}.teal-text.text-accent-1{color:#a7ffeb !important}.teal.accent-2{background-color:#64ffda !important}.teal-text.text-accent-2{color:#64ffda !important}.teal.accent-3{background-color:#1de9b6 !important}.teal-text.text-accent-3{color:#1de9b6 !important}.teal.accent-4{background-color:#00bfa5 !important}.teal-text.text-accent-4{color:#00bfa5 !important}.green{background-color:#4CAF50 !important}.green-text{color:#4CAF50 !important}.green.lighten-5{background-color:#E8F5E9 !important}.green-text.text-lighten-5{color:#E8F5E9 !important}.green.lighten-4{background-color:#C8E6C9 !important}.green-text.text-lighten-4{color:#C8E6C9 !important}.green.lighten-3{background-color:#A5D6A7 !important}.green-text.text-lighten-3{color:#A5D6A7 !important}.green.lighten-2{background-color:#81C784 !important}.green-text.text-lighten-2{color:#81C784 !important}.green.lighten-1{background-color:#66BB6A !important}.green-text.text-lighten-1{color:#66BB6A !important}.green.darken-1{background-color:#43A047 !important}.green-text.text-darken-1{color:#43A047 !important}.green.darken-2{background-color:#388E3C !important}.green-text.text-darken-2{color:#388E3C !important}.green.darken-3{background-color:#2E7D32 !important}.green-text.text-darken-3{color:#2E7D32 !important}.green.darken-4{background-color:#1B5E20 !important}.green-text.text-darken-4{color:#1B5E20 !important}.green.accent-1{background-color:#B9F6CA !important}.green-text.text-accent-1{color:#B9F6CA !important}.green.accent-2{background-color:#69F0AE !important}.green-text.text-accent-2{color:#69F0AE !important}.green.accent-3{background-color:#00E676 !important}.green-text.text-accent-3{color:#00E676 !important}.green.accent-4{background-color:#00C853 !important}.green-text.text-accent-4{color:#00C853 !important}.light-green{background-color:#8bc34a !important}.light-green-text{color:#8bc34a !important}.light-green.lighten-5{background-color:#f1f8e9 !important}.light-green-text.text-lighten-5{color:#f1f8e9 !important}.light-green.lighten-4{background-color:#dcedc8 !important}.light-green-text.text-lighten-4{color:#dcedc8 !important}.light-green.lighten-3{background-color:#c5e1a5 !important}.light-green-text.text-lighten-3{color:#c5e1a5 !important}.light-green.lighten-2{background-color:#aed581 !important}.light-green-text.text-lighten-2{color:#aed581 !important}.light-green.lighten-1{background-color:#9ccc65 !important}.light-green-text.text-lighten-1{color:#9ccc65 !important}.light-green.darken-1{background-color:#7cb342 !important}.light-green-text.text-darken-1{color:#7cb342 !important}.light-green.darken-2{background-color:#689f38 !important}.light-green-text.text-darken-2{color:#689f38 !important}.light-green.darken-3{background-color:#558b2f !important}.light-green-text.text-darken-3{color:#558b2f !important}.light-green.darken-4{background-color:#33691e !important}.light-green-text.text-darken-4{color:#33691e !important}.light-green.accent-1{background-color:#ccff90 !important}.light-green-text.text-accent-1{color:#ccff90 !important}.light-green.accent-2{background-color:#b2ff59 !important}.light-green-text.text-accent-2{color:#b2ff59 !important}.light-green.accent-3{background-color:#76ff03 !important}.light-green-text.text-accent-3{color:#76ff03 !important}.light-green.accent-4{background-color:#64dd17 !important}.light-green-text.text-accent-4{color:#64dd17 !important}.lime{background-color:#cddc39 !important}.lime-text{color:#cddc39 !important}.lime.lighten-5{background-color:#f9fbe7 !important}.lime-text.text-lighten-5{color:#f9fbe7 !important}.lime.lighten-4{background-color:#f0f4c3 !important}.lime-text.text-lighten-4{color:#f0f4c3 !important}.lime.lighten-3{background-color:#e6ee9c !important}.lime-text.text-lighten-3{color:#e6ee9c !important}.lime.lighten-2{background-color:#dce775 !important}.lime-text.text-lighten-2{color:#dce775 !important}.lime.lighten-1{background-color:#d4e157 !important}.lime-text.text-lighten-1{color:#d4e157 !important}.lime.darken-1{background-color:#c0ca33 !important}.lime-text.text-darken-1{color:#c0ca33 !important}.lime.darken-2{background-color:#afb42b !important}.lime-text.text-darken-2{color:#afb42b !important}.lime.darken-3{background-color:#9e9d24 !important}.lime-text.text-darken-3{color:#9e9d24 !important}.lime.darken-4{background-color:#827717 !important}.lime-text.text-darken-4{color:#827717 !important}.lime.accent-1{background-color:#f4ff81 !important}.lime-text.text-accent-1{color:#f4ff81 !important}.lime.accent-2{background-color:#eeff41 !important}.lime-text.text-accent-2{color:#eeff41 !important}.lime.accent-3{background-color:#c6ff00 !important}.lime-text.text-accent-3{color:#c6ff00 !important}.lime.accent-4{background-color:#aeea00 !important}.lime-text.text-accent-4{color:#aeea00 !important}.yellow{background-color:#ffeb3b !important}.yellow-text{color:#ffeb3b !important}.yellow.lighten-5{background-color:#fffde7 !important}.yellow-text.text-lighten-5{color:#fffde7 !important}.yellow.lighten-4{background-color:#fff9c4 !important}.yellow-text.text-lighten-4{color:#fff9c4 !important}.yellow.lighten-3{background-color:#fff59d !important}.yellow-text.text-lighten-3{color:#fff59d !important}.yellow.lighten-2{background-color:#fff176 !important}.yellow-text.text-lighten-2{color:#fff176 !important}.yellow.lighten-1{background-color:#ffee58 !important}.yellow-text.text-lighten-1{color:#ffee58 !important}.yellow.darken-1{background-color:#fdd835 !important}.yellow-text.text-darken-1{color:#fdd835 !important}.yellow.darken-2{background-color:#fbc02d !important}.yellow-text.text-darken-2{color:#fbc02d !important}.yellow.darken-3{background-color:#f9a825 !important}.yellow-text.text-darken-3{color:#f9a825 !important}.yellow.darken-4{background-color:#f57f17 !important}.yellow-text.text-darken-4{color:#f57f17 !important}.yellow.accent-1{background-color:#ffff8d !important}.yellow-text.text-accent-1{color:#ffff8d !important}.yellow.accent-2{background-color:#ff0 !important}.yellow-text.text-accent-2{color:#ff0 !important}.yellow.accent-3{background-color:#ffea00 !important}.yellow-text.text-accent-3{color:#ffea00 !important}.yellow.accent-4{background-color:#ffd600 !important}.yellow-text.text-accent-4{color:#ffd600 !important}.amber{background-color:#ffc107 !important}.amber-text{color:#ffc107 !important}.amber.lighten-5{background-color:#fff8e1 !important}.amber-text.text-lighten-5{color:#fff8e1 !important}.amber.lighten-4{background-color:#ffecb3 !important}.amber-text.text-lighten-4{color:#ffecb3 !important}.amber.lighten-3{background-color:#ffe082 !important}.amber-text.text-lighten-3{color:#ffe082 !important}.amber.lighten-2{background-color:#ffd54f !important}.amber-text.text-lighten-2{color:#ffd54f !important}.amber.lighten-1{background-color:#ffca28 !important}.amber-text.text-lighten-1{color:#ffca28 !important}.amber.darken-1{background-color:#ffb300 !important}.amber-text.text-darken-1{color:#ffb300 !important}.amber.darken-2{background-color:#ffa000 !important}.amber-text.text-darken-2{color:#ffa000 !important}.amber.darken-3{background-color:#ff8f00 !important}.amber-text.text-darken-3{color:#ff8f00 !important}.amber.darken-4{background-color:#ff6f00 !important}.amber-text.text-darken-4{color:#ff6f00 !important}.amber.accent-1{background-color:#ffe57f !important}.amber-text.text-accent-1{color:#ffe57f !important}.amber.accent-2{background-color:#ffd740 !important}.amber-text.text-accent-2{color:#ffd740 !important}.amber.accent-3{background-color:#ffc400 !important}.amber-text.text-accent-3{color:#ffc400 !important}.amber.accent-4{background-color:#ffab00 !important}.amber-text.text-accent-4{color:#ffab00 !important}.orange{background-color:#ff9800 !important}.orange-text{color:#ff9800 !important}.orange.lighten-5{background-color:#fff3e0 !important}.orange-text.text-lighten-5{color:#fff3e0 !important}.orange.lighten-4{background-color:#ffe0b2 !important}.orange-text.text-lighten-4{color:#ffe0b2 !important}.orange.lighten-3{background-color:#ffcc80 !important}.orange-text.text-lighten-3{color:#ffcc80 !important}.orange.lighten-2{background-color:#ffb74d !important}.orange-text.text-lighten-2{color:#ffb74d !important}.orange.lighten-1{background-color:#ffa726 !important}.orange-text.text-lighten-1{color:#ffa726 !important}.orange.darken-1{background-color:#fb8c00 !important}.orange-text.text-darken-1{color:#fb8c00 !important}.orange.darken-2{background-color:#f57c00 !important}.orange-text.text-darken-2{color:#f57c00 !important}.orange.darken-3{background-color:#ef6c00 !important}.orange-text.text-darken-3{color:#ef6c00 !important}.orange.darken-4{background-color:#e65100 !important}.orange-text.text-darken-4{color:#e65100 !important}.orange.accent-1{background-color:#ffd180 !important}.orange-text.text-accent-1{color:#ffd180 !important}.orange.accent-2{background-color:#ffab40 !important}.orange-text.text-accent-2{color:#ffab40 !important}.orange.accent-3{background-color:#ff9100 !important}.orange-text.text-accent-3{color:#ff9100 !important}.orange.accent-4{background-color:#ff6d00 !important}.orange-text.text-accent-4{color:#ff6d00 !important}.deep-orange{background-color:#ff5722 !important}.deep-orange-text{color:#ff5722 !important}.deep-orange.lighten-5{background-color:#fbe9e7 !important}.deep-orange-text.text-lighten-5{color:#fbe9e7 !important}.deep-orange.lighten-4{background-color:#ffccbc !important}.deep-orange-text.text-lighten-4{color:#ffccbc !important}.deep-orange.lighten-3{background-color:#ffab91 !important}.deep-orange-text.text-lighten-3{color:#ffab91 !important}.deep-orange.lighten-2{background-color:#ff8a65 !important}.deep-orange-text.text-lighten-2{color:#ff8a65 !important}.deep-orange.lighten-1{background-color:#ff7043 !important}.deep-orange-text.text-lighten-1{color:#ff7043 !important}.deep-orange.darken-1{background-color:#f4511e !important}.deep-orange-text.text-darken-1{color:#f4511e !important}.deep-orange.darken-2{background-color:#e64a19 !important}.deep-orange-text.text-darken-2{color:#e64a19 !important}.deep-orange.darken-3{background-color:#d84315 !important}.deep-orange-text.text-darken-3{color:#d84315 !important}.deep-orange.darken-4{background-color:#bf360c !important}.deep-orange-text.text-darken-4{color:#bf360c !important}.deep-orange.accent-1{background-color:#ff9e80 !important}.deep-orange-text.text-accent-1{color:#ff9e80 !important}.deep-orange.accent-2{background-color:#ff6e40 !important}.deep-orange-text.text-accent-2{color:#ff6e40 !important}.deep-orange.accent-3{background-color:#ff3d00 !important}.deep-orange-text.text-accent-3{color:#ff3d00 !important}.deep-orange.accent-4{background-color:#dd2c00 !important}.deep-orange-text.text-accent-4{color:#dd2c00 !important}.brown{background-color:#795548 !important}.brown-text{color:#795548 !important}.brown.lighten-5{background-color:#efebe9 !important}.brown-text.text-lighten-5{color:#efebe9 !important}.brown.lighten-4{background-color:#d7ccc8 !important}.brown-text.text-lighten-4{color:#d7ccc8 !important}.brown.lighten-3{background-color:#bcaaa4 !important}.brown-text.text-lighten-3{color:#bcaaa4 !important}.brown.lighten-2{background-color:#a1887f !important}.brown-text.text-lighten-2{color:#a1887f !important}.brown.lighten-1{background-color:#8d6e63 !important}.brown-text.text-lighten-1{color:#8d6e63 !important}.brown.darken-1{background-color:#6d4c41 !important}.brown-text.text-darken-1{color:#6d4c41 !important}.brown.darken-2{background-color:#5d4037 !important}.brown-text.text-darken-2{color:#5d4037 !important}.brown.darken-3{background-color:#4e342e !important}.brown-text.text-darken-3{color:#4e342e !important}.brown.darken-4{background-color:#3e2723 !important}.brown-text.text-darken-4{color:#3e2723 !important}.blue-grey{background-color:#607d8b !important}.blue-grey-text{color:#607d8b !important}.blue-grey.lighten-5{background-color:#eceff1 !important}.blue-grey-text.text-lighten-5{color:#eceff1 !important}.blue-grey.lighten-4{background-color:#cfd8dc !important}.blue-grey-text.text-lighten-4{color:#cfd8dc !important}.blue-grey.lighten-3{background-color:#b0bec5 !important}.blue-grey-text.text-lighten-3{color:#b0bec5 !important}.blue-grey.lighten-2{background-color:#90a4ae !important}.blue-grey-text.text-lighten-2{color:#90a4ae !important}.blue-grey.lighten-1{background-color:#78909c !important}.blue-grey-text.text-lighten-1{color:#78909c !important}.blue-grey.darken-1{background-color:#546e7a !important}.blue-grey-text.text-darken-1{color:#546e7a !important}.blue-grey.darken-2{background-color:#455a64 !important}.blue-grey-text.text-darken-2{color:#455a64 !important}.blue-grey.darken-3{background-color:#37474f !important}.blue-grey-text.text-darken-3{color:#37474f !important}.blue-grey.darken-4{background-color:#263238 !important}.blue-grey-text.text-darken-4{color:#263238 !important}.grey{background-color:#9e9e9e !important}.grey-text{color:#9e9e9e !important}.grey.lighten-5{background-color:#fafafa !important}.grey-text.text-lighten-5{color:#fafafa !important}.grey.lighten-4{background-color:#f5f5f5 !important}.grey-text.text-lighten-4{color:#f5f5f5 !important}.grey.lighten-3{background-color:#eee !important}.grey-text.text-lighten-3{color:#eee !important}.grey.lighten-2{background-color:#e0e0e0 !important}.grey-text.text-lighten-2{color:#e0e0e0 !important}.grey.lighten-1{background-color:#bdbdbd !important}.grey-text.text-lighten-1{color:#bdbdbd !important}.grey.darken-1{background-color:#757575 !important}.grey-text.text-darken-1{color:#757575 !important}.grey.darken-2{background-color:#616161 !important}.grey-text.text-darken-2{color:#616161 !important}.grey.darken-3{background-color:#424242 !important}.grey-text.text-darken-3{color:#424242 !important}.grey.darken-4{background-color:#212121 !important}.grey-text.text-darken-4{color:#212121 !important}.black{background-color:#000 !important}.black-text{color:#000 !important}.white{background-color:#fff !important}.white-text{color:#fff !important}.transparent{background-color:transparent !important}.transparent-text{color:transparent !important}/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */html{font-family:sans-serif;-ms-text-size-adjust:100%;-webkit-text-size-adjust:100%}body{margin:0}article,aside,details,figcaption,figure,footer,header,hgroup,main,menu,nav,section,summary{display:block}audio,canvas,progress,video{display:inline-block;vertical-align:baseline}audio:not([controls]){display:none;height:0}[hidden],template{display:none}a{background-color:transparent}a:active,a:hover{outline:0}abbr[title]{border-bottom:1px dotted}b,strong{font-weight:bold}dfn{font-style:italic}h1{font-size:2em;margin:0.67em 0}mark{background:#ff0;color:#000}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sup{top:-0.5em}sub{bottom:-0.25em}img{border:0}svg:not(:root){overflow:hidden}figure{margin:1em 40px}hr{box-sizing:content-box;height:0}pre{overflow:auto}code,kbd,pre,samp{font-family:monospace, monospace;font-size:1em}button,input,optgroup,select,textarea{color:inherit;font:inherit;margin:0}button{overflow:visible}button,select{text-transform:none}button,html input[type="button"],input[type="reset"],input[type="submit"]{-webkit-appearance:button;cursor:pointer}button[disabled],html input[disabled]{cursor:default}button::-moz-focus-inner,input::-moz-focus-inner{border:0;padding:0}input{line-height:normal}input[type="checkbox"],input[type="radio"]{box-sizing:border-box;padding:0}input[type="number"]::-webkit-inner-spin-button,input[type="number"]::-webkit-outer-spin-button{height:auto}input[type="search"]{-webkit-appearance:textfield;box-sizing:content-box}input[type="search"]::-webkit-search-cancel-button,input[type="search"]::-webkit-search-decoration{-webkit-appearance:none}fieldset{border:1px solid #c0c0c0;margin:0 2px;padding:0.35em 0.625em 0.75em}legend{border:0;padding:0}textarea{overflow:auto}optgroup{font-weight:bold}table{border-collapse:collapse;border-spacing:0}td,th{padding:0}html{box-sizing:border-box}*,*:before,*:after{box-sizing:inherit}ul:not(.browser-default){padding-left:0;list-style-type:none}ul:not(.browser-default) li{list-style-type:none}a{color:#039be5;text-decoration:none;-webkit-tap-highlight-color:transparent}.valign-wrapper{display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-align-items:center;-ms-flex-align:center;align-items:center}.valign-wrapper .valign{display:block}.clearfix{clear:both}.z-depth-0{box-shadow:none !important}.z-depth-1,nav,.card-panel,.card,.toast,.btn,.btn-large,.btn-floating,.dropdown-content,.collapsible,.side-nav{box-shadow:0 2px 2px 0 rgba(0,0,0,0.14),0 1px 5px 0 rgba(0,0,0,0.12),0 3px 1px -2px rgba(0,0,0,0.2)}.z-depth-1-half,.btn:hover,.btn-large:hover,.btn-floating:hover{box-shadow:0 3px 3px 0 rgba(0,0,0,0.14),0 1px 7px 0 rgba(0,0,0,0.12),0 3px 1px -1px rgba(0,0,0,0.2)}.z-depth-2{box-shadow:0 4px 5px 0 rgba(0,0,0,0.14),0 1px 10px 0 rgba(0,0,0,0.12),0 2px 4px -1px rgba(0,0,0,0.3)}.z-depth-3{box-shadow:0 6px 10px 0 rgba(0,0,0,0.14),0 1px 18px 0 rgba(0,0,0,0.12),0 3px 5px -1px rgba(0,0,0,0.3)}.z-depth-4,.modal{box-shadow:0 8px 10px 1px rgba(0,0,0,0.14),0 3px 14px 2px rgba(0,0,0,0.12),0 5px 5px -3px rgba(0,0,0,0.3)}.z-depth-5{box-shadow:0 16px 24px 2px rgba(0,0,0,0.14),0 6px 30px 5px rgba(0,0,0,0.12),0 8px 10px -5px rgba(0,0,0,0.3)}.hoverable{transition:box-shadow .25s;box-shadow:0}.hoverable:hover{transition:box-shadow .25s;box-shadow:0 8px 17px 0 rgba(0,0,0,0.2),0 6px 20px 0 rgba(0,0,0,0.19)}.divider{height:1px;overflow:hidden;background-color:#e0e0e0}blockquote{margin:20px 0;padding-left:1.5rem;border-left:5px solid #ee6e73}i{line-height:inherit}i.left{float:left;margin-right:15px}i.right{float:right;margin-left:15px}i.tiny{font-size:1rem}i.small{font-size:2rem}i.medium{font-size:4rem}i.large{font-size:6rem}img.responsive-img,video.responsive-video{max-width:100%;height:auto}.pagination li{display:inline-block;border-radius:2px;text-align:center;vertical-align:top;height:30px}.pagination li a{color:#444;display:inline-block;font-size:1.2rem;padding:0 10px;line-height:30px}.pagination li.active a{color:#fff}.pagination li.active{background-color:#ee6e73}.pagination li.disabled a{cursor:default;color:#999}.pagination li i{font-size:2rem}.pagination li.pages ul li{display:inline-block;float:none}@media only screen and (max-width: 992px){.pagination{width:100%}.pagination li.prev,.pagination li.next{width:10%}.pagination li.pages{width:80%;overflow:hidden;white-space:nowrap}}.breadcrumb{font-size:18px;color:rgba(255,255,255,0.7)}.breadcrumb i,.breadcrumb [class^="mdi-"],.breadcrumb [class*="mdi-"],.breadcrumb i.material-icons{display:inline-block;float:left;font-size:24px}.breadcrumb:before{content:'\E5CC';color:rgba(255,255,255,0.7);vertical-align:top;display:inline-block;font-family:'Material Icons';font-weight:normal;font-style:normal;font-size:25px;margin:0 10px 0 8px;-webkit-font-smoothing:antialiased}.breadcrumb:first-child:before{display:none}.breadcrumb:last-child{color:#fff}.parallax-container{position:relative;overflow:hidden;height:500px}.parallax{position:absolute;top:0;left:0;right:0;bottom:0;z-index:-1}.parallax img{display:none;position:absolute;left:50%;bottom:0;min-width:100%;min-height:100%;-webkit-transform:translate3d(0, 0, 0);transform:translate3d(0, 0, 0);-webkit-transform:translateX(-50%);transform:translateX(-50%)}.pin-top,.pin-bottom{position:relative}.pinned{position:fixed !important}ul.staggered-list li{opacity:0}.fade-in{opacity:0;-webkit-transform-origin:0 50%;transform-origin:0 50%}@media only screen and (max-width: 600px){.hide-on-small-only,.hide-on-small-and-down{display:none !important}}@media only screen and (max-width: 992px){.hide-on-med-and-down{display:none !important}}@media only screen and (min-width: 601px){.hide-on-med-and-up{display:none !important}}@media only screen and (min-width: 600px) and (max-width: 992px){.hide-on-med-only{display:none !important}}@media only screen and (min-width: 993px){.hide-on-large-only{display:none !important}}@media only screen and (min-width: 993px){.show-on-large{display:block !important}}@media only screen and (min-width: 600px) and (max-width: 992px){.show-on-medium{display:block !important}}@media only screen and (max-width: 600px){.show-on-small{display:block !important}}@media only screen and (min-width: 601px){.show-on-medium-and-up{display:block !important}}@media only screen and (max-width: 992px){.show-on-medium-and-down{display:block !important}}@media only screen and (max-width: 600px){.center-on-small-only{text-align:center}}footer.page-footer{padding-top:20px;background-color:#ee6e73}footer.page-footer .footer-copyright{overflow:hidden;min-height:50px;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-align-items:center;-ms-flex-align:center;align-items:center;padding:10px 0px;color:rgba(255,255,255,0.8);background-color:rgba(51,51,51,0.08)}table,th,td{border:none}table{width:100%;display:table}table.bordered>thead>tr,table.bordered>tbody>tr{border-bottom:1px solid #d0d0d0}table.striped>tbody>tr:nth-child(odd){background-color:#f2f2f2}table.striped>tbody>tr>td{border-radius:0}table.highlight>tbody>tr{transition:background-color .25s ease}table.highlight>tbody>tr:hover{background-color:#f2f2f2}table.centered thead tr th,table.centered tbody tr td{text-align:center}thead{border-bottom:1px solid #d0d0d0}td,th{padding:15px 5px;display:table-cell;text-align:left;vertical-align:middle;border-radius:2px}@media only screen and (max-width: 992px){table.responsive-table{width:100%;border-collapse:collapse;border-spacing:0;display:block;position:relative}table.responsive-table td:empty:before{content:'\00a0'}table.responsive-table th,table.responsive-table td{margin:0;vertical-align:top}table.responsive-table th{text-align:left}table.responsive-table thead{display:block;float:left}table.responsive-table thead tr{display:block;padding:0 10px 0 0}table.responsive-table thead tr th::before{content:"\00a0"}table.responsive-table tbody{display:block;width:auto;position:relative;overflow-x:auto;white-space:nowrap}table.responsive-table tbody tr{display:inline-block;vertical-align:top}table.responsive-table th{display:block;text-align:right}table.responsive-table td{display:block;min-height:1.25em;text-align:left}table.responsive-table tr{padding:0 10px}table.responsive-table thead{border:0;border-right:1px solid #d0d0d0}table.responsive-table.bordered th{border-bottom:0;border-left:0}table.responsive-table.bordered td{border-left:0;border-right:0;border-bottom:0}table.responsive-table.bordered tr{border:0}table.responsive-table.bordered tbody tr{border-right:1px solid #d0d0d0}}.collection{margin:.5rem 0 1rem 0;border:1px solid #e0e0e0;border-radius:2px;overflow:hidden;position:relative}.collection .collection-item{background-color:#fff;line-height:1.5rem;padding:10px 20px;margin:0;border-bottom:1px solid #e0e0e0}.collection .collection-item.avatar{min-height:84px;padding-left:72px;position:relative}.collection .collection-item.avatar .circle{position:absolute;width:42px;height:42px;overflow:hidden;left:15px;display:inline-block;vertical-align:middle}.collection .collection-item.avatar i.circle{font-size:18px;line-height:42px;color:#fff;background-color:#999;text-align:center}.collection .collection-item.avatar .title{font-size:16px}.collection .collection-item.avatar p{margin:0}.collection .collection-item.avatar .secondary-content{position:absolute;top:16px;right:16px}.collection .collection-item:last-child{border-bottom:none}.collection .collection-item.active{background-color:#26a69a;color:#eafaf9}.collection .collection-item.active .secondary-content{color:#fff}.collection a.collection-item{display:block;transition:.25s;color:#26a69a}.collection a.collection-item:not(.active):hover{background-color:#ddd}.collection.with-header .collection-header{background-color:#fff;border-bottom:1px solid #e0e0e0;padding:10px 20px}.collection.with-header .collection-item{padding-left:30px}.collection.with-header .collection-item.avatar{padding-left:72px}.secondary-content{float:right;color:#26a69a}.collapsible .collection{margin:0;border:none}.video-container{position:relative;padding-bottom:56.25%;height:0;overflow:hidden}.video-container iframe,.video-container object,.video-container embed{position:absolute;top:0;left:0;width:100%;height:100%}.progress{position:relative;height:4px;display:block;width:100%;background-color:#acece6;border-radius:2px;margin:.5rem 0 1rem 0;overflow:hidden}.progress .determinate{position:absolute;top:0;left:0;bottom:0;background-color:#26a69a;transition:width .3s linear}.progress .indeterminate{background-color:#26a69a}.progress .indeterminate:before{content:'';position:absolute;background-color:inherit;top:0;left:0;bottom:0;will-change:left, right;-webkit-animation:indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;animation:indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite}.progress .indeterminate:after{content:'';position:absolute;background-color:inherit;top:0;left:0;bottom:0;will-change:left, right;-webkit-animation:indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;animation:indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;-webkit-animation-delay:1.15s;animation-delay:1.15s}@-webkit-keyframes indeterminate{0%{left:-35%;right:100%}60%{left:100%;right:-90%}100%{left:100%;right:-90%}}@keyframes indeterminate{0%{left:-35%;right:100%}60%{left:100%;right:-90%}100%{left:100%;right:-90%}}@-webkit-keyframes indeterminate-short{0%{left:-200%;right:100%}60%{left:107%;right:-8%}100%{left:107%;right:-8%}}@keyframes indeterminate-short{0%{left:-200%;right:100%}60%{left:107%;right:-8%}100%{left:107%;right:-8%}}.hide{display:none !important}.left-align{text-align:left}.right-align{text-align:right}.center,.center-align{text-align:center}.left{float:left !important}.right{float:right !important}.no-select,input[type=range],input[type=range]+.thumb{-webkit-touch-callout:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.circle{border-radius:50%}.center-block{display:block;margin-left:auto;margin-right:auto}.truncate{display:block;white-space:nowrap;overflow:hidden;text-overflow:ellipsis}.no-padding{padding:0 !important}span.badge{min-width:3rem;padding:0 6px;margin-left:14px;text-align:center;font-size:1rem;line-height:22px;height:22px;color:#757575;float:right;box-sizing:border-box}span.badge.new{font-weight:300;font-size:0.8rem;color:#fff;background-color:#26a69a;border-radius:2px}span.badge.new:after{content:" new"}span.badge[data-badge-caption]::after{content:" " attr(data-badge-caption)}nav ul a span.badge{display:inline-block;float:none;margin-left:4px;line-height:22px;height:22px}.collection-item span.badge{margin-top:calc(.75rem - 11px)}.collapsible span.badge{margin-top:calc(1.5rem - 11px)}.side-nav span.badge{margin-top:calc(24px - 11px)}.material-icons{text-rendering:optimizeLegibility;-webkit-font-feature-settings:'liga';-moz-font-feature-settings:'liga';font-feature-settings:'liga'}.container{margin:0 auto;max-width:1280px;width:90%}@media only screen and (min-width: 601px){.container{width:85%}}@media only screen and (min-width: 993px){.container{width:70%}}.container .row{margin-left:-.75rem;margin-right:-.75rem}.section{padding-top:1rem;padding-bottom:1rem}.section.no-pad{padding:0}.section.no-pad-bot{padding-bottom:0}.section.no-pad-top{padding-top:0}.row{margin-left:auto;margin-right:auto;margin-bottom:20px}.row:after{content:"";display:table;clear:both}.row .col{float:left;box-sizing:border-box;padding:0 .75rem;min-height:1px}.row .col[class*="push-"],.row .col[class*="pull-"]{position:relative}.row .col.s1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.s4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.s7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.s10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-s1{margin-left:8.3333333333%}.row .col.pull-s1{right:8.3333333333%}.row .col.push-s1{left:8.3333333333%}.row .col.offset-s2{margin-left:16.6666666667%}.row .col.pull-s2{right:16.6666666667%}.row .col.push-s2{left:16.6666666667%}.row .col.offset-s3{margin-left:25%}.row .col.pull-s3{right:25%}.row .col.push-s3{left:25%}.row .col.offset-s4{margin-left:33.3333333333%}.row .col.pull-s4{right:33.3333333333%}.row .col.push-s4{left:33.3333333333%}.row .col.offset-s5{margin-left:41.6666666667%}.row .col.pull-s5{right:41.6666666667%}.row .col.push-s5{left:41.6666666667%}.row .col.offset-s6{margin-left:50%}.row .col.pull-s6{right:50%}.row .col.push-s6{left:50%}.row .col.offset-s7{margin-left:58.3333333333%}.row .col.pull-s7{right:58.3333333333%}.row .col.push-s7{left:58.3333333333%}.row .col.offset-s8{margin-left:66.6666666667%}.row .col.pull-s8{right:66.6666666667%}.row .col.push-s8{left:66.6666666667%}.row .col.offset-s9{margin-left:75%}.row .col.pull-s9{right:75%}.row .col.push-s9{left:75%}.row .col.offset-s10{margin-left:83.3333333333%}.row .col.pull-s10{right:83.3333333333%}.row .col.push-s10{left:83.3333333333%}.row .col.offset-s11{margin-left:91.6666666667%}.row .col.pull-s11{right:91.6666666667%}.row .col.push-s11{left:91.6666666667%}.row .col.offset-s12{margin-left:100%}.row .col.pull-s12{right:100%}.row .col.push-s12{left:100%}@media only screen and (min-width: 601px){.row .col.m1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.m4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.m7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.m10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-m1{margin-left:8.3333333333%}.row .col.pull-m1{right:8.3333333333%}.row .col.push-m1{left:8.3333333333%}.row .col.offset-m2{margin-left:16.6666666667%}.row .col.pull-m2{right:16.6666666667%}.row .col.push-m2{left:16.6666666667%}.row .col.offset-m3{margin-left:25%}.row .col.pull-m3{right:25%}.row .col.push-m3{left:25%}.row .col.offset-m4{margin-left:33.3333333333%}.row .col.pull-m4{right:33.3333333333%}.row .col.push-m4{left:33.3333333333%}.row .col.offset-m5{margin-left:41.6666666667%}.row .col.pull-m5{right:41.6666666667%}.row .col.push-m5{left:41.6666666667%}.row .col.offset-m6{margin-left:50%}.row .col.pull-m6{right:50%}.row .col.push-m6{left:50%}.row .col.offset-m7{margin-left:58.3333333333%}.row .col.pull-m7{right:58.3333333333%}.row .col.push-m7{left:58.3333333333%}.row .col.offset-m8{margin-left:66.6666666667%}.row .col.pull-m8{right:66.6666666667%}.row .col.push-m8{left:66.6666666667%}.row .col.offset-m9{margin-left:75%}.row .col.pull-m9{right:75%}.row .col.push-m9{left:75%}.row .col.offset-m10{margin-left:83.3333333333%}.row .col.pull-m10{right:83.3333333333%}.row .col.push-m10{left:83.3333333333%}.row .col.offset-m11{margin-left:91.6666666667%}.row .col.pull-m11{right:91.6666666667%}.row .col.push-m11{left:91.6666666667%}.row .col.offset-m12{margin-left:100%}.row .col.pull-m12{right:100%}.row .col.push-m12{left:100%}}@media only screen and (min-width: 993px){.row .col.l1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.l4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.l7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.l10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-l1{margin-left:8.3333333333%}.row .col.pull-l1{right:8.3333333333%}.row .col.push-l1{left:8.3333333333%}.row .col.offset-l2{margin-left:16.6666666667%}.row .col.pull-l2{right:16.6666666667%}.row .col.push-l2{left:16.6666666667%}.row .col.offset-l3{margin-left:25%}.row .col.pull-l3{right:25%}.row .col.push-l3{left:25%}.row .col.offset-l4{margin-left:33.3333333333%}.row .col.pull-l4{right:33.3333333333%}.row .col.push-l4{left:33.3333333333%}.row .col.offset-l5{margin-left:41.6666666667%}.row .col.pull-l5{right:41.6666666667%}.row .col.push-l5{left:41.6666666667%}.row .col.offset-l6{margin-left:50%}.row .col.pull-l6{right:50%}.row .col.push-l6{left:50%}.row .col.offset-l7{margin-left:58.3333333333%}.row .col.pull-l7{right:58.3333333333%}.row .col.push-l7{left:58.3333333333%}.row .col.offset-l8{margin-left:66.6666666667%}.row .col.pull-l8{right:66.6666666667%}.row .col.push-l8{left:66.6666666667%}.row .col.offset-l9{margin-left:75%}.row .col.pull-l9{right:75%}.row .col.push-l9{left:75%}.row .col.offset-l10{margin-left:83.3333333333%}.row .col.pull-l10{right:83.3333333333%}.row .col.push-l10{left:83.3333333333%}.row .col.offset-l11{margin-left:91.6666666667%}.row .col.pull-l11{right:91.6666666667%}.row .col.push-l11{left:91.6666666667%}.row .col.offset-l12{margin-left:100%}.row .col.pull-l12{right:100%}.row .col.push-l12{left:100%}}nav{color:#fff;background-color:#ee6e73;width:100%;height:56px;line-height:56px}nav.nav-extended{height:auto}nav.nav-extended .nav-wrapper{min-height:56px;height:auto}nav.nav-extended .nav-content{position:relative;line-height:normal}nav a{color:#fff}nav i,nav [class^="mdi-"],nav [class*="mdi-"],nav i.material-icons{display:block;font-size:24px;height:56px;line-height:56px}nav .nav-wrapper{position:relative;height:100%}@media only screen and (min-width: 993px){nav a.button-collapse{display:none}}nav .button-collapse{float:left;position:relative;z-index:1;height:56px;margin:0 18px}nav .button-collapse i{height:56px;line-height:56px}nav .brand-logo{position:absolute;color:#fff;display:inline-block;font-size:2.1rem;padding:0;white-space:nowrap}nav .brand-logo.center{left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%)}@media only screen and (max-width: 992px){nav .brand-logo{left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%)}nav .brand-logo.left,nav .brand-logo.right{padding:0;-webkit-transform:none;transform:none}nav .brand-logo.left{left:0.5rem}nav .brand-logo.right{right:0.5rem;left:auto}}nav .brand-logo.right{right:0.5rem;padding:0}nav .brand-logo i,nav .brand-logo [class^="mdi-"],nav .brand-logo [class*="mdi-"],nav .brand-logo i.material-icons{float:left;margin-right:15px}nav .nav-title{display:inline-block;font-size:32px;padding:28px 0}nav ul{margin:0}nav ul li{transition:background-color .3s;float:left;padding:0}nav ul li.active{background-color:rgba(0,0,0,0.1)}nav ul a{transition:background-color .3s;font-size:1rem;color:#fff;display:block;padding:0 15px;cursor:pointer}nav ul a.btn,nav ul a.btn-large,nav ul a.btn-large,nav ul a.btn-flat,nav ul a.btn-floating{margin-top:-2px;margin-left:15px;margin-right:15px}nav ul a.btn>.material-icons,nav ul a.btn-large>.material-icons,nav ul a.btn-large>.material-icons,nav ul a.btn-flat>.material-icons,nav ul a.btn-floating>.material-icons{height:inherit;line-height:inherit}nav ul a:hover{background-color:rgba(0,0,0,0.1)}nav ul.left{float:left}nav form{height:100%}nav .input-field{margin:0;height:100%}nav .input-field input{height:100%;font-size:1.2rem;border:none;padding-left:2rem}nav .input-field input:focus,nav .input-field input[type=text]:valid,nav .input-field input[type=password]:valid,nav .input-field input[type=email]:valid,nav .input-field input[type=url]:valid,nav .input-field input[type=date]:valid{border:none;box-shadow:none}nav .input-field label{top:0;left:0}nav .input-field label i{color:rgba(255,255,255,0.7);transition:color .3s}nav .input-field label.active i{color:#fff}.navbar-fixed{position:relative;height:56px;z-index:997}.navbar-fixed nav{position:fixed}@media only screen and (min-width: 601px){nav.nav-extended .nav-wrapper{min-height:64px}nav,nav .nav-wrapper i,nav a.button-collapse,nav a.button-collapse i{height:64px;line-height:64px}.navbar-fixed{height:64px}}@font-face{font-family:"Roboto";src:local(Roboto Thin),url("../fonts/roboto/Roboto-Thin.eot");src:url("../fonts/roboto/Roboto-Thin.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Thin.woff2") format("woff2"),url("../fonts/roboto/Roboto-Thin.woff") format("woff"),url("../fonts/roboto/Roboto-Thin.ttf") format("truetype");font-weight:200}@font-face{font-family:"Roboto";src:local(Roboto Light),url("../fonts/roboto/Roboto-Light.eot");src:url("../fonts/roboto/Roboto-Light.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Light.woff2") format("woff2"),url("../fonts/roboto/Roboto-Light.woff") format("woff"),url("../fonts/roboto/Roboto-Light.ttf") format("truetype");font-weight:300}@font-face{font-family:"Roboto";src:local(Roboto Regular),url("../fonts/roboto/Roboto-Regular.eot");src:url("../fonts/roboto/Roboto-Regular.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Regular.woff2") format("woff2"),url("../fonts/roboto/Roboto-Regular.woff") format("woff"),url("../fonts/roboto/Roboto-Regular.ttf") format("truetype");font-weight:400}@font-face{font-family:"Roboto";src:url("../fonts/roboto/Roboto-Medium.eot");src:url("../fonts/roboto/Roboto-Medium.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Medium.woff2") format("woff2"),url("../fonts/roboto/Roboto-Medium.woff") format("woff"),url("../fonts/roboto/Roboto-Medium.ttf") format("truetype");font-weight:500}@font-face{font-family:"Roboto";src:url("../fonts/roboto/Roboto-Bold.eot");src:url("../fonts/roboto/Roboto-Bold.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Bold.woff2") format("woff2"),url("../fonts/roboto/Roboto-Bold.woff") format("woff"),url("../fonts/roboto/Roboto-Bold.ttf") format("truetype");font-weight:700}a{text-decoration:none}html{line-height:1.5;font-family:"Roboto", sans-serif;font-weight:normal;color:rgba(0,0,0,0.87)}@media only screen and (min-width: 0){html{font-size:14px}}@media only screen and (min-width: 992px){html{font-size:14.5px}}@media only screen and (min-width: 1200px){html{font-size:15px}}h1,h2,h3,h4,h5,h6{font-weight:400;line-height:1.1}h1 a,h2 a,h3 a,h4 a,h5 a,h6 a{font-weight:inherit}h1{font-size:4.2rem;line-height:110%;margin:2.1rem 0 1.68rem 0}h2{font-size:3.56rem;line-height:110%;margin:1.78rem 0 1.424rem 0}h3{font-size:2.92rem;line-height:110%;margin:1.46rem 0 1.168rem 0}h4{font-size:2.28rem;line-height:110%;margin:1.14rem 0 .912rem 0}h5{font-size:1.64rem;line-height:110%;margin:.82rem 0 .656rem 0}h6{font-size:1rem;line-height:110%;margin:.5rem 0 .4rem 0}em{font-style:italic}strong{font-weight:500}small{font-size:75%}.light,footer.page-footer .footer-copyright{font-weight:300}.thin{font-weight:200}.flow-text{font-weight:300}@media only screen and (min-width: 360px){.flow-text{font-size:1.2rem}}@media only screen and (min-width: 390px){.flow-text{font-size:1.224rem}}@media only screen and (min-width: 420px){.flow-text{font-size:1.248rem}}@media only screen and (min-width: 450px){.flow-text{font-size:1.272rem}}@media only screen and (min-width: 480px){.flow-text{font-size:1.296rem}}@media only screen and (min-width: 510px){.flow-text{font-size:1.32rem}}@media only screen and (min-width: 540px){.flow-text{font-size:1.344rem}}@media only screen and (min-width: 570px){.flow-text{font-size:1.368rem}}@media only screen and (min-width: 600px){.flow-text{font-size:1.392rem}}@media only screen and (min-width: 630px){.flow-text{font-size:1.416rem}}@media only screen and (min-width: 660px){.flow-text{font-size:1.44rem}}@media only screen and (min-width: 690px){.flow-text{font-size:1.464rem}}@media only screen and (min-width: 720px){.flow-text{font-size:1.488rem}}@media only screen and (min-width: 750px){.flow-text{font-size:1.512rem}}@media only screen and (min-width: 780px){.flow-text{font-size:1.536rem}}@media only screen and (min-width: 810px){.flow-text{font-size:1.56rem}}@media only screen and (min-width: 840px){.flow-text{font-size:1.584rem}}@media only screen and (min-width: 870px){.flow-text{font-size:1.608rem}}@media only screen and (min-width: 900px){.flow-text{font-size:1.632rem}}@media only screen and (min-width: 930px){.flow-text{font-size:1.656rem}}@media only screen and (min-width: 960px){.flow-text{font-size:1.68rem}}@media only screen and (max-width: 360px){.flow-text{font-size:1.2rem}}.scale-transition{transition:-webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;transition:transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;transition:transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63), -webkit-transform 0.3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important}.scale-transition.scale-out{-webkit-transform:scale(0);transform:scale(0);transition:-webkit-transform .2s !important;transition:transform .2s !important;transition:transform .2s, -webkit-transform .2s !important}.scale-transition.scale-in{-webkit-transform:scale(1);transform:scale(1)}.card-panel{transition:box-shadow .25s;padding:24px;margin:.5rem 0 1rem 0;border-radius:2px;background-color:#fff}.card{position:relative;margin:.5rem 0 1rem 0;background-color:#fff;transition:box-shadow .25s;border-radius:2px}.card .card-title{font-size:24px;font-weight:300}.card .card-title.activator{cursor:pointer}.card.small,.card.medium,.card.large{position:relative}.card.small .card-image,.card.medium .card-image,.card.large .card-image{max-height:60%;overflow:hidden}.card.small .card-image+.card-content,.card.medium .card-image+.card-content,.card.large .card-image+.card-content{max-height:40%}.card.small .card-content,.card.medium .card-content,.card.large .card-content{max-height:100%;overflow:hidden}.card.small .card-action,.card.medium .card-action,.card.large .card-action{position:absolute;bottom:0;left:0;right:0}.card.small{height:300px}.card.medium{height:400px}.card.large{height:500px}.card.horizontal{display:-webkit-flex;display:-ms-flexbox;display:flex}.card.horizontal.small .card-image,.card.horizontal.medium .card-image,.card.horizontal.large .card-image{height:100%;max-height:none;overflow:visible}.card.horizontal.small .card-image img,.card.horizontal.medium .card-image img,.card.horizontal.large .card-image img{height:100%}.card.horizontal .card-image{max-width:50%}.card.horizontal .card-image img{border-radius:2px 0 0 2px;max-width:100%;width:auto}.card.horizontal .card-stacked{display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-flex:1;-ms-flex:1;flex:1;position:relative}.card.horizontal .card-stacked .card-content{-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.card.sticky-action .card-action{z-index:2}.card.sticky-action .card-reveal{z-index:1;padding-bottom:64px}.card .card-image{position:relative}.card .card-image img{display:block;border-radius:2px 2px 0 0;position:relative;left:0;right:0;top:0;bottom:0;width:100%}.card .card-image .card-title{color:#fff;position:absolute;bottom:0;left:0;max-width:100%;padding:24px}.card .card-content{padding:24px;border-radius:0 0 2px 2px}.card .card-content p{margin:0;color:inherit}.card .card-content .card-title{display:block;line-height:32px;margin-bottom:8px}.card .card-content .card-title i{line-height:32px}.card .card-action{position:relative;background-color:inherit;border-top:1px solid rgba(160,160,160,0.2);padding:16px 24px}.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating){color:#ffab40;margin-right:24px;transition:color .3s ease;text-transform:uppercase}.card .card-action a:not(.btn):not(.btn-large):not(.btn-large):not(.btn-floating):hover{color:#ffd8a6}.card .card-reveal{padding:24px;position:absolute;background-color:#fff;width:100%;overflow-y:auto;left:0;top:100%;height:100%;z-index:3;display:none}.card .card-reveal .card-title{cursor:pointer;display:block}#toast-container{display:block;position:fixed;z-index:10000}@media only screen and (max-width: 600px){#toast-container{min-width:100%;bottom:0%}}@media only screen and (min-width: 601px) and (max-width: 992px){#toast-container{left:5%;bottom:7%;max-width:90%}}@media only screen and (min-width: 993px){#toast-container{top:10%;right:7%;max-width:86%}}.toast{border-radius:2px;top:35px;width:auto;clear:both;margin-top:10px;position:relative;max-width:100%;height:auto;min-height:48px;line-height:1.5em;word-break:break-all;background-color:#323232;padding:10px 25px;font-size:1.1rem;font-weight:300;color:#fff;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between}.toast .btn,.toast .btn-large,.toast .btn-flat{margin:0;margin-left:3rem}.toast.rounded{border-radius:24px}@media only screen and (max-width: 600px){.toast{width:100%;border-radius:0}}@media only screen and (min-width: 601px) and (max-width: 992px){.toast{float:left}}@media only screen and (min-width: 993px){.toast{float:right}}.tabs{position:relative;overflow-x:auto;overflow-y:hidden;height:48px;width:100%;background-color:#fff;margin:0 auto;white-space:nowrap}.tabs.tabs-transparent{background-color:transparent}.tabs.tabs-transparent .tab a,.tabs.tabs-transparent .tab.disabled a,.tabs.tabs-transparent .tab.disabled a:hover{color:rgba(255,255,255,0.7)}.tabs.tabs-transparent .tab a:hover,.tabs.tabs-transparent .tab a.active{color:#fff}.tabs.tabs-transparent .indicator{background-color:#fff}.tabs.tabs-fixed-width{display:-webkit-flex;display:-ms-flexbox;display:flex}.tabs.tabs-fixed-width .tab{-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.tabs .tab{display:inline-block;text-align:center;line-height:48px;height:48px;padding:0;margin:0;text-transform:uppercase}.tabs .tab a{color:rgba(238,110,115,0.7);display:block;width:100%;height:100%;padding:0 24px;font-size:14px;text-overflow:ellipsis;overflow:hidden;transition:color .28s ease}.tabs .tab a:hover,.tabs .tab a.active{background-color:transparent;color:#ee6e73}.tabs .tab.disabled a,.tabs .tab.disabled a:hover{color:rgba(238,110,115,0.7);cursor:default}.tabs .indicator{position:absolute;bottom:0;height:2px;background-color:#f6b2b5;will-change:left, right}@media only screen and (max-width: 992px){.tabs{display:-webkit-flex;display:-ms-flexbox;display:flex}.tabs .tab{-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.tabs .tab a{padding:0 12px}}.material-tooltip{padding:10px 8px;font-size:1rem;z-index:2000;background-color:transparent;border-radius:2px;color:#fff;min-height:36px;line-height:120%;opacity:0;position:absolute;text-align:center;max-width:calc(100% - 4px);overflow:hidden;left:0;top:0;pointer-events:none;visibility:hidden}.backdrop{position:absolute;opacity:0;height:7px;width:14px;border-radius:0 0 50% 50%;background-color:#323232;z-index:-1;-webkit-transform-origin:50% 0%;transform-origin:50% 0%;visibility:hidden}.btn,.btn-large,.btn-flat{border:none;border-radius:2px;display:inline-block;height:36px;line-height:36px;padding:0 2rem;text-transform:uppercase;vertical-align:middle;-webkit-tap-highlight-color:transparent}.btn.disabled,.disabled.btn-large,.btn-floating.disabled,.btn-large.disabled,.btn-flat.disabled,.btn:disabled,.btn-large:disabled,.btn-floating:disabled,.btn-large:disabled,.btn-flat:disabled,.btn[disabled],[disabled].btn-large,.btn-floating[disabled],.btn-large[disabled],.btn-flat[disabled]{pointer-events:none;background-color:#DFDFDF !important;box-shadow:none;color:#9F9F9F !important;cursor:default}.btn.disabled:hover,.disabled.btn-large:hover,.btn-floating.disabled:hover,.btn-large.disabled:hover,.btn-flat.disabled:hover,.btn:disabled:hover,.btn-large:disabled:hover,.btn-floating:disabled:hover,.btn-large:disabled:hover,.btn-flat:disabled:hover,.btn[disabled]:hover,[disabled].btn-large:hover,.btn-floating[disabled]:hover,.btn-large[disabled]:hover,.btn-flat[disabled]:hover{background-color:#DFDFDF !important;color:#9F9F9F !important}.btn,.btn-large,.btn-floating,.btn-large,.btn-flat{outline:0}.btn i,.btn-large i,.btn-floating i,.btn-large i,.btn-flat i{font-size:1.3rem;line-height:inherit}.btn:focus,.btn-large:focus,.btn-floating:focus{background-color:#1d7d74}.btn,.btn-large{text-decoration:none;color:#fff;background-color:#26a69a;text-align:center;letter-spacing:.5px;transition:.2s ease-out;cursor:pointer}.btn:hover,.btn-large:hover{background-color:#2bbbad}.btn-floating{display:inline-block;color:#fff;position:relative;overflow:hidden;z-index:1;width:40px;height:40px;line-height:40px;padding:0;background-color:#26a69a;border-radius:50%;transition:.3s;cursor:pointer;vertical-align:middle}.btn-floating:hover{background-color:#26a69a}.btn-floating:before{border-radius:0}.btn-floating.btn-large{width:56px;height:56px}.btn-floating.btn-large i{line-height:56px}.btn-floating.halfway-fab{position:absolute;right:24px;bottom:0;-webkit-transform:translateY(50%);transform:translateY(50%)}.btn-floating.halfway-fab.left{right:auto;left:24px}.btn-floating i{width:inherit;display:inline-block;text-align:center;color:#fff;font-size:1.6rem;line-height:40px}button.btn-floating{border:none}.fixed-action-btn{position:fixed;right:23px;bottom:23px;padding-top:15px;margin-bottom:0;z-index:998}.fixed-action-btn.active ul{visibility:visible}.fixed-action-btn.horizontal{padding:0 0 0 15px}.fixed-action-btn.horizontal ul{text-align:right;right:64px;top:50%;-webkit-transform:translateY(-50%);transform:translateY(-50%);height:100%;left:auto;width:500px}.fixed-action-btn.horizontal ul li{display:inline-block;margin:15px 15px 0 0}.fixed-action-btn.toolbar{padding:0;height:56px}.fixed-action-btn.toolbar.active>a i{opacity:0}.fixed-action-btn.toolbar ul{display:-webkit-flex;display:-ms-flexbox;display:flex;top:0;bottom:0}.fixed-action-btn.toolbar ul li{-webkit-flex:1;-ms-flex:1;flex:1;display:inline-block;margin:0;height:100%;transition:none}.fixed-action-btn.toolbar ul li a{display:block;overflow:hidden;position:relative;width:100%;height:100%;background-color:transparent;box-shadow:none;color:#fff;line-height:56px;z-index:1}.fixed-action-btn.toolbar ul li a i{line-height:inherit}.fixed-action-btn ul{left:0;right:0;text-align:center;position:absolute;bottom:64px;margin:0;visibility:hidden}.fixed-action-btn ul li{margin-bottom:15px}.fixed-action-btn ul a.btn-floating{opacity:0}.fixed-action-btn .fab-backdrop{position:absolute;top:0;left:0;z-index:-1;width:40px;height:40px;background-color:#26a69a;border-radius:50%;-webkit-transform:scale(0);transform:scale(0)}.btn-flat{box-shadow:none;background-color:transparent;color:#343434;cursor:pointer;transition:background-color .2s}.btn-flat:focus,.btn-flat:active{background-color:transparent}.btn-flat:focus,.btn-flat:hover{background-color:rgba(0,0,0,0.1);box-shadow:none}.btn-flat:active{background-color:rgba(0,0,0,0.2)}.btn-flat.disabled{background-color:transparent !important;color:#b3b3b3 !important;cursor:default}.btn-large{height:54px;line-height:54px}.btn-large i{font-size:1.6rem}.btn-block{display:block}.dropdown-content{background-color:#fff;margin:0;display:none;min-width:100px;max-height:650px;overflow-y:auto;opacity:0;position:absolute;z-index:999;will-change:width, height}.dropdown-content li{clear:both;color:rgba(0,0,0,0.87);cursor:pointer;min-height:50px;line-height:1.5rem;width:100%;text-align:left;text-transform:none}.dropdown-content li:hover,.dropdown-content li.active,.dropdown-content li.selected{background-color:#eee}.dropdown-content li.active.selected{background-color:#e1e1e1}.dropdown-content li.divider{min-height:0;height:1px}.dropdown-content li>a,.dropdown-content li>span{font-size:16px;color:#26a69a;display:block;line-height:22px;padding:14px 16px}.dropdown-content li>span>label{top:1px;left:0;height:18px}.dropdown-content li>a>i{height:inherit;line-height:inherit}.input-field.col .dropdown-content [type="checkbox"]+label{top:1px;left:0;height:18px}/*! + * Waves v0.6.0 + * http://fian.my.id/Waves + * + * Copyright 2014 Alfiana E. Sibuea and other contributors + * Released under the MIT license + * https://github.com/fians/Waves/blob/master/LICENSE + */.waves-effect{position:relative;cursor:pointer;display:inline-block;overflow:hidden;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;-webkit-tap-highlight-color:transparent;vertical-align:middle;z-index:1;transition:.3s ease-out}.waves-effect .waves-ripple{position:absolute;border-radius:50%;width:20px;height:20px;margin-top:-10px;margin-left:-10px;opacity:0;background:rgba(0,0,0,0.2);transition:all 0.7s ease-out;transition-property:opacity, -webkit-transform;transition-property:transform, opacity;transition-property:transform, opacity, -webkit-transform;-webkit-transform:scale(0);transform:scale(0);pointer-events:none}.waves-effect.waves-light .waves-ripple{background-color:rgba(255,255,255,0.45)}.waves-effect.waves-red .waves-ripple{background-color:rgba(244,67,54,0.7)}.waves-effect.waves-yellow .waves-ripple{background-color:rgba(255,235,59,0.7)}.waves-effect.waves-orange .waves-ripple{background-color:rgba(255,152,0,0.7)}.waves-effect.waves-purple .waves-ripple{background-color:rgba(156,39,176,0.7)}.waves-effect.waves-green .waves-ripple{background-color:rgba(76,175,80,0.7)}.waves-effect.waves-teal .waves-ripple{background-color:rgba(0,150,136,0.7)}.waves-effect input[type="button"],.waves-effect input[type="reset"],.waves-effect input[type="submit"]{border:0;font-style:normal;font-size:inherit;text-transform:inherit;background:none}.waves-effect img{position:relative;z-index:-1}.waves-notransition{transition:none !important}.waves-circle{-webkit-transform:translateZ(0);transform:translateZ(0);-webkit-mask-image:-webkit-radial-gradient(circle, #fff 100%, #000 100%)}.waves-input-wrapper{border-radius:0.2em;vertical-align:bottom}.waves-input-wrapper .waves-button-input{position:relative;top:0;left:0;z-index:1}.waves-circle{text-align:center;width:2.5em;height:2.5em;line-height:2.5em;border-radius:50%;-webkit-mask-image:none}.waves-block{display:block}.waves-effect .waves-ripple{z-index:-1}.modal{display:none;position:fixed;left:0;right:0;background-color:#fafafa;padding:0;max-height:70%;width:55%;margin:auto;overflow-y:auto;border-radius:2px;will-change:top, opacity}@media only screen and (max-width: 992px){.modal{width:80%}}.modal h1,.modal h2,.modal h3,.modal h4{margin-top:0}.modal .modal-content{padding:24px}.modal .modal-close{cursor:pointer}.modal .modal-footer{border-radius:0 0 2px 2px;background-color:#fafafa;padding:4px 6px;height:56px;width:100%}.modal .modal-footer .btn,.modal .modal-footer .btn-large,.modal .modal-footer .btn-flat{float:right;margin:6px 0}.modal-overlay{position:fixed;z-index:999;top:-100px;left:0;bottom:0;right:0;height:125%;width:100%;background:#000;display:none;will-change:opacity}.modal.modal-fixed-footer{padding:0;height:70%}.modal.modal-fixed-footer .modal-content{position:absolute;height:calc(100% - 56px);max-height:100%;width:100%;overflow-y:auto}.modal.modal-fixed-footer .modal-footer{border-top:1px solid rgba(0,0,0,0.1);position:absolute;bottom:0}.modal.bottom-sheet{top:auto;bottom:-100%;margin:0;width:100%;max-height:45%;border-radius:0;will-change:bottom, opacity}.collapsible{border-top:1px solid #ddd;border-right:1px solid #ddd;border-left:1px solid #ddd;margin:.5rem 0 1rem 0}.collapsible-header{display:block;cursor:pointer;min-height:3rem;line-height:3rem;padding:0 1rem;background-color:#fff;border-bottom:1px solid #ddd}.collapsible-header i{width:2rem;font-size:1.6rem;line-height:3rem;display:block;float:left;text-align:center;margin-right:1rem}.collapsible-body{display:none;border-bottom:1px solid #ddd;box-sizing:border-box;padding:2rem}.side-nav .collapsible,.side-nav.fixed .collapsible{border:none;box-shadow:none}.side-nav .collapsible li,.side-nav.fixed .collapsible li{padding:0}.side-nav .collapsible-header,.side-nav.fixed .collapsible-header{background-color:transparent;border:none;line-height:inherit;height:inherit;padding:0 16px}.side-nav .collapsible-header:hover,.side-nav.fixed .collapsible-header:hover{background-color:rgba(0,0,0,0.05)}.side-nav .collapsible-header i,.side-nav.fixed .collapsible-header i{line-height:inherit}.side-nav .collapsible-body,.side-nav.fixed .collapsible-body{border:0;background-color:#fff}.side-nav .collapsible-body li a,.side-nav.fixed .collapsible-body li a{padding:0 23.5px 0 31px}.collapsible.popout{border:none;box-shadow:none}.collapsible.popout>li{box-shadow:0 2px 5px 0 rgba(0,0,0,0.16),0 2px 10px 0 rgba(0,0,0,0.12);margin:0 24px;transition:margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94)}.collapsible.popout>li.active{box-shadow:0 5px 11px 0 rgba(0,0,0,0.18),0 4px 15px 0 rgba(0,0,0,0.15);margin:16px 0}.chip{display:inline-block;height:32px;font-size:13px;font-weight:500;color:rgba(0,0,0,0.6);line-height:32px;padding:0 12px;border-radius:16px;background-color:#e4e4e4;margin-bottom:5px;margin-right:5px}.chip img{float:left;margin:0 8px 0 -12px;height:32px;width:32px;border-radius:50%}.chip .close{cursor:pointer;float:right;font-size:16px;line-height:32px;padding-left:8px}.chips{border:none;border-bottom:1px solid #9e9e9e;box-shadow:none;margin:0 0 20px 0;min-height:45px;outline:none;transition:all .3s}.chips.focus{border-bottom:1px solid #26a69a;box-shadow:0 1px 0 0 #26a69a}.chips:hover{cursor:text}.chips .chip.selected{background-color:#26a69a;color:#fff}.chips .input{background:none;border:0;color:rgba(0,0,0,0.6);display:inline-block;font-size:1rem;height:3rem;line-height:32px;outline:0;margin:0;padding:0 !important;width:120px !important}.chips .input:focus{border:0 !important;box-shadow:none !important}.prefix ~ .chips{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.chips:empty ~ label{font-size:0.8rem;-webkit-transform:translateY(-140%);transform:translateY(-140%)}.materialboxed{display:block;cursor:-webkit-zoom-in;cursor:zoom-in;position:relative;transition:opacity .4s;-webkit-backface-visibility:hidden}.materialboxed:hover:not(.active){opacity:.8}.materialboxed.active{cursor:-webkit-zoom-out;cursor:zoom-out}#materialbox-overlay{position:fixed;top:0;right:0;bottom:0;left:0;background-color:#292929;z-index:1000;will-change:opacity}.materialbox-caption{position:fixed;display:none;color:#fff;line-height:50px;bottom:0;left:0;width:100%;text-align:center;padding:0% 15%;height:50px;z-index:1000;-webkit-font-smoothing:antialiased}select:focus{outline:1px solid #c9f3ef}button:focus{outline:none;background-color:#2ab7a9}label{font-size:.8rem;color:#9e9e9e}::-webkit-input-placeholder{color:#d1d1d1}:-moz-placeholder{color:#d1d1d1}::-moz-placeholder{color:#d1d1d1}:-ms-input-placeholder{color:#d1d1d1}input:not([type]),input[type=text],input[type=password],input[type=email],input[type=url],input[type=time],input[type=date],input[type=datetime],input[type=datetime-local],input[type=tel],input[type=number],input[type=search],textarea.materialize-textarea{background-color:transparent;border:none;border-bottom:1px solid #9e9e9e;border-radius:0;outline:none;height:3rem;width:100%;font-size:1rem;margin:0 0 20px 0;padding:0;box-shadow:none;box-sizing:content-box;transition:all 0.3s}input:not([type]):disabled,input:not([type])[readonly="readonly"],input[type=text]:disabled,input[type=text][readonly="readonly"],input[type=password]:disabled,input[type=password][readonly="readonly"],input[type=email]:disabled,input[type=email][readonly="readonly"],input[type=url]:disabled,input[type=url][readonly="readonly"],input[type=time]:disabled,input[type=time][readonly="readonly"],input[type=date]:disabled,input[type=date][readonly="readonly"],input[type=datetime]:disabled,input[type=datetime][readonly="readonly"],input[type=datetime-local]:disabled,input[type=datetime-local][readonly="readonly"],input[type=tel]:disabled,input[type=tel][readonly="readonly"],input[type=number]:disabled,input[type=number][readonly="readonly"],input[type=search]:disabled,input[type=search][readonly="readonly"],textarea.materialize-textarea:disabled,textarea.materialize-textarea[readonly="readonly"]{color:rgba(0,0,0,0.26);border-bottom:1px dotted rgba(0,0,0,0.26)}input:not([type]):disabled+label,input:not([type])[readonly="readonly"]+label,input[type=text]:disabled+label,input[type=text][readonly="readonly"]+label,input[type=password]:disabled+label,input[type=password][readonly="readonly"]+label,input[type=email]:disabled+label,input[type=email][readonly="readonly"]+label,input[type=url]:disabled+label,input[type=url][readonly="readonly"]+label,input[type=time]:disabled+label,input[type=time][readonly="readonly"]+label,input[type=date]:disabled+label,input[type=date][readonly="readonly"]+label,input[type=datetime]:disabled+label,input[type=datetime][readonly="readonly"]+label,input[type=datetime-local]:disabled+label,input[type=datetime-local][readonly="readonly"]+label,input[type=tel]:disabled+label,input[type=tel][readonly="readonly"]+label,input[type=number]:disabled+label,input[type=number][readonly="readonly"]+label,input[type=search]:disabled+label,input[type=search][readonly="readonly"]+label,textarea.materialize-textarea:disabled+label,textarea.materialize-textarea[readonly="readonly"]+label{color:rgba(0,0,0,0.26)}input:not([type]):focus:not([readonly]),input[type=text]:focus:not([readonly]),input[type=password]:focus:not([readonly]),input[type=email]:focus:not([readonly]),input[type=url]:focus:not([readonly]),input[type=time]:focus:not([readonly]),input[type=date]:focus:not([readonly]),input[type=datetime]:focus:not([readonly]),input[type=datetime-local]:focus:not([readonly]),input[type=tel]:focus:not([readonly]),input[type=number]:focus:not([readonly]),input[type=search]:focus:not([readonly]),textarea.materialize-textarea:focus:not([readonly]){border-bottom:1px solid #26a69a;box-shadow:0 1px 0 0 #26a69a}input:not([type]):focus:not([readonly])+label,input[type=text]:focus:not([readonly])+label,input[type=password]:focus:not([readonly])+label,input[type=email]:focus:not([readonly])+label,input[type=url]:focus:not([readonly])+label,input[type=time]:focus:not([readonly])+label,input[type=date]:focus:not([readonly])+label,input[type=datetime]:focus:not([readonly])+label,input[type=datetime-local]:focus:not([readonly])+label,input[type=tel]:focus:not([readonly])+label,input[type=number]:focus:not([readonly])+label,input[type=search]:focus:not([readonly])+label,textarea.materialize-textarea:focus:not([readonly])+label{color:#26a69a}input:not([type]).valid,input:not([type]):focus.valid,input[type=text].valid,input[type=text]:focus.valid,input[type=password].valid,input[type=password]:focus.valid,input[type=email].valid,input[type=email]:focus.valid,input[type=url].valid,input[type=url]:focus.valid,input[type=time].valid,input[type=time]:focus.valid,input[type=date].valid,input[type=date]:focus.valid,input[type=datetime].valid,input[type=datetime]:focus.valid,input[type=datetime-local].valid,input[type=datetime-local]:focus.valid,input[type=tel].valid,input[type=tel]:focus.valid,input[type=number].valid,input[type=number]:focus.valid,input[type=search].valid,input[type=search]:focus.valid,textarea.materialize-textarea.valid,textarea.materialize-textarea:focus.valid{border-bottom:1px solid #4CAF50;box-shadow:0 1px 0 0 #4CAF50}input:not([type]).valid+label:after,input:not([type]):focus.valid+label:after,input[type=text].valid+label:after,input[type=text]:focus.valid+label:after,input[type=password].valid+label:after,input[type=password]:focus.valid+label:after,input[type=email].valid+label:after,input[type=email]:focus.valid+label:after,input[type=url].valid+label:after,input[type=url]:focus.valid+label:after,input[type=time].valid+label:after,input[type=time]:focus.valid+label:after,input[type=date].valid+label:after,input[type=date]:focus.valid+label:after,input[type=datetime].valid+label:after,input[type=datetime]:focus.valid+label:after,input[type=datetime-local].valid+label:after,input[type=datetime-local]:focus.valid+label:after,input[type=tel].valid+label:after,input[type=tel]:focus.valid+label:after,input[type=number].valid+label:after,input[type=number]:focus.valid+label:after,input[type=search].valid+label:after,input[type=search]:focus.valid+label:after,textarea.materialize-textarea.valid+label:after,textarea.materialize-textarea:focus.valid+label:after{content:attr(data-success);color:#4CAF50;opacity:1}input:not([type]).invalid,input:not([type]):focus.invalid,input[type=text].invalid,input[type=text]:focus.invalid,input[type=password].invalid,input[type=password]:focus.invalid,input[type=email].invalid,input[type=email]:focus.invalid,input[type=url].invalid,input[type=url]:focus.invalid,input[type=time].invalid,input[type=time]:focus.invalid,input[type=date].invalid,input[type=date]:focus.invalid,input[type=datetime].invalid,input[type=datetime]:focus.invalid,input[type=datetime-local].invalid,input[type=datetime-local]:focus.invalid,input[type=tel].invalid,input[type=tel]:focus.invalid,input[type=number].invalid,input[type=number]:focus.invalid,input[type=search].invalid,input[type=search]:focus.invalid,textarea.materialize-textarea.invalid,textarea.materialize-textarea:focus.invalid{border-bottom:1px solid #F44336;box-shadow:0 1px 0 0 #F44336}input:not([type]).invalid+label:after,input:not([type]):focus.invalid+label:after,input[type=text].invalid+label:after,input[type=text]:focus.invalid+label:after,input[type=password].invalid+label:after,input[type=password]:focus.invalid+label:after,input[type=email].invalid+label:after,input[type=email]:focus.invalid+label:after,input[type=url].invalid+label:after,input[type=url]:focus.invalid+label:after,input[type=time].invalid+label:after,input[type=time]:focus.invalid+label:after,input[type=date].invalid+label:after,input[type=date]:focus.invalid+label:after,input[type=datetime].invalid+label:after,input[type=datetime]:focus.invalid+label:after,input[type=datetime-local].invalid+label:after,input[type=datetime-local]:focus.invalid+label:after,input[type=tel].invalid+label:after,input[type=tel]:focus.invalid+label:after,input[type=number].invalid+label:after,input[type=number]:focus.invalid+label:after,input[type=search].invalid+label:after,input[type=search]:focus.invalid+label:after,textarea.materialize-textarea.invalid+label:after,textarea.materialize-textarea:focus.invalid+label:after{content:attr(data-error);color:#F44336;opacity:1}input:not([type]).validate+label,input[type=text].validate+label,input[type=password].validate+label,input[type=email].validate+label,input[type=url].validate+label,input[type=time].validate+label,input[type=date].validate+label,input[type=datetime].validate+label,input[type=datetime-local].validate+label,input[type=tel].validate+label,input[type=number].validate+label,input[type=search].validate+label,textarea.materialize-textarea.validate+label{width:100%;pointer-events:none}input:not([type])+label:after,input[type=text]+label:after,input[type=password]+label:after,input[type=email]+label:after,input[type=url]+label:after,input[type=time]+label:after,input[type=date]+label:after,input[type=datetime]+label:after,input[type=datetime-local]+label:after,input[type=tel]+label:after,input[type=number]+label:after,input[type=search]+label:after,textarea.materialize-textarea+label:after{display:block;content:"";position:absolute;top:60px;opacity:0;transition:.2s opacity ease-out, .2s color ease-out}.input-field{position:relative;margin-top:1rem}.input-field.inline{display:inline-block;vertical-align:middle;margin-left:5px}.input-field.inline input,.input-field.inline .select-dropdown{margin-bottom:1rem}.input-field.col label{left:.75rem}.input-field.col .prefix ~ label,.input-field.col .prefix ~ .validate ~ label{width:calc(100% - 3rem - 1.5rem)}.input-field label{color:#9e9e9e;position:absolute;top:0.8rem;left:0;font-size:1rem;cursor:text;transition:.2s ease-out}.input-field label:not(.label-icon).active{font-size:.8rem;-webkit-transform:translateY(-140%);transform:translateY(-140%)}.input-field .prefix{position:absolute;width:3rem;font-size:2rem;transition:color .2s}.input-field .prefix.active{color:#26a69a}.input-field .prefix ~ input,.input-field .prefix ~ textarea,.input-field .prefix ~ label,.input-field .prefix ~ .validate ~ label,.input-field .prefix ~ .autocomplete-content{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.input-field .prefix ~ label{margin-left:3rem}@media only screen and (max-width: 992px){.input-field .prefix ~ input{width:86%;width:calc(100% - 3rem)}}@media only screen and (max-width: 600px){.input-field .prefix ~ input{width:80%;width:calc(100% - 3rem)}}.input-field input[type=search]{display:block;line-height:inherit;padding-left:4rem;width:calc(100% - 4rem)}.input-field input[type=search]:focus{background-color:#fff;border:0;box-shadow:none;color:#444}.input-field input[type=search]:focus+label i,.input-field input[type=search]:focus ~ .mdi-navigation-close,.input-field input[type=search]:focus ~ .material-icons{color:#444}.input-field input[type=search]+label{left:1rem}.input-field input[type=search] ~ .mdi-navigation-close,.input-field input[type=search] ~ .material-icons{position:absolute;top:0;right:1rem;color:transparent;cursor:pointer;font-size:2rem;transition:.3s color}textarea{width:100%;height:3rem;background-color:transparent}textarea.materialize-textarea{overflow-y:hidden;padding:.8rem 0 1.6rem 0;resize:none;min-height:3rem}.hiddendiv{display:none;white-space:pre-wrap;word-wrap:break-word;overflow-wrap:break-word;padding-top:1.2rem}.autocomplete-content{margin-top:-15px;display:block;opacity:1;position:static}.autocomplete-content li .highlight{color:#444}.autocomplete-content li img{height:40px;width:40px;margin:5px 15px}[type="radio"]:not(:checked),[type="radio"]:checked{position:absolute;left:-9999px;opacity:0}[type="radio"]:not(:checked)+label,[type="radio"]:checked+label{position:relative;padding-left:35px;cursor:pointer;display:inline-block;height:25px;line-height:25px;font-size:1rem;transition:.28s ease;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}[type="radio"]+label:before,[type="radio"]+label:after{content:'';position:absolute;left:0;top:0;margin:4px;width:16px;height:16px;z-index:0;transition:.28s ease}[type="radio"]:not(:checked)+label:before,[type="radio"]:not(:checked)+label:after,[type="radio"]:checked+label:before,[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:before,[type="radio"].with-gap:checked+label:after{border-radius:50%}[type="radio"]:not(:checked)+label:before,[type="radio"]:not(:checked)+label:after{border:2px solid #5a5a5a}[type="radio"]:not(:checked)+label:after{-webkit-transform:scale(0);transform:scale(0)}[type="radio"]:checked+label:before{border:2px solid transparent}[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:before,[type="radio"].with-gap:checked+label:after{border:2px solid #26a69a}[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:after{background-color:#26a69a}[type="radio"]:checked+label:after{-webkit-transform:scale(1.02);transform:scale(1.02)}[type="radio"].with-gap:checked+label:after{-webkit-transform:scale(0.5);transform:scale(0.5)}[type="radio"].tabbed:focus+label:before{box-shadow:0 0 0 10px rgba(0,0,0,0.1)}[type="radio"].with-gap:disabled:checked+label:before{border:2px solid rgba(0,0,0,0.26)}[type="radio"].with-gap:disabled:checked+label:after{border:none;background-color:rgba(0,0,0,0.26)}[type="radio"]:disabled:not(:checked)+label:before,[type="radio"]:disabled:checked+label:before{background-color:transparent;border-color:rgba(0,0,0,0.26)}[type="radio"]:disabled+label{color:rgba(0,0,0,0.26)}[type="radio"]:disabled:not(:checked)+label:before{border-color:rgba(0,0,0,0.26)}[type="radio"]:disabled:checked+label:after{background-color:rgba(0,0,0,0.26);border-color:#BDBDBD}form p{margin-bottom:10px;text-align:left}form p:last-child{margin-bottom:0}[type="checkbox"]:not(:checked),[type="checkbox"]:checked{position:absolute;left:-9999px;opacity:0}[type="checkbox"]+label{position:relative;padding-left:35px;cursor:pointer;display:inline-block;height:25px;line-height:25px;font-size:1rem;-webkit-user-select:none;-moz-user-select:none;-khtml-user-select:none;-ms-user-select:none}[type="checkbox"]+label:before,[type="checkbox"]:not(.filled-in)+label:after{content:'';position:absolute;top:0;left:0;width:18px;height:18px;z-index:0;border:2px solid #5a5a5a;border-radius:1px;margin-top:2px;transition:.2s}[type="checkbox"]:not(.filled-in)+label:after{border:0;-webkit-transform:scale(0);transform:scale(0)}[type="checkbox"]:not(:checked):disabled+label:before{border:none;background-color:rgba(0,0,0,0.26)}[type="checkbox"].tabbed:focus+label:after{-webkit-transform:scale(1);transform:scale(1);border:0;border-radius:50%;box-shadow:0 0 0 10px rgba(0,0,0,0.1);background-color:rgba(0,0,0,0.1)}[type="checkbox"]:checked+label:before{top:-4px;left:-5px;width:12px;height:22px;border-top:2px solid transparent;border-left:2px solid transparent;border-right:2px solid #26a69a;border-bottom:2px solid #26a69a;-webkit-transform:rotate(40deg);transform:rotate(40deg);-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"]:checked:disabled+label:before{border-right:2px solid rgba(0,0,0,0.26);border-bottom:2px solid rgba(0,0,0,0.26)}[type="checkbox"]:indeterminate+label:before{top:-11px;left:-12px;width:10px;height:22px;border-top:none;border-left:none;border-right:2px solid #26a69a;border-bottom:none;-webkit-transform:rotate(90deg);transform:rotate(90deg);-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"]:indeterminate:disabled+label:before{border-right:2px solid rgba(0,0,0,0.26);background-color:transparent}[type="checkbox"].filled-in+label:after{border-radius:2px}[type="checkbox"].filled-in+label:before,[type="checkbox"].filled-in+label:after{content:'';left:0;position:absolute;transition:border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;z-index:1}[type="checkbox"].filled-in:not(:checked)+label:before{width:0;height:0;border:3px solid transparent;left:6px;top:10px;-webkit-transform:rotateZ(37deg);transform:rotateZ(37deg);-webkit-transform-origin:20% 40%;transform-origin:100% 100%}[type="checkbox"].filled-in:not(:checked)+label:after{height:20px;width:20px;background-color:transparent;border:2px solid #5a5a5a;top:0px;z-index:0}[type="checkbox"].filled-in:checked+label:before{top:0;left:1px;width:8px;height:13px;border-top:2px solid transparent;border-left:2px solid transparent;border-right:2px solid #fff;border-bottom:2px solid #fff;-webkit-transform:rotateZ(37deg);transform:rotateZ(37deg);-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"].filled-in:checked+label:after{top:0;width:20px;height:20px;border:2px solid #26a69a;background-color:#26a69a;z-index:0}[type="checkbox"].filled-in.tabbed:focus+label:after{border-radius:2px;border-color:#5a5a5a;background-color:rgba(0,0,0,0.1)}[type="checkbox"].filled-in.tabbed:checked:focus+label:after{border-radius:2px;background-color:#26a69a;border-color:#26a69a}[type="checkbox"].filled-in:disabled:not(:checked)+label:before{background-color:transparent;border:2px solid transparent}[type="checkbox"].filled-in:disabled:not(:checked)+label:after{border-color:transparent;background-color:#BDBDBD}[type="checkbox"].filled-in:disabled:checked+label:before{background-color:transparent}[type="checkbox"].filled-in:disabled:checked+label:after{background-color:#BDBDBD;border-color:#BDBDBD}.switch,.switch *{-webkit-user-select:none;-moz-user-select:none;-khtml-user-select:none;-ms-user-select:none}.switch label{cursor:pointer}.switch label input[type=checkbox]{opacity:0;width:0;height:0}.switch label input[type=checkbox]:checked+.lever{background-color:#84c7c1}.switch label input[type=checkbox]:checked+.lever:after{background-color:#26a69a;left:24px}.switch label .lever{content:"";display:inline-block;position:relative;width:40px;height:15px;background-color:#818181;border-radius:15px;margin-right:10px;transition:background 0.3s ease;vertical-align:middle;margin:0 16px}.switch label .lever:after{content:"";position:absolute;display:inline-block;width:21px;height:21px;background-color:#F1F1F1;border-radius:21px;box-shadow:0 1px 3px 1px rgba(0,0,0,0.4);left:-5px;top:-3px;transition:left 0.3s ease, background .3s ease, box-shadow 0.1s ease}input[type=checkbox]:checked:not(:disabled) ~ .lever:active::after,input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::after{box-shadow:0 1px 3px 1px rgba(0,0,0,0.4),0 0 0 15px rgba(38,166,154,0.1)}input[type=checkbox]:not(:disabled) ~ .lever:active:after,input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::after{box-shadow:0 1px 3px 1px rgba(0,0,0,0.4),0 0 0 15px rgba(0,0,0,0.08)}.switch input[type=checkbox][disabled]+.lever{cursor:default}.switch label input[type=checkbox][disabled]+.lever:after,.switch label input[type=checkbox][disabled]:checked+.lever:after{background-color:#BDBDBD}select{display:none}select.browser-default{display:block}select{background-color:rgba(255,255,255,0.9);width:100%;padding:5px;border:1px solid #f2f2f2;border-radius:2px;height:3rem}.select-label{position:absolute}.select-wrapper{position:relative}.select-wrapper input.select-dropdown{position:relative;cursor:pointer;background-color:transparent;border:none;border-bottom:1px solid #9e9e9e;outline:none;height:3rem;line-height:3rem;width:100%;font-size:1rem;margin:0 0 20px 0;padding:0;display:block}.select-wrapper span.caret{color:initial;position:absolute;right:0;top:0;bottom:0;height:10px;margin:auto 0;font-size:10px;line-height:10px}.select-wrapper span.caret.disabled{color:rgba(0,0,0,0.26)}.select-wrapper+label{position:absolute;top:-14px;font-size:.8rem}select:disabled{color:rgba(0,0,0,0.3)}.select-wrapper input.select-dropdown:disabled{color:rgba(0,0,0,0.3);cursor:default;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;border-bottom:1px solid rgba(0,0,0,0.3)}.select-wrapper i{color:rgba(0,0,0,0.3)}.select-dropdown li.disabled,.select-dropdown li.disabled>span,.select-dropdown li.optgroup{color:rgba(0,0,0,0.3);background-color:transparent}.prefix ~ .select-wrapper{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.prefix ~ label{margin-left:3rem}.select-dropdown li img{height:40px;width:40px;margin:5px 15px;float:right}.select-dropdown li.optgroup{border-top:1px solid #eee}.select-dropdown li.optgroup.selected>span{color:rgba(0,0,0,0.7)}.select-dropdown li.optgroup>span{color:rgba(0,0,0,0.4)}.select-dropdown li.optgroup ~ li.optgroup-option{padding-left:1rem}.file-field{position:relative}.file-field .file-path-wrapper{overflow:hidden;padding-left:10px}.file-field input.file-path{width:100%}.file-field .btn,.file-field .btn-large{float:left;height:3rem;line-height:3rem}.file-field span{cursor:pointer}.file-field input[type=file]{position:absolute;top:0;right:0;left:0;bottom:0;width:100%;margin:0;padding:0;font-size:20px;cursor:pointer;opacity:0;filter:alpha(opacity=0)}.range-field{position:relative}input[type=range],input[type=range]+.thumb{cursor:pointer}input[type=range]{position:relative;background-color:transparent;border:none;outline:none;width:100%;margin:15px 0;padding:0}input[type=range]:focus{outline:none}input[type=range]+.thumb{position:absolute;border:none;height:0;width:0;border-radius:50%;background-color:#26a69a;top:10px;margin-left:-6px;-webkit-transform-origin:50% 50%;transform-origin:50% 50%;-webkit-transform:rotate(-45deg);transform:rotate(-45deg)}input[type=range]+.thumb .value{display:block;width:30px;text-align:center;color:#26a69a;font-size:0;-webkit-transform:rotate(45deg);transform:rotate(45deg)}input[type=range]+.thumb.active{border-radius:50% 50% 50% 0}input[type=range]+.thumb.active .value{color:#fff;margin-left:-1px;margin-top:8px;font-size:10px}input[type=range]{-webkit-appearance:none}input[type=range]::-webkit-slider-runnable-track{height:3px;background:#c2c0c2;border:none}input[type=range]::-webkit-slider-thumb{-webkit-appearance:none;border:none;height:14px;width:14px;border-radius:50%;background-color:#26a69a;-webkit-transform-origin:50% 50%;transform-origin:50% 50%;margin:-5px 0 0 0;transition:.3s}input[type=range]:focus::-webkit-slider-runnable-track{background:#ccc}input[type=range]{border:1px solid white}input[type=range]::-moz-range-track{height:3px;background:#ddd;border:none}input[type=range]::-moz-range-thumb{border:none;height:14px;width:14px;border-radius:50%;background:#26a69a;margin-top:-5px}input[type=range]:-moz-focusring{outline:1px solid #fff;outline-offset:-1px}input[type=range]:focus::-moz-range-track{background:#ccc}input[type=range]::-ms-track{height:3px;background:transparent;border-color:transparent;border-width:6px 0;color:transparent}input[type=range]::-ms-fill-lower{background:#777}input[type=range]::-ms-fill-upper{background:#ddd}input[type=range]::-ms-thumb{border:none;height:14px;width:14px;border-radius:50%;background:#26a69a}input[type=range]:focus::-ms-fill-lower{background:#888}input[type=range]:focus::-ms-fill-upper{background:#ccc}.table-of-contents.fixed{position:fixed}.table-of-contents li{padding:2px 0}.table-of-contents a{display:inline-block;font-weight:300;color:#757575;padding-left:20px;height:1.5rem;line-height:1.5rem;letter-spacing:.4;display:inline-block}.table-of-contents a:hover{color:#a8a8a8;padding-left:19px;border-left:1px solid #ee6e73}.table-of-contents a.active{font-weight:500;padding-left:18px;border-left:2px solid #ee6e73}.side-nav{position:fixed;width:300px;left:0;top:0;margin:0;-webkit-transform:translateX(-100%);transform:translateX(-100%);height:100%;height:calc(100% + 60px);height:-moz-calc(100%);padding-bottom:60px;background-color:#fff;z-index:999;overflow-y:auto;will-change:transform;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform:translateX(-105%);transform:translateX(-105%)}.side-nav.right-aligned{right:0;-webkit-transform:translateX(105%);transform:translateX(105%);left:auto;-webkit-transform:translateX(100%);transform:translateX(100%)}.side-nav .collapsible{margin:0}.side-nav li{float:none;line-height:48px}.side-nav li.active{background-color:rgba(0,0,0,0.05)}.side-nav a{color:rgba(0,0,0,0.87);display:block;font-size:14px;font-weight:500;height:48px;line-height:48px;padding:0 32px}.side-nav a:hover{background-color:rgba(0,0,0,0.05)}.side-nav a.btn,.side-nav a.btn-large,.side-nav a.btn-large,.side-nav a.btn-flat,.side-nav a.btn-floating{margin:10px 15px}.side-nav a.btn,.side-nav a.btn-large,.side-nav a.btn-large,.side-nav a.btn-floating{color:#fff}.side-nav a.btn-flat{color:#343434}.side-nav a.btn:hover,.side-nav a.btn-large:hover,.side-nav a.btn-large:hover{background-color:#2bbbad}.side-nav a.btn-floating:hover{background-color:#26a69a}.side-nav li>a>i,.side-nav li>a>[class^="mdi-"],.side-nav li>a>[class*="mdi-"],.side-nav li>a>i.material-icons{float:left;height:48px;line-height:48px;margin:0 32px 0 0;width:24px;color:rgba(0,0,0,0.54)}.side-nav .divider{margin:8px 0 0 0}.side-nav .subheader{cursor:initial;pointer-events:none;color:rgba(0,0,0,0.54);font-size:14px;font-weight:500;line-height:48px}.side-nav .subheader:hover{background-color:transparent}.side-nav .userView{position:relative;padding:32px 32px 0;margin-bottom:8px}.side-nav .userView>a{height:auto;padding:0}.side-nav .userView>a:hover{background-color:transparent}.side-nav .userView .background{overflow:hidden;position:absolute;top:0;right:0;bottom:0;left:0;z-index:-1}.side-nav .userView .circle,.side-nav .userView .name,.side-nav .userView .email{display:block}.side-nav .userView .circle{height:64px;width:64px}.side-nav .userView .name,.side-nav .userView .email{font-size:14px;line-height:24px}.side-nav .userView .name{margin-top:16px;font-weight:500}.side-nav .userView .email{padding-bottom:16px;font-weight:400}.drag-target{height:100%;width:10px;position:fixed;top:0;z-index:998}.side-nav.fixed{left:0;-webkit-transform:translateX(0);transform:translateX(0);position:fixed}.side-nav.fixed.right-aligned{right:0;left:auto}@media only screen and (max-width: 992px){.side-nav.fixed{-webkit-transform:translateX(-105%);transform:translateX(-105%)}.side-nav.fixed.right-aligned{-webkit-transform:translateX(105%);transform:translateX(105%)}.side-nav a{padding:0 16px}.side-nav .userView{padding:16px 16px 0}}.side-nav .collapsible-body>ul:not(.collapsible)>li.active,.side-nav.fixed .collapsible-body>ul:not(.collapsible)>li.active{background-color:#ee6e73}.side-nav .collapsible-body>ul:not(.collapsible)>li.active a,.side-nav.fixed .collapsible-body>ul:not(.collapsible)>li.active a{color:#fff}#sidenav-overlay{position:fixed;top:0;left:0;right:0;height:120vh;background-color:rgba(0,0,0,0.5);z-index:997;will-change:opacity}.preloader-wrapper{display:inline-block;position:relative;width:48px;height:48px}.preloader-wrapper.small{width:36px;height:36px}.preloader-wrapper.big{width:64px;height:64px}.preloader-wrapper.active{-webkit-animation:container-rotate 1568ms linear infinite;animation:container-rotate 1568ms linear infinite}@-webkit-keyframes container-rotate{to{-webkit-transform:rotate(360deg)}}@keyframes container-rotate{to{-webkit-transform:rotate(360deg);transform:rotate(360deg)}}.spinner-layer{position:absolute;width:100%;height:100%;opacity:0;border-color:#26a69a}.spinner-blue,.spinner-blue-only{border-color:#4285f4}.spinner-red,.spinner-red-only{border-color:#db4437}.spinner-yellow,.spinner-yellow-only{border-color:#f4b400}.spinner-green,.spinner-green-only{border-color:#0f9d58}.active .spinner-layer.spinner-blue{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-red{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-yellow{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-green{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer,.active .spinner-layer.spinner-blue-only,.active .spinner-layer.spinner-red-only,.active .spinner-layer.spinner-yellow-only,.active .spinner-layer.spinner-green-only{opacity:1;-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}@-webkit-keyframes fill-unfill-rotate{12.5%{-webkit-transform:rotate(135deg)}25%{-webkit-transform:rotate(270deg)}37.5%{-webkit-transform:rotate(405deg)}50%{-webkit-transform:rotate(540deg)}62.5%{-webkit-transform:rotate(675deg)}75%{-webkit-transform:rotate(810deg)}87.5%{-webkit-transform:rotate(945deg)}to{-webkit-transform:rotate(1080deg)}}@keyframes fill-unfill-rotate{12.5%{-webkit-transform:rotate(135deg);transform:rotate(135deg)}25%{-webkit-transform:rotate(270deg);transform:rotate(270deg)}37.5%{-webkit-transform:rotate(405deg);transform:rotate(405deg)}50%{-webkit-transform:rotate(540deg);transform:rotate(540deg)}62.5%{-webkit-transform:rotate(675deg);transform:rotate(675deg)}75%{-webkit-transform:rotate(810deg);transform:rotate(810deg)}87.5%{-webkit-transform:rotate(945deg);transform:rotate(945deg)}to{-webkit-transform:rotate(1080deg);transform:rotate(1080deg)}}@-webkit-keyframes blue-fade-in-out{from{opacity:1}25%{opacity:1}26%{opacity:0}89%{opacity:0}90%{opacity:1}100%{opacity:1}}@keyframes blue-fade-in-out{from{opacity:1}25%{opacity:1}26%{opacity:0}89%{opacity:0}90%{opacity:1}100%{opacity:1}}@-webkit-keyframes red-fade-in-out{from{opacity:0}15%{opacity:0}25%{opacity:1}50%{opacity:1}51%{opacity:0}}@keyframes red-fade-in-out{from{opacity:0}15%{opacity:0}25%{opacity:1}50%{opacity:1}51%{opacity:0}}@-webkit-keyframes yellow-fade-in-out{from{opacity:0}40%{opacity:0}50%{opacity:1}75%{opacity:1}76%{opacity:0}}@keyframes yellow-fade-in-out{from{opacity:0}40%{opacity:0}50%{opacity:1}75%{opacity:1}76%{opacity:0}}@-webkit-keyframes green-fade-in-out{from{opacity:0}65%{opacity:0}75%{opacity:1}90%{opacity:1}100%{opacity:0}}@keyframes green-fade-in-out{from{opacity:0}65%{opacity:0}75%{opacity:1}90%{opacity:1}100%{opacity:0}}.gap-patch{position:absolute;top:0;left:45%;width:10%;height:100%;overflow:hidden;border-color:inherit}.gap-patch .circle{width:1000%;left:-450%}.circle-clipper{display:inline-block;position:relative;width:50%;height:100%;overflow:hidden;border-color:inherit}.circle-clipper .circle{width:200%;height:100%;border-width:3px;border-style:solid;border-color:inherit;border-bottom-color:transparent !important;border-radius:50%;-webkit-animation:none;animation:none;position:absolute;top:0;right:0;bottom:0}.circle-clipper.left .circle{left:0;border-right-color:transparent !important;-webkit-transform:rotate(129deg);transform:rotate(129deg)}.circle-clipper.right .circle{left:-100%;border-left-color:transparent !important;-webkit-transform:rotate(-129deg);transform:rotate(-129deg)}.active .circle-clipper.left .circle{-webkit-animation:left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .circle-clipper.right .circle{-webkit-animation:right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}@-webkit-keyframes left-spin{from{-webkit-transform:rotate(130deg)}50%{-webkit-transform:rotate(-5deg)}to{-webkit-transform:rotate(130deg)}}@keyframes left-spin{from{-webkit-transform:rotate(130deg);transform:rotate(130deg)}50%{-webkit-transform:rotate(-5deg);transform:rotate(-5deg)}to{-webkit-transform:rotate(130deg);transform:rotate(130deg)}}@-webkit-keyframes right-spin{from{-webkit-transform:rotate(-130deg)}50%{-webkit-transform:rotate(5deg)}to{-webkit-transform:rotate(-130deg)}}@keyframes right-spin{from{-webkit-transform:rotate(-130deg);transform:rotate(-130deg)}50%{-webkit-transform:rotate(5deg);transform:rotate(5deg)}to{-webkit-transform:rotate(-130deg);transform:rotate(-130deg)}}#spinnerContainer.cooldown{-webkit-animation:container-rotate 1568ms linear infinite,fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1);animation:container-rotate 1568ms linear infinite,fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1)}@-webkit-keyframes fade-out{from{opacity:1}to{opacity:0}}@keyframes fade-out{from{opacity:1}to{opacity:0}}.slider{position:relative;height:400px;width:100%}.slider.fullscreen{height:100%;width:100%;position:absolute;top:0;left:0;right:0;bottom:0}.slider.fullscreen ul.slides{height:100%}.slider.fullscreen ul.indicators{z-index:2;bottom:30px}.slider .slides{background-color:#9e9e9e;margin:0;height:400px}.slider .slides li{opacity:0;position:absolute;top:0;left:0;z-index:1;width:100%;height:inherit;overflow:hidden}.slider .slides li img{height:100%;width:100%;background-size:cover;background-position:center}.slider .slides li .caption{color:#fff;position:absolute;top:15%;left:15%;width:70%;opacity:0}.slider .slides li .caption p{color:#e0e0e0}.slider .slides li.active{z-index:2}.slider .indicators{position:absolute;text-align:center;left:0;right:0;bottom:0;margin:0}.slider .indicators .indicator-item{display:inline-block;position:relative;cursor:pointer;height:16px;width:16px;margin:0 12px;background-color:#e0e0e0;transition:background-color .3s;border-radius:50%}.slider .indicators .indicator-item.active{background-color:#4CAF50}.carousel{overflow:hidden;position:relative;width:100%;height:400px;-webkit-perspective:500px;perspective:500px;-webkit-transform-style:preserve-3d;transform-style:preserve-3d;-webkit-transform-origin:0% 50%;transform-origin:0% 50%}.carousel.carousel-slider{top:0;left:0;height:0}.carousel.carousel-slider .carousel-fixed-item{position:absolute;left:0;right:0;bottom:20px;z-index:1}.carousel.carousel-slider .carousel-fixed-item.with-indicators{bottom:68px}.carousel.carousel-slider .carousel-item{width:100%;height:100%;min-height:400px;position:absolute;top:0;left:0}.carousel.carousel-slider .carousel-item h2{font-size:24px;font-weight:500;line-height:32px}.carousel.carousel-slider .carousel-item p{font-size:15px}.carousel .carousel-item{display:none;width:200px;height:200px;position:absolute;top:0;left:0}.carousel .carousel-item img{width:100%}.carousel .indicators{position:absolute;text-align:center;left:0;right:0;bottom:0;margin:0}.carousel .indicators .indicator-item{display:inline-block;position:relative;cursor:pointer;height:8px;width:8px;margin:24px 4px;background-color:rgba(255,255,255,0.5);transition:background-color .3s;border-radius:50%}.carousel .indicators .indicator-item.active{background-color:#fff}.picker{font-size:16px;text-align:left;line-height:1.2;color:#000000;position:absolute;z-index:10000;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.picker__input{cursor:default}.picker__input.picker__input--active{border-color:#0089ec}.picker__holder{width:100%;overflow-y:auto;-webkit-overflow-scrolling:touch}/*! + * Default mobile-first, responsive styling for pickadate.js + * Demo: http://amsul.github.io/pickadate.js + */.picker__holder,.picker__frame{bottom:0;left:0;right:0;top:100%}.picker__holder{position:fixed;transition:background 0.15s ease-out, top 0s 0.15s;-webkit-backface-visibility:hidden}.picker__frame{position:absolute;margin:0 auto;min-width:256px;width:300px;max-height:350px;-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";filter:alpha(opacity=0);-moz-opacity:0;opacity:0;transition:all 0.15s ease-out}@media (min-height: 28.875em){.picker__frame{overflow:visible;top:auto;bottom:-100%;max-height:80%}}@media (min-height: 40.125em){.picker__frame{margin-bottom:7.5%}}.picker__wrap{display:table;width:100%;height:100%}@media (min-height: 28.875em){.picker__wrap{display:block}}.picker__box{background:#ffffff;display:table-cell;vertical-align:middle}@media (min-height: 28.875em){.picker__box{display:block;border:1px solid #777777;border-top-color:#898989;border-bottom-width:0;border-radius:5px 5px 0 0;box-shadow:0 12px 36px 16px rgba(0,0,0,0.24)}}.picker--opened .picker__holder{top:0;background:transparent;-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorstr=#1E000000,endColorstr=#1E000000)";zoom:1;background:rgba(0,0,0,0.32);transition:background 0.15s ease-out}.picker--opened .picker__frame{top:0;-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";filter:alpha(opacity=100);-moz-opacity:1;opacity:1}@media (min-height: 35.875em){.picker--opened .picker__frame{top:10%;bottom:auto}}.picker__input.picker__input--active{border-color:#E3F2FD}.picker__frame{margin:0 auto;max-width:325px}@media (min-height: 38.875em){.picker--opened .picker__frame{top:10%;bottom:auto}}.picker__box{padding:0 1em}.picker__header{text-align:center;position:relative;margin-top:.75em}.picker__month,.picker__year{display:inline-block;margin-left:.25em;margin-right:.25em}.picker__select--month,.picker__select--year{height:2em;padding:0;margin-left:.25em;margin-right:.25em}.picker__select--month.browser-default{display:inline;background-color:#FFFFFF;width:40%}.picker__select--year.browser-default{display:inline;background-color:#FFFFFF;width:26%}.picker__select--month:focus,.picker__select--year:focus{border-color:rgba(0,0,0,0.05)}.picker__nav--prev,.picker__nav--next{position:absolute;padding:.5em 1.25em;width:1em;height:1em;box-sizing:content-box;top:-0.25em}.picker__nav--prev{left:-1em;padding-right:1.25em}.picker__nav--next{right:-1em;padding-left:1.25em}.picker__nav--disabled,.picker__nav--disabled:hover,.picker__nav--disabled:before,.picker__nav--disabled:before:hover{cursor:default;background:none;border-right-color:#f5f5f5;border-left-color:#f5f5f5}.picker__table{text-align:center;border-collapse:collapse;border-spacing:0;table-layout:fixed;font-size:1rem;width:100%;margin-top:.75em;margin-bottom:.5em}.picker__table th,.picker__table td{text-align:center}.picker__table td{margin:0;padding:0}.picker__weekday{width:14.285714286%;font-size:.75em;padding-bottom:.25em;color:#999999;font-weight:500}@media (min-height: 33.875em){.picker__weekday{padding-bottom:.5em}}.picker__day--today{position:relative;color:#595959;letter-spacing:-.3;padding:.75rem 0;font-weight:400;border:1px solid transparent}.picker__day--disabled:before{border-top-color:#aaaaaa}.picker__day--infocus:hover{cursor:pointer;color:#000;font-weight:500}.picker__day--outfocus{display:none;padding:.75rem 0;color:#fff}.picker__day--outfocus:hover{cursor:pointer;color:#dddddd;font-weight:500}.picker__day--highlighted:hover,.picker--focused .picker__day--highlighted{cursor:pointer}.picker__day--selected,.picker__day--selected:hover,.picker--focused .picker__day--selected{border-radius:50%;-webkit-transform:scale(0.75);transform:scale(0.75);background:#0089ec;color:#ffffff}.picker__day--disabled,.picker__day--disabled:hover,.picker--focused .picker__day--disabled{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default}.picker__day--highlighted.picker__day--disabled,.picker__day--highlighted.picker__day--disabled:hover{background:#bbbbbb}.picker__footer{text-align:center;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between}.picker__button--today,.picker__button--clear,.picker__button--close{border:1px solid #ffffff;background:#ffffff;font-size:.8em;padding:.66em 0;font-weight:bold;width:33%;display:inline-block;vertical-align:bottom}.picker__button--today:hover,.picker__button--clear:hover,.picker__button--close:hover{cursor:pointer;color:#000000;background:#b1dcfb;border-bottom-color:#b1dcfb}.picker__button--today:focus,.picker__button--clear:focus,.picker__button--close:focus{background:#b1dcfb;border-color:rgba(0,0,0,0.05);outline:none}.picker__button--today:before,.picker__button--clear:before,.picker__button--close:before{position:relative;display:inline-block;height:0}.picker__button--today:before,.picker__button--clear:before{content:" ";margin-right:.45em}.picker__button--today:before{top:-0.05em;width:0;border-top:0.66em solid #0059bc;border-left:.66em solid transparent}.picker__button--clear:before{top:-0.25em;width:.66em;border-top:3px solid #ee2200}.picker__button--close:before{content:"\D7";top:-0.1em;vertical-align:top;font-size:1.1em;margin-right:.35em;color:#777777}.picker__button--today[disabled],.picker__button--today[disabled]:hover{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default}.picker__button--today[disabled]:before{border-top-color:#aaaaaa}.picker__box{border-radius:2px;overflow:hidden}.picker__date-display{text-align:center;background-color:#26a69a;color:#fff;padding-bottom:15px;font-weight:300}.picker__nav--prev:hover,.picker__nav--next:hover{cursor:pointer;color:#000000;background:#a1ded8}.picker__weekday-display{background-color:#1f897f;padding:10px;font-weight:200;letter-spacing:.5;font-size:1rem;margin-bottom:15px}.picker__month-display{text-transform:uppercase;font-size:2rem}.picker__day-display{font-size:4.5rem;font-weight:400}.picker__year-display{font-size:1.8rem;color:rgba(255,255,255,0.4)}.picker__box{padding:0}.picker__calendar-container{padding:0 1rem}.picker__calendar-container thead{border:none}.picker__table{margin-top:0;margin-bottom:.5em}.picker__day--infocus{color:#595959;letter-spacing:-.3;padding:.75rem 0;font-weight:400;border:1px solid transparent}.picker__day.picker__day--today{color:#26a69a}.picker__day.picker__day--today.picker__day--selected{color:#fff}.picker__weekday{font-size:.9rem}.picker__day--selected,.picker__day--selected:hover,.picker--focused .picker__day--selected{border-radius:50%;-webkit-transform:scale(0.9);transform:scale(0.9);background-color:#26a69a;color:#ffffff}.picker__day--selected.picker__day--outfocus,.picker__day--selected:hover.picker__day--outfocus,.picker--focused .picker__day--selected.picker__day--outfocus{background-color:#a1ded8}.picker__footer{text-align:right;padding:5px 10px}.picker__close,.picker__today{font-size:1.1rem;padding:0 1rem;color:#26a69a}.picker__nav--prev:before,.picker__nav--next:before{content:" ";border-top:.5em solid transparent;border-bottom:.5em solid transparent;border-right:0.75em solid #676767;width:0;height:0;display:block;margin:0 auto}.picker__nav--next:before{border-right:0;border-left:0.75em solid #676767}button.picker__today:focus,button.picker__clear:focus,button.picker__close:focus{background-color:#a1ded8}.picker__list{list-style:none;padding:0.75em 0 4.2em;margin:0}.picker__list-item{border-bottom:1px solid #dddddd;border-top:1px solid #dddddd;margin-bottom:-1px;position:relative;background:#ffffff;padding:.75em 1.25em}@media (min-height: 46.75em){.picker__list-item{padding:.5em 1em}}.picker__list-item:hover{cursor:pointer;color:#000000;background:#b1dcfb;border-color:#0089ec;z-index:10}.picker__list-item--highlighted{border-color:#0089ec;z-index:10}.picker__list-item--highlighted:hover,.picker--focused .picker__list-item--highlighted{cursor:pointer;color:#000000;background:#b1dcfb}.picker__list-item--selected,.picker__list-item--selected:hover,.picker--focused .picker__list-item--selected{background:#0089ec;color:#ffffff;z-index:10}.picker__list-item--disabled,.picker__list-item--disabled:hover,.picker--focused .picker__list-item--disabled{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default;border-color:#dddddd;z-index:auto}.picker--time .picker__button--clear{display:block;width:80%;margin:1em auto 0;padding:1em 1.25em;background:none;border:0;font-weight:500;font-size:.67em;text-align:center;text-transform:uppercase;color:#666}.picker--time .picker__button--clear:hover,.picker--time .picker__button--clear:focus{color:#000000;background:#b1dcfb;background:#ee2200;border-color:#ee2200;cursor:pointer;color:#ffffff;outline:none}.picker--time .picker__button--clear:before{top:-0.25em;color:#666;font-size:1.25em;font-weight:bold}.picker--time .picker__button--clear:hover:before,.picker--time .picker__button--clear:focus:before{color:#ffffff}.picker--time .picker__frame{min-width:256px;max-width:320px}.picker--time .picker__box{font-size:1em;background:#f2f2f2;padding:0}@media (min-height: 40.125em){.picker--time .picker__box{margin-bottom:5em}} diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/.DS_Store b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/.DS_Store Binary files differnew file mode 100644 index 000000000..ae0d28ed8 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/.DS_Store diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.eot b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.eot Binary files differnew file mode 100644 index 000000000..b73776ee3 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.eot diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.ttf b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.ttf Binary files differnew file mode 100644 index 000000000..68822caf2 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.ttf diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff Binary files differnew file mode 100644 index 000000000..1f75afdcc --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff2 b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff2 Binary files differnew file mode 100644 index 000000000..350d1c3a2 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Bold.woff2 diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.eot b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.eot Binary files differnew file mode 100644 index 000000000..072cdc480 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.eot diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.ttf b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.ttf Binary files differnew file mode 100644 index 000000000..aa4534075 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.ttf diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff Binary files differnew file mode 100644 index 000000000..3480c6c8b --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff2 b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff2 Binary files differnew file mode 100644 index 000000000..9a4d98c46 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Light.woff2 diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.eot b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.eot Binary files differnew file mode 100644 index 000000000..f9ad99566 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.eot diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.ttf b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.ttf Binary files differnew file mode 100644 index 000000000..a3c1a1f17 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.ttf diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff Binary files differnew file mode 100644 index 000000000..1186773fd --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff2 b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff2 Binary files differnew file mode 100644 index 000000000..d10a59261 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Medium.woff2 diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.eot b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.eot Binary files differnew file mode 100644 index 000000000..9b5e8e413 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.eot diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.ttf b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.ttf Binary files differnew file mode 100644 index 000000000..0e58508a6 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.ttf diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff Binary files differnew file mode 100644 index 000000000..f823258a4 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff2 b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff2 Binary files differnew file mode 100644 index 000000000..b7082ef31 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Regular.woff2 diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.eot b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.eot Binary files differnew file mode 100644 index 000000000..2284a3b3e --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.eot diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.ttf b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.ttf Binary files differnew file mode 100644 index 000000000..8779333b1 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.ttf diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff Binary files differnew file mode 100644 index 000000000..2a98c1e41 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff2 b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff2 Binary files differnew file mode 100644 index 000000000..a38025a15 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/fonts/roboto/Roboto-Thin.woff2 diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/js/materialize.js b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/js/materialize.js new file mode 100644 index 000000000..8c994c467 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/js/materialize.js @@ -0,0 +1,8031 @@ +/*! + * Materialize v0.98.0 (http://materializecss.com) + * Copyright 2014-2015 Materialize + * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) + */ +// Check for jQuery. +if (typeof(jQuery) === 'undefined') { + var jQuery; + // Check if require is a defined function. + if (typeof(require) === 'function') { + jQuery = $ = require('jquery'); + // Else use the dollar sign alias. + } else { + jQuery = $; + } +} +;/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright © 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +jQuery.easing['jswing'] = jQuery.easing['swing']; + +jQuery.extend( jQuery.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert(jQuery.easing.default); + return jQuery.easing[jQuery.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - jQuery.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return jQuery.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return jQuery.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright © 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */;// Custom Easing +jQuery.extend( jQuery.easing, +{ + easeInOutMaterial: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return c/4*((t-=2)*t*t + 2) + b; + } +});;/*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */ +/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */ +/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */ +jQuery.Velocity?console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity."):(!function(e){function t(e){var t=e.length,a=r.type(e);return"function"===a||r.isWindow(e)?!1:1===e.nodeType&&t?!0:"array"===a||0===t||"number"==typeof t&&t>0&&t-1 in e}if(!e.jQuery){var r=function(e,t){return new r.fn.init(e,t)};r.isWindow=function(e){return null!=e&&e==e.window},r.type=function(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[i.call(e)]||"object":typeof e},r.isArray=Array.isArray||function(e){return"array"===r.type(e)},r.isPlainObject=function(e){var t;if(!e||"object"!==r.type(e)||e.nodeType||r.isWindow(e))return!1;try{if(e.constructor&&!o.call(e,"constructor")&&!o.call(e.constructor.prototype,"isPrototypeOf"))return!1}catch(a){return!1}for(t in e);return void 0===t||o.call(e,t)},r.each=function(e,r,a){var n,o=0,i=e.length,s=t(e);if(a){if(s)for(;i>o&&(n=r.apply(e[o],a),n!==!1);o++);else for(o in e)if(n=r.apply(e[o],a),n===!1)break}else if(s)for(;i>o&&(n=r.call(e[o],o,e[o]),n!==!1);o++);else for(o in e)if(n=r.call(e[o],o,e[o]),n===!1)break;return e},r.data=function(e,t,n){if(void 0===n){var o=e[r.expando],i=o&&a[o];if(void 0===t)return i;if(i&&t in i)return i[t]}else if(void 0!==t){var o=e[r.expando]||(e[r.expando]=++r.uuid);return a[o]=a[o]||{},a[o][t]=n,n}},r.removeData=function(e,t){var n=e[r.expando],o=n&&a[n];o&&r.each(t,function(e,t){delete o[t]})},r.extend=function(){var e,t,a,n,o,i,s=arguments[0]||{},l=1,u=arguments.length,c=!1;for("boolean"==typeof s&&(c=s,s=arguments[l]||{},l++),"object"!=typeof s&&"function"!==r.type(s)&&(s={}),l===u&&(s=this,l--);u>l;l++)if(null!=(o=arguments[l]))for(n in o)e=s[n],a=o[n],s!==a&&(c&&a&&(r.isPlainObject(a)||(t=r.isArray(a)))?(t?(t=!1,i=e&&r.isArray(e)?e:[]):i=e&&r.isPlainObject(e)?e:{},s[n]=r.extend(c,i,a)):void 0!==a&&(s[n]=a));return s},r.queue=function(e,a,n){function o(e,r){var a=r||[];return null!=e&&(t(Object(e))?!function(e,t){for(var r=+t.length,a=0,n=e.length;r>a;)e[n++]=t[a++];if(r!==r)for(;void 0!==t[a];)e[n++]=t[a++];return e.length=n,e}(a,"string"==typeof e?[e]:e):[].push.call(a,e)),a}if(e){a=(a||"fx")+"queue";var i=r.data(e,a);return n?(!i||r.isArray(n)?i=r.data(e,a,o(n)):i.push(n),i):i||[]}},r.dequeue=function(e,t){r.each(e.nodeType?[e]:e,function(e,a){t=t||"fx";var n=r.queue(a,t),o=n.shift();"inprogress"===o&&(o=n.shift()),o&&("fx"===t&&n.unshift("inprogress"),o.call(a,function(){r.dequeue(a,t)}))})},r.fn=r.prototype={init:function(e){if(e.nodeType)return this[0]=e,this;throw new Error("Not a DOM node.")},offset:function(){var t=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:t.top+(e.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:t.left+(e.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function e(){for(var e=this.offsetParent||document;e&&"html"===!e.nodeType.toLowerCase&&"static"===e.style.position;)e=e.offsetParent;return e||document}var t=this[0],e=e.apply(t),a=this.offset(),n=/^(?:body|html)$/i.test(e.nodeName)?{top:0,left:0}:r(e).offset();return a.top-=parseFloat(t.style.marginTop)||0,a.left-=parseFloat(t.style.marginLeft)||0,e.style&&(n.top+=parseFloat(e.style.borderTopWidth)||0,n.left+=parseFloat(e.style.borderLeftWidth)||0),{top:a.top-n.top,left:a.left-n.left}}};var a={};r.expando="velocity"+(new Date).getTime(),r.uuid=0;for(var n={},o=n.hasOwnProperty,i=n.toString,s="Boolean Number String Function Array Date RegExp Object Error".split(" "),l=0;l<s.length;l++)n["[object "+s[l]+"]"]=s[l].toLowerCase();r.fn.init.prototype=r.fn,e.Velocity={Utilities:r}}}(window),function(e){"object"==typeof module&&"object"==typeof module.exports?module.exports=e():"function"==typeof define&&define.amd?define(e):e()}(function(){return function(e,t,r,a){function n(e){for(var t=-1,r=e?e.length:0,a=[];++t<r;){var n=e[t];n&&a.push(n)}return a}function o(e){return m.isWrapped(e)?e=[].slice.call(e):m.isNode(e)&&(e=[e]),e}function i(e){var t=f.data(e,"velocity");return null===t?a:t}function s(e){return function(t){return Math.round(t*e)*(1/e)}}function l(e,r,a,n){function o(e,t){return 1-3*t+3*e}function i(e,t){return 3*t-6*e}function s(e){return 3*e}function l(e,t,r){return((o(t,r)*e+i(t,r))*e+s(t))*e}function u(e,t,r){return 3*o(t,r)*e*e+2*i(t,r)*e+s(t)}function c(t,r){for(var n=0;m>n;++n){var o=u(r,e,a);if(0===o)return r;var i=l(r,e,a)-t;r-=i/o}return r}function p(){for(var t=0;b>t;++t)w[t]=l(t*x,e,a)}function f(t,r,n){var o,i,s=0;do i=r+(n-r)/2,o=l(i,e,a)-t,o>0?n=i:r=i;while(Math.abs(o)>h&&++s<v);return i}function d(t){for(var r=0,n=1,o=b-1;n!=o&&w[n]<=t;++n)r+=x;--n;var i=(t-w[n])/(w[n+1]-w[n]),s=r+i*x,l=u(s,e,a);return l>=y?c(t,s):0==l?s:f(t,r,r+x)}function g(){V=!0,(e!=r||a!=n)&&p()}var m=4,y=.001,h=1e-7,v=10,b=11,x=1/(b-1),S="Float32Array"in t;if(4!==arguments.length)return!1;for(var P=0;4>P;++P)if("number"!=typeof arguments[P]||isNaN(arguments[P])||!isFinite(arguments[P]))return!1;e=Math.min(e,1),a=Math.min(a,1),e=Math.max(e,0),a=Math.max(a,0);var w=S?new Float32Array(b):new Array(b),V=!1,C=function(t){return V||g(),e===r&&a===n?t:0===t?0:1===t?1:l(d(t),r,n)};C.getControlPoints=function(){return[{x:e,y:r},{x:a,y:n}]};var T="generateBezier("+[e,r,a,n]+")";return C.toString=function(){return T},C}function u(e,t){var r=e;return m.isString(e)?b.Easings[e]||(r=!1):r=m.isArray(e)&&1===e.length?s.apply(null,e):m.isArray(e)&&2===e.length?x.apply(null,e.concat([t])):m.isArray(e)&&4===e.length?l.apply(null,e):!1,r===!1&&(r=b.Easings[b.defaults.easing]?b.defaults.easing:v),r}function c(e){if(e){var t=(new Date).getTime(),r=b.State.calls.length;r>1e4&&(b.State.calls=n(b.State.calls));for(var o=0;r>o;o++)if(b.State.calls[o]){var s=b.State.calls[o],l=s[0],u=s[2],d=s[3],g=!!d,y=null;d||(d=b.State.calls[o][3]=t-16);for(var h=Math.min((t-d)/u.duration,1),v=0,x=l.length;x>v;v++){var P=l[v],V=P.element;if(i(V)){var C=!1;if(u.display!==a&&null!==u.display&&"none"!==u.display){if("flex"===u.display){var T=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];f.each(T,function(e,t){S.setPropertyValue(V,"display",t)})}S.setPropertyValue(V,"display",u.display)}u.visibility!==a&&"hidden"!==u.visibility&&S.setPropertyValue(V,"visibility",u.visibility);for(var k in P)if("element"!==k){var A,F=P[k],j=m.isString(F.easing)?b.Easings[F.easing]:F.easing;if(1===h)A=F.endValue;else{var E=F.endValue-F.startValue;if(A=F.startValue+E*j(h,u,E),!g&&A===F.currentValue)continue}if(F.currentValue=A,"tween"===k)y=A;else{if(S.Hooks.registered[k]){var H=S.Hooks.getRoot(k),N=i(V).rootPropertyValueCache[H];N&&(F.rootPropertyValue=N)}var L=S.setPropertyValue(V,k,F.currentValue+(0===parseFloat(A)?"":F.unitType),F.rootPropertyValue,F.scrollData);S.Hooks.registered[k]&&(i(V).rootPropertyValueCache[H]=S.Normalizations.registered[H]?S.Normalizations.registered[H]("extract",null,L[1]):L[1]),"transform"===L[0]&&(C=!0)}}u.mobileHA&&i(V).transformCache.translate3d===a&&(i(V).transformCache.translate3d="(0px, 0px, 0px)",C=!0),C&&S.flushTransformCache(V)}}u.display!==a&&"none"!==u.display&&(b.State.calls[o][2].display=!1),u.visibility!==a&&"hidden"!==u.visibility&&(b.State.calls[o][2].visibility=!1),u.progress&&u.progress.call(s[1],s[1],h,Math.max(0,d+u.duration-t),d,y),1===h&&p(o)}}b.State.isTicking&&w(c)}function p(e,t){if(!b.State.calls[e])return!1;for(var r=b.State.calls[e][0],n=b.State.calls[e][1],o=b.State.calls[e][2],s=b.State.calls[e][4],l=!1,u=0,c=r.length;c>u;u++){var p=r[u].element;if(t||o.loop||("none"===o.display&&S.setPropertyValue(p,"display",o.display),"hidden"===o.visibility&&S.setPropertyValue(p,"visibility",o.visibility)),o.loop!==!0&&(f.queue(p)[1]===a||!/\.velocityQueueEntryFlag/i.test(f.queue(p)[1]))&&i(p)){i(p).isAnimating=!1,i(p).rootPropertyValueCache={};var d=!1;f.each(S.Lists.transforms3D,function(e,t){var r=/^scale/.test(t)?1:0,n=i(p).transformCache[t];i(p).transformCache[t]!==a&&new RegExp("^\\("+r+"[^.]").test(n)&&(d=!0,delete i(p).transformCache[t])}),o.mobileHA&&(d=!0,delete i(p).transformCache.translate3d),d&&S.flushTransformCache(p),S.Values.removeClass(p,"velocity-animating")}if(!t&&o.complete&&!o.loop&&u===c-1)try{o.complete.call(n,n)}catch(g){setTimeout(function(){throw g},1)}s&&o.loop!==!0&&s(n),i(p)&&o.loop===!0&&!t&&(f.each(i(p).tweensContainer,function(e,t){/^rotate/.test(e)&&360===parseFloat(t.endValue)&&(t.endValue=0,t.startValue=360),/^backgroundPosition/.test(e)&&100===parseFloat(t.endValue)&&"%"===t.unitType&&(t.endValue=0,t.startValue=100)}),b(p,"reverse",{loop:!0,delay:o.delay})),o.queue!==!1&&f.dequeue(p,o.queue)}b.State.calls[e]=!1;for(var m=0,y=b.State.calls.length;y>m;m++)if(b.State.calls[m]!==!1){l=!0;break}l===!1&&(b.State.isTicking=!1,delete b.State.calls,b.State.calls=[])}var f,d=function(){if(r.documentMode)return r.documentMode;for(var e=7;e>4;e--){var t=r.createElement("div");if(t.innerHTML="<!--[if IE "+e+"]><span></span><![endif]-->",t.getElementsByTagName("span").length)return t=null,e}return a}(),g=function(){var e=0;return t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||function(t){var r,a=(new Date).getTime();return r=Math.max(0,16-(a-e)),e=a+r,setTimeout(function(){t(a+r)},r)}}(),m={isString:function(e){return"string"==typeof e},isArray:Array.isArray||function(e){return"[object Array]"===Object.prototype.toString.call(e)},isFunction:function(e){return"[object Function]"===Object.prototype.toString.call(e)},isNode:function(e){return e&&e.nodeType},isNodeList:function(e){return"object"==typeof e&&/^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e))&&e.length!==a&&(0===e.length||"object"==typeof e[0]&&e[0].nodeType>0)},isWrapped:function(e){return e&&(e.jquery||t.Zepto&&t.Zepto.zepto.isZ(e))},isSVG:function(e){return t.SVGElement&&e instanceof t.SVGElement},isEmptyObject:function(e){for(var t in e)return!1;return!0}},y=!1;if(e.fn&&e.fn.jquery?(f=e,y=!0):f=t.Velocity.Utilities,8>=d&&!y)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if(7>=d)return void(jQuery.fn.velocity=jQuery.fn.animate);var h=400,v="swing",b={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:t.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:r.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:f,Redirects:{},Easings:{},Promise:t.Promise,defaults:{queue:"",duration:h,easing:v,begin:a,complete:a,progress:a,display:a,visibility:a,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(e){f.data(e,"velocity",{isSVG:m.isSVG(e),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};t.pageYOffset!==a?(b.State.scrollAnchor=t,b.State.scrollPropertyLeft="pageXOffset",b.State.scrollPropertyTop="pageYOffset"):(b.State.scrollAnchor=r.documentElement||r.body.parentNode||r.body,b.State.scrollPropertyLeft="scrollLeft",b.State.scrollPropertyTop="scrollTop");var x=function(){function e(e){return-e.tension*e.x-e.friction*e.v}function t(t,r,a){var n={x:t.x+a.dx*r,v:t.v+a.dv*r,tension:t.tension,friction:t.friction};return{dx:n.v,dv:e(n)}}function r(r,a){var n={dx:r.v,dv:e(r)},o=t(r,.5*a,n),i=t(r,.5*a,o),s=t(r,a,i),l=1/6*(n.dx+2*(o.dx+i.dx)+s.dx),u=1/6*(n.dv+2*(o.dv+i.dv)+s.dv);return r.x=r.x+l*a,r.v=r.v+u*a,r}return function a(e,t,n){var o,i,s,l={x:-1,v:0,tension:null,friction:null},u=[0],c=0,p=1e-4,f=.016;for(e=parseFloat(e)||500,t=parseFloat(t)||20,n=n||null,l.tension=e,l.friction=t,o=null!==n,o?(c=a(e,t),i=c/n*f):i=f;s=r(s||l,i),u.push(1+s.x),c+=16,Math.abs(s.x)>p&&Math.abs(s.v)>p;);return o?function(e){return u[e*(u.length-1)|0]}:c}}();b.Easings={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},spring:function(e){return 1-Math.cos(4.5*e*Math.PI)*Math.exp(6*-e)}},f.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(e,t){b.Easings[t[0]]=l.apply(null,t[1])});var S=b.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(var e=0;e<S.Lists.colors.length;e++){var t="color"===S.Lists.colors[e]?"0 0 0 1":"255 255 255 1";S.Hooks.templates[S.Lists.colors[e]]=["Red Green Blue Alpha",t]}var r,a,n;if(d)for(r in S.Hooks.templates){a=S.Hooks.templates[r],n=a[0].split(" ");var o=a[1].match(S.RegEx.valueSplit);"Color"===n[0]&&(n.push(n.shift()),o.push(o.shift()),S.Hooks.templates[r]=[n.join(" "),o.join(" ")])}for(r in S.Hooks.templates){a=S.Hooks.templates[r],n=a[0].split(" ");for(var e in n){var i=r+n[e],s=e;S.Hooks.registered[i]=[r,s]}}},getRoot:function(e){var t=S.Hooks.registered[e];return t?t[0]:e},cleanRootPropertyValue:function(e,t){return S.RegEx.valueUnwrap.test(t)&&(t=t.match(S.RegEx.valueUnwrap)[1]),S.Values.isCSSNullValue(t)&&(t=S.Hooks.templates[e][1]),t},extractValue:function(e,t){var r=S.Hooks.registered[e];if(r){var a=r[0],n=r[1];return t=S.Hooks.cleanRootPropertyValue(a,t),t.toString().match(S.RegEx.valueSplit)[n]}return t},injectValue:function(e,t,r){var a=S.Hooks.registered[e];if(a){var n,o,i=a[0],s=a[1];return r=S.Hooks.cleanRootPropertyValue(i,r),n=r.toString().match(S.RegEx.valueSplit),n[s]=t,o=n.join(" ")}return r}},Normalizations:{registered:{clip:function(e,t,r){switch(e){case"name":return"clip";case"extract":var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r)?a=r:(a=r.toString().match(S.RegEx.valueUnwrap),a=a?a[1].replace(/,(\s+)?/g," "):r),a;case"inject":return"rect("+r+")"}},blur:function(e,t,r){switch(e){case"name":return b.State.isFirefox?"filter":"-webkit-filter";case"extract":var a=parseFloat(r);if(!a&&0!==a){var n=r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a=n?n[1]:0}return a;case"inject":return parseFloat(r)?"blur("+r+")":"none"}},opacity:function(e,t,r){if(8>=d)switch(e){case"name":return"filter";case"extract":var a=r.toString().match(/alpha\(opacity=(.*)\)/i);return r=a?a[1]/100:1;case"inject":return t.style.zoom=1,parseFloat(r)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(r),10)+")"}else switch(e){case"name":return"opacity";case"extract":return r;case"inject":return r}}},register:function(){9>=d||b.State.isGingerbread||(S.Lists.transformsBase=S.Lists.transformsBase.concat(S.Lists.transforms3D));for(var e=0;e<S.Lists.transformsBase.length;e++)!function(){var t=S.Lists.transformsBase[e];S.Normalizations.registered[t]=function(e,r,n){switch(e){case"name":return"transform";case"extract":return i(r)===a||i(r).transformCache[t]===a?/^scale/i.test(t)?1:0:i(r).transformCache[t].replace(/[()]/g,"");case"inject":var o=!1;switch(t.substr(0,t.length-1)){case"translate":o=!/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case"scal":case"scale":b.State.isAndroid&&i(r).transformCache[t]===a&&1>n&&(n=1),o=!/(\d)$/i.test(n);break;case"skew":o=!/(deg|\d)$/i.test(n);break;case"rotate":o=!/(deg|\d)$/i.test(n)}return o||(i(r).transformCache[t]="("+n+")"),i(r).transformCache[t]}}}();for(var e=0;e<S.Lists.colors.length;e++)!function(){var t=S.Lists.colors[e];S.Normalizations.registered[t]=function(e,r,n){switch(e){case"name":return t;case"extract":var o;if(S.RegEx.wrappedValueAlreadyExtracted.test(n))o=n;else{var i,s={black:"rgb(0, 0, 0)",blue:"rgb(0, 0, 255)",gray:"rgb(128, 128, 128)",green:"rgb(0, 128, 0)",red:"rgb(255, 0, 0)",white:"rgb(255, 255, 255)"};/^[A-z]+$/i.test(n)?i=s[n]!==a?s[n]:s.black:S.RegEx.isHex.test(n)?i="rgb("+S.Values.hexToRgb(n).join(" ")+")":/^rgba?\(/i.test(n)||(i=s.black),o=(i||n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g," ")}return 8>=d||3!==o.split(" ").length||(o+=" 1"),o;case"inject":return 8>=d?4===n.split(" ").length&&(n=n.split(/\s+/).slice(0,3).join(" ")):3===n.split(" ").length&&(n+=" 1"),(8>=d?"rgb":"rgba")+"("+n.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(e){return e.replace(/-(\w)/g,function(e,t){return t.toUpperCase()})},SVGAttribute:function(e){var t="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(d||b.State.isAndroid&&!b.State.isChrome)&&(t+="|transform"),new RegExp("^("+t+")$","i").test(e)},prefixCheck:function(e){if(b.State.prefixMatches[e])return[b.State.prefixMatches[e],!0];for(var t=["","Webkit","Moz","ms","O"],r=0,a=t.length;a>r;r++){var n;if(n=0===r?e:t[r]+e.replace(/^\w/,function(e){return e.toUpperCase()}),m.isString(b.State.prefixElement.style[n]))return b.State.prefixMatches[e]=n,[n,!0]}return[e,!1]}},Values:{hexToRgb:function(e){var t,r=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,a=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e=e.replace(r,function(e,t,r,a){return t+t+r+r+a+a}),t=a.exec(e),t?[parseInt(t[1],16),parseInt(t[2],16),parseInt(t[3],16)]:[0,0,0]},isCSSNullValue:function(e){return 0==e||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e)},getUnitType:function(e){return/^(rotate|skew)/i.test(e)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e)?"":"px"},getDisplayType:function(e){var t=e&&e.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t)?"inline":/^(li)$/i.test(t)?"list-item":/^(tr)$/i.test(t)?"table-row":/^(table)$/i.test(t)?"table":/^(tbody)$/i.test(t)?"table-row-group":"block"},addClass:function(e,t){e.classList?e.classList.add(t):e.className+=(e.className.length?" ":"")+t},removeClass:function(e,t){e.classList?e.classList.remove(t):e.className=e.className.toString().replace(new RegExp("(^|\\s)"+t.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(e,r,n,o){function s(e,r){function n(){u&&S.setPropertyValue(e,"display","none")}var l=0;if(8>=d)l=f.css(e,r);else{var u=!1;if(/^(width|height)$/.test(r)&&0===S.getPropertyValue(e,"display")&&(u=!0,S.setPropertyValue(e,"display",S.Values.getDisplayType(e))),!o){if("height"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var c=e.offsetHeight-(parseFloat(S.getPropertyValue(e,"borderTopWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderBottomWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingTop"))||0)-(parseFloat(S.getPropertyValue(e,"paddingBottom"))||0);return n(),c}if("width"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var p=e.offsetWidth-(parseFloat(S.getPropertyValue(e,"borderLeftWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderRightWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingLeft"))||0)-(parseFloat(S.getPropertyValue(e,"paddingRight"))||0);return n(),p}}var g;g=i(e)===a?t.getComputedStyle(e,null):i(e).computedStyle?i(e).computedStyle:i(e).computedStyle=t.getComputedStyle(e,null),"borderColor"===r&&(r="borderTopColor"),l=9===d&&"filter"===r?g.getPropertyValue(r):g[r],(""===l||null===l)&&(l=e.style[r]),n()}if("auto"===l&&/^(top|right|bottom|left)$/i.test(r)){var m=s(e,"position");("fixed"===m||"absolute"===m&&/top|left/i.test(r))&&(l=f(e).position()[r]+"px")}return l}var l;if(S.Hooks.registered[r]){var u=r,c=S.Hooks.getRoot(u);n===a&&(n=S.getPropertyValue(e,S.Names.prefixCheck(c)[0])),S.Normalizations.registered[c]&&(n=S.Normalizations.registered[c]("extract",e,n)),l=S.Hooks.extractValue(u,n)}else if(S.Normalizations.registered[r]){var p,g;p=S.Normalizations.registered[r]("name",e),"transform"!==p&&(g=s(e,S.Names.prefixCheck(p)[0]),S.Values.isCSSNullValue(g)&&S.Hooks.templates[r]&&(g=S.Hooks.templates[r][1])),l=S.Normalizations.registered[r]("extract",e,g)}if(!/^[\d-]/.test(l))if(i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r))if(/^(height|width)$/i.test(r))try{l=e.getBBox()[r]}catch(m){l=0}else l=e.getAttribute(r);else l=s(e,S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l)&&(l=0),b.debug>=2&&console.log("Get "+r+": "+l),l},setPropertyValue:function(e,r,a,n,o){var s=r;if("scroll"===r)o.container?o.container["scroll"+o.direction]=a:"Left"===o.direction?t.scrollTo(a,o.alternateValue):t.scrollTo(o.alternateValue,a);else if(S.Normalizations.registered[r]&&"transform"===S.Normalizations.registered[r]("name",e))S.Normalizations.registered[r]("inject",e,a),s="transform",a=i(e).transformCache[r];else{if(S.Hooks.registered[r]){var l=r,u=S.Hooks.getRoot(r);n=n||S.getPropertyValue(e,u),a=S.Hooks.injectValue(l,a,n),r=u}if(S.Normalizations.registered[r]&&(a=S.Normalizations.registered[r]("inject",e,a),r=S.Normalizations.registered[r]("name",e)),s=S.Names.prefixCheck(r)[0],8>=d)try{e.style[s]=a}catch(c){b.debug&&console.log("Browser does not support ["+a+"] for ["+s+"]")}else i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r)?e.setAttribute(r,a):e.style[s]=a;b.debug>=2&&console.log("Set "+r+" ("+s+"): "+a)}return[s,a]},flushTransformCache:function(e){function t(t){return parseFloat(S.getPropertyValue(e,t))}var r="";if((d||b.State.isAndroid&&!b.State.isChrome)&&i(e).isSVG){var a={translate:[t("translateX"),t("translateY")],skewX:[t("skewX")],skewY:[t("skewY")],scale:1!==t("scale")?[t("scale"),t("scale")]:[t("scaleX"),t("scaleY")],rotate:[t("rotateZ"),0,0]};f.each(i(e).transformCache,function(e){/^translate/i.test(e)?e="translate":/^scale/i.test(e)?e="scale":/^rotate/i.test(e)&&(e="rotate"),a[e]&&(r+=e+"("+a[e].join(" ")+") ",delete a[e])})}else{var n,o;f.each(i(e).transformCache,function(t){return n=i(e).transformCache[t],"transformPerspective"===t?(o=n,!0):(9===d&&"rotateZ"===t&&(t="rotate"),void(r+=t+n+" "))}),o&&(r="perspective"+o+" "+r)}S.setPropertyValue(e,"transform",r)}};S.Hooks.register(),S.Normalizations.register(),b.hook=function(e,t,r){var n=a;return e=o(e),f.each(e,function(e,o){if(i(o)===a&&b.init(o),r===a)n===a&&(n=b.CSS.getPropertyValue(o,t));else{var s=b.CSS.setPropertyValue(o,t,r);"transform"===s[0]&&b.CSS.flushTransformCache(o),n=s}}),n};var P=function(){function e(){return s?k.promise||null:l}function n(){function e(e){function p(e,t){var r=a,n=a,i=a;return m.isArray(e)?(r=e[0],!m.isArray(e[1])&&/^[\d-]/.test(e[1])||m.isFunction(e[1])||S.RegEx.isHex.test(e[1])?i=e[1]:(m.isString(e[1])&&!S.RegEx.isHex.test(e[1])||m.isArray(e[1]))&&(n=t?e[1]:u(e[1],s.duration),e[2]!==a&&(i=e[2]))):r=e,t||(n=n||s.easing),m.isFunction(r)&&(r=r.call(o,V,w)),m.isFunction(i)&&(i=i.call(o,V,w)),[r||0,n,i]}function d(e,t){var r,a;return a=(t||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(e){return r=e,""}),r||(r=S.Values.getUnitType(e)),[a,r]}function h(){var e={myParent:o.parentNode||r.body,position:S.getPropertyValue(o,"position"),fontSize:S.getPropertyValue(o,"fontSize")},a=e.position===L.lastPosition&&e.myParent===L.lastParent,n=e.fontSize===L.lastFontSize;L.lastParent=e.myParent,L.lastPosition=e.position,L.lastFontSize=e.fontSize;var s=100,l={};if(n&&a)l.emToPx=L.lastEmToPx,l.percentToPxWidth=L.lastPercentToPxWidth,l.percentToPxHeight=L.lastPercentToPxHeight;else{var u=i(o).isSVG?r.createElementNS("http://www.w3.org/2000/svg","rect"):r.createElement("div");b.init(u),e.myParent.appendChild(u),f.each(["overflow","overflowX","overflowY"],function(e,t){b.CSS.setPropertyValue(u,t,"hidden")}),b.CSS.setPropertyValue(u,"position",e.position),b.CSS.setPropertyValue(u,"fontSize",e.fontSize),b.CSS.setPropertyValue(u,"boxSizing","content-box"),f.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(e,t){b.CSS.setPropertyValue(u,t,s+"%")}),b.CSS.setPropertyValue(u,"paddingLeft",s+"em"),l.percentToPxWidth=L.lastPercentToPxWidth=(parseFloat(S.getPropertyValue(u,"width",null,!0))||1)/s,l.percentToPxHeight=L.lastPercentToPxHeight=(parseFloat(S.getPropertyValue(u,"height",null,!0))||1)/s,l.emToPx=L.lastEmToPx=(parseFloat(S.getPropertyValue(u,"paddingLeft"))||1)/s,e.myParent.removeChild(u)}return null===L.remToPx&&(L.remToPx=parseFloat(S.getPropertyValue(r.body,"fontSize"))||16),null===L.vwToPx&&(L.vwToPx=parseFloat(t.innerWidth)/100,L.vhToPx=parseFloat(t.innerHeight)/100),l.remToPx=L.remToPx,l.vwToPx=L.vwToPx,l.vhToPx=L.vhToPx,b.debug>=1&&console.log("Unit ratios: "+JSON.stringify(l),o),l}if(s.begin&&0===V)try{s.begin.call(g,g)}catch(x){setTimeout(function(){throw x},1)}if("scroll"===A){var P,C,T,F=/^x$/i.test(s.axis)?"Left":"Top",j=parseFloat(s.offset)||0;s.container?m.isWrapped(s.container)||m.isNode(s.container)?(s.container=s.container[0]||s.container,P=s.container["scroll"+F],T=P+f(o).position()[F.toLowerCase()]+j):s.container=null:(P=b.State.scrollAnchor[b.State["scrollProperty"+F]],C=b.State.scrollAnchor[b.State["scrollProperty"+("Left"===F?"Top":"Left")]],T=f(o).offset()[F.toLowerCase()]+j),l={scroll:{rootPropertyValue:!1,startValue:P,currentValue:P,endValue:T,unitType:"",easing:s.easing,scrollData:{container:s.container,direction:F,alternateValue:C}},element:o},b.debug&&console.log("tweensContainer (scroll): ",l.scroll,o)}else if("reverse"===A){if(!i(o).tweensContainer)return void f.dequeue(o,s.queue);"none"===i(o).opts.display&&(i(o).opts.display="auto"),"hidden"===i(o).opts.visibility&&(i(o).opts.visibility="visible"),i(o).opts.loop=!1,i(o).opts.begin=null,i(o).opts.complete=null,v.easing||delete s.easing,v.duration||delete s.duration,s=f.extend({},i(o).opts,s);var E=f.extend(!0,{},i(o).tweensContainer);for(var H in E)if("element"!==H){var N=E[H].startValue;E[H].startValue=E[H].currentValue=E[H].endValue,E[H].endValue=N,m.isEmptyObject(v)||(E[H].easing=s.easing),b.debug&&console.log("reverse tweensContainer ("+H+"): "+JSON.stringify(E[H]),o)}l=E}else if("start"===A){var E;i(o).tweensContainer&&i(o).isAnimating===!0&&(E=i(o).tweensContainer),f.each(y,function(e,t){if(RegExp("^"+S.Lists.colors.join("$|^")+"$").test(e)){var r=p(t,!0),n=r[0],o=r[1],i=r[2];if(S.RegEx.isHex.test(n)){for(var s=["Red","Green","Blue"],l=S.Values.hexToRgb(n),u=i?S.Values.hexToRgb(i):a,c=0;c<s.length;c++){var f=[l[c]];o&&f.push(o),u!==a&&f.push(u[c]),y[e+s[c]]=f}delete y[e]}}});for(var z in y){var O=p(y[z]),q=O[0],$=O[1],M=O[2];z=S.Names.camelCase(z);var I=S.Hooks.getRoot(z),B=!1;if(i(o).isSVG||"tween"===I||S.Names.prefixCheck(I)[1]!==!1||S.Normalizations.registered[I]!==a){(s.display!==a&&null!==s.display&&"none"!==s.display||s.visibility!==a&&"hidden"!==s.visibility)&&/opacity|filter/.test(z)&&!M&&0!==q&&(M=0),s._cacheValues&&E&&E[z]?(M===a&&(M=E[z].endValue+E[z].unitType),B=i(o).rootPropertyValueCache[I]):S.Hooks.registered[z]?M===a?(B=S.getPropertyValue(o,I),M=S.getPropertyValue(o,z,B)):B=S.Hooks.templates[I][1]:M===a&&(M=S.getPropertyValue(o,z));var W,G,Y,D=!1;if(W=d(z,M),M=W[0],Y=W[1],W=d(z,q),q=W[0].replace(/^([+-\/*])=/,function(e,t){return D=t,""}),G=W[1],M=parseFloat(M)||0,q=parseFloat(q)||0,"%"===G&&(/^(fontSize|lineHeight)$/.test(z)?(q/=100,G="em"):/^scale/.test(z)?(q/=100,G=""):/(Red|Green|Blue)$/i.test(z)&&(q=q/100*255,G="")),/[\/*]/.test(D))G=Y;else if(Y!==G&&0!==M)if(0===q)G=Y;else{n=n||h();var Q=/margin|padding|left|right|width|text|word|letter/i.test(z)||/X$/.test(z)||"x"===z?"x":"y";switch(Y){case"%":M*="x"===Q?n.percentToPxWidth:n.percentToPxHeight;break;case"px":break;default:M*=n[Y+"ToPx"]}switch(G){case"%":M*=1/("x"===Q?n.percentToPxWidth:n.percentToPxHeight);break;case"px":break;default:M*=1/n[G+"ToPx"]}}switch(D){case"+":q=M+q;break;case"-":q=M-q;break;case"*":q=M*q;break;case"/":q=M/q}l[z]={rootPropertyValue:B,startValue:M,currentValue:M,endValue:q,unitType:G,easing:$},b.debug&&console.log("tweensContainer ("+z+"): "+JSON.stringify(l[z]),o)}else b.debug&&console.log("Skipping ["+I+"] due to a lack of browser support.")}l.element=o}l.element&&(S.Values.addClass(o,"velocity-animating"),R.push(l),""===s.queue&&(i(o).tweensContainer=l,i(o).opts=s),i(o).isAnimating=!0,V===w-1?(b.State.calls.push([R,g,s,null,k.resolver]),b.State.isTicking===!1&&(b.State.isTicking=!0,c())):V++)}var n,o=this,s=f.extend({},b.defaults,v),l={};switch(i(o)===a&&b.init(o),parseFloat(s.delay)&&s.queue!==!1&&f.queue(o,s.queue,function(e){b.velocityQueueEntryFlag=!0,i(o).delayTimer={setTimeout:setTimeout(e,parseFloat(s.delay)),next:e}}),s.duration.toString().toLowerCase()){case"fast":s.duration=200;break;case"normal":s.duration=h;break;case"slow":s.duration=600;break;default:s.duration=parseFloat(s.duration)||1}b.mock!==!1&&(b.mock===!0?s.duration=s.delay=1:(s.duration*=parseFloat(b.mock)||1,s.delay*=parseFloat(b.mock)||1)),s.easing=u(s.easing,s.duration),s.begin&&!m.isFunction(s.begin)&&(s.begin=null),s.progress&&!m.isFunction(s.progress)&&(s.progress=null),s.complete&&!m.isFunction(s.complete)&&(s.complete=null),s.display!==a&&null!==s.display&&(s.display=s.display.toString().toLowerCase(),"auto"===s.display&&(s.display=b.CSS.Values.getDisplayType(o))),s.visibility!==a&&null!==s.visibility&&(s.visibility=s.visibility.toString().toLowerCase()),s.mobileHA=s.mobileHA&&b.State.isMobile&&!b.State.isGingerbread,s.queue===!1?s.delay?setTimeout(e,s.delay):e():f.queue(o,s.queue,function(t,r){return r===!0?(k.promise&&k.resolver(g),!0):(b.velocityQueueEntryFlag=!0,void e(t))}),""!==s.queue&&"fx"!==s.queue||"inprogress"===f.queue(o)[0]||f.dequeue(o)}var s,l,d,g,y,v,x=arguments[0]&&(arguments[0].p||f.isPlainObject(arguments[0].properties)&&!arguments[0].properties.names||m.isString(arguments[0].properties));if(m.isWrapped(this)?(s=!1,d=0,g=this,l=this):(s=!0,d=1,g=x?arguments[0].elements||arguments[0].e:arguments[0]),g=o(g)){x?(y=arguments[0].properties||arguments[0].p,v=arguments[0].options||arguments[0].o):(y=arguments[d],v=arguments[d+1]);var w=g.length,V=0;if(!/^(stop|finish)$/i.test(y)&&!f.isPlainObject(v)){var C=d+1;v={};for(var T=C;T<arguments.length;T++)m.isArray(arguments[T])||!/^(fast|normal|slow)$/i.test(arguments[T])&&!/^\d/.test(arguments[T])?m.isString(arguments[T])||m.isArray(arguments[T])?v.easing=arguments[T]:m.isFunction(arguments[T])&&(v.complete=arguments[T]):v.duration=arguments[T]}var k={promise:null,resolver:null,rejecter:null};s&&b.Promise&&(k.promise=new b.Promise(function(e,t){k.resolver=e,k.rejecter=t}));var A;switch(y){case"scroll":A="scroll";break;case"reverse":A="reverse";break;case"finish":case"stop":f.each(g,function(e,t){i(t)&&i(t).delayTimer&&(clearTimeout(i(t).delayTimer.setTimeout),i(t).delayTimer.next&&i(t).delayTimer.next(),delete i(t).delayTimer)});var F=[];return f.each(b.State.calls,function(e,t){t&&f.each(t[1],function(r,n){var o=v===a?"":v;return o===!0||t[2].queue===o||v===a&&t[2].queue===!1?void f.each(g,function(r,a){a===n&&((v===!0||m.isString(v))&&(f.each(f.queue(a,m.isString(v)?v:""),function(e,t){ +m.isFunction(t)&&t(null,!0)}),f.queue(a,m.isString(v)?v:"",[])),"stop"===y?(i(a)&&i(a).tweensContainer&&o!==!1&&f.each(i(a).tweensContainer,function(e,t){t.endValue=t.currentValue}),F.push(e)):"finish"===y&&(t[2].duration=1))}):!0})}),"stop"===y&&(f.each(F,function(e,t){p(t,!0)}),k.promise&&k.resolver(g)),e();default:if(!f.isPlainObject(y)||m.isEmptyObject(y)){if(m.isString(y)&&b.Redirects[y]){var j=f.extend({},v),E=j.duration,H=j.delay||0;return j.backwards===!0&&(g=f.extend(!0,[],g).reverse()),f.each(g,function(e,t){parseFloat(j.stagger)?j.delay=H+parseFloat(j.stagger)*e:m.isFunction(j.stagger)&&(j.delay=H+j.stagger.call(t,e,w)),j.drag&&(j.duration=parseFloat(E)||(/^(callout|transition)/.test(y)?1e3:h),j.duration=Math.max(j.duration*(j.backwards?1-e/w:(e+1)/w),.75*j.duration,200)),b.Redirects[y].call(t,t,j||{},e,w,g,k.promise?k:a)}),e()}var N="Velocity: First argument ("+y+") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise?k.rejecter(new Error(N)):console.log(N),e()}A="start"}var L={lastParent:null,lastPosition:null,lastFontSize:null,lastPercentToPxWidth:null,lastPercentToPxHeight:null,lastEmToPx:null,remToPx:null,vwToPx:null,vhToPx:null},R=[];f.each(g,function(e,t){m.isNode(t)&&n.call(t)});var z,j=f.extend({},b.defaults,v);if(j.loop=parseInt(j.loop),z=2*j.loop-1,j.loop)for(var O=0;z>O;O++){var q={delay:j.delay,progress:j.progress};O===z-1&&(q.display=j.display,q.visibility=j.visibility,q.complete=j.complete),P(g,"reverse",q)}return e()}};b=f.extend(P,b),b.animate=P;var w=t.requestAnimationFrame||g;return b.State.isMobile||r.hidden===a||r.addEventListener("visibilitychange",function(){r.hidden?(w=function(e){return setTimeout(function(){e(!0)},16)},c()):w=t.requestAnimationFrame||g}),e.Velocity=b,e!==t&&(e.fn.velocity=P,e.fn.velocity.defaults=b.defaults),f.each(["Down","Up"],function(e,t){b.Redirects["slide"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u=l.begin,c=l.complete,p={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},d={};l.display===a&&(l.display="Down"===t?"inline"===b.CSS.Values.getDisplayType(e)?"inline-block":"block":"none"),l.begin=function(){u&&u.call(i,i);for(var r in p){d[r]=e.style[r];var a=b.CSS.getPropertyValue(e,r);p[r]="Down"===t?[a,0]:[0,a]}d.overflow=e.style.overflow,e.style.overflow="hidden"},l.complete=function(){for(var t in d)e.style[t]=d[t];c&&c.call(i,i),s&&s.resolver(i)},b(e,p,l)}}),f.each(["In","Out"],function(e,t){b.Redirects["fade"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u={opacity:"In"===t?1:0},c=l.complete;l.complete=n!==o-1?l.begin=null:function(){c&&c.call(i,i),s&&s.resolver(i)},l.display===a&&(l.display="In"===t?"auto":"none"),b(this,u,l)}}),b}(window.jQuery||window.Zepto||window,window,document)})); +;!function(a,b,c,d){"use strict";function k(a,b,c){return setTimeout(q(a,c),b)}function l(a,b,c){return Array.isArray(a)?(m(a,c[b],c),!0):!1}function m(a,b,c){var e;if(a)if(a.forEach)a.forEach(b,c);else if(a.length!==d)for(e=0;e<a.length;)b.call(c,a[e],e,a),e++;else for(e in a)a.hasOwnProperty(e)&&b.call(c,a[e],e,a)}function n(a,b,c){for(var e=Object.keys(b),f=0;f<e.length;)(!c||c&&a[e[f]]===d)&&(a[e[f]]=b[e[f]]),f++;return a}function o(a,b){return n(a,b,!0)}function p(a,b,c){var e,d=b.prototype;e=a.prototype=Object.create(d),e.constructor=a,e._super=d,c&&n(e,c)}function q(a,b){return function(){return a.apply(b,arguments)}}function r(a,b){return typeof a==g?a.apply(b?b[0]||d:d,b):a}function s(a,b){return a===d?b:a}function t(a,b,c){m(x(b),function(b){a.addEventListener(b,c,!1)})}function u(a,b,c){m(x(b),function(b){a.removeEventListener(b,c,!1)})}function v(a,b){for(;a;){if(a==b)return!0;a=a.parentNode}return!1}function w(a,b){return a.indexOf(b)>-1}function x(a){return a.trim().split(/\s+/g)}function y(a,b,c){if(a.indexOf&&!c)return a.indexOf(b);for(var d=0;d<a.length;){if(c&&a[d][c]==b||!c&&a[d]===b)return d;d++}return-1}function z(a){return Array.prototype.slice.call(a,0)}function A(a,b,c){for(var d=[],e=[],f=0;f<a.length;){var g=b?a[f][b]:a[f];y(e,g)<0&&d.push(a[f]),e[f]=g,f++}return c&&(d=b?d.sort(function(a,c){return a[b]>c[b]}):d.sort()),d}function B(a,b){for(var c,f,g=b[0].toUpperCase()+b.slice(1),h=0;h<e.length;){if(c=e[h],f=c?c+g:b,f in a)return f;h++}return d}function D(){return C++}function E(a){var b=a.ownerDocument;return b.defaultView||b.parentWindow}function ab(a,b){var c=this;this.manager=a,this.callback=b,this.element=a.element,this.target=a.options.inputTarget,this.domHandler=function(b){r(a.options.enable,[a])&&c.handler(b)},this.init()}function bb(a){var b,c=a.options.inputClass;return b=c?c:H?wb:I?Eb:G?Gb:rb,new b(a,cb)}function cb(a,b,c){var d=c.pointers.length,e=c.changedPointers.length,f=b&O&&0===d-e,g=b&(Q|R)&&0===d-e;c.isFirst=!!f,c.isFinal=!!g,f&&(a.session={}),c.eventType=b,db(a,c),a.emit("hammer.input",c),a.recognize(c),a.session.prevInput=c}function db(a,b){var c=a.session,d=b.pointers,e=d.length;c.firstInput||(c.firstInput=gb(b)),e>1&&!c.firstMultiple?c.firstMultiple=gb(b):1===e&&(c.firstMultiple=!1);var f=c.firstInput,g=c.firstMultiple,h=g?g.center:f.center,i=b.center=hb(d);b.timeStamp=j(),b.deltaTime=b.timeStamp-f.timeStamp,b.angle=lb(h,i),b.distance=kb(h,i),eb(c,b),b.offsetDirection=jb(b.deltaX,b.deltaY),b.scale=g?nb(g.pointers,d):1,b.rotation=g?mb(g.pointers,d):0,fb(c,b);var k=a.element;v(b.srcEvent.target,k)&&(k=b.srcEvent.target),b.target=k}function eb(a,b){var c=b.center,d=a.offsetDelta||{},e=a.prevDelta||{},f=a.prevInput||{};(b.eventType===O||f.eventType===Q)&&(e=a.prevDelta={x:f.deltaX||0,y:f.deltaY||0},d=a.offsetDelta={x:c.x,y:c.y}),b.deltaX=e.x+(c.x-d.x),b.deltaY=e.y+(c.y-d.y)}function fb(a,b){var f,g,h,j,c=a.lastInterval||b,e=b.timeStamp-c.timeStamp;if(b.eventType!=R&&(e>N||c.velocity===d)){var k=c.deltaX-b.deltaX,l=c.deltaY-b.deltaY,m=ib(e,k,l);g=m.x,h=m.y,f=i(m.x)>i(m.y)?m.x:m.y,j=jb(k,l),a.lastInterval=b}else f=c.velocity,g=c.velocityX,h=c.velocityY,j=c.direction;b.velocity=f,b.velocityX=g,b.velocityY=h,b.direction=j}function gb(a){for(var b=[],c=0;c<a.pointers.length;)b[c]={clientX:h(a.pointers[c].clientX),clientY:h(a.pointers[c].clientY)},c++;return{timeStamp:j(),pointers:b,center:hb(b),deltaX:a.deltaX,deltaY:a.deltaY}}function hb(a){var b=a.length;if(1===b)return{x:h(a[0].clientX),y:h(a[0].clientY)};for(var c=0,d=0,e=0;b>e;)c+=a[e].clientX,d+=a[e].clientY,e++;return{x:h(c/b),y:h(d/b)}}function ib(a,b,c){return{x:b/a||0,y:c/a||0}}function jb(a,b){return a===b?S:i(a)>=i(b)?a>0?T:U:b>0?V:W}function kb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return Math.sqrt(d*d+e*e)}function lb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return 180*Math.atan2(e,d)/Math.PI}function mb(a,b){return lb(b[1],b[0],_)-lb(a[1],a[0],_)}function nb(a,b){return kb(b[0],b[1],_)/kb(a[0],a[1],_)}function rb(){this.evEl=pb,this.evWin=qb,this.allow=!0,this.pressed=!1,ab.apply(this,arguments)}function wb(){this.evEl=ub,this.evWin=vb,ab.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function Ab(){this.evTarget=yb,this.evWin=zb,this.started=!1,ab.apply(this,arguments)}function Bb(a,b){var c=z(a.touches),d=z(a.changedTouches);return b&(Q|R)&&(c=A(c.concat(d),"identifier",!0)),[c,d]}function Eb(){this.evTarget=Db,this.targetIds={},ab.apply(this,arguments)}function Fb(a,b){var c=z(a.touches),d=this.targetIds;if(b&(O|P)&&1===c.length)return d[c[0].identifier]=!0,[c,c];var e,f,g=z(a.changedTouches),h=[],i=this.target;if(f=c.filter(function(a){return v(a.target,i)}),b===O)for(e=0;e<f.length;)d[f[e].identifier]=!0,e++;for(e=0;e<g.length;)d[g[e].identifier]&&h.push(g[e]),b&(Q|R)&&delete d[g[e].identifier],e++;return h.length?[A(f.concat(h),"identifier",!0),h]:void 0}function Gb(){ab.apply(this,arguments);var a=q(this.handler,this);this.touch=new Eb(this.manager,a),this.mouse=new rb(this.manager,a)}function Pb(a,b){this.manager=a,this.set(b)}function Qb(a){if(w(a,Mb))return Mb;var b=w(a,Nb),c=w(a,Ob);return b&&c?Nb+" "+Ob:b||c?b?Nb:Ob:w(a,Lb)?Lb:Kb}function Yb(a){this.id=D(),this.manager=null,this.options=o(a||{},this.defaults),this.options.enable=s(this.options.enable,!0),this.state=Rb,this.simultaneous={},this.requireFail=[]}function Zb(a){return a&Wb?"cancel":a&Ub?"end":a&Tb?"move":a&Sb?"start":""}function $b(a){return a==W?"down":a==V?"up":a==T?"left":a==U?"right":""}function _b(a,b){var c=b.manager;return c?c.get(a):a}function ac(){Yb.apply(this,arguments)}function bc(){ac.apply(this,arguments),this.pX=null,this.pY=null}function cc(){ac.apply(this,arguments)}function dc(){Yb.apply(this,arguments),this._timer=null,this._input=null}function ec(){ac.apply(this,arguments)}function fc(){ac.apply(this,arguments)}function gc(){Yb.apply(this,arguments),this.pTime=!1,this.pCenter=!1,this._timer=null,this._input=null,this.count=0}function hc(a,b){return b=b||{},b.recognizers=s(b.recognizers,hc.defaults.preset),new kc(a,b)}function kc(a,b){b=b||{},this.options=o(b,hc.defaults),this.options.inputTarget=this.options.inputTarget||a,this.handlers={},this.session={},this.recognizers=[],this.element=a,this.input=bb(this),this.touchAction=new Pb(this,this.options.touchAction),lc(this,!0),m(b.recognizers,function(a){var b=this.add(new a[0](a[1]));a[2]&&b.recognizeWith(a[2]),a[3]&&b.requireFailure(a[3])},this)}function lc(a,b){var c=a.element;m(a.options.cssProps,function(a,d){c.style[B(c.style,d)]=b?a:""})}function mc(a,c){var d=b.createEvent("Event");d.initEvent(a,!0,!0),d.gesture=c,c.target.dispatchEvent(d)}var e=["","webkit","moz","MS","ms","o"],f=b.createElement("div"),g="function",h=Math.round,i=Math.abs,j=Date.now,C=1,F=/mobile|tablet|ip(ad|hone|od)|android/i,G="ontouchstart"in a,H=B(a,"PointerEvent")!==d,I=G&&F.test(navigator.userAgent),J="touch",K="pen",L="mouse",M="kinect",N=25,O=1,P=2,Q=4,R=8,S=1,T=2,U=4,V=8,W=16,X=T|U,Y=V|W,Z=X|Y,$=["x","y"],_=["clientX","clientY"];ab.prototype={handler:function(){},init:function(){this.evEl&&t(this.element,this.evEl,this.domHandler),this.evTarget&&t(this.target,this.evTarget,this.domHandler),this.evWin&&t(E(this.element),this.evWin,this.domHandler)},destroy:function(){this.evEl&&u(this.element,this.evEl,this.domHandler),this.evTarget&&u(this.target,this.evTarget,this.domHandler),this.evWin&&u(E(this.element),this.evWin,this.domHandler)}};var ob={mousedown:O,mousemove:P,mouseup:Q},pb="mousedown",qb="mousemove mouseup";p(rb,ab,{handler:function(a){var b=ob[a.type];b&O&&0===a.button&&(this.pressed=!0),b&P&&1!==a.which&&(b=Q),this.pressed&&this.allow&&(b&Q&&(this.pressed=!1),this.callback(this.manager,b,{pointers:[a],changedPointers:[a],pointerType:L,srcEvent:a}))}});var sb={pointerdown:O,pointermove:P,pointerup:Q,pointercancel:R,pointerout:R},tb={2:J,3:K,4:L,5:M},ub="pointerdown",vb="pointermove pointerup pointercancel";a.MSPointerEvent&&(ub="MSPointerDown",vb="MSPointerMove MSPointerUp MSPointerCancel"),p(wb,ab,{handler:function(a){var b=this.store,c=!1,d=a.type.toLowerCase().replace("ms",""),e=sb[d],f=tb[a.pointerType]||a.pointerType,g=f==J,h=y(b,a.pointerId,"pointerId");e&O&&(0===a.button||g)?0>h&&(b.push(a),h=b.length-1):e&(Q|R)&&(c=!0),0>h||(b[h]=a,this.callback(this.manager,e,{pointers:b,changedPointers:[a],pointerType:f,srcEvent:a}),c&&b.splice(h,1))}});var xb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},yb="touchstart",zb="touchstart touchmove touchend touchcancel";p(Ab,ab,{handler:function(a){var b=xb[a.type];if(b===O&&(this.started=!0),this.started){var c=Bb.call(this,a,b);b&(Q|R)&&0===c[0].length-c[1].length&&(this.started=!1),this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}});var Cb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},Db="touchstart touchmove touchend touchcancel";p(Eb,ab,{handler:function(a){var b=Cb[a.type],c=Fb.call(this,a,b);c&&this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}),p(Gb,ab,{handler:function(a,b,c){var d=c.pointerType==J,e=c.pointerType==L;if(d)this.mouse.allow=!1;else if(e&&!this.mouse.allow)return;b&(Q|R)&&(this.mouse.allow=!0),this.callback(a,b,c)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Hb=B(f.style,"touchAction"),Ib=Hb!==d,Jb="compute",Kb="auto",Lb="manipulation",Mb="none",Nb="pan-x",Ob="pan-y";Pb.prototype={set:function(a){a==Jb&&(a=this.compute()),Ib&&(this.manager.element.style[Hb]=a),this.actions=a.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var a=[];return m(this.manager.recognizers,function(b){r(b.options.enable,[b])&&(a=a.concat(b.getTouchAction()))}),Qb(a.join(" "))},preventDefaults:function(a){if(!Ib){var b=a.srcEvent,c=a.offsetDirection;if(this.manager.session.prevented)return b.preventDefault(),void 0;var d=this.actions,e=w(d,Mb),f=w(d,Ob),g=w(d,Nb);return e||f&&c&X||g&&c&Y?this.preventSrc(b):void 0}},preventSrc:function(a){this.manager.session.prevented=!0,a.preventDefault()}};var Rb=1,Sb=2,Tb=4,Ub=8,Vb=Ub,Wb=16,Xb=32;Yb.prototype={defaults:{},set:function(a){return n(this.options,a),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(a){if(l(a,"recognizeWith",this))return this;var b=this.simultaneous;return a=_b(a,this),b[a.id]||(b[a.id]=a,a.recognizeWith(this)),this},dropRecognizeWith:function(a){return l(a,"dropRecognizeWith",this)?this:(a=_b(a,this),delete this.simultaneous[a.id],this)},requireFailure:function(a){if(l(a,"requireFailure",this))return this;var b=this.requireFail;return a=_b(a,this),-1===y(b,a)&&(b.push(a),a.requireFailure(this)),this},dropRequireFailure:function(a){if(l(a,"dropRequireFailure",this))return this;a=_b(a,this);var b=y(this.requireFail,a);return b>-1&&this.requireFail.splice(b,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(a){return!!this.simultaneous[a.id]},emit:function(a){function d(d){b.manager.emit(b.options.event+(d?Zb(c):""),a)}var b=this,c=this.state;Ub>c&&d(!0),d(),c>=Ub&&d(!0)},tryEmit:function(a){return this.canEmit()?this.emit(a):(this.state=Xb,void 0)},canEmit:function(){for(var a=0;a<this.requireFail.length;){if(!(this.requireFail[a].state&(Xb|Rb)))return!1;a++}return!0},recognize:function(a){var b=n({},a);return r(this.options.enable,[this,b])?(this.state&(Vb|Wb|Xb)&&(this.state=Rb),this.state=this.process(b),this.state&(Sb|Tb|Ub|Wb)&&this.tryEmit(b),void 0):(this.reset(),this.state=Xb,void 0)},process:function(){},getTouchAction:function(){},reset:function(){}},p(ac,Yb,{defaults:{pointers:1},attrTest:function(a){var b=this.options.pointers;return 0===b||a.pointers.length===b},process:function(a){var b=this.state,c=a.eventType,d=b&(Sb|Tb),e=this.attrTest(a);return d&&(c&R||!e)?b|Wb:d||e?c&Q?b|Ub:b&Sb?b|Tb:Sb:Xb}}),p(bc,ac,{defaults:{event:"pan",threshold:10,pointers:1,direction:Z},getTouchAction:function(){var a=this.options.direction,b=[];return a&X&&b.push(Ob),a&Y&&b.push(Nb),b},directionTest:function(a){var b=this.options,c=!0,d=a.distance,e=a.direction,f=a.deltaX,g=a.deltaY;return e&b.direction||(b.direction&X?(e=0===f?S:0>f?T:U,c=f!=this.pX,d=Math.abs(a.deltaX)):(e=0===g?S:0>g?V:W,c=g!=this.pY,d=Math.abs(a.deltaY))),a.direction=e,c&&d>b.threshold&&e&b.direction},attrTest:function(a){return ac.prototype.attrTest.call(this,a)&&(this.state&Sb||!(this.state&Sb)&&this.directionTest(a))},emit:function(a){this.pX=a.deltaX,this.pY=a.deltaY;var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this._super.emit.call(this,a)}}),p(cc,ac,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.scale-1)>this.options.threshold||this.state&Sb)},emit:function(a){if(this._super.emit.call(this,a),1!==a.scale){var b=a.scale<1?"in":"out";this.manager.emit(this.options.event+b,a)}}}),p(dc,Yb,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[Kb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,e=a.deltaTime>b.time;if(this._input=a,!d||!c||a.eventType&(Q|R)&&!e)this.reset();else if(a.eventType&O)this.reset(),this._timer=k(function(){this.state=Vb,this.tryEmit()},b.time,this);else if(a.eventType&Q)return Vb;return Xb},reset:function(){clearTimeout(this._timer)},emit:function(a){this.state===Vb&&(a&&a.eventType&Q?this.manager.emit(this.options.event+"up",a):(this._input.timeStamp=j(),this.manager.emit(this.options.event,this._input)))}}),p(ec,ac,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.rotation)>this.options.threshold||this.state&Sb)}}),p(fc,ac,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:X|Y,pointers:1},getTouchAction:function(){return bc.prototype.getTouchAction.call(this)},attrTest:function(a){var c,b=this.options.direction;return b&(X|Y)?c=a.velocity:b&X?c=a.velocityX:b&Y&&(c=a.velocityY),this._super.attrTest.call(this,a)&&b&a.direction&&a.distance>this.options.threshold&&i(c)>this.options.velocity&&a.eventType&Q},emit:function(a){var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this.manager.emit(this.options.event,a)}}),p(gc,Yb,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[Lb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,e=a.deltaTime<b.time;if(this.reset(),a.eventType&O&&0===this.count)return this.failTimeout();if(d&&e&&c){if(a.eventType!=Q)return this.failTimeout();var f=this.pTime?a.timeStamp-this.pTime<b.interval:!0,g=!this.pCenter||kb(this.pCenter,a.center)<b.posThreshold;this.pTime=a.timeStamp,this.pCenter=a.center,g&&f?this.count+=1:this.count=1,this._input=a;var h=this.count%b.taps;if(0===h)return this.hasRequireFailures()?(this._timer=k(function(){this.state=Vb,this.tryEmit()},b.interval,this),Sb):Vb}return Xb},failTimeout:function(){return this._timer=k(function(){this.state=Xb},this.options.interval,this),Xb},reset:function(){clearTimeout(this._timer)},emit:function(){this.state==Vb&&(this._input.tapCount=this.count,this.manager.emit(this.options.event,this._input))}}),hc.VERSION="2.0.4",hc.defaults={domEvents:!1,touchAction:Jb,enable:!0,inputTarget:null,inputClass:null,preset:[[ec,{enable:!1}],[cc,{enable:!1},["rotate"]],[fc,{direction:X}],[bc,{direction:X},["swipe"]],[gc],[gc,{event:"doubletap",taps:2},["tap"]],[dc]],cssProps:{userSelect:"default",touchSelect:"none",touchCallout:"none",contentZooming:"none",userDrag:"none",tapHighlightColor:"rgba(0,0,0,0)"}};var ic=1,jc=2;kc.prototype={set:function(a){return n(this.options,a),a.touchAction&&this.touchAction.update(),a.inputTarget&&(this.input.destroy(),this.input.target=a.inputTarget,this.input.init()),this},stop:function(a){this.session.stopped=a?jc:ic},recognize:function(a){var b=this.session;if(!b.stopped){this.touchAction.preventDefaults(a);var c,d=this.recognizers,e=b.curRecognizer;(!e||e&&e.state&Vb)&&(e=b.curRecognizer=null);for(var f=0;f<d.length;)c=d[f],b.stopped===jc||e&&c!=e&&!c.canRecognizeWith(e)?c.reset():c.recognize(a),!e&&c.state&(Sb|Tb|Ub)&&(e=b.curRecognizer=c),f++}},get:function(a){if(a instanceof Yb)return a;for(var b=this.recognizers,c=0;c<b.length;c++)if(b[c].options.event==a)return b[c];return null},add:function(a){if(l(a,"add",this))return this;var b=this.get(a.options.event);return b&&this.remove(b),this.recognizers.push(a),a.manager=this,this.touchAction.update(),a},remove:function(a){if(l(a,"remove",this))return this;var b=this.recognizers;return a=this.get(a),b.splice(y(b,a),1),this.touchAction.update(),this},on:function(a,b){var c=this.handlers;return m(x(a),function(a){c[a]=c[a]||[],c[a].push(b)}),this},off:function(a,b){var c=this.handlers;return m(x(a),function(a){b?c[a].splice(y(c[a],b),1):delete c[a]}),this},emit:function(a,b){this.options.domEvents&&mc(a,b);var c=this.handlers[a]&&this.handlers[a].slice();if(c&&c.length){b.type=a,b.preventDefault=function(){b.srcEvent.preventDefault()};for(var d=0;d<c.length;)c[d](b),d++}},destroy:function(){this.element&&lc(this,!1),this.handlers={},this.session={},this.input.destroy(),this.element=null}},n(hc,{INPUT_START:O,INPUT_MOVE:P,INPUT_END:Q,INPUT_CANCEL:R,STATE_POSSIBLE:Rb,STATE_BEGAN:Sb,STATE_CHANGED:Tb,STATE_ENDED:Ub,STATE_RECOGNIZED:Vb,STATE_CANCELLED:Wb,STATE_FAILED:Xb,DIRECTION_NONE:S,DIRECTION_LEFT:T,DIRECTION_RIGHT:U,DIRECTION_UP:V,DIRECTION_DOWN:W,DIRECTION_HORIZONTAL:X,DIRECTION_VERTICAL:Y,DIRECTION_ALL:Z,Manager:kc,Input:ab,TouchAction:Pb,TouchInput:Eb,MouseInput:rb,PointerEventInput:wb,TouchMouseInput:Gb,SingleTouchInput:Ab,Recognizer:Yb,AttrRecognizer:ac,Tap:gc,Pan:bc,Swipe:fc,Pinch:cc,Rotate:ec,Press:dc,on:t,off:u,each:m,merge:o,extend:n,inherit:p,bindFn:q,prefixed:B}),typeof define==g&&define.amd?define(function(){return hc}):"undefined"!=typeof module&&module.exports?module.exports=hc:a[c]=hc}(window,document,"Hammer");;(function(factory) { + if (typeof define === 'function' && define.amd) { + define(['jquery', 'hammerjs'], factory); + } else if (typeof exports === 'object') { + factory(require('jquery'), require('hammerjs')); + } else { + factory(jQuery, Hammer); + } +}(function($, Hammer) { + function hammerify(el, options) { + var $el = $(el); + if(!$el.data("hammer")) { + $el.data("hammer", new Hammer($el[0], options)); + } + } + + $.fn.hammer = function(options) { + return this.each(function() { + hammerify(this, options); + }); + }; + + // extend the emit method to also trigger jQuery events + Hammer.Manager.prototype.emit = (function(originalEmit) { + return function(type, data) { + originalEmit.call(this, type, data); + $(this.element).trigger({ + type: type, + gesture: data + }); + }; + })(Hammer.Manager.prototype.emit); +})); +;// Required for Meteor package, the use of window prevents export by Meteor +(function(window){ + if(window.Package){ + Materialize = {}; + } else { + window.Materialize = {}; + } +})(window); + + +/* + * raf.js + * https://github.com/ngryman/raf.js + * + * original requestAnimationFrame polyfill by Erik Möller + * inspired from paul_irish gist and post + * + * Copyright (c) 2013 ngryman + * Licensed under the MIT license. + */ +(function(window) { + var lastTime = 0, + vendors = ['webkit', 'moz'], + requestAnimationFrame = window.requestAnimationFrame, + cancelAnimationFrame = window.cancelAnimationFrame, + i = vendors.length; + + // try to un-prefix existing raf + while (--i >= 0 && !requestAnimationFrame) { + requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame']; + cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame']; + } + + // polyfill with setTimeout fallback + // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945 + if (!requestAnimationFrame || !cancelAnimationFrame) { + requestAnimationFrame = function(callback) { + var now = +Date.now(), + nextTime = Math.max(lastTime + 16, now); + return setTimeout(function() { + callback(lastTime = nextTime); + }, nextTime - now); + }; + + cancelAnimationFrame = clearTimeout; + } + + // export to window + window.requestAnimationFrame = requestAnimationFrame; + window.cancelAnimationFrame = cancelAnimationFrame; +}(window)); + + +// Unique ID +Materialize.guid = (function() { + function s4() { + return Math.floor((1 + Math.random()) * 0x10000) + .toString(16) + .substring(1); + } + return function() { + return s4() + s4() + '-' + s4() + '-' + s4() + '-' + + s4() + '-' + s4() + s4() + s4(); + }; +})(); + +/** + * Escapes hash from special characters + * @param {string} hash String returned from this.hash + * @returns {string} + */ +Materialize.escapeHash = function(hash) { + return hash.replace( /(:|\.|\[|\]|,|=)/g, "\\$1" ); +}; + +Materialize.elementOrParentIsFixed = function(element) { + var $element = $(element); + var $checkElements = $element.add($element.parents()); + var isFixed = false; + $checkElements.each(function(){ + if ($(this).css("position") === "fixed") { + isFixed = true; + return false; + } + }); + return isFixed; +}; + + +/** + * Get time in ms + * @license https://raw.github.com/jashkenas/underscore/master/LICENSE + * @type {function} + * @return {number} + */ +var getTime = (Date.now || function () { + return new Date().getTime(); +}); + + +/** + * Returns a function, that, when invoked, will only be triggered at most once + * during a given window of time. Normally, the throttled function will run + * as much as it can, without ever going more than once per `wait` duration; + * but if you'd like to disable the execution on the leading edge, pass + * `{leading: false}`. To disable execution on the trailing edge, ditto. + * @license https://raw.github.com/jashkenas/underscore/master/LICENSE + * @param {function} func + * @param {number} wait + * @param {Object=} options + * @returns {Function} + */ +Materialize.throttle = function(func, wait, options) { + var context, args, result; + var timeout = null; + var previous = 0; + options || (options = {}); + var later = function () { + previous = options.leading === false ? 0 : getTime(); + timeout = null; + result = func.apply(context, args); + context = args = null; + }; + return function () { + var now = getTime(); + if (!previous && options.leading === false) previous = now; + var remaining = wait - (now - previous); + context = this; + args = arguments; + if (remaining <= 0) { + clearTimeout(timeout); + timeout = null; + previous = now; + result = func.apply(context, args); + context = args = null; + } else if (!timeout && options.trailing !== false) { + timeout = setTimeout(later, remaining); + } + return result; + }; +}; + + +// Velocity has conflicts when loaded with jQuery, this will check for it +// First, check if in noConflict mode +var Vel; +if (jQuery) { + Vel = jQuery.Velocity; +} else if ($) { + Vel = $.Velocity; +} else { + Vel = Velocity; +} +;(function ($) { + $.fn.collapsible = function(options) { + var defaults = { + accordion: undefined, + onOpen: undefined, + onClose: undefined + }; + + options = $.extend(defaults, options); + + + return this.each(function() { + + var $this = $(this); + + var $panel_headers = $(this).find('> li > .collapsible-header'); + + var collapsible_type = $this.data("collapsible"); + + // Turn off any existing event handlers + $this.off('click.collapse', '> li > .collapsible-header'); + $panel_headers.off('click.collapse'); + + + /**************** + Helper Functions + ****************/ + + // Accordion Open + function accordionOpen(object) { + $panel_headers = $this.find('> li > .collapsible-header'); + if (object.hasClass('active')) { + object.parent().addClass('active'); + } + else { + object.parent().removeClass('active'); + } + if (object.parent().hasClass('active')){ + object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + else{ + object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + + $panel_headers.not(object).removeClass('active').parent().removeClass('active'); + + // Close previously open accordion elements. + $panel_headers.not(object).parent().children('.collapsible-body').stop(true,false).each(function() { + if ($(this).is(':visible')) { + $(this).slideUp({ + duration: 350, + easing: "easeOutQuart", + queue: false, + complete: + function() { + $(this).css('height', ''); + execCallbacks($(this).siblings('.collapsible-header')); + } + }); + } + }); + } + + // Expandable Open + function expandableOpen(object) { + if (object.hasClass('active')) { + object.parent().addClass('active'); + } + else { + object.parent().removeClass('active'); + } + if (object.parent().hasClass('active')){ + object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + else { + object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + } + + // Open collapsible. object: .collapsible-header + function collapsibleOpen(object) { + if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion + accordionOpen(object); + } else { // Handle Expandables + expandableOpen(object); + } + + execCallbacks(object); + } + + // Handle callbacks + function execCallbacks(object) { + if (object.hasClass('active')) { + if (typeof(options.onOpen) === "function") { + options.onOpen.call(this, object.parent()); + } + } else { + if (typeof(options.onClose) === "function") { + options.onClose.call(this, object.parent()); + } + } + } + + /** + * Check if object is children of panel header + * @param {Object} object Jquery object + * @return {Boolean} true if it is children + */ + function isChildrenOfPanelHeader(object) { + + var panelHeader = getPanelHeader(object); + + return panelHeader.length > 0; + } + + /** + * Get panel header from a children element + * @param {Object} object Jquery object + * @return {Object} panel header object + */ + function getPanelHeader(object) { + + return object.closest('li > .collapsible-header'); + } + + /***** End Helper Functions *****/ + + + + // Add click handler to only direct collapsible header children + $this.on('click.collapse', '> li > .collapsible-header', function(e) { + var element = $(e.target); + + if (isChildrenOfPanelHeader(element)) { + element = getPanelHeader(element); + } + + element.toggleClass('active'); + + collapsibleOpen(element); + }); + + + // Open first active + if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion + collapsibleOpen($panel_headers.filter('.active').first()); + + } else { // Handle Expandables + $panel_headers.filter('.active').each(function() { + collapsibleOpen($(this)); + }); + } + + }); + }; + + $(document).ready(function(){ + $('.collapsible').collapsible(); + }); +}( jQuery ));;(function ($) { + + // Add posibility to scroll to selected option + // usefull for select for example + $.fn.scrollTo = function(elem) { + $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top); + return this; + }; + + $.fn.dropdown = function (options) { + var defaults = { + inDuration: 300, + outDuration: 225, + constrainWidth: true, // Constrains width of dropdown to the activator + hover: false, + gutter: 0, // Spacing from edge + belowOrigin: false, + alignment: 'left', + stopPropagation: false + }; + + // Open dropdown. + if (options === "open") { + this.each(function() { + $(this).trigger('open'); + }); + return false; + } + + // Close dropdown. + if (options === "close") { + this.each(function() { + $(this).trigger('close'); + }); + return false; + } + + this.each(function(){ + var origin = $(this); + var curr_options = $.extend({}, defaults, options); + var isFocused = false; + + // Dropdown menu + var activates = $("#"+ origin.attr('data-activates')); + + function updateOptions() { + if (origin.data('induration') !== undefined) + curr_options.inDuration = origin.data('induration'); + if (origin.data('outduration') !== undefined) + curr_options.outDuration = origin.data('outduration'); + if (origin.data('constrainwidth') !== undefined) + curr_options.constrainWidth = origin.data('constrainwidth'); + if (origin.data('hover') !== undefined) + curr_options.hover = origin.data('hover'); + if (origin.data('gutter') !== undefined) + curr_options.gutter = origin.data('gutter'); + if (origin.data('beloworigin') !== undefined) + curr_options.belowOrigin = origin.data('beloworigin'); + if (origin.data('alignment') !== undefined) + curr_options.alignment = origin.data('alignment'); + if (origin.data('stoppropagation') !== undefined) + curr_options.stopPropagation = origin.data('stoppropagation'); + } + + updateOptions(); + + // Attach dropdown to its activator + origin.after(activates); + + /* + Helper function to position and resize dropdown. + Used in hover and click handler. + */ + function placeDropdown(eventType) { + // Check for simultaneous focus and click events. + if (eventType === 'focus') { + isFocused = true; + } + + // Check html data attributes + updateOptions(); + + // Set Dropdown state + activates.addClass('active'); + origin.addClass('active'); + + // Constrain width + if (curr_options.constrainWidth === true) { + activates.css('width', origin.outerWidth()); + + } else { + activates.css('white-space', 'nowrap'); + } + + // Offscreen detection + var windowHeight = window.innerHeight; + var originHeight = origin.innerHeight(); + var offsetLeft = origin.offset().left; + var offsetTop = origin.offset().top - $(window).scrollTop(); + var currAlignment = curr_options.alignment; + var gutterSpacing = 0; + var leftPosition = 0; + + // Below Origin + var verticalOffset = 0; + if (curr_options.belowOrigin === true) { + verticalOffset = originHeight; + } + + // Check for scrolling positioned container. + var scrollYOffset = 0; + var scrollXOffset = 0; + var wrapper = origin.parent(); + if (!wrapper.is('body')) { + if (wrapper[0].scrollHeight > wrapper[0].clientHeight) { + scrollYOffset = wrapper[0].scrollTop; + } + if (wrapper[0].scrollWidth > wrapper[0].clientWidth) { + scrollXOffset = wrapper[0].scrollLeft; + } + } + + + if (offsetLeft + activates.innerWidth() > $(window).width()) { + // Dropdown goes past screen on right, force right alignment + currAlignment = 'right'; + + } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) { + // Dropdown goes past screen on left, force left alignment + currAlignment = 'left'; + } + // Vertical bottom offscreen detection + if (offsetTop + activates.innerHeight() > windowHeight) { + // If going upwards still goes offscreen, just crop height of dropdown. + if (offsetTop + originHeight - activates.innerHeight() < 0) { + var adjustedHeight = windowHeight - offsetTop - verticalOffset; + activates.css('max-height', adjustedHeight); + } else { + // Flow upwards. + if (!verticalOffset) { + verticalOffset += originHeight; + } + verticalOffset -= activates.innerHeight(); + } + } + + // Handle edge alignment + if (currAlignment === 'left') { + gutterSpacing = curr_options.gutter; + leftPosition = origin.position().left + gutterSpacing; + } + else if (currAlignment === 'right') { + var offsetRight = origin.position().left + origin.outerWidth() - activates.outerWidth(); + gutterSpacing = -curr_options.gutter; + leftPosition = offsetRight + gutterSpacing; + } + + // Position dropdown + activates.css({ + position: 'absolute', + top: origin.position().top + verticalOffset + scrollYOffset, + left: leftPosition + scrollXOffset + }); + + + // Show dropdown + activates.stop(true, true).css('opacity', 0) + .slideDown({ + queue: false, + duration: curr_options.inDuration, + easing: 'easeOutCubic', + complete: function() { + $(this).css('height', ''); + } + }) + .animate( {opacity: 1}, {queue: false, duration: curr_options.inDuration, easing: 'easeOutSine'}); + + // Add click close handler to document + $(document).bind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id'), function (e) { + if (!activates.is(e.target) && !origin.is(e.target) && (!origin.find(e.target).length) ) { + hideDropdown(); + $(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id')); + } + }); + } + + function hideDropdown() { + // Check for simultaneous focus and click events. + isFocused = false; + activates.fadeOut(curr_options.outDuration); + activates.removeClass('active'); + origin.removeClass('active'); + $(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id')); + setTimeout(function() { activates.css('max-height', ''); }, curr_options.outDuration); + } + + // Hover + if (curr_options.hover) { + var open = false; + origin.unbind('click.' + origin.attr('id')); + // Hover handler to show dropdown + origin.on('mouseenter', function(e){ // Mouse over + if (open === false) { + placeDropdown(); + open = true; + } + }); + origin.on('mouseleave', function(e){ + // If hover on origin then to something other than dropdown content, then close + var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element + if(!$(toEl).closest('.dropdown-content').is(activates)) { + activates.stop(true, true); + hideDropdown(); + open = false; + } + }); + + activates.on('mouseleave', function(e){ // Mouse out + var toEl = e.toElement || e.relatedTarget; + if(!$(toEl).closest('.dropdown-button').is(origin)) { + activates.stop(true, true); + hideDropdown(); + open = false; + } + }); + + // Click + } else { + // Click handler to show dropdown + origin.unbind('click.' + origin.attr('id')); + origin.bind('click.'+origin.attr('id'), function(e){ + if (!isFocused) { + if ( origin[0] == e.currentTarget && + !origin.hasClass('active') && + ($(e.target).closest('.dropdown-content').length === 0)) { + e.preventDefault(); // Prevents button click from moving window + if (curr_options.stopPropagation) { + e.stopPropagation(); + } + placeDropdown('click'); + } + // If origin is clicked and menu is open, close menu + else if (origin.hasClass('active')) { + hideDropdown(); + $(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id')); + } + } + }); + + } // End else + + // Listen to open and close event - useful for select component + origin.on('open', function(e, eventType) { + placeDropdown(eventType); + }); + origin.on('close', hideDropdown); + + + }); + }; // End dropdown plugin + + $(document).ready(function(){ + $('.dropdown-button').dropdown(); + }); +}( jQuery )); +;(function($) { + var _stack = 0, + _lastID = 0, + _generateID = function() { + _lastID++; + return 'materialize-modal-overlay-' + _lastID; + }; + + var methods = { + init : function(options) { + var defaults = { + opacity: 0.5, + inDuration: 350, + outDuration: 250, + ready: undefined, + complete: undefined, + dismissible: true, + startingTop: '4%', + endingTop: '10%' + }; + + // Override defaults + options = $.extend(defaults, options); + + return this.each(function() { + var $modal = $(this); + var modal_id = $(this).attr("id") || '#' + $(this).data('target'); + + var closeModal = function() { + var overlayID = $modal.data('overlay-id'); + var $overlay = $('#' + overlayID); + $modal.removeClass('open'); + + // Enable scrolling + $('body').css({ + overflow: '', + width: '' + }); + + $modal.find('.modal-close').off('click.close'); + $(document).off('keyup.modal' + overlayID); + + $overlay.velocity( { opacity: 0}, {duration: options.outDuration, queue: false, ease: "easeOutQuart"}); + + + // Define Bottom Sheet animation + var exitVelocityOptions = { + duration: options.outDuration, + queue: false, + ease: "easeOutCubic", + // Handle modal ready callback + complete: function() { + $(this).css({display:"none"}); + + // Call complete callback + if (typeof(options.complete) === "function") { + options.complete.call(this, $modal); + } + $overlay.remove(); + _stack--; + } + }; + if ($modal.hasClass('bottom-sheet')) { + $modal.velocity({bottom: "-100%", opacity: 0}, exitVelocityOptions); + } + else { + $modal.velocity( + { top: options.startingTop, opacity: 0, scaleX: 0.7}, + exitVelocityOptions + ); + } + }; + + var openModal = function($trigger) { + var $body = $('body'); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + if ($modal.hasClass('open')) { + return; + } + + var overlayID = _generateID(); + var $overlay = $('<div class="modal-overlay"></div>'); + lStack = (++_stack); + + // Store a reference of the overlay + $overlay.attr('id', overlayID).css('z-index', 1000 + lStack * 2); + $modal.data('overlay-id', overlayID).css('z-index', 1000 + lStack * 2 + 1); + $modal.addClass('open'); + + $("body").append($overlay); + + if (options.dismissible) { + $overlay.click(function() { + closeModal(); + }); + // Return on ESC + $(document).on('keyup.modal' + overlayID, function(e) { + if (e.keyCode === 27) { // ESC key + closeModal(); + } + }); + } + + $modal.find(".modal-close").on('click.close', function(e) { + closeModal(); + }); + + $overlay.css({ display : "block", opacity : 0 }); + + $modal.css({ + display : "block", + opacity: 0 + }); + + $overlay.velocity({opacity: options.opacity}, {duration: options.inDuration, queue: false, ease: "easeOutCubic"}); + $modal.data('associated-overlay', $overlay[0]); + + // Define Bottom Sheet animation + var enterVelocityOptions = { + duration: options.inDuration, + queue: false, + ease: "easeOutCubic", + // Handle modal ready callback + complete: function() { + if (typeof(options.ready) === "function") { + options.ready.call(this, $modal, $trigger); + } + } + }; + if ($modal.hasClass('bottom-sheet')) { + $modal.velocity({bottom: "0", opacity: 1}, enterVelocityOptions); + } + else { + $.Velocity.hook($modal, "scaleX", 0.7); + $modal.css({ top: options.startingTop }); + $modal.velocity({top: options.endingTop, opacity: 1, scaleX: '1'}, enterVelocityOptions); + } + + }; + + // Reset handlers + $(document).off('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]'); + $(this).off('openModal'); + $(this).off('closeModal'); + + // Close Handlers + $(document).on('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]', function(e) { + options.startingTop = ($(this).offset().top - $(window).scrollTop()) /1.15; + openModal($(this)); + e.preventDefault(); + }); // done set on click + + $(this).on('openModal', function() { + var modal_id = $(this).attr("href") || '#' + $(this).data('target'); + openModal(); + }); + + $(this).on('closeModal', function() { + closeModal(); + }); + }); // done return + }, + open : function() { + $(this).trigger('openModal'); + }, + close : function() { + $(this).trigger('closeModal'); + } + }; + + $.fn.modal = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.modal' ); + } + }; +})(jQuery); +;(function ($) { + + $.fn.materialbox = function () { + + return this.each(function() { + + if ($(this).hasClass('initialized')) { + return; + } + + $(this).addClass('initialized'); + + var overlayActive = false; + var doneAnimating = true; + var inDuration = 275; + var outDuration = 200; + var origin = $(this); + var placeholder = $('<div></div>').addClass('material-placeholder'); + var originalWidth = 0; + var originalHeight = 0; + var ancestorsChanged; + var ancestor; + origin.wrap(placeholder); + + + origin.on('click', function(){ + var placeholder = origin.parent('.material-placeholder'); + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var originalWidth = origin.width(); + var originalHeight = origin.height(); + + + // If already modal, return to original + if (doneAnimating === false) { + returnToOriginal(); + return false; + } + else if (overlayActive && doneAnimating===true) { + returnToOriginal(); + return false; + } + + + // Set states + doneAnimating = false; + origin.addClass('active'); + overlayActive = true; + + // Set positioning for placeholder + placeholder.css({ + width: placeholder[0].getBoundingClientRect().width, + height: placeholder[0].getBoundingClientRect().height, + position: 'relative', + top: 0, + left: 0 + }); + + // Find ancestor with overflow: hidden; and remove it + ancestorsChanged = undefined; + ancestor = placeholder[0].parentNode; + var count = 0; + while (ancestor !== null && !$(ancestor).is(document)) { + var curr = $(ancestor); + if (curr.css('overflow') !== 'visible') { + curr.css('overflow', 'visible'); + if (ancestorsChanged === undefined) { + ancestorsChanged = curr; + } + else { + ancestorsChanged = ancestorsChanged.add(curr); + } + } + ancestor = ancestor.parentNode; + } + + // Set css on origin + origin.css({ + position: 'absolute', + 'z-index': 1000, + 'will-change': 'left, top, width, height' + }) + .data('width', originalWidth) + .data('height', originalHeight); + + // Add overlay + var overlay = $('<div id="materialbox-overlay"></div>') + .css({ + opacity: 0 + }) + .click(function(){ + if (doneAnimating === true) + returnToOriginal(); + }); + + // Put before in origin image to preserve z-index layering. + origin.before(overlay); + + // Set dimensions if needed + var overlayOffset = overlay[0].getBoundingClientRect(); + overlay.css({ + width: windowWidth, + height: windowHeight, + left: -1 * overlayOffset.left, + top: -1 * overlayOffset.top + }) + + // Animate Overlay + overlay.velocity({opacity: 1}, + {duration: inDuration, queue: false, easing: 'easeOutQuad'} ); + + // Add and animate caption if it exists + if (origin.data('caption') !== "") { + var $photo_caption = $('<div class="materialbox-caption"></div>'); + $photo_caption.text(origin.data('caption')); + $('body').append($photo_caption); + $photo_caption.css({ "display": "inline" }); + $photo_caption.velocity({opacity: 1}, {duration: inDuration, queue: false, easing: 'easeOutQuad'}); + } + + // Resize Image + var ratio = 0; + var widthPercent = originalWidth / windowWidth; + var heightPercent = originalHeight / windowHeight; + var newWidth = 0; + var newHeight = 0; + + if (widthPercent > heightPercent) { + ratio = originalHeight / originalWidth; + newWidth = windowWidth * 0.9; + newHeight = windowWidth * 0.9 * ratio; + } + else { + ratio = originalWidth / originalHeight; + newWidth = (windowHeight * 0.9) * ratio; + newHeight = windowHeight * 0.9; + } + + // Animate image + set z-index + if(origin.hasClass('responsive-img')) { + origin.velocity({'max-width': newWidth, 'width': originalWidth}, {duration: 0, queue: false, + complete: function(){ + origin.css({left: 0, top: 0}) + .velocity( + { + height: newHeight, + width: newWidth, + left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2, + top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2 + }, + { + duration: inDuration, + queue: false, + easing: 'easeOutQuad', + complete: function(){doneAnimating = true;} + } + ); + } // End Complete + }); // End Velocity + } + else { + origin.css('left', 0) + .css('top', 0) + .velocity( + { + height: newHeight, + width: newWidth, + left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2, + top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2 + }, + { + duration: inDuration, + queue: false, + easing: 'easeOutQuad', + complete: function(){doneAnimating = true;} + } + ); // End Velocity + } + + }); // End origin on click + + + // Return on scroll + $(window).scroll(function() { + if (overlayActive) { + returnToOriginal(); + } + }); + + // Return on ESC + $(document).keyup(function(e) { + + if (e.keyCode === 27 && doneAnimating === true) { // ESC key + if (overlayActive) { + returnToOriginal(); + } + } + }); + + + // This function returns the modaled image to the original spot + function returnToOriginal() { + + doneAnimating = false; + + var placeholder = origin.parent('.material-placeholder'); + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var originalWidth = origin.data('width'); + var originalHeight = origin.data('height'); + + origin.velocity("stop", true); + $('#materialbox-overlay').velocity("stop", true); + $('.materialbox-caption').velocity("stop", true); + + + $('#materialbox-overlay').velocity({opacity: 0}, { + duration: outDuration, // Delay prevents animation overlapping + queue: false, easing: 'easeOutQuad', + complete: function(){ + // Remove Overlay + overlayActive = false; + $(this).remove(); + } + }); + + // Resize Image + origin.velocity( + { + width: originalWidth, + height: originalHeight, + left: 0, + top: 0 + }, + { + duration: outDuration, + queue: false, easing: 'easeOutQuad' + } + ); + + // Remove Caption + reset css settings on image + $('.materialbox-caption').velocity({opacity: 0}, { + duration: outDuration, // Delay prevents animation overlapping + queue: false, easing: 'easeOutQuad', + complete: function(){ + placeholder.css({ + height: '', + width: '', + position: '', + top: '', + left: '' + }); + + origin.css({ + height: '', + top: '', + left: '', + width: '', + 'max-width': '', + position: '', + 'z-index': '', + 'will-change': '' + }); + + // Remove class + origin.removeClass('active'); + doneAnimating = true; + $(this).remove(); + + // Remove overflow overrides on ancestors + if (ancestorsChanged) { + ancestorsChanged.css('overflow', ''); + } + } + }); + + } + }); + }; + + $(document).ready(function(){ + $('.materialboxed').materialbox(); + }); + +}( jQuery )); +;(function ($) { + + $.fn.parallax = function () { + var window_width = $(window).width(); + // Parallax Scripts + return this.each(function(i) { + var $this = $(this); + $this.addClass('parallax'); + + function updateParallax(initial) { + var container_height; + if (window_width < 601) { + container_height = ($this.height() > 0) ? $this.height() : $this.children("img").height(); + } + else { + container_height = ($this.height() > 0) ? $this.height() : 500; + } + var $img = $this.children("img").first(); + var img_height = $img.height(); + var parallax_dist = img_height - container_height; + var bottom = $this.offset().top + container_height; + var top = $this.offset().top; + var scrollTop = $(window).scrollTop(); + var windowHeight = window.innerHeight; + var windowBottom = scrollTop + windowHeight; + var percentScrolled = (windowBottom - top) / (container_height + windowHeight); + var parallax = Math.round((parallax_dist * percentScrolled)); + + if (initial) { + $img.css('display', 'block'); + } + if ((bottom > scrollTop) && (top < (scrollTop + windowHeight))) { + $img.css('transform', "translate3D(-50%," + parallax + "px, 0)"); + } + + } + + // Wait for image load + $this.children("img").one("load", function() { + updateParallax(true); + }).each(function() { + if (this.complete) $(this).trigger("load"); + }); + + $(window).scroll(function() { + window_width = $(window).width(); + updateParallax(false); + }); + + $(window).resize(function() { + window_width = $(window).width(); + updateParallax(false); + }); + + }); + + }; +}( jQuery )); +;(function ($) { + + var methods = { + init : function(options) { + var defaults = { + onShow: null, + swipeable: false, + responsiveThreshold: Infinity, // breakpoint for swipeable + }; + options = $.extend(defaults, options); + + return this.each(function() { + + // For each set of tabs, we want to keep track of + // which tab is active and its associated content + var $this = $(this), + window_width = $(window).width(); + + var $active, $content, $links = $this.find('li.tab a'), + $tabs_width = $this.width(), + $tabs_content = $(), + $tabs_wrapper, + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length, + $indicator, + index = prev_index = 0, + clicked = false, + clickedTimeout, + transition = 300; + + + // Finds right attribute for indicator based on active tab. + // el: jQuery Object + var calcRightPos = function(el) { + return $tabs_width - el.position().left - el.outerWidth() - $this.scrollLeft(); + }; + + // Finds left attribute for indicator based on active tab. + // el: jQuery Object + var calcLeftPos = function(el) { + return el.position().left + $this.scrollLeft(); + }; + + // Animates Indicator to active tab. + // prev_index: Number + var animateIndicator = function(prev_index) { + if ((index - prev_index) >= 0) { + $indicator.velocity({"right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'}); + $indicator.velocity({"left": calcLeftPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90}); + + } else { + $indicator.velocity({"left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'}); + $indicator.velocity({"right": calcRightPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90}); + } + }; + + // Change swipeable according to responsive threshold + if (options.swipeable) { + if (window_width > options.responsiveThreshold) { + options.swipeable = false; + } + } + + + // If the location.hash matches one of the links, use that as the active tab. + $active = $($links.filter('[href="'+location.hash+'"]')); + + // If no match is found, use the first link or any with class 'active' as the initial active tab. + if ($active.length === 0) { + $active = $(this).find('li.tab a.active').first(); + } + if ($active.length === 0) { + $active = $(this).find('li.tab a').first(); + } + + $active.addClass('active'); + index = $links.index($active); + if (index < 0) { + index = 0; + } + + if ($active[0] !== undefined) { + $content = $($active[0].hash); + $content.addClass('active'); + } + + // append indicator then set indicator width to tab width + if (!$this.find('.indicator').length) { + $this.append('<div class="indicator"></div>'); + } + $indicator = $this.find('.indicator'); + + // we make sure that the indicator is at the end of the tabs + $this.append($indicator); + + if ($this.is(":visible")) { + // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)}); + // $indicator.css({"left": index * $tab_width}); + setTimeout(function() { + $indicator.css({"right": calcRightPos($active) }); + $indicator.css({"left": calcLeftPos($active) }); + }, 0); + } + $(window).resize(function () { + $tabs_width = $this.width(); + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; + if (index < 0) { + index = 0; + } + if ($tab_width !== 0 && $tabs_width !== 0) { + $indicator.css({"right": calcRightPos($active) }); + $indicator.css({"left": calcLeftPos($active) }); + } + }); + + // Initialize Tabs Content. + if (options.swipeable) { + // TODO: Duplicate calls with swipeable? handle multiple div wrapping. + $links.each(function () { + var $curr_content = $(Materialize.escapeHash(this.hash)); + $curr_content.addClass('carousel-item'); + $tabs_content = $tabs_content.add($curr_content); + }); + $tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>'); + $tabs_content.css('display', ''); + $('.tabs-content.carousel').carousel({ + fullWidth: true, + noWrap: true, + onCycleTo: function(item) { + if (!clicked) { + var prev_index = index; + index = $tabs_wrapper.index(item); + $active = $links.eq(index); + animateIndicator(prev_index); + } + }, + }); + } else { + // Hide the remaining content + $links.not($active).each(function () { + $(Materialize.escapeHash(this.hash)).hide(); + }); + } + + + // Bind the click event handler + $this.on('click', 'a', function(e) { + if ($(this).parent().hasClass('disabled')) { + e.preventDefault(); + return; + } + + // Act as regular link if target attribute is specified. + if (!!$(this).attr("target")) { + return; + } + + clicked = true; + $tabs_width = $this.width(); + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; + + // Make the old tab inactive. + $active.removeClass('active'); + var $oldContent = $content + + // Update the variables with the new link and content + $active = $(this); + $content = $(Materialize.escapeHash(this.hash)); + $links = $this.find('li.tab a'); + var activeRect = $active.position(); + + // Make the tab active. + $active.addClass('active'); + prev_index = index; + index = $links.index($(this)); + if (index < 0) { + index = 0; + } + // Change url to current tab + // window.location.hash = $active.attr('href'); + + // Swap content + if (options.swipeable) { + if ($tabs_content.length) { + $tabs_content.carousel('set', index); + } + } else { + if ($content !== undefined) { + $content.show(); + $content.addClass('active'); + if (typeof(options.onShow) === "function") { + options.onShow.call(this, $content); + } + } + + if ($oldContent !== undefined && + !$oldContent.is($content)) { + $oldContent.hide(); + $oldContent.removeClass('active'); + } + } + + // Reset clicked state + clickedTimeout = setTimeout(function(){ clicked = false; }, transition); + + // Update indicator + animateIndicator(prev_index); + + // Prevent the anchor's default click action + e.preventDefault(); + }); + }); + + }, + select_tab : function( id ) { + this.find('a[href="#' + id + '"]').trigger('click'); + } + }; + + $.fn.tabs = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tabs' ); + } + }; + + $(document).ready(function(){ + $('ul.tabs').tabs(); + }); +}( jQuery )); +;(function ($) { + $.fn.tooltip = function (options) { + var timeout = null, + margin = 5; + + // Defaults + var defaults = { + delay: 350, + tooltip: '', + position: 'bottom', + html: false + }; + + // Remove tooltip from the activator + if (options === "remove") { + this.each(function() { + $('#' + $(this).attr('data-tooltip-id')).remove(); + $(this).off('mouseenter.tooltip mouseleave.tooltip'); + }); + return false; + } + + options = $.extend(defaults, options); + + return this.each(function() { + var tooltipId = Materialize.guid(); + var origin = $(this); + + // Destroy old tooltip + if (origin.attr('data-tooltip-id')) { + $('#' + origin.attr('data-tooltip-id')).remove(); + } + + origin.attr('data-tooltip-id', tooltipId); + + // Get attributes. + var allowHtml, + tooltipDelay, + tooltipPosition, + tooltipText, + tooltipEl, + backdrop; + var setAttributes = function() { + allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html; + tooltipDelay = origin.attr('data-delay'); + tooltipDelay = (tooltipDelay === undefined || tooltipDelay === '') ? + options.delay : tooltipDelay; + tooltipPosition = origin.attr('data-position'); + tooltipPosition = (tooltipPosition === undefined || tooltipPosition === '') ? + options.position : tooltipPosition; + tooltipText = origin.attr('data-tooltip'); + tooltipText = (tooltipText === undefined || tooltipText === '') ? + options.tooltip : tooltipText; + }; + setAttributes(); + + var renderTooltipEl = function() { + var tooltip = $('<div class="material-tooltip"></div>'); + + // Create Text span + if (allowHtml) { + tooltipText = $('<span></span>').html(tooltipText); + } else{ + tooltipText = $('<span></span>').text(tooltipText); + } + + // Create tooltip + tooltip.append(tooltipText) + .appendTo($('body')) + .attr('id', tooltipId); + + // Create backdrop + backdrop = $('<div class="backdrop"></div>'); + backdrop.appendTo(tooltip); + return tooltip; + }; + tooltipEl = renderTooltipEl(); + + // Destroy previously binded events + origin.off('mouseenter.tooltip mouseleave.tooltip'); + // Mouse In + var started = false, timeoutRef; + origin.on({'mouseenter.tooltip': function(e) { + var showTooltip = function() { + setAttributes(); + started = true; + tooltipEl.velocity('stop'); + backdrop.velocity('stop'); + tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' }); + + // Tooltip positioning + var originWidth = origin.outerWidth(); + var originHeight = origin.outerHeight(); + var tooltipHeight = tooltipEl.outerHeight(); + var tooltipWidth = tooltipEl.outerWidth(); + var tooltipVerticalMovement = '0px'; + var tooltipHorizontalMovement = '0px'; + var backdropOffsetWidth = backdrop[0].offsetWidth; + var backdropOffsetHeight = backdrop[0].offsetHeight; + var scaleXFactor = 8; + var scaleYFactor = 8; + var scaleFactor = 0; + var targetTop, targetLeft, newCoordinates; + + if (tooltipPosition === "top") { + // Top Position + targetTop = origin.offset().top - tooltipHeight - margin; + targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + tooltipVerticalMovement = '-10px'; + backdrop.css({ + bottom: 0, + left: 0, + borderRadius: '14px 14px 0 0', + transformOrigin: '50% 100%', + marginTop: tooltipHeight, + marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2) + }); + } + // Left Position + else if (tooltipPosition === "left") { + targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2; + targetLeft = origin.offset().left - tooltipWidth - margin; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + + tooltipHorizontalMovement = '-10px'; + backdrop.css({ + top: '-7px', + right: 0, + width: '14px', + height: '14px', + borderRadius: '14px 0 0 14px', + transformOrigin: '95% 50%', + marginTop: tooltipHeight/2, + marginLeft: tooltipWidth + }); + } + // Right Position + else if (tooltipPosition === "right") { + targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2; + targetLeft = origin.offset().left + originWidth + margin; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + + tooltipHorizontalMovement = '+10px'; + backdrop.css({ + top: '-7px', + left: 0, + width: '14px', + height: '14px', + borderRadius: '0 14px 14px 0', + transformOrigin: '5% 50%', + marginTop: tooltipHeight/2, + marginLeft: '0px' + }); + } + else { + // Bottom Position + targetTop = origin.offset().top + origin.outerHeight() + margin; + targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + tooltipVerticalMovement = '+10px'; + backdrop.css({ + top: 0, + left: 0, + marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2) + }); + } + + // Set tooptip css placement + tooltipEl.css({ + top: newCoordinates.y, + left: newCoordinates.x + }); + + // Calculate Scale to fill + scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth); + scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight); + scaleFactor = Math.max(scaleXFactor, scaleYFactor); + + tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement}, { duration: 350, queue: false }) + .velocity({opacity: 1}, {duration: 300, delay: 50, queue: false}); + backdrop.css({ visibility: 'visible' }) + .velocity({opacity:1},{duration: 55, delay: 0, queue: false}) + .velocity({scaleX: scaleFactor, scaleY: scaleFactor}, {duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad'}); + }; + + timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval + + // Mouse Out + }, + 'mouseleave.tooltip': function(){ + // Reset State + started = false; + clearTimeout(timeoutRef); + + // Animate back + setTimeout(function() { + if (started !== true) { + tooltipEl.velocity({ + opacity: 0, translateY: 0, translateX: 0}, { duration: 225, queue: false}); + backdrop.velocity({opacity: 0, scaleX: 1, scaleY: 1}, { + duration:225, + queue: false, + complete: function(){ + backdrop.css({ visibility: 'hidden' }); + tooltipEl.css({ visibility: 'hidden' }); + started = false;} + }); + } + },225); + } + }); + }); + }; + + var repositionWithinScreen = function(x, y, width, height) { + var newX = x; + var newY = y; + + if (newX < 0) { + newX = 4; + } else if (newX + width > window.innerWidth) { + newX -= newX + width - window.innerWidth; + } + + if (newY < 0) { + newY = 4; + } else if (newY + height > window.innerHeight + $(window).scrollTop) { + newY -= newY + height - window.innerHeight; + } + + return {x: newX, y: newY}; + }; + + $(document).ready(function(){ + $('.tooltipped').tooltip(); + }); +}( jQuery )); +;/*! + * Waves v0.6.4 + * http://fian.my.id/Waves + * + * Copyright 2014 Alfiana E. Sibuea and other contributors + * Released under the MIT license + * https://github.com/fians/Waves/blob/master/LICENSE + */ + +;(function(window) { + 'use strict'; + + var Waves = Waves || {}; + var $$ = document.querySelectorAll.bind(document); + + // Find exact position of element + function isWindow(obj) { + return obj !== null && obj === obj.window; + } + + function getWindow(elem) { + return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView; + } + + function offset(elem) { + var docElem, win, + box = {top: 0, left: 0}, + doc = elem && elem.ownerDocument; + + docElem = doc.documentElement; + + if (typeof elem.getBoundingClientRect !== typeof undefined) { + box = elem.getBoundingClientRect(); + } + win = getWindow(doc); + return { + top: box.top + win.pageYOffset - docElem.clientTop, + left: box.left + win.pageXOffset - docElem.clientLeft + }; + } + + function convertStyle(obj) { + var style = ''; + + for (var a in obj) { + if (obj.hasOwnProperty(a)) { + style += (a + ':' + obj[a] + ';'); + } + } + + return style; + } + + var Effect = { + + // Effect delay + duration: 750, + + show: function(e, element) { + + // Disable right click + if (e.button === 2) { + return false; + } + + var el = element || this; + + // Create ripple + var ripple = document.createElement('div'); + ripple.className = 'waves-ripple'; + el.appendChild(ripple); + + // Get click coordinate and element witdh + var pos = offset(el); + var relativeY = (e.pageY - pos.top); + var relativeX = (e.pageX - pos.left); + var scale = 'scale('+((el.clientWidth / 100) * 10)+')'; + + // Support for touch devices + if ('touches' in e) { + relativeY = (e.touches[0].pageY - pos.top); + relativeX = (e.touches[0].pageX - pos.left); + } + + // Attach data to element + ripple.setAttribute('data-hold', Date.now()); + ripple.setAttribute('data-scale', scale); + ripple.setAttribute('data-x', relativeX); + ripple.setAttribute('data-y', relativeY); + + // Set ripple position + var rippleStyle = { + 'top': relativeY+'px', + 'left': relativeX+'px' + }; + + ripple.className = ripple.className + ' waves-notransition'; + ripple.setAttribute('style', convertStyle(rippleStyle)); + ripple.className = ripple.className.replace('waves-notransition', ''); + + // Scale the ripple + rippleStyle['-webkit-transform'] = scale; + rippleStyle['-moz-transform'] = scale; + rippleStyle['-ms-transform'] = scale; + rippleStyle['-o-transform'] = scale; + rippleStyle.transform = scale; + rippleStyle.opacity = '1'; + + rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['-o-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['transition-duration'] = Effect.duration + 'ms'; + + rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + + ripple.setAttribute('style', convertStyle(rippleStyle)); + }, + + hide: function(e) { + TouchHandler.touchup(e); + + var el = this; + var width = el.clientWidth * 1.4; + + // Get first ripple + var ripple = null; + var ripples = el.getElementsByClassName('waves-ripple'); + if (ripples.length > 0) { + ripple = ripples[ripples.length - 1]; + } else { + return false; + } + + var relativeX = ripple.getAttribute('data-x'); + var relativeY = ripple.getAttribute('data-y'); + var scale = ripple.getAttribute('data-scale'); + + // Get delay beetween mousedown and mouse leave + var diff = Date.now() - Number(ripple.getAttribute('data-hold')); + var delay = 350 - diff; + + if (delay < 0) { + delay = 0; + } + + // Fade out ripple after delay + setTimeout(function() { + var style = { + 'top': relativeY+'px', + 'left': relativeX+'px', + 'opacity': '0', + + // Duration + '-webkit-transition-duration': Effect.duration + 'ms', + '-moz-transition-duration': Effect.duration + 'ms', + '-o-transition-duration': Effect.duration + 'ms', + 'transition-duration': Effect.duration + 'ms', + '-webkit-transform': scale, + '-moz-transform': scale, + '-ms-transform': scale, + '-o-transform': scale, + 'transform': scale, + }; + + ripple.setAttribute('style', convertStyle(style)); + + setTimeout(function() { + try { + el.removeChild(ripple); + } catch(e) { + return false; + } + }, Effect.duration); + }, delay); + }, + + // Little hack to make <input> can perform waves effect + wrapInput: function(elements) { + for (var a = 0; a < elements.length; a++) { + var el = elements[a]; + + if (el.tagName.toLowerCase() === 'input') { + var parent = el.parentNode; + + // If input already have parent just pass through + if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) { + continue; + } + + // Put element class and style to the specified parent + var wrapper = document.createElement('i'); + wrapper.className = el.className + ' waves-input-wrapper'; + + var elementStyle = el.getAttribute('style'); + + if (!elementStyle) { + elementStyle = ''; + } + + wrapper.setAttribute('style', elementStyle); + + el.className = 'waves-button-input'; + el.removeAttribute('style'); + + // Put element as child + parent.replaceChild(wrapper, el); + wrapper.appendChild(el); + } + } + } + }; + + + /** + * Disable mousedown event for 500ms during and after touch + */ + var TouchHandler = { + /* uses an integer rather than bool so there's no issues with + * needing to clear timeouts if another touch event occurred + * within the 500ms. Cannot mouseup between touchstart and + * touchend, nor in the 500ms after touchend. */ + touches: 0, + allowEvent: function(e) { + var allow = true; + + if (e.type === 'touchstart') { + TouchHandler.touches += 1; //push + } else if (e.type === 'touchend' || e.type === 'touchcancel') { + setTimeout(function() { + if (TouchHandler.touches > 0) { + TouchHandler.touches -= 1; //pop after 500ms + } + }, 500); + } else if (e.type === 'mousedown' && TouchHandler.touches > 0) { + allow = false; + } + + return allow; + }, + touchup: function(e) { + TouchHandler.allowEvent(e); + } + }; + + + /** + * Delegated click handler for .waves-effect element. + * returns null when .waves-effect element not in "click tree" + */ + function getWavesEffectElement(e) { + if (TouchHandler.allowEvent(e) === false) { + return null; + } + + var element = null; + var target = e.target || e.srcElement; + + while (target.parentElement !== null) { + if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) { + element = target; + break; + } else if (target.classList.contains('waves-effect')) { + element = target; + break; + } + target = target.parentElement; + } + + return element; + } + + /** + * Bubble the click and show effect if .waves-effect elem was found + */ + function showEffect(e) { + var element = getWavesEffectElement(e); + + if (element !== null) { + Effect.show(e, element); + + if ('ontouchstart' in window) { + element.addEventListener('touchend', Effect.hide, false); + element.addEventListener('touchcancel', Effect.hide, false); + } + + element.addEventListener('mouseup', Effect.hide, false); + element.addEventListener('mouseleave', Effect.hide, false); + } + } + + Waves.displayEffect = function(options) { + options = options || {}; + + if ('duration' in options) { + Effect.duration = options.duration; + } + + //Wrap input inside <i> tag + Effect.wrapInput($$('.waves-effect')); + + if ('ontouchstart' in window) { + document.body.addEventListener('touchstart', showEffect, false); + } + + document.body.addEventListener('mousedown', showEffect, false); + }; + + /** + * Attach Waves to an input element (or any element which doesn't + * bubble mouseup/mousedown events). + * Intended to be used with dynamically loaded forms/inputs, or + * where the user doesn't want a delegated click handler. + */ + Waves.attach = function(element) { + //FUTURE: automatically add waves classes and allow users + // to specify them with an options param? Eg. light/classic/button + if (element.tagName.toLowerCase() === 'input') { + Effect.wrapInput([element]); + element = element.parentElement; + } + + if ('ontouchstart' in window) { + element.addEventListener('touchstart', showEffect, false); + } + + element.addEventListener('mousedown', showEffect, false); + }; + + window.Waves = Waves; + + document.addEventListener('DOMContentLoaded', function() { + Waves.displayEffect(); + }, false); + +})(window); +;Materialize.toast = function (message, displayLength, className, completeCallback) { + className = className || ""; + + var container = document.getElementById('toast-container'); + + // Create toast container if it does not exist + if (container === null) { + // create notification container + container = document.createElement('div'); + container.id = 'toast-container'; + document.body.appendChild(container); + } + + // Select and append toast + var newToast = createToast(message); + + // only append toast if message is not undefined + if(message){ + container.appendChild(newToast); + } + + newToast.style.opacity = 0; + + // Animate toast in + Vel(newToast, {translateY: '-35px', opacity: 1 }, {duration: 300, + easing: 'easeOutCubic', + queue: false}); + + // Allows timer to be pause while being panned + var timeLeft = displayLength; + var counterInterval; + if (timeLeft != null) { + counterInterval = setInterval (function(){ + if (newToast.parentNode === null) + window.clearInterval(counterInterval); + + // If toast is not being dragged, decrease its time remaining + if (!newToast.classList.contains('panning')) { + timeLeft -= 20; + } + + if (timeLeft <= 0) { + // Animate toast out + Vel(newToast, {"opacity": 0, marginTop: '-40px'}, { duration: 375, + easing: 'easeOutExpo', + queue: false, + complete: function(){ + // Call the optional callback + if(typeof(completeCallback) === "function") + completeCallback(); + // Remove toast after it times out + this[0].parentNode.removeChild(this[0]); + } + }); + window.clearInterval(counterInterval); + } + }, 20); + } + + + + function createToast(html) { + + // Create toast + var toast = document.createElement('div'); + toast.classList.add('toast'); + if (className) { + var classes = className.split(' '); + + for (var i = 0, count = classes.length; i < count; i++) { + toast.classList.add(classes[i]); + } + } + // If type of parameter is HTML Element + if ( typeof HTMLElement === "object" ? html instanceof HTMLElement : html && typeof html === "object" && html !== null && html.nodeType === 1 && typeof html.nodeName==="string" +) { + toast.appendChild(html); + } + else if (html instanceof jQuery) { + // Check if it is jQuery object + toast.appendChild(html[0]); + } + else { + // Insert as text; + toast.innerHTML = html; + } + // Bind hammer + var hammerHandler = new Hammer(toast, {prevent_default: false}); + hammerHandler.on('pan', function(e) { + var deltaX = e.deltaX; + var activationDistance = 80; + + // Change toast state + if (!toast.classList.contains('panning')){ + toast.classList.add('panning'); + } + + var opacityPercent = 1-Math.abs(deltaX / activationDistance); + if (opacityPercent < 0) + opacityPercent = 0; + + Vel(toast, {left: deltaX, opacity: opacityPercent }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + + }); + + hammerHandler.on('panend', function(e) { + var deltaX = e.deltaX; + var activationDistance = 80; + + // If toast dragged past activation point + if (Math.abs(deltaX) > activationDistance) { + Vel(toast, {marginTop: '-40px'}, { duration: 375, + easing: 'easeOutExpo', + queue: false, + complete: function(){ + if(typeof(completeCallback) === "function") { + completeCallback(); + } + toast.parentNode.removeChild(toast); + } + }); + + } else { + toast.classList.remove('panning'); + // Put toast back into original position + Vel(toast, { left: 0, opacity: 1 }, { duration: 300, + easing: 'easeOutExpo', + queue: false + }); + + } + }); + + return toast; + } +}; +;(function ($) { + + var methods = { + init : function(options) { + var defaults = { + menuWidth: 300, + edge: 'left', + closeOnClick: false, + draggable: true + }; + options = $.extend(defaults, options); + + $(this).each(function(){ + var $this = $(this); + var menuId = $this.attr('data-activates'); + var menu = $("#"+ menuId); + + // Set to width + if (options.menuWidth != 300) { + menu.css('width', options.menuWidth); + } + + // Add Touch Area + var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]'); + if (options.draggable) { + // Regenerate dragTarget + if ($dragTarget.length) { + $dragTarget.remove(); + } + + $dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId); + $('body').append($dragTarget); + } else { + $dragTarget = $(); + } + + if (options.edge == 'left') { + menu.css('transform', 'translateX(-100%)'); + $dragTarget.css({'left': 0}); // Add Touch Area + } + else { + menu.addClass('right-aligned') // Change text-alignment to right + .css('transform', 'translateX(100%)'); + $dragTarget.css({'right': 0}); // Add Touch Area + } + + // If fixed sidenav, bring menu out + if (menu.hasClass('fixed')) { + if (window.innerWidth > 992) { + menu.css('transform', 'translateX(0)'); + } + } + + // Window resize to reset on large screens fixed + if (menu.hasClass('fixed')) { + $(window).resize( function() { + if (window.innerWidth > 992) { + // Close menu if window is resized bigger than 992 and user has fixed sidenav + if ($('#sidenav-overlay').length !== 0 && menuOut) { + removeMenu(true); + } + else { + // menu.removeAttr('style'); + menu.css('transform', 'translateX(0%)'); + // menu.css('width', options.menuWidth); + } + } + else if (menuOut === false){ + if (options.edge === 'left') { + menu.css('transform', 'translateX(-100%)'); + } else { + menu.css('transform', 'translateX(100%)'); + } + + } + + }); + } + + // if closeOnClick, then add close event for all a tags in side sideNav + if (options.closeOnClick === true) { + menu.on("click.itemclick", "a:not(.collapsible-header)", function(){ + removeMenu(); + }); + } + + var removeMenu = function(restoreNav) { + panning = false; + menuOut = false; + // Reenable scrolling + $('body').css({ + overflow: '', + width: '' + }); + + $('#sidenav-overlay').velocity({opacity: 0}, {duration: 200, + queue: false, easing: 'easeOutQuad', + complete: function() { + $(this).remove(); + } }); + if (options.edge === 'left') { + // Reset phantom div + $dragTarget.css({width: '', right: '', left: '0'}); + menu.velocity( + {'translateX': '-100%'}, + { duration: 200, + queue: false, + easing: 'easeOutCubic', + complete: function() { + if (restoreNav === true) { + // Restore Fixed sidenav + menu.removeAttr('style'); + menu.css('width', options.menuWidth); + } + } + + }); + } + else { + // Reset phantom div + $dragTarget.css({width: '', right: '0', left: ''}); + menu.velocity( + {'translateX': '100%'}, + { duration: 200, + queue: false, + easing: 'easeOutCubic', + complete: function() { + if (restoreNav === true) { + // Restore Fixed sidenav + menu.removeAttr('style'); + menu.css('width', options.menuWidth); + } + } + }); + } + }; + + + + // Touch Event + var panning = false; + var menuOut = false; + + if (options.draggable) { + $dragTarget.on('click', function(){ + if (menuOut) { + removeMenu(); + } + }); + + $dragTarget.hammer({ + prevent_default: false + }).bind('pan', function(e) { + + if (e.gesture.pointerType == "touch") { + + var direction = e.gesture.direction; + var x = e.gesture.center.x; + var y = e.gesture.center.y; + var velocityX = e.gesture.velocityX; + + // Disable Scrolling + var $body = $('body'); + var $overlay = $('#sidenav-overlay'); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + // If overlay does not exist, create one and if it is clicked, close menu + if ($overlay.length === 0) { + $overlay = $('<div id="sidenav-overlay"></div>'); + $overlay.css('opacity', 0).click( function(){ + removeMenu(); + }); + $('body').append($overlay); + } + + // Keep within boundaries + if (options.edge === 'left') { + if (x > options.menuWidth) { x = options.menuWidth; } + else if (x < 0) { x = 0; } + } + + if (options.edge === 'left') { + // Left Direction + if (x < (options.menuWidth / 2)) { menuOut = false; } + // Right Direction + else if (x >= (options.menuWidth / 2)) { menuOut = true; } + menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)'); + } + else { + // Left Direction + if (x < (window.innerWidth - options.menuWidth / 2)) { + menuOut = true; + } + // Right Direction + else if (x >= (window.innerWidth - options.menuWidth / 2)) { + menuOut = false; + } + var rightPos = (x - options.menuWidth / 2); + if (rightPos < 0) { + rightPos = 0; + } + + menu.css('transform', 'translateX(' + rightPos + 'px)'); + } + + + // Percentage overlay + var overlayPerc; + if (options.edge === 'left') { + overlayPerc = x / options.menuWidth; + $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'}); + } + else { + overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth); + $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'}); + } + } + + }).bind('panend', function(e) { + + if (e.gesture.pointerType == "touch") { + var $overlay = $('<div id="sidenav-overlay"></div>'); + var velocityX = e.gesture.velocityX; + var x = e.gesture.center.x; + var leftPos = x - options.menuWidth; + var rightPos = x - options.menuWidth / 2; + if (leftPos > 0 ) { + leftPos = 0; + } + if (rightPos < 0) { + rightPos = 0; + } + panning = false; + + if (options.edge === 'left') { + // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut + if ((menuOut && velocityX <= 0.3) || velocityX < -0.5) { + // Return menu to open + if (leftPos !== 0) { + menu.velocity({'translateX': [0, leftPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + $dragTarget.css({width: '50%', right: 0, left: ''}); + menuOut = true; + } + else if (!menuOut || velocityX > 0.3) { + // Enable Scrolling + $('body').css({ + overflow: '', + width: '' + }); + // Slide menu closed + menu.velocity({'translateX': [-1 * options.menuWidth - 10, leftPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'}); + $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad', + complete: function () { + $(this).remove(); + }}); + $dragTarget.css({width: '10px', right: '', left: 0}); + } + } + else { + if ((menuOut && velocityX >= -0.3) || velocityX > 0.5) { + // Return menu to open + if (rightPos !== 0) { + menu.velocity({'translateX': [0, rightPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + $dragTarget.css({width: '50%', right: '', left: 0}); + menuOut = true; + } + else if (!menuOut || velocityX < -0.3) { + // Enable Scrolling + $('body').css({ + overflow: '', + width: '' + }); + + // Slide menu closed + menu.velocity({'translateX': [options.menuWidth + 10, rightPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'}); + $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad', + complete: function () { + $(this).remove(); + }}); + $dragTarget.css({width: '10px', right: 0, left: ''}); + } + } + + } + }); + } + + $this.off('click.sidenav').on('click.sidenav', function() { + if (menuOut === true) { + menuOut = false; + panning = false; + removeMenu(); + } + else { + + // Disable Scrolling + var $body = $('body'); + var $overlay = $('<div id="sidenav-overlay"></div>'); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + // Push current drag target on top of DOM tree + $('body').append($dragTarget); + + if (options.edge === 'left') { + $dragTarget.css({width: '50%', right: 0, left: ''}); + menu.velocity({'translateX': [0, -1 * options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + else { + $dragTarget.css({width: '50%', right: '', left: 0}); + menu.velocity({'translateX': [0, options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + $overlay.css('opacity', 0) + .click(function(){ + menuOut = false; + panning = false; + removeMenu(); + $overlay.velocity({opacity: 0}, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function() { + $(this).remove(); + } }); + + }); + $('body').append($overlay); + $overlay.velocity({opacity: 1}, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + menuOut = true; + panning = false; + } + }); + } + + return false; + }); + }); + + + }, + destroy: function () { + var $overlay = $('#sidenav-overlay'); + var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]'); + $overlay.trigger('click'); + $dragTarget.remove(); + $(this).off('click'); + $overlay.remove(); + }, + show : function() { + this.trigger('click'); + }, + hide : function() { + $('#sidenav-overlay').trigger('click'); + } + }; + + + $.fn.sideNav = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.sideNav' ); + } + }; // Plugin end +}( jQuery )); +;/** + * Extend jquery with a scrollspy plugin. + * This watches the window scroll and fires events when elements are scrolled into viewport. + * + * throttle() and getTime() taken from Underscore.js + * https://github.com/jashkenas/underscore + * + * @author Copyright 2013 John Smart + * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE + * @see https://github.com/thesmart + * @version 0.1.2 + */ +(function($) { + + var jWindow = $(window); + var elements = []; + var elementsInView = []; + var isSpying = false; + var ticks = 0; + var unique_id = 1; + var offset = { + top : 0, + right : 0, + bottom : 0, + left : 0, + } + + /** + * Find elements that are within the boundary + * @param {number} top + * @param {number} right + * @param {number} bottom + * @param {number} left + * @return {jQuery} A collection of elements + */ + function findElements(top, right, bottom, left) { + var hits = $(); + $.each(elements, function(i, element) { + if (element.height() > 0) { + var elTop = element.offset().top, + elLeft = element.offset().left, + elRight = elLeft + element.width(), + elBottom = elTop + element.height(); + + var isIntersect = !(elLeft > right || + elRight < left || + elTop > bottom || + elBottom < top); + + if (isIntersect) { + hits.push(element); + } + } + }); + + return hits; + } + + + /** + * Called when the user scrolls the window + */ + function onScroll(scrollOffset) { + // unique tick id + ++ticks; + + // viewport rectangle + var top = jWindow.scrollTop(), + left = jWindow.scrollLeft(), + right = left + jWindow.width(), + bottom = top + jWindow.height(); + + // determine which elements are in view + var intersections = findElements(top+offset.top + scrollOffset || 200, right+offset.right, bottom+offset.bottom, left+offset.left); + $.each(intersections, function(i, element) { + + var lastTick = element.data('scrollSpy:ticks'); + if (typeof lastTick != 'number') { + // entered into view + element.triggerHandler('scrollSpy:enter'); + } + + // update tick id + element.data('scrollSpy:ticks', ticks); + }); + + // determine which elements are no longer in view + $.each(elementsInView, function(i, element) { + var lastTick = element.data('scrollSpy:ticks'); + if (typeof lastTick == 'number' && lastTick !== ticks) { + // exited from view + element.triggerHandler('scrollSpy:exit'); + element.data('scrollSpy:ticks', null); + } + }); + + // remember elements in view for next tick + elementsInView = intersections; + } + + /** + * Called when window is resized + */ + function onWinSize() { + jWindow.trigger('scrollSpy:winSize'); + } + + + /** + * Enables ScrollSpy using a selector + * @param {jQuery|string} selector The elements collection, or a selector + * @param {Object=} options Optional. + throttle : number -> scrollspy throttling. Default: 100 ms + offsetTop : number -> offset from top. Default: 0 + offsetRight : number -> offset from right. Default: 0 + offsetBottom : number -> offset from bottom. Default: 0 + offsetLeft : number -> offset from left. Default: 0 + * @returns {jQuery} + */ + $.scrollSpy = function(selector, options) { + var defaults = { + throttle: 100, + scrollOffset: 200 // offset - 200 allows elements near bottom of page to scroll + }; + options = $.extend(defaults, options); + + var visible = []; + selector = $(selector); + selector.each(function(i, element) { + elements.push($(element)); + $(element).data("scrollSpy:id", i); + // Smooth scroll to section + $('a[href="#' + $(element).attr('id') + '"]').click(function(e) { + e.preventDefault(); + var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1; + $('html, body').animate({ scrollTop: offset - options.scrollOffset }, {duration: 400, queue: false, easing: 'easeOutCubic'}); + }); + }); + + offset.top = options.offsetTop || 0; + offset.right = options.offsetRight || 0; + offset.bottom = options.offsetBottom || 0; + offset.left = options.offsetLeft || 0; + + var throttledScroll = Materialize.throttle(function() { + onScroll(options.scrollOffset); + }, options.throttle || 100); + var readyScroll = function(){ + $(document).ready(throttledScroll); + }; + + if (!isSpying) { + jWindow.on('scroll', readyScroll); + jWindow.on('resize', readyScroll); + isSpying = true; + } + + // perform a scan once, after current execution context, and after dom is ready + setTimeout(readyScroll, 0); + + + selector.on('scrollSpy:enter', function() { + visible = $.grep(visible, function(value) { + return value.height() != 0; + }); + + var $this = $(this); + + if (visible[0]) { + $('a[href="#' + visible[0].attr('id') + '"]').removeClass('active'); + if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) { + visible.unshift($(this)); + } + else { + visible.push($(this)); + } + } + else { + visible.push($(this)); + } + + + $('a[href="#' + visible[0].attr('id') + '"]').addClass('active'); + }); + selector.on('scrollSpy:exit', function() { + visible = $.grep(visible, function(value) { + return value.height() != 0; + }); + + if (visible[0]) { + $('a[href="#' + visible[0].attr('id') + '"]').removeClass('active'); + var $this = $(this); + visible = $.grep(visible, function(value) { + return value.attr('id') != $this.attr('id'); + }); + if (visible[0]) { // Check if empty + $('a[href="#' + visible[0].attr('id') + '"]').addClass('active'); + } + } + }); + + return selector; + }; + + /** + * Listen for window resize events + * @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms + * @returns {jQuery} $(window) + */ + $.winSizeSpy = function(options) { + $.winSizeSpy = function() { return jWindow; }; // lock from multiple calls + options = options || { + throttle: 100 + }; + return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100)); + }; + + /** + * Enables ScrollSpy on a collection of elements + * e.g. $('.scrollSpy').scrollSpy() + * @param {Object=} options Optional. + throttle : number -> scrollspy throttling. Default: 100 ms + offsetTop : number -> offset from top. Default: 0 + offsetRight : number -> offset from right. Default: 0 + offsetBottom : number -> offset from bottom. Default: 0 + offsetLeft : number -> offset from left. Default: 0 + * @returns {jQuery} + */ + $.fn.scrollSpy = function(options) { + return $.scrollSpy($(this), options); + }; + +})(jQuery); +;(function ($) { + $(document).ready(function() { + + // Function to update labels of text fields + Materialize.updateTextFields = function() { + var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; + $(input_selector).each(function(index, element) { + var $this = $(this); + if ($(element).val().length > 0 || element.autofocus || $this.attr('placeholder') !== undefined) { + $this.siblings('label').addClass('active'); + } else if ($(element)[0].validity) { + $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true); + } else { + $this.siblings('label').removeClass('active'); + } + }); + }; + + // Text based inputs + var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; + + // Add active if form auto complete + $(document).on('change', input_selector, function () { + if($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) { + $(this).siblings('label').addClass('active'); + } + validate_field($(this)); + }); + + // Add active if input element has been pre-populated on document ready + $(document).ready(function() { + Materialize.updateTextFields(); + }); + + // HTML DOM FORM RESET handling + $(document).on('reset', function(e) { + var formReset = $(e.target); + if (formReset.is('form')) { + formReset.find(input_selector).removeClass('valid').removeClass('invalid'); + formReset.find(input_selector).each(function () { + if ($(this).attr('value') === '') { + $(this).siblings('label').removeClass('active'); + } + }); + + // Reset select + formReset.find('select.initialized').each(function () { + var reset_text = formReset.find('option[selected]').text(); + formReset.siblings('input.select-dropdown').val(reset_text); + }); + } + }); + + // Add active when element has focus + $(document).on('focus', input_selector, function () { + $(this).siblings('label, .prefix').addClass('active'); + }); + + $(document).on('blur', input_selector, function () { + var $inputElement = $(this); + var selector = ".prefix"; + + if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) { + selector += ", label"; + } + + $inputElement.siblings(selector).removeClass('active'); + + validate_field($inputElement); + }); + + window.validate_field = function(object) { + var hasLength = object.attr('data-length') !== undefined; + var lenAttr = parseInt(object.attr('data-length')); + var len = object.val().length; + + if (object.val().length === 0 && object[0].validity.badInput === false) { + if (object.hasClass('validate')) { + object.removeClass('valid'); + object.removeClass('invalid'); + } + } + else { + if (object.hasClass('validate')) { + // Check for character counter attributes + if ((object.is(':valid') && hasLength && (len <= lenAttr)) || (object.is(':valid') && !hasLength)) { + object.removeClass('invalid'); + object.addClass('valid'); + } + else { + object.removeClass('valid'); + object.addClass('invalid'); + } + } + } + }; + + // Radio and Checkbox focus class + var radio_checkbox = 'input[type=radio], input[type=checkbox]'; + $(document).on('keyup.radio', radio_checkbox, function(e) { + // TAB, check if tabbing to radio or checkbox. + if (e.which === 9) { + $(this).addClass('tabbed'); + var $this = $(this); + $this.one('blur', function(e) { + + $(this).removeClass('tabbed'); + }); + return; + } + }); + + // Textarea Auto Resize + var hiddenDiv = $('.hiddendiv').first(); + if (!hiddenDiv.length) { + hiddenDiv = $('<div class="hiddendiv common"></div>'); + $('body').append(hiddenDiv); + } + var text_area_selector = '.materialize-textarea'; + + function textareaAutoResize($textarea) { + // Set font properties of hiddenDiv + + var fontFamily = $textarea.css('font-family'); + var fontSize = $textarea.css('font-size'); + var lineHeight = $textarea.css('line-height'); + + if (fontSize) { hiddenDiv.css('font-size', fontSize); } + if (fontFamily) { hiddenDiv.css('font-family', fontFamily); } + if (lineHeight) { hiddenDiv.css('line-height', lineHeight); } + + if ($textarea.attr('wrap') === "off") { + hiddenDiv.css('overflow-wrap', "normal") + .css('white-space', "pre"); + } + + hiddenDiv.text($textarea.val() + '\n'); + var content = hiddenDiv.html().replace(/\n/g, '<br>'); + hiddenDiv.html(content); + + + // When textarea is hidden, width goes crazy. + // Approximate with half of window size + + if ($textarea.is(':visible')) { + hiddenDiv.css('width', $textarea.width()); + } + else { + hiddenDiv.css('width', $(window).width()/2); + } + + $textarea.css('height', hiddenDiv.height()); + } + + $(text_area_selector).each(function () { + var $textarea = $(this); + if ($textarea.val().length) { + textareaAutoResize($textarea); + } + }); + + $('body').on('keyup keydown autoresize', text_area_selector, function () { + textareaAutoResize($(this)); + }); + + // File Input Path + $(document).on('change', '.file-field input[type="file"]', function () { + var file_field = $(this).closest('.file-field'); + var path_input = file_field.find('input.file-path'); + var files = $(this)[0].files; + var file_names = []; + for (var i = 0; i < files.length; i++) { + file_names.push(files[i].name); + } + path_input.val(file_names.join(", ")); + path_input.trigger('change'); + }); + + /**************** + * Range Input * + ****************/ + + var range_type = 'input[type=range]'; + var range_mousedown = false; + var left; + + $(range_type).each(function () { + var thumb = $('<span class="thumb"><span class="value"></span></span>'); + $(this).after(thumb); + }); + + var range_wrapper = '.range-field'; + $(document).on('change', range_type, function(e) { + var thumb = $(this).siblings('.thumb'); + thumb.find('.value').html($(this).val()); + }); + + $(document).on('input mousedown touchstart', range_type, function(e) { + var thumb = $(this).siblings('.thumb'); + var width = $(this).outerWidth(); + + // If thumb indicator does not exist yet, create it + if (thumb.length <= 0) { + thumb = $('<span class="thumb"><span class="value"></span></span>'); + $(this).after(thumb); + } + + // Set indicator value + thumb.find('.value').html($(this).val()); + + range_mousedown = true; + $(this).addClass('active'); + + if (!thumb.hasClass('active')) { + thumb.velocity({ height: "30px", width: "30px", top: "-20px", marginLeft: "-15px"}, { duration: 300, easing: 'easeOutExpo' }); + } + + if (e.type !== 'input') { + if(e.pageX === undefined || e.pageX === null){//mobile + left = e.originalEvent.touches[0].pageX - $(this).offset().left; + } + else{ // desktop + left = e.pageX - $(this).offset().left; + } + if (left < 0) { + left = 0; + } + else if (left > width) { + left = width; + } + thumb.addClass('active').css('left', left); + } + + thumb.find('.value').html($(this).val()); + }); + + $(document).on('mouseup touchend', range_wrapper, function() { + range_mousedown = false; + $(this).removeClass('active'); + }); + + $(document).on('mousemove touchmove', range_wrapper, function(e) { + var thumb = $(this).children('.thumb'); + var left; + if (range_mousedown) { + if (!thumb.hasClass('active')) { + thumb.velocity({ height: '30px', width: '30px', top: '-20px', marginLeft: '-15px'}, { duration: 300, easing: 'easeOutExpo' }); + } + if (e.pageX === undefined || e.pageX === null) { //mobile + left = e.originalEvent.touches[0].pageX - $(this).offset().left; + } + else{ // desktop + left = e.pageX - $(this).offset().left; + } + var width = $(this).outerWidth(); + + if (left < 0) { + left = 0; + } + else if (left > width) { + left = width; + } + thumb.addClass('active').css('left', left); + thumb.find('.value').html(thumb.siblings(range_type).val()); + } + }); + + $(document).on('mouseout touchleave', range_wrapper, function() { + if (!range_mousedown) { + + var thumb = $(this).children('.thumb'); + + if (thumb.hasClass('active')) { + thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: '-6px'}, { duration: 100 }); + } + thumb.removeClass('active'); + } + }); + + /************************** + * Auto complete plugin * + *************************/ + $.fn.autocomplete = function (options) { + // Defaults + var defaults = { + data: {}, + limit: Infinity, + onAutocomplete: null + }; + + options = $.extend(defaults, options); + + return this.each(function() { + var $input = $(this); + var data = options.data, + count = 0, + activeIndex = 0, + oldVal, + $inputDiv = $input.closest('.input-field'); // Div to append on + + // Check if data isn't empty + if (!$.isEmptyObject(data)) { + var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>'); + var $oldAutocomplete; + + // Append autocomplete element. + // Prevent double structure init. + if ($inputDiv.length) { + $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first(); + if (!$oldAutocomplete.length) { + $inputDiv.append($autocomplete); // Set ul in body + } + } else { + $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content'); + if (!$oldAutocomplete.length) { + $input.after($autocomplete); + } + } + if ($oldAutocomplete.length) { + $autocomplete = $oldAutocomplete; + } + + // Highlight partial match. + var highlight = function(string, $el) { + var img = $el.find('img'); + var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""), + matchEnd = matchStart + string.length - 1, + beforeMatch = $el.text().slice(0, matchStart), + matchText = $el.text().slice(matchStart, matchEnd + 1), + afterMatch = $el.text().slice(matchEnd + 1); + $el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>"); + if (img.length) { + $el.prepend(img); + } + }; + + // Reset current element position + var resetCurrentElement = function() { + activeIndex = 0; + $autocomplete.find('.active').removeClass('active'); + } + + // Perform search + $input.off('keyup.autocomplete').on('keyup.autocomplete', function (e) { + // Reset count. + count = 0; + + // Don't capture enter or arrow key usage. + if (e.which === 13 || + e.which === 38 || + e.which === 40) { + return; + } + + var val = $input.val().toLowerCase(); + + // Check if the input isn't empty + if (oldVal !== val) { + $autocomplete.empty(); + resetCurrentElement(); + + if (val !== '') { + for(var key in data) { + if (data.hasOwnProperty(key) && + key.toLowerCase().indexOf(val) !== -1 && + key.toLowerCase() !== val) { + // Break if past limit + if (count >= options.limit) { + break; + } + + var autocompleteOption = $('<li></li>'); + if (!!data[key]) { + autocompleteOption.append('<img src="'+ data[key] +'" class="right circle"><span>'+ key +'</span>'); + } else { + autocompleteOption.append('<span>'+ key +'</span>'); + } + + $autocomplete.append(autocompleteOption); + highlight(val, autocompleteOption); + count++; + } + } + } + } + + // Update oldVal + oldVal = val; + }); + + $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) { + // Arrow keys and enter key usage + var keyCode = e.which, + liElement, + numItems = $autocomplete.children('li').length, + $active = $autocomplete.children('.active').first(); + + // select element on Enter + if (keyCode === 13) { + liElement = $autocomplete.children('li').eq(activeIndex); + if (liElement.length) { + liElement.click(); + e.preventDefault(); + } + return; + } + + // Capture up and down key + if ( keyCode === 38 || keyCode === 40 ) { + e.preventDefault(); + + if (keyCode === 38 && + activeIndex > 0) { + activeIndex--; + } + + if (keyCode === 40 && + activeIndex < (numItems - 1) && + $active.length) { + activeIndex++; + } + + $active.removeClass('active'); + $autocomplete.children('li').eq(activeIndex).addClass('active'); + } + }); + + // Set input value + $autocomplete.on('click', 'li', function () { + var text = $(this).text().trim(); + $input.val(text); + $input.trigger('change'); + $autocomplete.empty(); + resetCurrentElement(); + + // Handle onAutocomplete callback. + if (typeof(options.onAutocomplete) === "function") { + options.onAutocomplete.call(this, text); + } + }); + } + }); + }; + + }); // End of $(document).ready + + /******************* + * Select Plugin * + ******************/ + $.fn.material_select = function (callback) { + $(this).each(function(){ + var $select = $(this); + + if ($select.hasClass('browser-default')) { + return; // Continue to next (return false breaks out of entire loop) + } + + var multiple = $select.attr('multiple') ? true : false, + lastID = $select.data('select-id'); // Tear down structure if Select needs to be rebuilt + + if (lastID) { + $select.parent().find('span.caret').remove(); + $select.parent().find('input').remove(); + + $select.unwrap(); + $('ul#select-options-'+lastID).remove(); + } + + // If destroying the select, remove the selelct-id and reset it to it's uninitialized state. + if(callback === 'destroy') { + $select.data('select-id', null).removeClass('initialized'); + return; + } + + var uniqueID = Materialize.guid(); + $select.data('select-id', uniqueID); + var wrapper = $('<div class="select-wrapper"></div>'); + wrapper.addClass($select.attr('class')); + var options = $('<ul id="select-options-' + uniqueID +'" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'), + selectChildren = $select.children('option, optgroup'), + valuesSelected = [], + optionsHover = false; + + var label = $select.find('option:selected').html() || $select.find('option:first').html() || ""; + + // Function that renders and appends the option taking into + // account type and possible image icon. + var appendOptionWithIcon = function(select, option, type) { + // Add disabled attr if disabled + var disabledClass = (option.is(':disabled')) ? 'disabled ' : ''; + var optgroupClass = (type === 'optgroup-option') ? 'optgroup-option ' : ''; + + // add icons + var icon_url = option.data('icon'); + var classes = option.attr('class'); + if (!!icon_url) { + var classString = ''; + if (!!classes) classString = ' class="' + classes + '"'; + + // Check for multiple type. + if (type === 'multiple') { + options.append($('<li class="' + disabledClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span><input type="checkbox"' + disabledClass + '/><label></label>' + option.html() + '</span></li>')); + } else { + options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + option.html() + '</span></li>')); + } + return true; + } + + // Check for multiple type. + if (type === 'multiple') { + options.append($('<li class="' + disabledClass + '"><span><input type="checkbox"' + disabledClass + '/><label></label>' + option.html() + '</span></li>')); + } else { + options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + option.html() + '</span></li>')); + } + }; + + /* Create dropdown structure. */ + if (selectChildren.length) { + selectChildren.each(function() { + if ($(this).is('option')) { + // Direct descendant option. + if (multiple) { + appendOptionWithIcon($select, $(this), 'multiple'); + + } else { + appendOptionWithIcon($select, $(this)); + } + } else if ($(this).is('optgroup')) { + // Optgroup. + var selectOptions = $(this).children('option'); + options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>')); + + selectOptions.each(function() { + appendOptionWithIcon($select, $(this), 'optgroup-option'); + }); + } + }); + } + + options.find('li:not(.optgroup)').each(function (i) { + $(this).click(function (e) { + // Check if option element is disabled + if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) { + var selected = true; + + if (multiple) { + $('input[type="checkbox"]', this).prop('checked', function(i, v) { return !v; }); + selected = toggleEntryFromArray(valuesSelected, $(this).index(), $select); + $newSelect.trigger('focus'); + } else { + options.find('li').removeClass('active'); + $(this).toggleClass('active'); + $newSelect.val($(this).text()); + } + + activateOption(options, $(this)); + $select.find('option').eq(i).prop('selected', selected); + // Trigger onchange() event + $select.trigger('change'); + if (typeof callback !== 'undefined') callback(); + } + + e.stopPropagation(); + }); + }); + + // Wrap Elements + $select.wrap(wrapper); + // Add Select Display Element + var dropdownIcon = $('<span class="caret">▼</span>'); + if ($select.is(':disabled')) + dropdownIcon.addClass('disabled'); + + // escape double quotes + var sanitizedLabelHtml = label.replace(/"/g, '"'); + + var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + (($select.is(':disabled')) ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID +'" value="'+ sanitizedLabelHtml +'"/>'); + $select.before($newSelect); + $newSelect.before(dropdownIcon); + + $newSelect.after(options); + // Check if section element is disabled + if (!$select.is(':disabled')) { + $newSelect.dropdown({'hover': false, 'closeOnClick': false}); + } + + // Copy tabindex + if ($select.attr('tabindex')) { + $($newSelect[0]).attr('tabindex', $select.attr('tabindex')); + } + + $select.addClass('initialized'); + + $newSelect.on({ + 'focus': function (){ + if ($('ul.select-dropdown').not(options[0]).is(':visible')) { + $('input.select-dropdown').trigger('close'); + } + if (!options.is(':visible')) { + $(this).trigger('open', ['focus']); + var label = $(this).val(); + if (multiple && label.indexOf(',') >= 0) { + label = label.split(',')[0]; + } + + var selectedOption = options.find('li').filter(function() { + return $(this).text().toLowerCase() === label.toLowerCase(); + })[0]; + activateOption(options, selectedOption, true); + } + }, + 'click': function (e){ + e.stopPropagation(); + } + }); + + $newSelect.on('blur', function() { + if (!multiple) { + $(this).trigger('close'); + } + options.find('li.selected').removeClass('selected'); + }); + + options.hover(function() { + optionsHover = true; + }, function () { + optionsHover = false; + }); + + $(window).on({ + 'click': function () { + multiple && (optionsHover || $newSelect.trigger('close')); + } + }); + + // Add initial multiple selections. + if (multiple) { + $select.find("option:selected:not(:disabled)").each(function () { + var index = $(this).index(); + + toggleEntryFromArray(valuesSelected, index, $select); + options.find("li").eq(index).find(":checkbox").prop("checked", true); + }); + } + + /** + * Make option as selected and scroll to selected position + * @param {jQuery} collection Select options jQuery element + * @param {Element} newOption element of the new option + * @param {Boolean} firstActivation If on first activation of select + */ + var activateOption = function(collection, newOption, firstActivation) { + if (newOption) { + collection.find('li.selected').removeClass('selected'); + var option = $(newOption); + option.addClass('selected'); + if (!multiple || !!firstActivation) { + options.scrollTo(option); + } + } + }; + + // Allow user to search by typing + // this array is cleared after 1 second + var filterQuery = [], + onKeyDown = function(e){ + // TAB - switch to another input + if(e.which == 9){ + $newSelect.trigger('close'); + return; + } + + // ARROW DOWN WHEN SELECT IS CLOSED - open select options + if(e.which == 40 && !options.is(':visible')){ + $newSelect.trigger('open'); + return; + } + + // ENTER WHEN SELECT IS CLOSED - submit form + if(e.which == 13 && !options.is(':visible')){ + return; + } + + e.preventDefault(); + + // CASE WHEN USER TYPE LETTERS + var letter = String.fromCharCode(e.which).toLowerCase(), + nonLetters = [9,13,27,38,40]; + if (letter && (nonLetters.indexOf(e.which) === -1)) { + filterQuery.push(letter); + + var string = filterQuery.join(''), + newOption = options.find('li').filter(function() { + return $(this).text().toLowerCase().indexOf(string) === 0; + })[0]; + + if (newOption) { + activateOption(options, newOption); + } + } + + // ENTER - select option and close when select options are opened + if (e.which == 13) { + var activeOption = options.find('li.selected:not(.disabled)')[0]; + if(activeOption){ + $(activeOption).trigger('click'); + if (!multiple) { + $newSelect.trigger('close'); + } + } + } + + // ARROW DOWN - move to next not disabled option + if (e.which == 40) { + if (options.find('li.selected').length) { + newOption = options.find('li.selected').next('li:not(.disabled)')[0]; + } else { + newOption = options.find('li:not(.disabled)')[0]; + } + activateOption(options, newOption); + } + + // ESC - close options + if (e.which == 27) { + $newSelect.trigger('close'); + } + + // ARROW UP - move to previous not disabled option + if (e.which == 38) { + newOption = options.find('li.selected').prev('li:not(.disabled)')[0]; + if(newOption) + activateOption(options, newOption); + } + + // Automaticaly clean filter query so user can search again by starting letters + setTimeout(function(){ filterQuery = []; }, 1000); + }; + + $newSelect.on('keydown', onKeyDown); + }); + + function toggleEntryFromArray(entriesArray, entryIndex, select) { + var index = entriesArray.indexOf(entryIndex), + notAdded = index === -1; + + if (notAdded) { + entriesArray.push(entryIndex); + } else { + entriesArray.splice(index, 1); + } + + select.siblings('ul.dropdown-content').find('li').eq(entryIndex).toggleClass('active'); + + // use notAdded instead of true (to detect if the option is selected or not) + select.find('option').eq(entryIndex).prop('selected', notAdded); + setValueToInput(entriesArray, select); + + return notAdded; + } + + function setValueToInput(entriesArray, select) { + var value = ''; + + for (var i = 0, count = entriesArray.length; i < count; i++) { + var text = select.find('option').eq(entriesArray[i]).text(); + + i === 0 ? value += text : value += ', ' + text; + } + + if (value === '') { + value = select.find('option:disabled').eq(0).text(); + } + + select.siblings('input.select-dropdown').val(value); + } + }; + +}( jQuery )); +;(function ($) { + + var methods = { + + init : function(options) { + var defaults = { + indicators: true, + height: 400, + transition: 500, + interval: 6000 + }; + options = $.extend(defaults, options); + + return this.each(function() { + + // For each slider, we want to keep track of + // which slide is active and its associated content + var $this = $(this); + var $slider = $this.find('ul.slides').first(); + var $slides = $slider.find('> li'); + var $active_index = $slider.find('.active').index(); + var $active, $indicators, $interval; + if ($active_index != -1) { $active = $slides.eq($active_index); } + + // Transitions the caption depending on alignment + function captionTransition(caption, duration) { + if (caption.hasClass("center-align")) { + caption.velocity({opacity: 0, translateY: -100}, {duration: duration, queue: false}); + } + else if (caption.hasClass("right-align")) { + caption.velocity({opacity: 0, translateX: 100}, {duration: duration, queue: false}); + } + else if (caption.hasClass("left-align")) { + caption.velocity({opacity: 0, translateX: -100}, {duration: duration, queue: false}); + } + } + + // This function will transition the slide to any index of the next slide + function moveToSlide(index) { + // Wrap around indices. + if (index >= $slides.length) index = 0; + else if (index < 0) index = $slides.length -1; + + $active_index = $slider.find('.active').index(); + + // Only do if index changes + if ($active_index != index) { + $active = $slides.eq($active_index); + $caption = $active.find('.caption'); + + $active.removeClass('active'); + $active.velocity({opacity: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad', + complete: function() { + $slides.not('.active').velocity({opacity: 0, translateX: 0, translateY: 0}, {duration: 0, queue: false}); + } }); + captionTransition($caption, options.transition); + + + // Update indicators + if (options.indicators) { + $indicators.eq($active_index).removeClass('active'); + } + + $slides.eq(index).velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'}); + $slides.eq(index).find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad'}); + $slides.eq(index).addClass('active'); + + + // Update indicators + if (options.indicators) { + $indicators.eq(index).addClass('active'); + } + } + } + + // Set height of slider + // If fullscreen, do nothing + if (!$this.hasClass('fullscreen')) { + if (options.indicators) { + // Add height if indicators are present + $this.height(options.height + 40); + } + else { + $this.height(options.height); + } + $slider.height(options.height); + } + + + // Set initial positions of captions + $slides.find('.caption').each(function () { + captionTransition($(this), 0); + }); + + // Move img src into background-image + $slides.find('img').each(function () { + var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw=='; + if ($(this).attr('src') !== placeholderBase64) { + $(this).css('background-image', 'url(' + $(this).attr('src') + ')' ); + $(this).attr('src', placeholderBase64); + } + }); + + // dynamically add indicators + if (options.indicators) { + $indicators = $('<ul class="indicators"></ul>'); + $slides.each(function( index ) { + var $indicator = $('<li class="indicator-item"></li>'); + + // Handle clicks on indicators + $indicator.click(function () { + var $parent = $slider.parent(); + var curr_index = $parent.find($(this)).index(); + moveToSlide(curr_index); + + // reset interval + clearInterval($interval); + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + + }, options.transition + options.interval + ); + }); + $indicators.append($indicator); + }); + $this.append($indicators); + $indicators = $this.find('ul.indicators').find('li.indicator-item'); + } + + if ($active) { + $active.show(); + } + else { + $slides.first().addClass('active').velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'}); + + $active_index = 0; + $active = $slides.eq($active_index); + + // Update indicators + if (options.indicators) { + $indicators.eq($active_index).addClass('active'); + } + } + + // Adjust height to current slide + $active.find('img').each(function() { + $active.find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad'}); + }); + + // auto scroll + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + moveToSlide($active_index + 1); + + }, options.transition + options.interval + ); + + + // HammerJS, Swipe navigation + + // Touch Event + var panning = false; + var swipeLeft = false; + var swipeRight = false; + + $this.hammer({ + prevent_default: false + }).bind('pan', function(e) { + if (e.gesture.pointerType === "touch") { + + // reset interval + clearInterval($interval); + + var direction = e.gesture.direction; + var x = e.gesture.deltaX; + var velocityX = e.gesture.velocityX; + var velocityY = e.gesture.velocityY; + + $curr_slide = $slider.find('.active'); + if (Math.abs(velocityX) > Math.abs(velocityY)) { + $curr_slide.velocity({ translateX: x + }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + } + + // Swipe Left + if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.65)) { + swipeRight = true; + } + // Swipe Right + else if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.65)) { + swipeLeft = true; + } + + // Make Slide Behind active slide visible + var next_slide; + if (swipeLeft) { + next_slide = $curr_slide.next(); + if (next_slide.length === 0) { + next_slide = $slides.first(); + } + next_slide.velocity({ opacity: 1 + }, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + if (swipeRight) { + next_slide = $curr_slide.prev(); + if (next_slide.length === 0) { + next_slide = $slides.last(); + } + next_slide.velocity({ opacity: 1 + }, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + + } + + }).bind('panend', function(e) { + if (e.gesture.pointerType === "touch") { + + $curr_slide = $slider.find('.active'); + panning = false; + curr_index = $slider.find('.active').index(); + + if (!swipeRight && !swipeLeft || $slides.length <=1) { + // Return to original spot + $curr_slide.velocity({ translateX: 0 + }, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + else if (swipeLeft) { + moveToSlide(curr_index + 1); + $curr_slide.velocity({translateX: -1 * $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function() { + $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false}); + } }); + } + else if (swipeRight) { + moveToSlide(curr_index - 1); + $curr_slide.velocity({translateX: $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function() { + $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false}); + } }); + } + swipeLeft = false; + swipeRight = false; + + // Restart interval + clearInterval($interval); + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + + }, options.transition + options.interval + ); + } + }); + + $this.on('sliderPause', function() { + clearInterval($interval); + }); + + $this.on('sliderStart', function() { + clearInterval($interval); + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + + }, options.transition + options.interval + ); + }); + + $this.on('sliderNext', function() { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index + 1); + }); + + $this.on('sliderPrev', function() { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index - 1); + }); + + }); + + + + }, + pause : function() { + $(this).trigger('sliderPause'); + }, + start : function() { + $(this).trigger('sliderStart'); + }, + next : function() { + $(this).trigger('sliderNext'); + }, + prev : function() { + $(this).trigger('sliderPrev'); + } + }; + + + $.fn.slider = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tooltip' ); + } + }; // Plugin end +}( jQuery )); +;(function ($) { + $(document).ready(function() { + + $(document).on('click.card', '.card', function (e) { + if ($(this).find('> .card-reveal').length) { + if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) { + // Make Reveal animate down and display none + $(this).find('.card-reveal').velocity( + {translateY: 0}, { + duration: 225, + queue: false, + easing: 'easeInOutQuad', + complete: function() { $(this).css({ display: 'none'}); } + } + ); + } + else if ($(e.target).is($('.card .activator')) || + $(e.target).is($('.card .activator i')) ) { + $(e.target).closest('.card').css('overflow', 'hidden'); + $(this).find('.card-reveal').css({ display: 'block'}).velocity("stop", false).velocity({translateY: '-100%'}, {duration: 300, queue: false, easing: 'easeInOutQuad'}); + } + } + }); + + }); +}( jQuery ));;(function ($) { + var materialChipsDefaults = { + data: [], + placeholder: '', + secondaryPlaceholder: '', + autocompleteData: {}, + autocompleteLimit: Infinity, + }; + + $(document).ready(function() { + // Handle removal of static chips. + $(document).on('click', '.chip .close', function(e){ + var $chips = $(this).closest('.chips'); + if ($chips.attr('data-initialized')) { + return; + } + $(this).closest('.chip').remove(); + }); + }); + + $.fn.material_chip = function (options) { + var self = this; + this.$el = $(this); + this.$document = $(document); + this.SELS = { + CHIPS: '.chips', + CHIP: '.chip', + INPUT: 'input', + DELETE: '.material-icons', + SELECTED_CHIP: '.selected', + }; + + if ('data' === options) { + return this.$el.data('chips'); + } + + var curr_options = $.extend({}, materialChipsDefaults, options); + self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteData); + + // Initialize + this.init = function() { + var i = 0; + var chips; + self.$el.each(function(){ + var $chips = $(this); + var chipId = Materialize.guid(); + self.chipId = chipId; + + if (!curr_options.data || !(curr_options.data instanceof Array)) { + curr_options.data = []; + } + $chips.data('chips', curr_options.data); + $chips.attr('data-index', i); + $chips.attr('data-initialized', true); + + if (!$chips.hasClass(self.SELS.CHIPS)) { + $chips.addClass('chips'); + } + + self.chips($chips, chipId); + i++; + }); + }; + + this.handleEvents = function() { + var SELS = self.SELS; + + self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function(e){ + $(e.target).find(SELS.INPUT).focus(); + }); + + self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function(e){ + var $chip = $(e.target); + if ($chip.length) { + var wasSelected = $chip.hasClass('selected'); + var $chips = $chip.closest(SELS.CHIPS); + $(SELS.CHIP).removeClass('selected'); + + if (!wasSelected) { + self.selectChip($chip.index(), $chips); + } + } + }); + + self.$document.off('keydown.chips').on('keydown.chips', function(e){ + if ($(e.target).is('input, textarea')) { + return; + } + + // delete + var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP); + var $chips = $chip.closest(SELS.CHIPS); + var length = $chip.siblings(SELS.CHIP).length; + var index; + + if (!$chip.length) { + return; + } + + if (e.which === 8 || e.which === 46) { + e.preventDefault(); + + index = $chip.index(); + self.deleteChip(index, $chips); + + var selectIndex = null; + if ((index + 1) < length) { + selectIndex = index; + } else if (index === length || (index + 1) === length) { + selectIndex = length - 1; + } + + if (selectIndex < 0) selectIndex = null; + + if (null !== selectIndex) { + self.selectChip(selectIndex, $chips); + } + if (!length) $chips.find('input').focus(); + + // left + } else if (e.which === 37) { + index = $chip.index() - 1; + if (index < 0) { + return; + } + $(SELS.CHIP).removeClass('selected'); + self.selectChip(index, $chips); + + // right + } else if (e.which === 39) { + index = $chip.index() + 1; + $(SELS.CHIP).removeClass('selected'); + if (index > length) { + $chips.find('input').focus(); + return; + } + self.selectChip(index, $chips); + } + }); + + self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){ + var $currChips = $(e.target).closest(SELS.CHIPS); + $currChips.addClass('focus'); + $currChips.siblings('label, .prefix').addClass('active'); + $(SELS.CHIP).removeClass('selected'); + }); + + self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){ + var $currChips = $(e.target).closest(SELS.CHIPS); + $currChips.removeClass('focus'); + + // Remove active if empty + if (!$currChips.data('chips').length) { + $currChips.siblings('label').removeClass('active'); + } + $currChips.siblings('.prefix').removeClass('active'); + }); + + self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function(e){ + var $target = $(e.target); + var $chips = $target.closest(SELS.CHIPS); + var chipsLength = $chips.children(SELS.CHIP).length; + + // enter + if (13 === e.which) { + // Override enter if autocompleting. + if (self.hasAutocomplete && + $chips.find('.autocomplete-content.dropdown-content').length && + $chips.find('.autocomplete-content.dropdown-content').children().length) { + return; + } + + e.preventDefault(); + self.addChip({tag: $target.val()}, $chips); + $target.val(''); + return; + } + + // delete or left + if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) { + e.preventDefault(); + self.selectChip(chipsLength - 1, $chips); + $target.blur(); + return; + } + }); + + // Click on delete icon in chip. + self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function(e) { + var $target = $(e.target); + var $chips = $target.closest(SELS.CHIPS); + var $chip = $target.closest(SELS.CHIP); + e.stopPropagation(); + self.deleteChip($chip.index(), $chips); + $chips.find('input').focus(); + }); + }; + + this.chips = function($chips, chipId) { + var html = ''; + $chips.data('chips').forEach(function(elem){ + html += self.renderChip(elem); + }); + html += '<input id="' + chipId +'" class="input" placeholder="">'; + $chips.html(html); + self.setPlaceholder($chips); + + // Set for attribute for label + var label = $chips.next('label'); + if (label.length) { + label.attr('for', chipId); + + if ($chips.data('chips').length) { + label.addClass('active'); + } + } + + // Setup autocomplete if needed. + var input = $('#' + chipId); + if (self.hasAutocomplete) { + input.autocomplete({ + data: curr_options.autocompleteData, + limit: curr_options.autocompleteLimit, + onAutocomplete: function(val) { + self.addChip({tag: val}, $chips); + input.val(''); + input.focus(); + }, + }) + } + }; + + this.renderChip = function(elem) { + if (!elem.tag) return; + + var html = '<div class="chip">' + elem.tag; + if (elem.image) { + html += ' <img src="' + elem.image + '"> '; + } + html += '<i class="material-icons close">close</i>'; + html += '</div>'; + return html; + }; + + this.setPlaceholder = function($chips) { + if ($chips.data('chips').length && curr_options.placeholder) { + $chips.find('input').prop('placeholder', curr_options.placeholder); + + } else if (!$chips.data('chips').length && curr_options.secondaryPlaceholder) { + $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder); + } + }; + + this.isValid = function($chips, elem) { + var chips = $chips.data('chips'); + var exists = false; + for (var i=0; i < chips.length; i++) { + if (chips[i].tag === elem.tag) { + exists = true; + return; + } + } + return '' !== elem.tag && !exists; + }; + + this.addChip = function(elem, $chips) { + if (!self.isValid($chips, elem)) { + return; + } + var chipHtml = self.renderChip(elem); + var newData = []; + var oldData = $chips.data('chips'); + for (var i = 0; i < oldData.length; i++) { + newData.push(oldData[i]); + } + newData.push(elem); + + $chips.data('chips', newData); + $(chipHtml).insertBefore($chips.find('input')); + $chips.trigger('chip.add', elem); + self.setPlaceholder($chips); + }; + + this.deleteChip = function(chipIndex, $chips) { + var chip = $chips.data('chips')[chipIndex]; + $chips.find('.chip').eq(chipIndex).remove(); + + var newData = []; + var oldData = $chips.data('chips'); + for (var i = 0; i < oldData.length; i++) { + if (i !== chipIndex) { + newData.push(oldData[i]); + } + } + + $chips.data('chips', newData); + $chips.trigger('chip.delete', chip); + self.setPlaceholder($chips); + }; + + this.selectChip = function(chipIndex, $chips) { + var $chip = $chips.find('.chip').eq(chipIndex); + if ($chip && false === $chip.hasClass('selected')) { + $chip.addClass('selected'); + $chips.trigger('chip.select', $chips.data('chips')[chipIndex]); + } + }; + + this.getChipsElement = function(index, $chips) { + return $chips.eq(index); + }; + + // init + this.init(); + + this.handleEvents(); + }; +}( jQuery )); +;(function ($) { + $.fn.pushpin = function (options) { + // Defaults + var defaults = { + top: 0, + bottom: Infinity, + offset: 0 + }; + + // Remove pushpin event and classes + if (options === "remove") { + this.each(function () { + if (id = $(this).data('pushpin-id')) { + $(window).off('scroll.' + id); + $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style'); + } + }); + return false; + } + + options = $.extend(defaults, options); + + + $index = 0; + return this.each(function() { + var $uniqueId = Materialize.guid(), + $this = $(this), + $original_offset = $(this).offset().top; + + function removePinClasses(object) { + object.removeClass('pin-top'); + object.removeClass('pinned'); + object.removeClass('pin-bottom'); + } + + function updateElements(objects, scrolled) { + objects.each(function () { + // Add position fixed (because its between top and bottom) + if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) { + removePinClasses($(this)); + $(this).css('top', options.offset); + $(this).addClass('pinned'); + } + + // Add pin-top (when scrolled position is above top) + if (scrolled < options.top && !$(this).hasClass('pin-top')) { + removePinClasses($(this)); + $(this).css('top', 0); + $(this).addClass('pin-top'); + } + + // Add pin-bottom (when scrolled position is below bottom) + if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) { + removePinClasses($(this)); + $(this).addClass('pin-bottom'); + $(this).css('top', options.bottom - $original_offset); + } + }); + } + + $(this).data('pushpin-id', $uniqueId); + updateElements($this, $(window).scrollTop()); + $(window).on('scroll.' + $uniqueId, function () { + var $scrolled = $(window).scrollTop() + options.offset; + updateElements($this, $scrolled); + }); + + }); + + }; +}( jQuery ));;(function ($) { + $(document).ready(function() { + + // jQuery reverse + $.fn.reverse = [].reverse; + + // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs! + $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) { + var $this = $(this); + openFABMenu($this); + }); + $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) { + var $this = $(this); + closeFABMenu($this); + }); + + // Toggle-on-click behaviour. + $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function(e) { + var $this = $(this); + var $menu = $this.parent(); + if ($menu.hasClass('active')) { + closeFABMenu($menu); + } else { + openFABMenu($menu); + } + }); + + // Toolbar transition behaviour. + $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function(e) { + var $this = $(this); + var $menu = $this.parent(); + FABtoToolbar($menu); + }); + + }); + + $.fn.extend({ + openFAB: function() { + openFABMenu($(this)); + }, + closeFAB: function() { + closeFABMenu($(this)); + }, + openToolbar: function() { + FABtoToolbar($(this)); + }, + closeToolbar: function() { + toolbarToFAB($(this)); + } + }); + + + var openFABMenu = function (btn) { + var $this = btn; + if ($this.hasClass('active') === false) { + + // Get direction option + var horizontal = $this.hasClass('horizontal'); + var offsetY, offsetX; + + if (horizontal === true) { + offsetX = 40; + } else { + offsetY = 40; + } + + $this.addClass('active'); + $this.find('ul .btn-floating').velocity( + { scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'}, + { duration: 0 }); + + var time = 0; + $this.find('ul .btn-floating').reverse().each( function () { + $(this).velocity( + { opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0'}, + { duration: 80, delay: time }); + time += 40; + }); + } + }; + + var closeFABMenu = function (btn) { + var $this = btn; + // Get direction option + var horizontal = $this.hasClass('horizontal'); + var offsetY, offsetX; + + if (horizontal === true) { + offsetX = 40; + } else { + offsetY = 40; + } + + $this.removeClass('active'); + var time = 0; + $this.find('ul .btn-floating').velocity("stop", true); + $this.find('ul .btn-floating').velocity( + { opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'}, + { duration: 80 } + ); + }; + + + /** + * Transform FAB into toolbar + * @param {Object} object jQuery object + */ + var FABtoToolbar = function(btn) { + if (btn.attr('data-open') === "true") { + return; + } + + var offsetX, offsetY, scaleFactor; + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var btnRect = btn[0].getBoundingClientRect(); + var anchor = btn.find('> a').first(); + var menu = btn.find('> ul').first(); + var backdrop = $('<div class="fab-backdrop"></div>'); + var fabColor = anchor.css('background-color'); + anchor.append(backdrop); + + offsetX = btnRect.left - (windowWidth / 2) + (btnRect.width / 2); + offsetY = windowHeight - btnRect.bottom; + scaleFactor = windowWidth / backdrop.width(); + btn.attr('data-origin-bottom', btnRect.bottom); + btn.attr('data-origin-left', btnRect.left); + btn.attr('data-origin-width', btnRect.width); + + // Set initial state + btn.addClass('active'); + btn.attr('data-open', true); + btn.css({ + 'text-align': 'center', + width: '100%', + bottom: 0, + left: 0, + transform: 'translateX(' + offsetX + 'px)', + transition: 'none' + }); + anchor.css({ + transform: 'translateY(' + -offsetY + 'px)', + transition: 'none' + }); + backdrop.css({ + 'background-color': fabColor + }); + + + setTimeout(function() { + btn.css({ + transform: '', + transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s' + }); + anchor.css({ + overflow: 'visible', + transform: '', + transition: 'transform .2s' + }); + + setTimeout(function() { + btn.css({ + overflow: 'hidden', + 'background-color': fabColor + }); + backdrop.css({ + transform: 'scale(' + scaleFactor + ')', + transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' + }); + menu.find('> li > a').css({ + opacity: 1 + }); + + // Scroll to close. + $(window).on('scroll.fabToolbarClose', function() { + toolbarToFAB(btn); + $(window).off('scroll.fabToolbarClose'); + $(document).off('click.fabToolbarClose'); + }); + + $(document).on('click.fabToolbarClose', function(e) { + if (!$(e.target).closest(menu).length) { + toolbarToFAB(btn); + $(window).off('scroll.fabToolbarClose'); + $(document).off('click.fabToolbarClose'); + } + }); + }, 100); + }, 0); + }; + + /** + * Transform toolbar back into FAB + * @param {Object} object jQuery object + */ + var toolbarToFAB = function(btn) { + if (btn.attr('data-open') !== "true") { + return; + } + + var offsetX, offsetY, scaleFactor; + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var btnWidth = btn.attr('data-origin-width'); + var btnBottom = btn.attr('data-origin-bottom'); + var btnLeft = btn.attr('data-origin-left'); + var anchor = btn.find('> .btn-floating').first(); + var menu = btn.find('> ul').first(); + var backdrop = btn.find('.fab-backdrop'); + var fabColor = anchor.css('background-color'); + + offsetX = btnLeft - (windowWidth / 2) + (btnWidth / 2); + offsetY = windowHeight - btnBottom; + scaleFactor = windowWidth / backdrop.width(); + + + // Hide backdrop + btn.removeClass('active'); + btn.attr('data-open', false); + btn.css({ + 'background-color': 'transparent', + transition: 'none' + }); + anchor.css({ + transition: 'none' + }); + backdrop.css({ + transform: 'scale(0)', + 'background-color': fabColor + }); + menu.find('> li > a').css({ + opacity: '' + }); + + setTimeout(function() { + backdrop.remove(); + + // Set initial state. + btn.css({ + 'text-align': '', + width: '', + bottom: '', + left: '', + overflow: '', + 'background-color': '', + transform: 'translate3d(' + -offsetX + 'px,0,0)' + }); + anchor.css({ + overflow: '', + transform: 'translate3d(0,' + offsetY + 'px,0)' + }); + + setTimeout(function() { + btn.css({ + transform: 'translate3d(0,0,0)', + transition: 'transform .2s' + }); + anchor.css({ + transform: 'translate3d(0,0,0)', + transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' + }); + }, 20); + }, 200); + }; + + +}( jQuery )); +;(function ($) { + // Image transition function + Materialize.fadeInImage = function(selectorOrEl) { + var element; + if (typeof(selectorOrEl) === 'string') { + element = $(selectorOrEl); + } else if (typeof(selectorOrEl) === 'object') { + element = selectorOrEl; + } else { + return; + } + element.css({opacity: 0}); + $(element).velocity({opacity: 1}, { + duration: 650, + queue: false, + easing: 'easeOutSine' + }); + $(element).velocity({opacity: 1}, { + duration: 1300, + queue: false, + easing: 'swing', + step: function(now, fx) { + fx.start = 100; + var grayscale_setting = now/100; + var brightness_setting = 150 - (100 - now)/1.75; + + if (brightness_setting < 100) { + brightness_setting = 100; + } + if (now >= 0) { + $(this).css({ + "-webkit-filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)", + "filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)" + }); + } + } + }); + }; + + // Horizontal staggered list + Materialize.showStaggeredList = function(selectorOrEl) { + var element; + if (typeof(selectorOrEl) === 'string') { + element = $(selectorOrEl); + } else if (typeof(selectorOrEl) === 'object') { + element = selectorOrEl; + } else { + return; + } + var time = 0; + element.find('li').velocity( + { translateX: "-100px"}, + { duration: 0 }); + + element.find('li').each(function() { + $(this).velocity( + { opacity: "1", translateX: "0"}, + { duration: 800, delay: time, easing: [60, 10] }); + time += 120; + }); + }; + + + $(document).ready(function() { + // Hardcoded .staggered-list scrollFire + // var staggeredListOptions = []; + // $('ul.staggered-list').each(function (i) { + + // var label = 'scrollFire-' + i; + // $(this).addClass(label); + // staggeredListOptions.push( + // {selector: 'ul.staggered-list.' + label, + // offset: 200, + // callback: 'showStaggeredList("ul.staggered-list.' + label + '")'}); + // }); + // scrollFire(staggeredListOptions); + + // HammerJS, Swipe navigation + + // Touch Event + var swipeLeft = false; + var swipeRight = false; + + + // Dismissible Collections + $('.dismissable').each(function() { + $(this).hammer({ + prevent_default: false + }).bind('pan', function(e) { + if (e.gesture.pointerType === "touch") { + var $this = $(this); + var direction = e.gesture.direction; + var x = e.gesture.deltaX; + var velocityX = e.gesture.velocityX; + + $this.velocity({ translateX: x + }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + + // Swipe Left + if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.75)) { + swipeLeft = true; + } + + // Swipe Right + if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.75)) { + swipeRight = true; + } + } + }).bind('panend', function(e) { + // Reset if collection is moved back into original position + if (Math.abs(e.gesture.deltaX) < ($(this).innerWidth() / 2)) { + swipeRight = false; + swipeLeft = false; + } + + if (e.gesture.pointerType === "touch") { + var $this = $(this); + if (swipeLeft || swipeRight) { + var fullWidth; + if (swipeLeft) { fullWidth = $this.innerWidth(); } + else { fullWidth = -1 * $this.innerWidth(); } + + $this.velocity({ translateX: fullWidth, + }, {duration: 100, queue: false, easing: 'easeOutQuad', complete: + function() { + $this.css('border', 'none'); + $this.velocity({ height: 0, padding: 0, + }, {duration: 200, queue: false, easing: 'easeOutQuad', complete: + function() { $this.remove(); } + }); + } + }); + } + else { + $this.velocity({ translateX: 0, + }, {duration: 100, queue: false, easing: 'easeOutQuad'}); + } + swipeLeft = false; + swipeRight = false; + } + }); + + }); + + + // time = 0 + // // Vertical Staggered list + // $('ul.staggered-list.vertical li').velocity( + // { translateY: "100px"}, + // { duration: 0 }); + + // $('ul.staggered-list.vertical li').each(function() { + // $(this).velocity( + // { opacity: "1", translateY: "0"}, + // { duration: 800, delay: time, easing: [60, 25] }); + // time += 120; + // }); + + // // Fade in and Scale + // $('.fade-in.scale').velocity( + // { scaleX: .4, scaleY: .4, translateX: -600}, + // { duration: 0}); + // $('.fade-in').each(function() { + // $(this).velocity( + // { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0}, + // { duration: 800, easing: [60, 10] }); + // }); + }); +}( jQuery )); +;(function($) { + + var scrollFireEventsHandled = false; + + // Input: Array of JSON objects {selector, offset, callback} + Materialize.scrollFire = function(options) { + var onScroll = function() { + var windowScroll = window.pageYOffset + window.innerHeight; + + for (var i = 0 ; i < options.length; i++) { + // Get options from each line + var value = options[i]; + var selector = value.selector, + offset = value.offset, + callback = value.callback; + + var currentElement = document.querySelector(selector); + if ( currentElement !== null) { + var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset; + + if (windowScroll > (elementOffset + offset)) { + if (value.done !== true) { + if (typeof(callback) === 'function') { + callback.call(this, currentElement); + } else if (typeof(callback) === 'string') { + var callbackFunc = new Function(callback); + callbackFunc(currentElement); + } + value.done = true; + } + } + } + } + }; + + + var throttledScroll = Materialize.throttle(function() { + onScroll(); + }, options.throttle || 100); + + if (!scrollFireEventsHandled) { + window.addEventListener("scroll", throttledScroll); + window.addEventListener("resize", throttledScroll); + scrollFireEventsHandled = true; + } + + // perform a scan once, after current execution context, and after dom is ready + setTimeout(throttledScroll, 0); + }; + +})(jQuery); +;/*! + * pickadate.js v3.5.0, 2014/04/13 + * By Amsul, http://amsul.ca + * Hosted on http://amsul.github.io/pickadate.js + * Licensed under MIT + */ + +(function ( factory ) { + + // AMD. + if ( typeof define == 'function' && define.amd ) + define( 'picker', ['jquery'], factory ) + + // Node.js/browserify. + else if ( typeof exports == 'object' ) + module.exports = factory( require('jquery') ) + + // Browser globals. + else this.Picker = factory( jQuery ) + +}(function( $ ) { + +var $window = $( window ) +var $document = $( document ) +var $html = $( document.documentElement ) + + +/** + * The picker constructor that creates a blank picker. + */ +function PickerConstructor( ELEMENT, NAME, COMPONENT, OPTIONS ) { + + // If there’s no element, return the picker constructor. + if ( !ELEMENT ) return PickerConstructor + + + var + IS_DEFAULT_THEME = false, + + + // The state of the picker. + STATE = { + id: ELEMENT.id || 'P' + Math.abs( ~~(Math.random() * new Date()) ) + }, + + + // Merge the defaults and options passed. + SETTINGS = COMPONENT ? $.extend( true, {}, COMPONENT.defaults, OPTIONS ) : OPTIONS || {}, + + + // Merge the default classes with the settings classes. + CLASSES = $.extend( {}, PickerConstructor.klasses(), SETTINGS.klass ), + + + // The element node wrapper into a jQuery object. + $ELEMENT = $( ELEMENT ), + + + // Pseudo picker constructor. + PickerInstance = function() { + return this.start() + }, + + + // The picker prototype. + P = PickerInstance.prototype = { + + constructor: PickerInstance, + + $node: $ELEMENT, + + + /** + * Initialize everything + */ + start: function() { + + // If it’s already started, do nothing. + if ( STATE && STATE.start ) return P + + + // Update the picker states. + STATE.methods = {} + STATE.start = true + STATE.open = false + STATE.type = ELEMENT.type + + + // Confirm focus state, convert into text input to remove UA stylings, + // and set as readonly to prevent keyboard popup. + ELEMENT.autofocus = ELEMENT == getActiveElement() + ELEMENT.readOnly = !SETTINGS.editable + ELEMENT.id = ELEMENT.id || STATE.id + if ( ELEMENT.type != 'text' ) { + ELEMENT.type = 'text' + } + + + // Create a new picker component with the settings. + P.component = new COMPONENT(P, SETTINGS) + + + // Create the picker root with a holder and then prepare it. + P.$root = $( PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"') ) + prepareElementRoot() + + + // If there’s a format for the hidden input element, create the element. + if ( SETTINGS.formatSubmit ) { + prepareElementHidden() + } + + + // Prepare the input element. + prepareElement() + + + // Insert the root as specified in the settings. + if ( SETTINGS.container ) $( SETTINGS.container ).append( P.$root ) + else $ELEMENT.after( P.$root ) + + + // Bind the default component and settings events. + P.on({ + start: P.component.onStart, + render: P.component.onRender, + stop: P.component.onStop, + open: P.component.onOpen, + close: P.component.onClose, + set: P.component.onSet + }).on({ + start: SETTINGS.onStart, + render: SETTINGS.onRender, + stop: SETTINGS.onStop, + open: SETTINGS.onOpen, + close: SETTINGS.onClose, + set: SETTINGS.onSet + }) + + + // Once we’re all set, check the theme in use. + IS_DEFAULT_THEME = isUsingDefaultTheme( P.$root.children()[ 0 ] ) + + + // If the element has autofocus, open the picker. + if ( ELEMENT.autofocus ) { + P.open() + } + + + // Trigger queued the “start” and “render” events. + return P.trigger( 'start' ).trigger( 'render' ) + }, //start + + + /** + * Render a new picker + */ + render: function( entireComponent ) { + + // Insert a new component holder in the root or box. + if ( entireComponent ) P.$root.html( createWrappedComponent() ) + else P.$root.find( '.' + CLASSES.box ).html( P.component.nodes( STATE.open ) ) + + // Trigger the queued “render” events. + return P.trigger( 'render' ) + }, //render + + + /** + * Destroy everything + */ + stop: function() { + + // If it’s already stopped, do nothing. + if ( !STATE.start ) return P + + // Then close the picker. + P.close() + + // Remove the hidden field. + if ( P._hidden ) { + P._hidden.parentNode.removeChild( P._hidden ) + } + + // Remove the root. + P.$root.remove() + + // Remove the input class, remove the stored data, and unbind + // the events (after a tick for IE - see `P.close`). + $ELEMENT.removeClass( CLASSES.input ).removeData( NAME ) + setTimeout( function() { + $ELEMENT.off( '.' + STATE.id ) + }, 0) + + // Restore the element state + ELEMENT.type = STATE.type + ELEMENT.readOnly = false + + // Trigger the queued “stop” events. + P.trigger( 'stop' ) + + // Reset the picker states. + STATE.methods = {} + STATE.start = false + + return P + }, //stop + + + /** + * Open up the picker + */ + open: function( dontGiveFocus ) { + + // If it’s already open, do nothing. + if ( STATE.open ) return P + + // Add the “active” class. + $ELEMENT.addClass( CLASSES.active ) + aria( ELEMENT, 'expanded', true ) + + // * A Firefox bug, when `html` has `overflow:hidden`, results in + // killing transitions :(. So add the “opened” state on the next tick. + // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 + setTimeout( function() { + + // Add the “opened” class to the picker root. + P.$root.addClass( CLASSES.opened ) + aria( P.$root[0], 'hidden', false ) + + }, 0 ) + + // If we have to give focus, bind the element and doc events. + if ( dontGiveFocus !== false ) { + + // Set it as open. + STATE.open = true + + // Prevent the page from scrolling. + if ( IS_DEFAULT_THEME ) { + $html. + css( 'overflow', 'hidden' ). + css( 'padding-right', '+=' + getScrollbarWidth() ) + } + + // Pass focus to the root element’s jQuery object. + // * Workaround for iOS8 to bring the picker’s root into view. + P.$root.eq(0).focus() + + // Bind the document events. + $document.on( 'click.' + STATE.id + ' focusin.' + STATE.id, function( event ) { + + var target = event.target + + // If the target of the event is not the element, close the picker picker. + // * Don’t worry about clicks or focusins on the root because those don’t bubble up. + // Also, for Firefox, a click on an `option` element bubbles up directly + // to the doc. So make sure the target wasn't the doc. + // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling, + // which causes the picker to unexpectedly close when right-clicking it. So make + // sure the event wasn’t a right-click. + if ( target != ELEMENT && target != document && event.which != 3 ) { + + // If the target was the holder that covers the screen, + // keep the element focused to maintain tabindex. + P.close( target === P.$root.children()[0] ) + } + + }).on( 'keydown.' + STATE.id, function( event ) { + + var + // Get the keycode. + keycode = event.keyCode, + + // Translate that to a selection change. + keycodeToMove = P.component.key[ keycode ], + + // Grab the target. + target = event.target + + + // On escape, close the picker and give focus. + if ( keycode == 27 ) { + P.close( true ) + } + + + // Check if there is a key movement or “enter” keypress on the element. + else if ( target == P.$root[0] && ( keycodeToMove || keycode == 13 ) ) { + + // Prevent the default action to stop page movement. + event.preventDefault() + + // Trigger the key movement action. + if ( keycodeToMove ) { + PickerConstructor._.trigger( P.component.key.go, P, [ PickerConstructor._.trigger( keycodeToMove ) ] ) + } + + // On “enter”, if the highlighted item isn’t disabled, set the value and close. + else if ( !P.$root.find( '.' + CLASSES.highlighted ).hasClass( CLASSES.disabled ) ) { + P.set( 'select', P.component.item.highlight ).close() + } + } + + + // If the target is within the root and “enter” is pressed, + // prevent the default action and trigger a click on the target instead. + else if ( $.contains( P.$root[0], target ) && keycode == 13 ) { + event.preventDefault() + target.click() + } + }) + } + + // Trigger the queued “open” events. + return P.trigger( 'open' ) + }, //open + + + /** + * Close the picker + */ + close: function( giveFocus ) { + + // If we need to give focus, do it before changing states. + if ( giveFocus ) { + // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :| + // The focus is triggered *after* the close has completed - causing it + // to open again. So unbind and rebind the event at the next tick. + P.$root.off( 'focus.toOpen' ).eq(0).focus() + setTimeout( function() { + P.$root.on( 'focus.toOpen', handleFocusToOpenEvent ) + }, 0 ) + } + + // Remove the “active” class. + $ELEMENT.removeClass( CLASSES.active ) + aria( ELEMENT, 'expanded', false ) + + // * A Firefox bug, when `html` has `overflow:hidden`, results in + // killing transitions :(. So remove the “opened” state on the next tick. + // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 + setTimeout( function() { + + // Remove the “opened” and “focused” class from the picker root. + P.$root.removeClass( CLASSES.opened + ' ' + CLASSES.focused ) + aria( P.$root[0], 'hidden', true ) + + }, 0 ) + + // If it’s already closed, do nothing more. + if ( !STATE.open ) return P + + // Set it as closed. + STATE.open = false + + // Allow the page to scroll. + if ( IS_DEFAULT_THEME ) { + $html. + css( 'overflow', '' ). + css( 'padding-right', '-=' + getScrollbarWidth() ) + } + + // Unbind the document events. + $document.off( '.' + STATE.id ) + + // Trigger the queued “close” events. + return P.trigger( 'close' ) + }, //close + + + /** + * Clear the values + */ + clear: function( options ) { + return P.set( 'clear', null, options ) + }, //clear + + + /** + * Set something + */ + set: function( thing, value, options ) { + + var thingItem, thingValue, + thingIsObject = $.isPlainObject( thing ), + thingObject = thingIsObject ? thing : {} + + // Make sure we have usable options. + options = thingIsObject && $.isPlainObject( value ) ? value : options || {} + + if ( thing ) { + + // If the thing isn’t an object, make it one. + if ( !thingIsObject ) { + thingObject[ thing ] = value + } + + // Go through the things of items to set. + for ( thingItem in thingObject ) { + + // Grab the value of the thing. + thingValue = thingObject[ thingItem ] + + // First, if the item exists and there’s a value, set it. + if ( thingItem in P.component.item ) { + if ( thingValue === undefined ) thingValue = null + P.component.set( thingItem, thingValue, options ) + } + + // Then, check to update the element value and broadcast a change. + if ( thingItem == 'select' || thingItem == 'clear' ) { + $ELEMENT. + val( thingItem == 'clear' ? '' : P.get( thingItem, SETTINGS.format ) ). + trigger( 'change' ) + } + } + + // Render a new picker. + P.render() + } + + // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`. + return options.muted ? P : P.trigger( 'set', thingObject ) + }, //set + + + /** + * Get something + */ + get: function( thing, format ) { + + // Make sure there’s something to get. + thing = thing || 'value' + + // If a picker state exists, return that. + if ( STATE[ thing ] != null ) { + return STATE[ thing ] + } + + // Return the submission value, if that. + if ( thing == 'valueSubmit' ) { + if ( P._hidden ) { + return P._hidden.value + } + thing = 'value' + } + + // Return the value, if that. + if ( thing == 'value' ) { + return ELEMENT.value + } + + // Check if a component item exists, return that. + if ( thing in P.component.item ) { + if ( typeof format == 'string' ) { + var thingValue = P.component.get( thing ) + return thingValue ? + PickerConstructor._.trigger( + P.component.formats.toString, + P.component, + [ format, thingValue ] + ) : '' + } + return P.component.get( thing ) + } + }, //get + + + + /** + * Bind events on the things. + */ + on: function( thing, method, internal ) { + + var thingName, thingMethod, + thingIsObject = $.isPlainObject( thing ), + thingObject = thingIsObject ? thing : {} + + if ( thing ) { + + // If the thing isn’t an object, make it one. + if ( !thingIsObject ) { + thingObject[ thing ] = method + } + + // Go through the things to bind to. + for ( thingName in thingObject ) { + + // Grab the method of the thing. + thingMethod = thingObject[ thingName ] + + // If it was an internal binding, prefix it. + if ( internal ) { + thingName = '_' + thingName + } + + // Make sure the thing methods collection exists. + STATE.methods[ thingName ] = STATE.methods[ thingName ] || [] + + // Add the method to the relative method collection. + STATE.methods[ thingName ].push( thingMethod ) + } + } + + return P + }, //on + + + + /** + * Unbind events on the things. + */ + off: function() { + var i, thingName, + names = arguments; + for ( i = 0, namesCount = names.length; i < namesCount; i += 1 ) { + thingName = names[i] + if ( thingName in STATE.methods ) { + delete STATE.methods[thingName] + } + } + return P + }, + + + /** + * Fire off method events. + */ + trigger: function( name, data ) { + var _trigger = function( name ) { + var methodList = STATE.methods[ name ] + if ( methodList ) { + methodList.map( function( method ) { + PickerConstructor._.trigger( method, P, [ data ] ) + }) + } + } + _trigger( '_' + name ) + _trigger( name ) + return P + } //trigger + } //PickerInstance.prototype + + + /** + * Wrap the picker holder components together. + */ + function createWrappedComponent() { + + // Create a picker wrapper holder + return PickerConstructor._.node( 'div', + + // Create a picker wrapper node + PickerConstructor._.node( 'div', + + // Create a picker frame + PickerConstructor._.node( 'div', + + // Create a picker box node + PickerConstructor._.node( 'div', + + // Create the components nodes. + P.component.nodes( STATE.open ), + + // The picker box class + CLASSES.box + ), + + // Picker wrap class + CLASSES.wrap + ), + + // Picker frame class + CLASSES.frame + ), + + // Picker holder class + CLASSES.holder + ) //endreturn + } //createWrappedComponent + + + + /** + * Prepare the input element with all bindings. + */ + function prepareElement() { + + $ELEMENT. + + // Store the picker data by component name. + data(NAME, P). + + // Add the “input” class name. + addClass(CLASSES.input). + + // Remove the tabindex. + attr('tabindex', -1). + + // If there’s a `data-value`, update the value of the element. + val( $ELEMENT.data('value') ? + P.get('select', SETTINGS.format) : + ELEMENT.value + ) + + + // Only bind keydown events if the element isn’t editable. + if ( !SETTINGS.editable ) { + + $ELEMENT. + + // On focus/click, focus onto the root to open it up. + on( 'focus.' + STATE.id + ' click.' + STATE.id, function( event ) { + event.preventDefault() + P.$root.eq(0).focus() + }). + + // Handle keyboard event based on the picker being opened or not. + on( 'keydown.' + STATE.id, handleKeydownEvent ) + } + + + // Update the aria attributes. + aria(ELEMENT, { + haspopup: true, + expanded: false, + readonly: false, + owns: ELEMENT.id + '_root' + }) + } + + + /** + * Prepare the root picker element with all bindings. + */ + function prepareElementRoot() { + + P.$root. + + on({ + + // For iOS8. + keydown: handleKeydownEvent, + + // When something within the root is focused, stop from bubbling + // to the doc and remove the “focused” state from the root. + focusin: function( event ) { + P.$root.removeClass( CLASSES.focused ) + event.stopPropagation() + }, + + // When something within the root holder is clicked, stop it + // from bubbling to the doc. + 'mousedown click': function( event ) { + + var target = event.target + + // Make sure the target isn’t the root holder so it can bubble up. + if ( target != P.$root.children()[ 0 ] ) { + + event.stopPropagation() + + // * For mousedown events, cancel the default action in order to + // prevent cases where focus is shifted onto external elements + // when using things like jQuery mobile or MagnificPopup (ref: #249 & #120). + // Also, for Firefox, don’t prevent action on the `option` element. + if ( event.type == 'mousedown' && !$( target ).is( 'input, select, textarea, button, option' )) { + + event.preventDefault() + + // Re-focus onto the root so that users can click away + // from elements focused within the picker. + P.$root.eq(0).focus() + } + } + } + }). + + // Add/remove the “target” class on focus and blur. + on({ + focus: function() { + $ELEMENT.addClass( CLASSES.target ) + }, + blur: function() { + $ELEMENT.removeClass( CLASSES.target ) + } + }). + + // Open the picker and adjust the root “focused” state + on( 'focus.toOpen', handleFocusToOpenEvent ). + + // If there’s a click on an actionable element, carry out the actions. + on( 'click', '[data-pick], [data-nav], [data-clear], [data-close]', function() { + + var $target = $( this ), + targetData = $target.data(), + targetDisabled = $target.hasClass( CLASSES.navDisabled ) || $target.hasClass( CLASSES.disabled ), + + // * For IE, non-focusable elements can be active elements as well + // (http://stackoverflow.com/a/2684561). + activeElement = getActiveElement() + activeElement = activeElement && ( activeElement.type || activeElement.href ) + + // If it’s disabled or nothing inside is actively focused, re-focus the element. + if ( targetDisabled || activeElement && !$.contains( P.$root[0], activeElement ) ) { + P.$root.eq(0).focus() + } + + // If something is superficially changed, update the `highlight` based on the `nav`. + if ( !targetDisabled && targetData.nav ) { + P.set( 'highlight', P.component.item.highlight, { nav: targetData.nav } ) + } + + // If something is picked, set `select` then close with focus. + else if ( !targetDisabled && 'pick' in targetData ) { + P.set( 'select', targetData.pick ) + } + + // If a “clear” button is pressed, empty the values and close with focus. + else if ( targetData.clear ) { + P.clear().close( true ) + } + + else if ( targetData.close ) { + P.close( true ) + } + + }) //P.$root + + aria( P.$root[0], 'hidden', true ) + } + + + /** + * Prepare the hidden input element along with all bindings. + */ + function prepareElementHidden() { + + var name + + if ( SETTINGS.hiddenName === true ) { + name = ELEMENT.name + ELEMENT.name = '' + } + else { + name = [ + typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', + typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit' + ] + name = name[0] + ELEMENT.name + name[1] + } + + P._hidden = $( + '<input ' + + 'type=hidden ' + + + // Create the name using the original input’s with a prefix and suffix. + 'name="' + name + '"' + + + // If the element has a value, set the hidden value as well. + ( + $ELEMENT.data('value') || ELEMENT.value ? + ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' : + '' + ) + + '>' + )[0] + + $ELEMENT. + + // If the value changes, update the hidden input with the correct format. + on('change.' + STATE.id, function() { + P._hidden.value = ELEMENT.value ? + P.get('select', SETTINGS.formatSubmit) : + '' + }) + + + // Insert the hidden input as specified in the settings. + if ( SETTINGS.container ) $( SETTINGS.container ).append( P._hidden ) + else $ELEMENT.after( P._hidden ) + } + + + // For iOS8. + function handleKeydownEvent( event ) { + + var keycode = event.keyCode, + + // Check if one of the delete keys was pressed. + isKeycodeDelete = /^(8|46)$/.test(keycode) + + // For some reason IE clears the input value on “escape”. + if ( keycode == 27 ) { + P.close() + return false + } + + // Check if `space` or `delete` was pressed or the picker is closed with a key movement. + if ( keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode] ) { + + // Prevent it from moving the page and bubbling to doc. + event.preventDefault() + event.stopPropagation() + + // If `delete` was pressed, clear the values and close the picker. + // Otherwise open the picker. + if ( isKeycodeDelete ) { P.clear().close() } + else { P.open() } + } + } + + + // Separated for IE + function handleFocusToOpenEvent( event ) { + + // Stop the event from propagating to the doc. + event.stopPropagation() + + // If it’s a focus event, add the “focused” class to the root. + if ( event.type == 'focus' ) { + P.$root.addClass( CLASSES.focused ) + } + + // And then finally open the picker. + P.open() + } + + + // Return a new picker instance. + return new PickerInstance() +} //PickerConstructor + + + +/** + * The default classes and prefix to use for the HTML classes. + */ +PickerConstructor.klasses = function( prefix ) { + prefix = prefix || 'picker' + return { + + picker: prefix, + opened: prefix + '--opened', + focused: prefix + '--focused', + + input: prefix + '__input', + active: prefix + '__input--active', + target: prefix + '__input--target', + + holder: prefix + '__holder', + + frame: prefix + '__frame', + wrap: prefix + '__wrap', + + box: prefix + '__box' + } +} //PickerConstructor.klasses + + + +/** + * Check if the default theme is being used. + */ +function isUsingDefaultTheme( element ) { + + var theme, + prop = 'position' + + // For IE. + if ( element.currentStyle ) { + theme = element.currentStyle[prop] + } + + // For normal browsers. + else if ( window.getComputedStyle ) { + theme = getComputedStyle( element )[prop] + } + + return theme == 'fixed' +} + + + +/** + * Get the width of the browser’s scrollbar. + * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js + */ +function getScrollbarWidth() { + + if ( $html.height() <= $window.height() ) { + return 0 + } + + var $outer = $( '<div style="visibility:hidden;width:100px" />' ). + appendTo( 'body' ) + + // Get the width without scrollbars. + var widthWithoutScroll = $outer[0].offsetWidth + + // Force adding scrollbars. + $outer.css( 'overflow', 'scroll' ) + + // Add the inner div. + var $inner = $( '<div style="width:100%" />' ).appendTo( $outer ) + + // Get the width with scrollbars. + var widthWithScroll = $inner[0].offsetWidth + + // Remove the divs. + $outer.remove() + + // Return the difference between the widths. + return widthWithoutScroll - widthWithScroll +} + + + +/** + * PickerConstructor helper methods. + */ +PickerConstructor._ = { + + /** + * Create a group of nodes. Expects: + * ` + { + min: {Integer}, + max: {Integer}, + i: {Integer}, + node: {String}, + item: {Function} + } + * ` + */ + group: function( groupObject ) { + + var + // Scope for the looped object + loopObjectScope, + + // Create the nodes list + nodesList = '', + + // The counter starts from the `min` + counter = PickerConstructor._.trigger( groupObject.min, groupObject ) + + + // Loop from the `min` to `max`, incrementing by `i` + for ( ; counter <= PickerConstructor._.trigger( groupObject.max, groupObject, [ counter ] ); counter += groupObject.i ) { + + // Trigger the `item` function within scope of the object + loopObjectScope = PickerConstructor._.trigger( groupObject.item, groupObject, [ counter ] ) + + // Splice the subgroup and create nodes out of the sub nodes + nodesList += PickerConstructor._.node( + groupObject.node, + loopObjectScope[ 0 ], // the node + loopObjectScope[ 1 ], // the classes + loopObjectScope[ 2 ] // the attributes + ) + } + + // Return the list of nodes + return nodesList + }, //group + + + /** + * Create a dom node string + */ + node: function( wrapper, item, klass, attribute ) { + + // If the item is false-y, just return an empty string + if ( !item ) return '' + + // If the item is an array, do a join + item = $.isArray( item ) ? item.join( '' ) : item + + // Check for the class + klass = klass ? ' class="' + klass + '"' : '' + + // Check for any attributes + attribute = attribute ? ' ' + attribute : '' + + // Return the wrapped item + return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>' + }, //node + + + /** + * Lead numbers below 10 with a zero. + */ + lead: function( number ) { + return ( number < 10 ? '0': '' ) + number + }, + + + /** + * Trigger a function otherwise return the value. + */ + trigger: function( callback, scope, args ) { + return typeof callback == 'function' ? callback.apply( scope, args || [] ) : callback + }, + + + /** + * If the second character is a digit, length is 2 otherwise 1. + */ + digits: function( string ) { + return ( /\d/ ).test( string[ 1 ] ) ? 2 : 1 + }, + + + /** + * Tell if something is a date object. + */ + isDate: function( value ) { + return {}.toString.call( value ).indexOf( 'Date' ) > -1 && this.isInteger( value.getDate() ) + }, + + + /** + * Tell if something is an integer. + */ + isInteger: function( value ) { + return {}.toString.call( value ).indexOf( 'Number' ) > -1 && value % 1 === 0 + }, + + + /** + * Create ARIA attribute strings. + */ + ariaAttr: ariaAttr +} //PickerConstructor._ + + + +/** + * Extend the picker with a component and defaults. + */ +PickerConstructor.extend = function( name, Component ) { + + // Extend jQuery. + $.fn[ name ] = function( options, action ) { + + // Grab the component data. + var componentData = this.data( name ) + + // If the picker is requested, return the data object. + if ( options == 'picker' ) { + return componentData + } + + // If the component data exists and `options` is a string, carry out the action. + if ( componentData && typeof options == 'string' ) { + return PickerConstructor._.trigger( componentData[ options ], componentData, [ action ] ) + } + + // Otherwise go through each matched element and if the component + // doesn’t exist, create a new picker using `this` element + // and merging the defaults and options with a deep copy. + return this.each( function() { + var $this = $( this ) + if ( !$this.data( name ) ) { + new PickerConstructor( this, name, Component, options ) + } + }) + } + + // Set the defaults. + $.fn[ name ].defaults = Component.defaults +} //PickerConstructor.extend + + + +function aria(element, attribute, value) { + if ( $.isPlainObject(attribute) ) { + for ( var key in attribute ) { + ariaSet(element, key, attribute[key]) + } + } + else { + ariaSet(element, attribute, value) + } +} +function ariaSet(element, attribute, value) { + element.setAttribute( + (attribute == 'role' ? '' : 'aria-') + attribute, + value + ) +} +function ariaAttr(attribute, data) { + if ( !$.isPlainObject(attribute) ) { + attribute = { attribute: data } + } + data = '' + for ( var key in attribute ) { + var attr = (key == 'role' ? '' : 'aria-') + key, + attrVal = attribute[key] + data += attrVal == null ? '' : attr + '="' + attribute[key] + '"' + } + return data +} + +// IE8 bug throws an error for activeElements within iframes. +function getActiveElement() { + try { + return document.activeElement + } catch ( err ) { } +} + + + +// Expose the picker constructor. +return PickerConstructor + + +})); + + +;/*! + * Date picker for pickadate.js v3.5.0 + * http://amsul.github.io/pickadate.js/date.htm + */ + +(function ( factory ) { + + // AMD. + if ( typeof define == 'function' && define.amd ) + define( ['picker', 'jquery'], factory ) + + // Node.js/browserify. + else if ( typeof exports == 'object' ) + module.exports = factory( require('./picker.js'), require('jquery') ) + + // Browser globals. + else factory( Picker, jQuery ) + +}(function( Picker, $ ) { + + +/** + * Globals and constants + */ +var DAYS_IN_WEEK = 7, + WEEKS_IN_CALENDAR = 6, + _ = Picker._ + + + +/** + * The date picker constructor + */ +function DatePicker( picker, settings ) { + + var calendar = this, + element = picker.$node[ 0 ], + elementValue = element.value, + elementDataValue = picker.$node.data( 'value' ), + valueString = elementDataValue || elementValue, + formatString = elementDataValue ? settings.formatSubmit : settings.format, + isRTL = function() { + + return element.currentStyle ? + + // For IE. + element.currentStyle.direction == 'rtl' : + + // For normal browsers. + getComputedStyle( picker.$root[0] ).direction == 'rtl' + } + + calendar.settings = settings + calendar.$node = picker.$node + + // The queue of methods that will be used to build item objects. + calendar.queue = { + min: 'measure create', + max: 'measure create', + now: 'now create', + select: 'parse create validate', + highlight: 'parse navigate create validate', + view: 'parse create validate viewset', + disable: 'deactivate', + enable: 'activate' + } + + // The component's item object. + calendar.item = {} + + calendar.item.clear = null + calendar.item.disable = ( settings.disable || [] ).slice( 0 ) + calendar.item.enable = -(function( collectionDisabled ) { + return collectionDisabled[ 0 ] === true ? collectionDisabled.shift() : -1 + })( calendar.item.disable ) + + calendar. + set( 'min', settings.min ). + set( 'max', settings.max ). + set( 'now' ) + + // When there’s a value, set the `select`, which in turn + // also sets the `highlight` and `view`. + if ( valueString ) { + calendar.set( 'select', valueString, { format: formatString }) + } + + // If there’s no value, default to highlighting “today”. + else { + calendar. + set( 'select', null ). + set( 'highlight', calendar.item.now ) + } + + + // The keycode to movement mapping. + calendar.key = { + 40: 7, // Down + 38: -7, // Up + 39: function() { return isRTL() ? -1 : 1 }, // Right + 37: function() { return isRTL() ? 1 : -1 }, // Left + go: function( timeChange ) { + var highlightedObject = calendar.item.highlight, + targetDate = new Date( highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange ) + calendar.set( + 'highlight', + targetDate, + { interval: timeChange } + ) + this.render() + } + } + + + // Bind some picker events. + picker. + on( 'render', function() { + picker.$root.find( '.' + settings.klass.selectMonth ).on( 'change', function() { + var value = this.value + if ( value ) { + picker.set( 'highlight', [ picker.get( 'view' ).year, value, picker.get( 'highlight' ).date ] ) + picker.$root.find( '.' + settings.klass.selectMonth ).trigger( 'focus' ) + } + }) + picker.$root.find( '.' + settings.klass.selectYear ).on( 'change', function() { + var value = this.value + if ( value ) { + picker.set( 'highlight', [ value, picker.get( 'view' ).month, picker.get( 'highlight' ).date ] ) + picker.$root.find( '.' + settings.klass.selectYear ).trigger( 'focus' ) + } + }) + }, 1 ). + on( 'open', function() { + var includeToday = '' + if ( calendar.disabled( calendar.get('now') ) ) { + includeToday = ':not(.' + settings.klass.buttonToday + ')' + } + picker.$root.find( 'button' + includeToday + ', select' ).attr( 'disabled', false ) + }, 1 ). + on( 'close', function() { + picker.$root.find( 'button, select' ).attr( 'disabled', true ) + }, 1 ) + +} //DatePicker + + +/** + * Set a datepicker item object. + */ +DatePicker.prototype.set = function( type, value, options ) { + + var calendar = this, + calendarItem = calendar.item + + // If the value is `null` just set it immediately. + if ( value === null ) { + if ( type == 'clear' ) type = 'select' + calendarItem[ type ] = value + return calendar + } + + // Otherwise go through the queue of methods, and invoke the functions. + // Update this as the time unit, and set the final value as this item. + // * In the case of `enable`, keep the queue but set `disable` instead. + // And in the case of `flip`, keep the queue but set `enable` instead. + calendarItem[ ( type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type ) ] = calendar.queue[ type ].split( ' ' ).map( function( method ) { + value = calendar[ method ]( type, value, options ) + return value + }).pop() + + // Check if we need to cascade through more updates. + if ( type == 'select' ) { + calendar.set( 'highlight', calendarItem.select, options ) + } + else if ( type == 'highlight' ) { + calendar.set( 'view', calendarItem.highlight, options ) + } + else if ( type.match( /^(flip|min|max|disable|enable)$/ ) ) { + if ( calendarItem.select && calendar.disabled( calendarItem.select ) ) { + calendar.set( 'select', calendarItem.select, options ) + } + if ( calendarItem.highlight && calendar.disabled( calendarItem.highlight ) ) { + calendar.set( 'highlight', calendarItem.highlight, options ) + } + } + + return calendar +} //DatePicker.prototype.set + + +/** + * Get a datepicker item object. + */ +DatePicker.prototype.get = function( type ) { + return this.item[ type ] +} //DatePicker.prototype.get + + +/** + * Create a picker date object. + */ +DatePicker.prototype.create = function( type, value, options ) { + + var isInfiniteValue, + calendar = this + + // If there’s no value, use the type as the value. + value = value === undefined ? type : value + + + // If it’s infinity, update the value. + if ( value == -Infinity || value == Infinity ) { + isInfiniteValue = value + } + + // If it’s an object, use the native date object. + else if ( $.isPlainObject( value ) && _.isInteger( value.pick ) ) { + value = value.obj + } + + // If it’s an array, convert it into a date and make sure + // that it’s a valid date – otherwise default to today. + else if ( $.isArray( value ) ) { + value = new Date( value[ 0 ], value[ 1 ], value[ 2 ] ) + value = _.isDate( value ) ? value : calendar.create().obj + } + + // If it’s a number or date object, make a normalized date. + else if ( _.isInteger( value ) || _.isDate( value ) ) { + value = calendar.normalize( new Date( value ), options ) + } + + // If it’s a literal true or any other case, set it to now. + else /*if ( value === true )*/ { + value = calendar.now( type, value, options ) + } + + // Return the compiled object. + return { + year: isInfiniteValue || value.getFullYear(), + month: isInfiniteValue || value.getMonth(), + date: isInfiniteValue || value.getDate(), + day: isInfiniteValue || value.getDay(), + obj: isInfiniteValue || value, + pick: isInfiniteValue || value.getTime() + } +} //DatePicker.prototype.create + + +/** + * Create a range limit object using an array, date object, + * literal “true”, or integer relative to another time. + */ +DatePicker.prototype.createRange = function( from, to ) { + + var calendar = this, + createDate = function( date ) { + if ( date === true || $.isArray( date ) || _.isDate( date ) ) { + return calendar.create( date ) + } + return date + } + + // Create objects if possible. + if ( !_.isInteger( from ) ) { + from = createDate( from ) + } + if ( !_.isInteger( to ) ) { + to = createDate( to ) + } + + // Create relative dates. + if ( _.isInteger( from ) && $.isPlainObject( to ) ) { + from = [ to.year, to.month, to.date + from ]; + } + else if ( _.isInteger( to ) && $.isPlainObject( from ) ) { + to = [ from.year, from.month, from.date + to ]; + } + + return { + from: createDate( from ), + to: createDate( to ) + } +} //DatePicker.prototype.createRange + + +/** + * Check if a date unit falls within a date range object. + */ +DatePicker.prototype.withinRange = function( range, dateUnit ) { + range = this.createRange(range.from, range.to) + return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick +} + + +/** + * Check if two date range objects overlap. + */ +DatePicker.prototype.overlapRanges = function( one, two ) { + + var calendar = this + + // Convert the ranges into comparable dates. + one = calendar.createRange( one.from, one.to ) + two = calendar.createRange( two.from, two.to ) + + return calendar.withinRange( one, two.from ) || calendar.withinRange( one, two.to ) || + calendar.withinRange( two, one.from ) || calendar.withinRange( two, one.to ) +} + + +/** + * Get the date today. + */ +DatePicker.prototype.now = function( type, value, options ) { + value = new Date() + if ( options && options.rel ) { + value.setDate( value.getDate() + options.rel ) + } + return this.normalize( value, options ) +} + + +/** + * Navigate to next/prev month. + */ +DatePicker.prototype.navigate = function( type, value, options ) { + + var targetDateObject, + targetYear, + targetMonth, + targetDate, + isTargetArray = $.isArray( value ), + isTargetObject = $.isPlainObject( value ), + viewsetObject = this.item.view/*, + safety = 100*/ + + + if ( isTargetArray || isTargetObject ) { + + if ( isTargetObject ) { + targetYear = value.year + targetMonth = value.month + targetDate = value.date + } + else { + targetYear = +value[0] + targetMonth = +value[1] + targetDate = +value[2] + } + + // If we’re navigating months but the view is in a different + // month, navigate to the view’s year and month. + if ( options && options.nav && viewsetObject && viewsetObject.month !== targetMonth ) { + targetYear = viewsetObject.year + targetMonth = viewsetObject.month + } + + // Figure out the expected target year and month. + targetDateObject = new Date( targetYear, targetMonth + ( options && options.nav ? options.nav : 0 ), 1 ) + targetYear = targetDateObject.getFullYear() + targetMonth = targetDateObject.getMonth() + + // If the month we’re going to doesn’t have enough days, + // keep decreasing the date until we reach the month’s last date. + while ( /*safety &&*/ new Date( targetYear, targetMonth, targetDate ).getMonth() !== targetMonth ) { + targetDate -= 1 + /*safety -= 1 + if ( !safety ) { + throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.' + }*/ + } + + value = [ targetYear, targetMonth, targetDate ] + } + + return value +} //DatePicker.prototype.navigate + + +/** + * Normalize a date by setting the hours to midnight. + */ +DatePicker.prototype.normalize = function( value/*, options*/ ) { + value.setHours( 0, 0, 0, 0 ) + return value +} + + +/** + * Measure the range of dates. + */ +DatePicker.prototype.measure = function( type, value/*, options*/ ) { + + var calendar = this + + // If it’s anything false-y, remove the limits. + if ( !value ) { + value = type == 'min' ? -Infinity : Infinity + } + + // If it’s a string, parse it. + else if ( typeof value == 'string' ) { + value = calendar.parse( type, value ) + } + + // If it's an integer, get a date relative to today. + else if ( _.isInteger( value ) ) { + value = calendar.now( type, value, { rel: value } ) + } + + return value +} ///DatePicker.prototype.measure + + +/** + * Create a viewset object based on navigation. + */ +DatePicker.prototype.viewset = function( type, dateObject/*, options*/ ) { + return this.create([ dateObject.year, dateObject.month, 1 ]) +} + + +/** + * Validate a date as enabled and shift if needed. + */ +DatePicker.prototype.validate = function( type, dateObject, options ) { + + var calendar = this, + + // Keep a reference to the original date. + originalDateObject = dateObject, + + // Make sure we have an interval. + interval = options && options.interval ? options.interval : 1, + + // Check if the calendar enabled dates are inverted. + isFlippedBase = calendar.item.enable === -1, + + // Check if we have any enabled dates after/before now. + hasEnabledBeforeTarget, hasEnabledAfterTarget, + + // The min & max limits. + minLimitObject = calendar.item.min, + maxLimitObject = calendar.item.max, + + // Check if we’ve reached the limit during shifting. + reachedMin, reachedMax, + + // Check if the calendar is inverted and at least one weekday is enabled. + hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter( function( value ) { + + // If there’s a date, check where it is relative to the target. + if ( $.isArray( value ) ) { + var dateTime = calendar.create( value ).pick + if ( dateTime < dateObject.pick ) hasEnabledBeforeTarget = true + else if ( dateTime > dateObject.pick ) hasEnabledAfterTarget = true + } + + // Return only integers for enabled weekdays. + return _.isInteger( value ) + }).length/*, + + safety = 100*/ + + + + // Cases to validate for: + // [1] Not inverted and date disabled. + // [2] Inverted and some dates enabled. + // [3] Not inverted and out of range. + // + // Cases to **not** validate for: + // • Navigating months. + // • Not inverted and date enabled. + // • Inverted and all dates disabled. + // • ..and anything else. + if ( !options || !options.nav ) if ( + /* 1 */ ( !isFlippedBase && calendar.disabled( dateObject ) ) || + /* 2 */ ( isFlippedBase && calendar.disabled( dateObject ) && ( hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget ) ) || + /* 3 */ ( !isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick) ) + ) { + + + // When inverted, flip the direction if there aren’t any enabled weekdays + // and there are no enabled dates in the direction of the interval. + if ( isFlippedBase && !hasEnabledWeekdays && ( ( !hasEnabledAfterTarget && interval > 0 ) || ( !hasEnabledBeforeTarget && interval < 0 ) ) ) { + interval *= -1 + } + + + // Keep looping until we reach an enabled date. + while ( /*safety &&*/ calendar.disabled( dateObject ) ) { + + /*safety -= 1 + if ( !safety ) { + throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.' + }*/ + + + // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval. + if ( Math.abs( interval ) > 1 && ( dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month ) ) { + dateObject = originalDateObject + interval = interval > 0 ? 1 : -1 + } + + + // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit. + if ( dateObject.pick <= minLimitObject.pick ) { + reachedMin = true + interval = 1 + dateObject = calendar.create([ + minLimitObject.year, + minLimitObject.month, + minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1) + ]) + } + else if ( dateObject.pick >= maxLimitObject.pick ) { + reachedMax = true + interval = -1 + dateObject = calendar.create([ + maxLimitObject.year, + maxLimitObject.month, + maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1) + ]) + } + + + // If we’ve reached both limits, just break out of the loop. + if ( reachedMin && reachedMax ) { + break + } + + + // Finally, create the shifted date using the interval and keep looping. + dateObject = calendar.create([ dateObject.year, dateObject.month, dateObject.date + interval ]) + } + + } //endif + + + // Return the date object settled on. + return dateObject +} //DatePicker.prototype.validate + + +/** + * Check if a date is disabled. + */ +DatePicker.prototype.disabled = function( dateToVerify ) { + + var + calendar = this, + + // Filter through the disabled dates to check if this is one. + isDisabledMatch = calendar.item.disable.filter( function( dateToDisable ) { + + // If the date is a number, match the weekday with 0index and `firstDay` check. + if ( _.isInteger( dateToDisable ) ) { + return dateToVerify.day === ( calendar.settings.firstDay ? dateToDisable : dateToDisable - 1 ) % 7 + } + + // If it’s an array or a native JS date, create and match the exact date. + if ( $.isArray( dateToDisable ) || _.isDate( dateToDisable ) ) { + return dateToVerify.pick === calendar.create( dateToDisable ).pick + } + + // If it’s an object, match a date within the “from” and “to” range. + if ( $.isPlainObject( dateToDisable ) ) { + return calendar.withinRange( dateToDisable, dateToVerify ) + } + }) + + // If this date matches a disabled date, confirm it’s not inverted. + isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function( dateToDisable ) { + return $.isArray( dateToDisable ) && dateToDisable[3] == 'inverted' || + $.isPlainObject( dateToDisable ) && dateToDisable.inverted + }).length + + // Check the calendar “enabled” flag and respectively flip the + // disabled state. Then also check if it’s beyond the min/max limits. + return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || + dateToVerify.pick < calendar.item.min.pick || + dateToVerify.pick > calendar.item.max.pick + +} //DatePicker.prototype.disabled + + +/** + * Parse a string into a usable type. + */ +DatePicker.prototype.parse = function( type, value, options ) { + + var calendar = this, + parsingObject = {} + + // If it’s already parsed, we’re good. + if ( !value || typeof value != 'string' ) { + return value + } + + // We need a `.format` to parse the value with. + if ( !( options && options.format ) ) { + options = options || {} + options.format = calendar.settings.format + } + + // Convert the format into an array and then map through it. + calendar.formats.toArray( options.format ).map( function( label ) { + + var + // Grab the formatting label. + formattingLabel = calendar.formats[ label ], + + // The format length is from the formatting label function or the + // label length without the escaping exclamation (!) mark. + formatLength = formattingLabel ? _.trigger( formattingLabel, calendar, [ value, parsingObject ] ) : label.replace( /^!/, '' ).length + + // If there's a format label, split the value up to the format length. + // Then add it to the parsing object with appropriate label. + if ( formattingLabel ) { + parsingObject[ label ] = value.substr( 0, formatLength ) + } + + // Update the value as the substring from format length to end. + value = value.substr( formatLength ) + }) + + // Compensate for month 0index. + return [ + parsingObject.yyyy || parsingObject.yy, + +( parsingObject.mm || parsingObject.m ) - 1, + parsingObject.dd || parsingObject.d + ] +} //DatePicker.prototype.parse + + +/** + * Various formats to display the object in. + */ +DatePicker.prototype.formats = (function() { + + // Return the length of the first word in a collection. + function getWordLengthFromCollection( string, collection, dateObject ) { + + // Grab the first word from the string. + var word = string.match( /\w+/ )[ 0 ] + + // If there's no month index, add it to the date object + if ( !dateObject.mm && !dateObject.m ) { + dateObject.m = collection.indexOf( word ) + 1 + } + + // Return the length of the word. + return word.length + } + + // Get the length of the first word in a string. + function getFirstWordLength( string ) { + return string.match( /\w+/ )[ 0 ].length + } + + return { + + d: function( string, dateObject ) { + + // If there's string, then get the digits length. + // Otherwise return the selected date. + return string ? _.digits( string ) : dateObject.date + }, + dd: function( string, dateObject ) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected date with a leading zero. + return string ? 2 : _.lead( dateObject.date ) + }, + ddd: function( string, dateObject ) { + + // If there's a string, then get the length of the first word. + // Otherwise return the short selected weekday. + return string ? getFirstWordLength( string ) : this.settings.weekdaysShort[ dateObject.day ] + }, + dddd: function( string, dateObject ) { + + // If there's a string, then get the length of the first word. + // Otherwise return the full selected weekday. + return string ? getFirstWordLength( string ) : this.settings.weekdaysFull[ dateObject.day ] + }, + m: function( string, dateObject ) { + + // If there's a string, then get the length of the digits + // Otherwise return the selected month with 0index compensation. + return string ? _.digits( string ) : dateObject.month + 1 + }, + mm: function( string, dateObject ) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected month with 0index and leading zero. + return string ? 2 : _.lead( dateObject.month + 1 ) + }, + mmm: function( string, dateObject ) { + + var collection = this.settings.monthsShort + + // If there's a string, get length of the relevant month from the short + // months collection. Otherwise return the selected month from that collection. + return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ] + }, + mmmm: function( string, dateObject ) { + + var collection = this.settings.monthsFull + + // If there's a string, get length of the relevant month from the full + // months collection. Otherwise return the selected month from that collection. + return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ] + }, + yy: function( string, dateObject ) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected year by slicing out the first 2 digits. + return string ? 2 : ( '' + dateObject.year ).slice( 2 ) + }, + yyyy: function( string, dateObject ) { + + // If there's a string, then the length is always 4. + // Otherwise return the selected year. + return string ? 4 : dateObject.year + }, + + // Create an array by splitting the formatting string passed. + toArray: function( formatString ) { return formatString.split( /(d{1,4}|m{1,4}|y{4}|yy|!.)/g ) }, + + // Format an object into a string using the formatting options. + toString: function ( formatString, itemObject ) { + var calendar = this + return calendar.formats.toArray( formatString ).map( function( label ) { + return _.trigger( calendar.formats[ label ], calendar, [ 0, itemObject ] ) || label.replace( /^!/, '' ) + }).join( '' ) + } + } +})() //DatePicker.prototype.formats + + + + +/** + * Check if two date units are the exact. + */ +DatePicker.prototype.isDateExact = function( one, two ) { + + var calendar = this + + // When we’re working with weekdays, do a direct comparison. + if ( + ( _.isInteger( one ) && _.isInteger( two ) ) || + ( typeof one == 'boolean' && typeof two == 'boolean' ) + ) { + return one === two + } + + // When we’re working with date representations, compare the “pick” value. + if ( + ( _.isDate( one ) || $.isArray( one ) ) && + ( _.isDate( two ) || $.isArray( two ) ) + ) { + return calendar.create( one ).pick === calendar.create( two ).pick + } + + // When we’re working with range objects, compare the “from” and “to”. + if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) { + return calendar.isDateExact( one.from, two.from ) && calendar.isDateExact( one.to, two.to ) + } + + return false +} + + +/** + * Check if two date units overlap. + */ +DatePicker.prototype.isDateOverlap = function( one, two ) { + + var calendar = this, + firstDay = calendar.settings.firstDay ? 1 : 0 + + // When we’re working with a weekday index, compare the days. + if ( _.isInteger( one ) && ( _.isDate( two ) || $.isArray( two ) ) ) { + one = one % 7 + firstDay + return one === calendar.create( two ).day + 1 + } + if ( _.isInteger( two ) && ( _.isDate( one ) || $.isArray( one ) ) ) { + two = two % 7 + firstDay + return two === calendar.create( one ).day + 1 + } + + // When we’re working with range objects, check if the ranges overlap. + if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) { + return calendar.overlapRanges( one, two ) + } + + return false +} + + +/** + * Flip the “enabled” state. + */ +DatePicker.prototype.flipEnable = function(val) { + var itemObject = this.item + itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1) +} + + +/** + * Mark a collection of dates as “disabled”. + */ +DatePicker.prototype.deactivate = function( type, datesToDisable ) { + + var calendar = this, + disabledItems = calendar.item.disable.slice(0) + + + // If we’re flipping, that’s all we need to do. + if ( datesToDisable == 'flip' ) { + calendar.flipEnable() + } + + else if ( datesToDisable === false ) { + calendar.flipEnable(1) + disabledItems = [] + } + + else if ( datesToDisable === true ) { + calendar.flipEnable(-1) + disabledItems = [] + } + + // Otherwise go through the dates to disable. + else { + + datesToDisable.map(function( unitToDisable ) { + + var matchFound + + // When we have disabled items, check for matches. + // If something is matched, immediately break out. + for ( var index = 0; index < disabledItems.length; index += 1 ) { + if ( calendar.isDateExact( unitToDisable, disabledItems[index] ) ) { + matchFound = true + break + } + } + + // If nothing was found, add the validated unit to the collection. + if ( !matchFound ) { + if ( + _.isInteger( unitToDisable ) || + _.isDate( unitToDisable ) || + $.isArray( unitToDisable ) || + ( $.isPlainObject( unitToDisable ) && unitToDisable.from && unitToDisable.to ) + ) { + disabledItems.push( unitToDisable ) + } + } + }) + } + + // Return the updated collection. + return disabledItems +} //DatePicker.prototype.deactivate + + +/** + * Mark a collection of dates as “enabled”. + */ +DatePicker.prototype.activate = function( type, datesToEnable ) { + + var calendar = this, + disabledItems = calendar.item.disable, + disabledItemsCount = disabledItems.length + + // If we’re flipping, that’s all we need to do. + if ( datesToEnable == 'flip' ) { + calendar.flipEnable() + } + + else if ( datesToEnable === true ) { + calendar.flipEnable(1) + disabledItems = [] + } + + else if ( datesToEnable === false ) { + calendar.flipEnable(-1) + disabledItems = [] + } + + // Otherwise go through the disabled dates. + else { + + datesToEnable.map(function( unitToEnable ) { + + var matchFound, + disabledUnit, + index, + isExactRange + + // Go through the disabled items and try to find a match. + for ( index = 0; index < disabledItemsCount; index += 1 ) { + + disabledUnit = disabledItems[index] + + // When an exact match is found, remove it from the collection. + if ( calendar.isDateExact( disabledUnit, unitToEnable ) ) { + matchFound = disabledItems[index] = null + isExactRange = true + break + } + + // When an overlapped match is found, add the “inverted” state to it. + else if ( calendar.isDateOverlap( disabledUnit, unitToEnable ) ) { + if ( $.isPlainObject( unitToEnable ) ) { + unitToEnable.inverted = true + matchFound = unitToEnable + } + else if ( $.isArray( unitToEnable ) ) { + matchFound = unitToEnable + if ( !matchFound[3] ) matchFound.push( 'inverted' ) + } + else if ( _.isDate( unitToEnable ) ) { + matchFound = [ unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted' ] + } + break + } + } + + // If a match was found, remove a previous duplicate entry. + if ( matchFound ) for ( index = 0; index < disabledItemsCount; index += 1 ) { + if ( calendar.isDateExact( disabledItems[index], unitToEnable ) ) { + disabledItems[index] = null + break + } + } + + // In the event that we’re dealing with an exact range of dates, + // make sure there are no “inverted” dates because of it. + if ( isExactRange ) for ( index = 0; index < disabledItemsCount; index += 1 ) { + if ( calendar.isDateOverlap( disabledItems[index], unitToEnable ) ) { + disabledItems[index] = null + break + } + } + + // If something is still matched, add it into the collection. + if ( matchFound ) { + disabledItems.push( matchFound ) + } + }) + } + + // Return the updated collection. + return disabledItems.filter(function( val ) { return val != null }) +} //DatePicker.prototype.activate + + +/** + * Create a string for the nodes in the picker. + */ +DatePicker.prototype.nodes = function( isOpen ) { + + var + calendar = this, + settings = calendar.settings, + calendarItem = calendar.item, + nowObject = calendarItem.now, + selectedObject = calendarItem.select, + highlightedObject = calendarItem.highlight, + viewsetObject = calendarItem.view, + disabledCollection = calendarItem.disable, + minLimitObject = calendarItem.min, + maxLimitObject = calendarItem.max, + + + // Create the calendar table head using a copy of weekday labels collection. + // * We do a copy so we don't mutate the original array. + tableHead = (function( collection, fullCollection ) { + + // If the first day should be Monday, move Sunday to the end. + if ( settings.firstDay ) { + collection.push( collection.shift() ) + fullCollection.push( fullCollection.shift() ) + } + + // Create and return the table head group. + return _.node( + 'thead', + _.node( + 'tr', + _.group({ + min: 0, + max: DAYS_IN_WEEK - 1, + i: 1, + node: 'th', + item: function( counter ) { + return [ + collection[ counter ], + settings.klass.weekdays, + 'scope=col title="' + fullCollection[ counter ] + '"' + ] + } + }) + ) + ) //endreturn + + // Materialize modified + })( ( settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter ).slice( 0 ), settings.weekdaysFull.slice( 0 ) ), //tableHead + + + // Create the nav for next/prev month. + createMonthNav = function( next ) { + + // Otherwise, return the created month tag. + return _.node( + 'div', + ' ', + settings.klass[ 'nav' + ( next ? 'Next' : 'Prev' ) ] + ( + + // If the focused month is outside the range, disabled the button. + ( next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month ) || + ( !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ) ? + ' ' + settings.klass.navDisabled : '' + ), + 'data-nav=' + ( next || -1 ) + ' ' + + _.ariaAttr({ + role: 'button', + controls: calendar.$node[0].id + '_table' + }) + ' ' + + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev ) + '"' + ) //endreturn + }, //createMonthNav + + + // Create the month label. + //Materialize modified + createMonthLabel = function(override) { + + var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull + + // Materialize modified + if (override == "short_months") { + monthsCollection = settings.monthsShort; + } + + // If there are months to select, add a dropdown menu. + if ( settings.selectMonths && override == undefined) { + + return _.node( 'select', + _.group({ + min: 0, + max: 11, + i: 1, + node: 'option', + item: function( loopedMonth ) { + + return [ + + // The looped month and no classes. + monthsCollection[ loopedMonth ], 0, + + // Set the value and selected index. + 'value=' + loopedMonth + + ( viewsetObject.month == loopedMonth ? ' selected' : '' ) + + ( + ( + ( viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month ) || + ( viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ) + ) ? + ' disabled' : '' + ) + ] + } + }), + settings.klass.selectMonth + ' browser-default', + ( isOpen ? '' : 'disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + + 'title="' + settings.labelMonthSelect + '"' + ) + } + + // Materialize modified + if (override == "short_months") + if (selectedObject != null) + return _.node( 'div', monthsCollection[ selectedObject.month ] ); + else return _.node( 'div', monthsCollection[ viewsetObject.month ] ); + + // If there's a need for a month selector + return _.node( 'div', monthsCollection[ viewsetObject.month ], settings.klass.month ) + }, //createMonthLabel + + + // Create the year label. + // Materialize modified + createYearLabel = function(override) { + + var focusedYear = viewsetObject.year, + + // If years selector is set to a literal "true", set it to 5. Otherwise + // divide in half to get half before and half after focused year. + numberYears = settings.selectYears === true ? 5 : ~~( settings.selectYears / 2 ) + + // If there are years to select, add a dropdown menu. + if ( numberYears ) { + + var + minYear = minLimitObject.year, + maxYear = maxLimitObject.year, + lowestYear = focusedYear - numberYears, + highestYear = focusedYear + numberYears + + // If the min year is greater than the lowest year, increase the highest year + // by the difference and set the lowest year to the min year. + if ( minYear > lowestYear ) { + highestYear += minYear - lowestYear + lowestYear = minYear + } + + // If the max year is less than the highest year, decrease the lowest year + // by the lower of the two: available and needed years. Then set the + // highest year to the max year. + if ( maxYear < highestYear ) { + + var availableYears = lowestYear - minYear, + neededYears = highestYear - maxYear + + lowestYear -= availableYears > neededYears ? neededYears : availableYears + highestYear = maxYear + } + + if ( settings.selectYears && override == undefined ) { + return _.node( 'select', + _.group({ + min: lowestYear, + max: highestYear, + i: 1, + node: 'option', + item: function( loopedYear ) { + return [ + + // The looped year and no classes. + loopedYear, 0, + + // Set the value and selected index. + 'value=' + loopedYear + ( focusedYear == loopedYear ? ' selected' : '' ) + ] + } + }), + settings.klass.selectYear + ' browser-default', + ( isOpen ? '' : 'disabled' ) + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + + 'title="' + settings.labelYearSelect + '"' + ) + } + } + + // Materialize modified + if (override == "raw") + return _.node( 'div', focusedYear ) + + // Otherwise just return the year focused + return _.node( 'div', focusedYear, settings.klass.year ) + } //createYearLabel + + + // Materialize modified + createDayLabel = function() { + if (selectedObject != null) + return _.node( 'div', selectedObject.date) + else return _.node( 'div', nowObject.date) + } + createWeekdayLabel = function() { + var display_day; + + if (selectedObject != null) + display_day = selectedObject.day; + else + display_day = nowObject.day; + var weekday = settings.weekdaysFull[ display_day ] + return weekday + } + + + // Create and return the entire calendar. +return _.node( + // Date presentation View + 'div', + _.node( + 'div', + createWeekdayLabel(), + "picker__weekday-display" + )+ + _.node( + // Div for short Month + 'div', + createMonthLabel("short_months"), + settings.klass.month_display + )+ + _.node( + // Div for Day + 'div', + createDayLabel() , + settings.klass.day_display + )+ + _.node( + // Div for Year + 'div', + createYearLabel("raw") , + settings.klass.year_display + ), + settings.klass.date_display + )+ + // Calendar container + _.node('div', + _.node('div', + ( settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel() ) + + createMonthNav() + createMonthNav( 1 ), + settings.klass.header + ) + _.node( + 'table', + tableHead + + _.node( + 'tbody', + _.group({ + min: 0, + max: WEEKS_IN_CALENDAR - 1, + i: 1, + node: 'tr', + item: function( rowCounter ) { + + // If Monday is the first day and the month starts on Sunday, shift the date back a week. + var shiftDateBy = settings.firstDay && calendar.create([ viewsetObject.year, viewsetObject.month, 1 ]).day === 0 ? -7 : 0 + + return [ + _.group({ + min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index + max: function() { + return this.min + DAYS_IN_WEEK - 1 + }, + i: 1, + node: 'td', + item: function( targetDate ) { + + // Convert the time date from a relative date to a target date. + targetDate = calendar.create([ viewsetObject.year, viewsetObject.month, targetDate + ( settings.firstDay ? 1 : 0 ) ]) + + var isSelected = selectedObject && selectedObject.pick == targetDate.pick, + isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick, + isDisabled = disabledCollection && calendar.disabled( targetDate ) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick, + formattedDate = _.trigger( calendar.formats.toString, calendar, [ settings.format, targetDate ] ) + + return [ + _.node( + 'div', + targetDate.date, + (function( klasses ) { + + // Add the `infocus` or `outfocus` classes based on month in view. + klasses.push( viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus ) + + // Add the `today` class if needed. + if ( nowObject.pick == targetDate.pick ) { + klasses.push( settings.klass.now ) + } + + // Add the `selected` class if something's selected and the time matches. + if ( isSelected ) { + klasses.push( settings.klass.selected ) + } + + // Add the `highlighted` class if something's highlighted and the time matches. + if ( isHighlighted ) { + klasses.push( settings.klass.highlighted ) + } + + // Add the `disabled` class if something's disabled and the object matches. + if ( isDisabled ) { + klasses.push( settings.klass.disabled ) + } + + return klasses.join( ' ' ) + })([ settings.klass.day ]), + 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({ + role: 'gridcell', + label: formattedDate, + selected: isSelected && calendar.$node.val() === formattedDate ? true : null, + activedescendant: isHighlighted ? true : null, + disabled: isDisabled ? true : null + }) + ), + '', + _.ariaAttr({ role: 'presentation' }) + ] //endreturn + } + }) + ] //endreturn + } + }) + ), + settings.klass.table, + 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({ + role: 'grid', + controls: calendar.$node[0].id, + readonly: true + }) + ) + , settings.klass.calendar_container) // end calendar + + + + + // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”. + _.node( + 'div', + _.node( 'button', settings.today, "btn-flat picker__today", + 'type=button data-pick=' + nowObject.pick + + ( isOpen && !calendar.disabled(nowObject) ? '' : ' disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id }) ) + + _.node( 'button', settings.clear, "btn-flat picker__clear", + 'type=button data-clear=1' + + ( isOpen ? '' : ' disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id }) ) + + _.node('button', settings.close, "btn-flat picker__close", + 'type=button data-close=true ' + + ( isOpen ? '' : ' disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id }) ), + settings.klass.footer + ) //endreturn +} //DatePicker.prototype.nodes + + + + +/** + * The date picker defaults. + */ +DatePicker.defaults = (function( prefix ) { + + return { + + // The title label to use for the month nav buttons + labelMonthNext: 'Next month', + labelMonthPrev: 'Previous month', + + // The title label to use for the dropdown selectors + labelMonthSelect: 'Select a month', + labelYearSelect: 'Select a year', + + // Months and weekdays + monthsFull: [ 'January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December' ], + monthsShort: [ 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec' ], + weekdaysFull: [ 'Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday' ], + weekdaysShort: [ 'Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat' ], + + // Materialize modified + weekdaysLetter: [ 'S', 'M', 'T', 'W', 'T', 'F', 'S' ], + + // Today and clear + today: 'Today', + clear: 'Clear', + close: 'Close', + + // The format to show on the `input` element + format: 'd mmmm, yyyy', + + // Classes + klass: { + + table: prefix + 'table', + + header: prefix + 'header', + + + // Materialize Added klasses + date_display: prefix + 'date-display', + day_display: prefix + 'day-display', + month_display: prefix + 'month-display', + year_display: prefix + 'year-display', + calendar_container: prefix + 'calendar-container', + // end + + + + navPrev: prefix + 'nav--prev', + navNext: prefix + 'nav--next', + navDisabled: prefix + 'nav--disabled', + + month: prefix + 'month', + year: prefix + 'year', + + selectMonth: prefix + 'select--month', + selectYear: prefix + 'select--year', + + weekdays: prefix + 'weekday', + + day: prefix + 'day', + disabled: prefix + 'day--disabled', + selected: prefix + 'day--selected', + highlighted: prefix + 'day--highlighted', + now: prefix + 'day--today', + infocus: prefix + 'day--infocus', + outfocus: prefix + 'day--outfocus', + + footer: prefix + 'footer', + + buttonClear: prefix + 'button--clear', + buttonToday: prefix + 'button--today', + buttonClose: prefix + 'button--close' + } + } +})( Picker.klasses().picker + '__' ) + + + + + +/** + * Extend the picker to add the date picker. + */ +Picker.extend( 'pickadate', DatePicker ) + + +})); + + +;(function ($) { + + $.fn.characterCounter = function(){ + return this.each(function(){ + var $input = $(this); + var $counterElement = $input.parent().find('span[class="character-counter"]'); + + // character counter has already been added appended to the parent container + if ($counterElement.length) { + return; + } + + var itHasLengthAttribute = $input.attr('data-length') !== undefined; + + if(itHasLengthAttribute){ + $input.on('input', updateCounter); + $input.on('focus', updateCounter); + $input.on('blur', removeCounterElement); + + addCounterElement($input); + } + + }); + }; + + function updateCounter(){ + var maxLength = +$(this).attr('data-length'), + actualLength = +$(this).val().length, + isValidLength = actualLength <= maxLength; + + $(this).parent().find('span[class="character-counter"]') + .html( actualLength + '/' + maxLength); + + addInputStyle(isValidLength, $(this)); + } + + function addCounterElement($input) { + var $counterElement = $input.parent().find('span[class="character-counter"]'); + + if ($counterElement.length) { + return; + } + + $counterElement = $('<span/>') + .addClass('character-counter') + .css('float','right') + .css('font-size','12px') + .css('height', 1); + + $input.parent().append($counterElement); + } + + function removeCounterElement(){ + $(this).parent().find('span[class="character-counter"]').html(''); + } + + function addInputStyle(isValidLength, $input){ + var inputHasInvalidClass = $input.hasClass('invalid'); + if (isValidLength && inputHasInvalidClass) { + $input.removeClass('invalid'); + } + else if(!isValidLength && !inputHasInvalidClass){ + $input.removeClass('valid'); + $input.addClass('invalid'); + } + } + + $(document).ready(function(){ + $('input, textarea').characterCounter(); + }); + +}( jQuery )); +;(function ($) { + + var methods = { + + init : function(options) { + var defaults = { + duration: 200, // ms + dist: -100, // zoom scale TODO: make this more intuitive as an option + shift: 0, // spacing for center image + padding: 0, // Padding between non center items + fullWidth: false, // Change to full width styles + indicators: false, // Toggle indicators + noWrap: false, // Don't wrap around and cycle through items. + onCycleTo: null // Callback for when a new slide is cycled to. + }; + options = $.extend(defaults, options); + + return this.each(function() { + + var images, item_width, item_height, offset, center, pressed, dim, count, + reference, referenceY, amplitude, target, velocity, + xform, frame, timestamp, ticker, dragged, vertical_dragged; + var $indicators = $('<ul class="indicators"></ul>'); + + + // Initialize + var view = $(this); + var showIndicators = view.attr('data-indicators') || options.indicators; + + // Don't double initialize. + if (view.hasClass('initialized')) { + // Redraw carousel. + $(this).trigger('carouselNext', [0.000001]); + return true; + } + + + // Options + if (options.fullWidth) { + options.dist = 0; + var firstImage = view.find('.carousel-item img').first(); + if (firstImage.length) { + imageHeight = firstImage.on('load', function(){ + view.css('height', $(this).height()); + }); + } else { + imageHeight = view.find('.carousel-item').first().height(); + view.css('height', imageHeight); + } + + // Offset fixed items when indicators. + if (showIndicators) { + view.find('.carousel-fixed-item').addClass('with-indicators'); + } + } + + + view.addClass('initialized'); + pressed = false; + offset = target = 0; + images = []; + item_width = view.find('.carousel-item').first().innerWidth(); + item_height = view.find('.carousel-item').first().innerHeight(); + dim = item_width * 2 + options.padding; + + view.find('.carousel-item').each(function (i) { + images.push($(this)[0]); + if (showIndicators) { + var $indicator = $('<li class="indicator-item"></li>'); + + // Add active to first by default. + if (i === 0) { + $indicator.addClass('active'); + } + + // Handle clicks on indicators. + $indicator.click(function (e) { + e.stopPropagation(); + + var index = $(this).index(); + cycleTo(index); + }); + $indicators.append($indicator); + } + }); + + if (showIndicators) { + view.append($indicators); + } + count = images.length; + + + function setupEvents() { + if (typeof window.ontouchstart !== 'undefined') { + view[0].addEventListener('touchstart', tap); + view[0].addEventListener('touchmove', drag); + view[0].addEventListener('touchend', release); + } + view[0].addEventListener('mousedown', tap); + view[0].addEventListener('mousemove', drag); + view[0].addEventListener('mouseup', release); + view[0].addEventListener('mouseleave', release); + view[0].addEventListener('click', click); + } + + function xpos(e) { + // touch event + if (e.targetTouches && (e.targetTouches.length >= 1)) { + return e.targetTouches[0].clientX; + } + + // mouse event + return e.clientX; + } + + function ypos(e) { + // touch event + if (e.targetTouches && (e.targetTouches.length >= 1)) { + return e.targetTouches[0].clientY; + } + + // mouse event + return e.clientY; + } + + function wrap(x) { + return (x >= count) ? (x % count) : (x < 0) ? wrap(count + (x % count)) : x; + } + + function scroll(x) { + var i, half, delta, dir, tween, el, alignment, xTranslation; + var lastCenter = center; + + offset = (typeof x === 'number') ? x : offset; + center = Math.floor((offset + dim / 2) / dim); + delta = offset - center * dim; + dir = (delta < 0) ? 1 : -1; + tween = -dir * delta * 2 / dim; + half = count >> 1; + + if (!options.fullWidth) { + alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) '; + alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)'; + } else { + alignment = 'translateX(0)'; + } + + // Set indicator active + if (showIndicators) { + var diff = (center % count); + var activeIndicator = $indicators.find('.indicator-item.active'); + if (activeIndicator.index() !== diff) { + activeIndicator.removeClass('active'); + $indicators.find('.indicator-item').eq(diff).addClass('active'); + } + } + + // center + // Don't show wrapped items. + if (!options.noWrap || (center >= 0 && center < count)) { + el = images[wrap(center)]; + + // Add active class to center item. + if (!$(el).hasClass('active')) { + view.find('.carousel-item').removeClass('active'); + $(el).addClass('active'); + } + el.style[xform] = alignment + + ' translateX(' + (-delta / 2) + 'px)' + + ' translateX(' + (dir * options.shift * tween * i) + 'px)' + + ' translateZ(' + (options.dist * tween) + 'px)'; + el.style.zIndex = 0; + if (options.fullWidth) { tweenedOpacity = 1; } + else { tweenedOpacity = 1 - 0.2 * tween; } + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + for (i = 1; i <= half; ++i) { + // right side + if (options.fullWidth) { + zTranslation = options.dist; + tweenedOpacity = (i === half && delta < 0) ? 1 - tween : 1; + } else { + zTranslation = options.dist * (i * 2 + tween * dir); + tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir); + } + // Don't show wrapped items. + if (!options.noWrap || center + i < count) { + el = images[wrap(center + i)]; + el.style[xform] = alignment + + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + + ' translateZ(' + zTranslation + 'px)'; + el.style.zIndex = -i; + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + + // left side + if (options.fullWidth) { + zTranslation = options.dist; + tweenedOpacity = (i === half && delta > 0) ? 1 - tween : 1; + } else { + zTranslation = options.dist * (i * 2 - tween * dir); + tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir); + } + // Don't show wrapped items. + if (!options.noWrap || center - i >= 0) { + el = images[wrap(center - i)]; + el.style[xform] = alignment + + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + + ' translateZ(' + zTranslation + 'px)'; + el.style.zIndex = -i; + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + } + + // center + // Don't show wrapped items. + if (!options.noWrap || (center >= 0 && center < count)) { + el = images[wrap(center)]; + el.style[xform] = alignment + + ' translateX(' + (-delta / 2) + 'px)' + + ' translateX(' + (dir * options.shift * tween) + 'px)' + + ' translateZ(' + (options.dist * tween) + 'px)'; + el.style.zIndex = 0; + if (options.fullWidth) { tweenedOpacity = 1; } + else { tweenedOpacity = 1 - 0.2 * tween; } + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + // onCycleTo callback + if (lastCenter !== center && + typeof(options.onCycleTo) === "function") { + var $curr_item = view.find('.carousel-item').eq(wrap(center)); + options.onCycleTo.call(this, $curr_item, dragged); + } + } + + function track() { + var now, elapsed, delta, v; + + now = Date.now(); + elapsed = now - timestamp; + timestamp = now; + delta = offset - frame; + frame = offset; + + v = 1000 * delta / (1 + elapsed); + velocity = 0.8 * v + 0.2 * velocity; + } + + function autoScroll() { + var elapsed, delta; + + if (amplitude) { + elapsed = Date.now() - timestamp; + delta = amplitude * Math.exp(-elapsed / options.duration); + if (delta > 2 || delta < -2) { + scroll(target - delta); + requestAnimationFrame(autoScroll); + } else { + scroll(target); + } + } + } + + function click(e) { + // Disable clicks if carousel was dragged. + if (dragged) { + e.preventDefault(); + e.stopPropagation(); + return false; + + } else if (!options.fullWidth) { + var clickedIndex = $(e.target).closest('.carousel-item').index(); + var diff = (center % count) - clickedIndex; + + // Disable clicks if carousel was shifted by click + if (diff !== 0) { + e.preventDefault(); + e.stopPropagation(); + } + cycleTo(clickedIndex); + } + } + + function cycleTo(n) { + var diff = (center % count) - n; + + // Account for wraparound. + if (!options.noWrap) { + if (diff < 0) { + if (Math.abs(diff + count) < Math.abs(diff)) { diff += count; } + + } else if (diff > 0) { + if (Math.abs(diff - count) < diff) { diff -= count; } + } + } + + // Call prev or next accordingly. + if (diff < 0) { + view.trigger('carouselNext', [Math.abs(diff)]); + + } else if (diff > 0) { + view.trigger('carouselPrev', [diff]); + } + } + + function tap(e) { + pressed = true; + dragged = false; + vertical_dragged = false; + reference = xpos(e); + referenceY = ypos(e); + + velocity = amplitude = 0; + frame = offset; + timestamp = Date.now(); + clearInterval(ticker); + ticker = setInterval(track, 100); + + } + + function drag(e) { + var x, delta, deltaY; + if (pressed) { + x = xpos(e); + y = ypos(e); + delta = reference - x; + deltaY = Math.abs(referenceY - y); + if (deltaY < 30 && !vertical_dragged) { + // If vertical scrolling don't allow dragging. + if (delta > 2 || delta < -2) { + dragged = true; + reference = x; + scroll(offset + delta); + } + + } else if (dragged) { + // If dragging don't allow vertical scroll. + e.preventDefault(); + e.stopPropagation(); + return false; + + } else { + // Vertical scrolling. + vertical_dragged = true; + } + } + + if (dragged) { + // If dragging don't allow vertical scroll. + e.preventDefault(); + e.stopPropagation(); + return false; + } + } + + function release(e) { + if (pressed) { + pressed = false; + } else { + return; + } + + clearInterval(ticker); + target = offset; + if (velocity > 10 || velocity < -10) { + amplitude = 0.9 * velocity; + target = offset + amplitude; + } + target = Math.round(target / dim) * dim; + + // No wrap of items. + if (options.noWrap) { + if (target >= dim * (count - 1)) { + target = dim * (count - 1); + } else if (target < 0) { + target = 0; + } + } + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + + if (dragged) { + e.preventDefault(); + e.stopPropagation(); + } + return false; + } + + xform = 'transform'; + ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) { + var e = prefix + 'Transform'; + if (typeof document.body.style[e] !== 'undefined') { + xform = e; + return false; + } + return true; + }); + + + $(window).on('resize.carousel', function() { + if (options.fullWidth) { + item_width = view.find('.carousel-item').first().innerWidth(); + item_height = view.find('.carousel-item').first().innerHeight(); + dim = item_width * 2 + options.padding; + offset = center * 2 * item_width; + target = offset; + } else { + scroll(); + } + }); + + setupEvents(); + scroll(offset); + + $(this).on('carouselNext', function(e, n) { + if (n === undefined) { + n = 1; + } + target = (dim * Math.round(offset / dim)) + (dim * n); + if (offset !== target) { + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + } + }); + + $(this).on('carouselPrev', function(e, n) { + if (n === undefined) { + n = 1; + } + target = (dim * Math.round(offset / dim)) - (dim * n); + if (offset !== target) { + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + } + }); + + $(this).on('carouselSet', function(e, n) { + if (n === undefined) { + n = 0; + } + cycleTo(n); + }); + + }); + + + + }, + next : function(n) { + $(this).trigger('carouselNext', [n]); + }, + prev : function(n) { + $(this).trigger('carouselPrev', [n]); + }, + set : function(n) { + $(this).trigger('carouselSet', [n]); + } + }; + + + $.fn.carousel = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.carousel' ); + } + }; // Plugin end +}( jQuery ));
\ No newline at end of file diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/js/materialize.min.js b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/js/materialize.min.js new file mode 100644 index 000000000..00c0d5f85 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/3rd_party/materialize/js/materialize.min.js @@ -0,0 +1,10 @@ +/*! + * Materialize v0.98.0 (http://materializecss.com) + * Copyright 2014-2015 Materialize + * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) + */ +if("undefined"==typeof jQuery){var jQuery;jQuery="function"==typeof require?$=require("jquery"):$}jQuery.easing.jswing=jQuery.easing.swing,jQuery.extend(jQuery.easing,{def:"easeOutQuad",swing:function(a,b,c,d,e){return jQuery.easing[jQuery.easing.def](a,b,c,d,e)},easeInQuad:function(a,b,c,d,e){return d*(b/=e)*b+c},easeOutQuad:function(a,b,c,d,e){return-d*(b/=e)*(b-2)+c},easeInOutQuad:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:-d/2*(--b*(b-2)-1)+c},easeInCubic:function(a,b,c,d,e){return d*(b/=e)*b*b+c},easeOutCubic:function(a,b,c,d,e){return d*((b=b/e-1)*b*b+1)+c},easeInOutCubic:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b+c:d/2*((b-=2)*b*b+2)+c},easeInQuart:function(a,b,c,d,e){return d*(b/=e)*b*b*b+c},easeOutQuart:function(a,b,c,d,e){return-d*((b=b/e-1)*b*b*b-1)+c},easeInOutQuart:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b+c:-d/2*((b-=2)*b*b*b-2)+c},easeInQuint:function(a,b,c,d,e){return d*(b/=e)*b*b*b*b+c},easeOutQuint:function(a,b,c,d,e){return d*((b=b/e-1)*b*b*b*b+1)+c},easeInOutQuint:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b*b+c:d/2*((b-=2)*b*b*b*b+2)+c},easeInSine:function(a,b,c,d,e){return-d*Math.cos(b/e*(Math.PI/2))+d+c},easeOutSine:function(a,b,c,d,e){return d*Math.sin(b/e*(Math.PI/2))+c},easeInOutSine:function(a,b,c,d,e){return-d/2*(Math.cos(Math.PI*b/e)-1)+c},easeInExpo:function(a,b,c,d,e){return 0==b?c:d*Math.pow(2,10*(b/e-1))+c},easeOutExpo:function(a,b,c,d,e){return b==e?c+d:d*(-Math.pow(2,-10*b/e)+1)+c},easeInOutExpo:function(a,b,c,d,e){return 0==b?c:b==e?c+d:(b/=e/2)<1?d/2*Math.pow(2,10*(b-1))+c:d/2*(-Math.pow(2,-10*--b)+2)+c},easeInCirc:function(a,b,c,d,e){return-d*(Math.sqrt(1-(b/=e)*b)-1)+c},easeOutCirc:function(a,b,c,d,e){return d*Math.sqrt(1-(b=b/e-1)*b)+c},easeInOutCirc:function(a,b,c,d,e){return(b/=e/2)<1?-d/2*(Math.sqrt(1-b*b)-1)+c:d/2*(Math.sqrt(1-(b-=2)*b)+1)+c},easeInElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(0==b)return c;if(1==(b/=e))return c+d;if(g||(g=.3*e),h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(b-=1))*Math.sin((b*e-f)*(2*Math.PI)/g))+c},easeOutElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(0==b)return c;if(1==(b/=e))return c+d;if(g||(g=.3*e),h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*b)*Math.sin((b*e-f)*(2*Math.PI)/g)+d+c},easeInOutElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(0==b)return c;if(2==(b/=e/2))return c+d;if(g||(g=e*(.3*1.5)),h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return b<1?-.5*(h*Math.pow(2,10*(b-=1))*Math.sin((b*e-f)*(2*Math.PI)/g))+c:h*Math.pow(2,-10*(b-=1))*Math.sin((b*e-f)*(2*Math.PI)/g)*.5+d+c},easeInBack:function(a,b,c,d,e,f){return void 0==f&&(f=1.70158),d*(b/=e)*b*((f+1)*b-f)+c},easeOutBack:function(a,b,c,d,e,f){return void 0==f&&(f=1.70158),d*((b=b/e-1)*b*((f+1)*b+f)+1)+c},easeInOutBack:function(a,b,c,d,e,f){return void 0==f&&(f=1.70158),(b/=e/2)<1?d/2*(b*b*(((f*=1.525)+1)*b-f))+c:d/2*((b-=2)*b*(((f*=1.525)+1)*b+f)+2)+c},easeInBounce:function(a,b,c,d,e){return d-jQuery.easing.easeOutBounce(a,e-b,0,d,e)+c},easeOutBounce:function(a,b,c,d,e){return(b/=e)<1/2.75?d*(7.5625*b*b)+c:b<2/2.75?d*(7.5625*(b-=1.5/2.75)*b+.75)+c:b<2.5/2.75?d*(7.5625*(b-=2.25/2.75)*b+.9375)+c:d*(7.5625*(b-=2.625/2.75)*b+.984375)+c},easeInOutBounce:function(a,b,c,d,e){return b<e/2?.5*jQuery.easing.easeInBounce(a,2*b,0,d,e)+c:.5*jQuery.easing.easeOutBounce(a,2*b-e,0,d,e)+.5*d+c}}),jQuery.extend(jQuery.easing,{easeInOutMaterial:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:d/4*((b-=2)*b*b+2)+c}}),jQuery.Velocity?console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity."):(!function(a){function b(a){var b=a.length,d=c.type(a);return"function"!==d&&!c.isWindow(a)&&(!(1!==a.nodeType||!b)||("array"===d||0===b||"number"==typeof b&&b>0&&b-1 in a))}if(!a.jQuery){var c=function(a,b){return new c.fn.init(a,b)};c.isWindow=function(a){return null!=a&&a==a.window},c.type=function(a){return null==a?a+"":"object"==typeof a||"function"==typeof a?e[g.call(a)]||"object":typeof a},c.isArray=Array.isArray||function(a){return"array"===c.type(a)},c.isPlainObject=function(a){var b;if(!a||"object"!==c.type(a)||a.nodeType||c.isWindow(a))return!1;try{if(a.constructor&&!f.call(a,"constructor")&&!f.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(d){return!1}for(b in a);return void 0===b||f.call(a,b)},c.each=function(a,c,d){var e,f=0,g=a.length,h=b(a);if(d){if(h)for(;g>f&&(e=c.apply(a[f],d),e!==!1);f++);else for(f in a)if(e=c.apply(a[f],d),e===!1)break}else if(h)for(;g>f&&(e=c.call(a[f],f,a[f]),e!==!1);f++);else for(f in a)if(e=c.call(a[f],f,a[f]),e===!1)break;return a},c.data=function(a,b,e){if(void 0===e){var f=a[c.expando],g=f&&d[f];if(void 0===b)return g;if(g&&b in g)return g[b]}else if(void 0!==b){var f=a[c.expando]||(a[c.expando]=++c.uuid);return d[f]=d[f]||{},d[f][b]=e,e}},c.removeData=function(a,b){var e=a[c.expando],f=e&&d[e];f&&c.each(b,function(a,b){delete f[b]})},c.extend=function(){var a,b,d,e,f,g,h=arguments[0]||{},i=1,j=arguments.length,k=!1;for("boolean"==typeof h&&(k=h,h=arguments[i]||{},i++),"object"!=typeof h&&"function"!==c.type(h)&&(h={}),i===j&&(h=this,i--);j>i;i++)if(null!=(f=arguments[i]))for(e in f)a=h[e],d=f[e],h!==d&&(k&&d&&(c.isPlainObject(d)||(b=c.isArray(d)))?(b?(b=!1,g=a&&c.isArray(a)?a:[]):g=a&&c.isPlainObject(a)?a:{},h[e]=c.extend(k,g,d)):void 0!==d&&(h[e]=d));return h},c.queue=function(a,d,e){function f(a,c){var d=c||[];return null!=a&&(b(Object(a))?!function(a,b){for(var c=+b.length,d=0,e=a.length;c>d;)a[e++]=b[d++];if(c!==c)for(;void 0!==b[d];)a[e++]=b[d++];return a.length=e,a}(d,"string"==typeof a?[a]:a):[].push.call(d,a)),d}if(a){d=(d||"fx")+"queue";var g=c.data(a,d);return e?(!g||c.isArray(e)?g=c.data(a,d,f(e)):g.push(e),g):g||[]}},c.dequeue=function(a,b){c.each(a.nodeType?[a]:a,function(a,d){b=b||"fx";var e=c.queue(d,b),f=e.shift();"inprogress"===f&&(f=e.shift()),f&&("fx"===b&&e.unshift("inprogress"),f.call(d,function(){c.dequeue(d,b)}))})},c.fn=c.prototype={init:function(a){if(a.nodeType)return this[0]=a,this;throw new Error("Not a DOM node.")},offset:function(){var b=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:b.top+(a.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:b.left+(a.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function a(){for(var a=this.offsetParent||document;a&&"html"===!a.nodeType.toLowerCase&&"static"===a.style.position;)a=a.offsetParent;return a||document}var b=this[0],a=a.apply(b),d=this.offset(),e=/^(?:body|html)$/i.test(a.nodeName)?{top:0,left:0}:c(a).offset();return d.top-=parseFloat(b.style.marginTop)||0,d.left-=parseFloat(b.style.marginLeft)||0,a.style&&(e.top+=parseFloat(a.style.borderTopWidth)||0,e.left+=parseFloat(a.style.borderLeftWidth)||0),{top:d.top-e.top,left:d.left-e.left}}};var d={};c.expando="velocity"+(new Date).getTime(),c.uuid=0;for(var e={},f=e.hasOwnProperty,g=e.toString,h="Boolean Number String Function Array Date RegExp Object Error".split(" "),i=0;i<h.length;i++)e["[object "+h[i]+"]"]=h[i].toLowerCase();c.fn.init.prototype=c.fn,a.Velocity={Utilities:c}}}(window),function(a){"object"==typeof module&&"object"==typeof module.exports?module.exports=a():"function"==typeof define&&define.amd?define(a):a()}(function(){return function(a,b,c,d){function e(a){for(var b=-1,c=a?a.length:0,d=[];++b<c;){var e=a[b];e&&d.push(e)}return d}function f(a){return p.isWrapped(a)?a=[].slice.call(a):p.isNode(a)&&(a=[a]),a}function g(a){var b=m.data(a,"velocity");return null===b?d:b}function h(a){return function(b){return Math.round(b*a)*(1/a)}}function i(a,c,d,e){function f(a,b){return 1-3*b+3*a}function g(a,b){return 3*b-6*a}function h(a){return 3*a}function i(a,b,c){return((f(b,c)*a+g(b,c))*a+h(b))*a}function j(a,b,c){return 3*f(b,c)*a*a+2*g(b,c)*a+h(b)}function k(b,c){for(var e=0;p>e;++e){var f=j(c,a,d);if(0===f)return c;var g=i(c,a,d)-b;c-=g/f}return c}function l(){for(var b=0;t>b;++b)x[b]=i(b*u,a,d)}function m(b,c,e){var f,g,h=0;do g=c+(e-c)/2,f=i(g,a,d)-b,f>0?e=g:c=g;while(Math.abs(f)>r&&++h<s);return g}function n(b){for(var c=0,e=1,f=t-1;e!=f&&x[e]<=b;++e)c+=u;--e;var g=(b-x[e])/(x[e+1]-x[e]),h=c+g*u,i=j(h,a,d);return i>=q?k(b,h):0==i?h:m(b,c,c+u)}function o(){y=!0,(a!=c||d!=e)&&l()}var p=4,q=.001,r=1e-7,s=10,t=11,u=1/(t-1),v="Float32Array"in b;if(4!==arguments.length)return!1;for(var w=0;4>w;++w)if("number"!=typeof arguments[w]||isNaN(arguments[w])||!isFinite(arguments[w]))return!1;a=Math.min(a,1),d=Math.min(d,1),a=Math.max(a,0),d=Math.max(d,0);var x=v?new Float32Array(t):new Array(t),y=!1,z=function(b){return y||o(),a===c&&d===e?b:0===b?0:1===b?1:i(n(b),c,e)};z.getControlPoints=function(){return[{x:a,y:c},{x:d,y:e}]};var A="generateBezier("+[a,c,d,e]+")";return z.toString=function(){return A},z}function j(a,b){var c=a;return p.isString(a)?t.Easings[a]||(c=!1):c=p.isArray(a)&&1===a.length?h.apply(null,a):p.isArray(a)&&2===a.length?u.apply(null,a.concat([b])):!(!p.isArray(a)||4!==a.length)&&i.apply(null,a),c===!1&&(c=t.Easings[t.defaults.easing]?t.defaults.easing:s),c}function k(a){if(a){var b=(new Date).getTime(),c=t.State.calls.length;c>1e4&&(t.State.calls=e(t.State.calls));for(var f=0;c>f;f++)if(t.State.calls[f]){var h=t.State.calls[f],i=h[0],j=h[2],n=h[3],o=!!n,q=null;n||(n=t.State.calls[f][3]=b-16);for(var r=Math.min((b-n)/j.duration,1),s=0,u=i.length;u>s;s++){var w=i[s],y=w.element;if(g(y)){var z=!1;if(j.display!==d&&null!==j.display&&"none"!==j.display){if("flex"===j.display){var A=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];m.each(A,function(a,b){v.setPropertyValue(y,"display",b)})}v.setPropertyValue(y,"display",j.display)}j.visibility!==d&&"hidden"!==j.visibility&&v.setPropertyValue(y,"visibility",j.visibility);for(var B in w)if("element"!==B){var C,D=w[B],E=p.isString(D.easing)?t.Easings[D.easing]:D.easing;if(1===r)C=D.endValue;else{var F=D.endValue-D.startValue;if(C=D.startValue+F*E(r,j,F),!o&&C===D.currentValue)continue}if(D.currentValue=C,"tween"===B)q=C;else{if(v.Hooks.registered[B]){var G=v.Hooks.getRoot(B),H=g(y).rootPropertyValueCache[G];H&&(D.rootPropertyValue=H)}var I=v.setPropertyValue(y,B,D.currentValue+(0===parseFloat(C)?"":D.unitType),D.rootPropertyValue,D.scrollData);v.Hooks.registered[B]&&(g(y).rootPropertyValueCache[G]=v.Normalizations.registered[G]?v.Normalizations.registered[G]("extract",null,I[1]):I[1]),"transform"===I[0]&&(z=!0)}}j.mobileHA&&g(y).transformCache.translate3d===d&&(g(y).transformCache.translate3d="(0px, 0px, 0px)",z=!0),z&&v.flushTransformCache(y)}}j.display!==d&&"none"!==j.display&&(t.State.calls[f][2].display=!1),j.visibility!==d&&"hidden"!==j.visibility&&(t.State.calls[f][2].visibility=!1),j.progress&&j.progress.call(h[1],h[1],r,Math.max(0,n+j.duration-b),n,q),1===r&&l(f)}}t.State.isTicking&&x(k)}function l(a,b){if(!t.State.calls[a])return!1;for(var c=t.State.calls[a][0],e=t.State.calls[a][1],f=t.State.calls[a][2],h=t.State.calls[a][4],i=!1,j=0,k=c.length;k>j;j++){var l=c[j].element;if(b||f.loop||("none"===f.display&&v.setPropertyValue(l,"display",f.display),"hidden"===f.visibility&&v.setPropertyValue(l,"visibility",f.visibility)),f.loop!==!0&&(m.queue(l)[1]===d||!/\.velocityQueueEntryFlag/i.test(m.queue(l)[1]))&&g(l)){g(l).isAnimating=!1,g(l).rootPropertyValueCache={};var n=!1;m.each(v.Lists.transforms3D,function(a,b){var c=/^scale/.test(b)?1:0,e=g(l).transformCache[b];g(l).transformCache[b]!==d&&new RegExp("^\\("+c+"[^.]").test(e)&&(n=!0,delete g(l).transformCache[b])}),f.mobileHA&&(n=!0,delete g(l).transformCache.translate3d),n&&v.flushTransformCache(l),v.Values.removeClass(l,"velocity-animating")}if(!b&&f.complete&&!f.loop&&j===k-1)try{f.complete.call(e,e)}catch(o){setTimeout(function(){throw o},1)}h&&f.loop!==!0&&h(e),g(l)&&f.loop===!0&&!b&&(m.each(g(l).tweensContainer,function(a,b){/^rotate/.test(a)&&360===parseFloat(b.endValue)&&(b.endValue=0,b.startValue=360),/^backgroundPosition/.test(a)&&100===parseFloat(b.endValue)&&"%"===b.unitType&&(b.endValue=0,b.startValue=100)}),t(l,"reverse",{loop:!0,delay:f.delay})),f.queue!==!1&&m.dequeue(l,f.queue)}t.State.calls[a]=!1;for(var p=0,q=t.State.calls.length;q>p;p++)if(t.State.calls[p]!==!1){i=!0;break}i===!1&&(t.State.isTicking=!1,delete t.State.calls,t.State.calls=[])}var m,n=function(){if(c.documentMode)return c.documentMode;for(var a=7;a>4;a--){var b=c.createElement("div");if(b.innerHTML="<!--[if IE "+a+"]><span></span><![endif]-->",b.getElementsByTagName("span").length)return b=null,a}return d}(),o=function(){var a=0;return b.webkitRequestAnimationFrame||b.mozRequestAnimationFrame||function(b){var c,d=(new Date).getTime();return c=Math.max(0,16-(d-a)),a=d+c,setTimeout(function(){b(d+c)},c)}}(),p={isString:function(a){return"string"==typeof a},isArray:Array.isArray||function(a){return"[object Array]"===Object.prototype.toString.call(a)},isFunction:function(a){return"[object Function]"===Object.prototype.toString.call(a)},isNode:function(a){return a&&a.nodeType},isNodeList:function(a){return"object"==typeof a&&/^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(a))&&a.length!==d&&(0===a.length||"object"==typeof a[0]&&a[0].nodeType>0)},isWrapped:function(a){return a&&(a.jquery||b.Zepto&&b.Zepto.zepto.isZ(a))},isSVG:function(a){return b.SVGElement&&a instanceof b.SVGElement},isEmptyObject:function(a){for(var b in a)return!1;return!0}},q=!1;if(a.fn&&a.fn.jquery?(m=a,q=!0):m=b.Velocity.Utilities,8>=n&&!q)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if(7>=n)return void(jQuery.fn.velocity=jQuery.fn.animate);var r=400,s="swing",t={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:b.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:c.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:m,Redirects:{},Easings:{},Promise:b.Promise,defaults:{queue:"",duration:r,easing:s,begin:d,complete:d,progress:d,display:d,visibility:d,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(a){m.data(a,"velocity",{isSVG:p.isSVG(a),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};b.pageYOffset!==d?(t.State.scrollAnchor=b,t.State.scrollPropertyLeft="pageXOffset",t.State.scrollPropertyTop="pageYOffset"):(t.State.scrollAnchor=c.documentElement||c.body.parentNode||c.body,t.State.scrollPropertyLeft="scrollLeft",t.State.scrollPropertyTop="scrollTop");var u=function(){function a(a){return-a.tension*a.x-a.friction*a.v}function b(b,c,d){var e={x:b.x+d.dx*c,v:b.v+d.dv*c,tension:b.tension,friction:b.friction};return{dx:e.v,dv:a(e)}}function c(c,d){var e={dx:c.v,dv:a(c)},f=b(c,.5*d,e),g=b(c,.5*d,f),h=b(c,d,g),i=1/6*(e.dx+2*(f.dx+g.dx)+h.dx),j=1/6*(e.dv+2*(f.dv+g.dv)+h.dv);return c.x=c.x+i*d,c.v=c.v+j*d,c}return function d(a,b,e){var f,g,h,i={x:-1,v:0,tension:null,friction:null},j=[0],k=0,l=1e-4,m=.016;for(a=parseFloat(a)||500,b=parseFloat(b)||20,e=e||null,i.tension=a,i.friction=b,f=null!==e,f?(k=d(a,b),g=k/e*m):g=m;h=c(h||i,g),j.push(1+h.x),k+=16,Math.abs(h.x)>l&&Math.abs(h.v)>l;);return f?function(a){return j[a*(j.length-1)|0]}:k}}();t.Easings={linear:function(a){return a},swing:function(a){return.5-Math.cos(a*Math.PI)/2},spring:function(a){return 1-Math.cos(4.5*a*Math.PI)*Math.exp(6*-a)}},m.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(a,b){t.Easings[b[0]]=i.apply(null,b[1])});var v=t.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(var a=0;a<v.Lists.colors.length;a++){var b="color"===v.Lists.colors[a]?"0 0 0 1":"255 255 255 1";v.Hooks.templates[v.Lists.colors[a]]=["Red Green Blue Alpha",b]}var c,d,e;if(n)for(c in v.Hooks.templates){d=v.Hooks.templates[c],e=d[0].split(" ");var f=d[1].match(v.RegEx.valueSplit);"Color"===e[0]&&(e.push(e.shift()),f.push(f.shift()),v.Hooks.templates[c]=[e.join(" "),f.join(" ")])}for(c in v.Hooks.templates){d=v.Hooks.templates[c],e=d[0].split(" ");for(var a in e){var g=c+e[a],h=a;v.Hooks.registered[g]=[c,h]}}},getRoot:function(a){var b=v.Hooks.registered[a];return b?b[0]:a},cleanRootPropertyValue:function(a,b){return v.RegEx.valueUnwrap.test(b)&&(b=b.match(v.RegEx.valueUnwrap)[1]),v.Values.isCSSNullValue(b)&&(b=v.Hooks.templates[a][1]),b},extractValue:function(a,b){var c=v.Hooks.registered[a];if(c){var d=c[0],e=c[1];return b=v.Hooks.cleanRootPropertyValue(d,b),b.toString().match(v.RegEx.valueSplit)[e]}return b},injectValue:function(a,b,c){var d=v.Hooks.registered[a];if(d){var e,f,g=d[0],h=d[1];return c=v.Hooks.cleanRootPropertyValue(g,c),e=c.toString().match(v.RegEx.valueSplit),e[h]=b,f=e.join(" ")}return c}},Normalizations:{registered:{clip:function(a,b,c){switch(a){case"name":return"clip";case"extract":var d;return v.RegEx.wrappedValueAlreadyExtracted.test(c)?d=c:(d=c.toString().match(v.RegEx.valueUnwrap),d=d?d[1].replace(/,(\s+)?/g," "):c),d;case"inject":return"rect("+c+")"}},blur:function(a,b,c){switch(a){case"name":return t.State.isFirefox?"filter":"-webkit-filter";case"extract":var d=parseFloat(c);if(!d&&0!==d){var e=c.toString().match(/blur\(([0-9]+[A-z]+)\)/i);d=e?e[1]:0}return d;case"inject":return parseFloat(c)?"blur("+c+")":"none"}},opacity:function(a,b,c){if(8>=n)switch(a){case"name":return"filter";case"extract":var d=c.toString().match(/alpha\(opacity=(.*)\)/i);return c=d?d[1]/100:1;case"inject":return b.style.zoom=1,parseFloat(c)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(c),10)+")"}else switch(a){case"name":return"opacity";case"extract":return c;case"inject":return c}}},register:function(){9>=n||t.State.isGingerbread||(v.Lists.transformsBase=v.Lists.transformsBase.concat(v.Lists.transforms3D));for(var a=0;a<v.Lists.transformsBase.length;a++)!function(){var b=v.Lists.transformsBase[a];v.Normalizations.registered[b]=function(a,c,e){switch(a){case"name":return"transform";case"extract":return g(c)===d||g(c).transformCache[b]===d?/^scale/i.test(b)?1:0:g(c).transformCache[b].replace(/[()]/g,"");case"inject":var f=!1;switch(b.substr(0,b.length-1)){case"translate":f=!/(%|px|em|rem|vw|vh|\d)$/i.test(e);break;case"scal":case"scale":t.State.isAndroid&&g(c).transformCache[b]===d&&1>e&&(e=1),f=!/(\d)$/i.test(e);break;case"skew":f=!/(deg|\d)$/i.test(e);break;case"rotate":f=!/(deg|\d)$/i.test(e)}return f||(g(c).transformCache[b]="("+e+")"),g(c).transformCache[b]}}}();for(var a=0;a<v.Lists.colors.length;a++)!function(){var b=v.Lists.colors[a];v.Normalizations.registered[b]=function(a,c,e){switch(a){case"name":return b;case"extract":var f;if(v.RegEx.wrappedValueAlreadyExtracted.test(e))f=e;else{var g,h={black:"rgb(0, 0, 0)",blue:"rgb(0, 0, 255)",gray:"rgb(128, 128, 128)",green:"rgb(0, 128, 0)",red:"rgb(255, 0, 0)",white:"rgb(255, 255, 255)"};/^[A-z]+$/i.test(e)?g=h[e]!==d?h[e]:h.black:v.RegEx.isHex.test(e)?g="rgb("+v.Values.hexToRgb(e).join(" ")+")":/^rgba?\(/i.test(e)||(g=h.black),f=(g||e).toString().match(v.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g," ")}return 8>=n||3!==f.split(" ").length||(f+=" 1"),f;case"inject":return 8>=n?4===e.split(" ").length&&(e=e.split(/\s+/).slice(0,3).join(" ")):3===e.split(" ").length&&(e+=" 1"),(8>=n?"rgb":"rgba")+"("+e.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(a){return a.replace(/-(\w)/g,function(a,b){return b.toUpperCase()})},SVGAttribute:function(a){var b="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(n||t.State.isAndroid&&!t.State.isChrome)&&(b+="|transform"),new RegExp("^("+b+")$","i").test(a)},prefixCheck:function(a){if(t.State.prefixMatches[a])return[t.State.prefixMatches[a],!0];for(var b=["","Webkit","Moz","ms","O"],c=0,d=b.length;d>c;c++){var e;if(e=0===c?a:b[c]+a.replace(/^\w/,function(a){return a.toUpperCase()}),p.isString(t.State.prefixElement.style[e]))return t.State.prefixMatches[a]=e,[e,!0]}return[a,!1]}},Values:{hexToRgb:function(a){var b,c=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,d=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return a=a.replace(c,function(a,b,c,d){return b+b+c+c+d+d}),b=d.exec(a),b?[parseInt(b[1],16),parseInt(b[2],16),parseInt(b[3],16)]:[0,0,0]},isCSSNullValue:function(a){return 0==a||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(a)},getUnitType:function(a){return/^(rotate|skew)/i.test(a)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(a)?"":"px"},getDisplayType:function(a){var b=a&&a.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(b)?"inline":/^(li)$/i.test(b)?"list-item":/^(tr)$/i.test(b)?"table-row":/^(table)$/i.test(b)?"table":/^(tbody)$/i.test(b)?"table-row-group":"block"},addClass:function(a,b){a.classList?a.classList.add(b):a.className+=(a.className.length?" ":"")+b},removeClass:function(a,b){a.classList?a.classList.remove(b):a.className=a.className.toString().replace(new RegExp("(^|\\s)"+b.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(a,c,e,f){function h(a,c){function e(){j&&v.setPropertyValue(a,"display","none")}var i=0;if(8>=n)i=m.css(a,c);else{var j=!1;if(/^(width|height)$/.test(c)&&0===v.getPropertyValue(a,"display")&&(j=!0,v.setPropertyValue(a,"display",v.Values.getDisplayType(a))),!f){if("height"===c&&"border-box"!==v.getPropertyValue(a,"boxSizing").toString().toLowerCase()){var k=a.offsetHeight-(parseFloat(v.getPropertyValue(a,"borderTopWidth"))||0)-(parseFloat(v.getPropertyValue(a,"borderBottomWidth"))||0)-(parseFloat(v.getPropertyValue(a,"paddingTop"))||0)-(parseFloat(v.getPropertyValue(a,"paddingBottom"))||0);return e(),k}if("width"===c&&"border-box"!==v.getPropertyValue(a,"boxSizing").toString().toLowerCase()){var l=a.offsetWidth-(parseFloat(v.getPropertyValue(a,"borderLeftWidth"))||0)-(parseFloat(v.getPropertyValue(a,"borderRightWidth"))||0)-(parseFloat(v.getPropertyValue(a,"paddingLeft"))||0)-(parseFloat(v.getPropertyValue(a,"paddingRight"))||0);return e(),l}}var o;o=g(a)===d?b.getComputedStyle(a,null):g(a).computedStyle?g(a).computedStyle:g(a).computedStyle=b.getComputedStyle(a,null),"borderColor"===c&&(c="borderTopColor"),i=9===n&&"filter"===c?o.getPropertyValue(c):o[c],(""===i||null===i)&&(i=a.style[c]),e()}if("auto"===i&&/^(top|right|bottom|left)$/i.test(c)){var p=h(a,"position");("fixed"===p||"absolute"===p&&/top|left/i.test(c))&&(i=m(a).position()[c]+"px")}return i}var i;if(v.Hooks.registered[c]){var j=c,k=v.Hooks.getRoot(j);e===d&&(e=v.getPropertyValue(a,v.Names.prefixCheck(k)[0])),v.Normalizations.registered[k]&&(e=v.Normalizations.registered[k]("extract",a,e)),i=v.Hooks.extractValue(j,e)}else if(v.Normalizations.registered[c]){var l,o;l=v.Normalizations.registered[c]("name",a),"transform"!==l&&(o=h(a,v.Names.prefixCheck(l)[0]),v.Values.isCSSNullValue(o)&&v.Hooks.templates[c]&&(o=v.Hooks.templates[c][1])),i=v.Normalizations.registered[c]("extract",a,o)}if(!/^[\d-]/.test(i))if(g(a)&&g(a).isSVG&&v.Names.SVGAttribute(c))if(/^(height|width)$/i.test(c))try{i=a.getBBox()[c]}catch(p){i=0}else i=a.getAttribute(c);else i=h(a,v.Names.prefixCheck(c)[0]);return v.Values.isCSSNullValue(i)&&(i=0),t.debug>=2&&console.log("Get "+c+": "+i),i},setPropertyValue:function(a,c,d,e,f){var h=c;if("scroll"===c)f.container?f.container["scroll"+f.direction]=d:"Left"===f.direction?b.scrollTo(d,f.alternateValue):b.scrollTo(f.alternateValue,d);else if(v.Normalizations.registered[c]&&"transform"===v.Normalizations.registered[c]("name",a))v.Normalizations.registered[c]("inject",a,d),h="transform",d=g(a).transformCache[c];else{if(v.Hooks.registered[c]){var i=c,j=v.Hooks.getRoot(c);e=e||v.getPropertyValue(a,j),d=v.Hooks.injectValue(i,d,e),c=j}if(v.Normalizations.registered[c]&&(d=v.Normalizations.registered[c]("inject",a,d),c=v.Normalizations.registered[c]("name",a)),h=v.Names.prefixCheck(c)[0],8>=n)try{a.style[h]=d}catch(k){t.debug&&console.log("Browser does not support ["+d+"] for ["+h+"]")}else g(a)&&g(a).isSVG&&v.Names.SVGAttribute(c)?a.setAttribute(c,d):a.style[h]=d;t.debug>=2&&console.log("Set "+c+" ("+h+"): "+d)}return[h,d]},flushTransformCache:function(a){function b(b){return parseFloat(v.getPropertyValue(a,b))}var c="";if((n||t.State.isAndroid&&!t.State.isChrome)&&g(a).isSVG){var d={translate:[b("translateX"),b("translateY")],skewX:[b("skewX")],skewY:[b("skewY")],scale:1!==b("scale")?[b("scale"),b("scale")]:[b("scaleX"),b("scaleY")],rotate:[b("rotateZ"),0,0]};m.each(g(a).transformCache,function(a){/^translate/i.test(a)?a="translate":/^scale/i.test(a)?a="scale":/^rotate/i.test(a)&&(a="rotate"),d[a]&&(c+=a+"("+d[a].join(" ")+") ",delete d[a])})}else{var e,f;m.each(g(a).transformCache,function(b){return e=g(a).transformCache[b],"transformPerspective"===b?(f=e,!0):(9===n&&"rotateZ"===b&&(b="rotate"),void(c+=b+e+" "))}),f&&(c="perspective"+f+" "+c)}v.setPropertyValue(a,"transform",c)}};v.Hooks.register(),v.Normalizations.register(),t.hook=function(a,b,c){var e=d;return a=f(a),m.each(a,function(a,f){if(g(f)===d&&t.init(f),c===d)e===d&&(e=t.CSS.getPropertyValue(f,b));else{var h=t.CSS.setPropertyValue(f,b,c);"transform"===h[0]&&t.CSS.flushTransformCache(f),e=h}}),e};var w=function(){function a(){return h?B.promise||null:i}function e(){function a(a){function l(a,b){var c=d,e=d,g=d;return p.isArray(a)?(c=a[0],!p.isArray(a[1])&&/^[\d-]/.test(a[1])||p.isFunction(a[1])||v.RegEx.isHex.test(a[1])?g=a[1]:(p.isString(a[1])&&!v.RegEx.isHex.test(a[1])||p.isArray(a[1]))&&(e=b?a[1]:j(a[1],h.duration),a[2]!==d&&(g=a[2]))):c=a,b||(e=e||h.easing),p.isFunction(c)&&(c=c.call(f,y,x)),p.isFunction(g)&&(g=g.call(f,y,x)),[c||0,e,g]}function n(a,b){var c,d;return d=(b||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(a){return c=a,""}),c||(c=v.Values.getUnitType(a)),[d,c]}function r(){var a={myParent:f.parentNode||c.body,position:v.getPropertyValue(f,"position"),fontSize:v.getPropertyValue(f,"fontSize")},d=a.position===I.lastPosition&&a.myParent===I.lastParent,e=a.fontSize===I.lastFontSize;I.lastParent=a.myParent,I.lastPosition=a.position,I.lastFontSize=a.fontSize;var h=100,i={};if(e&&d)i.emToPx=I.lastEmToPx,i.percentToPxWidth=I.lastPercentToPxWidth,i.percentToPxHeight=I.lastPercentToPxHeight;else{var j=g(f).isSVG?c.createElementNS("http://www.w3.org/2000/svg","rect"):c.createElement("div");t.init(j),a.myParent.appendChild(j),m.each(["overflow","overflowX","overflowY"],function(a,b){t.CSS.setPropertyValue(j,b,"hidden")}),t.CSS.setPropertyValue(j,"position",a.position),t.CSS.setPropertyValue(j,"fontSize",a.fontSize),t.CSS.setPropertyValue(j,"boxSizing","content-box"),m.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(a,b){t.CSS.setPropertyValue(j,b,h+"%")}),t.CSS.setPropertyValue(j,"paddingLeft",h+"em"),i.percentToPxWidth=I.lastPercentToPxWidth=(parseFloat(v.getPropertyValue(j,"width",null,!0))||1)/h,i.percentToPxHeight=I.lastPercentToPxHeight=(parseFloat(v.getPropertyValue(j,"height",null,!0))||1)/h,i.emToPx=I.lastEmToPx=(parseFloat(v.getPropertyValue(j,"paddingLeft"))||1)/h,a.myParent.removeChild(j)}return null===I.remToPx&&(I.remToPx=parseFloat(v.getPropertyValue(c.body,"fontSize"))||16),null===I.vwToPx&&(I.vwToPx=parseFloat(b.innerWidth)/100,I.vhToPx=parseFloat(b.innerHeight)/100),i.remToPx=I.remToPx,i.vwToPx=I.vwToPx,i.vhToPx=I.vhToPx,t.debug>=1&&console.log("Unit ratios: "+JSON.stringify(i),f),i}if(h.begin&&0===y)try{h.begin.call(o,o)}catch(u){setTimeout(function(){throw u},1)}if("scroll"===C){var w,z,A,D=/^x$/i.test(h.axis)?"Left":"Top",E=parseFloat(h.offset)||0;h.container?p.isWrapped(h.container)||p.isNode(h.container)?(h.container=h.container[0]||h.container,w=h.container["scroll"+D],A=w+m(f).position()[D.toLowerCase()]+E):h.container=null:(w=t.State.scrollAnchor[t.State["scrollProperty"+D]],z=t.State.scrollAnchor[t.State["scrollProperty"+("Left"===D?"Top":"Left")]],A=m(f).offset()[D.toLowerCase()]+E),i={scroll:{rootPropertyValue:!1,startValue:w,currentValue:w,endValue:A,unitType:"",easing:h.easing,scrollData:{container:h.container,direction:D,alternateValue:z}},element:f},t.debug&&console.log("tweensContainer (scroll): ",i.scroll,f)}else if("reverse"===C){if(!g(f).tweensContainer)return void m.dequeue(f,h.queue);"none"===g(f).opts.display&&(g(f).opts.display="auto"),"hidden"===g(f).opts.visibility&&(g(f).opts.visibility="visible"),g(f).opts.loop=!1,g(f).opts.begin=null,g(f).opts.complete=null,s.easing||delete h.easing,s.duration||delete h.duration,h=m.extend({},g(f).opts,h);var F=m.extend(!0,{},g(f).tweensContainer);for(var G in F)if("element"!==G){var H=F[G].startValue;F[G].startValue=F[G].currentValue=F[G].endValue,F[G].endValue=H,p.isEmptyObject(s)||(F[G].easing=h.easing),t.debug&&console.log("reverse tweensContainer ("+G+"): "+JSON.stringify(F[G]),f)}i=F}else if("start"===C){var F;g(f).tweensContainer&&g(f).isAnimating===!0&&(F=g(f).tweensContainer),m.each(q,function(a,b){if(RegExp("^"+v.Lists.colors.join("$|^")+"$").test(a)){var c=l(b,!0),e=c[0],f=c[1],g=c[2];if(v.RegEx.isHex.test(e)){for(var h=["Red","Green","Blue"],i=v.Values.hexToRgb(e),j=g?v.Values.hexToRgb(g):d,k=0;k<h.length;k++){var m=[i[k]];f&&m.push(f),j!==d&&m.push(j[k]),q[a+h[k]]=m}delete q[a]}}});for(var K in q){var L=l(q[K]),M=L[0],N=L[1],O=L[2];K=v.Names.camelCase(K);var P=v.Hooks.getRoot(K),Q=!1;if(g(f).isSVG||"tween"===P||v.Names.prefixCheck(P)[1]!==!1||v.Normalizations.registered[P]!==d){(h.display!==d&&null!==h.display&&"none"!==h.display||h.visibility!==d&&"hidden"!==h.visibility)&&/opacity|filter/.test(K)&&!O&&0!==M&&(O=0),h._cacheValues&&F&&F[K]?(O===d&&(O=F[K].endValue+F[K].unitType),Q=g(f).rootPropertyValueCache[P]):v.Hooks.registered[K]?O===d?(Q=v.getPropertyValue(f,P),O=v.getPropertyValue(f,K,Q)):Q=v.Hooks.templates[P][1]:O===d&&(O=v.getPropertyValue(f,K));var R,S,T,U=!1;if(R=n(K,O),O=R[0],T=R[1],R=n(K,M),M=R[0].replace(/^([+-\/*])=/,function(a,b){return U=b,""}),S=R[1],O=parseFloat(O)||0,M=parseFloat(M)||0,"%"===S&&(/^(fontSize|lineHeight)$/.test(K)?(M/=100,S="em"):/^scale/.test(K)?(M/=100,S=""):/(Red|Green|Blue)$/i.test(K)&&(M=M/100*255,S="")),/[\/*]/.test(U))S=T;else if(T!==S&&0!==O)if(0===M)S=T;else{e=e||r();var V=/margin|padding|left|right|width|text|word|letter/i.test(K)||/X$/.test(K)||"x"===K?"x":"y"; +switch(T){case"%":O*="x"===V?e.percentToPxWidth:e.percentToPxHeight;break;case"px":break;default:O*=e[T+"ToPx"]}switch(S){case"%":O*=1/("x"===V?e.percentToPxWidth:e.percentToPxHeight);break;case"px":break;default:O*=1/e[S+"ToPx"]}}switch(U){case"+":M=O+M;break;case"-":M=O-M;break;case"*":M=O*M;break;case"/":M=O/M}i[K]={rootPropertyValue:Q,startValue:O,currentValue:O,endValue:M,unitType:S,easing:N},t.debug&&console.log("tweensContainer ("+K+"): "+JSON.stringify(i[K]),f)}else t.debug&&console.log("Skipping ["+P+"] due to a lack of browser support.")}i.element=f}i.element&&(v.Values.addClass(f,"velocity-animating"),J.push(i),""===h.queue&&(g(f).tweensContainer=i,g(f).opts=h),g(f).isAnimating=!0,y===x-1?(t.State.calls.push([J,o,h,null,B.resolver]),t.State.isTicking===!1&&(t.State.isTicking=!0,k())):y++)}var e,f=this,h=m.extend({},t.defaults,s),i={};switch(g(f)===d&&t.init(f),parseFloat(h.delay)&&h.queue!==!1&&m.queue(f,h.queue,function(a){t.velocityQueueEntryFlag=!0,g(f).delayTimer={setTimeout:setTimeout(a,parseFloat(h.delay)),next:a}}),h.duration.toString().toLowerCase()){case"fast":h.duration=200;break;case"normal":h.duration=r;break;case"slow":h.duration=600;break;default:h.duration=parseFloat(h.duration)||1}t.mock!==!1&&(t.mock===!0?h.duration=h.delay=1:(h.duration*=parseFloat(t.mock)||1,h.delay*=parseFloat(t.mock)||1)),h.easing=j(h.easing,h.duration),h.begin&&!p.isFunction(h.begin)&&(h.begin=null),h.progress&&!p.isFunction(h.progress)&&(h.progress=null),h.complete&&!p.isFunction(h.complete)&&(h.complete=null),h.display!==d&&null!==h.display&&(h.display=h.display.toString().toLowerCase(),"auto"===h.display&&(h.display=t.CSS.Values.getDisplayType(f))),h.visibility!==d&&null!==h.visibility&&(h.visibility=h.visibility.toString().toLowerCase()),h.mobileHA=h.mobileHA&&t.State.isMobile&&!t.State.isGingerbread,h.queue===!1?h.delay?setTimeout(a,h.delay):a():m.queue(f,h.queue,function(b,c){return c===!0?(B.promise&&B.resolver(o),!0):(t.velocityQueueEntryFlag=!0,void a(b))}),""!==h.queue&&"fx"!==h.queue||"inprogress"===m.queue(f)[0]||m.dequeue(f)}var h,i,n,o,q,s,u=arguments[0]&&(arguments[0].p||m.isPlainObject(arguments[0].properties)&&!arguments[0].properties.names||p.isString(arguments[0].properties));if(p.isWrapped(this)?(h=!1,n=0,o=this,i=this):(h=!0,n=1,o=u?arguments[0].elements||arguments[0].e:arguments[0]),o=f(o)){u?(q=arguments[0].properties||arguments[0].p,s=arguments[0].options||arguments[0].o):(q=arguments[n],s=arguments[n+1]);var x=o.length,y=0;if(!/^(stop|finish)$/i.test(q)&&!m.isPlainObject(s)){var z=n+1;s={};for(var A=z;A<arguments.length;A++)p.isArray(arguments[A])||!/^(fast|normal|slow)$/i.test(arguments[A])&&!/^\d/.test(arguments[A])?p.isString(arguments[A])||p.isArray(arguments[A])?s.easing=arguments[A]:p.isFunction(arguments[A])&&(s.complete=arguments[A]):s.duration=arguments[A]}var B={promise:null,resolver:null,rejecter:null};h&&t.Promise&&(B.promise=new t.Promise(function(a,b){B.resolver=a,B.rejecter=b}));var C;switch(q){case"scroll":C="scroll";break;case"reverse":C="reverse";break;case"finish":case"stop":m.each(o,function(a,b){g(b)&&g(b).delayTimer&&(clearTimeout(g(b).delayTimer.setTimeout),g(b).delayTimer.next&&g(b).delayTimer.next(),delete g(b).delayTimer)});var D=[];return m.each(t.State.calls,function(a,b){b&&m.each(b[1],function(c,e){var f=s===d?"":s;return f!==!0&&b[2].queue!==f&&(s!==d||b[2].queue!==!1)||void m.each(o,function(c,d){d===e&&((s===!0||p.isString(s))&&(m.each(m.queue(d,p.isString(s)?s:""),function(a,b){p.isFunction(b)&&b(null,!0)}),m.queue(d,p.isString(s)?s:"",[])),"stop"===q?(g(d)&&g(d).tweensContainer&&f!==!1&&m.each(g(d).tweensContainer,function(a,b){b.endValue=b.currentValue}),D.push(a)):"finish"===q&&(b[2].duration=1))})})}),"stop"===q&&(m.each(D,function(a,b){l(b,!0)}),B.promise&&B.resolver(o)),a();default:if(!m.isPlainObject(q)||p.isEmptyObject(q)){if(p.isString(q)&&t.Redirects[q]){var E=m.extend({},s),F=E.duration,G=E.delay||0;return E.backwards===!0&&(o=m.extend(!0,[],o).reverse()),m.each(o,function(a,b){parseFloat(E.stagger)?E.delay=G+parseFloat(E.stagger)*a:p.isFunction(E.stagger)&&(E.delay=G+E.stagger.call(b,a,x)),E.drag&&(E.duration=parseFloat(F)||(/^(callout|transition)/.test(q)?1e3:r),E.duration=Math.max(E.duration*(E.backwards?1-a/x:(a+1)/x),.75*E.duration,200)),t.Redirects[q].call(b,b,E||{},a,x,o,B.promise?B:d)}),a()}var H="Velocity: First argument ("+q+") was not a property map, a known action, or a registered redirect. Aborting.";return B.promise?B.rejecter(new Error(H)):console.log(H),a()}C="start"}var I={lastParent:null,lastPosition:null,lastFontSize:null,lastPercentToPxWidth:null,lastPercentToPxHeight:null,lastEmToPx:null,remToPx:null,vwToPx:null,vhToPx:null},J=[];m.each(o,function(a,b){p.isNode(b)&&e.call(b)});var K,E=m.extend({},t.defaults,s);if(E.loop=parseInt(E.loop),K=2*E.loop-1,E.loop)for(var L=0;K>L;L++){var M={delay:E.delay,progress:E.progress};L===K-1&&(M.display=E.display,M.visibility=E.visibility,M.complete=E.complete),w(o,"reverse",M)}return a()}};t=m.extend(w,t),t.animate=w;var x=b.requestAnimationFrame||o;return t.State.isMobile||c.hidden===d||c.addEventListener("visibilitychange",function(){c.hidden?(x=function(a){return setTimeout(function(){a(!0)},16)},k()):x=b.requestAnimationFrame||o}),a.Velocity=t,a!==b&&(a.fn.velocity=w,a.fn.velocity.defaults=t.defaults),m.each(["Down","Up"],function(a,b){t.Redirects["slide"+b]=function(a,c,e,f,g,h){var i=m.extend({},c),j=i.begin,k=i.complete,l={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},n={};i.display===d&&(i.display="Down"===b?"inline"===t.CSS.Values.getDisplayType(a)?"inline-block":"block":"none"),i.begin=function(){j&&j.call(g,g);for(var c in l){n[c]=a.style[c];var d=t.CSS.getPropertyValue(a,c);l[c]="Down"===b?[d,0]:[0,d]}n.overflow=a.style.overflow,a.style.overflow="hidden"},i.complete=function(){for(var b in n)a.style[b]=n[b];k&&k.call(g,g),h&&h.resolver(g)},t(a,l,i)}}),m.each(["In","Out"],function(a,b){t.Redirects["fade"+b]=function(a,c,e,f,g,h){var i=m.extend({},c),j={opacity:"In"===b?1:0},k=i.complete;i.complete=e!==f-1?i.begin=null:function(){k&&k.call(g,g),h&&h.resolver(g)},i.display===d&&(i.display="In"===b?"auto":"none"),t(this,j,i)}}),t}(window.jQuery||window.Zepto||window,window,document)})),!function(a,b,c,d){"use strict";function e(a,b,c){return setTimeout(k(a,c),b)}function f(a,b,c){return!!Array.isArray(a)&&(g(a,c[b],c),!0)}function g(a,b,c){var e;if(a)if(a.forEach)a.forEach(b,c);else if(a.length!==d)for(e=0;e<a.length;)b.call(c,a[e],e,a),e++;else for(e in a)a.hasOwnProperty(e)&&b.call(c,a[e],e,a)}function h(a,b,c){for(var e=Object.keys(b),f=0;f<e.length;)(!c||c&&a[e[f]]===d)&&(a[e[f]]=b[e[f]]),f++;return a}function i(a,b){return h(a,b,!0)}function j(a,b,c){var d,e=b.prototype;d=a.prototype=Object.create(e),d.constructor=a,d._super=e,c&&h(d,c)}function k(a,b){return function(){return a.apply(b,arguments)}}function l(a,b){return typeof a==ka?a.apply(b?b[0]||d:d,b):a}function m(a,b){return a===d?b:a}function n(a,b,c){g(r(b),function(b){a.addEventListener(b,c,!1)})}function o(a,b,c){g(r(b),function(b){a.removeEventListener(b,c,!1)})}function p(a,b){for(;a;){if(a==b)return!0;a=a.parentNode}return!1}function q(a,b){return a.indexOf(b)>-1}function r(a){return a.trim().split(/\s+/g)}function s(a,b,c){if(a.indexOf&&!c)return a.indexOf(b);for(var d=0;d<a.length;){if(c&&a[d][c]==b||!c&&a[d]===b)return d;d++}return-1}function t(a){return Array.prototype.slice.call(a,0)}function u(a,b,c){for(var d=[],e=[],f=0;f<a.length;){var g=b?a[f][b]:a[f];s(e,g)<0&&d.push(a[f]),e[f]=g,f++}return c&&(d=b?d.sort(function(a,c){return a[b]>c[b]}):d.sort()),d}function v(a,b){for(var c,e,f=b[0].toUpperCase()+b.slice(1),g=0;g<ia.length;){if(c=ia[g],e=c?c+f:b,e in a)return e;g++}return d}function w(){return oa++}function x(a){var b=a.ownerDocument;return b.defaultView||b.parentWindow}function y(a,b){var c=this;this.manager=a,this.callback=b,this.element=a.element,this.target=a.options.inputTarget,this.domHandler=function(b){l(a.options.enable,[a])&&c.handler(b)},this.init()}function z(a){var b,c=a.options.inputClass;return new(b=c?c:ra?N:sa?Q:qa?S:M)(a,A)}function A(a,b,c){var d=c.pointers.length,e=c.changedPointers.length,f=b&ya&&0===d-e,g=b&(Aa|Ba)&&0===d-e;c.isFirst=!!f,c.isFinal=!!g,f&&(a.session={}),c.eventType=b,B(a,c),a.emit("hammer.input",c),a.recognize(c),a.session.prevInput=c}function B(a,b){var c=a.session,d=b.pointers,e=d.length;c.firstInput||(c.firstInput=E(b)),e>1&&!c.firstMultiple?c.firstMultiple=E(b):1===e&&(c.firstMultiple=!1);var f=c.firstInput,g=c.firstMultiple,h=g?g.center:f.center,i=b.center=F(d);b.timeStamp=na(),b.deltaTime=b.timeStamp-f.timeStamp,b.angle=J(h,i),b.distance=I(h,i),C(c,b),b.offsetDirection=H(b.deltaX,b.deltaY),b.scale=g?L(g.pointers,d):1,b.rotation=g?K(g.pointers,d):0,D(c,b);var j=a.element;p(b.srcEvent.target,j)&&(j=b.srcEvent.target),b.target=j}function C(a,b){var c=b.center,d=a.offsetDelta||{},e=a.prevDelta||{},f=a.prevInput||{};(b.eventType===ya||f.eventType===Aa)&&(e=a.prevDelta={x:f.deltaX||0,y:f.deltaY||0},d=a.offsetDelta={x:c.x,y:c.y}),b.deltaX=e.x+(c.x-d.x),b.deltaY=e.y+(c.y-d.y)}function D(a,b){var c,e,f,g,h=a.lastInterval||b,i=b.timeStamp-h.timeStamp;if(b.eventType!=Ba&&(i>xa||h.velocity===d)){var j=h.deltaX-b.deltaX,k=h.deltaY-b.deltaY,l=G(i,j,k);e=l.x,f=l.y,c=ma(l.x)>ma(l.y)?l.x:l.y,g=H(j,k),a.lastInterval=b}else c=h.velocity,e=h.velocityX,f=h.velocityY,g=h.direction;b.velocity=c,b.velocityX=e,b.velocityY=f,b.direction=g}function E(a){for(var b=[],c=0;c<a.pointers.length;)b[c]={clientX:la(a.pointers[c].clientX),clientY:la(a.pointers[c].clientY)},c++;return{timeStamp:na(),pointers:b,center:F(b),deltaX:a.deltaX,deltaY:a.deltaY}}function F(a){var b=a.length;if(1===b)return{x:la(a[0].clientX),y:la(a[0].clientY)};for(var c=0,d=0,e=0;b>e;)c+=a[e].clientX,d+=a[e].clientY,e++;return{x:la(c/b),y:la(d/b)}}function G(a,b,c){return{x:b/a||0,y:c/a||0}}function H(a,b){return a===b?Ca:ma(a)>=ma(b)?a>0?Da:Ea:b>0?Fa:Ga}function I(a,b,c){c||(c=Ka);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return Math.sqrt(d*d+e*e)}function J(a,b,c){c||(c=Ka);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return 180*Math.atan2(e,d)/Math.PI}function K(a,b){return J(b[1],b[0],La)-J(a[1],a[0],La)}function L(a,b){return I(b[0],b[1],La)/I(a[0],a[1],La)}function M(){this.evEl=Na,this.evWin=Oa,this.allow=!0,this.pressed=!1,y.apply(this,arguments)}function N(){this.evEl=Ra,this.evWin=Sa,y.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function O(){this.evTarget=Ua,this.evWin=Va,this.started=!1,y.apply(this,arguments)}function P(a,b){var c=t(a.touches),d=t(a.changedTouches);return b&(Aa|Ba)&&(c=u(c.concat(d),"identifier",!0)),[c,d]}function Q(){this.evTarget=Xa,this.targetIds={},y.apply(this,arguments)}function R(a,b){var c=t(a.touches),d=this.targetIds;if(b&(ya|za)&&1===c.length)return d[c[0].identifier]=!0,[c,c];var e,f,g=t(a.changedTouches),h=[],i=this.target;if(f=c.filter(function(a){return p(a.target,i)}),b===ya)for(e=0;e<f.length;)d[f[e].identifier]=!0,e++;for(e=0;e<g.length;)d[g[e].identifier]&&h.push(g[e]),b&(Aa|Ba)&&delete d[g[e].identifier],e++;return h.length?[u(f.concat(h),"identifier",!0),h]:void 0}function S(){y.apply(this,arguments);var a=k(this.handler,this);this.touch=new Q(this.manager,a),this.mouse=new M(this.manager,a)}function T(a,b){this.manager=a,this.set(b)}function U(a){if(q(a,bb))return bb;var b=q(a,cb),c=q(a,db);return b&&c?cb+" "+db:b||c?b?cb:db:q(a,ab)?ab:_a}function V(a){this.id=w(),this.manager=null,this.options=i(a||{},this.defaults),this.options.enable=m(this.options.enable,!0),this.state=eb,this.simultaneous={},this.requireFail=[]}function W(a){return a&jb?"cancel":a&hb?"end":a&gb?"move":a&fb?"start":""}function X(a){return a==Ga?"down":a==Fa?"up":a==Da?"left":a==Ea?"right":""}function Y(a,b){var c=b.manager;return c?c.get(a):a}function Z(){V.apply(this,arguments)}function $(){Z.apply(this,arguments),this.pX=null,this.pY=null}function _(){Z.apply(this,arguments)}function aa(){V.apply(this,arguments),this._timer=null,this._input=null}function ba(){Z.apply(this,arguments)}function ca(){Z.apply(this,arguments)}function da(){V.apply(this,arguments),this.pTime=!1,this.pCenter=!1,this._timer=null,this._input=null,this.count=0}function ea(a,b){return b=b||{},b.recognizers=m(b.recognizers,ea.defaults.preset),new fa(a,b)}function fa(a,b){b=b||{},this.options=i(b,ea.defaults),this.options.inputTarget=this.options.inputTarget||a,this.handlers={},this.session={},this.recognizers=[],this.element=a,this.input=z(this),this.touchAction=new T(this,this.options.touchAction),ga(this,!0),g(b.recognizers,function(a){var b=this.add(new a[0](a[1]));a[2]&&b.recognizeWith(a[2]),a[3]&&b.requireFailure(a[3])},this)}function ga(a,b){var c=a.element;g(a.options.cssProps,function(a,d){c.style[v(c.style,d)]=b?a:""})}function ha(a,c){var d=b.createEvent("Event");d.initEvent(a,!0,!0),d.gesture=c,c.target.dispatchEvent(d)}var ia=["","webkit","moz","MS","ms","o"],ja=b.createElement("div"),ka="function",la=Math.round,ma=Math.abs,na=Date.now,oa=1,pa=/mobile|tablet|ip(ad|hone|od)|android/i,qa="ontouchstart"in a,ra=v(a,"PointerEvent")!==d,sa=qa&&pa.test(navigator.userAgent),ta="touch",ua="pen",va="mouse",wa="kinect",xa=25,ya=1,za=2,Aa=4,Ba=8,Ca=1,Da=2,Ea=4,Fa=8,Ga=16,Ha=Da|Ea,Ia=Fa|Ga,Ja=Ha|Ia,Ka=["x","y"],La=["clientX","clientY"];y.prototype={handler:function(){},init:function(){this.evEl&&n(this.element,this.evEl,this.domHandler),this.evTarget&&n(this.target,this.evTarget,this.domHandler),this.evWin&&n(x(this.element),this.evWin,this.domHandler)},destroy:function(){this.evEl&&o(this.element,this.evEl,this.domHandler),this.evTarget&&o(this.target,this.evTarget,this.domHandler),this.evWin&&o(x(this.element),this.evWin,this.domHandler)}};var Ma={mousedown:ya,mousemove:za,mouseup:Aa},Na="mousedown",Oa="mousemove mouseup";j(M,y,{handler:function(a){var b=Ma[a.type];b&ya&&0===a.button&&(this.pressed=!0),b&za&&1!==a.which&&(b=Aa),this.pressed&&this.allow&&(b&Aa&&(this.pressed=!1),this.callback(this.manager,b,{pointers:[a],changedPointers:[a],pointerType:va,srcEvent:a}))}});var Pa={pointerdown:ya,pointermove:za,pointerup:Aa,pointercancel:Ba,pointerout:Ba},Qa={2:ta,3:ua,4:va,5:wa},Ra="pointerdown",Sa="pointermove pointerup pointercancel";a.MSPointerEvent&&(Ra="MSPointerDown",Sa="MSPointerMove MSPointerUp MSPointerCancel"),j(N,y,{handler:function(a){var b=this.store,c=!1,d=a.type.toLowerCase().replace("ms",""),e=Pa[d],f=Qa[a.pointerType]||a.pointerType,g=f==ta,h=s(b,a.pointerId,"pointerId");e&ya&&(0===a.button||g)?0>h&&(b.push(a),h=b.length-1):e&(Aa|Ba)&&(c=!0),0>h||(b[h]=a,this.callback(this.manager,e,{pointers:b,changedPointers:[a],pointerType:f,srcEvent:a}),c&&b.splice(h,1))}});var Ta={touchstart:ya,touchmove:za,touchend:Aa,touchcancel:Ba},Ua="touchstart",Va="touchstart touchmove touchend touchcancel";j(O,y,{handler:function(a){var b=Ta[a.type];if(b===ya&&(this.started=!0),this.started){var c=P.call(this,a,b);b&(Aa|Ba)&&0===c[0].length-c[1].length&&(this.started=!1),this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:ta,srcEvent:a})}}});var Wa={touchstart:ya,touchmove:za,touchend:Aa,touchcancel:Ba},Xa="touchstart touchmove touchend touchcancel";j(Q,y,{handler:function(a){var b=Wa[a.type],c=R.call(this,a,b);c&&this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:ta,srcEvent:a})}}),j(S,y,{handler:function(a,b,c){var d=c.pointerType==ta,e=c.pointerType==va;if(d)this.mouse.allow=!1;else if(e&&!this.mouse.allow)return;b&(Aa|Ba)&&(this.mouse.allow=!0),this.callback(a,b,c)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Ya=v(ja.style,"touchAction"),Za=Ya!==d,$a="compute",_a="auto",ab="manipulation",bb="none",cb="pan-x",db="pan-y";T.prototype={set:function(a){a==$a&&(a=this.compute()),Za&&(this.manager.element.style[Ya]=a),this.actions=a.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var a=[];return g(this.manager.recognizers,function(b){l(b.options.enable,[b])&&(a=a.concat(b.getTouchAction()))}),U(a.join(" "))},preventDefaults:function(a){if(!Za){var b=a.srcEvent,c=a.offsetDirection;if(this.manager.session.prevented)return void b.preventDefault();var d=this.actions,e=q(d,bb),f=q(d,db),g=q(d,cb);return e||f&&c&Ha||g&&c&Ia?this.preventSrc(b):void 0}},preventSrc:function(a){this.manager.session.prevented=!0,a.preventDefault()}};var eb=1,fb=2,gb=4,hb=8,ib=hb,jb=16,kb=32;V.prototype={defaults:{},set:function(a){return h(this.options,a),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(a){if(f(a,"recognizeWith",this))return this;var b=this.simultaneous;return a=Y(a,this),b[a.id]||(b[a.id]=a,a.recognizeWith(this)),this},dropRecognizeWith:function(a){return f(a,"dropRecognizeWith",this)?this:(a=Y(a,this),delete this.simultaneous[a.id],this)},requireFailure:function(a){if(f(a,"requireFailure",this))return this;var b=this.requireFail;return a=Y(a,this),-1===s(b,a)&&(b.push(a),a.requireFailure(this)),this},dropRequireFailure:function(a){if(f(a,"dropRequireFailure",this))return this;a=Y(a,this);var b=s(this.requireFail,a);return b>-1&&this.requireFail.splice(b,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(a){return!!this.simultaneous[a.id]},emit:function(a){function b(b){c.manager.emit(c.options.event+(b?W(d):""),a)}var c=this,d=this.state;hb>d&&b(!0),b(),d>=hb&&b(!0)},tryEmit:function(a){return this.canEmit()?this.emit(a):void(this.state=kb)},canEmit:function(){for(var a=0;a<this.requireFail.length;){if(!(this.requireFail[a].state&(kb|eb)))return!1;a++}return!0},recognize:function(a){var b=h({},a);return l(this.options.enable,[this,b])?(this.state&(ib|jb|kb)&&(this.state=eb),this.state=this.process(b),void(this.state&(fb|gb|hb|jb)&&this.tryEmit(b))):(this.reset(),void(this.state=kb))},process:function(){},getTouchAction:function(){},reset:function(){}},j(Z,V,{defaults:{pointers:1},attrTest:function(a){var b=this.options.pointers;return 0===b||a.pointers.length===b},process:function(a){var b=this.state,c=a.eventType,d=b&(fb|gb),e=this.attrTest(a);return d&&(c&Ba||!e)?b|jb:d||e?c&Aa?b|hb:b&fb?b|gb:fb:kb}}),j($,Z,{defaults:{event:"pan",threshold:10,pointers:1,direction:Ja},getTouchAction:function(){var a=this.options.direction,b=[];return a&Ha&&b.push(db),a&Ia&&b.push(cb),b},directionTest:function(a){var b=this.options,c=!0,d=a.distance,e=a.direction,f=a.deltaX,g=a.deltaY;return e&b.direction||(b.direction&Ha?(e=0===f?Ca:0>f?Da:Ea,c=f!=this.pX,d=Math.abs(a.deltaX)):(e=0===g?Ca:0>g?Fa:Ga,c=g!=this.pY,d=Math.abs(a.deltaY))),a.direction=e,c&&d>b.threshold&&e&b.direction},attrTest:function(a){return Z.prototype.attrTest.call(this,a)&&(this.state&fb||!(this.state&fb)&&this.directionTest(a))},emit:function(a){this.pX=a.deltaX,this.pY=a.deltaY;var b=X(a.direction);b&&this.manager.emit(this.options.event+b,a),this._super.emit.call(this,a)}}),j(_,Z,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[bb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.scale-1)>this.options.threshold||this.state&fb)},emit:function(a){if(this._super.emit.call(this,a),1!==a.scale){var b=a.scale<1?"in":"out";this.manager.emit(this.options.event+b,a)}}}),j(aa,V,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[_a]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,f=a.deltaTime>b.time;if(this._input=a,!d||!c||a.eventType&(Aa|Ba)&&!f)this.reset();else if(a.eventType&ya)this.reset(),this._timer=e(function(){this.state=ib,this.tryEmit()},b.time,this);else if(a.eventType&Aa)return ib;return kb},reset:function(){clearTimeout(this._timer)},emit:function(a){this.state===ib&&(a&&a.eventType&Aa?this.manager.emit(this.options.event+"up",a):(this._input.timeStamp=na(),this.manager.emit(this.options.event,this._input)))}}),j(ba,Z,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[bb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.rotation)>this.options.threshold||this.state&fb)}}),j(ca,Z,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:Ha|Ia,pointers:1},getTouchAction:function(){return $.prototype.getTouchAction.call(this)},attrTest:function(a){var b,c=this.options.direction;return c&(Ha|Ia)?b=a.velocity:c&Ha?b=a.velocityX:c&Ia&&(b=a.velocityY),this._super.attrTest.call(this,a)&&c&a.direction&&a.distance>this.options.threshold&&ma(b)>this.options.velocity&&a.eventType&Aa},emit:function(a){var b=X(a.direction);b&&this.manager.emit(this.options.event+b,a),this.manager.emit(this.options.event,a)}}),j(da,V,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[ab]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,f=a.deltaTime<b.time;if(this.reset(),a.eventType&ya&&0===this.count)return this.failTimeout();if(d&&f&&c){if(a.eventType!=Aa)return this.failTimeout();var g=!this.pTime||a.timeStamp-this.pTime<b.interval,h=!this.pCenter||I(this.pCenter,a.center)<b.posThreshold;this.pTime=a.timeStamp,this.pCenter=a.center,h&&g?this.count+=1:this.count=1,this._input=a;var i=this.count%b.taps;if(0===i)return this.hasRequireFailures()?(this._timer=e(function(){this.state=ib,this.tryEmit()},b.interval,this),fb):ib}return kb},failTimeout:function(){return this._timer=e(function(){this.state=kb},this.options.interval,this),kb},reset:function(){clearTimeout(this._timer)},emit:function(){this.state==ib&&(this._input.tapCount=this.count,this.manager.emit(this.options.event,this._input))}}),ea.VERSION="2.0.4",ea.defaults={domEvents:!1,touchAction:$a,enable:!0,inputTarget:null,inputClass:null,preset:[[ba,{enable:!1}],[_,{enable:!1},["rotate"]],[ca,{direction:Ha}],[$,{direction:Ha},["swipe"]],[da],[da,{event:"doubletap",taps:2},["tap"]],[aa]],cssProps:{userSelect:"default",touchSelect:"none",touchCallout:"none",contentZooming:"none",userDrag:"none",tapHighlightColor:"rgba(0,0,0,0)"}};var lb=1,mb=2;fa.prototype={set:function(a){return h(this.options,a),a.touchAction&&this.touchAction.update(),a.inputTarget&&(this.input.destroy(),this.input.target=a.inputTarget,this.input.init()),this},stop:function(a){this.session.stopped=a?mb:lb},recognize:function(a){var b=this.session;if(!b.stopped){this.touchAction.preventDefaults(a);var c,d=this.recognizers,e=b.curRecognizer;(!e||e&&e.state&ib)&&(e=b.curRecognizer=null);for(var f=0;f<d.length;)c=d[f],b.stopped===mb||e&&c!=e&&!c.canRecognizeWith(e)?c.reset():c.recognize(a),!e&&c.state&(fb|gb|hb)&&(e=b.curRecognizer=c),f++}},get:function(a){if(a instanceof V)return a;for(var b=this.recognizers,c=0;c<b.length;c++)if(b[c].options.event==a)return b[c];return null},add:function(a){if(f(a,"add",this))return this;var b=this.get(a.options.event);return b&&this.remove(b),this.recognizers.push(a),a.manager=this,this.touchAction.update(),a},remove:function(a){if(f(a,"remove",this))return this;var b=this.recognizers;return a=this.get(a),b.splice(s(b,a),1),this.touchAction.update(),this},on:function(a,b){var c=this.handlers;return g(r(a),function(a){c[a]=c[a]||[],c[a].push(b)}),this},off:function(a,b){var c=this.handlers;return g(r(a),function(a){b?c[a].splice(s(c[a],b),1):delete c[a]}),this},emit:function(a,b){this.options.domEvents&&ha(a,b);var c=this.handlers[a]&&this.handlers[a].slice();if(c&&c.length){b.type=a,b.preventDefault=function(){b.srcEvent.preventDefault()};for(var d=0;d<c.length;)c[d](b),d++}},destroy:function(){this.element&&ga(this,!1),this.handlers={},this.session={},this.input.destroy(),this.element=null}},h(ea,{INPUT_START:ya,INPUT_MOVE:za,INPUT_END:Aa,INPUT_CANCEL:Ba,STATE_POSSIBLE:eb,STATE_BEGAN:fb,STATE_CHANGED:gb,STATE_ENDED:hb,STATE_RECOGNIZED:ib,STATE_CANCELLED:jb,STATE_FAILED:kb,DIRECTION_NONE:Ca,DIRECTION_LEFT:Da,DIRECTION_RIGHT:Ea,DIRECTION_UP:Fa,DIRECTION_DOWN:Ga,DIRECTION_HORIZONTAL:Ha,DIRECTION_VERTICAL:Ia,DIRECTION_ALL:Ja,Manager:fa,Input:y,TouchAction:T,TouchInput:Q,MouseInput:M,PointerEventInput:N,TouchMouseInput:S,SingleTouchInput:O,Recognizer:V,AttrRecognizer:Z,Tap:da,Pan:$,Swipe:ca,Pinch:_,Rotate:ba,Press:aa,on:n,off:o,each:g,merge:i,extend:h,inherit:j,bindFn:k,prefixed:v}),typeof define==ka&&define.amd?define(function(){return ea}):"undefined"!=typeof module&&module.exports?module.exports=ea:a[c]=ea}(window,document,"Hammer"),function(a){"function"==typeof define&&define.amd?define(["jquery","hammerjs"],a):"object"==typeof exports?a(require("jquery"),require("hammerjs")):a(jQuery,Hammer)}(function(a,b){function c(c,d){var e=a(c);e.data("hammer")||e.data("hammer",new b(e[0],d))}a.fn.hammer=function(a){return this.each(function(){c(this,a)})},b.Manager.prototype.emit=function(b){return function(c,d){b.call(this,c,d),a(this.element).trigger({type:c,gesture:d})}}(b.Manager.prototype.emit)}),function(a){a.Package?Materialize={}:a.Materialize={}}(window),function(a){for(var b=0,c=["webkit","moz"],d=a.requestAnimationFrame,e=a.cancelAnimationFrame,f=c.length;--f>=0&&!d;)d=a[c[f]+"RequestAnimationFrame"],e=a[c[f]+"CancelRequestAnimationFrame"];d&&e||(d=function(a){var c=+Date.now(),d=Math.max(b+16,c);return setTimeout(function(){a(b=d)},d-c)},e=clearTimeout),a.requestAnimationFrame=d,a.cancelAnimationFrame=e}(window),Materialize.guid=function(){function a(){return Math.floor(65536*(1+Math.random())).toString(16).substring(1)}return function(){return a()+a()+"-"+a()+"-"+a()+"-"+a()+"-"+a()+a()+a()}}(),Materialize.escapeHash=function(a){return a.replace(/(:|\.|\[|\]|,|=)/g,"\\$1")},Materialize.elementOrParentIsFixed=function(a){var b=$(a),c=b.add(b.parents()),d=!1;return c.each(function(){if("fixed"===$(this).css("position"))return d=!0,!1}),d};var getTime=Date.now||function(){return(new Date).getTime()};Materialize.throttle=function(a,b,c){var d,e,f,g=null,h=0;c||(c={});var i=function(){h=c.leading===!1?0:getTime(),g=null,f=a.apply(d,e),d=e=null};return function(){var j=getTime();h||c.leading!==!1||(h=j);var k=b-(j-h);return d=this,e=arguments,k<=0?(clearTimeout(g),g=null,h=j,f=a.apply(d,e),d=e=null):g||c.trailing===!1||(g=setTimeout(i,k)),f}};var Vel;Vel=jQuery?jQuery.Velocity:$?$.Velocity:Velocity,function(a){a.fn.collapsible=function(b){var c={accordion:void 0,onOpen:void 0,onClose:void 0};return b=a.extend(c,b),this.each(function(){function c(b){j=i.find("> li > .collapsible-header"),b.hasClass("active")?b.parent().addClass("active"):b.parent().removeClass("active"),b.parent().hasClass("active")?b.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}}):b.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}}),j.not(b).removeClass("active").parent().removeClass("active"),j.not(b).parent().children(".collapsible-body").stop(!0,!1).each(function(){a(this).is(":visible")&&a(this).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height",""),f(a(this).siblings(".collapsible-header"))}})})}function d(b){b.hasClass("active")?b.parent().addClass("active"):b.parent().removeClass("active"),b.parent().hasClass("active")?b.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}}):b.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}})}function e(a){b.accordion||"accordion"===k||void 0===k?c(a):d(a),f(a)}function f(a){a.hasClass("active")?"function"==typeof b.onOpen&&b.onOpen.call(this,a.parent()):"function"==typeof b.onClose&&b.onClose.call(this,a.parent())}function g(a){var b=h(a);return b.length>0}function h(a){return a.closest("li > .collapsible-header")}var i=a(this),j=a(this).find("> li > .collapsible-header"),k=i.data("collapsible");i.off("click.collapse","> li > .collapsible-header"),j.off("click.collapse"),i.on("click.collapse","> li > .collapsible-header",function(b){var c=a(b.target);g(c)&&(c=h(c)),c.toggleClass("active"),e(c)}),b.accordion||"accordion"===k||void 0===k?e(j.filter(".active").first()):j.filter(".active").each(function(){e(a(this))})})},a(document).ready(function(){a(".collapsible").collapsible()})}(jQuery),function(a){a.fn.scrollTo=function(b){return a(this).scrollTop(a(this).scrollTop()-a(this).offset().top+a(b).offset().top),this},a.fn.dropdown=function(b){var c={inDuration:300,outDuration:225,constrainWidth:!0,hover:!1,gutter:0,belowOrigin:!1,alignment:"left",stopPropagation:!1};return"open"===b?(this.each(function(){a(this).trigger("open")}),!1):"close"===b?(this.each(function(){a(this).trigger("close")}),!1):void this.each(function(){function d(){void 0!==g.data("induration")&&(h.inDuration=g.data("induration")),void 0!==g.data("outduration")&&(h.outDuration=g.data("outduration")),void 0!==g.data("constrainwidth")&&(h.constrainWidth=g.data("constrainwidth")),void 0!==g.data("hover")&&(h.hover=g.data("hover")),void 0!==g.data("gutter")&&(h.gutter=g.data("gutter")),void 0!==g.data("beloworigin")&&(h.belowOrigin=g.data("beloworigin")),void 0!==g.data("alignment")&&(h.alignment=g.data("alignment")),void 0!==g.data("stoppropagation")&&(h.stopPropagation=g.data("stoppropagation"))}function e(b){"focus"===b&&(i=!0),d(),j.addClass("active"),g.addClass("active"),h.constrainWidth===!0?j.css("width",g.outerWidth()):j.css("white-space","nowrap");var c=window.innerHeight,e=g.innerHeight(),k=g.offset().left,l=g.offset().top-a(window).scrollTop(),m=h.alignment,n=0,o=0,p=0;h.belowOrigin===!0&&(p=e);var q=0,r=0,s=g.parent();if(s.is("body")||(s[0].scrollHeight>s[0].clientHeight&&(q=s[0].scrollTop),s[0].scrollWidth>s[0].clientWidth&&(r=s[0].scrollLeft)),k+j.innerWidth()>a(window).width()?m="right":k-j.innerWidth()+g.innerWidth()<0&&(m="left"),l+j.innerHeight()>c)if(l+e-j.innerHeight()<0){var t=c-l-p;j.css("max-height",t)}else p||(p+=e),p-=j.innerHeight();if("left"===m)n=h.gutter,o=g.position().left+n;else if("right"===m){var u=g.position().left+g.outerWidth()-j.outerWidth();n=-h.gutter,o=u+n}j.css({position:"absolute",top:g.position().top+p+q,left:o+r}),j.stop(!0,!0).css("opacity",0).slideDown({queue:!1,duration:h.inDuration,easing:"easeOutCubic",complete:function(){a(this).css("height","")}}).animate({opacity:1},{queue:!1,duration:h.inDuration,easing:"easeOutSine"}),a(document).bind("click."+j.attr("id")+" touchstart."+j.attr("id"),function(b){j.is(b.target)||g.is(b.target)||g.find(b.target).length||(f(),a(document).unbind("click."+j.attr("id")+" touchstart."+j.attr("id")))})}function f(){i=!1,j.fadeOut(h.outDuration),j.removeClass("active"),g.removeClass("active"),a(document).unbind("click."+j.attr("id")+" touchstart."+j.attr("id")),setTimeout(function(){j.css("max-height","")},h.outDuration)}var g=a(this),h=a.extend({},c,b),i=!1,j=a("#"+g.attr("data-activates"));if(d(),g.after(j),h.hover){var k=!1;g.unbind("click."+g.attr("id")),g.on("mouseenter",function(a){k===!1&&(e(),k=!0)}),g.on("mouseleave",function(b){var c=b.toElement||b.relatedTarget;a(c).closest(".dropdown-content").is(j)||(j.stop(!0,!0),f(),k=!1)}),j.on("mouseleave",function(b){var c=b.toElement||b.relatedTarget;a(c).closest(".dropdown-button").is(g)||(j.stop(!0,!0),f(),k=!1)})}else g.unbind("click."+g.attr("id")),g.bind("click."+g.attr("id"),function(b){i||(g[0]!=b.currentTarget||g.hasClass("active")||0!==a(b.target).closest(".dropdown-content").length?g.hasClass("active")&&(f(),a(document).unbind("click."+j.attr("id")+" touchstart."+j.attr("id"))):(b.preventDefault(),h.stopPropagation&&b.stopPropagation(),e("click")))});g.on("open",function(a,b){e(b)}),g.on("close",f)})},a(document).ready(function(){a(".dropdown-button").dropdown()})}(jQuery),function(a){var b=0,c=0,d=function(){return c++,"materialize-modal-overlay-"+c},e={init:function(c){var e={opacity:.5,inDuration:350,outDuration:250,ready:void 0, +complete:void 0,dismissible:!0,startingTop:"4%",endingTop:"10%"};return c=a.extend(e,c),this.each(function(){var e=a(this),f=a(this).attr("id")||"#"+a(this).data("target"),g=function(){var d=e.data("overlay-id"),f=a("#"+d);e.removeClass("open"),a("body").css({overflow:"",width:""}),e.find(".modal-close").off("click.close"),a(document).off("keyup.modal"+d),f.velocity({opacity:0},{duration:c.outDuration,queue:!1,ease:"easeOutQuart"});var g={duration:c.outDuration,queue:!1,ease:"easeOutCubic",complete:function(){a(this).css({display:"none"}),"function"==typeof c.complete&&c.complete.call(this,e),f.remove(),b--}};e.hasClass("bottom-sheet")?e.velocity({bottom:"-100%",opacity:0},g):e.velocity({top:c.startingTop,opacity:0,scaleX:.7},g)},h=function(f){var h=a("body"),i=h.innerWidth();if(h.css("overflow","hidden"),h.width(i),!e.hasClass("open")){var j=d(),k=a('<div class="modal-overlay"></div>');lStack=++b,k.attr("id",j).css("z-index",1e3+2*lStack),e.data("overlay-id",j).css("z-index",1e3+2*lStack+1),e.addClass("open"),a("body").append(k),c.dismissible&&(k.click(function(){g()}),a(document).on("keyup.modal"+j,function(a){27===a.keyCode&&g()})),e.find(".modal-close").on("click.close",function(a){g()}),k.css({display:"block",opacity:0}),e.css({display:"block",opacity:0}),k.velocity({opacity:c.opacity},{duration:c.inDuration,queue:!1,ease:"easeOutCubic"}),e.data("associated-overlay",k[0]);var l={duration:c.inDuration,queue:!1,ease:"easeOutCubic",complete:function(){"function"==typeof c.ready&&c.ready.call(this,e,f)}};e.hasClass("bottom-sheet")?e.velocity({bottom:"0",opacity:1},l):(a.Velocity.hook(e,"scaleX",.7),e.css({top:c.startingTop}),e.velocity({top:c.endingTop,opacity:1,scaleX:"1"},l))}};a(document).off("click.modalTrigger",'a[href="#'+f+'"], [data-target="'+f+'"]'),a(this).off("openModal"),a(this).off("closeModal"),a(document).on("click.modalTrigger",'a[href="#'+f+'"], [data-target="'+f+'"]',function(b){c.startingTop=(a(this).offset().top-a(window).scrollTop())/1.15,h(a(this)),b.preventDefault()}),a(this).on("openModal",function(){a(this).attr("href")||"#"+a(this).data("target");h()}),a(this).on("closeModal",function(){g()})})},open:function(){a(this).trigger("openModal")},close:function(){a(this).trigger("closeModal")}};a.fn.modal=function(b){return e[b]?e[b].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof b&&b?void a.error("Method "+b+" does not exist on jQuery.modal"):e.init.apply(this,arguments)}}(jQuery),function(a){a.fn.materialbox=function(){return this.each(function(){function b(){f=!1;var b=i.parent(".material-placeholder"),d=(window.innerWidth,window.innerHeight,i.data("width")),g=i.data("height");i.velocity("stop",!0),a("#materialbox-overlay").velocity("stop",!0),a(".materialbox-caption").velocity("stop",!0),a("#materialbox-overlay").velocity({opacity:0},{duration:h,queue:!1,easing:"easeOutQuad",complete:function(){e=!1,a(this).remove()}}),i.velocity({width:d,height:g,left:0,top:0},{duration:h,queue:!1,easing:"easeOutQuad"}),a(".materialbox-caption").velocity({opacity:0},{duration:h,queue:!1,easing:"easeOutQuad",complete:function(){b.css({height:"",width:"",position:"",top:"",left:""}),i.css({height:"",top:"",left:"",width:"","max-width":"",position:"","z-index":"","will-change":""}),i.removeClass("active"),f=!0,a(this).remove(),c&&c.css("overflow","")}})}if(!a(this).hasClass("initialized")){a(this).addClass("initialized");var c,d,e=!1,f=!0,g=275,h=200,i=a(this),j=a("<div></div>").addClass("material-placeholder");i.wrap(j),i.on("click",function(){var h=i.parent(".material-placeholder"),j=window.innerWidth,k=window.innerHeight,l=i.width(),m=i.height();if(f===!1)return b(),!1;if(e&&f===!0)return b(),!1;f=!1,i.addClass("active"),e=!0,h.css({width:h[0].getBoundingClientRect().width,height:h[0].getBoundingClientRect().height,position:"relative",top:0,left:0}),c=void 0,d=h[0].parentNode;for(;null!==d&&!a(d).is(document);){var n=a(d);"visible"!==n.css("overflow")&&(n.css("overflow","visible"),c=void 0===c?n:c.add(n)),d=d.parentNode}i.css({position:"absolute","z-index":1e3,"will-change":"left, top, width, height"}).data("width",l).data("height",m);var o=a('<div id="materialbox-overlay"></div>').css({opacity:0}).click(function(){f===!0&&b()});i.before(o);var p=o[0].getBoundingClientRect();if(o.css({width:j,height:k,left:-1*p.left,top:-1*p.top}),o.velocity({opacity:1},{duration:g,queue:!1,easing:"easeOutQuad"}),""!==i.data("caption")){var q=a('<div class="materialbox-caption"></div>');q.text(i.data("caption")),a("body").append(q),q.css({display:"inline"}),q.velocity({opacity:1},{duration:g,queue:!1,easing:"easeOutQuad"})}var r=0,s=l/j,t=m/k,u=0,v=0;s>t?(r=m/l,u=.9*j,v=.9*j*r):(r=l/m,u=.9*k*r,v=.9*k),i.hasClass("responsive-img")?i.velocity({"max-width":u,width:l},{duration:0,queue:!1,complete:function(){i.css({left:0,top:0}).velocity({height:v,width:u,left:a(document).scrollLeft()+j/2-i.parent(".material-placeholder").offset().left-u/2,top:a(document).scrollTop()+k/2-i.parent(".material-placeholder").offset().top-v/2},{duration:g,queue:!1,easing:"easeOutQuad",complete:function(){f=!0}})}}):i.css("left",0).css("top",0).velocity({height:v,width:u,left:a(document).scrollLeft()+j/2-i.parent(".material-placeholder").offset().left-u/2,top:a(document).scrollTop()+k/2-i.parent(".material-placeholder").offset().top-v/2},{duration:g,queue:!1,easing:"easeOutQuad",complete:function(){f=!0}})}),a(window).scroll(function(){e&&b()}),a(document).keyup(function(a){27===a.keyCode&&f===!0&&e&&b()})}})},a(document).ready(function(){a(".materialboxed").materialbox()})}(jQuery),function(a){a.fn.parallax=function(){var b=a(window).width();return this.each(function(c){function d(c){var d;d=b<601?e.height()>0?e.height():e.children("img").height():e.height()>0?e.height():500;var f=e.children("img").first(),g=f.height(),h=g-d,i=e.offset().top+d,j=e.offset().top,k=a(window).scrollTop(),l=window.innerHeight,m=k+l,n=(m-j)/(d+l),o=Math.round(h*n);c&&f.css("display","block"),i>k&&j<k+l&&f.css("transform","translate3D(-50%,"+o+"px, 0)")}var e=a(this);e.addClass("parallax"),e.children("img").one("load",function(){d(!0)}).each(function(){this.complete&&a(this).trigger("load")}),a(window).scroll(function(){b=a(window).width(),d(!1)}),a(window).resize(function(){b=a(window).width(),d(!1)})})}}(jQuery),function(a){var b={init:function(b){var c={onShow:null,swipeable:!1,responsiveThreshold:1/0};return b=a.extend(c,b),this.each(function(){var c,d,e,f,g,h=a(this),i=a(window).width(),j=h.find("li.tab a"),k=h.width(),l=a(),m=Math.max(k,h[0].scrollWidth)/j.length,n=prev_index=0,o=!1,p=300,q=function(a){return k-a.position().left-a.outerWidth()-h.scrollLeft()},r=function(a){return a.position().left+h.scrollLeft()},s=function(a){n-a>=0?(f.velocity({right:q(c)},{duration:p,queue:!1,easing:"easeOutQuad"}),f.velocity({left:r(c)},{duration:p,queue:!1,easing:"easeOutQuad",delay:90})):(f.velocity({left:r(c)},{duration:p,queue:!1,easing:"easeOutQuad"}),f.velocity({right:q(c)},{duration:p,queue:!1,easing:"easeOutQuad",delay:90}))};b.swipeable&&i>b.responsiveThreshold&&(b.swipeable=!1),c=a(j.filter('[href="'+location.hash+'"]')),0===c.length&&(c=a(this).find("li.tab a.active").first()),0===c.length&&(c=a(this).find("li.tab a").first()),c.addClass("active"),n=j.index(c),n<0&&(n=0),void 0!==c[0]&&(d=a(c[0].hash),d.addClass("active")),h.find(".indicator").length||h.append('<div class="indicator"></div>'),f=h.find(".indicator"),h.append(f),h.is(":visible")&&setTimeout(function(){f.css({right:q(c)}),f.css({left:r(c)})},0),a(window).resize(function(){k=h.width(),m=Math.max(k,h[0].scrollWidth)/j.length,n<0&&(n=0),0!==m&&0!==k&&(f.css({right:q(c)}),f.css({left:r(c)}))}),b.swipeable?(j.each(function(){var b=a(Materialize.escapeHash(this.hash));b.addClass("carousel-item"),l=l.add(b)}),e=l.wrapAll('<div class="tabs-content carousel"></div>'),l.css("display",""),a(".tabs-content.carousel").carousel({fullWidth:!0,noWrap:!0,onCycleTo:function(a){if(!o){var b=n;n=e.index(a),c=j.eq(n),s(b)}}})):j.not(c).each(function(){a(Materialize.escapeHash(this.hash)).hide()}),h.on("click","a",function(e){if(a(this).parent().hasClass("disabled"))return void e.preventDefault();if(!a(this).attr("target")){o=!0,k=h.width(),m=Math.max(k,h[0].scrollWidth)/j.length,c.removeClass("active");var f=d;c=a(this),d=a(Materialize.escapeHash(this.hash)),j=h.find("li.tab a");c.position();c.addClass("active"),prev_index=n,n=j.index(a(this)),n<0&&(n=0),b.swipeable?l.length&&l.carousel("set",n):(void 0!==d&&(d.show(),d.addClass("active"),"function"==typeof b.onShow&&b.onShow.call(this,d)),void 0===f||f.is(d)||(f.hide(),f.removeClass("active"))),g=setTimeout(function(){o=!1},p),s(prev_index),e.preventDefault()}})})},select_tab:function(a){this.find('a[href="#'+a+'"]').trigger("click")}};a.fn.tabs=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.tabs"):b.init.apply(this,arguments)},a(document).ready(function(){a("ul.tabs").tabs()})}(jQuery),function(a){a.fn.tooltip=function(c){var d=5,e={delay:350,tooltip:"",position:"bottom",html:!1};return"remove"===c?(this.each(function(){a("#"+a(this).attr("data-tooltip-id")).remove(),a(this).off("mouseenter.tooltip mouseleave.tooltip")}),!1):(c=a.extend(e,c),this.each(function(){var e=Materialize.guid(),f=a(this);f.attr("data-tooltip-id")&&a("#"+f.attr("data-tooltip-id")).remove(),f.attr("data-tooltip-id",e);var g,h,i,j,k,l,m=function(){g=f.attr("data-html")?"true"===f.attr("data-html"):c.html,h=f.attr("data-delay"),h=void 0===h||""===h?c.delay:h,i=f.attr("data-position"),i=void 0===i||""===i?c.position:i,j=f.attr("data-tooltip"),j=void 0===j||""===j?c.tooltip:j};m();var n=function(){var b=a('<div class="material-tooltip"></div>');return j=g?a("<span></span>").html(j):a("<span></span>").text(j),b.append(j).appendTo(a("body")).attr("id",e),l=a('<div class="backdrop"></div>'),l.appendTo(b),b};k=n(),f.off("mouseenter.tooltip mouseleave.tooltip");var o,p=!1;f.on({"mouseenter.tooltip":function(a){var c=function(){m(),p=!0,k.velocity("stop"),l.velocity("stop"),k.css({visibility:"visible",left:"0px",top:"0px"});var a,c,e,g=f.outerWidth(),h=f.outerHeight(),j=k.outerHeight(),n=k.outerWidth(),o="0px",q="0px",r=l[0].offsetWidth,s=l[0].offsetHeight,t=8,u=8,v=0;"top"===i?(a=f.offset().top-j-d,c=f.offset().left+g/2-n/2,e=b(c,a,n,j),o="-10px",l.css({bottom:0,left:0,borderRadius:"14px 14px 0 0",transformOrigin:"50% 100%",marginTop:j,marginLeft:n/2-r/2})):"left"===i?(a=f.offset().top+h/2-j/2,c=f.offset().left-n-d,e=b(c,a,n,j),q="-10px",l.css({top:"-7px",right:0,width:"14px",height:"14px",borderRadius:"14px 0 0 14px",transformOrigin:"95% 50%",marginTop:j/2,marginLeft:n})):"right"===i?(a=f.offset().top+h/2-j/2,c=f.offset().left+g+d,e=b(c,a,n,j),q="+10px",l.css({top:"-7px",left:0,width:"14px",height:"14px",borderRadius:"0 14px 14px 0",transformOrigin:"5% 50%",marginTop:j/2,marginLeft:"0px"})):(a=f.offset().top+f.outerHeight()+d,c=f.offset().left+g/2-n/2,e=b(c,a,n,j),o="+10px",l.css({top:0,left:0,marginLeft:n/2-r/2})),k.css({top:e.y,left:e.x}),t=Math.SQRT2*n/parseInt(r),u=Math.SQRT2*j/parseInt(s),v=Math.max(t,u),k.velocity({translateY:o,translateX:q},{duration:350,queue:!1}).velocity({opacity:1},{duration:300,delay:50,queue:!1}),l.css({visibility:"visible"}).velocity({opacity:1},{duration:55,delay:0,queue:!1}).velocity({scaleX:v,scaleY:v},{duration:300,delay:0,queue:!1,easing:"easeInOutQuad"})};o=setTimeout(c,h)},"mouseleave.tooltip":function(){p=!1,clearTimeout(o),setTimeout(function(){p!==!0&&(k.velocity({opacity:0,translateY:0,translateX:0},{duration:225,queue:!1}),l.velocity({opacity:0,scaleX:1,scaleY:1},{duration:225,queue:!1,complete:function(){l.css({visibility:"hidden"}),k.css({visibility:"hidden"}),p=!1}}))},225)}})}))};var b=function(b,c,d,e){var f=b,g=c;return f<0?f=4:f+d>window.innerWidth&&(f-=f+d-window.innerWidth),g<0?g=4:g+e>window.innerHeight+a(window).scrollTop&&(g-=g+e-window.innerHeight),{x:f,y:g}};a(document).ready(function(){a(".tooltipped").tooltip()})}(jQuery),function(a){"use strict";function b(a){return null!==a&&a===a.window}function c(a){return b(a)?a:9===a.nodeType&&a.defaultView}function d(a){var b,d,e={top:0,left:0},f=a&&a.ownerDocument;return b=f.documentElement,"undefined"!=typeof a.getBoundingClientRect&&(e=a.getBoundingClientRect()),d=c(f),{top:e.top+d.pageYOffset-b.clientTop,left:e.left+d.pageXOffset-b.clientLeft}}function e(a){var b="";for(var c in a)a.hasOwnProperty(c)&&(b+=c+":"+a[c]+";");return b}function f(a){if(k.allowEvent(a)===!1)return null;for(var b=null,c=a.target||a.srcElement;null!==c.parentElement;){if(!(c instanceof SVGElement||c.className.indexOf("waves-effect")===-1)){b=c;break}if(c.classList.contains("waves-effect")){b=c;break}c=c.parentElement}return b}function g(b){var c=f(b);null!==c&&(j.show(b,c),"ontouchstart"in a&&(c.addEventListener("touchend",j.hide,!1),c.addEventListener("touchcancel",j.hide,!1)),c.addEventListener("mouseup",j.hide,!1),c.addEventListener("mouseleave",j.hide,!1))}var h=h||{},i=document.querySelectorAll.bind(document),j={duration:750,show:function(a,b){if(2===a.button)return!1;var c=b||this,f=document.createElement("div");f.className="waves-ripple",c.appendChild(f);var g=d(c),h=a.pageY-g.top,i=a.pageX-g.left,k="scale("+c.clientWidth/100*10+")";"touches"in a&&(h=a.touches[0].pageY-g.top,i=a.touches[0].pageX-g.left),f.setAttribute("data-hold",Date.now()),f.setAttribute("data-scale",k),f.setAttribute("data-x",i),f.setAttribute("data-y",h);var l={top:h+"px",left:i+"px"};f.className=f.className+" waves-notransition",f.setAttribute("style",e(l)),f.className=f.className.replace("waves-notransition",""),l["-webkit-transform"]=k,l["-moz-transform"]=k,l["-ms-transform"]=k,l["-o-transform"]=k,l.transform=k,l.opacity="1",l["-webkit-transition-duration"]=j.duration+"ms",l["-moz-transition-duration"]=j.duration+"ms",l["-o-transition-duration"]=j.duration+"ms",l["transition-duration"]=j.duration+"ms",l["-webkit-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",l["-moz-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",l["-o-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",l["transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",f.setAttribute("style",e(l))},hide:function(a){k.touchup(a);var b=this,c=(1.4*b.clientWidth,null),d=b.getElementsByClassName("waves-ripple");if(!(d.length>0))return!1;c=d[d.length-1];var f=c.getAttribute("data-x"),g=c.getAttribute("data-y"),h=c.getAttribute("data-scale"),i=Date.now()-Number(c.getAttribute("data-hold")),l=350-i;l<0&&(l=0),setTimeout(function(){var a={top:g+"px",left:f+"px",opacity:"0","-webkit-transition-duration":j.duration+"ms","-moz-transition-duration":j.duration+"ms","-o-transition-duration":j.duration+"ms","transition-duration":j.duration+"ms","-webkit-transform":h,"-moz-transform":h,"-ms-transform":h,"-o-transform":h,transform:h};c.setAttribute("style",e(a)),setTimeout(function(){try{b.removeChild(c)}catch(a){return!1}},j.duration)},l)},wrapInput:function(a){for(var b=0;b<a.length;b++){var c=a[b];if("input"===c.tagName.toLowerCase()){var d=c.parentNode;if("i"===d.tagName.toLowerCase()&&d.className.indexOf("waves-effect")!==-1)continue;var e=document.createElement("i");e.className=c.className+" waves-input-wrapper";var f=c.getAttribute("style");f||(f=""),e.setAttribute("style",f),c.className="waves-button-input",c.removeAttribute("style"),d.replaceChild(e,c),e.appendChild(c)}}}},k={touches:0,allowEvent:function(a){var b=!0;return"touchstart"===a.type?k.touches+=1:"touchend"===a.type||"touchcancel"===a.type?setTimeout(function(){k.touches>0&&(k.touches-=1)},500):"mousedown"===a.type&&k.touches>0&&(b=!1),b},touchup:function(a){k.allowEvent(a)}};h.displayEffect=function(b){b=b||{},"duration"in b&&(j.duration=b.duration),j.wrapInput(i(".waves-effect")),"ontouchstart"in a&&document.body.addEventListener("touchstart",g,!1),document.body.addEventListener("mousedown",g,!1)},h.attach=function(b){"input"===b.tagName.toLowerCase()&&(j.wrapInput([b]),b=b.parentElement),"ontouchstart"in a&&b.addEventListener("touchstart",g,!1),b.addEventListener("mousedown",g,!1)},a.Waves=h,document.addEventListener("DOMContentLoaded",function(){h.displayEffect()},!1)}(window),Materialize.toast=function(a,b,c,d){function e(a){var b=document.createElement("div");if(b.classList.add("toast"),c)for(var e=c.split(" "),f=0,g=e.length;f<g;f++)b.classList.add(e[f]);("object"==typeof HTMLElement?a instanceof HTMLElement:a&&"object"==typeof a&&null!==a&&1===a.nodeType&&"string"==typeof a.nodeName)?b.appendChild(a):a instanceof jQuery?b.appendChild(a[0]):b.innerHTML=a;var h=new Hammer(b,{prevent_default:!1});return h.on("pan",function(a){var c=a.deltaX,d=80;b.classList.contains("panning")||b.classList.add("panning");var e=1-Math.abs(c/d);e<0&&(e=0),Vel(b,{left:c,opacity:e},{duration:50,queue:!1,easing:"easeOutQuad"})}),h.on("panend",function(a){var c=a.deltaX,e=80;Math.abs(c)>e?Vel(b,{marginTop:"-40px"},{duration:375,easing:"easeOutExpo",queue:!1,complete:function(){"function"==typeof d&&d(),b.parentNode.removeChild(b)}}):(b.classList.remove("panning"),Vel(b,{left:0,opacity:1},{duration:300,easing:"easeOutExpo",queue:!1}))}),b}c=c||"";var f=document.getElementById("toast-container");null===f&&(f=document.createElement("div"),f.id="toast-container",document.body.appendChild(f));var g=e(a);a&&f.appendChild(g),g.style.opacity=0,Vel(g,{translateY:"-35px",opacity:1},{duration:300,easing:"easeOutCubic",queue:!1});var h,i=b;null!=i&&(h=setInterval(function(){null===g.parentNode&&window.clearInterval(h),g.classList.contains("panning")||(i-=20),i<=0&&(Vel(g,{opacity:0,marginTop:"-40px"},{duration:375,easing:"easeOutExpo",queue:!1,complete:function(){"function"==typeof d&&d(),this[0].parentNode.removeChild(this[0])}}),window.clearInterval(h))},20))},function(a){var b={init:function(b){var c={menuWidth:300,edge:"left",closeOnClick:!1,draggable:!0};b=a.extend(c,b),a(this).each(function(){var c=a(this),d=c.attr("data-activates"),e=a("#"+d);300!=b.menuWidth&&e.css("width",b.menuWidth);var f=a('.drag-target[data-sidenav="'+d+'"]');b.draggable?(f.length&&f.remove(),f=a('<div class="drag-target"></div>').attr("data-sidenav",d),a("body").append(f)):f=a(),"left"==b.edge?(e.css("transform","translateX(-100%)"),f.css({left:0})):(e.addClass("right-aligned").css("transform","translateX(100%)"),f.css({right:0})),e.hasClass("fixed")&&window.innerWidth>992&&e.css("transform","translateX(0)"),e.hasClass("fixed")&&a(window).resize(function(){window.innerWidth>992?0!==a("#sidenav-overlay").length&&i?g(!0):e.css("transform","translateX(0%)"):i===!1&&("left"===b.edge?e.css("transform","translateX(-100%)"):e.css("transform","translateX(100%)"))}),b.closeOnClick===!0&&e.on("click.itemclick","a:not(.collapsible-header)",function(){g()});var g=function(c){h=!1,i=!1,a("body").css({overflow:"",width:""}),a("#sidenav-overlay").velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}}),"left"===b.edge?(f.css({width:"",right:"",left:"0"}),e.velocity({translateX:"-100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){c===!0&&(e.removeAttr("style"),e.css("width",b.menuWidth))}})):(f.css({width:"",right:"0",left:""}),e.velocity({translateX:"100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){c===!0&&(e.removeAttr("style"),e.css("width",b.menuWidth))}}))},h=!1,i=!1;b.draggable&&(f.on("click",function(){i&&g()}),f.hammer({prevent_default:!1}).bind("pan",function(c){if("touch"==c.gesture.pointerType){var d=(c.gesture.direction,c.gesture.center.x),f=(c.gesture.center.y,c.gesture.velocityX,a("body")),h=a("#sidenav-overlay"),j=f.innerWidth();if(f.css("overflow","hidden"),f.width(j),0===h.length&&(h=a('<div id="sidenav-overlay"></div>'),h.css("opacity",0).click(function(){g()}),a("body").append(h)),"left"===b.edge&&(d>b.menuWidth?d=b.menuWidth:d<0&&(d=0)),"left"===b.edge)d<b.menuWidth/2?i=!1:d>=b.menuWidth/2&&(i=!0),e.css("transform","translateX("+(d-b.menuWidth)+"px)");else{d<window.innerWidth-b.menuWidth/2?i=!0:d>=window.innerWidth-b.menuWidth/2&&(i=!1);var k=d-b.menuWidth/2;k<0&&(k=0),e.css("transform","translateX("+k+"px)")}var l;"left"===b.edge?(l=d/b.menuWidth,h.velocity({opacity:l},{duration:10,queue:!1,easing:"easeOutQuad"})):(l=Math.abs((d-window.innerWidth)/b.menuWidth),h.velocity({opacity:l},{duration:10,queue:!1,easing:"easeOutQuad"}))}}).bind("panend",function(c){if("touch"==c.gesture.pointerType){var d=a('<div id="sidenav-overlay"></div>'),g=c.gesture.velocityX,j=c.gesture.center.x,k=j-b.menuWidth,l=j-b.menuWidth/2;k>0&&(k=0),l<0&&(l=0),h=!1,"left"===b.edge?i&&g<=.3||g<-.5?(0!==k&&e.velocity({translateX:[0,k]},{duration:300,queue:!1,easing:"easeOutQuad"}),d.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),f.css({width:"50%",right:0,left:""}),i=!0):(!i||g>.3)&&(a("body").css({overflow:"",width:""}),e.velocity({translateX:[-1*b.menuWidth-10,k]},{duration:200,queue:!1,easing:"easeOutQuad"}),d.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}}),f.css({width:"10px",right:"",left:0})):i&&g>=-.3||g>.5?(0!==l&&e.velocity({translateX:[0,l]},{duration:300,queue:!1,easing:"easeOutQuad"}),d.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),f.css({width:"50%",right:"",left:0}),i=!0):(!i||g<-.3)&&(a("body").css({overflow:"",width:""}),e.velocity({translateX:[b.menuWidth+10,l]},{duration:200,queue:!1,easing:"easeOutQuad"}),d.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}}),f.css({width:"10px",right:0,left:""}))}})),c.off("click.sidenav").on("click.sidenav",function(){if(i===!0)i=!1,h=!1,g();else{var c=a("body"),d=a('<div id="sidenav-overlay"></div>'),j=c.innerWidth();c.css("overflow","hidden"),c.width(j),a("body").append(f),"left"===b.edge?(f.css({width:"50%",right:0,left:""}),e.velocity({translateX:[0,-1*b.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})):(f.css({width:"50%",right:"",left:0}),e.velocity({translateX:[0,b.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})),d.css("opacity",0).click(function(){i=!1,h=!1,g(),d.velocity({opacity:0},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}})}),a("body").append(d),d.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){i=!0,h=!1}})}return!1})})},destroy:function(){var b=a("#sidenav-overlay"),c=a('.drag-target[data-sidenav="'+a(this).attr("data-activates")+'"]');b.trigger("click"),c.remove(),a(this).off("click"),b.remove()},show:function(){this.trigger("click")},hide:function(){a("#sidenav-overlay").trigger("click")}};a.fn.sideNav=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.sideNav"):b.init.apply(this,arguments)}}(jQuery),function(a){function b(b,c,d,e){var g=a();return a.each(f,function(a,f){if(f.height()>0){var h=f.offset().top,i=f.offset().left,j=i+f.width(),k=h+f.height(),l=!(i>c||j<e||h>d||k<b);l&&g.push(f)}}),g}function c(c){++i;var d=e.scrollTop(),f=e.scrollLeft(),h=f+e.width(),k=d+e.height(),l=b(d+j.top+c||200,h+j.right,k+j.bottom,f+j.left);a.each(l,function(a,b){var c=b.data("scrollSpy:ticks");"number"!=typeof c&&b.triggerHandler("scrollSpy:enter"),b.data("scrollSpy:ticks",i)}),a.each(g,function(a,b){var c=b.data("scrollSpy:ticks");"number"==typeof c&&c!==i&&(b.triggerHandler("scrollSpy:exit"),b.data("scrollSpy:ticks",null))}),g=l}function d(){e.trigger("scrollSpy:winSize")}var e=a(window),f=[],g=[],h=!1,i=0,j={top:0,right:0,bottom:0,left:0};a.scrollSpy=function(b,d){var g={throttle:100,scrollOffset:200};d=a.extend(g,d);var i=[];b=a(b),b.each(function(b,c){f.push(a(c)),a(c).data("scrollSpy:id",b),a('a[href="#'+a(c).attr("id")+'"]').click(function(b){b.preventDefault();var c=a(Materialize.escapeHash(this.hash)).offset().top+1;a("html, body").animate({scrollTop:c-d.scrollOffset},{duration:400,queue:!1,easing:"easeOutCubic"})})}),j.top=d.offsetTop||0,j.right=d.offsetRight||0,j.bottom=d.offsetBottom||0,j.left=d.offsetLeft||0;var k=Materialize.throttle(function(){c(d.scrollOffset)},d.throttle||100),l=function(){a(document).ready(k)};return h||(e.on("scroll",l),e.on("resize",l),h=!0),setTimeout(l,0),b.on("scrollSpy:enter",function(){i=a.grep(i,function(a){return 0!=a.height()});var b=a(this);i[0]?(a('a[href="#'+i[0].attr("id")+'"]').removeClass("active"),b.data("scrollSpy:id")<i[0].data("scrollSpy:id")?i.unshift(a(this)):i.push(a(this))):i.push(a(this)),a('a[href="#'+i[0].attr("id")+'"]').addClass("active")}),b.on("scrollSpy:exit",function(){if(i=a.grep(i,function(a){return 0!=a.height()}),i[0]){a('a[href="#'+i[0].attr("id")+'"]').removeClass("active");var b=a(this);i=a.grep(i,function(a){return a.attr("id")!=b.attr("id")}),i[0]&&a('a[href="#'+i[0].attr("id")+'"]').addClass("active")}}),b},a.winSizeSpy=function(b){return a.winSizeSpy=function(){return e},b=b||{throttle:100},e.on("resize",Materialize.throttle(d,b.throttle||100))},a.fn.scrollSpy=function(b){return a.scrollSpy(a(this),b)}}(jQuery),function(a){a(document).ready(function(){function b(b){var c=b.css("font-family"),d=b.css("font-size"),f=b.css("line-height");d&&e.css("font-size",d),c&&e.css("font-family",c),f&&e.css("line-height",f),"off"===b.attr("wrap")&&e.css("overflow-wrap","normal").css("white-space","pre"),e.text(b.val()+"\n");var g=e.html().replace(/\n/g,"<br>");e.html(g),b.is(":visible")?e.css("width",b.width()):e.css("width",a(window).width()/2),b.css("height",e.height())}Materialize.updateTextFields=function(){var b="input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea";a(b).each(function(b,c){var d=a(this);a(c).val().length>0||c.autofocus||void 0!==d.attr("placeholder")?d.siblings("label").addClass("active"):a(c)[0].validity?d.siblings("label").toggleClass("active",a(c)[0].validity.badInput===!0):d.siblings("label").removeClass("active")})};var c="input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea";a(document).on("change",c,function(){0===a(this).val().length&&void 0===a(this).attr("placeholder")||a(this).siblings("label").addClass("active"),validate_field(a(this))}),a(document).ready(function(){Materialize.updateTextFields()}),a(document).on("reset",function(b){var d=a(b.target);d.is("form")&&(d.find(c).removeClass("valid").removeClass("invalid"),d.find(c).each(function(){""===a(this).attr("value")&&a(this).siblings("label").removeClass("active")}),d.find("select.initialized").each(function(){var a=d.find("option[selected]").text();d.siblings("input.select-dropdown").val(a)}))}),a(document).on("focus",c,function(){a(this).siblings("label, .prefix").addClass("active")}),a(document).on("blur",c,function(){var b=a(this),c=".prefix";0===b.val().length&&b[0].validity.badInput!==!0&&void 0===b.attr("placeholder")&&(c+=", label"),b.siblings(c).removeClass("active"),validate_field(b)}),window.validate_field=function(a){var b=void 0!==a.attr("data-length"),c=parseInt(a.attr("data-length")),d=a.val().length;0===a.val().length&&a[0].validity.badInput===!1?a.hasClass("validate")&&(a.removeClass("valid"),a.removeClass("invalid")):a.hasClass("validate")&&(a.is(":valid")&&b&&d<=c||a.is(":valid")&&!b?(a.removeClass("invalid"),a.addClass("valid")):(a.removeClass("valid"),a.addClass("invalid")))};var d="input[type=radio], input[type=checkbox]";a(document).on("keyup.radio",d,function(b){if(9===b.which){a(this).addClass("tabbed");var c=a(this);return void c.one("blur",function(b){a(this).removeClass("tabbed")})}});var e=a(".hiddendiv").first();e.length||(e=a('<div class="hiddendiv common"></div>'),a("body").append(e));var f=".materialize-textarea";a(f).each(function(){var c=a(this);c.val().length&&b(c)}),a("body").on("keyup keydown autoresize",f,function(){b(a(this))}),a(document).on("change",'.file-field input[type="file"]',function(){for(var b=a(this).closest(".file-field"),c=b.find("input.file-path"),d=a(this)[0].files,e=[],f=0;f<d.length;f++)e.push(d[f].name);c.val(e.join(", ")),c.trigger("change")});var g,h="input[type=range]",i=!1;a(h).each(function(){var b=a('<span class="thumb"><span class="value"></span></span>');a(this).after(b)});var j=".range-field";a(document).on("change",h,function(b){var c=a(this).siblings(".thumb");c.find(".value").html(a(this).val())}),a(document).on("input mousedown touchstart",h,function(b){var c=a(this).siblings(".thumb"),d=a(this).outerWidth();c.length<=0&&(c=a('<span class="thumb"><span class="value"></span></span>'),a(this).after(c)),c.find(".value").html(a(this).val()),i=!0,a(this).addClass("active"),c.hasClass("active")||c.velocity({height:"30px",width:"30px",top:"-20px",marginLeft:"-15px"},{duration:300,easing:"easeOutExpo"}),"input"!==b.type&&(g=void 0===b.pageX||null===b.pageX?b.originalEvent.touches[0].pageX-a(this).offset().left:b.pageX-a(this).offset().left,g<0?g=0:g>d&&(g=d),c.addClass("active").css("left",g)),c.find(".value").html(a(this).val())}),a(document).on("mouseup touchend",j,function(){i=!1,a(this).removeClass("active")}),a(document).on("mousemove touchmove",j,function(b){var c,d=a(this).children(".thumb");if(i){d.hasClass("active")||d.velocity({height:"30px",width:"30px",top:"-20px",marginLeft:"-15px"},{duration:300,easing:"easeOutExpo"}),c=void 0===b.pageX||null===b.pageX?b.originalEvent.touches[0].pageX-a(this).offset().left:b.pageX-a(this).offset().left;var e=a(this).outerWidth();c<0?c=0:c>e&&(c=e),d.addClass("active").css("left",c),d.find(".value").html(d.siblings(h).val())}}),a(document).on("mouseout touchleave",j,function(){if(!i){var b=a(this).children(".thumb");b.hasClass("active")&&b.velocity({height:"0",width:"0",top:"10px",marginLeft:"-6px"},{duration:100}),b.removeClass("active")}}),a.fn.autocomplete=function(b){var c={data:{},limit:1/0,onAutocomplete:null};return b=a.extend(c,b),this.each(function(){var c,d=a(this),e=b.data,f=0,g=0,h=d.closest(".input-field");if(!a.isEmptyObject(e)){var i,j=a('<ul class="autocomplete-content dropdown-content"></ul>');h.length?(i=h.children(".autocomplete-content.dropdown-content").first(),i.length||h.append(j)):(i=d.next(".autocomplete-content.dropdown-content"),i.length||d.after(j)),i.length&&(j=i);var k=function(a,b){var c=b.find("img"),d=b.text().toLowerCase().indexOf(""+a.toLowerCase()),e=d+a.length-1,f=b.text().slice(0,d),g=b.text().slice(d,e+1),h=b.text().slice(e+1);b.html("<span>"+f+"<span class='highlight'>"+g+"</span>"+h+"</span>"),c.length&&b.prepend(c)},l=function(){g=0,j.find(".active").removeClass("active")};d.off("keyup.autocomplete").on("keyup.autocomplete",function(g){if(f=0,13!==g.which&&38!==g.which&&40!==g.which){var h=d.val().toLowerCase();if(c!==h&&(j.empty(),l(),""!==h))for(var i in e)if(e.hasOwnProperty(i)&&i.toLowerCase().indexOf(h)!==-1&&i.toLowerCase()!==h){if(f>=b.limit)break;var m=a("<li></li>");e[i]?m.append('<img src="'+e[i]+'" class="right circle"><span>'+i+"</span>"):m.append("<span>"+i+"</span>"),j.append(m),k(h,m),f++}c=h}}),d.off("keydown.autocomplete").on("keydown.autocomplete",function(a){var b,c=a.which,d=j.children("li").length,e=j.children(".active").first();return 13===c?(b=j.children("li").eq(g),void(b.length&&(b.click(),a.preventDefault()))):void(38!==c&&40!==c||(a.preventDefault(),38===c&&g>0&&g--,40===c&&g<d-1&&e.length&&g++,e.removeClass("active"),j.children("li").eq(g).addClass("active")))}),j.on("click","li",function(){var c=a(this).text().trim();d.val(c),d.trigger("change"),j.empty(),l(),"function"==typeof b.onAutocomplete&&b.onAutocomplete.call(this,c)})}})}}),a.fn.material_select=function(b){function c(a,b,c){var e=a.indexOf(b),f=e===-1;return f?a.push(b):a.splice(e,1),c.siblings("ul.dropdown-content").find("li").eq(b).toggleClass("active"),c.find("option").eq(b).prop("selected",f),d(a,c),f}function d(a,b){ +for(var c="",d=0,e=a.length;d<e;d++){var f=b.find("option").eq(a[d]).text();c+=0===d?f:", "+f}""===c&&(c=b.find("option:disabled").eq(0).text()),b.siblings("input.select-dropdown").val(c)}a(this).each(function(){var d=a(this);if(!d.hasClass("browser-default")){var e=!!d.attr("multiple"),f=d.data("select-id");if(f&&(d.parent().find("span.caret").remove(),d.parent().find("input").remove(),d.unwrap(),a("ul#select-options-"+f).remove()),"destroy"===b)return void d.data("select-id",null).removeClass("initialized");var g=Materialize.guid();d.data("select-id",g);var h=a('<div class="select-wrapper"></div>');h.addClass(d.attr("class"));var i=a('<ul id="select-options-'+g+'" class="dropdown-content select-dropdown '+(e?"multiple-select-dropdown":"")+'"></ul>'),j=d.children("option, optgroup"),k=[],l=!1,m=d.find("option:selected").html()||d.find("option:first").html()||"",n=function(b,c,d){var e=c.is(":disabled")?"disabled ":"",f="optgroup-option"===d?"optgroup-option ":"",g=c.data("icon"),h=c.attr("class");if(g){var j="";return h&&(j=' class="'+h+'"'),"multiple"===d?i.append(a('<li class="'+e+'"><img alt="" src="'+g+'"'+j+'><span><input type="checkbox"'+e+"/><label></label>"+c.html()+"</span></li>")):i.append(a('<li class="'+e+f+'"><img alt="" src="'+g+'"'+j+"><span>"+c.html()+"</span></li>")),!0}"multiple"===d?i.append(a('<li class="'+e+'"><span><input type="checkbox"'+e+"/><label></label>"+c.html()+"</span></li>")):i.append(a('<li class="'+e+f+'"><span>'+c.html()+"</span></li>"))};j.length&&j.each(function(){if(a(this).is("option"))e?n(d,a(this),"multiple"):n(d,a(this));else if(a(this).is("optgroup")){var b=a(this).children("option");i.append(a('<li class="optgroup"><span>'+a(this).attr("label")+"</span></li>")),b.each(function(){n(d,a(this),"optgroup-option")})}}),i.find("li:not(.optgroup)").each(function(f){a(this).click(function(g){if(!a(this).hasClass("disabled")&&!a(this).hasClass("optgroup")){var h=!0;e?(a('input[type="checkbox"]',this).prop("checked",function(a,b){return!b}),h=c(k,a(this).index(),d),q.trigger("focus")):(i.find("li").removeClass("active"),a(this).toggleClass("active"),q.val(a(this).text())),r(i,a(this)),d.find("option").eq(f).prop("selected",h),d.trigger("change"),"undefined"!=typeof b&&b()}g.stopPropagation()})}),d.wrap(h);var o=a('<span class="caret">▼</span>');d.is(":disabled")&&o.addClass("disabled");var p=m.replace(/"/g,"""),q=a('<input type="text" class="select-dropdown" readonly="true" '+(d.is(":disabled")?"disabled":"")+' data-activates="select-options-'+g+'" value="'+p+'"/>');d.before(q),q.before(o),q.after(i),d.is(":disabled")||q.dropdown({hover:!1,closeOnClick:!1}),d.attr("tabindex")&&a(q[0]).attr("tabindex",d.attr("tabindex")),d.addClass("initialized"),q.on({focus:function(){if(a("ul.select-dropdown").not(i[0]).is(":visible")&&a("input.select-dropdown").trigger("close"),!i.is(":visible")){a(this).trigger("open",["focus"]);var b=a(this).val();e&&b.indexOf(",")>=0&&(b=b.split(",")[0]);var c=i.find("li").filter(function(){return a(this).text().toLowerCase()===b.toLowerCase()})[0];r(i,c,!0)}},click:function(a){a.stopPropagation()}}),q.on("blur",function(){e||a(this).trigger("close"),i.find("li.selected").removeClass("selected")}),i.hover(function(){l=!0},function(){l=!1}),a(window).on({click:function(){e&&(l||q.trigger("close"))}}),e&&d.find("option:selected:not(:disabled)").each(function(){var b=a(this).index();c(k,b,d),i.find("li").eq(b).find(":checkbox").prop("checked",!0)});var r=function(b,c,d){if(c){b.find("li.selected").removeClass("selected");var f=a(c);f.addClass("selected"),e&&!d||i.scrollTo(f)}},s=[],t=function(b){if(9==b.which)return void q.trigger("close");if(40==b.which&&!i.is(":visible"))return void q.trigger("open");if(13!=b.which||i.is(":visible")){b.preventDefault();var c=String.fromCharCode(b.which).toLowerCase(),d=[9,13,27,38,40];if(c&&d.indexOf(b.which)===-1){s.push(c);var f=s.join(""),g=i.find("li").filter(function(){return 0===a(this).text().toLowerCase().indexOf(f)})[0];g&&r(i,g)}if(13==b.which){var h=i.find("li.selected:not(.disabled)")[0];h&&(a(h).trigger("click"),e||q.trigger("close"))}40==b.which&&(g=i.find("li.selected").length?i.find("li.selected").next("li:not(.disabled)")[0]:i.find("li:not(.disabled)")[0],r(i,g)),27==b.which&&q.trigger("close"),38==b.which&&(g=i.find("li.selected").prev("li:not(.disabled)")[0],g&&r(i,g)),setTimeout(function(){s=[]},1e3)}};q.on("keydown",t)}})}}(jQuery),function(a){var b={init:function(b){var c={indicators:!0,height:400,transition:500,interval:6e3};return b=a.extend(c,b),this.each(function(){function c(a,b){a.hasClass("center-align")?a.velocity({opacity:0,translateY:-100},{duration:b,queue:!1}):a.hasClass("right-align")?a.velocity({opacity:0,translateX:100},{duration:b,queue:!1}):a.hasClass("left-align")&&a.velocity({opacity:0,translateX:-100},{duration:b,queue:!1})}function d(a){a>=j.length?a=0:a<0&&(a=j.length-1),k=i.find(".active").index(),k!=a&&(e=j.eq(k),$caption=e.find(".caption"),e.removeClass("active"),e.velocity({opacity:0},{duration:b.transition,queue:!1,easing:"easeOutQuad",complete:function(){j.not(".active").velocity({opacity:0,translateX:0,translateY:0},{duration:0,queue:!1})}}),c($caption,b.transition),b.indicators&&f.eq(k).removeClass("active"),j.eq(a).velocity({opacity:1},{duration:b.transition,queue:!1,easing:"easeOutQuad"}),j.eq(a).find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:b.transition,delay:b.transition,queue:!1,easing:"easeOutQuad"}),j.eq(a).addClass("active"),b.indicators&&f.eq(a).addClass("active"))}var e,f,g,h=a(this),i=h.find("ul.slides").first(),j=i.find("> li"),k=i.find(".active").index();k!=-1&&(e=j.eq(k)),h.hasClass("fullscreen")||(b.indicators?h.height(b.height+40):h.height(b.height),i.height(b.height)),j.find(".caption").each(function(){c(a(this),0)}),j.find("img").each(function(){var b="data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==";a(this).attr("src")!==b&&(a(this).css("background-image","url("+a(this).attr("src")+")"),a(this).attr("src",b))}),b.indicators&&(f=a('<ul class="indicators"></ul>'),j.each(function(c){var e=a('<li class="indicator-item"></li>');e.click(function(){var c=i.parent(),e=c.find(a(this)).index();d(e),clearInterval(g),g=setInterval(function(){k=i.find(".active").index(),j.length==k+1?k=0:k+=1,d(k)},b.transition+b.interval)}),f.append(e)}),h.append(f),f=h.find("ul.indicators").find("li.indicator-item")),e?e.show():(j.first().addClass("active").velocity({opacity:1},{duration:b.transition,queue:!1,easing:"easeOutQuad"}),k=0,e=j.eq(k),b.indicators&&f.eq(k).addClass("active")),e.find("img").each(function(){e.find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:b.transition,queue:!1,easing:"easeOutQuad"})}),g=setInterval(function(){k=i.find(".active").index(),d(k+1)},b.transition+b.interval);var l=!1,m=!1,n=!1;h.hammer({prevent_default:!1}).bind("pan",function(a){if("touch"===a.gesture.pointerType){clearInterval(g);var b=a.gesture.direction,c=a.gesture.deltaX,d=a.gesture.velocityX,e=a.gesture.velocityY;$curr_slide=i.find(".active"),Math.abs(d)>Math.abs(e)&&$curr_slide.velocity({translateX:c},{duration:50,queue:!1,easing:"easeOutQuad"}),4===b&&(c>h.innerWidth()/2||d<-.65)?n=!0:2===b&&(c<-1*h.innerWidth()/2||d>.65)&&(m=!0);var f;m&&(f=$curr_slide.next(),0===f.length&&(f=j.first()),f.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"})),n&&(f=$curr_slide.prev(),0===f.length&&(f=j.last()),f.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"}))}}).bind("panend",function(a){"touch"===a.gesture.pointerType&&($curr_slide=i.find(".active"),l=!1,curr_index=i.find(".active").index(),!n&&!m||j.length<=1?$curr_slide.velocity({translateX:0},{duration:300,queue:!1,easing:"easeOutQuad"}):m?(d(curr_index+1),$curr_slide.velocity({translateX:-1*h.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})):n&&(d(curr_index-1),$curr_slide.velocity({translateX:h.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})),m=!1,n=!1,clearInterval(g),g=setInterval(function(){k=i.find(".active").index(),j.length==k+1?k=0:k+=1,d(k)},b.transition+b.interval))}),h.on("sliderPause",function(){clearInterval(g)}),h.on("sliderStart",function(){clearInterval(g),g=setInterval(function(){k=i.find(".active").index(),j.length==k+1?k=0:k+=1,d(k)},b.transition+b.interval)}),h.on("sliderNext",function(){k=i.find(".active").index(),d(k+1)}),h.on("sliderPrev",function(){k=i.find(".active").index(),d(k-1)})})},pause:function(){a(this).trigger("sliderPause")},start:function(){a(this).trigger("sliderStart")},next:function(){a(this).trigger("sliderNext")},prev:function(){a(this).trigger("sliderPrev")}};a.fn.slider=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.tooltip"):b.init.apply(this,arguments)}}(jQuery),function(a){a(document).ready(function(){a(document).on("click.card",".card",function(b){a(this).find("> .card-reveal").length&&(a(b.target).is(a(".card-reveal .card-title"))||a(b.target).is(a(".card-reveal .card-title i"))?a(this).find(".card-reveal").velocity({translateY:0},{duration:225,queue:!1,easing:"easeInOutQuad",complete:function(){a(this).css({display:"none"})}}):(a(b.target).is(a(".card .activator"))||a(b.target).is(a(".card .activator i")))&&(a(b.target).closest(".card").css("overflow","hidden"),a(this).find(".card-reveal").css({display:"block"}).velocity("stop",!1).velocity({translateY:"-100%"},{duration:300,queue:!1,easing:"easeInOutQuad"})))})})}(jQuery),function(a){var b={data:[],placeholder:"",secondaryPlaceholder:"",autocompleteData:{},autocompleteLimit:1/0};a(document).ready(function(){a(document).on("click",".chip .close",function(b){var c=a(this).closest(".chips");c.attr("data-initialized")||a(this).closest(".chip").remove()})}),a.fn.material_chip=function(c){var d=this;if(this.$el=a(this),this.$document=a(document),this.SELS={CHIPS:".chips",CHIP:".chip",INPUT:"input",DELETE:".material-icons",SELECTED_CHIP:".selected"},"data"===c)return this.$el.data("chips");var e=a.extend({},b,c);d.hasAutocomplete=!a.isEmptyObject(e.autocompleteData),this.init=function(){var b=0;d.$el.each(function(){var c=a(this),f=Materialize.guid();d.chipId=f,e.data&&e.data instanceof Array||(e.data=[]),c.data("chips",e.data),c.attr("data-index",b),c.attr("data-initialized",!0),c.hasClass(d.SELS.CHIPS)||c.addClass("chips"),d.chips(c,f),b++})},this.handleEvents=function(){var b=d.SELS;d.$document.off("click.chips-focus",b.CHIPS).on("click.chips-focus",b.CHIPS,function(c){a(c.target).find(b.INPUT).focus()}),d.$document.off("click.chips-select",b.CHIP).on("click.chips-select",b.CHIP,function(c){var e=a(c.target);if(e.length){var f=e.hasClass("selected"),g=e.closest(b.CHIPS);a(b.CHIP).removeClass("selected"),f||d.selectChip(e.index(),g)}}),d.$document.off("keydown.chips").on("keydown.chips",function(c){if(!a(c.target).is("input, textarea")){var e,f=d.$document.find(b.CHIP+b.SELECTED_CHIP),g=f.closest(b.CHIPS),h=f.siblings(b.CHIP).length;if(f.length)if(8===c.which||46===c.which){c.preventDefault(),e=f.index(),d.deleteChip(e,g);var i=null;e+1<h?i=e:e!==h&&e+1!==h||(i=h-1),i<0&&(i=null),null!==i&&d.selectChip(i,g),h||g.find("input").focus()}else if(37===c.which){if(e=f.index()-1,e<0)return;a(b.CHIP).removeClass("selected"),d.selectChip(e,g)}else if(39===c.which){if(e=f.index()+1,a(b.CHIP).removeClass("selected"),e>h)return void g.find("input").focus();d.selectChip(e,g)}}}),d.$document.off("focusin.chips",b.CHIPS+" "+b.INPUT).on("focusin.chips",b.CHIPS+" "+b.INPUT,function(c){var d=a(c.target).closest(b.CHIPS);d.addClass("focus"),d.siblings("label, .prefix").addClass("active"),a(b.CHIP).removeClass("selected")}),d.$document.off("focusout.chips",b.CHIPS+" "+b.INPUT).on("focusout.chips",b.CHIPS+" "+b.INPUT,function(c){var d=a(c.target).closest(b.CHIPS);d.removeClass("focus"),d.data("chips").length||d.siblings("label").removeClass("active"),d.siblings(".prefix").removeClass("active")}),d.$document.off("keydown.chips-add",b.CHIPS+" "+b.INPUT).on("keydown.chips-add",b.CHIPS+" "+b.INPUT,function(c){var e=a(c.target),f=e.closest(b.CHIPS),g=f.children(b.CHIP).length;if(13===c.which){if(d.hasAutocomplete&&f.find(".autocomplete-content.dropdown-content").length&&f.find(".autocomplete-content.dropdown-content").children().length)return;return c.preventDefault(),d.addChip({tag:e.val()},f),void e.val("")}if((8===c.keyCode||37===c.keyCode)&&""===e.val()&&g)return c.preventDefault(),d.selectChip(g-1,f),void e.blur()}),d.$document.off("click.chips-delete",b.CHIPS+" "+b.DELETE).on("click.chips-delete",b.CHIPS+" "+b.DELETE,function(c){var e=a(c.target),f=e.closest(b.CHIPS),g=e.closest(b.CHIP);c.stopPropagation(),d.deleteChip(g.index(),f),f.find("input").focus()})},this.chips=function(b,c){var f="";b.data("chips").forEach(function(a){f+=d.renderChip(a)}),f+='<input id="'+c+'" class="input" placeholder="">',b.html(f),d.setPlaceholder(b);var g=b.next("label");g.length&&(g.attr("for",c),b.data("chips").length&&g.addClass("active"));var h=a("#"+c);d.hasAutocomplete&&h.autocomplete({data:e.autocompleteData,limit:e.autocompleteLimit,onAutocomplete:function(a){d.addChip({tag:a},b),h.val(""),h.focus()}})},this.renderChip=function(a){if(a.tag){var b='<div class="chip">'+a.tag;return a.image&&(b+=' <img src="'+a.image+'"> '),b+='<i class="material-icons close">close</i>',b+="</div>"}},this.setPlaceholder=function(a){a.data("chips").length&&e.placeholder?a.find("input").prop("placeholder",e.placeholder):!a.data("chips").length&&e.secondaryPlaceholder&&a.find("input").prop("placeholder",e.secondaryPlaceholder)},this.isValid=function(a,b){for(var c=a.data("chips"),d=!1,e=0;e<c.length;e++)if(c[e].tag===b.tag)return void(d=!0);return""!==b.tag&&!d},this.addChip=function(b,c){if(d.isValid(c,b)){for(var e=d.renderChip(b),f=[],g=c.data("chips"),h=0;h<g.length;h++)f.push(g[h]);f.push(b),c.data("chips",f),a(e).insertBefore(c.find("input")),c.trigger("chip.add",b),d.setPlaceholder(c)}},this.deleteChip=function(a,b){var c=b.data("chips")[a];b.find(".chip").eq(a).remove();for(var e=[],f=b.data("chips"),g=0;g<f.length;g++)g!==a&&e.push(f[g]);b.data("chips",e),b.trigger("chip.delete",c),d.setPlaceholder(b)},this.selectChip=function(a,b){var c=b.find(".chip").eq(a);c&&!1===c.hasClass("selected")&&(c.addClass("selected"),b.trigger("chip.select",b.data("chips")[a]))},this.getChipsElement=function(a,b){return b.eq(a)},this.init(),this.handleEvents()}}(jQuery),function(a){a.fn.pushpin=function(b){var c={top:0,bottom:1/0,offset:0};return"remove"===b?(this.each(function(){(id=a(this).data("pushpin-id"))&&(a(window).off("scroll."+id),a(this).removeData("pushpin-id").removeClass("pin-top pinned pin-bottom").removeAttr("style"))}),!1):(b=a.extend(c,b),$index=0,this.each(function(){function c(a){a.removeClass("pin-top"),a.removeClass("pinned"),a.removeClass("pin-bottom")}function d(d,e){d.each(function(){b.top<=e&&b.bottom>=e&&!a(this).hasClass("pinned")&&(c(a(this)),a(this).css("top",b.offset),a(this).addClass("pinned")),e<b.top&&!a(this).hasClass("pin-top")&&(c(a(this)),a(this).css("top",0),a(this).addClass("pin-top")),e>b.bottom&&!a(this).hasClass("pin-bottom")&&(c(a(this)),a(this).addClass("pin-bottom"),a(this).css("top",b.bottom-g))})}var e=Materialize.guid(),f=a(this),g=a(this).offset().top;a(this).data("pushpin-id",e),d(f,a(window).scrollTop()),a(window).on("scroll."+e,function(){var c=a(window).scrollTop()+b.offset;d(f,c)})}))}}(jQuery),function(a){a(document).ready(function(){a.fn.reverse=[].reverse,a(document).on("mouseenter.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(c){var d=a(this);b(d)}),a(document).on("mouseleave.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(b){var d=a(this);c(d)}),a(document).on("click.fabClickToggle",".fixed-action-btn.click-to-toggle > a",function(d){var e=a(this),f=e.parent();f.hasClass("active")?c(f):b(f)}),a(document).on("click.fabToolbar",".fixed-action-btn.toolbar > a",function(b){var c=a(this),e=c.parent();d(e)})}),a.fn.extend({openFAB:function(){b(a(this))},closeFAB:function(){c(a(this))},openToolbar:function(){d(a(this))},closeToolbar:function(){e(a(this))}});var b=function(b){var c=b;if(c.hasClass("active")===!1){var d,e,f=c.hasClass("horizontal");f===!0?e=40:d=40,c.addClass("active"),c.find("ul .btn-floating").velocity({scaleY:".4",scaleX:".4",translateY:d+"px",translateX:e+"px"},{duration:0});var g=0;c.find("ul .btn-floating").reverse().each(function(){a(this).velocity({opacity:"1",scaleX:"1",scaleY:"1",translateY:"0",translateX:"0"},{duration:80,delay:g}),g+=40})}},c=function(a){var b,c,d=a,e=d.hasClass("horizontal");e===!0?c=40:b=40,d.removeClass("active");d.find("ul .btn-floating").velocity("stop",!0),d.find("ul .btn-floating").velocity({opacity:"0",scaleX:".4",scaleY:".4",translateY:b+"px",translateX:c+"px"},{duration:80})},d=function(b){if("true"!==b.attr("data-open")){var c,d,f,g=window.innerWidth,h=window.innerHeight,i=b[0].getBoundingClientRect(),j=b.find("> a").first(),k=b.find("> ul").first(),l=a('<div class="fab-backdrop"></div>'),m=j.css("background-color");j.append(l),c=i.left-g/2+i.width/2,d=h-i.bottom,f=g/l.width(),b.attr("data-origin-bottom",i.bottom),b.attr("data-origin-left",i.left),b.attr("data-origin-width",i.width),b.addClass("active"),b.attr("data-open",!0),b.css({"text-align":"center",width:"100%",bottom:0,left:0,transform:"translateX("+c+"px)",transition:"none"}),j.css({transform:"translateY("+-d+"px)",transition:"none"}),l.css({"background-color":m}),setTimeout(function(){b.css({transform:"",transition:"transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s"}),j.css({overflow:"visible",transform:"",transition:"transform .2s"}),setTimeout(function(){b.css({overflow:"hidden","background-color":m}),l.css({transform:"scale("+f+")",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"}),k.find("> li > a").css({opacity:1}),a(window).on("scroll.fabToolbarClose",function(){e(b),a(window).off("scroll.fabToolbarClose"),a(document).off("click.fabToolbarClose")}),a(document).on("click.fabToolbarClose",function(c){a(c.target).closest(k).length||(e(b),a(window).off("scroll.fabToolbarClose"),a(document).off("click.fabToolbarClose"))})},100)},0)}},e=function(a){if("true"===a.attr("data-open")){var b,c,d,e=window.innerWidth,f=window.innerHeight,g=a.attr("data-origin-width"),h=a.attr("data-origin-bottom"),i=a.attr("data-origin-left"),j=a.find("> .btn-floating").first(),k=a.find("> ul").first(),l=a.find(".fab-backdrop"),m=j.css("background-color");b=i-e/2+g/2,c=f-h,d=e/l.width(),a.removeClass("active"),a.attr("data-open",!1),a.css({"background-color":"transparent",transition:"none"}),j.css({transition:"none"}),l.css({transform:"scale(0)","background-color":m}),k.find("> li > a").css({opacity:""}),setTimeout(function(){l.remove(),a.css({"text-align":"",width:"",bottom:"",left:"",overflow:"","background-color":"",transform:"translate3d("+-b+"px,0,0)"}),j.css({overflow:"",transform:"translate3d(0,"+c+"px,0)"}),setTimeout(function(){a.css({transform:"translate3d(0,0,0)",transition:"transform .2s"}),j.css({transform:"translate3d(0,0,0)",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"})},20)},200)}}}(jQuery),function(a){Materialize.fadeInImage=function(b){var c;if("string"==typeof b)c=a(b);else{if("object"!=typeof b)return;c=b}c.css({opacity:0}),a(c).velocity({opacity:1},{duration:650,queue:!1,easing:"easeOutSine"}),a(c).velocity({opacity:1},{duration:1300,queue:!1,easing:"swing",step:function(b,c){c.start=100;var d=b/100,e=150-(100-b)/1.75;e<100&&(e=100),b>=0&&a(this).css({"-webkit-filter":"grayscale("+d+")brightness("+e+"%)",filter:"grayscale("+d+")brightness("+e+"%)"})}})},Materialize.showStaggeredList=function(b){var c;if("string"==typeof b)c=a(b);else{if("object"!=typeof b)return;c=b}var d=0;c.find("li").velocity({translateX:"-100px"},{duration:0}),c.find("li").each(function(){a(this).velocity({opacity:"1",translateX:"0"},{duration:800,delay:d,easing:[60,10]}),d+=120})},a(document).ready(function(){var b=!1,c=!1;a(".dismissable").each(function(){a(this).hammer({prevent_default:!1}).bind("pan",function(d){if("touch"===d.gesture.pointerType){var e=a(this),f=d.gesture.direction,g=d.gesture.deltaX,h=d.gesture.velocityX;e.velocity({translateX:g},{duration:50,queue:!1,easing:"easeOutQuad"}),4===f&&(g>e.innerWidth()/2||h<-.75)&&(b=!0),2===f&&(g<-1*e.innerWidth()/2||h>.75)&&(c=!0)}}).bind("panend",function(d){if(Math.abs(d.gesture.deltaX)<a(this).innerWidth()/2&&(c=!1,b=!1),"touch"===d.gesture.pointerType){var e=a(this);if(b||c){var f;f=b?e.innerWidth():-1*e.innerWidth(),e.velocity({translateX:f},{duration:100,queue:!1,easing:"easeOutQuad",complete:function(){e.css("border","none"),e.velocity({height:0,padding:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){e.remove()}})}})}else e.velocity({translateX:0},{duration:100,queue:!1,easing:"easeOutQuad"});b=!1,c=!1}})})})}(jQuery),function(a){var b=!1;Materialize.scrollFire=function(a){var c=function(){for(var b=window.pageYOffset+window.innerHeight,c=0;c<a.length;c++){var d=a[c],e=d.selector,f=d.offset,g=d.callback,h=document.querySelector(e);if(null!==h){var i=h.getBoundingClientRect().top+window.pageYOffset;if(b>i+f&&d.done!==!0){if("function"==typeof g)g.call(this,h);else if("string"==typeof g){var j=new Function(g);j(h)}d.done=!0}}}},d=Materialize.throttle(function(){c()},a.throttle||100);b||(window.addEventListener("scroll",d),window.addEventListener("resize",d),b=!0),setTimeout(d,0)}}(jQuery),function(a){"function"==typeof define&&define.amd?define("picker",["jquery"],a):"object"==typeof exports?module.exports=a(require("jquery")):this.Picker=a(jQuery)}(function(a){function b(f,g,i,l){function m(){return b._.node("div",b._.node("div",b._.node("div",b._.node("div",y.component.nodes(t.open),v.box),v.wrap),v.frame),v.holder)}function n(){w.data(g,y).addClass(v.input).attr("tabindex",-1).val(w.data("value")?y.get("select",u.format):f.value),u.editable||w.on("focus."+t.id+" click."+t.id,function(a){a.preventDefault(),y.$root.eq(0).focus()}).on("keydown."+t.id,q),e(f,{haspopup:!0,expanded:!1,readonly:!1,owns:f.id+"_root"})}function o(){y.$root.on({keydown:q,focusin:function(a){y.$root.removeClass(v.focused),a.stopPropagation()},"mousedown click":function(b){var c=b.target;c!=y.$root.children()[0]&&(b.stopPropagation(),"mousedown"!=b.type||a(c).is("input, select, textarea, button, option")||(b.preventDefault(),y.$root.eq(0).focus()))}}).on({focus:function(){w.addClass(v.target)},blur:function(){w.removeClass(v.target)}}).on("focus.toOpen",r).on("click","[data-pick], [data-nav], [data-clear], [data-close]",function(){var b=a(this),c=b.data(),d=b.hasClass(v.navDisabled)||b.hasClass(v.disabled),e=h();e=e&&(e.type||e.href),(d||e&&!a.contains(y.$root[0],e))&&y.$root.eq(0).focus(),!d&&c.nav?y.set("highlight",y.component.item.highlight,{nav:c.nav}):!d&&"pick"in c?y.set("select",c.pick):c.clear?y.clear().close(!0):c.close&&y.close(!0)}),e(y.$root[0],"hidden",!0)}function p(){var b;u.hiddenName===!0?(b=f.name,f.name=""):(b=["string"==typeof u.hiddenPrefix?u.hiddenPrefix:"","string"==typeof u.hiddenSuffix?u.hiddenSuffix:"_submit"],b=b[0]+f.name+b[1]),y._hidden=a('<input type=hidden name="'+b+'"'+(w.data("value")||f.value?' value="'+y.get("select",u.formatSubmit)+'"':"")+">")[0],w.on("change."+t.id,function(){y._hidden.value=f.value?y.get("select",u.formatSubmit):""}),u.container?a(u.container).append(y._hidden):w.after(y._hidden)}function q(a){var b=a.keyCode,c=/^(8|46)$/.test(b);return 27==b?(y.close(),!1):void((32==b||c||!t.open&&y.component.key[b])&&(a.preventDefault(),a.stopPropagation(),c?y.clear().close():y.open()))}function r(a){a.stopPropagation(),"focus"==a.type&&y.$root.addClass(v.focused),y.open()}if(!f)return b;var s=!1,t={id:f.id||"P"+Math.abs(~~(Math.random()*new Date))},u=i?a.extend(!0,{},i.defaults,l):l||{},v=a.extend({},b.klasses(),u.klass),w=a(f),x=function(){return this.start()},y=x.prototype={constructor:x,$node:w,start:function(){return t&&t.start?y:(t.methods={},t.start=!0,t.open=!1,t.type=f.type,f.autofocus=f==h(),f.readOnly=!u.editable,f.id=f.id||t.id,"text"!=f.type&&(f.type="text"),y.component=new i(y,u),y.$root=a(b._.node("div",m(),v.picker,'id="'+f.id+'_root" tabindex="0"')),o(),u.formatSubmit&&p(),n(),u.container?a(u.container).append(y.$root):w.after(y.$root),y.on({start:y.component.onStart,render:y.component.onRender,stop:y.component.onStop,open:y.component.onOpen,close:y.component.onClose,set:y.component.onSet}).on({start:u.onStart,render:u.onRender,stop:u.onStop,open:u.onOpen,close:u.onClose,set:u.onSet}),s=c(y.$root.children()[0]),f.autofocus&&y.open(),y.trigger("start").trigger("render"))},render:function(a){return a?y.$root.html(m()):y.$root.find("."+v.box).html(y.component.nodes(t.open)),y.trigger("render")},stop:function(){return t.start?(y.close(),y._hidden&&y._hidden.parentNode.removeChild(y._hidden),y.$root.remove(),w.removeClass(v.input).removeData(g),setTimeout(function(){w.off("."+t.id)},0),f.type=t.type,f.readOnly=!1,y.trigger("stop"),t.methods={},t.start=!1,y):y},open:function(c){return t.open?y:(w.addClass(v.active),e(f,"expanded",!0),setTimeout(function(){y.$root.addClass(v.opened),e(y.$root[0],"hidden",!1)},0),c!==!1&&(t.open=!0,s&&k.css("overflow","hidden").css("padding-right","+="+d()),y.$root.eq(0).focus(),j.on("click."+t.id+" focusin."+t.id,function(a){var b=a.target;b!=f&&b!=document&&3!=a.which&&y.close(b===y.$root.children()[0])}).on("keydown."+t.id,function(c){var d=c.keyCode,e=y.component.key[d],f=c.target;27==d?y.close(!0):f!=y.$root[0]||!e&&13!=d?a.contains(y.$root[0],f)&&13==d&&(c.preventDefault(),f.click()):(c.preventDefault(),e?b._.trigger(y.component.key.go,y,[b._.trigger(e)]):y.$root.find("."+v.highlighted).hasClass(v.disabled)||y.set("select",y.component.item.highlight).close())})),y.trigger("open"))},close:function(a){return a&&(y.$root.off("focus.toOpen").eq(0).focus(),setTimeout(function(){y.$root.on("focus.toOpen",r)},0)),w.removeClass(v.active),e(f,"expanded",!1),setTimeout(function(){y.$root.removeClass(v.opened+" "+v.focused),e(y.$root[0],"hidden",!0)},0),t.open?(t.open=!1,s&&k.css("overflow","").css("padding-right","-="+d()),j.off("."+t.id),y.trigger("close")):y},clear:function(a){return y.set("clear",null,a)},set:function(b,c,d){var e,f,g=a.isPlainObject(b),h=g?b:{};if(d=g&&a.isPlainObject(c)?c:d||{},b){g||(h[b]=c);for(e in h)f=h[e],e in y.component.item&&(void 0===f&&(f=null),y.component.set(e,f,d)),"select"!=e&&"clear"!=e||w.val("clear"==e?"":y.get(e,u.format)).trigger("change");y.render()}return d.muted?y:y.trigger("set",h)},get:function(a,c){if(a=a||"value",null!=t[a])return t[a];if("valueSubmit"==a){if(y._hidden)return y._hidden.value;a="value"}if("value"==a)return f.value;if(a in y.component.item){if("string"==typeof c){var d=y.component.get(a);return d?b._.trigger(y.component.formats.toString,y.component,[c,d]):""}return y.component.get(a)}},on:function(b,c,d){var e,f,g=a.isPlainObject(b),h=g?b:{};if(b){g||(h[b]=c);for(e in h)f=h[e],d&&(e="_"+e),t.methods[e]=t.methods[e]||[],t.methods[e].push(f)}return y},off:function(){var a,b,c=arguments;for(a=0,namesCount=c.length;a<namesCount;a+=1)b=c[a],b in t.methods&&delete t.methods[b];return y},trigger:function(a,c){var d=function(a){var d=t.methods[a];d&&d.map(function(a){b._.trigger(a,y,[c])})};return d("_"+a),d(a),y}};return new x}function c(a){var b,c="position";return a.currentStyle?b=a.currentStyle[c]:window.getComputedStyle&&(b=getComputedStyle(a)[c]),"fixed"==b}function d(){if(k.height()<=i.height())return 0;var b=a('<div style="visibility:hidden;width:100px" />').appendTo("body"),c=b[0].offsetWidth;b.css("overflow","scroll");var d=a('<div style="width:100%" />').appendTo(b),e=d[0].offsetWidth;return b.remove(),c-e}function e(b,c,d){if(a.isPlainObject(c))for(var e in c)f(b,e,c[e]);else f(b,c,d)}function f(a,b,c){a.setAttribute(("role"==b?"":"aria-")+b,c)}function g(b,c){a.isPlainObject(b)||(b={attribute:c}),c="";for(var d in b){var e=("role"==d?"":"aria-")+d,f=b[d];c+=null==f?"":e+'="'+b[d]+'"'}return c}function h(){try{return document.activeElement}catch(a){}}var i=a(window),j=a(document),k=a(document.documentElement);return b.klasses=function(a){return a=a||"picker",{picker:a,opened:a+"--opened",focused:a+"--focused",input:a+"__input",active:a+"__input--active",target:a+"__input--target",holder:a+"__holder",frame:a+"__frame",wrap:a+"__wrap",box:a+"__box"}},b._={group:function(a){for(var c,d="",e=b._.trigger(a.min,a);e<=b._.trigger(a.max,a,[e]);e+=a.i)c=b._.trigger(a.item,a,[e]),d+=b._.node(a.node,c[0],c[1],c[2]);return d},node:function(b,c,d,e){return c?(c=a.isArray(c)?c.join(""):c,d=d?' class="'+d+'"':"",e=e?" "+e:"","<"+b+d+e+">"+c+"</"+b+">"):""},lead:function(a){return(a<10?"0":"")+a},trigger:function(a,b,c){return"function"==typeof a?a.apply(b,c||[]):a},digits:function(a){return/\d/.test(a[1])?2:1},isDate:function(a){return{}.toString.call(a).indexOf("Date")>-1&&this.isInteger(a.getDate())},isInteger:function(a){return{}.toString.call(a).indexOf("Number")>-1&&a%1===0},ariaAttr:g},b.extend=function(c,d){a.fn[c]=function(e,f){var g=this.data(c);return"picker"==e?g:g&&"string"==typeof e?b._.trigger(g[e],g,[f]):this.each(function(){var f=a(this);f.data(c)||new b(this,c,d,e)})},a.fn[c].defaults=d.defaults},b}),function(a){"function"==typeof define&&define.amd?define(["picker","jquery"],a):"object"==typeof exports?module.exports=a(require("./picker.js"),require("jquery")):a(Picker,jQuery)}(function(a,b){function c(a,b){var c=this,d=a.$node[0],e=d.value,f=a.$node.data("value"),g=f||e,h=f?b.formatSubmit:b.format,i=function(){return d.currentStyle?"rtl"==d.currentStyle.direction:"rtl"==getComputedStyle(a.$root[0]).direction};c.settings=b,c.$node=a.$node,c.queue={min:"measure create",max:"measure create",now:"now create",select:"parse create validate",highlight:"parse navigate create validate",view:"parse create validate viewset",disable:"deactivate",enable:"activate"},c.item={},c.item.clear=null,c.item.disable=(b.disable||[]).slice(0),c.item.enable=-function(a){return a[0]===!0?a.shift():-1}(c.item.disable),c.set("min",b.min).set("max",b.max).set("now"),g?c.set("select",g,{format:h}):c.set("select",null).set("highlight",c.item.now),c.key={40:7,38:-7,39:function(){return i()?-1:1},37:function(){return i()?1:-1},go:function(a){var b=c.item.highlight,d=new Date(b.year,b.month,b.date+a);c.set("highlight",d,{interval:a}),this.render()}},a.on("render",function(){a.$root.find("."+b.klass.selectMonth).on("change",function(){var c=this.value;c&&(a.set("highlight",[a.get("view").year,c,a.get("highlight").date]),a.$root.find("."+b.klass.selectMonth).trigger("focus"))}),a.$root.find("."+b.klass.selectYear).on("change",function(){var c=this.value;c&&(a.set("highlight",[c,a.get("view").month,a.get("highlight").date]),a.$root.find("."+b.klass.selectYear).trigger("focus"))})},1).on("open",function(){var d="";c.disabled(c.get("now"))&&(d=":not(."+b.klass.buttonToday+")"),a.$root.find("button"+d+", select").attr("disabled",!1)},1).on("close",function(){a.$root.find("button, select").attr("disabled",!0)},1)}var d=7,e=6,f=a._;c.prototype.set=function(a,b,c){var d=this,e=d.item;return null===b?("clear"==a&&(a="select"),e[a]=b,d):(e["enable"==a?"disable":"flip"==a?"enable":a]=d.queue[a].split(" ").map(function(e){return b=d[e](a,b,c)}).pop(),"select"==a?d.set("highlight",e.select,c):"highlight"==a?d.set("view",e.highlight,c):a.match(/^(flip|min|max|disable|enable)$/)&&(e.select&&d.disabled(e.select)&&d.set("select",e.select,c),e.highlight&&d.disabled(e.highlight)&&d.set("highlight",e.highlight,c)),d)},c.prototype.get=function(a){return this.item[a]},c.prototype.create=function(a,c,d){var e,g=this;return c=void 0===c?a:c, +c==-(1/0)||c==1/0?e=c:b.isPlainObject(c)&&f.isInteger(c.pick)?c=c.obj:b.isArray(c)?(c=new Date(c[0],c[1],c[2]),c=f.isDate(c)?c:g.create().obj):c=f.isInteger(c)||f.isDate(c)?g.normalize(new Date(c),d):g.now(a,c,d),{year:e||c.getFullYear(),month:e||c.getMonth(),date:e||c.getDate(),day:e||c.getDay(),obj:e||c,pick:e||c.getTime()}},c.prototype.createRange=function(a,c){var d=this,e=function(a){return a===!0||b.isArray(a)||f.isDate(a)?d.create(a):a};return f.isInteger(a)||(a=e(a)),f.isInteger(c)||(c=e(c)),f.isInteger(a)&&b.isPlainObject(c)?a=[c.year,c.month,c.date+a]:f.isInteger(c)&&b.isPlainObject(a)&&(c=[a.year,a.month,a.date+c]),{from:e(a),to:e(c)}},c.prototype.withinRange=function(a,b){return a=this.createRange(a.from,a.to),b.pick>=a.from.pick&&b.pick<=a.to.pick},c.prototype.overlapRanges=function(a,b){var c=this;return a=c.createRange(a.from,a.to),b=c.createRange(b.from,b.to),c.withinRange(a,b.from)||c.withinRange(a,b.to)||c.withinRange(b,a.from)||c.withinRange(b,a.to)},c.prototype.now=function(a,b,c){return b=new Date,c&&c.rel&&b.setDate(b.getDate()+c.rel),this.normalize(b,c)},c.prototype.navigate=function(a,c,d){var e,f,g,h,i=b.isArray(c),j=b.isPlainObject(c),k=this.item.view;if(i||j){for(j?(f=c.year,g=c.month,h=c.date):(f=+c[0],g=+c[1],h=+c[2]),d&&d.nav&&k&&k.month!==g&&(f=k.year,g=k.month),e=new Date(f,g+(d&&d.nav?d.nav:0),1),f=e.getFullYear(),g=e.getMonth();new Date(f,g,h).getMonth()!==g;)h-=1;c=[f,g,h]}return c},c.prototype.normalize=function(a){return a.setHours(0,0,0,0),a},c.prototype.measure=function(a,b){var c=this;return b?"string"==typeof b?b=c.parse(a,b):f.isInteger(b)&&(b=c.now(a,b,{rel:b})):b="min"==a?-(1/0):1/0,b},c.prototype.viewset=function(a,b){return this.create([b.year,b.month,1])},c.prototype.validate=function(a,c,d){var e,g,h,i,j=this,k=c,l=d&&d.interval?d.interval:1,m=j.item.enable===-1,n=j.item.min,o=j.item.max,p=m&&j.item.disable.filter(function(a){if(b.isArray(a)){var d=j.create(a).pick;d<c.pick?e=!0:d>c.pick&&(g=!0)}return f.isInteger(a)}).length;if((!d||!d.nav)&&(!m&&j.disabled(c)||m&&j.disabled(c)&&(p||e||g)||!m&&(c.pick<=n.pick||c.pick>=o.pick)))for(m&&!p&&(!g&&l>0||!e&&l<0)&&(l*=-1);j.disabled(c)&&(Math.abs(l)>1&&(c.month<k.month||c.month>k.month)&&(c=k,l=l>0?1:-1),c.pick<=n.pick?(h=!0,l=1,c=j.create([n.year,n.month,n.date+(c.pick===n.pick?0:-1)])):c.pick>=o.pick&&(i=!0,l=-1,c=j.create([o.year,o.month,o.date+(c.pick===o.pick?0:1)])),!h||!i);)c=j.create([c.year,c.month,c.date+l]);return c},c.prototype.disabled=function(a){var c=this,d=c.item.disable.filter(function(d){return f.isInteger(d)?a.day===(c.settings.firstDay?d:d-1)%7:b.isArray(d)||f.isDate(d)?a.pick===c.create(d).pick:b.isPlainObject(d)?c.withinRange(d,a):void 0});return d=d.length&&!d.filter(function(a){return b.isArray(a)&&"inverted"==a[3]||b.isPlainObject(a)&&a.inverted}).length,c.item.enable===-1?!d:d||a.pick<c.item.min.pick||a.pick>c.item.max.pick},c.prototype.parse=function(a,b,c){var d=this,e={};return b&&"string"==typeof b?(c&&c.format||(c=c||{},c.format=d.settings.format),d.formats.toArray(c.format).map(function(a){var c=d.formats[a],g=c?f.trigger(c,d,[b,e]):a.replace(/^!/,"").length;c&&(e[a]=b.substr(0,g)),b=b.substr(g)}),[e.yyyy||e.yy,+(e.mm||e.m)-1,e.dd||e.d]):b},c.prototype.formats=function(){function a(a,b,c){var d=a.match(/\w+/)[0];return c.mm||c.m||(c.m=b.indexOf(d)+1),d.length}function b(a){return a.match(/\w+/)[0].length}return{d:function(a,b){return a?f.digits(a):b.date},dd:function(a,b){return a?2:f.lead(b.date)},ddd:function(a,c){return a?b(a):this.settings.weekdaysShort[c.day]},dddd:function(a,c){return a?b(a):this.settings.weekdaysFull[c.day]},m:function(a,b){return a?f.digits(a):b.month+1},mm:function(a,b){return a?2:f.lead(b.month+1)},mmm:function(b,c){var d=this.settings.monthsShort;return b?a(b,d,c):d[c.month]},mmmm:function(b,c){var d=this.settings.monthsFull;return b?a(b,d,c):d[c.month]},yy:function(a,b){return a?2:(""+b.year).slice(2)},yyyy:function(a,b){return a?4:b.year},toArray:function(a){return a.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)},toString:function(a,b){var c=this;return c.formats.toArray(a).map(function(a){return f.trigger(c.formats[a],c,[0,b])||a.replace(/^!/,"")}).join("")}}}(),c.prototype.isDateExact=function(a,c){var d=this;return f.isInteger(a)&&f.isInteger(c)||"boolean"==typeof a&&"boolean"==typeof c?a===c:(f.isDate(a)||b.isArray(a))&&(f.isDate(c)||b.isArray(c))?d.create(a).pick===d.create(c).pick:!(!b.isPlainObject(a)||!b.isPlainObject(c))&&(d.isDateExact(a.from,c.from)&&d.isDateExact(a.to,c.to))},c.prototype.isDateOverlap=function(a,c){var d=this,e=d.settings.firstDay?1:0;return f.isInteger(a)&&(f.isDate(c)||b.isArray(c))?(a=a%7+e,a===d.create(c).day+1):f.isInteger(c)&&(f.isDate(a)||b.isArray(a))?(c=c%7+e,c===d.create(a).day+1):!(!b.isPlainObject(a)||!b.isPlainObject(c))&&d.overlapRanges(a,c)},c.prototype.flipEnable=function(a){var b=this.item;b.enable=a||(b.enable==-1?1:-1)},c.prototype.deactivate=function(a,c){var d=this,e=d.item.disable.slice(0);return"flip"==c?d.flipEnable():c===!1?(d.flipEnable(1),e=[]):c===!0?(d.flipEnable(-1),e=[]):c.map(function(a){for(var c,g=0;g<e.length;g+=1)if(d.isDateExact(a,e[g])){c=!0;break}c||(f.isInteger(a)||f.isDate(a)||b.isArray(a)||b.isPlainObject(a)&&a.from&&a.to)&&e.push(a)}),e},c.prototype.activate=function(a,c){var d=this,e=d.item.disable,g=e.length;return"flip"==c?d.flipEnable():c===!0?(d.flipEnable(1),e=[]):c===!1?(d.flipEnable(-1),e=[]):c.map(function(a){var c,h,i,j;for(i=0;i<g;i+=1){if(h=e[i],d.isDateExact(h,a)){c=e[i]=null,j=!0;break}if(d.isDateOverlap(h,a)){b.isPlainObject(a)?(a.inverted=!0,c=a):b.isArray(a)?(c=a,c[3]||c.push("inverted")):f.isDate(a)&&(c=[a.getFullYear(),a.getMonth(),a.getDate(),"inverted"]);break}}if(c)for(i=0;i<g;i+=1)if(d.isDateExact(e[i],a)){e[i]=null;break}if(j)for(i=0;i<g;i+=1)if(d.isDateOverlap(e[i],a)){e[i]=null;break}c&&e.push(c)}),e.filter(function(a){return null!=a})},c.prototype.nodes=function(a){var b=this,c=b.settings,g=b.item,h=g.now,i=g.select,j=g.highlight,k=g.view,l=g.disable,m=g.min,n=g.max,o=function(a,b){return c.firstDay&&(a.push(a.shift()),b.push(b.shift())),f.node("thead",f.node("tr",f.group({min:0,max:d-1,i:1,node:"th",item:function(d){return[a[d],c.klass.weekdays,'scope=col title="'+b[d]+'"']}})))}((c.showWeekdaysFull?c.weekdaysFull:c.weekdaysLetter).slice(0),c.weekdaysFull.slice(0)),p=function(a){return f.node("div"," ",c.klass["nav"+(a?"Next":"Prev")]+(a&&k.year>=n.year&&k.month>=n.month||!a&&k.year<=m.year&&k.month<=m.month?" "+c.klass.navDisabled:""),"data-nav="+(a||-1)+" "+f.ariaAttr({role:"button",controls:b.$node[0].id+"_table"})+' title="'+(a?c.labelMonthNext:c.labelMonthPrev)+'"')},q=function(d){var e=c.showMonthsShort?c.monthsShort:c.monthsFull;return"short_months"==d&&(e=c.monthsShort),c.selectMonths&&void 0==d?f.node("select",f.group({min:0,max:11,i:1,node:"option",item:function(a){return[e[a],0,"value="+a+(k.month==a?" selected":"")+(k.year==m.year&&a<m.month||k.year==n.year&&a>n.month?" disabled":"")]}}),c.klass.selectMonth+" browser-default",(a?"":"disabled")+" "+f.ariaAttr({controls:b.$node[0].id+"_table"})+' title="'+c.labelMonthSelect+'"'):"short_months"==d?null!=i?f.node("div",e[i.month]):f.node("div",e[k.month]):f.node("div",e[k.month],c.klass.month)},r=function(d){var e=k.year,g=c.selectYears===!0?5:~~(c.selectYears/2);if(g){var h=m.year,i=n.year,j=e-g,l=e+g;if(h>j&&(l+=h-j,j=h),i<l){var o=j-h,p=l-i;j-=o>p?p:o,l=i}if(c.selectYears&&void 0==d)return f.node("select",f.group({min:j,max:l,i:1,node:"option",item:function(a){return[a,0,"value="+a+(e==a?" selected":"")]}}),c.klass.selectYear+" browser-default",(a?"":"disabled")+" "+f.ariaAttr({controls:b.$node[0].id+"_table"})+' title="'+c.labelYearSelect+'"')}return"raw"==d?f.node("div",e):f.node("div",e,c.klass.year)};return createDayLabel=function(){return null!=i?f.node("div",i.date):f.node("div",h.date)},createWeekdayLabel=function(){var a;a=null!=i?i.day:h.day;var b=c.weekdaysFull[a];return b},f.node("div",f.node("div",createWeekdayLabel(),"picker__weekday-display")+f.node("div",q("short_months"),c.klass.month_display)+f.node("div",createDayLabel(),c.klass.day_display)+f.node("div",r("raw"),c.klass.year_display),c.klass.date_display)+f.node("div",f.node("div",(c.selectYears?q()+r():q()+r())+p()+p(1),c.klass.header)+f.node("table",o+f.node("tbody",f.group({min:0,max:e-1,i:1,node:"tr",item:function(a){var e=c.firstDay&&0===b.create([k.year,k.month,1]).day?-7:0;return[f.group({min:d*a-k.day+e+1,max:function(){return this.min+d-1},i:1,node:"td",item:function(a){a=b.create([k.year,k.month,a+(c.firstDay?1:0)]);var d=i&&i.pick==a.pick,e=j&&j.pick==a.pick,g=l&&b.disabled(a)||a.pick<m.pick||a.pick>n.pick,o=f.trigger(b.formats.toString,b,[c.format,a]);return[f.node("div",a.date,function(b){return b.push(k.month==a.month?c.klass.infocus:c.klass.outfocus),h.pick==a.pick&&b.push(c.klass.now),d&&b.push(c.klass.selected),e&&b.push(c.klass.highlighted),g&&b.push(c.klass.disabled),b.join(" ")}([c.klass.day]),"data-pick="+a.pick+" "+f.ariaAttr({role:"gridcell",label:o,selected:!(!d||b.$node.val()!==o)||null,activedescendant:!!e||null,disabled:!!g||null})),"",f.ariaAttr({role:"presentation"})]}})]}})),c.klass.table,'id="'+b.$node[0].id+'_table" '+f.ariaAttr({role:"grid",controls:b.$node[0].id,readonly:!0})),c.klass.calendar_container)+f.node("div",f.node("button",c.today,"btn-flat picker__today","type=button data-pick="+h.pick+(a&&!b.disabled(h)?"":" disabled")+" "+f.ariaAttr({controls:b.$node[0].id}))+f.node("button",c.clear,"btn-flat picker__clear","type=button data-clear=1"+(a?"":" disabled")+" "+f.ariaAttr({controls:b.$node[0].id}))+f.node("button",c.close,"btn-flat picker__close","type=button data-close=true "+(a?"":" disabled")+" "+f.ariaAttr({controls:b.$node[0].id})),c.klass.footer)},c.defaults=function(a){return{labelMonthNext:"Next month",labelMonthPrev:"Previous month",labelMonthSelect:"Select a month",labelYearSelect:"Select a year",monthsFull:["January","February","March","April","May","June","July","August","September","October","November","December"],monthsShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],weekdaysFull:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],weekdaysShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],weekdaysLetter:["S","M","T","W","T","F","S"],today:"Today",clear:"Clear",close:"Close",format:"d mmmm, yyyy",klass:{table:a+"table",header:a+"header",date_display:a+"date-display",day_display:a+"day-display",month_display:a+"month-display",year_display:a+"year-display",calendar_container:a+"calendar-container",navPrev:a+"nav--prev",navNext:a+"nav--next",navDisabled:a+"nav--disabled",month:a+"month",year:a+"year",selectMonth:a+"select--month",selectYear:a+"select--year",weekdays:a+"weekday",day:a+"day",disabled:a+"day--disabled",selected:a+"day--selected",highlighted:a+"day--highlighted",now:a+"day--today",infocus:a+"day--infocus",outfocus:a+"day--outfocus",footer:a+"footer",buttonClear:a+"button--clear",buttonToday:a+"button--today",buttonClose:a+"button--close"}}}(a.klasses().picker+"__"),a.extend("pickadate",c)}),function(a){function b(){var b=+a(this).attr("data-length"),c=+a(this).val().length,d=c<=b;a(this).parent().find('span[class="character-counter"]').html(c+"/"+b),e(d,a(this))}function c(b){var c=b.parent().find('span[class="character-counter"]');c.length||(c=a("<span/>").addClass("character-counter").css("float","right").css("font-size","12px").css("height",1),b.parent().append(c))}function d(){a(this).parent().find('span[class="character-counter"]').html("")}function e(a,b){var c=b.hasClass("invalid");a&&c?b.removeClass("invalid"):a||c||(b.removeClass("valid"),b.addClass("invalid"))}a.fn.characterCounter=function(){return this.each(function(){var e=a(this),f=e.parent().find('span[class="character-counter"]');if(!f.length){var g=void 0!==e.attr("data-length");g&&(e.on("input",b),e.on("focus",b),e.on("blur",d),c(e))}})},a(document).ready(function(){a("input, textarea").characterCounter()})}(jQuery),function(a){var b={init:function(b){var c={duration:200,dist:-100,shift:0,padding:0,fullWidth:!1,indicators:!1,noWrap:!1,onCycleTo:null};return b=a.extend(c,b),this.each(function(){function c(){"undefined"!=typeof window.ontouchstart&&(J[0].addEventListener("touchstart",l),J[0].addEventListener("touchmove",m),J[0].addEventListener("touchend",n)),J[0].addEventListener("mousedown",l),J[0].addEventListener("mousemove",m),J[0].addEventListener("mouseup",n),J[0].addEventListener("mouseleave",n),J[0].addEventListener("click",j)}function d(a){return a.targetTouches&&a.targetTouches.length>=1?a.targetTouches[0].clientX:a.clientX}function e(a){return a.targetTouches&&a.targetTouches.length>=1?a.targetTouches[0].clientY:a.clientY}function f(a){return a>=v?a%v:a<0?f(v+a%v):a}function g(c){var d,e,g,h,i,j,k,l=s;if(r="number"==typeof c?c:r,s=Math.floor((r+u/2)/u),g=r-s*u,h=g<0?1:-1,i=-h*g*2/u,e=v>>1,b.fullWidth?k="translateX(0)":(k="translateX("+(J[0].clientWidth-p)/2+"px) ",k+="translateY("+(J[0].clientHeight-q)/2+"px)"),K){var m=s%v,n=I.find(".indicator-item.active");n.index()!==m&&(n.removeClass("active"),I.find(".indicator-item").eq(m).addClass("active"))}for((!b.noWrap||s>=0&&s<v)&&(j=o[f(s)],a(j).hasClass("active")||(J.find(".carousel-item").removeClass("active"),a(j).addClass("active")),j.style[C]=k+" translateX("+-g/2+"px) translateX("+h*b.shift*i*d+"px) translateZ("+b.dist*i+"px)",j.style.zIndex=0,b.fullWidth?tweenedOpacity=1:tweenedOpacity=1-.2*i,j.style.opacity=tweenedOpacity,j.style.display="block"),d=1;d<=e;++d)b.fullWidth?(zTranslation=b.dist,tweenedOpacity=d===e&&g<0?1-i:1):(zTranslation=b.dist*(2*d+i*h),tweenedOpacity=1-.2*(2*d+i*h)),(!b.noWrap||s+d<v)&&(j=o[f(s+d)],j.style[C]=k+" translateX("+(b.shift+(u*d-g)/2)+"px) translateZ("+zTranslation+"px)",j.style.zIndex=-d,j.style.opacity=tweenedOpacity,j.style.display="block"),b.fullWidth?(zTranslation=b.dist,tweenedOpacity=d===e&&g>0?1-i:1):(zTranslation=b.dist*(2*d-i*h),tweenedOpacity=1-.2*(2*d-i*h)),(!b.noWrap||s-d>=0)&&(j=o[f(s-d)],j.style[C]=k+" translateX("+(-b.shift+(-u*d-g)/2)+"px) translateZ("+zTranslation+"px)",j.style.zIndex=-d,j.style.opacity=tweenedOpacity,j.style.display="block");if((!b.noWrap||s>=0&&s<v)&&(j=o[f(s)],j.style[C]=k+" translateX("+-g/2+"px) translateX("+h*b.shift*i+"px) translateZ("+b.dist*i+"px)",j.style.zIndex=0,b.fullWidth?tweenedOpacity=1:tweenedOpacity=1-.2*i,j.style.opacity=tweenedOpacity,j.style.display="block"),l!==s&&"function"==typeof b.onCycleTo){var t=J.find(".carousel-item").eq(f(s));b.onCycleTo.call(this,t,G)}}function h(){var a,b,c,d;a=Date.now(),b=a-E,E=a,c=r-D,D=r,d=1e3*c/(1+b),B=.8*d+.2*B}function i(){var a,c;z&&(a=Date.now()-E,c=z*Math.exp(-a/b.duration),c>2||c<-2?(g(A-c),requestAnimationFrame(i)):g(A))}function j(c){if(G)return c.preventDefault(),c.stopPropagation(),!1;if(!b.fullWidth){var d=a(c.target).closest(".carousel-item").index(),e=s%v-d;0!==e&&(c.preventDefault(),c.stopPropagation()),k(d)}}function k(a){var c=s%v-a;b.noWrap||(c<0?Math.abs(c+v)<Math.abs(c)&&(c+=v):c>0&&Math.abs(c-v)<c&&(c-=v)),c<0?J.trigger("carouselNext",[Math.abs(c)]):c>0&&J.trigger("carouselPrev",[c])}function l(a){t=!0,G=!1,H=!1,w=d(a),x=e(a),B=z=0,D=r,E=Date.now(),clearInterval(F),F=setInterval(h,100)}function m(a){var b,c,f;if(t)if(b=d(a),y=e(a),c=w-b,f=Math.abs(x-y),f<30&&!H)(c>2||c<-2)&&(G=!0,w=b,g(r+c));else{if(G)return a.preventDefault(),a.stopPropagation(),!1;H=!0}if(G)return a.preventDefault(),a.stopPropagation(),!1}function n(a){if(t)return t=!1,clearInterval(F),A=r,(B>10||B<-10)&&(z=.9*B,A=r+z),A=Math.round(A/u)*u,b.noWrap&&(A>=u*(v-1)?A=u*(v-1):A<0&&(A=0)),z=A-r,E=Date.now(),requestAnimationFrame(i),G&&(a.preventDefault(),a.stopPropagation()),!1}var o,p,q,r,s,t,u,v,w,x,z,A,B,C,D,E,F,G,H,I=a('<ul class="indicators"></ul>'),J=a(this),K=J.attr("data-indicators")||b.indicators;if(J.hasClass("initialized"))return a(this).trigger("carouselNext",[1e-6]),!0;if(b.fullWidth){b.dist=0;var L=J.find(".carousel-item img").first();L.length?imageHeight=L.on("load",function(){J.css("height",a(this).height())}):(imageHeight=J.find(".carousel-item").first().height(),J.css("height",imageHeight)),K&&J.find(".carousel-fixed-item").addClass("with-indicators")}J.addClass("initialized"),t=!1,r=A=0,o=[],p=J.find(".carousel-item").first().innerWidth(),q=J.find(".carousel-item").first().innerHeight(),u=2*p+b.padding,J.find(".carousel-item").each(function(b){if(o.push(a(this)[0]),K){var c=a('<li class="indicator-item"></li>');0===b&&c.addClass("active"),c.click(function(b){b.stopPropagation();var c=a(this).index();k(c)}),I.append(c)}}),K&&J.append(I),v=o.length,C="transform",["webkit","Moz","O","ms"].every(function(a){var b=a+"Transform";return"undefined"==typeof document.body.style[b]||(C=b,!1)}),a(window).on("resize.carousel",function(){b.fullWidth?(p=J.find(".carousel-item").first().innerWidth(),q=J.find(".carousel-item").first().innerHeight(),u=2*p+b.padding,r=2*s*p,A=r):g()}),c(),g(r),a(this).on("carouselNext",function(a,b){void 0===b&&(b=1),A=u*Math.round(r/u)+u*b,r!==A&&(z=A-r,E=Date.now(),requestAnimationFrame(i))}),a(this).on("carouselPrev",function(a,b){void 0===b&&(b=1),A=u*Math.round(r/u)-u*b,r!==A&&(z=A-r,E=Date.now(),requestAnimationFrame(i))}),a(this).on("carouselSet",function(a,b){void 0===b&&(b=0),k(b)})})},next:function(b){a(this).trigger("carouselNext",[b])},prev:function(b){a(this).trigger("carouselPrev",[b])},set:function(b){a(this).trigger("carouselSet",[b])}};a.fn.carousel=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.carousel"):b.init.apply(this,arguments)}}(jQuery);
\ No newline at end of file diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/images/3rd_party/commits.png b/utils/test/vnfcatalogue/VNF_Catalogue/public/images/3rd_party/commits.png Binary files differnew file mode 100644 index 000000000..1247621a7 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/images/3rd_party/commits.png diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/images/logo.png b/utils/test/vnfcatalogue/VNF_Catalogue/public/images/logo.png Binary files differnew file mode 100644 index 000000000..fe18194ec --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/images/logo.png diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/javascripts/global.js b/utils/test/vnfcatalogue/VNF_Catalogue/public/javascripts/global.js new file mode 100644 index 000000000..3ae20d1a9 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/javascripts/global.js @@ -0,0 +1,27 @@ +/*******************************************************************************
+ * Copyright (c) 2017 Kumar Rishabh and others.
+ *
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Apache License, Version 2.0
+ * which accompanies this distribution, and is available at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *******************************************************************************/
+
+$(document).ready( function() {
+ $(".button-collapse").sideNav();
+ $('#Search').click(function() {
+ var tags = $('#Tags').val().toLowerCase().split(/[ ,]+/);
+ window.location.href = '/search_projects?tags=' + tags;
+ return false;
+ });
+ $('#SearchSpan').click(function(){
+ var tags = $('#Tags').val().toLowerCase().split(/[ ,]+/);
+ window.location.href = '/search_projects?tags=' + tags;
+ return false;
+ });
+ $('div.form-group-custom i.material-icons').click(function(e){
+ var tags = $('#Tags').val().toLowerCase().split(/[ ,]+/);
+ window.location.href = '/search_projects?tags=' + tags;
+ return false;
+ });
+});
diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/stylesheets/3rd_party/bootstrap.css b/utils/test/vnfcatalogue/VNF_Catalogue/public/stylesheets/3rd_party/bootstrap.css new file mode 100755 index 000000000..6167622ce --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/stylesheets/3rd_party/bootstrap.css @@ -0,0 +1,6757 @@ +/*! + * Bootstrap v3.3.7 (http://getbootstrap.com) + * Copyright 2011-2016 Twitter, Inc. + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + */ +/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */ +html { + font-family: sans-serif; + -webkit-text-size-adjust: 100%; + -ms-text-size-adjust: 100%; +} +body { + margin: 0; +} +article, +aside, +details, +figcaption, +figure, +footer, +header, +hgroup, +main, +menu, +nav, +section, +summary { + display: block; +} +audio, +canvas, +progress, +video { + display: inline-block; + vertical-align: baseline; +} +audio:not([controls]) { + display: none; + height: 0; +} +[hidden], +template { + display: none; +} +a { + background-color: transparent; +} +a:active, +a:hover { + outline: 0; +} +abbr[title] { + border-bottom: 1px dotted; +} +b, +strong { + font-weight: bold; +} +dfn { + font-style: italic; +} +h1 { + margin: .67em 0; + font-size: 2em; +} +mark { + color: #000; + background: #ff0; +} +small { + font-size: 80%; +} +sub, +sup { + position: relative; + font-size: 75%; + line-height: 0; + vertical-align: baseline; +} +sup { + top: -.5em; +} +sub { + bottom: -.25em; +} +img { + border: 0; +} +svg:not(:root) { + overflow: hidden; +} +figure { + margin: 1em 40px; +} +hr { + height: 0; + -webkit-box-sizing: content-box; + -moz-box-sizing: content-box; + box-sizing: content-box; +} +pre { + overflow: auto; +} +code, +kbd, +pre, +samp { + font-family: monospace, monospace; + font-size: 1em; +} +button, +input, +optgroup, +select, +textarea { + margin: 0; + font: inherit; + color: inherit; +} +button { + overflow: visible; +} +button, +select { + text-transform: none; +} +button, +html input[type="button"], +input[type="reset"], +input[type="submit"] { + -webkit-appearance: button; + cursor: pointer; +} +button[disabled], +html input[disabled] { + cursor: default; +} +button::-moz-focus-inner, +input::-moz-focus-inner { + padding: 0; + border: 0; +} +input { + line-height: normal; +} +input[type="checkbox"], +input[type="radio"] { + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; + padding: 0; +} +input[type="number"]::-webkit-inner-spin-button, +input[type="number"]::-webkit-outer-spin-button { + height: auto; +} +input[type="search"] { + -webkit-box-sizing: content-box; + -moz-box-sizing: content-box; + box-sizing: content-box; + -webkit-appearance: textfield; +} +input[type="search"]::-webkit-search-cancel-button, +input[type="search"]::-webkit-search-decoration { + -webkit-appearance: none; +} +fieldset { + padding: .35em .625em .75em; + margin: 0 2px; + border: 1px solid #c0c0c0; +} +legend { + padding: 0; + border: 0; +} +textarea { + overflow: auto; +} +optgroup { + font-weight: bold; +} +table { + border-spacing: 0; + border-collapse: collapse; +} +td, +th { + padding: 0; +} +/*! Source: https://github.com/h5bp/html5-boilerplate/blob/master/src/css/main.css */ +@media print { + *, + *:before, + *:after { + color: #000 !important; + text-shadow: none !important; + background: transparent !important; + -webkit-box-shadow: none !important; + box-shadow: none !important; + } + a, + a:visited { + text-decoration: underline; + } + a[href]:after { + content: " (" attr(href) ")"; + } + abbr[title]:after { + content: " (" attr(title) ")"; + } + a[href^="#"]:after, + a[href^="javascript:"]:after { + content: ""; + } + pre, + blockquote { + border: 1px solid #999; + + page-break-inside: avoid; + } + thead { + display: table-header-group; + } + tr, + img { + page-break-inside: avoid; + } + img { + max-width: 100% !important; + } + p, + h2, + h3 { + orphans: 3; + widows: 3; + } + h2, + h3 { + page-break-after: avoid; + } + .navbar { + display: none; + } + .btn > .caret, + .dropup > .btn > .caret { + border-top-color: #000 !important; + } + .label { + border: 1px solid #000; + } + .table { + border-collapse: collapse !important; + } + .table td, + .table th { + background-color: #fff !important; + } + .table-bordered th, + .table-bordered td { + border: 1px solid #ddd !important; + } +} +@font-face { + font-family: 'Glyphicons Halflings'; + + src: url('../fonts/glyphicons-halflings-regular.eot'); + src: url('../fonts/glyphicons-halflings-regular.eot?#iefix') format('embedded-opentype'), url('../fonts/glyphicons-halflings-regular.woff2') format('woff2'), url('../fonts/glyphicons-halflings-regular.woff') format('woff'), url('../fonts/glyphicons-halflings-regular.ttf') format('truetype'), url('../fonts/glyphicons-halflings-regular.svg#glyphicons_halflingsregular') format('svg'); +} +.glyphicon { + position: relative; + top: 1px; + display: inline-block; + font-family: 'Glyphicons Halflings'; + font-style: normal; + font-weight: normal; + line-height: 1; + + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; +} +.glyphicon-asterisk:before { + content: "\002a"; +} +.glyphicon-plus:before { + content: "\002b"; +} +.glyphicon-euro:before, +.glyphicon-eur:before { + content: "\20ac"; +} +.glyphicon-minus:before { + content: "\2212"; +} +.glyphicon-cloud:before { + content: "\2601"; +} +.glyphicon-envelope:before { + content: "\2709"; +} +.glyphicon-pencil:before { + content: "\270f"; +} +.glyphicon-glass:before { + content: "\e001"; +} +.glyphicon-music:before { + content: "\e002"; +} +.glyphicon-search:before { + content: "\e003"; +} +.glyphicon-heart:before { + content: "\e005"; +} +.glyphicon-star:before { + content: "\e006"; +} +.glyphicon-star-empty:before { + content: "\e007"; +} +.glyphicon-user:before { + content: "\e008"; +} +.glyphicon-film:before { + content: "\e009"; +} +.glyphicon-th-large:before { + content: "\e010"; +} +.glyphicon-th:before { + content: "\e011"; +} +.glyphicon-th-list:before { + content: "\e012"; +} +.glyphicon-ok:before { + content: "\e013"; +} +.glyphicon-remove:before { + content: "\e014"; +} +.glyphicon-zoom-in:before { + content: "\e015"; +} +.glyphicon-zoom-out:before { + content: "\e016"; +} +.glyphicon-off:before { + content: "\e017"; +} +.glyphicon-signal:before { + content: "\e018"; +} +.glyphicon-cog:before { + content: "\e019"; +} +.glyphicon-trash:before { + content: "\e020"; +} +.glyphicon-home:before { + content: "\e021"; +} +.glyphicon-file:before { + content: "\e022"; +} +.glyphicon-time:before { + content: "\e023"; +} +.glyphicon-road:before { + content: "\e024"; +} +.glyphicon-download-alt:before { + content: "\e025"; +} +.glyphicon-download:before { + content: "\e026"; +} +.glyphicon-upload:before { + content: "\e027"; +} +.glyphicon-inbox:before { + content: "\e028"; +} +.glyphicon-play-circle:before { + content: "\e029"; +} +.glyphicon-repeat:before { + content: "\e030"; +} +.glyphicon-refresh:before { + content: "\e031"; +} +.glyphicon-list-alt:before { + content: "\e032"; +} +.glyphicon-lock:before { + content: "\e033"; +} +.glyphicon-flag:before { + content: "\e034"; +} +.glyphicon-headphones:before { + content: "\e035"; +} +.glyphicon-volume-off:before { + content: "\e036"; +} +.glyphicon-volume-down:before { + content: "\e037"; +} +.glyphicon-volume-up:before { + content: "\e038"; +} +.glyphicon-qrcode:before { + content: "\e039"; +} +.glyphicon-barcode:before { + content: "\e040"; +} +.glyphicon-tag:before { + content: "\e041"; +} +.glyphicon-tags:before { + content: "\e042"; +} +.glyphicon-book:before { + content: "\e043"; +} +.glyphicon-bookmark:before { + content: "\e044"; +} +.glyphicon-print:before { + content: "\e045"; +} +.glyphicon-camera:before { + content: "\e046"; +} +.glyphicon-font:before { + content: "\e047"; +} +.glyphicon-bold:before { + content: "\e048"; +} +.glyphicon-italic:before { + content: "\e049"; +} +.glyphicon-text-height:before { + content: "\e050"; +} +.glyphicon-text-width:before { + content: "\e051"; +} +.glyphicon-align-left:before { + content: "\e052"; +} +.glyphicon-align-center:before { + content: "\e053"; +} +.glyphicon-align-right:before { + content: "\e054"; +} +.glyphicon-align-justify:before { + content: "\e055"; +} +.glyphicon-list:before { + content: "\e056"; +} +.glyphicon-indent-left:before { + content: "\e057"; +} +.glyphicon-indent-right:before { + content: "\e058"; +} +.glyphicon-facetime-video:before { + content: "\e059"; +} +.glyphicon-picture:before { + content: "\e060"; +} +.glyphicon-map-marker:before { + content: "\e062"; +} +.glyphicon-adjust:before { + content: "\e063"; +} +.glyphicon-tint:before { + content: "\e064"; +} +.glyphicon-edit:before { + content: "\e065"; +} +.glyphicon-share:before { + content: "\e066"; +} +.glyphicon-check:before { + content: "\e067"; +} +.glyphicon-move:before { + content: "\e068"; +} +.glyphicon-step-backward:before { + content: "\e069"; +} +.glyphicon-fast-backward:before { + content: "\e070"; +} +.glyphicon-backward:before { + content: "\e071"; +} +.glyphicon-play:before { + content: "\e072"; +} +.glyphicon-pause:before { + content: "\e073"; +} +.glyphicon-stop:before { + content: "\e074"; +} +.glyphicon-forward:before { + content: "\e075"; +} +.glyphicon-fast-forward:before { + content: "\e076"; +} +.glyphicon-step-forward:before { + content: "\e077"; +} +.glyphicon-eject:before { + content: "\e078"; +} +.glyphicon-chevron-left:before { + content: "\e079"; +} +.glyphicon-chevron-right:before { + content: "\e080"; +} +.glyphicon-plus-sign:before { + content: "\e081"; +} +.glyphicon-minus-sign:before { + content: "\e082"; +} +.glyphicon-remove-sign:before { + content: "\e083"; +} +.glyphicon-ok-sign:before { + content: "\e084"; +} +.glyphicon-question-sign:before { + content: "\e085"; +} +.glyphicon-info-sign:before { + content: "\e086"; +} +.glyphicon-screenshot:before { + content: "\e087"; +} +.glyphicon-remove-circle:before { + content: "\e088"; +} +.glyphicon-ok-circle:before { + content: "\e089"; +} +.glyphicon-ban-circle:before { + content: "\e090"; +} +.glyphicon-arrow-left:before { + content: "\e091"; +} +.glyphicon-arrow-right:before { + content: "\e092"; +} +.glyphicon-arrow-up:before { + content: "\e093"; +} +.glyphicon-arrow-down:before { + content: "\e094"; +} +.glyphicon-share-alt:before { + content: "\e095"; +} +.glyphicon-resize-full:before { + content: "\e096"; +} +.glyphicon-resize-small:before { + content: "\e097"; +} +.glyphicon-exclamation-sign:before { + content: "\e101"; +} +.glyphicon-gift:before { + content: "\e102"; +} +.glyphicon-leaf:before { + content: "\e103"; +} +.glyphicon-fire:before { + content: "\e104"; +} +.glyphicon-eye-open:before { + content: "\e105"; +} +.glyphicon-eye-close:before { + content: "\e106"; +} +.glyphicon-warning-sign:before { + content: "\e107"; +} +.glyphicon-plane:before { + content: "\e108"; +} +.glyphicon-calendar:before { + content: "\e109"; +} +.glyphicon-random:before { + content: "\e110"; +} +.glyphicon-comment:before { + content: "\e111"; +} +.glyphicon-magnet:before { + content: "\e112"; +} +.glyphicon-chevron-up:before { + content: "\e113"; +} +.glyphicon-chevron-down:before { + content: "\e114"; +} +.glyphicon-retweet:before { + content: "\e115"; +} +.glyphicon-shopping-cart:before { + content: "\e116"; +} +.glyphicon-folder-close:before { + content: "\e117"; +} +.glyphicon-folder-open:before { + content: "\e118"; +} +.glyphicon-resize-vertical:before { + content: "\e119"; +} +.glyphicon-resize-horizontal:before { + content: "\e120"; +} +.glyphicon-hdd:before { + content: "\e121"; +} +.glyphicon-bullhorn:before { + content: "\e122"; +} +.glyphicon-bell:before { + content: "\e123"; +} +.glyphicon-certificate:before { + content: "\e124"; +} +.glyphicon-thumbs-up:before { + content: "\e125"; +} +.glyphicon-thumbs-down:before { + content: "\e126"; +} +.glyphicon-hand-right:before { + content: "\e127"; +} +.glyphicon-hand-left:before { + content: "\e128"; +} +.glyphicon-hand-up:before { + content: "\e129"; +} +.glyphicon-hand-down:before { + content: "\e130"; +} +.glyphicon-circle-arrow-right:before { + content: "\e131"; +} +.glyphicon-circle-arrow-left:before { + content: "\e132"; +} +.glyphicon-circle-arrow-up:before { + content: "\e133"; +} +.glyphicon-circle-arrow-down:before { + content: "\e134"; +} +.glyphicon-globe:before { + content: "\e135"; +} +.glyphicon-wrench:before { + content: "\e136"; +} +.glyphicon-tasks:before { + content: "\e137"; +} +.glyphicon-filter:before { + content: "\e138"; +} +.glyphicon-briefcase:before { + content: "\e139"; +} +.glyphicon-fullscreen:before { + content: "\e140"; +} +.glyphicon-dashboard:before { + content: "\e141"; +} +.glyphicon-paperclip:before { + content: "\e142"; +} +.glyphicon-heart-empty:before { + content: "\e143"; +} +.glyphicon-link:before { + content: "\e144"; +} +.glyphicon-phone:before { + content: "\e145"; +} +.glyphicon-pushpin:before { + content: "\e146"; +} +.glyphicon-usd:before { + content: "\e148"; +} +.glyphicon-gbp:before { + content: "\e149"; +} +.glyphicon-sort:before { + content: "\e150"; +} +.glyphicon-sort-by-alphabet:before { + content: "\e151"; +} +.glyphicon-sort-by-alphabet-alt:before { + content: "\e152"; +} +.glyphicon-sort-by-order:before { + content: "\e153"; +} +.glyphicon-sort-by-order-alt:before { + content: "\e154"; +} +.glyphicon-sort-by-attributes:before { + content: "\e155"; +} +.glyphicon-sort-by-attributes-alt:before { + content: "\e156"; +} +.glyphicon-unchecked:before { + content: "\e157"; +} +.glyphicon-expand:before { + content: "\e158"; +} +.glyphicon-collapse-down:before { + content: "\e159"; +} +.glyphicon-collapse-up:before { + content: "\e160"; +} +.glyphicon-log-in:before { + content: "\e161"; +} +.glyphicon-flash:before { + content: "\e162"; +} +.glyphicon-log-out:before { + content: "\e163"; +} +.glyphicon-new-window:before { + content: "\e164"; +} +.glyphicon-record:before { + content: "\e165"; +} +.glyphicon-save:before { + content: "\e166"; +} +.glyphicon-open:before { + content: "\e167"; +} +.glyphicon-saved:before { + content: "\e168"; +} +.glyphicon-import:before { + content: "\e169"; +} +.glyphicon-export:before { + content: "\e170"; +} +.glyphicon-send:before { + content: "\e171"; +} +.glyphicon-floppy-disk:before { + content: "\e172"; +} +.glyphicon-floppy-saved:before { + content: "\e173"; +} +.glyphicon-floppy-remove:before { + content: "\e174"; +} +.glyphicon-floppy-save:before { + content: "\e175"; +} +.glyphicon-floppy-open:before { + content: "\e176"; +} +.glyphicon-credit-card:before { + content: "\e177"; +} +.glyphicon-transfer:before { + content: "\e178"; +} +.glyphicon-cutlery:before { + content: "\e179"; +} +.glyphicon-header:before { + content: "\e180"; +} +.glyphicon-compressed:before { + content: "\e181"; +} +.glyphicon-earphone:before { + content: "\e182"; +} +.glyphicon-phone-alt:before { + content: "\e183"; +} +.glyphicon-tower:before { + content: "\e184"; +} +.glyphicon-stats:before { + content: "\e185"; +} +.glyphicon-sd-video:before { + content: "\e186"; +} +.glyphicon-hd-video:before { + content: "\e187"; +} +.glyphicon-subtitles:before { + content: "\e188"; +} +.glyphicon-sound-stereo:before { + content: "\e189"; +} +.glyphicon-sound-dolby:before { + content: "\e190"; +} +.glyphicon-sound-5-1:before { + content: "\e191"; +} +.glyphicon-sound-6-1:before { + content: "\e192"; +} +.glyphicon-sound-7-1:before { + content: "\e193"; +} +.glyphicon-copyright-mark:before { + content: "\e194"; +} +.glyphicon-registration-mark:before { + content: "\e195"; +} +.glyphicon-cloud-download:before { + content: "\e197"; +} +.glyphicon-cloud-upload:before { + content: "\e198"; +} +.glyphicon-tree-conifer:before { + content: "\e199"; +} +.glyphicon-tree-deciduous:before { + content: "\e200"; +} +.glyphicon-cd:before { + content: "\e201"; +} +.glyphicon-save-file:before { + content: "\e202"; +} +.glyphicon-open-file:before { + content: "\e203"; +} +.glyphicon-level-up:before { + content: "\e204"; +} +.glyphicon-copy:before { + content: "\e205"; +} +.glyphicon-paste:before { + content: "\e206"; +} +.glyphicon-alert:before { + content: "\e209"; +} +.glyphicon-equalizer:before { + content: "\e210"; +} +.glyphicon-king:before { + content: "\e211"; +} +.glyphicon-queen:before { + content: "\e212"; +} +.glyphicon-pawn:before { + content: "\e213"; +} +.glyphicon-bishop:before { + content: "\e214"; +} +.glyphicon-knight:before { + content: "\e215"; +} +.glyphicon-baby-formula:before { + content: "\e216"; +} +.glyphicon-tent:before { + content: "\26fa"; +} +.glyphicon-blackboard:before { + content: "\e218"; +} +.glyphicon-bed:before { + content: "\e219"; +} +.glyphicon-apple:before { + content: "\f8ff"; +} +.glyphicon-erase:before { + content: "\e221"; +} +.glyphicon-hourglass:before { + content: "\231b"; +} +.glyphicon-lamp:before { + content: "\e223"; +} +.glyphicon-duplicate:before { + content: "\e224"; +} +.glyphicon-piggy-bank:before { + content: "\e225"; +} +.glyphicon-scissors:before { + content: "\e226"; +} +.glyphicon-bitcoin:before { + content: "\e227"; +} +.glyphicon-btc:before { + content: "\e227"; +} +.glyphicon-xbt:before { + content: "\e227"; +} +.glyphicon-yen:before { + content: "\00a5"; +} +.glyphicon-jpy:before { + content: "\00a5"; +} +.glyphicon-ruble:before { + content: "\20bd"; +} +.glyphicon-rub:before { + content: "\20bd"; +} +.glyphicon-scale:before { + content: "\e230"; +} +.glyphicon-ice-lolly:before { + content: "\e231"; +} +.glyphicon-ice-lolly-tasted:before { + content: "\e232"; +} +.glyphicon-education:before { + content: "\e233"; +} +.glyphicon-option-horizontal:before { + content: "\e234"; +} +.glyphicon-option-vertical:before { + content: "\e235"; +} +.glyphicon-menu-hamburger:before { + content: "\e236"; +} +.glyphicon-modal-window:before { + content: "\e237"; +} +.glyphicon-oil:before { + content: "\e238"; +} +.glyphicon-grain:before { + content: "\e239"; +} +.glyphicon-sunglasses:before { + content: "\e240"; +} +.glyphicon-text-size:before { + content: "\e241"; +} +.glyphicon-text-color:before { + content: "\e242"; +} +.glyphicon-text-background:before { + content: "\e243"; +} +.glyphicon-object-align-top:before { + content: "\e244"; +} +.glyphicon-object-align-bottom:before { + content: "\e245"; +} +.glyphicon-object-align-horizontal:before { + content: "\e246"; +} +.glyphicon-object-align-left:before { + content: "\e247"; +} +.glyphicon-object-align-vertical:before { + content: "\e248"; +} +.glyphicon-object-align-right:before { + content: "\e249"; +} +.glyphicon-triangle-right:before { + content: "\e250"; +} +.glyphicon-triangle-left:before { + content: "\e251"; +} +.glyphicon-triangle-bottom:before { + content: "\e252"; +} +.glyphicon-triangle-top:before { + content: "\e253"; +} +.glyphicon-console:before { + content: "\e254"; +} +.glyphicon-superscript:before { + content: "\e255"; +} +.glyphicon-subscript:before { + content: "\e256"; +} +.glyphicon-menu-left:before { + content: "\e257"; +} +.glyphicon-menu-right:before { + content: "\e258"; +} +.glyphicon-menu-down:before { + content: "\e259"; +} +.glyphicon-menu-up:before { + content: "\e260"; +} +* { + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} +*:before, +*:after { + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} +html { + font-size: 10px; + + -webkit-tap-highlight-color: rgba(0, 0, 0, 0); +} +body { + font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; + font-size: 14px; + line-height: 1.42857143; + color: #333; + background-color: #fff; +} +input, +button, +select, +textarea { + font-family: inherit; + font-size: inherit; + line-height: inherit; +} +a { + color: #337ab7; + text-decoration: none; +} +a:hover, +a:focus { + color: #23527c; + text-decoration: underline; +} +a:focus { + outline: 5px auto -webkit-focus-ring-color; + outline-offset: -2px; +} +figure { + margin: 0; +} +img { + vertical-align: middle; +} +.img-responsive, +.thumbnail > img, +.thumbnail a > img, +.carousel-inner > .item > img, +.carousel-inner > .item > a > img { + display: block; + max-width: 100%; + height: auto; +} +.img-rounded { + border-radius: 6px; +} +.img-thumbnail { + display: inline-block; + max-width: 100%; + height: auto; + padding: 4px; + line-height: 1.42857143; + background-color: #fff; + border: 1px solid #ddd; + border-radius: 4px; + -webkit-transition: all .2s ease-in-out; + -o-transition: all .2s ease-in-out; + transition: all .2s ease-in-out; +} +.img-circle { + border-radius: 50%; +} +hr { + margin-top: 20px; + margin-bottom: 20px; + border: 0; + border-top: 1px solid #eee; +} +.sr-only { + position: absolute; + width: 1px; + height: 1px; + padding: 0; + margin: -1px; + overflow: hidden; + clip: rect(0, 0, 0, 0); + border: 0; +} +.sr-only-focusable:active, +.sr-only-focusable:focus { + position: static; + width: auto; + height: auto; + margin: 0; + overflow: visible; + clip: auto; +} +[role="button"] { + cursor: pointer; +} +h1, +h2, +h3, +h4, +h5, +h6, +.h1, +.h2, +.h3, +.h4, +.h5, +.h6 { + font-family: inherit; + font-weight: 500; + line-height: 1.1; + color: inherit; +} +h1 small, +h2 small, +h3 small, +h4 small, +h5 small, +h6 small, +.h1 small, +.h2 small, +.h3 small, +.h4 small, +.h5 small, +.h6 small, +h1 .small, +h2 .small, +h3 .small, +h4 .small, +h5 .small, +h6 .small, +.h1 .small, +.h2 .small, +.h3 .small, +.h4 .small, +.h5 .small, +.h6 .small { + font-weight: normal; + line-height: 1; + color: #777; +} +h1, +.h1, +h2, +.h2, +h3, +.h3 { + margin-top: 20px; + margin-bottom: 10px; +} +h1 small, +.h1 small, +h2 small, +.h2 small, +h3 small, +.h3 small, +h1 .small, +.h1 .small, +h2 .small, +.h2 .small, +h3 .small, +.h3 .small { + font-size: 65%; +} +h4, +.h4, +h5, +.h5, +h6, +.h6 { + margin-top: 10px; + margin-bottom: 10px; +} +h4 small, +.h4 small, +h5 small, +.h5 small, +h6 small, +.h6 small, +h4 .small, +.h4 .small, +h5 .small, +.h5 .small, +h6 .small, +.h6 .small { + font-size: 75%; +} +h1, +.h1 { + font-size: 36px; +} +h2, +.h2 { + font-size: 30px; +} +h3, +.h3 { + font-size: 24px; +} +h4, +.h4 { + font-size: 18px; +} +h5, +.h5 { + font-size: 14px; +} +h6, +.h6 { + font-size: 12px; +} +p { + margin: 0 0 10px; +} +.lead { + margin-bottom: 20px; + font-size: 16px; + font-weight: 300; + line-height: 1.4; +} +@media (min-width: 768px) { + .lead { + font-size: 21px; + } +} +small, +.small { + font-size: 85%; +} +mark, +.mark { + padding: .2em; + background-color: #fcf8e3; +} +.text-left { + text-align: left; +} +.text-right { + text-align: right; +} +.text-center { + text-align: center; +} +.text-justify { + text-align: justify; +} +.text-nowrap { + white-space: nowrap; +} +.text-lowercase { + text-transform: lowercase; +} +.text-uppercase { + text-transform: uppercase; +} +.text-capitalize { + text-transform: capitalize; +} +.text-muted { + color: #777; +} +.text-primary { + color: #337ab7; +} +a.text-primary:hover, +a.text-primary:focus { + color: #286090; +} +.text-success { + color: #3c763d; +} +a.text-success:hover, +a.text-success:focus { + color: #2b542c; +} +.text-info { + color: #31708f; +} +a.text-info:hover, +a.text-info:focus { + color: #245269; +} +.text-warning { + color: #8a6d3b; +} +a.text-warning:hover, +a.text-warning:focus { + color: #66512c; +} +.text-danger { + color: #a94442; +} +a.text-danger:hover, +a.text-danger:focus { + color: #843534; +} +.bg-primary { + color: #fff; + background-color: #337ab7; +} +a.bg-primary:hover, +a.bg-primary:focus { + background-color: #286090; +} +.bg-success { + background-color: #dff0d8; +} +a.bg-success:hover, +a.bg-success:focus { + background-color: #c1e2b3; +} +.bg-info { + background-color: #d9edf7; +} +a.bg-info:hover, +a.bg-info:focus { + background-color: #afd9ee; +} +.bg-warning { + background-color: #fcf8e3; +} +a.bg-warning:hover, +a.bg-warning:focus { + background-color: #f7ecb5; +} +.bg-danger { + background-color: #f2dede; +} +a.bg-danger:hover, +a.bg-danger:focus { + background-color: #e4b9b9; +} +.page-header { + padding-bottom: 9px; + margin: 40px 0 20px; + border-bottom: 1px solid #eee; +} +ul, +ol { + margin-top: 0; + margin-bottom: 10px; +} +ul ul, +ol ul, +ul ol, +ol ol { + margin-bottom: 0; +} +.list-unstyled { + padding-left: 0; + list-style: none; +} +.list-inline { + padding-left: 0; + margin-left: -5px; + list-style: none; +} +.list-inline > li { + display: inline-block; + padding-right: 5px; + padding-left: 5px; +} +dl { + margin-top: 0; + margin-bottom: 20px; +} +dt, +dd { + line-height: 1.42857143; +} +dt { + font-weight: bold; +} +dd { + margin-left: 0; +} +@media (min-width: 768px) { + .dl-horizontal dt { + float: left; + width: 160px; + overflow: hidden; + clear: left; + text-align: right; + text-overflow: ellipsis; + white-space: nowrap; + } + .dl-horizontal dd { + margin-left: 180px; + } +} +abbr[title], +abbr[data-original-title] { + cursor: help; + border-bottom: 1px dotted #777; +} +.initialism { + font-size: 90%; + text-transform: uppercase; +} +blockquote { + padding: 10px 20px; + margin: 0 0 20px; + font-size: 17.5px; + border-left: 5px solid #eee; +} +blockquote p:last-child, +blockquote ul:last-child, +blockquote ol:last-child { + margin-bottom: 0; +} +blockquote footer, +blockquote small, +blockquote .small { + display: block; + font-size: 80%; + line-height: 1.42857143; + color: #777; +} +blockquote footer:before, +blockquote small:before, +blockquote .small:before { + content: '\2014 \00A0'; +} +.blockquote-reverse, +blockquote.pull-right { + padding-right: 15px; + padding-left: 0; + text-align: right; + border-right: 5px solid #eee; + border-left: 0; +} +.blockquote-reverse footer:before, +blockquote.pull-right footer:before, +.blockquote-reverse small:before, +blockquote.pull-right small:before, +.blockquote-reverse .small:before, +blockquote.pull-right .small:before { + content: ''; +} +.blockquote-reverse footer:after, +blockquote.pull-right footer:after, +.blockquote-reverse small:after, +blockquote.pull-right small:after, +.blockquote-reverse .small:after, +blockquote.pull-right .small:after { + content: '\00A0 \2014'; +} +address { + margin-bottom: 20px; + font-style: normal; + line-height: 1.42857143; +} +code, +kbd, +pre, +samp { + font-family: Menlo, Monaco, Consolas, "Courier New", monospace; +} +code { + padding: 2px 4px; + font-size: 90%; + color: #c7254e; + background-color: #f9f2f4; + border-radius: 4px; +} +kbd { + padding: 2px 4px; + font-size: 90%; + color: #fff; + background-color: #333; + border-radius: 3px; + -webkit-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, .25); + box-shadow: inset 0 -1px 0 rgba(0, 0, 0, .25); +} +kbd kbd { + padding: 0; + font-size: 100%; + font-weight: bold; + -webkit-box-shadow: none; + box-shadow: none; +} +pre { + display: block; + padding: 9.5px; + margin: 0 0 10px; + font-size: 13px; + line-height: 1.42857143; + color: #333; + word-break: break-all; + word-wrap: break-word; + background-color: #f5f5f5; + border: 1px solid #ccc; + border-radius: 4px; +} +pre code { + padding: 0; + font-size: inherit; + color: inherit; + white-space: pre-wrap; + background-color: transparent; + border-radius: 0; +} +.pre-scrollable { + max-height: 340px; + overflow-y: scroll; +} +.container { + padding-right: 15px; + padding-left: 15px; + margin-right: auto; + margin-left: auto; +} +@media (min-width: 768px) { + .container { + width: 750px; + } +} +@media (min-width: 992px) { + .container { + width: 970px; + } +} +@media (min-width: 1200px) { + .container { + width: 1170px; + } +} +.container-fluid { + padding-right: 15px; + padding-left: 15px; + margin-right: auto; + margin-left: auto; +} +.row { + margin-right: -15px; + margin-left: -15px; +} +.col-xs-1, .col-sm-1, .col-md-1, .col-lg-1, .col-xs-2, .col-sm-2, .col-md-2, .col-lg-2, .col-xs-3, .col-sm-3, .col-md-3, .col-lg-3, .col-xs-4, .col-sm-4, .col-md-4, .col-lg-4, .col-xs-5, .col-sm-5, .col-md-5, .col-lg-5, .col-xs-6, .col-sm-6, .col-md-6, .col-lg-6, .col-xs-7, .col-sm-7, .col-md-7, .col-lg-7, .col-xs-8, .col-sm-8, .col-md-8, .col-lg-8, .col-xs-9, .col-sm-9, .col-md-9, .col-lg-9, .col-xs-10, .col-sm-10, .col-md-10, .col-lg-10, .col-xs-11, .col-sm-11, .col-md-11, .col-lg-11, .col-xs-12, .col-sm-12, .col-md-12, .col-lg-12 { + position: relative; + min-height: 1px; + padding-right: 15px; + padding-left: 15px; +} +.col-xs-1, .col-xs-2, .col-xs-3, .col-xs-4, .col-xs-5, .col-xs-6, .col-xs-7, .col-xs-8, .col-xs-9, .col-xs-10, .col-xs-11, .col-xs-12 { + float: left; +} +.col-xs-12 { + width: 100%; +} +.col-xs-11 { + width: 91.66666667%; +} +.col-xs-10 { + width: 83.33333333%; +} +.col-xs-9 { + width: 75%; +} +.col-xs-8 { + width: 66.66666667%; +} +.col-xs-7 { + width: 58.33333333%; +} +.col-xs-6 { + width: 50%; +} +.col-xs-5 { + width: 41.66666667%; +} +.col-xs-4 { + width: 33.33333333%; +} +.col-xs-3 { + width: 25%; +} +.col-xs-2 { + width: 16.66666667%; +} +.col-xs-1 { + width: 8.33333333%; +} +.col-xs-pull-12 { + right: 100%; +} +.col-xs-pull-11 { + right: 91.66666667%; +} +.col-xs-pull-10 { + right: 83.33333333%; +} +.col-xs-pull-9 { + right: 75%; +} +.col-xs-pull-8 { + right: 66.66666667%; +} +.col-xs-pull-7 { + right: 58.33333333%; +} +.col-xs-pull-6 { + right: 50%; +} +.col-xs-pull-5 { + right: 41.66666667%; +} +.col-xs-pull-4 { + right: 33.33333333%; +} +.col-xs-pull-3 { + right: 25%; +} +.col-xs-pull-2 { + right: 16.66666667%; +} +.col-xs-pull-1 { + right: 8.33333333%; +} +.col-xs-pull-0 { + right: auto; +} +.col-xs-push-12 { + left: 100%; +} +.col-xs-push-11 { + left: 91.66666667%; +} +.col-xs-push-10 { + left: 83.33333333%; +} +.col-xs-push-9 { + left: 75%; +} +.col-xs-push-8 { + left: 66.66666667%; +} +.col-xs-push-7 { + left: 58.33333333%; +} +.col-xs-push-6 { + left: 50%; +} +.col-xs-push-5 { + left: 41.66666667%; +} +.col-xs-push-4 { + left: 33.33333333%; +} +.col-xs-push-3 { + left: 25%; +} +.col-xs-push-2 { + left: 16.66666667%; +} +.col-xs-push-1 { + left: 8.33333333%; +} +.col-xs-push-0 { + left: auto; +} +.col-xs-offset-12 { + margin-left: 100%; +} +.col-xs-offset-11 { + margin-left: 91.66666667%; +} +.col-xs-offset-10 { + margin-left: 83.33333333%; +} +.col-xs-offset-9 { + margin-left: 75%; +} +.col-xs-offset-8 { + margin-left: 66.66666667%; +} +.col-xs-offset-7 { + margin-left: 58.33333333%; +} +.col-xs-offset-6 { + margin-left: 50%; +} +.col-xs-offset-5 { + margin-left: 41.66666667%; +} +.col-xs-offset-4 { + margin-left: 33.33333333%; +} +.col-xs-offset-3 { + margin-left: 25%; +} +.col-xs-offset-2 { + margin-left: 16.66666667%; +} +.col-xs-offset-1 { + margin-left: 8.33333333%; +} +.col-xs-offset-0 { + margin-left: 0; +} +@media (min-width: 768px) { + .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12 { + float: left; + } + .col-sm-12 { + width: 100%; + } + .col-sm-11 { + width: 91.66666667%; + } + .col-sm-10 { + width: 83.33333333%; + } + .col-sm-9 { + width: 75%; + } + .col-sm-8 { + width: 66.66666667%; + } + .col-sm-7 { + width: 58.33333333%; + } + .col-sm-6 { + width: 50%; + } + .col-sm-5 { + width: 41.66666667%; + } + .col-sm-4 { + width: 33.33333333%; + } + .col-sm-3 { + width: 25%; + } + .col-sm-2 { + width: 16.66666667%; + } + .col-sm-1 { + width: 8.33333333%; + } + .col-sm-pull-12 { + right: 100%; + } + .col-sm-pull-11 { + right: 91.66666667%; + } + .col-sm-pull-10 { + right: 83.33333333%; + } + .col-sm-pull-9 { + right: 75%; + } + .col-sm-pull-8 { + right: 66.66666667%; + } + .col-sm-pull-7 { + right: 58.33333333%; + } + .col-sm-pull-6 { + right: 50%; + } + .col-sm-pull-5 { + right: 41.66666667%; + } + .col-sm-pull-4 { + right: 33.33333333%; + } + .col-sm-pull-3 { + right: 25%; + } + .col-sm-pull-2 { + right: 16.66666667%; + } + .col-sm-pull-1 { + right: 8.33333333%; + } + .col-sm-pull-0 { + right: auto; + } + .col-sm-push-12 { + left: 100%; + } + .col-sm-push-11 { + left: 91.66666667%; + } + .col-sm-push-10 { + left: 83.33333333%; + } + .col-sm-push-9 { + left: 75%; + } + .col-sm-push-8 { + left: 66.66666667%; + } + .col-sm-push-7 { + left: 58.33333333%; + } + .col-sm-push-6 { + left: 50%; + } + .col-sm-push-5 { + left: 41.66666667%; + } + .col-sm-push-4 { + left: 33.33333333%; + } + .col-sm-push-3 { + left: 25%; + } + .col-sm-push-2 { + left: 16.66666667%; + } + .col-sm-push-1 { + left: 8.33333333%; + } + .col-sm-push-0 { + left: auto; + } + .col-sm-offset-12 { + margin-left: 100%; + } + .col-sm-offset-11 { + margin-left: 91.66666667%; + } + .col-sm-offset-10 { + margin-left: 83.33333333%; + } + .col-sm-offset-9 { + margin-left: 75%; + } + .col-sm-offset-8 { + margin-left: 66.66666667%; + } + .col-sm-offset-7 { + margin-left: 58.33333333%; + } + .col-sm-offset-6 { + margin-left: 50%; + } + .col-sm-offset-5 { + margin-left: 41.66666667%; + } + .col-sm-offset-4 { + margin-left: 33.33333333%; + } + .col-sm-offset-3 { + margin-left: 25%; + } + .col-sm-offset-2 { + margin-left: 16.66666667%; + } + .col-sm-offset-1 { + margin-left: 8.33333333%; + } + .col-sm-offset-0 { + margin-left: 0; + } +} +@media (min-width: 992px) { + .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12 { + float: left; + } + .col-md-12 { + width: 100%; + } + .col-md-11 { + width: 91.66666667%; + } + .col-md-10 { + width: 83.33333333%; + } + .col-md-9 { + width: 75%; + } + .col-md-8 { + width: 66.66666667%; + } + .col-md-7 { + width: 58.33333333%; + } + .col-md-6 { + width: 50%; + } + .col-md-5 { + width: 41.66666667%; + } + .col-md-4 { + width: 33.33333333%; + } + .col-md-3 { + width: 25%; + } + .col-md-2 { + width: 16.66666667%; + } + .col-md-1 { + width: 8.33333333%; + } + .col-md-pull-12 { + right: 100%; + } + .col-md-pull-11 { + right: 91.66666667%; + } + .col-md-pull-10 { + right: 83.33333333%; + } + .col-md-pull-9 { + right: 75%; + } + .col-md-pull-8 { + right: 66.66666667%; + } + .col-md-pull-7 { + right: 58.33333333%; + } + .col-md-pull-6 { + right: 50%; + } + .col-md-pull-5 { + right: 41.66666667%; + } + .col-md-pull-4 { + right: 33.33333333%; + } + .col-md-pull-3 { + right: 25%; + } + .col-md-pull-2 { + right: 16.66666667%; + } + .col-md-pull-1 { + right: 8.33333333%; + } + .col-md-pull-0 { + right: auto; + } + .col-md-push-12 { + left: 100%; + } + .col-md-push-11 { + left: 91.66666667%; + } + .col-md-push-10 { + left: 83.33333333%; + } + .col-md-push-9 { + left: 75%; + } + .col-md-push-8 { + left: 66.66666667%; + } + .col-md-push-7 { + left: 58.33333333%; + } + .col-md-push-6 { + left: 50%; + } + .col-md-push-5 { + left: 41.66666667%; + } + .col-md-push-4 { + left: 33.33333333%; + } + .col-md-push-3 { + left: 25%; + } + .col-md-push-2 { + left: 16.66666667%; + } + .col-md-push-1 { + left: 8.33333333%; + } + .col-md-push-0 { + left: auto; + } + .col-md-offset-12 { + margin-left: 100%; + } + .col-md-offset-11 { + margin-left: 91.66666667%; + } + .col-md-offset-10 { + margin-left: 83.33333333%; + } + .col-md-offset-9 { + margin-left: 75%; + } + .col-md-offset-8 { + margin-left: 66.66666667%; + } + .col-md-offset-7 { + margin-left: 58.33333333%; + } + .col-md-offset-6 { + margin-left: 50%; + } + .col-md-offset-5 { + margin-left: 41.66666667%; + } + .col-md-offset-4 { + margin-left: 33.33333333%; + } + .col-md-offset-3 { + margin-left: 25%; + } + .col-md-offset-2 { + margin-left: 16.66666667%; + } + .col-md-offset-1 { + margin-left: 8.33333333%; + } + .col-md-offset-0 { + margin-left: 0; + } +} +@media (min-width: 1200px) { + .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12 { + float: left; + } + .col-lg-12 { + width: 100%; + } + .col-lg-11 { + width: 91.66666667%; + } + .col-lg-10 { + width: 83.33333333%; + } + .col-lg-9 { + width: 75%; + } + .col-lg-8 { + width: 66.66666667%; + } + .col-lg-7 { + width: 58.33333333%; + } + .col-lg-6 { + width: 50%; + } + .col-lg-5 { + width: 41.66666667%; + } + .col-lg-4 { + width: 33.33333333%; + } + .col-lg-3 { + width: 25%; + } + .col-lg-2 { + width: 16.66666667%; + } + .col-lg-1 { + width: 8.33333333%; + } + .col-lg-pull-12 { + right: 100%; + } + .col-lg-pull-11 { + right: 91.66666667%; + } + .col-lg-pull-10 { + right: 83.33333333%; + } + .col-lg-pull-9 { + right: 75%; + } + .col-lg-pull-8 { + right: 66.66666667%; + } + .col-lg-pull-7 { + right: 58.33333333%; + } + .col-lg-pull-6 { + right: 50%; + } + .col-lg-pull-5 { + right: 41.66666667%; + } + .col-lg-pull-4 { + right: 33.33333333%; + } + .col-lg-pull-3 { + right: 25%; + } + .col-lg-pull-2 { + right: 16.66666667%; + } + .col-lg-pull-1 { + right: 8.33333333%; + } + .col-lg-pull-0 { + right: auto; + } + .col-lg-push-12 { + left: 100%; + } + .col-lg-push-11 { + left: 91.66666667%; + } + .col-lg-push-10 { + left: 83.33333333%; + } + .col-lg-push-9 { + left: 75%; + } + .col-lg-push-8 { + left: 66.66666667%; + } + .col-lg-push-7 { + left: 58.33333333%; + } + .col-lg-push-6 { + left: 50%; + } + .col-lg-push-5 { + left: 41.66666667%; + } + .col-lg-push-4 { + left: 33.33333333%; + } + .col-lg-push-3 { + left: 25%; + } + .col-lg-push-2 { + left: 16.66666667%; + } + .col-lg-push-1 { + left: 8.33333333%; + } + .col-lg-push-0 { + left: auto; + } + .col-lg-offset-12 { + margin-left: 100%; + } + .col-lg-offset-11 { + margin-left: 91.66666667%; + } + .col-lg-offset-10 { + margin-left: 83.33333333%; + } + .col-lg-offset-9 { + margin-left: 75%; + } + .col-lg-offset-8 { + margin-left: 66.66666667%; + } + .col-lg-offset-7 { + margin-left: 58.33333333%; + } + .col-lg-offset-6 { + margin-left: 50%; + } + .col-lg-offset-5 { + margin-left: 41.66666667%; + } + .col-lg-offset-4 { + margin-left: 33.33333333%; + } + .col-lg-offset-3 { + margin-left: 25%; + } + .col-lg-offset-2 { + margin-left: 16.66666667%; + } + .col-lg-offset-1 { + margin-left: 8.33333333%; + } + .col-lg-offset-0 { + margin-left: 0; + } +} +table { + background-color: transparent; +} +caption { + padding-top: 8px; + padding-bottom: 8px; + color: #777; + text-align: left; +} +th { + text-align: left; +} +.table { + width: 100%; + max-width: 100%; + margin-bottom: 20px; +} +.table > thead > tr > th, +.table > tbody > tr > th, +.table > tfoot > tr > th, +.table > thead > tr > td, +.table > tbody > tr > td, +.table > tfoot > tr > td { + padding: 8px; + line-height: 1.42857143; + vertical-align: top; + border-top: 1px solid #ddd; +} +.table > thead > tr > th { + vertical-align: bottom; + border-bottom: 2px solid #ddd; +} +.table > caption + thead > tr:first-child > th, +.table > colgroup + thead > tr:first-child > th, +.table > thead:first-child > tr:first-child > th, +.table > caption + thead > tr:first-child > td, +.table > colgroup + thead > tr:first-child > td, +.table > thead:first-child > tr:first-child > td { + border-top: 0; +} +.table > tbody + tbody { + border-top: 2px solid #ddd; +} +.table .table { + background-color: #fff; +} +.table-condensed > thead > tr > th, +.table-condensed > tbody > tr > th, +.table-condensed > tfoot > tr > th, +.table-condensed > thead > tr > td, +.table-condensed > tbody > tr > td, +.table-condensed > tfoot > tr > td { + padding: 5px; +} +.table-bordered { + border: 1px solid #ddd; +} +.table-bordered > thead > tr > th, +.table-bordered > tbody > tr > th, +.table-bordered > tfoot > tr > th, +.table-bordered > thead > tr > td, +.table-bordered > tbody > tr > td, +.table-bordered > tfoot > tr > td { + border: 1px solid #ddd; +} +.table-bordered > thead > tr > th, +.table-bordered > thead > tr > td { + border-bottom-width: 2px; +} +.table-striped > tbody > tr:nth-of-type(odd) { + background-color: #f9f9f9; +} +.table-hover > tbody > tr:hover { + background-color: #f5f5f5; +} +table col[class*="col-"] { + position: static; + display: table-column; + float: none; +} +table td[class*="col-"], +table th[class*="col-"] { + position: static; + display: table-cell; + float: none; +} +.table > thead > tr > td.active, +.table > tbody > tr > td.active, +.table > tfoot > tr > td.active, +.table > thead > tr > th.active, +.table > tbody > tr > th.active, +.table > tfoot > tr > th.active, +.table > thead > tr.active > td, +.table > tbody > tr.active > td, +.table > tfoot > tr.active > td, +.table > thead > tr.active > th, +.table > tbody > tr.active > th, +.table > tfoot > tr.active > th { + background-color: #f5f5f5; +} +.table-hover > tbody > tr > td.active:hover, +.table-hover > tbody > tr > th.active:hover, +.table-hover > tbody > tr.active:hover > td, +.table-hover > tbody > tr:hover > .active, +.table-hover > tbody > tr.active:hover > th { + background-color: #e8e8e8; +} +.table > thead > tr > td.success, +.table > tbody > tr > td.success, +.table > tfoot > tr > td.success, +.table > thead > tr > th.success, +.table > tbody > tr > th.success, +.table > tfoot > tr > th.success, +.table > thead > tr.success > td, +.table > tbody > tr.success > td, +.table > tfoot > tr.success > td, +.table > thead > tr.success > th, +.table > tbody > tr.success > th, +.table > tfoot > tr.success > th { + background-color: #dff0d8; +} +.table-hover > tbody > tr > td.success:hover, +.table-hover > tbody > tr > th.success:hover, +.table-hover > tbody > tr.success:hover > td, +.table-hover > tbody > tr:hover > .success, +.table-hover > tbody > tr.success:hover > th { + background-color: #d0e9c6; +} +.table > thead > tr > td.info, +.table > tbody > tr > td.info, +.table > tfoot > tr > td.info, +.table > thead > tr > th.info, +.table > tbody > tr > th.info, +.table > tfoot > tr > th.info, +.table > thead > tr.info > td, +.table > tbody > tr.info > td, +.table > tfoot > tr.info > td, +.table > thead > tr.info > th, +.table > tbody > tr.info > th, +.table > tfoot > tr.info > th { + background-color: #d9edf7; +} +.table-hover > tbody > tr > td.info:hover, +.table-hover > tbody > tr > th.info:hover, +.table-hover > tbody > tr.info:hover > td, +.table-hover > tbody > tr:hover > .info, +.table-hover > tbody > tr.info:hover > th { + background-color: #c4e3f3; +} +.table > thead > tr > td.warning, +.table > tbody > tr > td.warning, +.table > tfoot > tr > td.warning, +.table > thead > tr > th.warning, +.table > tbody > tr > th.warning, +.table > tfoot > tr > th.warning, +.table > thead > tr.warning > td, +.table > tbody > tr.warning > td, +.table > tfoot > tr.warning > td, +.table > thead > tr.warning > th, +.table > tbody > tr.warning > th, +.table > tfoot > tr.warning > th { + background-color: #fcf8e3; +} +.table-hover > tbody > tr > td.warning:hover, +.table-hover > tbody > tr > th.warning:hover, +.table-hover > tbody > tr.warning:hover > td, +.table-hover > tbody > tr:hover > .warning, +.table-hover > tbody > tr.warning:hover > th { + background-color: #faf2cc; +} +.table > thead > tr > td.danger, +.table > tbody > tr > td.danger, +.table > tfoot > tr > td.danger, +.table > thead > tr > th.danger, +.table > tbody > tr > th.danger, +.table > tfoot > tr > th.danger, +.table > thead > tr.danger > td, +.table > tbody > tr.danger > td, +.table > tfoot > tr.danger > td, +.table > thead > tr.danger > th, +.table > tbody > tr.danger > th, +.table > tfoot > tr.danger > th { + background-color: #f2dede; +} +.table-hover > tbody > tr > td.danger:hover, +.table-hover > tbody > tr > th.danger:hover, +.table-hover > tbody > tr.danger:hover > td, +.table-hover > tbody > tr:hover > .danger, +.table-hover > tbody > tr.danger:hover > th { + background-color: #ebcccc; +} +.table-responsive { + min-height: .01%; + overflow-x: auto; +} +@media screen and (max-width: 767px) { + .table-responsive { + width: 100%; + margin-bottom: 15px; + overflow-y: hidden; + -ms-overflow-style: -ms-autohiding-scrollbar; + border: 1px solid #ddd; + } + .table-responsive > .table { + margin-bottom: 0; + } + .table-responsive > .table > thead > tr > th, + .table-responsive > .table > tbody > tr > th, + .table-responsive > .table > tfoot > tr > th, + .table-responsive > .table > thead > tr > td, + .table-responsive > .table > tbody > tr > td, + .table-responsive > .table > tfoot > tr > td { + white-space: nowrap; + } + .table-responsive > .table-bordered { + border: 0; + } + .table-responsive > .table-bordered > thead > tr > th:first-child, + .table-responsive > .table-bordered > tbody > tr > th:first-child, + .table-responsive > .table-bordered > tfoot > tr > th:first-child, + .table-responsive > .table-bordered > thead > tr > td:first-child, + .table-responsive > .table-bordered > tbody > tr > td:first-child, + .table-responsive > .table-bordered > tfoot > tr > td:first-child { + border-left: 0; + } + .table-responsive > .table-bordered > thead > tr > th:last-child, + .table-responsive > .table-bordered > tbody > tr > th:last-child, + .table-responsive > .table-bordered > tfoot > tr > th:last-child, + .table-responsive > .table-bordered > thead > tr > td:last-child, + .table-responsive > .table-bordered > tbody > tr > td:last-child, + .table-responsive > .table-bordered > tfoot > tr > td:last-child { + border-right: 0; + } + .table-responsive > .table-bordered > tbody > tr:last-child > th, + .table-responsive > .table-bordered > tfoot > tr:last-child > th, + .table-responsive > .table-bordered > tbody > tr:last-child > td, + .table-responsive > .table-bordered > tfoot > tr:last-child > td { + border-bottom: 0; + } +} +fieldset { + min-width: 0; + padding: 0; + margin: 0; + border: 0; +} +legend { + display: block; + width: 100%; + padding: 0; + margin-bottom: 20px; + font-size: 21px; + line-height: inherit; + color: #333; + border: 0; + border-bottom: 1px solid #e5e5e5; +} +label { + display: inline-block; + max-width: 100%; + margin-bottom: 5px; + font-weight: bold; +} +input[type="search"] { + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} +input[type="radio"], +input[type="checkbox"] { + margin: 4px 0 0; + margin-top: 1px \9; + line-height: normal; +} +input[type="file"] { + display: block; +} +input[type="range"] { + display: block; + width: 100%; +} +select[multiple], +select[size] { + height: auto; +} +input[type="file"]:focus, +input[type="radio"]:focus, +input[type="checkbox"]:focus { + outline: 5px auto -webkit-focus-ring-color; + outline-offset: -2px; +} +output { + display: block; + padding-top: 7px; + font-size: 14px; + line-height: 1.42857143; + color: #555; +} +.form-control { + display: block; + width: 100%; + height: 34px; + padding: 6px 12px; + font-size: 14px; + line-height: 1.42857143; + color: #555; + background-color: #fff; + background-image: none; + border: 1px solid #ccc; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075); + box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075); + -webkit-transition: border-color ease-in-out .15s, -webkit-box-shadow ease-in-out .15s; + -o-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; + transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; +} +.form-control:focus { + border-color: #66afe9; + outline: 0; + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, .6); + box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, .6); +} +.form-control::-moz-placeholder { + color: #999; + opacity: 1; +} +.form-control:-ms-input-placeholder { + color: #999; +} +.form-control::-webkit-input-placeholder { + color: #999; +} +.form-control::-ms-expand { + background-color: transparent; + border: 0; +} +.form-control[disabled], +.form-control[readonly], +fieldset[disabled] .form-control { + background-color: #eee; + opacity: 1; +} +.form-control[disabled], +fieldset[disabled] .form-control { + cursor: not-allowed; +} +textarea.form-control { + height: auto; +} +input[type="search"] { + -webkit-appearance: none; +} +@media screen and (-webkit-min-device-pixel-ratio: 0) { + input[type="date"].form-control, + input[type="time"].form-control, + input[type="datetime-local"].form-control, + input[type="month"].form-control { + line-height: 34px; + } + input[type="date"].input-sm, + input[type="time"].input-sm, + input[type="datetime-local"].input-sm, + input[type="month"].input-sm, + .input-group-sm input[type="date"], + .input-group-sm input[type="time"], + .input-group-sm input[type="datetime-local"], + .input-group-sm input[type="month"] { + line-height: 30px; + } + input[type="date"].input-lg, + input[type="time"].input-lg, + input[type="datetime-local"].input-lg, + input[type="month"].input-lg, + .input-group-lg input[type="date"], + .input-group-lg input[type="time"], + .input-group-lg input[type="datetime-local"], + .input-group-lg input[type="month"] { + line-height: 46px; + } +} +.form-group { + margin-bottom: 15px; +} +.radio, +.checkbox { + position: relative; + display: block; + margin-top: 10px; + margin-bottom: 10px; +} +.radio label, +.checkbox label { + min-height: 20px; + padding-left: 20px; + margin-bottom: 0; + font-weight: normal; + cursor: pointer; +} +.radio input[type="radio"], +.radio-inline input[type="radio"], +.checkbox input[type="checkbox"], +.checkbox-inline input[type="checkbox"] { + position: absolute; + margin-top: 4px \9; + margin-left: -20px; +} +.radio + .radio, +.checkbox + .checkbox { + margin-top: -5px; +} +.radio-inline, +.checkbox-inline { + position: relative; + display: inline-block; + padding-left: 20px; + margin-bottom: 0; + font-weight: normal; + vertical-align: middle; + cursor: pointer; +} +.radio-inline + .radio-inline, +.checkbox-inline + .checkbox-inline { + margin-top: 0; + margin-left: 10px; +} +input[type="radio"][disabled], +input[type="checkbox"][disabled], +input[type="radio"].disabled, +input[type="checkbox"].disabled, +fieldset[disabled] input[type="radio"], +fieldset[disabled] input[type="checkbox"] { + cursor: not-allowed; +} +.radio-inline.disabled, +.checkbox-inline.disabled, +fieldset[disabled] .radio-inline, +fieldset[disabled] .checkbox-inline { + cursor: not-allowed; +} +.radio.disabled label, +.checkbox.disabled label, +fieldset[disabled] .radio label, +fieldset[disabled] .checkbox label { + cursor: not-allowed; +} +.form-control-static { + min-height: 34px; + padding-top: 7px; + padding-bottom: 7px; + margin-bottom: 0; +} +.form-control-static.input-lg, +.form-control-static.input-sm { + padding-right: 0; + padding-left: 0; +} +.input-sm { + height: 30px; + padding: 5px 10px; + font-size: 12px; + line-height: 1.5; + border-radius: 3px; +} +select.input-sm { + height: 30px; + line-height: 30px; +} +textarea.input-sm, +select[multiple].input-sm { + height: auto; +} +.form-group-sm .form-control { + height: 30px; + padding: 5px 10px; + font-size: 12px; + line-height: 1.5; + border-radius: 3px; +} +.form-group-sm select.form-control { + height: 30px; + line-height: 30px; +} +.form-group-sm textarea.form-control, +.form-group-sm select[multiple].form-control { + height: auto; +} +.form-group-sm .form-control-static { + height: 30px; + min-height: 32px; + padding: 6px 10px; + font-size: 12px; + line-height: 1.5; +} +.input-lg { + height: 46px; + padding: 10px 16px; + font-size: 18px; + line-height: 1.3333333; + border-radius: 6px; +} +select.input-lg { + height: 46px; + line-height: 46px; +} +textarea.input-lg, +select[multiple].input-lg { + height: auto; +} +.form-group-lg .form-control { + height: 46px; + padding: 10px 16px; + font-size: 18px; + line-height: 1.3333333; + border-radius: 6px; +} +.form-group-lg select.form-control { + height: 46px; + line-height: 46px; +} +.form-group-lg textarea.form-control, +.form-group-lg select[multiple].form-control { + height: auto; +} +.form-group-lg .form-control-static { + height: 46px; + min-height: 38px; + padding: 11px 16px; + font-size: 18px; + line-height: 1.3333333; +} +.has-feedback { + position: relative; +} +.has-feedback .form-control { + padding-right: 42.5px; +} +.form-control-feedback { + position: absolute; + top: 0; + right: 0; + z-index: 2; + display: block; + width: 34px; + height: 34px; + line-height: 34px; + text-align: center; + pointer-events: none; +} +.input-lg + .form-control-feedback, +.input-group-lg + .form-control-feedback, +.form-group-lg .form-control + .form-control-feedback { + width: 46px; + height: 46px; + line-height: 46px; +} +.input-sm + .form-control-feedback, +.input-group-sm + .form-control-feedback, +.form-group-sm .form-control + .form-control-feedback { + width: 30px; + height: 30px; + line-height: 30px; +} +.has-success .help-block, +.has-success .control-label, +.has-success .radio, +.has-success .checkbox, +.has-success .radio-inline, +.has-success .checkbox-inline, +.has-success.radio label, +.has-success.checkbox label, +.has-success.radio-inline label, +.has-success.checkbox-inline label { + color: #3c763d; +} +.has-success .form-control { + border-color: #3c763d; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075); + box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075); +} +.has-success .form-control:focus { + border-color: #2b542c; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #67b168; + box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #67b168; +} +.has-success .input-group-addon { + color: #3c763d; + background-color: #dff0d8; + border-color: #3c763d; +} +.has-success .form-control-feedback { + color: #3c763d; +} +.has-warning .help-block, +.has-warning .control-label, +.has-warning .radio, +.has-warning .checkbox, +.has-warning .radio-inline, +.has-warning .checkbox-inline, +.has-warning.radio label, +.has-warning.checkbox label, +.has-warning.radio-inline label, +.has-warning.checkbox-inline label { + color: #8a6d3b; +} +.has-warning .form-control { + border-color: #8a6d3b; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075); + box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075); +} +.has-warning .form-control:focus { + border-color: #66512c; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #c0a16b; + box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #c0a16b; +} +.has-warning .input-group-addon { + color: #8a6d3b; + background-color: #fcf8e3; + border-color: #8a6d3b; +} +.has-warning .form-control-feedback { + color: #8a6d3b; +} +.has-error .help-block, +.has-error .control-label, +.has-error .radio, +.has-error .checkbox, +.has-error .radio-inline, +.has-error .checkbox-inline, +.has-error.radio label, +.has-error.checkbox label, +.has-error.radio-inline label, +.has-error.checkbox-inline label { + color: #a94442; +} +.has-error .form-control { + border-color: #a94442; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075); + box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075); +} +.has-error .form-control:focus { + border-color: #843534; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #ce8483; + box-shadow: inset 0 1px 1px rgba(0, 0, 0, .075), 0 0 6px #ce8483; +} +.has-error .input-group-addon { + color: #a94442; + background-color: #f2dede; + border-color: #a94442; +} +.has-error .form-control-feedback { + color: #a94442; +} +.has-feedback label ~ .form-control-feedback { + top: 25px; +} +.has-feedback label.sr-only ~ .form-control-feedback { + top: 0; +} +.help-block { + display: block; + margin-top: 5px; + margin-bottom: 10px; + color: #737373; +} +@media (min-width: 768px) { + .form-inline .form-group { + display: inline-block; + margin-bottom: 0; + vertical-align: middle; + } + .form-inline .form-control { + display: inline-block; + width: auto; + vertical-align: middle; + } + .form-inline .form-control-static { + display: inline-block; + } + .form-inline .input-group { + display: inline-table; + vertical-align: middle; + } + .form-inline .input-group .input-group-addon, + .form-inline .input-group .input-group-btn, + .form-inline .input-group .form-control { + width: auto; + } + .form-inline .input-group > .form-control { + width: 100%; + } + .form-inline .control-label { + margin-bottom: 0; + vertical-align: middle; + } + .form-inline .radio, + .form-inline .checkbox { + display: inline-block; + margin-top: 0; + margin-bottom: 0; + vertical-align: middle; + } + .form-inline .radio label, + .form-inline .checkbox label { + padding-left: 0; + } + .form-inline .radio input[type="radio"], + .form-inline .checkbox input[type="checkbox"] { + position: relative; + margin-left: 0; + } + .form-inline .has-feedback .form-control-feedback { + top: 0; + } +} +.form-horizontal .radio, +.form-horizontal .checkbox, +.form-horizontal .radio-inline, +.form-horizontal .checkbox-inline { + padding-top: 7px; + margin-top: 0; + margin-bottom: 0; +} +.form-horizontal .radio, +.form-horizontal .checkbox { + min-height: 27px; +} +.form-horizontal .form-group { + margin-right: -15px; + margin-left: -15px; +} +@media (min-width: 768px) { + .form-horizontal .control-label { + padding-top: 7px; + margin-bottom: 0; + text-align: right; + } +} +.form-horizontal .has-feedback .form-control-feedback { + right: 15px; +} +@media (min-width: 768px) { + .form-horizontal .form-group-lg .control-label { + padding-top: 11px; + font-size: 18px; + } +} +@media (min-width: 768px) { + .form-horizontal .form-group-sm .control-label { + padding-top: 6px; + font-size: 12px; + } +} +.btn { + display: inline-block; + padding: 6px 12px; + margin-bottom: 0; + font-size: 14px; + font-weight: normal; + line-height: 1.42857143; + text-align: center; + white-space: nowrap; + vertical-align: middle; + -ms-touch-action: manipulation; + touch-action: manipulation; + cursor: pointer; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + background-image: none; + border: 1px solid transparent; + border-radius: 4px; +} +.btn:focus, +.btn:active:focus, +.btn.active:focus, +.btn.focus, +.btn:active.focus, +.btn.active.focus { + outline: 5px auto -webkit-focus-ring-color; + outline-offset: -2px; +} +.btn:hover, +.btn:focus, +.btn.focus { + color: #333; + text-decoration: none; +} +.btn:active, +.btn.active { + background-image: none; + outline: 0; + -webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, .125); + box-shadow: inset 0 3px 5px rgba(0, 0, 0, .125); +} +.btn.disabled, +.btn[disabled], +fieldset[disabled] .btn { + cursor: not-allowed; + filter: alpha(opacity=65); + -webkit-box-shadow: none; + box-shadow: none; + opacity: .65; +} +a.btn.disabled, +fieldset[disabled] a.btn { + pointer-events: none; +} +.btn-default { + color: #333; + background-color: #fff; + border-color: #ccc; +} +.btn-default:focus, +.btn-default.focus { + color: #333; + background-color: #e6e6e6; + border-color: #8c8c8c; +} +.btn-default:hover { + color: #333; + background-color: #e6e6e6; + border-color: #adadad; +} +.btn-default:active, +.btn-default.active, +.open > .dropdown-toggle.btn-default { + color: #333; + background-color: #e6e6e6; + border-color: #adadad; +} +.btn-default:active:hover, +.btn-default.active:hover, +.open > .dropdown-toggle.btn-default:hover, +.btn-default:active:focus, +.btn-default.active:focus, +.open > .dropdown-toggle.btn-default:focus, +.btn-default:active.focus, +.btn-default.active.focus, +.open > .dropdown-toggle.btn-default.focus { + color: #333; + background-color: #d4d4d4; + border-color: #8c8c8c; +} +.btn-default:active, +.btn-default.active, +.open > .dropdown-toggle.btn-default { + background-image: none; +} +.btn-default.disabled:hover, +.btn-default[disabled]:hover, +fieldset[disabled] .btn-default:hover, +.btn-default.disabled:focus, +.btn-default[disabled]:focus, +fieldset[disabled] .btn-default:focus, +.btn-default.disabled.focus, +.btn-default[disabled].focus, +fieldset[disabled] .btn-default.focus { + background-color: #fff; + border-color: #ccc; +} +.btn-default .badge { + color: #fff; + background-color: #333; +} +.btn-primary { + color: #fff; + background-color: #337ab7; + border-color: #2e6da4; +} +.btn-primary:focus, +.btn-primary.focus { + color: #fff; + background-color: #286090; + border-color: #122b40; +} +.btn-primary:hover { + color: #fff; + background-color: #286090; + border-color: #204d74; +} +.btn-primary:active, +.btn-primary.active, +.open > .dropdown-toggle.btn-primary { + color: #fff; + background-color: #286090; + border-color: #204d74; +} +.btn-primary:active:hover, +.btn-primary.active:hover, +.open > .dropdown-toggle.btn-primary:hover, +.btn-primary:active:focus, +.btn-primary.active:focus, +.open > .dropdown-toggle.btn-primary:focus, +.btn-primary:active.focus, +.btn-primary.active.focus, +.open > .dropdown-toggle.btn-primary.focus { + color: #fff; + background-color: #204d74; + border-color: #122b40; +} +.btn-primary:active, +.btn-primary.active, +.open > .dropdown-toggle.btn-primary { + background-image: none; +} +.btn-primary.disabled:hover, +.btn-primary[disabled]:hover, +fieldset[disabled] .btn-primary:hover, +.btn-primary.disabled:focus, +.btn-primary[disabled]:focus, +fieldset[disabled] .btn-primary:focus, +.btn-primary.disabled.focus, +.btn-primary[disabled].focus, +fieldset[disabled] .btn-primary.focus { + background-color: #337ab7; + border-color: #2e6da4; +} +.btn-primary .badge { + color: #337ab7; + background-color: #fff; +} +.btn-success { + color: #fff; + background-color: #5cb85c; + border-color: #4cae4c; +} +.btn-success:focus, +.btn-success.focus { + color: #fff; + background-color: #449d44; + border-color: #255625; +} +.btn-success:hover { + color: #fff; + background-color: #449d44; + border-color: #398439; +} +.btn-success:active, +.btn-success.active, +.open > .dropdown-toggle.btn-success { + color: #fff; + background-color: #449d44; + border-color: #398439; +} +.btn-success:active:hover, +.btn-success.active:hover, +.open > .dropdown-toggle.btn-success:hover, +.btn-success:active:focus, +.btn-success.active:focus, +.open > .dropdown-toggle.btn-success:focus, +.btn-success:active.focus, +.btn-success.active.focus, +.open > .dropdown-toggle.btn-success.focus { + color: #fff; + background-color: #398439; + border-color: #255625; +} +.btn-success:active, +.btn-success.active, +.open > .dropdown-toggle.btn-success { + background-image: none; +} +.btn-success.disabled:hover, +.btn-success[disabled]:hover, +fieldset[disabled] .btn-success:hover, +.btn-success.disabled:focus, +.btn-success[disabled]:focus, +fieldset[disabled] .btn-success:focus, +.btn-success.disabled.focus, +.btn-success[disabled].focus, +fieldset[disabled] .btn-success.focus { + background-color: #5cb85c; + border-color: #4cae4c; +} +.btn-success .badge { + color: #5cb85c; + background-color: #fff; +} +.btn-info { + color: #fff; + background-color: #5bc0de; + border-color: #46b8da; +} +.btn-info:focus, +.btn-info.focus { + color: #fff; + background-color: #31b0d5; + border-color: #1b6d85; +} +.btn-info:hover { + color: #fff; + background-color: #31b0d5; + border-color: #269abc; +} +.btn-info:active, +.btn-info.active, +.open > .dropdown-toggle.btn-info { + color: #fff; + background-color: #31b0d5; + border-color: #269abc; +} +.btn-info:active:hover, +.btn-info.active:hover, +.open > .dropdown-toggle.btn-info:hover, +.btn-info:active:focus, +.btn-info.active:focus, +.open > .dropdown-toggle.btn-info:focus, +.btn-info:active.focus, +.btn-info.active.focus, +.open > .dropdown-toggle.btn-info.focus { + color: #fff; + background-color: #269abc; + border-color: #1b6d85; +} +.btn-info:active, +.btn-info.active, +.open > .dropdown-toggle.btn-info { + background-image: none; +} +.btn-info.disabled:hover, +.btn-info[disabled]:hover, +fieldset[disabled] .btn-info:hover, +.btn-info.disabled:focus, +.btn-info[disabled]:focus, +fieldset[disabled] .btn-info:focus, +.btn-info.disabled.focus, +.btn-info[disabled].focus, +fieldset[disabled] .btn-info.focus { + background-color: #5bc0de; + border-color: #46b8da; +} +.btn-info .badge { + color: #5bc0de; + background-color: #fff; +} +.btn-warning { + color: #fff; + background-color: #f0ad4e; + border-color: #eea236; +} +.btn-warning:focus, +.btn-warning.focus { + color: #fff; + background-color: #ec971f; + border-color: #985f0d; +} +.btn-warning:hover { + color: #fff; + background-color: #ec971f; + border-color: #d58512; +} +.btn-warning:active, +.btn-warning.active, +.open > .dropdown-toggle.btn-warning { + color: #fff; + background-color: #ec971f; + border-color: #d58512; +} +.btn-warning:active:hover, +.btn-warning.active:hover, +.open > .dropdown-toggle.btn-warning:hover, +.btn-warning:active:focus, +.btn-warning.active:focus, +.open > .dropdown-toggle.btn-warning:focus, +.btn-warning:active.focus, +.btn-warning.active.focus, +.open > .dropdown-toggle.btn-warning.focus { + color: #fff; + background-color: #d58512; + border-color: #985f0d; +} +.btn-warning:active, +.btn-warning.active, +.open > .dropdown-toggle.btn-warning { + background-image: none; +} +.btn-warning.disabled:hover, +.btn-warning[disabled]:hover, +fieldset[disabled] .btn-warning:hover, +.btn-warning.disabled:focus, +.btn-warning[disabled]:focus, +fieldset[disabled] .btn-warning:focus, +.btn-warning.disabled.focus, +.btn-warning[disabled].focus, +fieldset[disabled] .btn-warning.focus { + background-color: #f0ad4e; + border-color: #eea236; +} +.btn-warning .badge { + color: #f0ad4e; + background-color: #fff; +} +.btn-danger { + color: #fff; + background-color: #d9534f; + border-color: #d43f3a; +} +.btn-danger:focus, +.btn-danger.focus { + color: #fff; + background-color: #c9302c; + border-color: #761c19; +} +.btn-danger:hover { + color: #fff; + background-color: #c9302c; + border-color: #ac2925; +} +.btn-danger:active, +.btn-danger.active, +.open > .dropdown-toggle.btn-danger { + color: #fff; + background-color: #c9302c; + border-color: #ac2925; +} +.btn-danger:active:hover, +.btn-danger.active:hover, +.open > .dropdown-toggle.btn-danger:hover, +.btn-danger:active:focus, +.btn-danger.active:focus, +.open > .dropdown-toggle.btn-danger:focus, +.btn-danger:active.focus, +.btn-danger.active.focus, +.open > .dropdown-toggle.btn-danger.focus { + color: #fff; + background-color: #ac2925; + border-color: #761c19; +} +.btn-danger:active, +.btn-danger.active, +.open > .dropdown-toggle.btn-danger { + background-image: none; +} +.btn-danger.disabled:hover, +.btn-danger[disabled]:hover, +fieldset[disabled] .btn-danger:hover, +.btn-danger.disabled:focus, +.btn-danger[disabled]:focus, +fieldset[disabled] .btn-danger:focus, +.btn-danger.disabled.focus, +.btn-danger[disabled].focus, +fieldset[disabled] .btn-danger.focus { + background-color: #d9534f; + border-color: #d43f3a; +} +.btn-danger .badge { + color: #d9534f; + background-color: #fff; +} +.btn-link { + font-weight: normal; + color: #337ab7; + border-radius: 0; +} +.btn-link, +.btn-link:active, +.btn-link.active, +.btn-link[disabled], +fieldset[disabled] .btn-link { + background-color: transparent; + -webkit-box-shadow: none; + box-shadow: none; +} +.btn-link, +.btn-link:hover, +.btn-link:focus, +.btn-link:active { + border-color: transparent; +} +.btn-link:hover, +.btn-link:focus { + color: #23527c; + text-decoration: underline; + background-color: transparent; +} +.btn-link[disabled]:hover, +fieldset[disabled] .btn-link:hover, +.btn-link[disabled]:focus, +fieldset[disabled] .btn-link:focus { + color: #777; + text-decoration: none; +} +.btn-lg, +.btn-group-lg > .btn { + padding: 10px 16px; + font-size: 18px; + line-height: 1.3333333; + border-radius: 6px; +} +.btn-sm, +.btn-group-sm > .btn { + padding: 5px 10px; + font-size: 12px; + line-height: 1.5; + border-radius: 3px; +} +.btn-xs, +.btn-group-xs > .btn { + padding: 1px 5px; + font-size: 12px; + line-height: 1.5; + border-radius: 3px; +} +.btn-block { + display: block; + width: 100%; +} +.btn-block + .btn-block { + margin-top: 5px; +} +input[type="submit"].btn-block, +input[type="reset"].btn-block, +input[type="button"].btn-block { + width: 100%; +} +.fade { + opacity: 0; + -webkit-transition: opacity .15s linear; + -o-transition: opacity .15s linear; + transition: opacity .15s linear; +} +.fade.in { + opacity: 1; +} +.collapse { + display: none; +} +.collapse.in { + display: block; +} +tr.collapse.in { + display: table-row; +} +tbody.collapse.in { + display: table-row-group; +} +.collapsing { + position: relative; + height: 0; + overflow: hidden; + -webkit-transition-timing-function: ease; + -o-transition-timing-function: ease; + transition-timing-function: ease; + -webkit-transition-duration: .35s; + -o-transition-duration: .35s; + transition-duration: .35s; + -webkit-transition-property: height, visibility; + -o-transition-property: height, visibility; + transition-property: height, visibility; +} +.caret { + display: inline-block; + width: 0; + height: 0; + margin-left: 2px; + vertical-align: middle; + border-top: 4px dashed; + border-top: 4px solid \9; + border-right: 4px solid transparent; + border-left: 4px solid transparent; +} +.dropup, +.dropdown { + position: relative; +} +.dropdown-toggle:focus { + outline: 0; +} +.dropdown-menu { + position: absolute; + top: 100%; + left: 0; + z-index: 1000; + display: none; + float: left; + min-width: 160px; + padding: 5px 0; + margin: 2px 0 0; + font-size: 14px; + text-align: left; + list-style: none; + background-color: #fff; + -webkit-background-clip: padding-box; + background-clip: padding-box; + border: 1px solid #ccc; + border: 1px solid rgba(0, 0, 0, .15); + border-radius: 4px; + -webkit-box-shadow: 0 6px 12px rgba(0, 0, 0, .175); + box-shadow: 0 6px 12px rgba(0, 0, 0, .175); +} +.dropdown-menu.pull-right { + right: 0; + left: auto; +} +.dropdown-menu .divider { + height: 1px; + margin: 9px 0; + overflow: hidden; + background-color: #e5e5e5; +} +.dropdown-menu > li > a { + display: block; + padding: 3px 20px; + clear: both; + font-weight: normal; + line-height: 1.42857143; + color: #333; + white-space: nowrap; +} +.dropdown-menu > li > a:hover, +.dropdown-menu > li > a:focus { + color: #262626; + text-decoration: none; + background-color: #f5f5f5; +} +.dropdown-menu > .active > a, +.dropdown-menu > .active > a:hover, +.dropdown-menu > .active > a:focus { + color: #fff; + text-decoration: none; + background-color: #337ab7; + outline: 0; +} +.dropdown-menu > .disabled > a, +.dropdown-menu > .disabled > a:hover, +.dropdown-menu > .disabled > a:focus { + color: #777; +} +.dropdown-menu > .disabled > a:hover, +.dropdown-menu > .disabled > a:focus { + text-decoration: none; + cursor: not-allowed; + background-color: transparent; + background-image: none; + filter: progid:DXImageTransform.Microsoft.gradient(enabled = false); +} +.open > .dropdown-menu { + display: block; +} +.open > a { + outline: 0; +} +.dropdown-menu-right { + right: 0; + left: auto; +} +.dropdown-menu-left { + right: auto; + left: 0; +} +.dropdown-header { + display: block; + padding: 3px 20px; + font-size: 12px; + line-height: 1.42857143; + color: #777; + white-space: nowrap; +} +.dropdown-backdrop { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 990; +} +.pull-right > .dropdown-menu { + right: 0; + left: auto; +} +.dropup .caret, +.navbar-fixed-bottom .dropdown .caret { + content: ""; + border-top: 0; + border-bottom: 4px dashed; + border-bottom: 4px solid \9; +} +.dropup .dropdown-menu, +.navbar-fixed-bottom .dropdown .dropdown-menu { + top: auto; + bottom: 100%; + margin-bottom: 2px; +} +@media (min-width: 768px) { + .navbar-right .dropdown-menu { + right: 0; + left: auto; + } + .navbar-right .dropdown-menu-left { + right: auto; + left: 0; + } +} +.btn-group, +.btn-group-vertical { + position: relative; + display: inline-block; + vertical-align: middle; +} +.btn-group > .btn, +.btn-group-vertical > .btn { + position: relative; + float: left; +} +.btn-group > .btn:hover, +.btn-group-vertical > .btn:hover, +.btn-group > .btn:focus, +.btn-group-vertical > .btn:focus, +.btn-group > .btn:active, +.btn-group-vertical > .btn:active, +.btn-group > .btn.active, +.btn-group-vertical > .btn.active { + z-index: 2; +} +.btn-group .btn + .btn, +.btn-group .btn + .btn-group, +.btn-group .btn-group + .btn, +.btn-group .btn-group + .btn-group { + margin-left: -1px; +} +.btn-toolbar { + margin-left: -5px; +} +.btn-toolbar .btn, +.btn-toolbar .btn-group, +.btn-toolbar .input-group { + float: left; +} +.btn-toolbar > .btn, +.btn-toolbar > .btn-group, +.btn-toolbar > .input-group { + margin-left: 5px; +} +.btn-group > .btn:not(:first-child):not(:last-child):not(.dropdown-toggle) { + border-radius: 0; +} +.btn-group > .btn:first-child { + margin-left: 0; +} +.btn-group > .btn:first-child:not(:last-child):not(.dropdown-toggle) { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} +.btn-group > .btn:last-child:not(:first-child), +.btn-group > .dropdown-toggle:not(:first-child) { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} +.btn-group > .btn-group { + float: left; +} +.btn-group > .btn-group:not(:first-child):not(:last-child) > .btn { + border-radius: 0; +} +.btn-group > .btn-group:first-child:not(:last-child) > .btn:last-child, +.btn-group > .btn-group:first-child:not(:last-child) > .dropdown-toggle { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} +.btn-group > .btn-group:last-child:not(:first-child) > .btn:first-child { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} +.btn-group .dropdown-toggle:active, +.btn-group.open .dropdown-toggle { + outline: 0; +} +.btn-group > .btn + .dropdown-toggle { + padding-right: 8px; + padding-left: 8px; +} +.btn-group > .btn-lg + .dropdown-toggle { + padding-right: 12px; + padding-left: 12px; +} +.btn-group.open .dropdown-toggle { + -webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, .125); + box-shadow: inset 0 3px 5px rgba(0, 0, 0, .125); +} +.btn-group.open .dropdown-toggle.btn-link { + -webkit-box-shadow: none; + box-shadow: none; +} +.btn .caret { + margin-left: 0; +} +.btn-lg .caret { + border-width: 5px 5px 0; + border-bottom-width: 0; +} +.dropup .btn-lg .caret { + border-width: 0 5px 5px; +} +.btn-group-vertical > .btn, +.btn-group-vertical > .btn-group, +.btn-group-vertical > .btn-group > .btn { + display: block; + float: none; + width: 100%; + max-width: 100%; +} +.btn-group-vertical > .btn-group > .btn { + float: none; +} +.btn-group-vertical > .btn + .btn, +.btn-group-vertical > .btn + .btn-group, +.btn-group-vertical > .btn-group + .btn, +.btn-group-vertical > .btn-group + .btn-group { + margin-top: -1px; + margin-left: 0; +} +.btn-group-vertical > .btn:not(:first-child):not(:last-child) { + border-radius: 0; +} +.btn-group-vertical > .btn:first-child:not(:last-child) { + border-top-left-radius: 4px; + border-top-right-radius: 4px; + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; +} +.btn-group-vertical > .btn:last-child:not(:first-child) { + border-top-left-radius: 0; + border-top-right-radius: 0; + border-bottom-right-radius: 4px; + border-bottom-left-radius: 4px; +} +.btn-group-vertical > .btn-group:not(:first-child):not(:last-child) > .btn { + border-radius: 0; +} +.btn-group-vertical > .btn-group:first-child:not(:last-child) > .btn:last-child, +.btn-group-vertical > .btn-group:first-child:not(:last-child) > .dropdown-toggle { + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; +} +.btn-group-vertical > .btn-group:last-child:not(:first-child) > .btn:first-child { + border-top-left-radius: 0; + border-top-right-radius: 0; +} +.btn-group-justified { + display: table; + width: 100%; + table-layout: fixed; + border-collapse: separate; +} +.btn-group-justified > .btn, +.btn-group-justified > .btn-group { + display: table-cell; + float: none; + width: 1%; +} +.btn-group-justified > .btn-group .btn { + width: 100%; +} +.btn-group-justified > .btn-group .dropdown-menu { + left: auto; +} +[data-toggle="buttons"] > .btn input[type="radio"], +[data-toggle="buttons"] > .btn-group > .btn input[type="radio"], +[data-toggle="buttons"] > .btn input[type="checkbox"], +[data-toggle="buttons"] > .btn-group > .btn input[type="checkbox"] { + position: absolute; + clip: rect(0, 0, 0, 0); + pointer-events: none; +} +.input-group { + position: relative; + display: table; + border-collapse: separate; +} +.input-group[class*="col-"] { + float: none; + padding-right: 0; + padding-left: 0; +} +.input-group .form-control { + position: relative; + z-index: 2; + float: left; + width: 100%; + margin-bottom: 0; +} +.input-group .form-control:focus { + z-index: 3; +} +.input-group-lg > .form-control, +.input-group-lg > .input-group-addon, +.input-group-lg > .input-group-btn > .btn { + height: 46px; + padding: 10px 16px; + font-size: 18px; + line-height: 1.3333333; + border-radius: 6px; +} +select.input-group-lg > .form-control, +select.input-group-lg > .input-group-addon, +select.input-group-lg > .input-group-btn > .btn { + height: 46px; + line-height: 46px; +} +textarea.input-group-lg > .form-control, +textarea.input-group-lg > .input-group-addon, +textarea.input-group-lg > .input-group-btn > .btn, +select[multiple].input-group-lg > .form-control, +select[multiple].input-group-lg > .input-group-addon, +select[multiple].input-group-lg > .input-group-btn > .btn { + height: auto; +} +.input-group-sm > .form-control, +.input-group-sm > .input-group-addon, +.input-group-sm > .input-group-btn > .btn { + height: 30px; + padding: 5px 10px; + font-size: 12px; + line-height: 1.5; + border-radius: 3px; +} +select.input-group-sm > .form-control, +select.input-group-sm > .input-group-addon, +select.input-group-sm > .input-group-btn > .btn { + height: 30px; + line-height: 30px; +} +textarea.input-group-sm > .form-control, +textarea.input-group-sm > .input-group-addon, +textarea.input-group-sm > .input-group-btn > .btn, +select[multiple].input-group-sm > .form-control, +select[multiple].input-group-sm > .input-group-addon, +select[multiple].input-group-sm > .input-group-btn > .btn { + height: auto; +} +.input-group-addon, +.input-group-btn, +.input-group .form-control { + display: table-cell; +} +.input-group-addon:not(:first-child):not(:last-child), +.input-group-btn:not(:first-child):not(:last-child), +.input-group .form-control:not(:first-child):not(:last-child) { + border-radius: 0; +} +.input-group-addon, +.input-group-btn { + width: 1%; + white-space: nowrap; + vertical-align: middle; +} +.input-group-addon { + padding: 6px 12px; + font-size: 14px; + font-weight: normal; + line-height: 1; + color: #555; + text-align: center; + background-color: #eee; + border: 1px solid #ccc; + border-radius: 4px; +} +.input-group-addon.input-sm { + padding: 5px 10px; + font-size: 12px; + border-radius: 3px; +} +.input-group-addon.input-lg { + padding: 10px 16px; + font-size: 18px; + border-radius: 6px; +} +.input-group-addon input[type="radio"], +.input-group-addon input[type="checkbox"] { + margin-top: 0; +} +.input-group .form-control:first-child, +.input-group-addon:first-child, +.input-group-btn:first-child > .btn, +.input-group-btn:first-child > .btn-group > .btn, +.input-group-btn:first-child > .dropdown-toggle, +.input-group-btn:last-child > .btn:not(:last-child):not(.dropdown-toggle), +.input-group-btn:last-child > .btn-group:not(:last-child) > .btn { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} +.input-group-addon:first-child { + border-right: 0; +} +.input-group .form-control:last-child, +.input-group-addon:last-child, +.input-group-btn:last-child > .btn, +.input-group-btn:last-child > .btn-group > .btn, +.input-group-btn:last-child > .dropdown-toggle, +.input-group-btn:first-child > .btn:not(:first-child), +.input-group-btn:first-child > .btn-group:not(:first-child) > .btn { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} +.input-group-addon:last-child { + border-left: 0; +} +.input-group-btn { + position: relative; + font-size: 0; + white-space: nowrap; +} +.input-group-btn > .btn { + position: relative; +} +.input-group-btn > .btn + .btn { + margin-left: -1px; +} +.input-group-btn > .btn:hover, +.input-group-btn > .btn:focus, +.input-group-btn > .btn:active { + z-index: 2; +} +.input-group-btn:first-child > .btn, +.input-group-btn:first-child > .btn-group { + margin-right: -1px; +} +.input-group-btn:last-child > .btn, +.input-group-btn:last-child > .btn-group { + z-index: 2; + margin-left: -1px; +} +.nav { + padding-left: 0; + margin-bottom: 0; + list-style: none; +} +.nav > li { + position: relative; + display: block; +} +.nav > li > a { + position: relative; + display: block; + padding: 10px 15px; +} +.nav > li > a:hover, +.nav > li > a:focus { + text-decoration: none; + background-color: #eee; +} +.nav > li.disabled > a { + color: #777; +} +.nav > li.disabled > a:hover, +.nav > li.disabled > a:focus { + color: #777; + text-decoration: none; + cursor: not-allowed; + background-color: transparent; +} +.nav .open > a, +.nav .open > a:hover, +.nav .open > a:focus { + background-color: #eee; + border-color: #337ab7; +} +.nav .nav-divider { + height: 1px; + margin: 9px 0; + overflow: hidden; + background-color: #e5e5e5; +} +.nav > li > a > img { + max-width: none; +} +.nav-tabs { + border-bottom: 1px solid #ddd; +} +.nav-tabs > li { + float: left; + margin-bottom: -1px; +} +.nav-tabs > li > a { + margin-right: 2px; + line-height: 1.42857143; + border: 1px solid transparent; + border-radius: 4px 4px 0 0; +} +.nav-tabs > li > a:hover { + border-color: #eee #eee #ddd; +} +.nav-tabs > li.active > a, +.nav-tabs > li.active > a:hover, +.nav-tabs > li.active > a:focus { + color: #555; + cursor: default; + background-color: #fff; + border: 1px solid #ddd; + border-bottom-color: transparent; +} +.nav-tabs.nav-justified { + width: 100%; + border-bottom: 0; +} +.nav-tabs.nav-justified > li { + float: none; +} +.nav-tabs.nav-justified > li > a { + margin-bottom: 5px; + text-align: center; +} +.nav-tabs.nav-justified > .dropdown .dropdown-menu { + top: auto; + left: auto; +} +@media (min-width: 768px) { + .nav-tabs.nav-justified > li { + display: table-cell; + width: 1%; + } + .nav-tabs.nav-justified > li > a { + margin-bottom: 0; + } +} +.nav-tabs.nav-justified > li > a { + margin-right: 0; + border-radius: 4px; +} +.nav-tabs.nav-justified > .active > a, +.nav-tabs.nav-justified > .active > a:hover, +.nav-tabs.nav-justified > .active > a:focus { + border: 1px solid #ddd; +} +@media (min-width: 768px) { + .nav-tabs.nav-justified > li > a { + border-bottom: 1px solid #ddd; + border-radius: 4px 4px 0 0; + } + .nav-tabs.nav-justified > .active > a, + .nav-tabs.nav-justified > .active > a:hover, + .nav-tabs.nav-justified > .active > a:focus { + border-bottom-color: #fff; + } +} +.nav-pills > li { + float: left; +} +.nav-pills > li > a { + border-radius: 4px; +} +.nav-pills > li + li { + margin-left: 2px; +} +.nav-pills > li.active > a, +.nav-pills > li.active > a:hover, +.nav-pills > li.active > a:focus { + color: #fff; + background-color: #337ab7; +} +.nav-stacked > li { + float: none; +} +.nav-stacked > li + li { + margin-top: 2px; + margin-left: 0; +} +.nav-justified { + width: 100%; +} +.nav-justified > li { + float: none; +} +.nav-justified > li > a { + margin-bottom: 5px; + text-align: center; +} +.nav-justified > .dropdown .dropdown-menu { + top: auto; + left: auto; +} +@media (min-width: 768px) { + .nav-justified > li { + display: table-cell; + width: 1%; + } + .nav-justified > li > a { + margin-bottom: 0; + } +} +.nav-tabs-justified { + border-bottom: 0; +} +.nav-tabs-justified > li > a { + margin-right: 0; + border-radius: 4px; +} +.nav-tabs-justified > .active > a, +.nav-tabs-justified > .active > a:hover, +.nav-tabs-justified > .active > a:focus { + border: 1px solid #ddd; +} +@media (min-width: 768px) { + .nav-tabs-justified > li > a { + border-bottom: 1px solid #ddd; + border-radius: 4px 4px 0 0; + } + .nav-tabs-justified > .active > a, + .nav-tabs-justified > .active > a:hover, + .nav-tabs-justified > .active > a:focus { + border-bottom-color: #fff; + } +} +.tab-content > .tab-pane { + display: none; +} +.tab-content > .active { + display: block; +} +.nav-tabs .dropdown-menu { + margin-top: -1px; + border-top-left-radius: 0; + border-top-right-radius: 0; +} +.navbar { + position: relative; + min-height: 50px; + margin-bottom: 20px; + border: 1px solid transparent; +} +@media (min-width: 768px) { + .navbar { + border-radius: 4px; + } +} +@media (min-width: 768px) { + .navbar-header { + float: left; + } +} +.navbar-collapse { + padding-right: 15px; + padding-left: 15px; + overflow-x: visible; + -webkit-overflow-scrolling: touch; + border-top: 1px solid transparent; + -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, .1); + box-shadow: inset 0 1px 0 rgba(255, 255, 255, .1); +} +.navbar-collapse.in { + overflow-y: auto; +} +@media (min-width: 768px) { + .navbar-collapse { + width: auto; + border-top: 0; + -webkit-box-shadow: none; + box-shadow: none; + } + .navbar-collapse.collapse { + display: block !important; + height: auto !important; + padding-bottom: 0; + overflow: visible !important; + } + .navbar-collapse.in { + overflow-y: visible; + } + .navbar-fixed-top .navbar-collapse, + .navbar-static-top .navbar-collapse, + .navbar-fixed-bottom .navbar-collapse { + padding-right: 0; + padding-left: 0; + } +} +.navbar-fixed-top .navbar-collapse, +.navbar-fixed-bottom .navbar-collapse { + max-height: 340px; +} +@media (max-device-width: 480px) and (orientation: landscape) { + .navbar-fixed-top .navbar-collapse, + .navbar-fixed-bottom .navbar-collapse { + max-height: 200px; + } +} +.container > .navbar-header, +.container-fluid > .navbar-header, +.container > .navbar-collapse, +.container-fluid > .navbar-collapse { + margin-right: -15px; + margin-left: -15px; +} +@media (min-width: 768px) { + .container > .navbar-header, + .container-fluid > .navbar-header, + .container > .navbar-collapse, + .container-fluid > .navbar-collapse { + margin-right: 0; + margin-left: 0; + } +} +.navbar-static-top { + z-index: 1000; + border-width: 0 0 1px; +} +@media (min-width: 768px) { + .navbar-static-top { + border-radius: 0; + } +} +.navbar-fixed-top, +.navbar-fixed-bottom { + position: fixed; + right: 0; + left: 0; + z-index: 1030; +} +@media (min-width: 768px) { + .navbar-fixed-top, + .navbar-fixed-bottom { + border-radius: 0; + } +} +.navbar-fixed-top { + top: 0; + border-width: 0 0 1px; +} +.navbar-fixed-bottom { + bottom: 0; + margin-bottom: 0; + border-width: 1px 0 0; +} +.navbar-brand { + float: left; + height: 50px; + padding: 15px 15px; + font-size: 18px; + line-height: 20px; +} +.navbar-brand:hover, +.navbar-brand:focus { + text-decoration: none; +} +.navbar-brand > img { + display: block; +} +@media (min-width: 768px) { + .navbar > .container .navbar-brand, + .navbar > .container-fluid .navbar-brand { + margin-left: -15px; + } +} +.navbar-toggle { + position: relative; + float: right; + padding: 9px 10px; + margin-top: 8px; + margin-right: 15px; + margin-bottom: 8px; + background-color: transparent; + background-image: none; + border: 1px solid transparent; + border-radius: 4px; +} +.navbar-toggle:focus { + outline: 0; +} +.navbar-toggle .icon-bar { + display: block; + width: 22px; + height: 2px; + border-radius: 1px; +} +.navbar-toggle .icon-bar + .icon-bar { + margin-top: 4px; +} +@media (min-width: 768px) { + .navbar-toggle { + display: none; + } +} +.navbar-nav { + margin: 7.5px -15px; +} +.navbar-nav > li > a { + padding-top: 10px; + padding-bottom: 10px; + line-height: 20px; +} +@media (max-width: 767px) { + .navbar-nav .open .dropdown-menu { + position: static; + float: none; + width: auto; + margin-top: 0; + background-color: transparent; + border: 0; + -webkit-box-shadow: none; + box-shadow: none; + } + .navbar-nav .open .dropdown-menu > li > a, + .navbar-nav .open .dropdown-menu .dropdown-header { + padding: 5px 15px 5px 25px; + } + .navbar-nav .open .dropdown-menu > li > a { + line-height: 20px; + } + .navbar-nav .open .dropdown-menu > li > a:hover, + .navbar-nav .open .dropdown-menu > li > a:focus { + background-image: none; + } +} +@media (min-width: 768px) { + .navbar-nav { + float: left; + margin: 0; + } + .navbar-nav > li { + float: left; + } + .navbar-nav > li > a { + padding-top: 15px; + padding-bottom: 15px; + } +} +.navbar-form { + padding: 10px 15px; + margin-top: 8px; + margin-right: -15px; + margin-bottom: 8px; + margin-left: -15px; + border-top: 1px solid transparent; + border-bottom: 1px solid transparent; + -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, .1), 0 1px 0 rgba(255, 255, 255, .1); + box-shadow: inset 0 1px 0 rgba(255, 255, 255, .1), 0 1px 0 rgba(255, 255, 255, .1); +} +@media (min-width: 768px) { + .navbar-form .form-group { + display: inline-block; + margin-bottom: 0; + vertical-align: middle; + } + .navbar-form .form-control { + display: inline-block; + width: auto; + vertical-align: middle; + } + .navbar-form .form-control-static { + display: inline-block; + } + .navbar-form .input-group { + display: inline-table; + vertical-align: middle; + } + .navbar-form .input-group .input-group-addon, + .navbar-form .input-group .input-group-btn, + .navbar-form .input-group .form-control { + width: auto; + } + .navbar-form .input-group > .form-control { + width: 100%; + } + .navbar-form .control-label { + margin-bottom: 0; + vertical-align: middle; + } + .navbar-form .radio, + .navbar-form .checkbox { + display: inline-block; + margin-top: 0; + margin-bottom: 0; + vertical-align: middle; + } + .navbar-form .radio label, + .navbar-form .checkbox label { + padding-left: 0; + } + .navbar-form .radio input[type="radio"], + .navbar-form .checkbox input[type="checkbox"] { + position: relative; + margin-left: 0; + } + .navbar-form .has-feedback .form-control-feedback { + top: 0; + } +} +@media (max-width: 767px) { + .navbar-form .form-group { + margin-bottom: 5px; + } + .navbar-form .form-group:last-child { + margin-bottom: 0; + } +} +@media (min-width: 768px) { + .navbar-form { + width: auto; + padding-top: 0; + padding-bottom: 0; + margin-right: 0; + margin-left: 0; + border: 0; + -webkit-box-shadow: none; + box-shadow: none; + } +} +.navbar-nav > li > .dropdown-menu { + margin-top: 0; + border-top-left-radius: 0; + border-top-right-radius: 0; +} +.navbar-fixed-bottom .navbar-nav > li > .dropdown-menu { + margin-bottom: 0; + border-top-left-radius: 4px; + border-top-right-radius: 4px; + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; +} +.navbar-btn { + margin-top: 8px; + margin-bottom: 8px; +} +.navbar-btn.btn-sm { + margin-top: 10px; + margin-bottom: 10px; +} +.navbar-btn.btn-xs { + margin-top: 14px; + margin-bottom: 14px; +} +.navbar-text { + margin-top: 15px; + margin-bottom: 15px; +} +@media (min-width: 768px) { + .navbar-text { + float: left; + margin-right: 15px; + margin-left: 15px; + } +} +@media (min-width: 768px) { + .navbar-left { + float: left !important; + } + .navbar-right { + float: right !important; + margin-right: -15px; + } + .navbar-right ~ .navbar-right { + margin-right: 0; + } +} +.navbar-default { + background-color: #f8f8f8; + border-color: #e7e7e7; +} +.navbar-default .navbar-brand { + color: #777; +} +.navbar-default .navbar-brand:hover, +.navbar-default .navbar-brand:focus { + color: #5e5e5e; + background-color: transparent; +} +.navbar-default .navbar-text { + color: #777; +} +.navbar-default .navbar-nav > li > a { + color: #777; +} +.navbar-default .navbar-nav > li > a:hover, +.navbar-default .navbar-nav > li > a:focus { + color: #333; + background-color: transparent; +} +.navbar-default .navbar-nav > .active > a, +.navbar-default .navbar-nav > .active > a:hover, +.navbar-default .navbar-nav > .active > a:focus { + color: #555; + background-color: #e7e7e7; +} +.navbar-default .navbar-nav > .disabled > a, +.navbar-default .navbar-nav > .disabled > a:hover, +.navbar-default .navbar-nav > .disabled > a:focus { + color: #ccc; + background-color: transparent; +} +.navbar-default .navbar-toggle { + border-color: #ddd; +} +.navbar-default .navbar-toggle:hover, +.navbar-default .navbar-toggle:focus { + background-color: #ddd; +} +.navbar-default .navbar-toggle .icon-bar { + background-color: #888; +} +.navbar-default .navbar-collapse, +.navbar-default .navbar-form { + border-color: #e7e7e7; +} +.navbar-default .navbar-nav > .open > a, +.navbar-default .navbar-nav > .open > a:hover, +.navbar-default .navbar-nav > .open > a:focus { + color: #555; + background-color: #e7e7e7; +} +@media (max-width: 767px) { + .navbar-default .navbar-nav .open .dropdown-menu > li > a { + color: #777; + } + .navbar-default .navbar-nav .open .dropdown-menu > li > a:hover, + .navbar-default .navbar-nav .open .dropdown-menu > li > a:focus { + color: #333; + background-color: transparent; + } + .navbar-default .navbar-nav .open .dropdown-menu > .active > a, + .navbar-default .navbar-nav .open .dropdown-menu > .active > a:hover, + .navbar-default .navbar-nav .open .dropdown-menu > .active > a:focus { + color: #555; + background-color: #e7e7e7; + } + .navbar-default .navbar-nav .open .dropdown-menu > .disabled > a, + .navbar-default .navbar-nav .open .dropdown-menu > .disabled > a:hover, + .navbar-default .navbar-nav .open .dropdown-menu > .disabled > a:focus { + color: #ccc; + background-color: transparent; + } +} +.navbar-default .navbar-link { + color: #777; +} +.navbar-default .navbar-link:hover { + color: #333; +} +.navbar-default .btn-link { + color: #777; +} +.navbar-default .btn-link:hover, +.navbar-default .btn-link:focus { + color: #333; +} +.navbar-default .btn-link[disabled]:hover, +fieldset[disabled] .navbar-default .btn-link:hover, +.navbar-default .btn-link[disabled]:focus, +fieldset[disabled] .navbar-default .btn-link:focus { + color: #ccc; +} +.navbar-inverse { + background-color: #222; + border-color: #080808; +} +.navbar-inverse .navbar-brand { + color: #9d9d9d; +} +.navbar-inverse .navbar-brand:hover, +.navbar-inverse .navbar-brand:focus { + color: #fff; + background-color: transparent; +} +.navbar-inverse .navbar-text { + color: #9d9d9d; +} +.navbar-inverse .navbar-nav > li > a { + color: #9d9d9d; +} +.navbar-inverse .navbar-nav > li > a:hover, +.navbar-inverse .navbar-nav > li > a:focus { + color: #fff; + background-color: transparent; +} +.navbar-inverse .navbar-nav > .active > a, +.navbar-inverse .navbar-nav > .active > a:hover, +.navbar-inverse .navbar-nav > .active > a:focus { + color: #fff; + background-color: #080808; +} +.navbar-inverse .navbar-nav > .disabled > a, +.navbar-inverse .navbar-nav > .disabled > a:hover, +.navbar-inverse .navbar-nav > .disabled > a:focus { + color: #444; + background-color: transparent; +} +.navbar-inverse .navbar-toggle { + border-color: #333; +} +.navbar-inverse .navbar-toggle:hover, +.navbar-inverse .navbar-toggle:focus { + background-color: #333; +} +.navbar-inverse .navbar-toggle .icon-bar { + background-color: #fff; +} +.navbar-inverse .navbar-collapse, +.navbar-inverse .navbar-form { + border-color: #101010; +} +.navbar-inverse .navbar-nav > .open > a, +.navbar-inverse .navbar-nav > .open > a:hover, +.navbar-inverse .navbar-nav > .open > a:focus { + color: #fff; + background-color: #080808; +} +@media (max-width: 767px) { + .navbar-inverse .navbar-nav .open .dropdown-menu > .dropdown-header { + border-color: #080808; + } + .navbar-inverse .navbar-nav .open .dropdown-menu .divider { + background-color: #080808; + } + .navbar-inverse .navbar-nav .open .dropdown-menu > li > a { + color: #9d9d9d; + } + .navbar-inverse .navbar-nav .open .dropdown-menu > li > a:hover, + .navbar-inverse .navbar-nav .open .dropdown-menu > li > a:focus { + color: #fff; + background-color: transparent; + } + .navbar-inverse .navbar-nav .open .dropdown-menu > .active > a, + .navbar-inverse .navbar-nav .open .dropdown-menu > .active > a:hover, + .navbar-inverse .navbar-nav .open .dropdown-menu > .active > a:focus { + color: #fff; + background-color: #080808; + } + .navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a, + .navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a:hover, + .navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a:focus { + color: #444; + background-color: transparent; + } +} +.navbar-inverse .navbar-link { + color: #9d9d9d; +} +.navbar-inverse .navbar-link:hover { + color: #fff; +} +.navbar-inverse .btn-link { + color: #9d9d9d; +} +.navbar-inverse .btn-link:hover, +.navbar-inverse .btn-link:focus { + color: #fff; +} +.navbar-inverse .btn-link[disabled]:hover, +fieldset[disabled] .navbar-inverse .btn-link:hover, +.navbar-inverse .btn-link[disabled]:focus, +fieldset[disabled] .navbar-inverse .btn-link:focus { + color: #444; +} +.breadcrumb { + padding: 8px 15px; + margin-bottom: 20px; + list-style: none; + background-color: #f5f5f5; + border-radius: 4px; +} +.breadcrumb > li { + display: inline-block; +} +.breadcrumb > li + li:before { + padding: 0 5px; + color: #ccc; + content: "/\00a0"; +} +.breadcrumb > .active { + color: #777; +} +.pagination { + display: inline-block; + padding-left: 0; + margin: 20px 0; + border-radius: 4px; +} +.pagination > li { + display: inline; +} +.pagination > li > a, +.pagination > li > span { + position: relative; + float: left; + padding: 6px 12px; + margin-left: -1px; + line-height: 1.42857143; + color: #337ab7; + text-decoration: none; + background-color: #fff; + border: 1px solid #ddd; +} +.pagination > li:first-child > a, +.pagination > li:first-child > span { + margin-left: 0; + border-top-left-radius: 4px; + border-bottom-left-radius: 4px; +} +.pagination > li:last-child > a, +.pagination > li:last-child > span { + border-top-right-radius: 4px; + border-bottom-right-radius: 4px; +} +.pagination > li > a:hover, +.pagination > li > span:hover, +.pagination > li > a:focus, +.pagination > li > span:focus { + z-index: 2; + color: #23527c; + background-color: #eee; + border-color: #ddd; +} +.pagination > .active > a, +.pagination > .active > span, +.pagination > .active > a:hover, +.pagination > .active > span:hover, +.pagination > .active > a:focus, +.pagination > .active > span:focus { + z-index: 3; + color: #fff; + cursor: default; + background-color: #337ab7; + border-color: #337ab7; +} +.pagination > .disabled > span, +.pagination > .disabled > span:hover, +.pagination > .disabled > span:focus, +.pagination > .disabled > a, +.pagination > .disabled > a:hover, +.pagination > .disabled > a:focus { + color: #777; + cursor: not-allowed; + background-color: #fff; + border-color: #ddd; +} +.pagination-lg > li > a, +.pagination-lg > li > span { + padding: 10px 16px; + font-size: 18px; + line-height: 1.3333333; +} +.pagination-lg > li:first-child > a, +.pagination-lg > li:first-child > span { + border-top-left-radius: 6px; + border-bottom-left-radius: 6px; +} +.pagination-lg > li:last-child > a, +.pagination-lg > li:last-child > span { + border-top-right-radius: 6px; + border-bottom-right-radius: 6px; +} +.pagination-sm > li > a, +.pagination-sm > li > span { + padding: 5px 10px; + font-size: 12px; + line-height: 1.5; +} +.pagination-sm > li:first-child > a, +.pagination-sm > li:first-child > span { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} +.pagination-sm > li:last-child > a, +.pagination-sm > li:last-child > span { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} +.pager { + padding-left: 0; + margin: 20px 0; + text-align: center; + list-style: none; +} +.pager li { + display: inline; +} +.pager li > a, +.pager li > span { + display: inline-block; + padding: 5px 14px; + background-color: #fff; + border: 1px solid #ddd; + border-radius: 15px; +} +.pager li > a:hover, +.pager li > a:focus { + text-decoration: none; + background-color: #eee; +} +.pager .next > a, +.pager .next > span { + float: right; +} +.pager .previous > a, +.pager .previous > span { + float: left; +} +.pager .disabled > a, +.pager .disabled > a:hover, +.pager .disabled > a:focus, +.pager .disabled > span { + color: #777; + cursor: not-allowed; + background-color: #fff; +} +.label { + display: inline; + padding: .2em .6em .3em; + font-size: 75%; + font-weight: bold; + line-height: 1; + color: #fff; + text-align: center; + white-space: nowrap; + vertical-align: baseline; + border-radius: .25em; +} +a.label:hover, +a.label:focus { + color: #fff; + text-decoration: none; + cursor: pointer; +} +.label:empty { + display: none; +} +.btn .label { + position: relative; + top: -1px; +} +.label-default { + background-color: #777; +} +.label-default[href]:hover, +.label-default[href]:focus { + background-color: #5e5e5e; +} +.label-primary { + background-color: #337ab7; +} +.label-primary[href]:hover, +.label-primary[href]:focus { + background-color: #286090; +} +.label-success { + background-color: #5cb85c; +} +.label-success[href]:hover, +.label-success[href]:focus { + background-color: #449d44; +} +.label-info { + background-color: #5bc0de; +} +.label-info[href]:hover, +.label-info[href]:focus { + background-color: #31b0d5; +} +.label-warning { + background-color: #f0ad4e; +} +.label-warning[href]:hover, +.label-warning[href]:focus { + background-color: #ec971f; +} +.label-danger { + background-color: #d9534f; +} +.label-danger[href]:hover, +.label-danger[href]:focus { + background-color: #c9302c; +} +.badge { + display: inline-block; + min-width: 10px; + padding: 3px 7px; + font-size: 12px; + font-weight: bold; + line-height: 1; + color: #fff; + text-align: center; + white-space: nowrap; + vertical-align: middle; + background-color: #777; + border-radius: 10px; +} +.badge:empty { + display: none; +} +.btn .badge { + position: relative; + top: -1px; +} +.btn-xs .badge, +.btn-group-xs > .btn .badge { + top: 0; + padding: 1px 5px; +} +a.badge:hover, +a.badge:focus { + color: #fff; + text-decoration: none; + cursor: pointer; +} +.list-group-item.active > .badge, +.nav-pills > .active > a > .badge { + color: #337ab7; + background-color: #fff; +} +.list-group-item > .badge { + float: right; +} +.list-group-item > .badge + .badge { + margin-right: 5px; +} +.nav-pills > li > a > .badge { + margin-left: 3px; +} +.jumbotron { + padding-top: 30px; + padding-bottom: 30px; + margin-bottom: 30px; + color: inherit; + background-color: #eee; +} +.jumbotron h1, +.jumbotron .h1 { + color: inherit; +} +.jumbotron p { + margin-bottom: 15px; + font-size: 21px; + font-weight: 200; +} +.jumbotron > hr { + border-top-color: #d5d5d5; +} +.container .jumbotron, +.container-fluid .jumbotron { + padding-right: 15px; + padding-left: 15px; + border-radius: 6px; +} +.jumbotron .container { + max-width: 100%; +} +@media screen and (min-width: 768px) { + .jumbotron { + padding-top: 48px; + padding-bottom: 48px; + } + .container .jumbotron, + .container-fluid .jumbotron { + padding-right: 60px; + padding-left: 60px; + } + .jumbotron h1, + .jumbotron .h1 { + font-size: 63px; + } +} +.thumbnail { + display: block; + padding: 4px; + margin-bottom: 20px; + line-height: 1.42857143; + background-color: #fff; + border: 1px solid #ddd; + border-radius: 4px; + -webkit-transition: border .2s ease-in-out; + -o-transition: border .2s ease-in-out; + transition: border .2s ease-in-out; +} +.thumbnail > img, +.thumbnail a > img { + margin-right: auto; + margin-left: auto; +} +a.thumbnail:hover, +a.thumbnail:focus, +a.thumbnail.active { + border-color: #337ab7; +} +.thumbnail .caption { + padding: 9px; + color: #333; +} +.alert { + padding: 15px; + margin-bottom: 20px; + border: 1px solid transparent; + border-radius: 4px; +} +.alert h4 { + margin-top: 0; + color: inherit; +} +.alert .alert-link { + font-weight: bold; +} +.alert > p, +.alert > ul { + margin-bottom: 0; +} +.alert > p + p { + margin-top: 5px; +} +.alert-dismissable, +.alert-dismissible { + padding-right: 35px; +} +.alert-dismissable .close, +.alert-dismissible .close { + position: relative; + top: -2px; + right: -21px; + color: inherit; +} +.alert-success { + color: #3c763d; + background-color: #dff0d8; + border-color: #d6e9c6; +} +.alert-success hr { + border-top-color: #c9e2b3; +} +.alert-success .alert-link { + color: #2b542c; +} +.alert-info { + color: #31708f; + background-color: #d9edf7; + border-color: #bce8f1; +} +.alert-info hr { + border-top-color: #a6e1ec; +} +.alert-info .alert-link { + color: #245269; +} +.alert-warning { + color: #8a6d3b; + background-color: #fcf8e3; + border-color: #faebcc; +} +.alert-warning hr { + border-top-color: #f7e1b5; +} +.alert-warning .alert-link { + color: #66512c; +} +.alert-danger { + color: #a94442; + background-color: #f2dede; + border-color: #ebccd1; +} +.alert-danger hr { + border-top-color: #e4b9c0; +} +.alert-danger .alert-link { + color: #843534; +} +@-webkit-keyframes progress-bar-stripes { + from { + background-position: 40px 0; + } + to { + background-position: 0 0; + } +} +@-o-keyframes progress-bar-stripes { + from { + background-position: 40px 0; + } + to { + background-position: 0 0; + } +} +@keyframes progress-bar-stripes { + from { + background-position: 40px 0; + } + to { + background-position: 0 0; + } +} +.progress { + height: 20px; + margin-bottom: 20px; + overflow: hidden; + background-color: #f5f5f5; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, .1); + box-shadow: inset 0 1px 2px rgba(0, 0, 0, .1); +} +.progress-bar { + float: left; + width: 0; + height: 100%; + font-size: 12px; + line-height: 20px; + color: #fff; + text-align: center; + background-color: #337ab7; + -webkit-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, .15); + box-shadow: inset 0 -1px 0 rgba(0, 0, 0, .15); + -webkit-transition: width .6s ease; + -o-transition: width .6s ease; + transition: width .6s ease; +} +.progress-striped .progress-bar, +.progress-bar-striped { + background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent); + background-image: linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent); + -webkit-background-size: 40px 40px; + background-size: 40px 40px; +} +.progress.active .progress-bar, +.progress-bar.active { + -webkit-animation: progress-bar-stripes 2s linear infinite; + -o-animation: progress-bar-stripes 2s linear infinite; + animation: progress-bar-stripes 2s linear infinite; +} +.progress-bar-success { + background-color: #5cb85c; +} +.progress-striped .progress-bar-success { + background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent); + background-image: linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent); +} +.progress-bar-info { + background-color: #5bc0de; +} +.progress-striped .progress-bar-info { + background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent); + background-image: linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent); +} +.progress-bar-warning { + background-color: #f0ad4e; +} +.progress-striped .progress-bar-warning { + background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent); + background-image: linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent); +} +.progress-bar-danger { + background-color: #d9534f; +} +.progress-striped .progress-bar-danger { + background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent); + background-image: linear-gradient(45deg, rgba(255, 255, 255, .15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, .15) 50%, rgba(255, 255, 255, .15) 75%, transparent 75%, transparent); +} +.media { + margin-top: 15px; +} +.media:first-child { + margin-top: 0; +} +.media, +.media-body { + overflow: hidden; + zoom: 1; +} +.media-body { + width: 10000px; +} +.media-object { + display: block; +} +.media-object.img-thumbnail { + max-width: none; +} +.media-right, +.media > .pull-right { + padding-left: 10px; +} +.media-left, +.media > .pull-left { + padding-right: 10px; +} +.media-left, +.media-right, +.media-body { + display: table-cell; + vertical-align: top; +} +.media-middle { + vertical-align: middle; +} +.media-bottom { + vertical-align: bottom; +} +.media-heading { + margin-top: 0; + margin-bottom: 5px; +} +.media-list { + padding-left: 0; + list-style: none; +} +.list-group { + padding-left: 0; + margin-bottom: 20px; +} +.list-group-item { + position: relative; + display: block; + padding: 10px 15px; + margin-bottom: -1px; + background-color: #fff; + border: 1px solid #ddd; +} +.list-group-item:first-child { + border-top-left-radius: 4px; + border-top-right-radius: 4px; +} +.list-group-item:last-child { + margin-bottom: 0; + border-bottom-right-radius: 4px; + border-bottom-left-radius: 4px; +} +a.list-group-item, +button.list-group-item { + color: #555; +} +a.list-group-item .list-group-item-heading, +button.list-group-item .list-group-item-heading { + color: #333; +} +a.list-group-item:hover, +button.list-group-item:hover, +a.list-group-item:focus, +button.list-group-item:focus { + color: #555; + text-decoration: none; + background-color: #f5f5f5; +} +button.list-group-item { + width: 100%; + text-align: left; +} +.list-group-item.disabled, +.list-group-item.disabled:hover, +.list-group-item.disabled:focus { + color: #777; + cursor: not-allowed; + background-color: #eee; +} +.list-group-item.disabled .list-group-item-heading, +.list-group-item.disabled:hover .list-group-item-heading, +.list-group-item.disabled:focus .list-group-item-heading { + color: inherit; +} +.list-group-item.disabled .list-group-item-text, +.list-group-item.disabled:hover .list-group-item-text, +.list-group-item.disabled:focus .list-group-item-text { + color: #777; +} +.list-group-item.active, +.list-group-item.active:hover, +.list-group-item.active:focus { + z-index: 2; + color: #fff; + background-color: #337ab7; + border-color: #337ab7; +} +.list-group-item.active .list-group-item-heading, +.list-group-item.active:hover .list-group-item-heading, +.list-group-item.active:focus .list-group-item-heading, +.list-group-item.active .list-group-item-heading > small, +.list-group-item.active:hover .list-group-item-heading > small, +.list-group-item.active:focus .list-group-item-heading > small, +.list-group-item.active .list-group-item-heading > .small, +.list-group-item.active:hover .list-group-item-heading > .small, +.list-group-item.active:focus .list-group-item-heading > .small { + color: inherit; +} +.list-group-item.active .list-group-item-text, +.list-group-item.active:hover .list-group-item-text, +.list-group-item.active:focus .list-group-item-text { + color: #c7ddef; +} +.list-group-item-success { + color: #3c763d; + background-color: #dff0d8; +} +a.list-group-item-success, +button.list-group-item-success { + color: #3c763d; +} +a.list-group-item-success .list-group-item-heading, +button.list-group-item-success .list-group-item-heading { + color: inherit; +} +a.list-group-item-success:hover, +button.list-group-item-success:hover, +a.list-group-item-success:focus, +button.list-group-item-success:focus { + color: #3c763d; + background-color: #d0e9c6; +} +a.list-group-item-success.active, +button.list-group-item-success.active, +a.list-group-item-success.active:hover, +button.list-group-item-success.active:hover, +a.list-group-item-success.active:focus, +button.list-group-item-success.active:focus { + color: #fff; + background-color: #3c763d; + border-color: #3c763d; +} +.list-group-item-info { + color: #31708f; + background-color: #d9edf7; +} +a.list-group-item-info, +button.list-group-item-info { + color: #31708f; +} +a.list-group-item-info .list-group-item-heading, +button.list-group-item-info .list-group-item-heading { + color: inherit; +} +a.list-group-item-info:hover, +button.list-group-item-info:hover, +a.list-group-item-info:focus, +button.list-group-item-info:focus { + color: #31708f; + background-color: #c4e3f3; +} +a.list-group-item-info.active, +button.list-group-item-info.active, +a.list-group-item-info.active:hover, +button.list-group-item-info.active:hover, +a.list-group-item-info.active:focus, +button.list-group-item-info.active:focus { + color: #fff; + background-color: #31708f; + border-color: #31708f; +} +.list-group-item-warning { + color: #8a6d3b; + background-color: #fcf8e3; +} +a.list-group-item-warning, +button.list-group-item-warning { + color: #8a6d3b; +} +a.list-group-item-warning .list-group-item-heading, +button.list-group-item-warning .list-group-item-heading { + color: inherit; +} +a.list-group-item-warning:hover, +button.list-group-item-warning:hover, +a.list-group-item-warning:focus, +button.list-group-item-warning:focus { + color: #8a6d3b; + background-color: #faf2cc; +} +a.list-group-item-warning.active, +button.list-group-item-warning.active, +a.list-group-item-warning.active:hover, +button.list-group-item-warning.active:hover, +a.list-group-item-warning.active:focus, +button.list-group-item-warning.active:focus { + color: #fff; + background-color: #8a6d3b; + border-color: #8a6d3b; +} +.list-group-item-danger { + color: #a94442; + background-color: #f2dede; +} +a.list-group-item-danger, +button.list-group-item-danger { + color: #a94442; +} +a.list-group-item-danger .list-group-item-heading, +button.list-group-item-danger .list-group-item-heading { + color: inherit; +} +a.list-group-item-danger:hover, +button.list-group-item-danger:hover, +a.list-group-item-danger:focus, +button.list-group-item-danger:focus { + color: #a94442; + background-color: #ebcccc; +} +a.list-group-item-danger.active, +button.list-group-item-danger.active, +a.list-group-item-danger.active:hover, +button.list-group-item-danger.active:hover, +a.list-group-item-danger.active:focus, +button.list-group-item-danger.active:focus { + color: #fff; + background-color: #a94442; + border-color: #a94442; +} +.list-group-item-heading { + margin-top: 0; + margin-bottom: 5px; +} +.list-group-item-text { + margin-bottom: 0; + line-height: 1.3; +} +.panel { + margin-bottom: 20px; + background-color: #fff; + border: 1px solid transparent; + border-radius: 4px; + -webkit-box-shadow: 0 1px 1px rgba(0, 0, 0, .05); + box-shadow: 0 1px 1px rgba(0, 0, 0, .05); +} +.panel-body { + padding: 15px; +} +.panel-heading { + padding: 10px 15px; + border-bottom: 1px solid transparent; + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} +.panel-heading > .dropdown .dropdown-toggle { + color: inherit; +} +.panel-title { + margin-top: 0; + margin-bottom: 0; + font-size: 16px; + color: inherit; +} +.panel-title > a, +.panel-title > small, +.panel-title > .small, +.panel-title > small > a, +.panel-title > .small > a { + color: inherit; +} +.panel-footer { + padding: 10px 15px; + background-color: #f5f5f5; + border-top: 1px solid #ddd; + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} +.panel > .list-group, +.panel > .panel-collapse > .list-group { + margin-bottom: 0; +} +.panel > .list-group .list-group-item, +.panel > .panel-collapse > .list-group .list-group-item { + border-width: 1px 0; + border-radius: 0; +} +.panel > .list-group:first-child .list-group-item:first-child, +.panel > .panel-collapse > .list-group:first-child .list-group-item:first-child { + border-top: 0; + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} +.panel > .list-group:last-child .list-group-item:last-child, +.panel > .panel-collapse > .list-group:last-child .list-group-item:last-child { + border-bottom: 0; + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} +.panel > .panel-heading + .panel-collapse > .list-group .list-group-item:first-child { + border-top-left-radius: 0; + border-top-right-radius: 0; +} +.panel-heading + .list-group .list-group-item:first-child { + border-top-width: 0; +} +.list-group + .panel-footer { + border-top-width: 0; +} +.panel > .table, +.panel > .table-responsive > .table, +.panel > .panel-collapse > .table { + margin-bottom: 0; +} +.panel > .table caption, +.panel > .table-responsive > .table caption, +.panel > .panel-collapse > .table caption { + padding-right: 15px; + padding-left: 15px; +} +.panel > .table:first-child, +.panel > .table-responsive:first-child > .table:first-child { + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} +.panel > .table:first-child > thead:first-child > tr:first-child, +.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child, +.panel > .table:first-child > tbody:first-child > tr:first-child, +.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child { + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} +.panel > .table:first-child > thead:first-child > tr:first-child td:first-child, +.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child td:first-child, +.panel > .table:first-child > tbody:first-child > tr:first-child td:first-child, +.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child td:first-child, +.panel > .table:first-child > thead:first-child > tr:first-child th:first-child, +.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child th:first-child, +.panel > .table:first-child > tbody:first-child > tr:first-child th:first-child, +.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child th:first-child { + border-top-left-radius: 3px; +} +.panel > .table:first-child > thead:first-child > tr:first-child td:last-child, +.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child td:last-child, +.panel > .table:first-child > tbody:first-child > tr:first-child td:last-child, +.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child td:last-child, +.panel > .table:first-child > thead:first-child > tr:first-child th:last-child, +.panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child th:last-child, +.panel > .table:first-child > tbody:first-child > tr:first-child th:last-child, +.panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child th:last-child { + border-top-right-radius: 3px; +} +.panel > .table:last-child, +.panel > .table-responsive:last-child > .table:last-child { + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} +.panel > .table:last-child > tbody:last-child > tr:last-child, +.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child, +.panel > .table:last-child > tfoot:last-child > tr:last-child, +.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child { + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} +.panel > .table:last-child > tbody:last-child > tr:last-child td:first-child, +.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child td:first-child, +.panel > .table:last-child > tfoot:last-child > tr:last-child td:first-child, +.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child td:first-child, +.panel > .table:last-child > tbody:last-child > tr:last-child th:first-child, +.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child th:first-child, +.panel > .table:last-child > tfoot:last-child > tr:last-child th:first-child, +.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child th:first-child { + border-bottom-left-radius: 3px; +} +.panel > .table:last-child > tbody:last-child > tr:last-child td:last-child, +.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child td:last-child, +.panel > .table:last-child > tfoot:last-child > tr:last-child td:last-child, +.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child td:last-child, +.panel > .table:last-child > tbody:last-child > tr:last-child th:last-child, +.panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child th:last-child, +.panel > .table:last-child > tfoot:last-child > tr:last-child th:last-child, +.panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child th:last-child { + border-bottom-right-radius: 3px; +} +.panel > .panel-body + .table, +.panel > .panel-body + .table-responsive, +.panel > .table + .panel-body, +.panel > .table-responsive + .panel-body { + border-top: 1px solid #ddd; +} +.panel > .table > tbody:first-child > tr:first-child th, +.panel > .table > tbody:first-child > tr:first-child td { + border-top: 0; +} +.panel > .table-bordered, +.panel > .table-responsive > .table-bordered { + border: 0; +} +.panel > .table-bordered > thead > tr > th:first-child, +.panel > .table-responsive > .table-bordered > thead > tr > th:first-child, +.panel > .table-bordered > tbody > tr > th:first-child, +.panel > .table-responsive > .table-bordered > tbody > tr > th:first-child, +.panel > .table-bordered > tfoot > tr > th:first-child, +.panel > .table-responsive > .table-bordered > tfoot > tr > th:first-child, +.panel > .table-bordered > thead > tr > td:first-child, +.panel > .table-responsive > .table-bordered > thead > tr > td:first-child, +.panel > .table-bordered > tbody > tr > td:first-child, +.panel > .table-responsive > .table-bordered > tbody > tr > td:first-child, +.panel > .table-bordered > tfoot > tr > td:first-child, +.panel > .table-responsive > .table-bordered > tfoot > tr > td:first-child { + border-left: 0; +} +.panel > .table-bordered > thead > tr > th:last-child, +.panel > .table-responsive > .table-bordered > thead > tr > th:last-child, +.panel > .table-bordered > tbody > tr > th:last-child, +.panel > .table-responsive > .table-bordered > tbody > tr > th:last-child, +.panel > .table-bordered > tfoot > tr > th:last-child, +.panel > .table-responsive > .table-bordered > tfoot > tr > th:last-child, +.panel > .table-bordered > thead > tr > td:last-child, +.panel > .table-responsive > .table-bordered > thead > tr > td:last-child, +.panel > .table-bordered > tbody > tr > td:last-child, +.panel > .table-responsive > .table-bordered > tbody > tr > td:last-child, +.panel > .table-bordered > tfoot > tr > td:last-child, +.panel > .table-responsive > .table-bordered > tfoot > tr > td:last-child { + border-right: 0; +} +.panel > .table-bordered > thead > tr:first-child > td, +.panel > .table-responsive > .table-bordered > thead > tr:first-child > td, +.panel > .table-bordered > tbody > tr:first-child > td, +.panel > .table-responsive > .table-bordered > tbody > tr:first-child > td, +.panel > .table-bordered > thead > tr:first-child > th, +.panel > .table-responsive > .table-bordered > thead > tr:first-child > th, +.panel > .table-bordered > tbody > tr:first-child > th, +.panel > .table-responsive > .table-bordered > tbody > tr:first-child > th { + border-bottom: 0; +} +.panel > .table-bordered > tbody > tr:last-child > td, +.panel > .table-responsive > .table-bordered > tbody > tr:last-child > td, +.panel > .table-bordered > tfoot > tr:last-child > td, +.panel > .table-responsive > .table-bordered > tfoot > tr:last-child > td, +.panel > .table-bordered > tbody > tr:last-child > th, +.panel > .table-responsive > .table-bordered > tbody > tr:last-child > th, +.panel > .table-bordered > tfoot > tr:last-child > th, +.panel > .table-responsive > .table-bordered > tfoot > tr:last-child > th { + border-bottom: 0; +} +.panel > .table-responsive { + margin-bottom: 0; + border: 0; +} +.panel-group { + margin-bottom: 20px; +} +.panel-group .panel { + margin-bottom: 0; + border-radius: 4px; +} +.panel-group .panel + .panel { + margin-top: 5px; +} +.panel-group .panel-heading { + border-bottom: 0; +} +.panel-group .panel-heading + .panel-collapse > .panel-body, +.panel-group .panel-heading + .panel-collapse > .list-group { + border-top: 1px solid #ddd; +} +.panel-group .panel-footer { + border-top: 0; +} +.panel-group .panel-footer + .panel-collapse .panel-body { + border-bottom: 1px solid #ddd; +} +.panel-default { + border-color: #ddd; +} +.panel-default > .panel-heading { + color: #333; + background-color: #f5f5f5; + border-color: #ddd; +} +.panel-default > .panel-heading + .panel-collapse > .panel-body { + border-top-color: #ddd; +} +.panel-default > .panel-heading .badge { + color: #f5f5f5; + background-color: #333; +} +.panel-default > .panel-footer + .panel-collapse > .panel-body { + border-bottom-color: #ddd; +} +.panel-primary { + border-color: #337ab7; +} +.panel-primary > .panel-heading { + color: #fff; + background-color: #337ab7; + border-color: #337ab7; +} +.panel-primary > .panel-heading + .panel-collapse > .panel-body { + border-top-color: #337ab7; +} +.panel-primary > .panel-heading .badge { + color: #337ab7; + background-color: #fff; +} +.panel-primary > .panel-footer + .panel-collapse > .panel-body { + border-bottom-color: #337ab7; +} +.panel-success { + border-color: #d6e9c6; +} +.panel-success > .panel-heading { + color: #3c763d; + background-color: #dff0d8; + border-color: #d6e9c6; +} +.panel-success > .panel-heading + .panel-collapse > .panel-body { + border-top-color: #d6e9c6; +} +.panel-success > .panel-heading .badge { + color: #dff0d8; + background-color: #3c763d; +} +.panel-success > .panel-footer + .panel-collapse > .panel-body { + border-bottom-color: #d6e9c6; +} +.panel-info { + border-color: #bce8f1; +} +.panel-info > .panel-heading { + color: #31708f; + background-color: #d9edf7; + border-color: #bce8f1; +} +.panel-info > .panel-heading + .panel-collapse > .panel-body { + border-top-color: #bce8f1; +} +.panel-info > .panel-heading .badge { + color: #d9edf7; + background-color: #31708f; +} +.panel-info > .panel-footer + .panel-collapse > .panel-body { + border-bottom-color: #bce8f1; +} +.panel-warning { + border-color: #faebcc; +} +.panel-warning > .panel-heading { + color: #8a6d3b; + background-color: #fcf8e3; + border-color: #faebcc; +} +.panel-warning > .panel-heading + .panel-collapse > .panel-body { + border-top-color: #faebcc; +} +.panel-warning > .panel-heading .badge { + color: #fcf8e3; + background-color: #8a6d3b; +} +.panel-warning > .panel-footer + .panel-collapse > .panel-body { + border-bottom-color: #faebcc; +} +.panel-danger { + border-color: #ebccd1; +} +.panel-danger > .panel-heading { + color: #a94442; + background-color: #f2dede; + border-color: #ebccd1; +} +.panel-danger > .panel-heading + .panel-collapse > .panel-body { + border-top-color: #ebccd1; +} +.panel-danger > .panel-heading .badge { + color: #f2dede; + background-color: #a94442; +} +.panel-danger > .panel-footer + .panel-collapse > .panel-body { + border-bottom-color: #ebccd1; +} +.embed-responsive { + position: relative; + display: block; + height: 0; + padding: 0; + overflow: hidden; +} +.embed-responsive .embed-responsive-item, +.embed-responsive iframe, +.embed-responsive embed, +.embed-responsive object, +.embed-responsive video { + position: absolute; + top: 0; + bottom: 0; + left: 0; + width: 100%; + height: 100%; + border: 0; +} +.embed-responsive-16by9 { + padding-bottom: 56.25%; +} +.embed-responsive-4by3 { + padding-bottom: 75%; +} +.well { + min-height: 20px; + padding: 19px; + margin-bottom: 20px; + background-color: #f5f5f5; + border: 1px solid #e3e3e3; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, .05); + box-shadow: inset 0 1px 1px rgba(0, 0, 0, .05); +} +.well blockquote { + border-color: #ddd; + border-color: rgba(0, 0, 0, .15); +} +.well-lg { + padding: 24px; + border-radius: 6px; +} +.well-sm { + padding: 9px; + border-radius: 3px; +} +.close { + float: right; + font-size: 21px; + font-weight: bold; + line-height: 1; + color: #000; + text-shadow: 0 1px 0 #fff; + filter: alpha(opacity=20); + opacity: .2; +} +.close:hover, +.close:focus { + color: #000; + text-decoration: none; + cursor: pointer; + filter: alpha(opacity=50); + opacity: .5; +} +button.close { + -webkit-appearance: none; + padding: 0; + cursor: pointer; + background: transparent; + border: 0; +} +.modal-open { + overflow: hidden; +} +.modal { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 1050; + display: none; + overflow: hidden; + -webkit-overflow-scrolling: touch; + outline: 0; +} +.modal.fade .modal-dialog { + -webkit-transition: -webkit-transform .3s ease-out; + -o-transition: -o-transform .3s ease-out; + transition: transform .3s ease-out; + -webkit-transform: translate(0, -25%); + -ms-transform: translate(0, -25%); + -o-transform: translate(0, -25%); + transform: translate(0, -25%); +} +.modal.in .modal-dialog { + -webkit-transform: translate(0, 0); + -ms-transform: translate(0, 0); + -o-transform: translate(0, 0); + transform: translate(0, 0); +} +.modal-open .modal { + overflow-x: hidden; + overflow-y: auto; +} +.modal-dialog { + position: relative; + width: auto; + margin: 10px; +} +.modal-content { + position: relative; + background-color: #fff; + -webkit-background-clip: padding-box; + background-clip: padding-box; + border: 1px solid #999; + border: 1px solid rgba(0, 0, 0, .2); + border-radius: 6px; + outline: 0; + -webkit-box-shadow: 0 3px 9px rgba(0, 0, 0, .5); + box-shadow: 0 3px 9px rgba(0, 0, 0, .5); +} +.modal-backdrop { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 1040; + background-color: #000; +} +.modal-backdrop.fade { + filter: alpha(opacity=0); + opacity: 0; +} +.modal-backdrop.in { + filter: alpha(opacity=50); + opacity: .5; +} +.modal-header { + padding: 15px; + border-bottom: 1px solid #e5e5e5; +} +.modal-header .close { + margin-top: -2px; +} +.modal-title { + margin: 0; + line-height: 1.42857143; +} +.modal-body { + position: relative; + padding: 15px; +} +.modal-footer { + padding: 15px; + text-align: right; + border-top: 1px solid #e5e5e5; +} +.modal-footer .btn + .btn { + margin-bottom: 0; + margin-left: 5px; +} +.modal-footer .btn-group .btn + .btn { + margin-left: -1px; +} +.modal-footer .btn-block + .btn-block { + margin-left: 0; +} +.modal-scrollbar-measure { + position: absolute; + top: -9999px; + width: 50px; + height: 50px; + overflow: scroll; +} +@media (min-width: 768px) { + .modal-dialog { + width: 600px; + margin: 30px auto; + } + .modal-content { + -webkit-box-shadow: 0 5px 15px rgba(0, 0, 0, .5); + box-shadow: 0 5px 15px rgba(0, 0, 0, .5); + } + .modal-sm { + width: 300px; + } +} +@media (min-width: 992px) { + .modal-lg { + width: 900px; + } +} +.tooltip { + position: absolute; + z-index: 1070; + display: block; + font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; + font-size: 12px; + font-style: normal; + font-weight: normal; + line-height: 1.42857143; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + word-spacing: normal; + word-wrap: normal; + white-space: normal; + filter: alpha(opacity=0); + opacity: 0; + + line-break: auto; +} +.tooltip.in { + filter: alpha(opacity=90); + opacity: .9; +} +.tooltip.top { + padding: 5px 0; + margin-top: -3px; +} +.tooltip.right { + padding: 0 5px; + margin-left: 3px; +} +.tooltip.bottom { + padding: 5px 0; + margin-top: 3px; +} +.tooltip.left { + padding: 0 5px; + margin-left: -3px; +} +.tooltip-inner { + max-width: 200px; + padding: 3px 8px; + color: #fff; + text-align: center; + background-color: #000; + border-radius: 4px; +} +.tooltip-arrow { + position: absolute; + width: 0; + height: 0; + border-color: transparent; + border-style: solid; +} +.tooltip.top .tooltip-arrow { + bottom: 0; + left: 50%; + margin-left: -5px; + border-width: 5px 5px 0; + border-top-color: #000; +} +.tooltip.top-left .tooltip-arrow { + right: 5px; + bottom: 0; + margin-bottom: -5px; + border-width: 5px 5px 0; + border-top-color: #000; +} +.tooltip.top-right .tooltip-arrow { + bottom: 0; + left: 5px; + margin-bottom: -5px; + border-width: 5px 5px 0; + border-top-color: #000; +} +.tooltip.right .tooltip-arrow { + top: 50%; + left: 0; + margin-top: -5px; + border-width: 5px 5px 5px 0; + border-right-color: #000; +} +.tooltip.left .tooltip-arrow { + top: 50%; + right: 0; + margin-top: -5px; + border-width: 5px 0 5px 5px; + border-left-color: #000; +} +.tooltip.bottom .tooltip-arrow { + top: 0; + left: 50%; + margin-left: -5px; + border-width: 0 5px 5px; + border-bottom-color: #000; +} +.tooltip.bottom-left .tooltip-arrow { + top: 0; + right: 5px; + margin-top: -5px; + border-width: 0 5px 5px; + border-bottom-color: #000; +} +.tooltip.bottom-right .tooltip-arrow { + top: 0; + left: 5px; + margin-top: -5px; + border-width: 0 5px 5px; + border-bottom-color: #000; +} +.popover { + position: absolute; + top: 0; + left: 0; + z-index: 1060; + display: none; + max-width: 276px; + padding: 1px; + font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; + font-size: 14px; + font-style: normal; + font-weight: normal; + line-height: 1.42857143; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + word-spacing: normal; + word-wrap: normal; + white-space: normal; + background-color: #fff; + -webkit-background-clip: padding-box; + background-clip: padding-box; + border: 1px solid #ccc; + border: 1px solid rgba(0, 0, 0, .2); + border-radius: 6px; + -webkit-box-shadow: 0 5px 10px rgba(0, 0, 0, .2); + box-shadow: 0 5px 10px rgba(0, 0, 0, .2); + + line-break: auto; +} +.popover.top { + margin-top: -10px; +} +.popover.right { + margin-left: 10px; +} +.popover.bottom { + margin-top: 10px; +} +.popover.left { + margin-left: -10px; +} +.popover-title { + padding: 8px 14px; + margin: 0; + font-size: 14px; + background-color: #f7f7f7; + border-bottom: 1px solid #ebebeb; + border-radius: 5px 5px 0 0; +} +.popover-content { + padding: 9px 14px; +} +.popover > .arrow, +.popover > .arrow:after { + position: absolute; + display: block; + width: 0; + height: 0; + border-color: transparent; + border-style: solid; +} +.popover > .arrow { + border-width: 11px; +} +.popover > .arrow:after { + content: ""; + border-width: 10px; +} +.popover.top > .arrow { + bottom: -11px; + left: 50%; + margin-left: -11px; + border-top-color: #999; + border-top-color: rgba(0, 0, 0, .25); + border-bottom-width: 0; +} +.popover.top > .arrow:after { + bottom: 1px; + margin-left: -10px; + content: " "; + border-top-color: #fff; + border-bottom-width: 0; +} +.popover.right > .arrow { + top: 50%; + left: -11px; + margin-top: -11px; + border-right-color: #999; + border-right-color: rgba(0, 0, 0, .25); + border-left-width: 0; +} +.popover.right > .arrow:after { + bottom: -10px; + left: 1px; + content: " "; + border-right-color: #fff; + border-left-width: 0; +} +.popover.bottom > .arrow { + top: -11px; + left: 50%; + margin-left: -11px; + border-top-width: 0; + border-bottom-color: #999; + border-bottom-color: rgba(0, 0, 0, .25); +} +.popover.bottom > .arrow:after { + top: 1px; + margin-left: -10px; + content: " "; + border-top-width: 0; + border-bottom-color: #fff; +} +.popover.left > .arrow { + top: 50%; + right: -11px; + margin-top: -11px; + border-right-width: 0; + border-left-color: #999; + border-left-color: rgba(0, 0, 0, .25); +} +.popover.left > .arrow:after { + right: 1px; + bottom: -10px; + content: " "; + border-right-width: 0; + border-left-color: #fff; +} +.carousel { + position: relative; +} +.carousel-inner { + position: relative; + width: 100%; + overflow: hidden; +} +.carousel-inner > .item { + position: relative; + display: none; + -webkit-transition: .6s ease-in-out left; + -o-transition: .6s ease-in-out left; + transition: .6s ease-in-out left; +} +.carousel-inner > .item > img, +.carousel-inner > .item > a > img { + line-height: 1; +} +@media all and (transform-3d), (-webkit-transform-3d) { + .carousel-inner > .item { + -webkit-transition: -webkit-transform .6s ease-in-out; + -o-transition: -o-transform .6s ease-in-out; + transition: transform .6s ease-in-out; + + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-perspective: 1000px; + perspective: 1000px; + } + .carousel-inner > .item.next, + .carousel-inner > .item.active.right { + left: 0; + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + } + .carousel-inner > .item.prev, + .carousel-inner > .item.active.left { + left: 0; + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + } + .carousel-inner > .item.next.left, + .carousel-inner > .item.prev.right, + .carousel-inner > .item.active { + left: 0; + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} +.carousel-inner > .active, +.carousel-inner > .next, +.carousel-inner > .prev { + display: block; +} +.carousel-inner > .active { + left: 0; +} +.carousel-inner > .next, +.carousel-inner > .prev { + position: absolute; + top: 0; + width: 100%; +} +.carousel-inner > .next { + left: 100%; +} +.carousel-inner > .prev { + left: -100%; +} +.carousel-inner > .next.left, +.carousel-inner > .prev.right { + left: 0; +} +.carousel-inner > .active.left { + left: -100%; +} +.carousel-inner > .active.right { + left: 100%; +} +.carousel-control { + position: absolute; + top: 0; + bottom: 0; + left: 0; + width: 15%; + font-size: 20px; + color: #fff; + text-align: center; + text-shadow: 0 1px 2px rgba(0, 0, 0, .6); + background-color: rgba(0, 0, 0, 0); + filter: alpha(opacity=50); + opacity: .5; +} +.carousel-control.left { + background-image: -webkit-linear-gradient(left, rgba(0, 0, 0, .5) 0%, rgba(0, 0, 0, .0001) 100%); + background-image: -o-linear-gradient(left, rgba(0, 0, 0, .5) 0%, rgba(0, 0, 0, .0001) 100%); + background-image: -webkit-gradient(linear, left top, right top, from(rgba(0, 0, 0, .5)), to(rgba(0, 0, 0, .0001))); + background-image: linear-gradient(to right, rgba(0, 0, 0, .5) 0%, rgba(0, 0, 0, .0001) 100%); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#80000000', endColorstr='#00000000', GradientType=1); + background-repeat: repeat-x; +} +.carousel-control.right { + right: 0; + left: auto; + background-image: -webkit-linear-gradient(left, rgba(0, 0, 0, .0001) 0%, rgba(0, 0, 0, .5) 100%); + background-image: -o-linear-gradient(left, rgba(0, 0, 0, .0001) 0%, rgba(0, 0, 0, .5) 100%); + background-image: -webkit-gradient(linear, left top, right top, from(rgba(0, 0, 0, .0001)), to(rgba(0, 0, 0, .5))); + background-image: linear-gradient(to right, rgba(0, 0, 0, .0001) 0%, rgba(0, 0, 0, .5) 100%); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#00000000', endColorstr='#80000000', GradientType=1); + background-repeat: repeat-x; +} +.carousel-control:hover, +.carousel-control:focus { + color: #fff; + text-decoration: none; + filter: alpha(opacity=90); + outline: 0; + opacity: .9; +} +.carousel-control .icon-prev, +.carousel-control .icon-next, +.carousel-control .glyphicon-chevron-left, +.carousel-control .glyphicon-chevron-right { + position: absolute; + top: 50%; + z-index: 5; + display: inline-block; + margin-top: -10px; +} +.carousel-control .icon-prev, +.carousel-control .glyphicon-chevron-left { + left: 50%; + margin-left: -10px; +} +.carousel-control .icon-next, +.carousel-control .glyphicon-chevron-right { + right: 50%; + margin-right: -10px; +} +.carousel-control .icon-prev, +.carousel-control .icon-next { + width: 20px; + height: 20px; + font-family: serif; + line-height: 1; +} +.carousel-control .icon-prev:before { + content: '\2039'; +} +.carousel-control .icon-next:before { + content: '\203a'; +} +.carousel-indicators { + position: absolute; + bottom: 10px; + left: 50%; + z-index: 15; + width: 60%; + padding-left: 0; + margin-left: -30%; + text-align: center; + list-style: none; +} +.carousel-indicators li { + display: inline-block; + width: 10px; + height: 10px; + margin: 1px; + text-indent: -999px; + cursor: pointer; + background-color: #000 \9; + background-color: rgba(0, 0, 0, 0); + border: 1px solid #fff; + border-radius: 10px; +} +.carousel-indicators .active { + width: 12px; + height: 12px; + margin: 0; + background-color: #fff; +} +.carousel-caption { + position: absolute; + right: 15%; + bottom: 20px; + left: 15%; + z-index: 10; + padding-top: 20px; + padding-bottom: 20px; + color: #fff; + text-align: center; + text-shadow: 0 1px 2px rgba(0, 0, 0, .6); +} +.carousel-caption .btn { + text-shadow: none; +} +@media screen and (min-width: 768px) { + .carousel-control .glyphicon-chevron-left, + .carousel-control .glyphicon-chevron-right, + .carousel-control .icon-prev, + .carousel-control .icon-next { + width: 30px; + height: 30px; + margin-top: -10px; + font-size: 30px; + } + .carousel-control .glyphicon-chevron-left, + .carousel-control .icon-prev { + margin-left: -10px; + } + .carousel-control .glyphicon-chevron-right, + .carousel-control .icon-next { + margin-right: -10px; + } + .carousel-caption { + right: 20%; + left: 20%; + padding-bottom: 30px; + } + .carousel-indicators { + bottom: 20px; + } +} +.clearfix:before, +.clearfix:after, +.dl-horizontal dd:before, +.dl-horizontal dd:after, +.container:before, +.container:after, +.container-fluid:before, +.container-fluid:after, +.row:before, +.row:after, +.form-horizontal .form-group:before, +.form-horizontal .form-group:after, +.btn-toolbar:before, +.btn-toolbar:after, +.btn-group-vertical > .btn-group:before, +.btn-group-vertical > .btn-group:after, +.nav:before, +.nav:after, +.navbar:before, +.navbar:after, +.navbar-header:before, +.navbar-header:after, +.navbar-collapse:before, +.navbar-collapse:after, +.pager:before, +.pager:after, +.panel-body:before, +.panel-body:after, +.modal-header:before, +.modal-header:after, +.modal-footer:before, +.modal-footer:after { + display: table; + content: " "; +} +.clearfix:after, +.dl-horizontal dd:after, +.container:after, +.container-fluid:after, +.row:after, +.form-horizontal .form-group:after, +.btn-toolbar:after, +.btn-group-vertical > .btn-group:after, +.nav:after, +.navbar:after, +.navbar-header:after, +.navbar-collapse:after, +.pager:after, +.panel-body:after, +.modal-header:after, +.modal-footer:after { + clear: both; +} +.center-block { + display: block; + margin-right: auto; + margin-left: auto; +} +.pull-right { + float: right !important; +} +.pull-left { + float: left !important; +} +.hide { + display: none !important; +} +.show { + display: block !important; +} +.invisible { + visibility: hidden; +} +.text-hide { + font: 0/0 a; + color: transparent; + text-shadow: none; + background-color: transparent; + border: 0; +} +.hidden { + display: none !important; +} +.affix { + position: fixed; +} +@-ms-viewport { + width: device-width; +} +.visible-xs, +.visible-sm, +.visible-md, +.visible-lg { + display: none !important; +} +.visible-xs-block, +.visible-xs-inline, +.visible-xs-inline-block, +.visible-sm-block, +.visible-sm-inline, +.visible-sm-inline-block, +.visible-md-block, +.visible-md-inline, +.visible-md-inline-block, +.visible-lg-block, +.visible-lg-inline, +.visible-lg-inline-block { + display: none !important; +} +@media (max-width: 767px) { + .visible-xs { + display: block !important; + } + table.visible-xs { + display: table !important; + } + tr.visible-xs { + display: table-row !important; + } + th.visible-xs, + td.visible-xs { + display: table-cell !important; + } +} +@media (max-width: 767px) { + .visible-xs-block { + display: block !important; + } +} +@media (max-width: 767px) { + .visible-xs-inline { + display: inline !important; + } +} +@media (max-width: 767px) { + .visible-xs-inline-block { + display: inline-block !important; + } +} +@media (min-width: 768px) and (max-width: 991px) { + .visible-sm { + display: block !important; + } + table.visible-sm { + display: table !important; + } + tr.visible-sm { + display: table-row !important; + } + th.visible-sm, + td.visible-sm { + display: table-cell !important; + } +} +@media (min-width: 768px) and (max-width: 991px) { + .visible-sm-block { + display: block !important; + } +} +@media (min-width: 768px) and (max-width: 991px) { + .visible-sm-inline { + display: inline !important; + } +} +@media (min-width: 768px) and (max-width: 991px) { + .visible-sm-inline-block { + display: inline-block !important; + } +} +@media (min-width: 992px) and (max-width: 1199px) { + .visible-md { + display: block !important; + } + table.visible-md { + display: table !important; + } + tr.visible-md { + display: table-row !important; + } + th.visible-md, + td.visible-md { + display: table-cell !important; + } +} +@media (min-width: 992px) and (max-width: 1199px) { + .visible-md-block { + display: block !important; + } +} +@media (min-width: 992px) and (max-width: 1199px) { + .visible-md-inline { + display: inline !important; + } +} +@media (min-width: 992px) and (max-width: 1199px) { + .visible-md-inline-block { + display: inline-block !important; + } +} +@media (min-width: 1200px) { + .visible-lg { + display: block !important; + } + table.visible-lg { + display: table !important; + } + tr.visible-lg { + display: table-row !important; + } + th.visible-lg, + td.visible-lg { + display: table-cell !important; + } +} +@media (min-width: 1200px) { + .visible-lg-block { + display: block !important; + } +} +@media (min-width: 1200px) { + .visible-lg-inline { + display: inline !important; + } +} +@media (min-width: 1200px) { + .visible-lg-inline-block { + display: inline-block !important; + } +} +@media (max-width: 767px) { + .hidden-xs { + display: none !important; + } +} +@media (min-width: 768px) and (max-width: 991px) { + .hidden-sm { + display: none !important; + } +} +@media (min-width: 992px) and (max-width: 1199px) { + .hidden-md { + display: none !important; + } +} +@media (min-width: 1200px) { + .hidden-lg { + display: none !important; + } +} +.visible-print { + display: none !important; +} +@media print { + .visible-print { + display: block !important; + } + table.visible-print { + display: table !important; + } + tr.visible-print { + display: table-row !important; + } + th.visible-print, + td.visible-print { + display: table-cell !important; + } +} +.visible-print-block { + display: none !important; +} +@media print { + .visible-print-block { + display: block !important; + } +} +.visible-print-inline { + display: none !important; +} +@media print { + .visible-print-inline { + display: inline !important; + } +} +.visible-print-inline-block { + display: none !important; +} +@media print { + .visible-print-inline-block { + display: inline-block !important; + } +} +@media print { + .hidden-print { + display: none !important; + } +} +/*# sourceMappingURL=bootstrap.css.map */ diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/stylesheets/search_projects.css b/utils/test/vnfcatalogue/VNF_Catalogue/public/stylesheets/search_projects.css new file mode 100644 index 000000000..8875f7fe5 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/stylesheets/search_projects.css @@ -0,0 +1,132 @@ +/******************************************************************************* + * Copyright (c) 2017 Kumar Rishabh and others. + * + * All rights reserved. This program and the accompanying materials + * are made available under the terms of the Apache License, Version 2.0 + * which accompanies this distribution, and is available at + * http://www.apache.org/licenses/LICENSE-2.0 + *******************************************************************************/ + +input[type="text"]:focus:not([readonly]) { + transition: all 0s !important; + border-radius: 5px; + border: 2px solid #333333; + box-shadow: 0 0 15px 1px rgba(0,0,0,0.50); + color: #333333; +} +.gray { + background: rgb(249,249,249); +} +.material-search-custom { + left : -30px; + + padding-left: 10px; +} +.form-group-custom { + width : 400px; + position: relative; + float: right; + left: -40%; +} +.form-control-custom { + padding-top: 10px; + padding-left: 50px; +} +.card-shadow-custom { + box-shadow: 0 2px 3px 0 rgba(0,0,0,0.50); + border-bottom: 2px solid #8B19A2; +} +.row-custom { + width: 100%; + margin: 1em 1em 1em 1em; + padding-right: 20px; +} +.card-title-div-custom { + margin: 0.5em 0 0.5em 0; + text-align: left; + display: inline-block; +} +.card-title-span-custom { + margin: 0 0 0 2em; + display: inline-block; +} +.card-title-div-custom-right { + margin: 0.5em 0em 0.5em 0; + text-align: right; + display: inline-block; +} +.card-image-picture-custom { + margin: 1em 0em 0em 3.5em; + display: inline-block; +} +.collection .collection-item.active { + background-color: rgb(255,245,114); + text-decoration: none; + transition: none; +} +.collection a.collection-item:not(.active):hover { + background-color: rgb(255,245,114); + text-decoration: none; + transition: none; +} +.collection .collection-item { + padding: 1px 25px; + border-bottom: 0px; + transition: none; +} +.chip > a { + display: block; + text-decoration: none; + text-align: center; + display:inline-block; + font-size:13px; + font-weight:500; + color:rgba(0, 0, 0, 0.6) !important; + margin-right: 15px !important; + margin-left: 15px !important; + text-transform: none !important; +} +.chip > a:hover { + background-color: transparent; + text-decoration: none; + transition: none; +} +a.a-custom-more { + display: block; + text-decoration: none; + text-align: center; + display:inline-block; + font-size: 20px; + font-weight:500; + color:rgba(0, 0, 0, 0.6) !important; + margin-right: 15px !important; + text-transform: none !important; +} +a.a-custom-more:hover { + background-color: transparent; +} +.collection-custom { + margin: 0em 0em 0em 1em; +} +.card .row .card-action-custom { + margin-left: 20px; +} +.rating { + color: rgb(253,225,109) !important; +} +.filled-stars .star i { + color: rgb(253,225,109) !important; +} +.glyphicon-star-empty { + color: rgb(221,221,221); +} +.star { +} +span.glyphicon.glyphicon-search.form-control-feedback, + div.form-group-custom i.material-icons { + top: 0.5em; + left: 16.5em; + cursor:pointer; + z-index: 30; + position: absolute; +} diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/public/stylesheets/style.css b/utils/test/vnfcatalogue/VNF_Catalogue/public/stylesheets/style.css new file mode 100644 index 000000000..4769cfcc0 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/public/stylesheets/style.css @@ -0,0 +1,318 @@ +/******************************************************************************* + * Copyright (c) 2017 Kumar Rishabh and others. + * + * All rights reserved. This program and the accompanying materials + * are made available under the terms of the Apache License, Version 2.0 + * which accompanies this distribution, and is available at + * http://www.apache.org/licenses/LICENSE-2.0 + *******************************************************************************/ + +@import url('https://fonts.googleapis.com/css?family=Muli:300,400,600,700,800'); +* +{ + color: #333333; + font-family: 'Muli', sans-serif; +} +*:focus +{ + outline: none; +} +html, +body +{ + margin: 0; + padding: 0; + background: #ffffff; + font-family: 'Muli', sans-serif; +} +header +{ + padding: 10px 35px 0 0px; +} +header ul +{ + list-style: none; + display: inline-block; +} +header ul li +{ + display: inline-block; +} +header .logo +{ + background: url(../images/logo.png) no-repeat; + background-size: cover; + +} +header .brand-logo-extends +{ + background: url(../images/logo.png) no-repeat; + background-size: cover; + width: 154px; + height: 34px; + margin-top: 11%; + margin-right: 0%; + padding: 0; + position: relative !important; + /*margin-right: 20px; + margin-left: 0; + float: left;*/ + /*display: inline-block; + */ +} + +nav +{ + height: 10px; +} + +header ul li.links +{ + margin: 7px 10px 0 0; +} +header ul li > a, +.content ul.most-menu li.items a +{ + color: #333333; + font-weight: 800; + font-size: 14px; + letter-spacing: 0.6px; + font-family: 'Muli', sans-serif; +} +header ul.navigation-right +{ + float: right; + padding-top: 8px; +} +header li.signup > a +{ + border: 2px solid #333333; + border-radius: 4px; + font-size: 14px; + font-weigt: 700; + padding: 2px 10px; +} +header li.signin > a +{ + border-bottom: 2px solid #333333; + font-size: 13px; + font-weight: 700; + padding: 0px 2px; +} +header li.option +{ + font-weight: 800; + padding: 0 10px; +} +header ul li > a:hover, +header li.signin > a:hover, +header li.signup > a:hover, +header ul li > a:focus, +header li.signin > a:focus, +header li.signup > a:focus, +.content ul.most-menu li a:hover, +.content ul.most-menu li a:focus +{ + text-decoration: none; + cursor: pointer; + color: #333333; +} +header li.signup > a:hover +{ + background: #333333; + color: #ffffff; +} +.search-box +{ + text-align: center; + padding: 100px 0; +} +.search-box h1 +{ + font-size: 30px; + letter-spacing: 2px; + color: #333333; + font-weight: 600; +} +form.search-form +{ + padding: 10px 20px; +} +form.search-form input.search-input +{ + font-weight: 400; + margin: 30px 0; + height: 80px; + padding: 10px 30px; + max-width: 800px; + width: 70%; + border-radius: 5px; + border: 2px solid #333333; + box-shadow: 0 0 15px 1px rgba(0,0,0,0.50); + color: #333333; + font-size: 22px; +} +input.search-input-rest +{ + font-weight: 400; + margin: 0px 0; + height: 30px; + padding: 10px 30px; + min-width: 90%; + max-width: 90%; + /*max-width: 500px; + */ + border-radius: 5px; + border: 2px solid #333333; + box-shadow: 0 0 15px 1px rgba(0,0,0,0.50); + color: #333333; + font-size: 22px; +} + + +form.search-form button.search-button +{ + padding: 18px 35px; + background: #FFF572; + border: 0; + box-shadow: 0 0 15px 1px #958F40; + border-radius: 1px; + font-size: 20px; + color: #393E41; + letter-spacing: 1px; + border-radius: 5px; + font-weight: 600; +} +form.search-form input:focus +{ + outline: none; +} +form.search-form input::-webkit-input-placeholder +{ + font-weight: 400; + letter-spacing: 1px; + color: #333333; +} +form.search-form input::-moz-placeholder +{ + font-weight: 400; + letter-spacing: 1px; + color: #333333; +} +form.search-form input:-moz-placeholder +{ + font-weight: 400; + letter-spacing: 5px; + color: #333333; +} +form.search-form input:-ms-input-placeholder +{ + font-weight: 400; + letter-spacing: 1px; + color: #333333; +} +.content +{ + height: 500px; + background: #f9f9f9; + padding: 10px 0; +} +.content ul.most-menu +{ + list-style: none; + text-align: center; + padding-bottom: 10px; +} +.content ul.most-menu li.items +{ + display: inline-block; + margin-right: 5px; + padding: 15px 25px; +} +.content ul.most-menu li.active +{ + /*background: #FFF572;*/ +} +.content-box +{ + overflow: hidden; + padding: 20px 0 50px 0; + display: flex; + justify-content: center; + background: #FFFFFF; + box-shadow: 0 2px 3px 0 rgba(0,0,0,0.50); + border-bottom: 2px solid #8B19A2; + margin-bottom: 30px; +} +.content-data +{ + align-self: center; +} +.content-data h1.content-title +{ + font-size: 25px; + color: #000000; + letter-spacing: 1.2px; +} +.content-data .box +{ + padding: 10px 0; + height: 90px; + text-align: center; + border: 2px solid #4D4D4D; + border-radius: 2px; +} +.content-data .commit-icon +{ + width: 23px; + height: 16px; +} +.content-data .box h3.commits +{ + text-align: center; + font-size: 12px; + color: #333333; + letter-spacing: 0.03px; +} +.content-height-overwrite +{ + height: 110px; +} +.float-center-magic +{ + float: right; + position: relative; + left: -30%; +} +nav ul li:hover, nav ul li.active, nav ul li a.active, nav ul li a:hover { + background-color: rgb(255,245,114); +} +a:hover, a.active { + background-color: rgb(255,245,114); +} +footer +{ + font-size: 12px; + font-weight: 800; + color: #333333; + text-align: center; + padding: 20px; +} +.space-10 +{ + height: 10px; +} +.space-30 +{ + height: 100px; +} +input[type="text"]:focus:not([readonly]) { + transition: all 0s !important; + border-radius: 5px; + border: 2px solid #333333; + box-shadow: 0 0 15px 1px rgba(0,0,0,0.50); + color: #333333; +} +.gray { + background: rgb(249,249,249); +} diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/routes/index.js b/utils/test/vnfcatalogue/VNF_Catalogue/routes/index.js new file mode 100644 index 000000000..950fcd57e --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/routes/index.js @@ -0,0 +1,18 @@ +/******************************************************************************* + * Copyright (c) 2017 Kumar Rishabh and others. + * + * All rights reserved. This program and the accompanying materials + * are made available under the terms of the Apache License, Version 2.0 + * which accompanies this distribution, and is available at + * http://www.apache.org/licenses/LICENSE-2.0 + *******************************************************************************/ + +var express = require('express'); +var router = express.Router(); + +/* GET VNF_Catalogue Home Page. */ +router.get('/', function(req, res) { + res.render('index', { title: 'Express' }); +}); + +module.exports = router; diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/routes/search_projects.js b/utils/test/vnfcatalogue/VNF_Catalogue/routes/search_projects.js new file mode 100644 index 000000000..49fceeb3c --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/routes/search_projects.js @@ -0,0 +1,19 @@ +/******************************************************************************* + * Copyright (c) 2017 Kumar Rishabh and others. + * + * All rights reserved. This program and the accompanying materials + * are made available under the terms of the Apache License, Version 2.0 + * which accompanies this distribution, and is available at + * http://www.apache.org/licenses/LICENSE-2.0 + *******************************************************************************/ + +var express = require('express'); +var router = express.Router(); + +router.get('/', function(req, res) { + var tags = req.param('tags'); + console.log(tags); + res.render('search_projects', { title: 'Express' }); +}); + +module.exports = router; diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/views/error.jade b/utils/test/vnfcatalogue/VNF_Catalogue/views/error.jade new file mode 100644 index 000000000..4f7fbcaeb --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/views/error.jade @@ -0,0 +1,12 @@ +// + Copyright (c) 2017 Kumar Rishabh and others. + All rights reserved. This program and the accompanying materials + are made available under the terms of the Apache License, Version 2.0 + which accompanies this distribution, and is available at + http://www.apache.org/licenses/LICENSE-2.0 +extends layout + +block content + h1= message + h2= error.status + pre #{error.stack} diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/views/index.jade b/utils/test/vnfcatalogue/VNF_Catalogue/views/index.jade new file mode 100644 index 000000000..e60c3ba26 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/views/index.jade @@ -0,0 +1,122 @@ +extends layout + +// + Copyright (c) 2017 Kumar Rishabh and others. + All rights reserved. This program and the accompanying materials + are made available under the terms of the Apache License, Version 2.0 + which accompanies this distribution, and is available at + http://www.apache.org/licenses/LICENSE-2.0 +block content + .search-box + h1 VNF Catalogue + form.search-form + input.search-input(type='text', placeholder='Search...', id='Tags') + .space-10 + button.search-button(type='submit', value='Search', id='Search') Search + .content.content-height-overwrite + nav.z-depth-0.transparent + .nav-wrapper + ul#nav-mobile.float-center-magic.hide-on-med-and-down.most-menu + li.items + a(href='#') Most Popular + li.items + a(href='#') Most Active + li.items + a(href='#') Most Active Contributions + .content + .container + .row + .box-container + .col-md-3 + .content-box + .content-data + h1.content-title Beacon + .box + img.commit-icon(src='/images/3rd_party/commits.png') + h3.commits + | 4,845 + br + | commits + .col-md-3 + .content-box + .content-data + h1.content-title Beacon + .box + img.commit-icon(src='/images/3rd_party/commits.png') + h3.commits + | 4,845 + br + | commits + .col-md-3 + .content-box + .content-data + h1.content-title Beacon + .box + img.commit-icon(src='/images/3rd_party/commits.png') + h3.commits + | 4,845 + br + | commits + .col-md-3 + .content-box + .content-data + h1.content-title Beacon + .box + img.commit-icon(src='/images/3rd_party/commits.png') + h3.commits + | 4,845 + br + | commits + .col-md-3 + .content-box + .content-data + h1.content-title Beacon + .box + img.commit-icon(src='/images/3rd_party/commits.png') + h3.commits + | 4,845 + br + | commits + .col-md-3 + .content-box + .content-data + h1.content-title Beacon + .box + img.commit-icon(src='/images/3rd_party/commits.png') + h3.commits + | 4,845 + br + | commits + .col-md-3 + .content-box + .content-data + h1.content-title Beacon + .box + img.commit-icon(src='/images/3rd_party/commits.png') + h3.commits + | 4,845 + br + | commits + .col-md-3 + .content-box + .content-data + h1.content-title Beacon + .box + img.commit-icon(src='/images/3rd_party/commits.png') + h3.commits + | 4,845 + br + | commits + footer + | © 2017 XYZ Company + style(type='text/css'). + input[type="text"]:focus:not([readonly]) { + transition: all 0s !important; + border-radius: 5px; + border: 2px solid #333333; + box-shadow: 0 0 15px 1px rgba(0,0,0,0.50); + color: #333333; + } + .gray { + background: rgb(249,249,249); + } diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/views/layout.jade b/utils/test/vnfcatalogue/VNF_Catalogue/views/layout.jade new file mode 100644 index 000000000..89142f813 --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/views/layout.jade @@ -0,0 +1,53 @@ +doctype html +// + Copyright (c) 2017 Kumar Rishabh and others. + All rights reserved. This program and the accompanying materials + are made available under the terms of the Apache License, Version 2.0 + which accompanies this distribution, and is available at + http://www.apache.org/licenses/LICENSE-2.0 +html(lang='en') +html + head + title= title + link(rel='stylesheet', href='/stylesheets/3rd_party/bootstrap.css') + link(rel='stylesheet', href='/3rd_party/materialize/css/materialize.css') + script(type='text/javascript', src='https://code.jquery.com/jquery-3.1.1.min.js') + script(src='/javascripts/global.js') + script(src='/3rd_party/materialize/js/materialize.js') + link(href='https://fonts.googleapis.com/icon?family=Material+Icons', rel='stylesheet') + link(rel='stylesheet', href='/stylesheets/style.css') + body + header + nav.transparent.z-depth-0 + .nav-wrapper + a.button-collapse(href='#', data-activates='mobile-demo') + i.material-icons menu + ul#nav-mobile.left.hide-on-med-and-down + li + a(href='#') + img.left.brand-logo.brand-logo-extends + li + a(href='#') Projects + li + a(href='#') People + li + a(href='#') About + ul#nav-mobile.right.hide-on-med-and-down + li.signup + a(href='#') Sign up + li.option or + li.signin + a(href='#') Sign in + ul#mobile-demo.side-nav + li + a(href='#') Projects + li + a(href='#') People + li + a(href='#') About + li.signup + a(href='#') Sign up + li.signin + a(href='#') Sign in + block content + diff --git a/utils/test/vnfcatalogue/VNF_Catalogue/views/search_projects.jade b/utils/test/vnfcatalogue/VNF_Catalogue/views/search_projects.jade new file mode 100644 index 000000000..6670d212c --- /dev/null +++ b/utils/test/vnfcatalogue/VNF_Catalogue/views/search_projects.jade @@ -0,0 +1,75 @@ +extends layout + +// + Copyright (c) 2017 Kumar Rishabh and others. + All rights reserved. This program and the accompanying materials + are made available under the terms of the Apache License, Version 2.0 + which accompanies this distribution, and is available at + http://www.apache.org/licenses/LICENSE-2.0 +block content + .search-box + .form-group-custom.form-group.has-feedback + input.search-input-rest.form-control(type='text', placeholder='Search...', id='Tags') + i.material-icons search + .content + .container + .card.card-shadow-custom.horizontal + .row.row-custom + .col.s5.card-title-div-custom + span.card-title.card-title-span-custom Card Title + .col.s5.card-title-div-custom + i.material-icons grade + span.card-title PenguinScore: 42 + .col.s2.card-title-div-custom-right + form(action='#') + input#search_result_1(type='checkbox') + label(for='search_result_1') Compare + // + <div class="card-action"> + <a href="#">This is a link</a> + </div> + .col.s4.card-image + img.card-image-picture-custom(src='/images/logo.png') + .col.s8.card-stacked + .card-content + p + .collection.collection-custom + a.collection-item(href='#!') + span + i.material-icons code + | Lines Of Code: 1.03M + a.collection-item(href='#!') + span + i.material-icons code + | Lines Of Code: 1.03M + a.collection-item(href='#!') + span + i.material-icons code + | Lines Of Code: 1.03M + a.collection-item(href='#!') + span + i.material-icons code + | Lines Of Code: 1.03M + .card-action + | Tags: + .chip + a.a-custom(href='#!') Tag1 + .chip + a.a-custom(href='#!') Tag2 + .chip + a.a-custom(href='#!') Tag3 + .chip + a.a-custom(href='#!') Tag4 + .chip + a.a-custom(href='#!') Tag5 + a.a-custom-more(href='#!') more + .divider + .card-action-custom.col.s12.card-action + | License: + a(href='#') MIT + | Complexity: + a(href='#') Atomic + footer + | © 2017 XYZ Company + link(rel='stylesheet', href='/stylesheets/search_projects.css') + diff --git a/utils/test/vnfcatalogue/helpers/README.md b/utils/test/vnfcatalogue/helpers/README.md new file mode 100644 index 000000000..6c0ca78c3 --- /dev/null +++ b/utils/test/vnfcatalogue/helpers/README.md @@ -0,0 +1,22 @@ +# Helper Directory + +## Helper to migrate database + +First make sure nodejs and mysql are installed. Then use + +```bash +npm install bookshelf mysql knex when lodash --save +``` + +Create a database named **vnf_catalogue**. +Enter the mysql credentials in migrate.js. + +Then use + +```bash +node migrate +``` + +If successful the script will return success message. The current script is +idempotent is nature, if run twice it will just return error and write nothing. + diff --git a/utils/test/vnfcatalogue/helpers/migrate.js b/utils/test/vnfcatalogue/helpers/migrate.js new file mode 100644 index 000000000..ec209053c --- /dev/null +++ b/utils/test/vnfcatalogue/helpers/migrate.js @@ -0,0 +1,78 @@ +/******************************************************************************* + * Copyright (c) 2017 Kumar Rishabh(penguinRaider) and others. + * + * All rights reserved. This program and the accompanying materials + * are made available under the terms of the Apache License, Version 2.0 + * which accompanies this distribution, and is available at + * http://www.apache.org/licenses/LICENSE-2.0 + *******************************************************************************/ + +var knex = require('knex')({ + client: 'mysql', + connection: { + host : 'localhost', + user : '*', + password : '*', + database : 'vnf_catalogue', + charset : 'utf8' + } +}); +var Schema = require('./schema'); +var sequence = require('when/sequence'); +var _ = require('lodash'); +function createTable(tableName) { + return knex.schema.createTable(tableName, function (table) { + var column; + var columnKeys = _.keys(Schema[tableName]); + _.each(columnKeys, function (key) { + if (Schema[tableName][key].type === 'text' && Schema[tableName][key].hasOwnProperty('fieldtype')) { + column = table[Schema[tableName][key].type](key, Schema[tableName][key].fieldtype); + } + else if (Schema[tableName][key].type === 'string' && Schema[tableName][key].hasOwnProperty('maxlength')) { + column = table[Schema[tableName][key].type](key, Schema[tableName][key].maxlength); + } + else { + column = table[Schema[tableName][key].type](key); + } + if (Schema[tableName][key].hasOwnProperty('nullable') && Schema[tableName][key].nullable === true) { + column.nullable(); + } + else { + column.notNullable(); + } + if (Schema[tableName][key].hasOwnProperty('primary') && Schema[tableName][key].primary === true) { + column.primary(); + } + if (Schema[tableName][key].hasOwnProperty('unique') && Schema[tableName][key].unique) { + column.unique(); + } + if (Schema[tableName][key].hasOwnProperty('unsigned') && Schema[tableName][key].unsigned) { + column.unsigned(); + } + if (Schema[tableName][key].hasOwnProperty('references')) { + column.references(Schema[tableName][key].references); + } + if (Schema[tableName][key].hasOwnProperty('defaultTo')) { + column.defaultTo(Schema[tableName][key].defaultTo); + } + }); + }); +} +function createTables () { + var tables = []; + var tableNames = _.keys(Schema); + tables = _.map(tableNames, function (tableName) { + return function () { + return createTable(tableName); + }; + }); + return sequence(tables); +} +createTables() +.then(function() { + console.log('Tables created!!'); + process.exit(0); +}) +.catch(function (error) { + throw error; +}); diff --git a/utils/test/vnfcatalogue/helpers/schema.js b/utils/test/vnfcatalogue/helpers/schema.js new file mode 100644 index 000000000..2aaf99ae2 --- /dev/null +++ b/utils/test/vnfcatalogue/helpers/schema.js @@ -0,0 +1,51 @@ +/******************************************************************************* + * Copyright (c) 2017 Kumar Rishabh(penguinRaider) and others. + * + * All rights reserved. This program and the accompanying materials + * are made available under the terms of the Apache License, Version 2.0 + * which accompanies this distribution, and is available at + * http://www.apache.org/licenses/LICENSE-2.0 + *******************************************************************************/ +var Schema = { + photo: { + photo_id: {type: 'increments', nullable: false, primary: true}, + photo_url: {type: 'string', maxlength: 254, nullable: false} + }, + user: { + user_id: {type: 'increments', nullable: false, primary: true}, + user_name: {type: 'string', maxlength: 254, nullable: false}, + password: {type: 'string', maxlength: 150, nullable: false}, + email_id: {type: 'string', maxlength: 254, nullable: false, unique: true, validations: {isEmail: true}}, + photo_id: {type: 'integer', nullable: true, unsigned: true, references: 'photo.photo_id'}, + company: {type: 'string', maxlength: 254, nullable: false}, + introduction: {type: 'string', maxlength: 510, nullable: false}, + last_login: {type: 'dateTime', nullable: true}, + created_at: {type: 'dateTime', nullable: false}, + }, + vnf: { + vnf_id: {type: 'increments', nullable: false, primary: true}, + vnf_name: {type: 'string', maxlength: 254, nullable: false}, + repo_url: {type: 'string', maxlength: 254, nullable: false}, + photo_id: {type: 'integer', nullable: true, unsigned: true, references: 'photo.photo_id'}, + submitter_id: {type: 'integer', nullable: false, unsigned: true, references: 'user.user_id'}, + lines_of_code: {type: 'integer', nullable: true, unsigned: true}, + versions: {type: 'integer', nullable: true, unsigned: true}, + no_of_developers: {type: 'integer', nullable: true, unsigned: true}, + }, + tag: { + tag_id: {type: 'increments', nullable: false, primary: true}, + name: {type: 'string', maxlength: 150, nullable: false} + }, + vnf_tags: { + vnf_tag_id: {type: 'increments', nullable: false, primary: true}, + tag_id: {type: 'integer', nullable: false, unsigned: true, references: 'tag.tag_id'}, + vnf_id: {type: 'integer', nullable: false, unsigned: true, references: 'vnf.vnf_id'}, + }, + vnf_contributors: { + vnf_contributors_id: {type: 'increments', nullable: false, primary: true}, + user_id: {type: 'integer', nullable: false, unsigned: true, references: 'user.user_id'}, + vnf_id: {type: 'integer', nullable: false, unsigned: true, references: 'vnf.vnf_id'}, + created_at: {type: 'dateTime', nullable: false}, + } +}; +module.exports = Schema; |